diff --git a/ResoursesManager/ResoursesManager/ResoursesManager.csproj b/ResoursesManager/ResoursesManager/ResoursesManager.csproj index 53bba17..87e5182 100644 --- a/ResoursesManager/ResoursesManager/ResoursesManager.csproj +++ b/ResoursesManager/ResoursesManager/ResoursesManager.csproj @@ -236,6 +236,196 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + @@ -258,6 +448,25 @@ + + + + + + + + + + + + + + + + + + + diff --git a/ResoursesManager/ResoursesManager/amcharts/amcharts.js b/ResoursesManager/ResoursesManager/amcharts/amcharts.js new file mode 100644 index 0000000..2a2bd13 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/amcharts.js @@ -0,0 +1,391 @@ +(function(){var d;window.AmCharts?d=window.AmCharts:(d={},window.AmCharts=d,d.themes={},d.maps={},d.inheriting={},d.charts=[],d.onReadyArray=[],d.useUTC=!1,d.updateRate=30,d.uid=0,d.lang={},d.translations={},d.mapTranslations={},d.windows={},d.initHandlers=[]);d.Class=function(a){var b=function(){arguments[0]!==d.inheriting&&(this.events={},this.construct.apply(this,arguments))};a.inherits?(b.prototype=new a.inherits(d.inheriting),b.base=a.inherits.prototype,delete a.inherits):(b.prototype.createEvents= +function(){for(var a=0,b=arguments.length;ad.IEversion&&0");if(10k){q=Math.ceil(q.width/k);m.remove();for(var m=[],p=0;-1<(p=b.indexOf(" ",p));)m.push(p),p+=1;for(var r,p=0;pc&&(a=c);return a};d.isDefined=function(a){return void 0===a?!1:!0};d.stripNumbers=function(a){return a.replace(/[0-9]+/g, +"")};d.roundTo=function(a,b){if(0>b)return a;var c=Math.pow(10,b);return Math.round(a*c)/c};d.toFixed=function(a,b){var c=String(Math.round(a*Math.pow(10,b)));if(0=g[b].contains){var l=a-Math.floor(a/g[b].contains)*g[b].contains;"ss"==b&&(l=d.formatNumber(l, +f),1==l.split(k)[0].length&&(l="0"+l));("mm"==b||"hh"==b)&&10>l&&(l="0"+l);c=l+""+e[b]+""+c;a=Math.floor(a/g[b].contains);b=g[b].nextInterval;return d.formatDuration(a,b,c,e,h,f)}"ss"==b&&(a=d.formatNumber(a,f),1==a.split(k)[0].length&&(a="0"+a));("mm"==b||"hh"==b)&&10>a&&(a="0"+a);c=a+""+e[b]+""+c;if(g[h].count>g[b].count)for(a=g[b].count;aa?"-":"";a=Math.abs(a);var k=String(a),l=!1;-1!=k.indexOf("e")&&(l=!0);0<=c&&!l&&(k=d.toFixed(a,c));var m="";if(l)m=k;else{var k=k.split("."),l=String(k[0]),n;for(n=l.length;0<=n;n-=3)m=n!=l.length?0!==n?l.substring(n-3,n)+b+m:l.substring(n-3,n)+m:l.substring(n-3,n);void 0!==k[1]&&(m=m+f+k[1]);void 0!==c&&0=c.x-5&&a<=c.x+c.width+5&&b>=c.y-5&&b<=c.y+c.height+5?!0:!1};d.isPercents=function(a){if(-1!=String(a).indexOf("%"))return!0};d.findPosX=function(a){var b=a,c=a.offsetLeft;if(a.offsetParent){for(;a=a.offsetParent;)c+=a.offsetLeft;for(;(b=b.parentNode)&&b!=document.body;)c-=b.scrollLeft||0}return c};d.findPosY=function(a){var b=a,c=a.offsetTop;if(a.offsetParent){for(;a=a.offsetParent;)c+=a.offsetTop;for(;(b=b.parentNode)&&b!=document.body;)c-=b.scrollTop||0}return c};d.findIfFixed=function(a){if(a.offsetParent)for(;a= +a.offsetParent;)if("fixed"==d.getStyle(a,"position"))return!0;return!1};d.findIfAuto=function(a){return a.style&&"auto"==d.getStyle(a,"overflow")?!0:a.parentNode?d.findIfAuto(a.parentNode):!1};d.findScrollLeft=function(a,b){a.scrollLeft&&(b+=a.scrollLeft);return a.parentNode?d.findScrollLeft(a.parentNode,b):b};d.findScrollTop=function(a,b){a.scrollTop&&(b+=a.scrollTop);return a.parentNode?d.findScrollTop(a.parentNode,b):b};d.formatValue=function(a,b,c,e,h,f,g,k){if(b){void 0===h&&(h="");var l;for(l= +0;la&&(g="-");a=Math.abs(a);if(1=b[k].number&&(l=a/b[k].number,m=Number(e.precision),1>m&&(m=1),c=d.roundTo(l,m),m=d.formatNumber(c,{precision:-1,decimalSeparator:e.decimalSeparator,thousandsSeparator:e.thousandsSeparator}),!h||l==c)){f=g+""+m+""+b[k].prefix;break}}else for(k=0;k"==a&&(a="easeOutSine");"<"==a&&(a="easeInSine");"elastic"==a&&(a="easeOutElastic");return a};d.getObjById=function(a,b){var c,e;for(e=0;e"));return a};d.fixBrakes=function(a){if(d.isModern){var b=RegExp("
", +"g");a&&(a=a.replace(b,"\n"))}else a=d.fixNewLines(a);return a};d.deleteObject=function(a,b){if(a){if(void 0===b||null===b)b=20;if(0!==b)if("[object Array]"===Object.prototype.toString.call(a))for(var c=0;cb?Math.abs(b)-1:Math.abs(b);var h;for(h=0;hb?Number("0."+c+String(a)):Number(String(a)+c)};d.setCN=function(a,b,c,e){if(a.addClassNames&&b&&(b=b.node)&&c){var h=b.getAttribute("class");a=a.classNamePrefix+"-";e&&(a="");h?b.setAttribute("class",h+" "+a+c):b.setAttribute("class",a+c)}};d.parseDefs=function(a,b){for(var c in a){var e=typeof a[c];if(0a&&(a=3)):a=this.width/this.minHorizontalGap,this.gridCountR=Math.max(a,1)):this.gridCountR= +this.gridCount;this.axisWidth=this.axisLine.axisWidth;this.addTitle()},setOrientation:function(a){this.orientation=a?"H":"V"},addTitle:function(){var a=this.title;this.titleLabel=null;if(a){var b=this.chart,c=this.titleColor;void 0===c&&(c=b.color);var e=this.titleFontSize;isNaN(e)&&(e=b.fontSize+1);a=d.text(b.container,a,c,b.fontFamily,e,this.titleAlign,this.titleBold);d.setCN(b,a,this.bcn+"title");this.titleLabel=a}},positionTitle:function(){var a=this.titleLabel;if(a){var b,c,e=this.labelsSet, +h={};0=this.gridCountR&&(this.gridCountR=1);this.totals=[];this.data=this.chart.chartData;var a=this.chart;"xy"!=a.type&&(this.stackGraphs("smoothedLine"),this.stackGraphs("line"),this.stackGraphs("column"),this.stackGraphs("step"));this.recalculateToPercents&& +this.recalculate();this.synchronizationMultiplier&&this.synchronizeWith?(d.isString(this.synchronizeWith)&&(this.synchronizeWith=a.getValueAxisById(this.synchronizeWith)),this.synchronizeWith&&(this.synchronizeWithAxis(this.synchronizeWith),this.foundGraphs=!0)):(this.foundGraphs=!1,this.getMinMax())},draw:function(){d.ValueAxis.base.draw.call(this);var a=this.chart,b=this.set;d.setCN(a,this.set,"value-axis value-axis-"+this.id);d.setCN(a,this.labelsSet,"value-axis value-axis-"+this.id);d.setCN(a, +this.axisLine.axisSet,"value-axis value-axis-"+this.id);var c=this.type;"duration"==c&&(this.duration="ss");!0===this.dataChanged&&(this.updateData(),this.dataChanged=!1);"date"==c&&(this.logarithmic=!1,this.min=this.minRR,this.max=this.maxRR,this.minimumDate&&(this.min=this.minimumDate.getTime()),this.maximumDate&&(this.max=this.maximumDate.getTime()));if(this.logarithmic){var e=this.treatZeroAs,h=this.getMin(0,this.data.length-1);this.minReal=h||0>=this.minimum){this.fire("logarithmicAxisFailed",{type:"logarithmicAxisFailed",chart:a});return}}this.grid0=null;var f,g,k=a.dx,l=a.dy,e=!1,h=this.logarithmic;if(isNaN(this.min)||isNaN(this.max)||!this.foundGraphs||Infinity==this.min||-Infinity==this.max)e=!0;else{var m=this.labelFrequency,n=this.showFirstLabel,q=this.showLastLabel,p=1;f=0;this.minCalc=this.min;this.maxCalc=this.max;this.strictMinMax&&(isNaN(this.minimum)||(this.min=this.minimum),isNaN(this.maximum)|| +(this.max=this.maximum));isNaN(this.minZoom)||(this.min=this.minZoom);isNaN(this.maxZoom)||(this.max=this.maxZoom);var r=Math.round((this.maxCalc-this.minCalc)/this.step)+1,t;!0===h?(t=Math.log(this.max)*Math.LOG10E-Math.log(this.minReal)*Math.LOG10E,this.stepWidth=this.axisWidth/t,t>this.logGridLimit&&(r=Math.ceil(Math.log(this.max)*Math.LOG10E)+1,f=Math.round(Math.log(this.minReal)*Math.LOG10E),r>this.gridCountR&&(p=Math.ceil(r/this.gridCountR)))):this.stepWidth=this.axisWidth/(this.max-this.min); +var u=0;1>this.step&&-1this.maxDecCount&&(u=this.maxDecCount);var z=this.precision;isNaN(z)||(u=z);this.max=d.roundTo(this.max,this.maxDecCount);this.min=d.roundTo(this.min,this.maxDecCount);g={};g.precision=u;g.decimalSeparator=a.nf.decimalSeparator;g.thousandsSeparator=a.nf.thousandsSeparator;this.numberFormatter=g;var v,w=this.guides,x=w.length;if(010*this.min&&(c-=this.min), +c=d.roundTo(c,this.maxDecCount+1),!this.integersOnly||Math.round(c)==c)if(isNaN(z)||Number(d.toFixed(c,z))==c){!0===h&&(0===c&&(c=this.minReal),t>this.logGridLimit&&(c=Math.pow(10,g)));v=this.formatValue(c,!1,g);Math.round(g/m)!=g/m&&(v=void 0);if(0===g&&!n||g==r-1&&!q)v=" ";f=this.getCoordinate(c);v=new this.axisItemRenderer(this,f,v,void 0,void 0,void 0,void 0,this.boldLabels);this.pushAxisItem(v);if(c==this.baseValue&&"radar"!=a.type){var O,J,A=this.viW,B=this.viH;v=this.viX;x=this.viY;"H"==this.orientation? +0<=f&&f<=A+1&&(O=[f,f,f+k],J=[B,0,l]):0<=f&&f<=B+1&&(O=[0,A,A+k],J=[f,f,f+l]);O&&(f=d.fitToBounds(2*this.gridAlpha,0,1),f=d.line(a.container,O,J,this.gridColor,f,1,this.dashLength),f.translate(v,x),this.grid0=f,a.axesSet.push(f),f.toBack(),d.setCN(a,f,this.bcn+"zero-grid-"+this.id),d.setCN(a,f,this.bcn+"zero-grid"))}if(!isNaN(H)&&0this.baseValue&&this.max>this.baseValue&&(t=this.min);this.minc&&(f.precision=Math.abs(c)),b&&1b&&c.shift();for(var e=Math.floor(Math.log(Math.abs(a))*Math.LOG10E),h=0;ha){if(g=Math.pow(10,-g)*d,g==Math.round(g))return d}else if(d==Math.round(d))return d}},stackGraphs:function(a){var b=this.stackType;"stacked"==b&&(b="regular"); +"line"==b&&(b="none");"100% stacked"==b&&(b="100%");this.stackType=b;var c=[],e=[],h=[],f=[],g,k=this.chart.graphs,l,m,n,q,p=this.baseValue,r=!1;if("line"==a||"step"==a||"smoothedLine"==a)r=!0;if(r&&("regular"==b||"100%"==b))for(q=0;qg?(m.values.close=g,isNaN(e[l])?m.values.open=p:(m.values.close+=e[l],m.values.open=e[l]),e[l]=m.values.close):(m.values.close=g,isNaN(h[l])?m.values.open=p:(m.values.close+=h[l],m.values.open=h[l]),h[l]=m.values.close)))}}for(l=this.start;l<=this.end;l++)for(q=0;qc?(m.values.close=d.fitToBounds(c+e[l],-100,100),m.values.open=e[l],e[l]=m.values.close):(m.values.close=d.fitToBounds(c+h[l],-100,100),m.values.open=h[l],h[l]=m.values.close)))))},recalculate:function(){var a=this.chart,b=a.graphs,c;for(c=0;cq&&g++}if(m=a.recalculateFromDate)m=d.getDate(m,a.dataDateFormat,"fff"),g=a.getClosestIndex(a.chartData,"time",m.getTime(),!0,0,a.chartData.length), +k=a.chartData.length-1;for(m=g;m<=k&&(g=this.data[m].axes[this.id].graphs[e.id],f=g.values[h],isNaN(f));m++);this.recBaseValue=f;for(h=l;h<=k;h++){g=this.data[h].axes[this.id].graphs[e.id];g.percents={};var l=g.values,p;for(p in l)g.percents[p]="percents"!=p?l[p]/f*100-100:l[p]}}}},getMinMax:function(){var a=!1,b=this.chart,c=b.graphs,e;for(e=0;ethis.max&&(this.max=c.toValue),c.value> +this.max&&(this.max=c.value);isNaN(this.minimum)||(this.min=this.minimum);isNaN(this.maximum)||(this.max=this.maximum);this.minimumDate&&(this.min=this.minimumDate.getTime());this.maximumDate&&(this.max=this.maximumDate.getTime());this.min>this.max&&(a=this.max,this.max=this.min,this.min=a);isNaN(this.minTemp)||(this.min=this.minTemp);isNaN(this.maxTemp)||(this.max=this.maxTemp);this.minReal=this.min;this.maxReal=this.max;0===this.min&&0===this.max&&(this.max=9);this.min>this.max&&(this.min=this.max- +1);a=this.min;b=this.max;c=this.max-this.min;e=0===c?Math.pow(10,Math.floor(Math.log(Math.abs(this.max))*Math.LOG10E))/10:Math.pow(10,Math.floor(Math.log(Math.abs(c))*Math.LOG10E))/10;isNaN(this.maximum)&&isNaN(this.maxTemp)&&(this.max=Math.ceil(this.max/e)*e+e);isNaN(this.minimum)&&isNaN(this.minTemp)&&(this.min=Math.floor(this.min/e)*e-e);0>this.min&&0<=a&&(this.min=0);0=b&&(this.max=0);"100%"==this.stackType&&(this.min=0>this.min?-100:0,this.max=0>this.max?0:100);c=this.max-this.min; +e=Math.pow(10,Math.floor(Math.log(Math.abs(c))*Math.LOG10E))/10;this.step=Math.ceil(c/this.gridCountR/e)*e;c=Math.pow(10,Math.floor(Math.log(Math.abs(this.step))*Math.LOG10E));c=d.fixStepE(c);e=Math.ceil(this.step/c);5=e&&2c?(this.maxDecCount=Math.abs(Math.log(Math.abs(c))*Math.LOG10E),this.maxDecCount=Math.round(this.maxDecCount),this.step=d.roundTo(this.step,this.maxDecCount+1)):this.maxDecCount=0;this.min=this.step*Math.floor(this.min/ +this.step);this.max=this.step*Math.ceil(this.max/this.step);0>this.min&&0<=a&&(this.min=0);0=b&&(this.max=0);1a&&(a=f);else for(var g in d)d.hasOwnProperty(g)&&"percents"!=g&&"total"!=g&&(f=d[g],f>a&&(a=f))}}}return a},dispatchZoomEvent:function(a,b){var c={type:"axisZoomed",startValue:a,endValue:b,target:this,chart:this.chart};this.fire(c.type,c)},zoomOut:function(){var a=this.chart;"xy"!=a.type&&(this.maxZoom=this.minZoom= +void 0,a.updateAfterValueZoom())},zoomToValues:function(a,b){var c=this.chart;"xy"==c.type?(bthis.max&&(b=this.max),c={type:"axisSelfZoomed"},c.chart=this.chart,c.valueAxis=this,c.multiplier=this.axisWidth/Math.abs(this.getCoordinate(b)-this.getCoordinate(a)),c.startValue=a,c.endValue=b,c.position="V"==this.orientation?this.reversed?this.getCoordinate(a):this.getCoordinate(b):this.reversed?this.getCoordinate(b):this.getCoordinate(a),this.fire(c.type,c)): +(this.minZoom=a,this.maxZoom=b,c.updateAfterValueZoom())},coordinateToValue:function(a){if(isNaN(a))return NaN;var b=this.axisWidth,c=this.stepWidth,e=this.reversed,d=this.rotate,f=this.min,g=this.minReal;return!0===this.logarithmic?Math.pow(10,(d?!0===e?(b-a)/c:a/c:!0===e?a/c:(b-a)/c)+Math.log(g)*Math.LOG10E):!0===e?d?f-(a-b)/c:a/c+f:d?a/c+f:f-(a-b)/c},getCoordinate:function(a){if(isNaN(a))return NaN;var b=this.rotate,c=this.reversed,e=this.axisWidth,d=this.stepWidth,f=this.min,g=this.minReal;!0=== +this.logarithmic?(0===a&&(a=this.treatZeroAs),a=Math.log(a)*Math.LOG10E-Math.log(g)*Math.LOG10E,b=b?!0===c?e-d*a:d*a:!0===c?d*a:e-d*a):b=!0===c?b?e-d*(a-f):d*(a-f):b?d*(a-f):e-d*(a-f);b=this.rotate?b+(this.x-this.viX):b+(this.y-this.viY);1E7n?(y=V+ea*Math.sin(Q)- +B-3+2,G+=-ea*Math.cos(Q)-Qa*Math.sin(Q)-4):y-=B+t+3+3,y-=na):(0n?(y=V+B+3-ea/2*Math.sin(Q)+2,G+=ea/2*Math.cos(Q)):y+=B+w+3+3,y+=na)):(y+=ja+t/2-ba,G+=qa,U?(0sa+2||0>f))Y.remove(), +Y=null}else{0<=b&&b<=V+1&&(0V+1||yc&&"object"==typeof n&&(n=n.join(",").split(",").reverse());"V"==g?(g=d.rect(l,a.viW,c,n,m),g.translate(h,b-k+f)):(g=d.rect(l,c,a.viH,n, +m),g.translate(b-k+h,f));d.setCN(a.chart,g,"guide-fill");e.id&&d.setCN(a.chart,g,"guide-fill-"+e.id);this.set=l.set([g])},graphics:function(){return this.set},getLabel:function(){}})})();(function(){var d=window.AmCharts;d.AmChart=d.Class({construct:function(a){this.theme=a;this.classNamePrefix="amcharts";this.addClassNames=!1;this.version="3.14.5";d.addChart(this);this.createEvents("dataUpdated","init","rendered","drawn","failed","resized");this.height=this.width="100%";this.dataChanged=!0;this.chartCreated=!1;this.previousWidth=this.previousHeight=0;this.backgroundColor="#FFFFFF";this.borderAlpha=this.backgroundAlpha=0;this.color=this.borderColor="#000000";this.fontFamily="Verdana"; +this.fontSize=11;this.usePrefixes=!1;this.addCodeCredits=this.autoResize=!0;this.precision=-1;this.percentPrecision=2;this.decimalSeparator=".";this.thousandsSeparator=",";this.labels=[];this.allLabels=[];this.titles=[];this.marginRight=this.marginLeft=this.autoMarginOffset=0;this.timeOuts=[];this.creditsPosition="top-left";var b=document.createElement("div"),c=b.style;c.overflow="hidden";c.position="relative";c.textAlign="left";this.chartDiv=b;b=document.createElement("div");c=b.style;c.overflow= +"hidden";c.position="relative";c.textAlign="left";this.legendDiv=b;this.titleHeight=0;this.hideBalloonTime=150;this.handDrawScatter=2;this.handDrawThickness=1;this.prefixesOfBigNumbers=[{number:1E3,prefix:"k"},{number:1E6,prefix:"M"},{number:1E9,prefix:"G"},{number:1E12,prefix:"T"},{number:1E15,prefix:"P"},{number:1E18,prefix:"E"},{number:1E21,prefix:"Z"},{number:1E24,prefix:"Y"}];this.prefixesOfSmallNumbers=[{number:1E-24,prefix:"y"},{number:1E-21,prefix:"z"},{number:1E-18,prefix:"a"},{number:1E-15, +prefix:"f"},{number:1E-12,prefix:"p"},{number:1E-9,prefix:"n"},{number:1E-6,prefix:"\u03bc"},{number:.001,prefix:"m"}];this.panEventsEnabled=!0;this.product="amcharts";this.animations=[];this.balloon=new d.AmBalloon(this.theme);this.balloon.chart=this;d.applyTheme(this,a,"AmChart")},drawChart:function(){this.drawBackground();this.redrawLabels();this.drawTitles();this.brr()},drawBackground:function(){d.remove(this.background);var a=this.container,b=this.backgroundColor,c=this.backgroundAlpha,e=this.set; +d.isModern||0!==c||(c=.001);var h=this.updateWidth();this.realWidth=h;var f=this.updateHeight();this.realHeight=f;b=d.polygon(a,[0,h-1,h-1,0],[0,0,f-1,f-1],b,c,1,this.borderColor,this.borderAlpha);d.setCN(this,b,"bg");this.background=b;e.push(b);if(b=this.backgroundImage)a=a.image(b,0,0,h,f),d.setCN(this,b,"bg-image"),this.bgImg=a,e.push(a)},drawTitles:function(){var a=this.titles;if(d.ifArray(a)){var b=20,c;for(c=0;ca||isNaN(a))a=0;this.chartDiv.style.height=a+"px"}}return a},updateWidth:function(){var a=this.divRealWidth,b=this.divRealHeight,c=this.legend;if(c){var e=this.legendDiv, +d=e.offsetWidth;isNaN(c.width)||(d=c.width);c.ieW&&(d=c.ieW);var f=e.offsetHeight,e=e.style,g=this.chartDiv.style,c=c.position;if("right"==c||"left"==c){a-=d;if(0>a||isNaN(a))a=0;g.width=a+"px";"left"==c?(g.left=d+"px",e.left="0px"):(g.left="0px",e.left=a+"px");b>f&&(e.top=(b-f)/2+"px")}}return a},getTitleHeight:function(){var a=0,b=this.titles,c=!0;if(0a.valueAxis.minMaxMultiplier&&a.positiveClip(a.set));break;case "radar":a.createRadarGraph();break;case "xy":a.createXYGraph(),a.positiveClip(a.set)}a.playedTO=setTimeout(function(){a.setAnimationPlayed.call(a)},500*a.chart.startDuration)}},setAnimationPlayed:function(){this.animationPlayed=!0},createXYGraph:function(){var a=[],b=[],c=this.xAxis,e=this.yAxis;this.pmh=e.viH+1;this.pmw=c.viW+1;this.pmy=this.pmx=0;var d;for(d=this.start;d<=this.end;d++){var f=this.data[d].axes[c.id].graphs[this.id], +g=f.values,k=g.x,l=g.y,g=c.getCoordinate(k),m=e.getCoordinate(l);!isNaN(k)&&!isNaN(l)&&(a.push(g),b.push(m),f.x=g,f.y=m,k=this.createBullet(f,g,m,d),l=this.labelText)&&(f=this.createLabel(f,g,m,l),this.positionLabel(g,m,f,k),this.allBullets.push(f))}this.drawLineGraph(a,b);this.launchAnimation()},createRadarGraph:function(){var a=this.valueAxis.stackType,b=[],c=[],e,d,f;for(f=this.start;f<=this.end;f++){var g=this.data[f].axes[this.valueAxis.id].graphs[this.id],k;k="none"==a||"3d"==a?g.values.value: +g.values.close;if(isNaN(k))this.drawLineGraph(b,c),b=[],c=[];else{var l=this.y-(this.valueAxis.getCoordinate(k)-this.height),m=180-360/(this.end-this.start+1)*f;k=l*Math.sin(m/180*Math.PI);l*=Math.cos(m/180*Math.PI);b.push(k);c.push(l);var m=this.createBullet(g,k,l,f),n=this.labelText;n&&(g=this.createLabel(g,k,l,n),this.positionLabel(k,l,g,m),this.allBullets.push(g));isNaN(e)&&(e=k);isNaN(d)&&(d=l)}}b.push(e);c.push(d);this.drawLineGraph(b,c);this.launchAnimation()},positionLabel:function(a,b,c, +e){var d="middle",f=!1,g=this.labelPosition,k=c.getBBox();if(e){var l=e.graphDataItem,m=this.chart.rotate,n=l.isNegative,q=this.chart;b-=k.height/4/2;switch(g){case "top":g=m?"top":n?"bottom":"top";break;case "right":g=m?n?"left":"right":"right";break;case "bottom":g=m?"bottom":n?"top":"bottom";break;case "left":g=m?n?"right":"left":"left"}var p=l.columnGraphics,r=0,t=0;p&&(r=p.x,t=p.y);var u=this.labelOffset;switch(g){case "top":b-=e.size/2+k.height/2+u;break;case "right":d="start";a+=e.size/2+u; +break;case "bottom":b+=e.size/2+k.height/2+u;break;case "left":d="end";a-=e.size/2+u;break;case "inside":"column"==this.type&&(f=!0,m?n?(d="end",a=r-3-u):(d="start",a=r+3+u):b=n?t+7+u:t-10-u);break;case "middle":"column"==this.type&&(f=!0,m?a-=(a-r)/2+u-3:b-=(b-t)/2+u-3)}"auto"!=this.labelAnchor&&(d=this.labelAnchor);c.attr({"text-anchor":d});this.labelRotation&&c.rotate(this.labelRotation);c.translate(a,b);k=c.getBBox();!this.showAllValueLabels&&p&&f&&(k.height>l.columnHeight||k.width>l.columnWidth)&& +(c.remove(),c=!1);if(c&&("serial"==q.type||"gantt"==q.type))if(m){if(0>b||b>this.height)c.remove(),c=!1}else if(0>a||a>this.width)c.remove(),c=!1;return c}},getGradRotation:function(){var a=270;"horizontal"==this.gradientOrientation&&(a=0);return this.gradientRotation=a},createSerialGraph:function(){this.dashLengthSwitched=this.fillColorsSwitched=this.lineColorSwitched=void 0;var a=this.chart,b=this.id,c=this.index,e=this.data,h=this.chart.container,f=this.valueAxis,g=this.type,k=this.columnWidthReal, +l=this.showBulletsAt;isNaN(this.columnWidth)||(k=this.columnWidth);isNaN(k)&&(k=.8);var m=this.useNegativeColorIfDown,n=this.width,q=this.height,p=this.y,r=this.rotate,t=this.columnCount,u=d.toCoordinate(this.cornerRadiusTop,k/2),z=this.connect,v=[],w=[],x,A,B,D,C=this.chart.graphs.length,I,H=this.dx/this.tcc,O=this.dy/this.tcc,J=f.stackType,da=this.start,pa=this.end,U=this.scrollbar,na="graph-column-";U&&(na="scrollbar-graph-column-");var qa=this.categoryAxis,ja=this.baseCoord,Pa=this.negativeBase, +aa=this.columnIndex,Z=this.lineThickness,V=this.lineAlpha,sa=this.lineColorR,ba=this.dashLength,ca=this.set,ta,ia=this.getGradRotation(),Q=this.chart.columnSpacing,W=qa.cellWidth,wa=(W*k-t)/t;Q>wa&&(Q=wa);var G,y,ka,ea=q+1,Qa=n+1,Y=0,qb=0,rb,sb,eb,fb,tb=this.fillColorsR,Ja=this.negativeFillColors,Da=this.negativeLineColor,Wa=this.fillAlphas,Xa=this.negativeFillAlphas;"object"==typeof Wa&&(Wa=Wa[0]);"object"==typeof Xa&&(Xa=Xa[0]);var gb=f.getCoordinate(f.min);f.logarithmic&&(gb=f.getCoordinate(f.minReal)); +this.minCoord=gb;this.resetBullet&&(this.bullet="none");if(!(U||"line"!=g&&"smoothedLine"!=g&&"step"!=g||(1==e.length&&"step"!=g&&"none"==this.bullet&&(this.bullet="round",this.resetBullet=!0),!Ja&&void 0==Da||m))){var Ra=Pa;Ra>f.max&&(Ra=f.max);Rak&&(k=1);var Jb=this.fixedColumnWidth;isNaN(Jb)||(k=Jb);var K;if("line"==g||"step"==g||"smoothedLine"==g){if(0X?!0:!1);if(!U)switch(this.showBalloonAt){case "close":y.y=E;break;case "open":y.y=L;break;case "high":y.y=Fa;break;case "low":y.y=Ea}var la=G.x[qa.id],Ta=this.periodSpan-1,ra=Math.floor(W/2)+Math.floor(Ta*W/2),Aa=ra,lb=0;"left"==this.stepDirection&&(lb=(2*W+Ta*W)/2,la-=lb);"center"== +this.stepDirection&&(lb=W/2,la-=lb);"start"==this.pointPosition&&(la-=W/2+Math.floor(Ta*W/2),ra=0,Aa=Math.floor(W)+Math.floor(Ta*W));"end"==this.pointPosition&&(la+=W/2+Math.floor(Ta*W/2),ra=Math.floor(W)+Math.floor(Ta*W),Aa=0);if(Kb){var yb=this.columnWidth;isNaN(yb)||(ra*=yb,Aa*=yb)}U||(y.x=la);-1E5>la&&(la=-1E5);la>n+1E5&&(la=n+1E5);r?(F=E,N=L,L=E=la,isNaN(ma)&&!this.fillToGraph&&(N=ja),Na=Ea,Oa=Fa):(N=F=la,isNaN(ma)&&!this.fillToGraph&&(L=ja));if(!xb&&XMa?(La&&(Ya=!0),La=!1):(La||(Ya=!0),La=!0):y.isNegative=X=jb||Math.abs(E-ib)>=jb)v.push(F),w.push(E),hb=F,ib=E;ya=F;za=E;ga=F;ha=E;!Ka||isNaN(L)||isNaN(N)||(R.push(N),S.push(L));if(Ya||void 0!=y.lineColor|| +void 0!=y.fillColors||!isNaN(y.dashLength))this.drawLineGraph(v,w,R,S),v=[F],w=[E],R=[],S=[],!Ka||isNaN(L)||isNaN(N)||(R.push(N),S.push(L)),m?La?(this.lineColorSwitched=sa,this.fillColorsSwitched=tb):(this.lineColorSwitched=Da,this.fillColorsSwitched=Ja):(this.lineColorSwitched=y.lineColor,this.fillColorsSwitched=y.fillColors),this.dashLengthSwitched=y.dashLength;y.gap&&(this.drawLineGraph(v,w,R,S),v=[],w=[],R=[],S=[])}break;case "smoothedLine":if(isNaN(X))z||(this.drawSmoothedGraph(v,w,R,S),v=[], +w=[],R=[],S=[]);else{if(Math.abs(F-hb)>=jb||Math.abs(E-ib)>=jb)v.push(F),w.push(E),hb=F,ib=E;ya=F;za=E;ga=F;ha=E;!Ka||isNaN(L)||isNaN(N)||(R.push(N),S.push(L));void 0==y.lineColor&&void 0==y.fillColors&&isNaN(y.dashLength)||(this.drawSmoothedGraph(v,w,R,S),v=[F],w=[E],R=[],S=[],!Ka||isNaN(L)||isNaN(N)||(R.push(N),S.push(L)),this.lineColorSwitched=y.lineColor,this.fillColorsSwitched=y.fillColors,this.dashLengthSwitched=y.dashLength);y.gap&&(this.drawSmoothedGraph(v,w,R,S),v=[],w=[],R=[],S=[])}break; +case "step":if(!isNaN(X)){r?(isNaN(x)||(v.push(x),w.push(E-ra)),w.push(E-ra),v.push(F),w.push(E+Aa),v.push(F),!Ka||isNaN(L)||isNaN(N)||(isNaN(B)||(R.push(B),S.push(L-ra)),R.push(N),S.push(L-ra),R.push(N),S.push(L+Aa))):(isNaN(A)||(w.push(A),v.push(F-ra)),v.push(F-ra),w.push(E),v.push(F+Aa),w.push(E),!Ka||isNaN(L)||isNaN(N)||(isNaN(D)||(R.push(N-ra),S.push(D)),R.push(N-ra),S.push(L),R.push(N+Aa),S.push(L)));x=F;A=E;B=N;D=L;ya=F;za=E;ga=F;ha=E;if(Ya||void 0!=y.lineColor||void 0!=y.fillColors||!isNaN(y.dashLength)){var Zb= +v[v.length-2],$b=w[w.length-2];v.pop();w.pop();this.drawLineGraph(v,w,R,S);v=[Zb];w=[$b];r?(w.push(E+Aa),v.push(F)):(v.push(F+Aa),w.push(E));R=[];S=[];this.lineColorSwitched=y.lineColor;this.fillColorsSwitched=y.fillColors;this.dashLengthSwitched=y.dashLength;m&&(La?(this.lineColorSwitched=sa,this.fillColorsSwitched=tb):(this.lineColorSwitched=Da,this.fillColorsSwitched=Ja))}if(Kb||y.gap)x=A=NaN,this.drawLineGraph(v,w,R,S),v=[],w=[],R=[],S=[]}else if(!z){if(1>=this.periodSpan||1ra+Aa)x=A=NaN;this.drawLineGraph(v,w,R,S);v=[];w=[];R=[];S=[]}break;case "column":ua=Ba;void 0!=y.lineColor&&(ua=y.lineColor);if(!isNaN(X)){m||(y.isNegative=XNb&&ma>Nb)){var va;if(r){"3d"==J?(P=E-(t/2-this.depthCount+1)*(k+Q)+Q/2+O*aa,T=N+H*aa,va=aa):(P=Math.floor(E-(t/2-aa)*(k+Q)+Q/2),T=N,va=0);M=k;ya=F;za=P+k/2;isNaN(N)||N>F&&!y.isNegative&&(ya=N);ga=F;ha=P+k/2;P+M>q+va*O&&(M=q-P+va*O);Pn+va*H&&(M=n-T+va*H);Tq&&(M=q-P),0>P&&(M+=P,P=0),Pma?(zb=[F,Oa],Ab=[N,Na]):(zb=[N,Oa],Ab=[F,Na]);!isNaN(Oa)&&!isNaN(Na)&&En&&(M=n-T),0>T&&(M+=T,T=0),fa=E-L,T=ma&&(Sa=0);var oa=new d.Cuboid(h, +M,fa,H,O,Ia,Sa,Z,ua,V,ia,u,r,ba,$a,kb,na),Bb,Cb;X>ma?(Bb=[E,Fa],Cb=[L,Ea]):(Bb=[L,Fa],Cb=[E,Ea]);!isNaN(Fa)&&!isNaN(Ea)&&FX?F-Wb/2-2-db-pb:F+Wb/2+3+db+pb):(bb=F,cb=0>X?E+Xb/2+db+pb:E-Xb/2-3-db-pb);Va.translate(bb,cb);f.totals[K]=Va;r?(0>cb||cb>q)&&Va.remove():(0>bb||bb>n)&&Va.remove()}}}}}}if("line"==g||"step"==g||"smoothedLine"==g)"smoothedLine"==g?this.drawSmoothedGraph(v,w,R,S):this.drawLineGraph(v,w,R,S),U||this.launchAnimation();this.bulletsHidden&& +this.hideBullets();this.customBulletsHidden&&this.hideCustomBullets()},animateColumns:function(a,b){var c=this,e=c.chart.startDuration;0h.height&&(x=h.height),0>x&&(x=0));n=d.line(k,a,b,p,n,q,z,!1,!0);d.setCN(g,n,h.bcn+"stroke");l.push(n);l.click(function(a){h.handleGraphEvent(a, +"clickGraph")}).mouseover(function(a){h.handleGraphEvent(a,"rollOverGraph")}).mouseout(function(a){h.handleGraphEvent(a,"rollOutGraph")});void 0===u||h.useNegativeColorIfDown||(q=d.line(k,a,b,u,r,q,z,!1,!0),d.setCN(g,q,h.bcn+"stroke"),d.setCN(g,q,h.bcn+"stroke-negative"),m.push(q));if(0a&&(a=this.fillAlphas),0===a&&(a=this.bulletAlpha),0===a&&(a= +1));return a},createBullet:function(a,b,c){if(!isNaN(b)&&!isNaN(c)){var e=this.chart,h=this.container,f=this.bulletOffset,g=this.bulletSize;isNaN(a.bulletSize)||(g=a.bulletSize);var k=a.values.value,l=this.maxValue,m=this.minValue,n=this.maxBulletSize,q=this.minBulletSize;isNaN(l)||(isNaN(k)||(g=(k-m)/(l-m)*(n-q)+q),m==l&&(g=n));l=g;this.bulletAxis&&(g=a.values.error,isNaN(g)||(k=g),g=this.bulletAxis.stepWidth*k);gb-0||b-0>this.width||c<-g/2||c-0>this.height)p.remove(),p=null;p&&(this.bulletSet.push(p),p.translate(b,c),this.addListeners(p,a),this.allBullets.push(p));a.bx=b;a.by=c;d.setCN(e,p,this.bcn+"bullet");a.className&&d.setCN(e,p,a.className,!0)}p?(p.size=g||0,a.bulletGraphics=p):p={size:0};p.graphDataItem=a;return p}},showBullets:function(){var a=this.allBullets,b;this.bulletsHidden= +!1;for(b=0;ba&&(a=0),a>c&&(a=c)):(a=a.mouseX-this.x-1,0>a&&(a=0),a>b&&(a=b));return a},updateCrosshair:function(){var a=this.chart,b=a.mouseX-this.x,c=a.mouseY-this.y,e=this.vLine,h=this.hLine,b=d.fitToBounds(b,0,this.width),c=d.fitToBounds(c,0,this.height);e&&0a&&(h=a,g=c-a),cb&&(f=b,k=e-b),ex&&(h=x-c),B+h=this.data.length||0>m+h||(k.start=m+h,k.end=I+h,this.fire(k.type,k)))}else{"start"==A?t-=g.cellWidth/2:"mouse"==A&&(c.mouseIsOver?t=u?f-2:h-2:isNaN(this.tempPosition)||(t=this.tempPosition-2));if(u){if(0>t)if(B)t=0;else{this.hideCursor();return}if(t>p+1)if(B)t=p+1;else{this.hideCursor();return}}else{if(0>t)if(B)t=0;else{this.hideCursor();return}if(t>q)if(B)t=q;else{this.hideCursor();return}}w=this.line;0e||e>p)l=!1}else if(z=e,e=x,0>z||z>q+k+1)l=!1;l&&(l=this.graphBulletSize,A=this.graphBulletAlpha,1==l&&isNaN(A)||!d.isModern||!(D=w.bulletGraphics)||(D.translate(w.bx,w.by,l),this.resizedBullets.push(w),isNaN(A)||(D.setAttr("fill-opacity",A),D.setAttr("stroke-opacity",A))),l=v.valueBalloon,A=c.getBalloonColor(v,w), +l.setBounds(m,n,m+q,n+p),l.pointerOrientation="H",D=this.balloonPointerOrientation,"vertical"==D&&(l.pointerOrientation="V"),"horizontal"==D&&(l.pointerOrientation="H"),l.changeColor(A),void 0!==v.balloonAlpha&&(l.fillAlpha=v.balloonAlpha),void 0!==v.balloonTextColor&&(l.color=v.balloonTextColor),l.setPosition(z+m,e+n),z=c.formatString(v.balloonText,w,!0),(e=v.balloonFunction)&&(z=e(w,v).toString()),""!==z&&(u?l.showBalloon(z):(l.text=z,l.show=!0),t.push({yy:x,balloon:l})),!u&&l.set&&(l.set.hide(), +v=l.textDiv)&&(v.style.visibility="hidden"))}}this.avoidBalloonOverlapping&&this.arrangeBalloons()}b?(k={type:"changed"},k.index=a,k.chart=this.chart,k.zooming=B,k.mostCloseGraph=I,k.position=u?f:h,k.target=this,c.fire("changed",k),this.fire("changed",k),this.skipZoomDispatch=!1):(this.skipZoomDispatch=!0,c.updateLegendValues(a));this.previousIndex=a;this.previousMostCloseGraph=I}}}else this.hideCursor()},setBalloonPosition:function(a,b,c,e){var d=b.position,f=b.inside;b=b.axisThickness;var g=this.chart, +k=g.dx,g=g.dy,l=this.x,m=this.y,n=this.width,q=this.height;e?(f&&("right"==d?a.setBounds(l,m+g,l+n+k,m+c+g):a.setBounds(l,m+g,l+n+k,m+c)),"right"==d?f?a.setPosition(l+n+k,m+c+g):a.setPosition(l+n+k+b,m+c+g):f?a.setPosition(l,m+c):a.setPosition(l-b,m+c)):"top"==d?f?a.setPosition(l+c+k,m+g):a.setPosition(l+c+k,m+g-b+1):f?a.setPosition(l+c,m+q):a.setPosition(l+c,m+q+b-1)},setBalloonBounds:function(a,b,c){var e=b.position,d=b.inside,f=b.axisThickness,g=b.tickLength,k=this.chart,l=k.dx,k=k.dy,m=this.x, +n=this.y,q=this.width,p=this.height;c?(d&&(a.pointerWidth=0),"right"==e?d?a.setBounds(m,n+k,m+q+l,n+p+k):a.setBounds(m+q+l+f,n+k,m+q+1E3,n+p+k):d?a.setBounds(m,n,q+m,p+n):a.setBounds(-1E3,-1E3,m-g-f,n+p+15)):(a.maxWidth=q,b.parseDates&&(g=0,a.pointerWidth=0),"top"==e?d?a.setBounds(m+l,n+k,q+l+m,p+n):a.setBounds(m+l,-1E3,q+l+m,n+k-g-f):d?a.setBounds(m,n,q+m,p+n-g):a.setBounds(m,n+p+g+f-1,m+q,n+p+g+f))},enableDrawing:function(a){this.enabled=!a;this.hideCursor();this.rolledOver=!1;this.drawing=a},isZooming:function(a){a&& +a!=this.zooming&&this.handleMouseDown("fake");a||a==this.zooming||this.handleMouseUp()},handleMouseOut:function(){if(this.enabled)if(this.zooming)this.setPosition();else{this.index=void 0;var a={type:"changed",index:void 0,target:this};a.chart=this.chart;this.fire("changed",a);this.hideCursor()}},handleReleaseOutside:function(){this.handleMouseUp()},handleMouseUp:function(){var a=this.chart,b=this.data,c;if(a){var e=a.mouseX-this.x,h=a.mouseY-this.y;if(this.drawingNow){this.drawingNow=!1;d.remove(this.drawingLine); +c=this.drawStartX;var f=this.drawStartY;if(2Math.abs(h-this.initialMouse)&&this.fromIndex==this.index||(this.index< +this.fromIndex?(c.end=this.fromIndex,c.start=this.index):(c.end=this.index,c.start=this.fromIndex),h=a.categoryAxis,h.parseDates&&!h.equalSpacing&&(b[c.start]&&(c.start=b[c.start].time),b[c.end]&&(c.end=a.getEndTime(b[c.end].time))),this.skipZoomDispatch||this.fire(c.type,c));else{var g=this.initialMouseX,k=this.initialMouseY;3>Math.abs(e-g)&&3>Math.abs(h-k)||(b=Math.min(g,e),f=Math.min(k,h),e=Math.abs(g-e),h=Math.abs(k-h),a.hideXScrollbar&&(b=0,e=this.width),a.hideYScrollbar&&(f=0,h=this.height), +c.selectionHeight=h,c.selectionWidth=e,c.selectionY=f,c.selectionX=b,this.skipZoomDispatch||this.fire(c.type,c))}this.selectWithoutZooming||d.remove(this.selection)}this.skipZoomDispatch=!1}}this.panning=this.zooming=!1},showCursorAt:function(a){var b=this.chart.categoryAxis;a=b.parseDates?b.dateToCoordinate(a):b.categoryToCoordinate(a);this.previousMousePosition=NaN;this.forceShow=!0;this.setPosition(a,!1)},clearSelection:function(){d.remove(this.selection)},handleMouseDown:function(a){if(this.zoomable|| +this.pan||this.drawing){var b=this.rotate,c=this.chart,e=c.mouseX-this.x,h=c.mouseY-this.y;if(0document.documentMode&&(this.updateOnReleaseOnly=!0);this.dragIconHeight=this.dragIconWidth=35;this.dragIcon="dragIconRoundBig";d.applyTheme(this, +a,"SimpleChartScrollbar")},draw:function(){var a=this;a.destroy();if(a.enabled){var b=a.chart.container,c=a.rotate,e=a.chart,h=b.set();a.set=h;e.scrollbarsSet.push(h);var f,g;c?(f=a.scrollbarHeight,g=e.plotAreaHeight):(g=a.scrollbarHeight,f=e.plotAreaWidth);a.width=f;if((a.height=g)&&f){var k=d.rect(b,f,g,a.backgroundColor,a.backgroundAlpha,1,a.backgroundColor,a.backgroundAlpha);d.setCN(e,k,"scrollbar-bg");a.bg=k;h.push(k);k=d.rect(b,f,g,"#000",.005);h.push(k);a.invisibleBg=k;k.click(function(){a.handleBgClick()}).mouseover(function(){a.handleMouseOver()}).mouseout(function(){a.handleMouseOut()}).touchend(function(){a.handleBgClick()}); +k=d.rect(b,f,g,a.selectedBackgroundColor,a.selectedBackgroundAlpha);d.setCN(e,k,"scrollbar-bg-selected");a.selectedBG=k;h.push(k);f=d.rect(b,f,g,"#000",.005);a.dragger=f;h.push(f);f.mousedown(function(b){a.handleDragStart(b)}).mouseup(function(){a.handleDragStop()}).mouseover(function(){a.handleDraggerOver()}).mouseout(function(){a.handleMouseOut()}).touchstart(function(b){a.handleDragStart(b)}).touchend(function(){a.handleDragStop()});f=e.pathToImages;c?(k=f+a.dragIcon+"H.png",f=a.dragIconWidth, +c=a.dragIconHeight):(k=f+a.dragIcon+".png",c=a.dragIconWidth,f=a.dragIconHeight);g=b.image(k,0,0,c,f);d.setCN(e,g,"scrollbar-grip-left");k=b.image(k,0,0,c,f);d.setCN(e,k,"scrollbar-grip-right");var l=10,m=20;e.panEventsEnabled&&(l=25,m=a.scrollbarHeight);var n=d.rect(b,l,m,"#000",.005),q=d.rect(b,l,m,"#000",.005);q.translate(-(l-c)/2,-(m-f)/2);n.translate(-(l-c)/2,-(m-f)/2);c=b.set([g,q]);b=b.set([k,n]);a.iconLeft=c;h.push(a.iconLeft);a.iconRight=b;h.push(b);c.mousedown(function(){a.leftDragStart()}).mouseup(function(){a.leftDragStop()}).mouseover(function(){a.iconRollOver()}).mouseout(function(){a.iconRollOut()}).touchstart(function(){a.leftDragStart()}).touchend(function(){a.leftDragStop()}); +b.mousedown(function(){a.rightDragStart()}).mouseup(function(){a.rightDragStop()}).mouseover(function(){a.iconRollOver()}).mouseout(function(){a.iconRollOut()}).touchstart(function(){a.rightDragStart()}).touchend(function(){a.rightDragStop()});d.ifArray(e.chartData)?h.show():h.hide();a.hideDragIcons();a.clipDragger(!1)}h.translate(a.x,a.y);h.node.style.msTouchAction="none"}},updateScrollbarSize:function(a,b){a=Math.round(a);b=Math.round(b);var c=this.dragger,e,d,f,g;this.rotate?(e=0,d=a,f=this.width+ +1,g=b-a,c.setAttr("height",b-a),c.setAttr("y",d)):(e=a,d=0,f=b-a,g=this.height+1,c.setAttr("width",b-a),c.setAttr("x",e));this.clipAndUpdate(e,d,f,g)},update:function(){var a,b=!1,c,e,d=this.x,f=this.y,g=this.dragger,k=this.getDBox();if(k){c=k.x+d;e=k.y+f;var l=k.width,k=k.height,m=this.rotate,n=this.chart,q=this.width,p=this.height,r=n.mouseX,t=n.mouseY;a=this.initialMouse;this.forceClip&&this.clipDragger(!0);n.mouseIsOver&&(this.dragging&&(n=this.initialCoord,m?(a=n+(t-a),0>a&&(a=0),n=p-k,a>n&& +(a=n),g.setAttr("y",a)):(a=n+(r-a),0>a&&(a=0),n=q-l,a>n&&(a=n),g.setAttr("x",a)),this.clipDragger(!0)),this.resizingRight&&(m?(a=t-e,a+e>p+f&&(a=p-e+f),0>a?(this.resizingRight=!1,b=this.resizingLeft=!0):(0===a&&(a=.1),g.setAttr("height",a))):(a=r-c,a+c>q+d&&(a=q-c+d),0>a?(this.resizingRight=!1,b=this.resizingLeft=!0):(0===a&&(a=.1),g.setAttr("width",a))),this.clipDragger(!0)),this.resizingLeft&&(m?(c=e,e=t,ep+f&&(e=p+f),a=!0===b?c-e:k+c-e,0>a?(this.resizingRight=!0,this.resizingLeft=!1, +g.setAttr("y",c+k-f)):(0===a&&(a=.1),g.setAttr("y",e-f),g.setAttr("height",a))):(e=r,eq+d&&(e=q+d),a=!0===b?c-e:l+c-e,0>a?(this.resizingRight=!0,this.resizingLeft=!1,g.setAttr("x",c+l-d)):(0===a&&(a=.1),g.setAttr("x",e-d),g.setAttr("width",a))),this.clipDragger(!0)))}},stopForceClip:function(){this.forceClip=!1},clipDragger:function(a){var b=this.getDBox();if(b){var c=b.x,e=b.y,d=b.width,b=b.height,f=!1;if(this.rotate){if(c=0,d=this.width+1,this.clipY!=e||this.clipH!=b)f=!0}else if(e= +0,b=this.height+1,this.clipX!=c||this.clipW!=d)f=!0;f&&(this.clipAndUpdate(c,e,d,b),a&&(this.updateOnReleaseOnly||this.dispatchScrollbarEvent()))}},maskGraphs:function(){},clipAndUpdate:function(a,b,c,e){this.clipX=a;this.clipY=b;this.clipW=c;this.clipH=e;this.selectedBG.clipRect(a,b,c,e);this.updateDragIconPositions();this.maskGraphs(a,b,c,e)},dispatchScrollbarEvent:function(){if(this.skipEvent)this.skipEvent=!1;else{var a=this.chart;a.hideBalloon();var b=this.getDBox(),c=b.x,e=b.y,d=b.width,b=b.height; +this.rotate?(c=e,d=this.height/b):d=this.width/d;a={type:"zoomed",position:c,chart:a,target:this,multiplier:d};this.fire(a.type,a)}},updateDragIconPositions:function(){var a=this.getDBox(),b=a.x,c=a.y,e=this.iconLeft,d=this.iconRight,f,g,k=this.scrollbarHeight;this.rotate?(f=this.dragIconWidth,g=this.dragIconHeight,e.translate((k-g)/2,c-f/2),d.translate((k-g)/2,c+a.height-f/2)):(f=this.dragIconHeight,g=this.dragIconWidth,e.translate(b-g/2,(k-f)/2),d.translate(b-g/2+a.width,(k-f)/2))},showDragIcons:function(){this.resizeEnabled&& +(this.iconLeft.show(),this.iconRight.show())},hideDragIcons:function(){if(!this.resizingLeft&&!this.resizingRight&&!this.dragging){if(this.hideResizeGrips||!this.resizeEnabled)this.iconLeft.hide(),this.iconRight.hide();this.removeCursors()}},removeCursors:function(){this.chart.setMouseCursor("auto")},relativeZoom:function(a,b){this.enabled&&(this.dragger.stop(),this.multiplier=a,this.position=b,this.updateScrollbarSize(b,this.rotate?b+this.height/a:b+this.width/a),this.clipDragger())},destroy:function(){this.clear(); +d.remove(this.set);d.remove(this.iconRight);d.remove(this.iconLeft)},clear:function(){},handleDragStart:function(){if(this.enabled){var a=this.chart;this.dragger.stop();this.removeCursors();this.dragging=!0;var b=this.getDBox();this.rotate?(this.initialCoord=b.y,this.initialMouse=a.mouseY):(this.initialCoord=b.x,this.initialMouse=a.mouseX)}},handleDragStop:function(){this.updateOnReleaseOnly&&(this.update(),this.skipEvent=!1,this.dispatchScrollbarEvent());this.dragging=!1;this.mouseIsOver&&this.removeCursors(); +this.update()},handleDraggerOver:function(){this.handleMouseOver()},leftDragStart:function(){this.dragger.stop();this.resizingLeft=!0},leftDragStop:function(){this.resizingLeft=!1;this.mouseIsOver||this.removeCursors();this.updateOnRelease()},rightDragStart:function(){this.dragger.stop();this.resizingRight=!0},rightDragStop:function(){this.resizingRight=!1;this.mouseIsOver||this.removeCursors();this.updateOnRelease()},iconRollOut:function(){this.removeCursors()},iconRollOver:function(){this.rotate? +this.chart.setMouseCursor("n-resize"):this.chart.setMouseCursor("e-resize");this.handleMouseOver()},getDBox:function(){if(this.dragger)return this.dragger.getBBox()},handleBgClick:function(){var a=this;if(!a.resizingRight&&!a.resizingLeft){a.zooming=!0;var b,c,e=a.scrollDuration,h=a.dragger;b=a.getDBox();var f=b.height,g=b.width;c=a.chart;var k=a.y,l=a.x,m=a.rotate;m?(b="y",c=c.mouseY-f/2-k,c=d.fitToBounds(c,0,a.height-f)):(b="x",c=c.mouseX-g/2-l,c=d.fitToBounds(c,0,a.width-g));a.updateOnReleaseOnly? +(a.skipEvent=!1,h.setAttr(b,c),a.dispatchScrollbarEvent(),a.clipDragger()):(c=Math.round(c),m?h.animate({y:c},e,">"):h.animate({x:c},e,">"),a.forceClip=!0,clearTimeout(a.forceTO),a.forceTO=setTimeout(function(){a.stopForceClip.call(a)},5E3*e))}},updateOnRelease:function(){this.updateOnReleaseOnly&&(this.update(),this.skipEvent=!1,this.dispatchScrollbarEvent())},handleReleaseOutside:function(){if(this.set){if(this.resizingLeft||this.resizingRight||this.dragging)this.updateOnRelease(),this.removeCursors(); +this.mouseIsOver=this.dragging=this.resizingRight=this.resizingLeft=!1;this.hideDragIcons();this.update()}},handleMouseOver:function(){this.mouseIsOver=!0;this.showDragIcons()},handleMouseOut:function(){this.mouseIsOver=!1;this.hideDragIcons()}})})();(function(){var d=window.AmCharts;d.ChartScrollbar=d.Class({inherits:d.SimpleChartScrollbar,construct:function(a){this.cname="ChartScrollbar";d.ChartScrollbar.base.construct.call(this,a);this.enabled=!0;this.graphLineColor="#BBBBBB";this.graphLineAlpha=0;this.graphFillColor="#BBBBBB";this.graphFillAlpha=1;this.selectedGraphLineColor="#888888";this.selectedGraphLineAlpha=0;this.selectedGraphFillColor="#888888";this.selectedGraphFillAlpha=1;this.gridCount=0;this.gridColor="#FFFFFF";this.gridAlpha=.7; +this.skipEvent=this.autoGridCount=!1;this.color="#FFFFFF";this.scrollbarCreated=!1;this.offset=0;this.oppositeAxis=!0;d.applyTheme(this,a,this.cname)},init:function(){var a=this.categoryAxis,b=this.chart;a||(this.categoryAxis=a=new d.CategoryAxis);a.chart=b;a.id="scrollbar";a.dateFormats=b.categoryAxis.dateFormats;a.markPeriodChange=b.categoryAxis.markPeriodChange;a.boldPeriodBeginning=b.categoryAxis.boldPeriodBeginning;a.axisItemRenderer=d.RecItem;a.axisRenderer=d.RecAxis;a.guideFillRenderer=d.RecFill; +a.inside=!0;a.fontSize=this.fontSize;a.tickLength=0;a.axisAlpha=0;d.isString(this.graph)&&(this.graph=d.getObjById(b.graphs,this.graph));if(a=this.graph){var c=this.valueAxis;c||(this.valueAxis=c=new d.ValueAxis,c.visible=!1,c.scrollbar=!0,c.axisItemRenderer=d.RecItem,c.axisRenderer=d.RecAxis,c.guideFillRenderer=d.RecFill,c.labelsEnabled=!1,c.chart=b);b=this.unselectedGraph;b||(b=new d.AmGraph,b.scrollbar=!0,this.unselectedGraph=b,b.negativeBase=a.negativeBase,b.noStepRisers=a.noStepRisers);b=this.selectedGraph; +b||(b=new d.AmGraph,b.scrollbar=!0,this.selectedGraph=b,b.negativeBase=a.negativeBase,b.noStepRisers=a.noStepRisers)}this.scrollbarCreated=!0},draw:function(){var a=this;d.ChartScrollbar.base.draw.call(a);if(a.enabled){a.scrollbarCreated||a.init();var b=a.chart,c=b.chartData,e=a.categoryAxis,h=a.rotate,f=a.x,g=a.y,k=a.width,l=a.height,m=b.categoryAxis,n=a.set;e.setOrientation(!h);e.parseDates=m.parseDates;e.rotate=h;e.equalSpacing=m.equalSpacing;e.minPeriod=m.minPeriod;e.startOnAxis=m.startOnAxis; +e.viW=k;e.viH=l;e.width=k;e.height=l;e.gridCount=a.gridCount;e.gridColor=a.gridColor;e.gridAlpha=a.gridAlpha;e.color=a.color;e.tickLength=0;e.axisAlpha=0;e.autoGridCount=a.autoGridCount;e.parseDates&&!e.equalSpacing&&e.timeZoom(b.firstTime,b.lastTime);e.zoom(0,c.length-1);if(m=a.graph){var q=a.valueAxis,p=m.valueAxis;q.id=p.id;q.rotate=h;q.setOrientation(h);q.width=k;q.height=l;q.viW=k;q.viH=l;q.dataProvider=c;q.reversed=p.reversed;q.logarithmic=p.logarithmic;q.gridAlpha=0;q.axisAlpha=0;n.push(q.set); +h?(q.y=g,q.x=0):(q.x=f,q.y=0);var f=Infinity,g=-Infinity,r;for(r=0;rg&&(g=z)}}Infinity!=f&&(q.minimum=f);-Infinity!=g&&(q.maximum=g+.1*(g-f));f==g&&(--q.minimum,q.maximum+=1);void 0!==a.minimum&&(q.minimum=a.minimum);void 0!==a.maximum&&(q.maximum=a.maximum);q.zoom(0,c.length-1);u=a.unselectedGraph;u.id=m.id;u.bcn="scrollbar-graph-";u.rotate=h;u.chart=b; +u.data=c;u.valueAxis=q;u.chart=m.chart;u.categoryAxis=a.categoryAxis;u.periodSpan=m.periodSpan;u.valueField=m.valueField;u.openField=m.openField;u.closeField=m.closeField;u.highField=m.highField;u.lowField=m.lowField;u.lineAlpha=a.graphLineAlpha;u.lineColorR=a.graphLineColor;u.fillAlphas=a.graphFillAlpha;u.fillColorsR=a.graphFillColor;u.connect=m.connect;u.hidden=m.hidden;u.width=k;u.height=l;u.pointPosition=m.pointPosition;u.stepDirection=m.stepDirection;u.periodSpan=m.periodSpan;p=a.selectedGraph; +p.id=m.id;p.bcn=u.bcn+"selected-";p.rotate=h;p.chart=b;p.data=c;p.valueAxis=q;p.chart=m.chart;p.categoryAxis=e;p.periodSpan=m.periodSpan;p.valueField=m.valueField;p.openField=m.openField;p.closeField=m.closeField;p.highField=m.highField;p.lowField=m.lowField;p.lineAlpha=a.selectedGraphLineAlpha;p.lineColorR=a.selectedGraphLineColor;p.fillAlphas=a.selectedGraphFillAlpha;p.fillColorsR=a.selectedGraphFillColor;p.connect=m.connect;p.hidden=m.hidden;p.width=k;p.height=l;p.pointPosition=m.pointPosition; +p.stepDirection=m.stepDirection;p.periodSpan=m.periodSpan;b=a.graphType;b||(b=m.type);u.type=b;p.type=b;c=c.length-1;u.zoom(0,c);p.zoom(0,c);p.set.click(function(){a.handleBackgroundClick()}).mouseover(function(){a.handleMouseOver()}).mouseout(function(){a.handleMouseOut()});u.set.click(function(){a.handleBackgroundClick()}).mouseover(function(){a.handleMouseOver()}).mouseout(function(){a.handleMouseOut()});n.push(u.set);n.push(p.set)}n.push(e.set);n.push(e.labelsSet);a.bg.toBack();a.invisibleBg.toFront(); +a.dragger.toFront();a.iconLeft.toFront();a.iconRight.toFront()}},timeZoom:function(a,b,c){this.startTime=a;this.endTime=b;this.timeDifference=b-a;this.skipEvent=!d.toBoolean(c);this.zoomScrollbar();this.skipEvent||this.dispatchScrollbarEvent()},zoom:function(a,b){this.start=a;this.end=b;this.skipEvent=!0;this.zoomScrollbar()},dispatchScrollbarEvent:function(){if(this.skipEvent)this.skipEvent=!1;else{var a=this.chart.chartData,b,c,e=this.dragger.getBBox();b=e.x;var d=e.y,f=e.width,e=e.height,g=this.chart; +this.rotate?(b=d,c=e):c=f;f={type:"zoomed",target:this};f.chart=g;var k=this.categoryAxis,l=this.stepWidth,d=g.minSelectedTime,e=!1;if(k.parseDates&&!k.equalSpacing){if(a=g.lastTime,g=g.firstTime,k=Math.round(b/l)+g,b=this.dragging?k+this.timeDifference:Math.round((b+c)/l)+g,k>b&&(k=b),0a&&(b=a),b-db&&(b=k+d),k!=this.startTime||b!=this.endTime)this.startTime=k,this.endTime=b,f.start=k,f.end=b,f.startDate= +new Date(k),f.endDate=new Date(b),this.fire(f.type,f)}else if(k.startOnAxis||(b+=l/2),c-=this.stepWidth/2,d=k.xToIndex(b),b=k.xToIndex(b+c),d!=this.start||this.end!=b)k.startOnAxis&&(this.resizingRight&&d==b&&b++,this.resizingLeft&&d==b&&(0this.timeDifference&&(this.timeDifference=0)},handleBackgroundClick:function(){d.ChartScrollbar.base.handleBackgroundClick.call(this);this.dragging||(this.difference=this.end-this.start,this.timeDifference=this.endTime-this.startTime,0>this.timeDifference&&(this.timeDifference=0))}})})();(function(){var d=window.AmCharts;d.AmBalloon=d.Class({construct:function(a){this.cname="AmBalloon";this.enabled=!0;this.fillColor="#FFFFFF";this.fillAlpha=.8;this.borderThickness=2;this.borderColor="#FFFFFF";this.borderAlpha=1;this.cornerRadius=0;this.maxWidth=220;this.horizontalPadding=8;this.verticalPadding=4;this.pointerWidth=6;this.pointerOrientation="V";this.color="#000000";this.adjustBorderColor=!0;this.show=this.follow=this.showBullet=!1;this.bulletSize=3;this.shadowAlpha=.4;this.shadowColor= +"#000000";this.fadeOutDuration=this.animationDuration=.3;this.fixedPosition=!1;this.offsetY=6;this.offsetX=1;this.textAlign="center";this.disableMouseEvents=!0;this.deltaSignX=this.deltaSignY=1;d.isModern||(this.offsetY*=1.5);d.applyTheme(this,a,this.cname)},draw:function(){var a=this.pointToX,b=this.pointToY,c=this.chart;d.VML&&(this.fadeOutDuration=0);this.xAnim&&c.stopAnim(this.xAnim);this.yAnim&&c.stopAnim(this.yAnim);if(!isNaN(a)){var e=this.follow,h=c.container,f=this.set;d.remove(f);this.removeDiv(); +f=h.set();f.node.style.pointerEvents="none";this.set=f;c.balloonsSet.push(f);if(this.show){var g=this.l,k=this.t,l=this.r,m=this.b,n=this.balloonColor,q=this.fillColor,p=this.borderColor,r=q;void 0!=n&&(this.adjustBorderColor?r=p=n:q=n);var t=this.horizontalPadding,u=this.verticalPadding,z=this.pointerWidth,v=this.pointerOrientation,w=this.cornerRadius,x=c.fontFamily,A=this.fontSize;void 0==A&&(A=c.fontSize);var n=document.createElement("div"),B=c.classNamePrefix;n.className=B+"-balloon-div";this.className&& +(n.className=n.className+" "+B+"-balloon-div-"+this.className);B=n.style;this.disableMouseEvents&&(B.pointerEvents="none");B.position="absolute";var D=this.minWidth,C="";isNaN(D)||(C="min-width:"+(D-2*t)+"px; ");n.innerHTML="
"+this.text+"
";c.chartDiv.appendChild(n);this.textDiv=n;A=n.offsetWidth;x=n.offsetHeight;n.clientHeight&&(A=n.clientWidth,x=n.clientHeight); +x+=2*u;C=A+2*t;!isNaN(D)&&Cx&&(z=x/2),A=b-x/2,a=m&&(A=m-x);Al&&(D=l-C);var k=A+u,m=D+t,u=this.shadowAlpha,H=this.shadowColor,t=this.borderThickness,O=this.bulletSize,J;0C-z&&(g=C-z),gx-z&&(r=x-z),ra?C:a-D,C,C,0,0,C]),0this.r-e.width&&(a=this.r-e.width);d=t*O&&(w[H].gap=!0);this.processFields(c,da,pa);da.category=x.category;da.serialDataItem=x;da.graph=c;x.axes[C].graphs[H]= +da;r[H]=x.time;w[H]=da}}}this.chartData[z]=x}}for(a=0;ab?this.colors[b]:d.randomColor();a.lineColorR=c}a.fillColorsR=a.fillColors?a.fillColors:a.lineColorR;a.bulletBorderColorR=a.bulletBorderColor?a.bulletBorderColor:a.useLineColorForBulletBorder?a.lineColorR:a.bulletColor;a.bulletColorR=a.bulletColor?a.bulletColor:a.lineColorR;if(c=this.patterns)a.pattern= +c[b]},handleLegendEvent:function(a){var b=a.type;a=a.dataItem;if(!this.legend.data&&a){var c=a.hidden,e=a.showBalloon;switch(b){case "clickMarker":this.textClickEnabled&&(e?this.hideGraphsBalloon(a):this.showGraphsBalloon(a));break;case "clickLabel":e?this.hideGraphsBalloon(a):this.showGraphsBalloon(a);break;case "rollOverItem":c||this.highlightGraph(a);break;case "rollOutItem":c||this.unhighlightGraph();break;case "hideItem":this.hideGraph(a);break;case "showItem":this.showGraph(a)}}},highlightGraph:function(a){var b= +this.graphs,c,e=.2;this.legend&&(e=this.legend.rollOverGraphAlpha);if(1!=e)for(c=0;cthis.hoverAlpha&&a.wedge&&a.wedge.attr({opacity:this.hoverAlpha});var e=a.balloonX,h=a.balloonY;a.pulled&& +(e+=a.pullX,h+=a.pullY);var f=this.formatString(this.balloonText,a,!0),g=this.balloonFunction;g&&(f=g(a,f));g=d.adjustLuminosity(a.color,-.15);f?this.showBalloon(f,g,b,e,h):this.hideBalloon();0===a.value&&this.hideBalloon();a={type:"rollOverSlice",dataItem:a,chart:this,event:c};this.fire(a.type,a)}},rollOutSlice:function(a,b){isNaN(a)||(a=this.chartData[a]);a.wedge&&a.wedge.attr({opacity:1});this.hideBalloon();var c={type:"rollOutSlice",dataItem:a,chart:this,event:b};this.fire(c.type,c)},clickSlice:function(a, +b,c){isNaN(a)||(a=this.chartData[a]);a.pulled?this.pullSlice(a,0):this.pullSlice(a,1);d.getURL(a.url,this.urlTarget);c||(a={type:"clickSlice",dataItem:a,chart:this,event:b},this.fire(a.type,a))},handleRightClick:function(a,b){isNaN(a)||(a=this.chartData[a]);var c={type:"rightClickSlice",dataItem:a,chart:this,event:b};this.fire(c.type,c)},drawTicks:function(){var a=this.chartData,b;for(b=0;bb&&(b=h);e.remove()}return b}})})();(function(){var d=window.AmCharts;d.AmRectangularChart=d.Class({inherits:d.AmCoordinateChart,construct:function(a){d.AmRectangularChart.base.construct.call(this,a);this.theme=a;this.createEvents("zoomed");this.marginRight=this.marginBottom=this.marginTop=this.marginLeft=20;this.verticalPosition=this.horizontalPosition=this.depth3D=this.angle=0;this.heightMultiplier=this.widthMultiplier=1;this.plotAreaFillColors="#FFFFFF";this.plotAreaFillAlphas=0;this.plotAreaBorderColor="#000000";this.plotAreaBorderAlpha= +0;this.zoomOutButtonImageSize=19;this.zoomOutButtonImage="lens.png";this.zoomOutText="Show all";this.zoomOutButtonColor="#e5e5e5";this.zoomOutButtonAlpha=0;this.zoomOutButtonRollOverAlpha=1;this.zoomOutButtonPadding=8;this.trendLines=[];this.autoMargins=!0;this.marginsUpdated=!1;this.autoMarginOffset=10;d.applyTheme(this,a,"AmRectangularChart")},initChart:function(){d.AmRectangularChart.base.initChart.call(this);this.updateDxy();var a=!0;!this.marginsUpdated&&this.autoMargins&&(this.resetMargins(), +a=!1);this.processScrollbars();this.updateMargins();this.updatePlotArea();this.updateScrollbars();this.updateTrendLines();this.updateChartCursor();this.updateValueAxes();a&&(this.scrollbarOnly||this.updateGraphs())},drawChart:function(){d.AmRectangularChart.base.drawChart.call(this);this.drawPlotArea();if(d.ifArray(this.chartData)){var a=this.chartCursor;a&&a.draw()}},resetMargins:function(){var a={},b;if("xy"==this.type){var c=this.xAxes,e=this.yAxes;for(b=0;b=d-c&&(this.marginRight=Math.round(l-d+c));e.top&&kf-c&&(this.marginBottom=Math.round(this.marginBottom+b-f+c));this.initChart()},getAxisBounds:function(a,b,c,e,d){if(!a.ignoreAxisWidth){var f=a.labelsSet,g=a.tickLength;a.inside&&(g=0);if(f)switch(f=a.getBBox(),a.position){case "top":a=f.y;e>a&&(e=a);break;case "bottom":a=f.y+f.height;da&&(b=a)}}return{l:b,t:e,r:c,b:d}},drawZoomOutButton:function(){var a=this;if(!a.zbSet){var b=a.container.set();a.zoomButtonSet.push(b);var c=a.color,e=a.fontSize,h=a.zoomOutButtonImageSize,f=a.zoomOutButtonImage,g=d.lang.zoomOutText||a.zoomOutText,k=a.zoomOutButtonColor,l=a.zoomOutButtonAlpha,m=a.zoomOutButtonFontSize,n=a.zoomOutButtonPadding;isNaN(m)||(e=m);(m=a.zoomOutButtonFontColor)&&(c=m);var m=a.zoomOutButton,q; +m&&(m.fontSize&&(e=m.fontSize),m.color&&(c=m.color),m.backgroundColor&&(k=m.backgroundColor),isNaN(m.backgroundAlpha)||(a.zoomOutButtonRollOverAlpha=m.backgroundAlpha));var p=m=0;void 0!==a.pathToImages&&f&&(q=a.container.image(a.pathToImages+f,0,0,h,h),d.setCN(a,q,"zoom-out-image"),b.push(q),q=q.getBBox(),m=q.width+5);void 0!==g&&(c=d.text(a.container,g,c,a.fontFamily,e,"start"),d.setCN(a,c,"zoom-out-label"),e=c.getBBox(),p=q?q.height/2-3:e.height/2,c.translate(m,p),b.push(c));q=b.getBBox();c=1; +d.isModern||(c=0);k=d.rect(a.container,q.width+2*n+5,q.height+2*n-2,k,1,1,k,c);k.setAttr("opacity",l);k.translate(-n,-n);d.setCN(a,k,"zoom-out-bg");b.push(k);k.toBack();a.zbBG=k;q=k.getBBox();b.translate(a.marginLeftReal+a.plotAreaWidth-q.width+n,a.marginTopReal+n);b.hide();b.mouseover(function(){a.rollOverZB()}).mouseout(function(){a.rollOutZB()}).click(function(){a.clickZB()}).touchstart(function(){a.rollOverZB()}).touchend(function(){a.rollOutZB();a.clickZB()});for(l=0;la&&(a=1);1>b&&(b=1);this.plotAreaWidth=Math.round(a);this.plotAreaHeight=Math.round(b)},updateDxy:function(){this.dx=Math.round(this.depth3D*Math.cos(this.angle*Math.PI/ +180));this.dy=Math.round(-this.depth3D*Math.sin(this.angle*Math.PI/180));this.d3x=Math.round(this.columnSpacing3D*Math.cos(this.angle*Math.PI/180));this.d3y=Math.round(-this.columnSpacing3D*Math.sin(this.angle*Math.PI/180))},updateMargins:function(){var a=this.getTitleHeight();this.titleHeight=a;this.marginTopReal=this.marginTop-this.dy;this.fixMargins&&!this.fixMargins.top&&(this.marginTopReal+=a);this.marginBottomReal=this.marginBottom;this.marginLeftReal=this.marginLeft;this.marginRightReal=this.marginRight}, +updateValueAxes:function(){var a=this.valueAxes,b=this.marginLeftReal,c=this.marginTopReal,e=this.plotAreaHeight,h=this.plotAreaWidth,f;for(f=0;f=b&&(b=.001);if(void 0==h||0===h)h=.01;void 0===f&&(f="#000000");void 0===g&&(g=0);e={fill:c,stroke:f,"fill-opacity":e,"stroke-width":h,"stroke-opacity":g};a=isNaN(l)?a.circle(0,0,b).attr(e):a.ellipse(0,0,b,l).attr(e);k&&a.gradient("radialGradient",[c,d.adjustLuminosity(c,-.6)]);return a};d.text=function(a,b,c,e,h,f,g,k){f||(f="middle");"right"==f&&(f="end");"left"==f&&(f="start");isNaN(k)&&(k=1);void 0!==b&&(b=String(b),d.isIE&& +!d.isModern&&(b=b.replace("&","&"),b=b.replace("&","&")));c={fill:c,"font-family":e,"font-size":h,opacity:k};!0===g&&(c["font-weight"]="bold");c["text-anchor"]=f;return a.text(b,c)};d.polygon=function(a,b,c,e,h,f,g,k,l,m,n){isNaN(f)&&(f=.01);isNaN(k)&&(k=h);var q=e,p=!1;"object"==typeof q&&1b&&(b=Math.abs(b),r=-b);0>c&&(c=Math.abs(c),t=-c);r+=d.dx;t+=d.dy;h={fill:q,stroke:g,"fill-opacity":h,"stroke-opacity":k};void 0!==n&&0=z&& +(h=z);var v=1/180*Math.PI,z=b+Math.sin(e*v)*k,w=c-Math.cos(e*v)*t,x=b+Math.sin(e*v)*f,A=c-Math.cos(e*v)*g,B=b+Math.sin((e+h)*v)*f,D=c-Math.cos((e+h)*v)*g,C=b+Math.sin((e+h)*v)*k,v=c-Math.cos((e+h)*v)*t,I={fill:d.adjustLuminosity(m.fill,-.2),"stroke-opacity":0,"fill-opacity":m["fill-opacity"]},H=0;180Math.abs(h)&&1>=Math.abs(B- +x)&&1>=Math.abs(D-A)&&(O=!0));h="";var J;q&&(I["fill-opacity"]=0,I["stroke-opacity"]=m["stroke-opacity"]/2,I.stroke=m.stroke);0a.length&&(a=String(a[0])+String(a[0])+String(a[1])+String(a[1])+String(a[2])+String(a[2]));b=b||0;var c="#",d,h;for(h=0;3>h;h++)d=parseInt(a.substr(2*h,2),16),d=Math.round(Math.min(Math.max(0,d+d*b),255)).toString(16),c+=("00"+d).substr(d.length);return c}})();(function(){var d=window.AmCharts;d.Bezier=d.Class({construct:function(a,b,c,e,h,f,g,k,l,m){"object"==typeof g&&(g=g[0]);"object"==typeof k&&(k=k[0]);0===k&&(g="none");f={fill:g,"fill-opacity":k,"stroke-width":f};void 0!==l&&0c&&(k=c);b.push({x:l.x-k/h,y:l.y-e/f});b.push({x:l.x,y:l.y});b.push({x:l.x+k/h,y:l.y+e/f})}e=a[a.length-1].y-a[a.length-2].y;c=a[a.length-1].x- +a[a.length-2].x;b.push({x:a[a.length-1].x-c/h,y:a[a.length-1].y-e/f});b.push({x:a[a.length-1].x,y:a[a.length-1].y});return b},drawBeziers:function(a){var b="",c;for(c=0;c<(a.length-1)/3;c++)b+=this.drawBezierMidpoint(a[3*c],a[3*c+1],a[3*c+2],a[3*c+3]);return b},drawBezierMidpoint:function(a,b,c,d){var h=Math.round,f=this.getPointOnSegment(a,b,.75),g=this.getPointOnSegment(d,c,.75),k=(d.x-a.x)/16,l=(d.y-a.y)/16,m=this.getPointOnSegment(a,b,.375);a=this.getPointOnSegment(f,g,.375);a.x-=k;a.y-=l;b=this.getPointOnSegment(g, +f,.375);b.x+=k;b.y+=l;c=this.getPointOnSegment(d,c,.375);k=this.getMiddle(m,a);f=this.getMiddle(f,g);g=this.getMiddle(b,c);m=" Q"+h(m.x)+","+h(m.y)+","+h(k.x)+","+h(k.y);m+=" Q"+h(a.x)+","+h(a.y)+","+h(f.x)+","+h(f.y);m+=" Q"+h(b.x)+","+h(b.y)+","+h(g.x)+","+h(g.y);return m+=" Q"+h(c.x)+","+h(c.y)+","+h(d.x)+","+h(d.y)},getMiddle:function(a,b){return{x:(a.x+b.x)/2,y:(a.y+b.y)/2}},getPointOnSegment:function(a,b,c){return{x:a.x+(b.x-a.x)*c,y:a.y+(b.y-a.y)*c}}})})();(function(){var d=window.AmCharts;d.AmDraw=d.Class({construct:function(a,b,c,e){d.SVG_NS="http://www.w3.org/2000/svg";d.SVG_XLINK="http://www.w3.org/1999/xlink";d.hasSVG=!!document.createElementNS&&!!document.createElementNS(d.SVG_NS,"svg").createSVGRect;1>b&&(b=10);1>c&&(c=10);this.div=a;this.width=b;this.height=c;this.rBin=document.createElement("div");d.hasSVG?(d.SVG=!0,b=this.createSvgElement("svg"),a.appendChild(b),this.container=b,this.addDefs(e),this.R=new d.SVGRenderer(this)):d.isIE&&d.VMLRenderer&& +(d.VML=!0,d.vmlStyleSheet||(document.namespaces.add("amvml","urn:schemas-microsoft-com:vml"),31>document.styleSheets.length?(b=document.createStyleSheet(),b.addRule(".amvml","behavior:url(#default#VML); display:inline-block; antialias:true"),d.vmlStyleSheet=b):document.styleSheets[0].addRule(".amvml","behavior:url(#default#VML); display:inline-block; antialias:true")),this.container=a,this.R=new d.VMLRenderer(this,e),this.R.disableSelection(a))},createSvgElement:function(a){return document.createElementNS(d.SVG_NS, +a)},circle:function(a,b,c,e){var h=new d.AmDObject("circle",this);h.attr({r:c,cx:a,cy:b});this.addToContainer(h.node,e);return h},ellipse:function(a,b,c,e,h){var f=new d.AmDObject("ellipse",this);f.attr({rx:c,ry:e,cx:a,cy:b});this.addToContainer(f.node,h);return f},setSize:function(a,b){0c&&(c=1);1>e&&(e=1);k.attr({x:a,y:b,width:c,height:e,rx:h,ry:h,"stroke-width":f});this.addToContainer(k.node,g);return k},image:function(a,b,c,e,h,f){var g=new d.AmDObject("image",this);g.attr({x:b,y:c,width:e,height:h});this.R.path(g,a);this.addToContainer(g.node,f);return g},addToContainer:function(a,b){b||(b=this.container);b.appendChild(a)},text:function(a,b,c){return this.R.text(a,b,c)},path:function(a,b,c,e){var h=new d.AmDObject("path",this);e||(e="100,100"); +h.attr({cs:e});c?h.attr({dd:a}):h.attr({d:a});this.addToContainer(h.node,b);return h},set:function(a){return this.R.set(a)},remove:function(a){if(a){var b=this.rBin;b.appendChild(a);b.innerHTML=""}},renderFix:function(){var a=this.container,b=a.style,c;try{c=a.getScreenCTM()||a.createSVGMatrix()}catch(d){c=a.createSVGMatrix()}a=1-c.e%1;c=1-c.f%1;.5c&&(g="dot"),3<=c&&6>=c&&(g="dash"),6g&&(b+=g);0>k&&(c+=k)}return{x:b,y:c,width:d,height:h}},setText:function(a,b){var c=a.node;c&&(c.innerHTML=b);this.setAttr(a,"text-anchor",a.anchor)},addListener:function(a,b,c){a.node["on"+b]=c},move:function(a,b,c){var e=a.node,h=e.style;"text"==a.type&&(c-=d.removePx(h.fontSize)/2-1);"oval"==a.shapeType&&(b-=d.removePx(h.width)/2,c-=d.removePx(h.height)/2);a=a.bw;isNaN(a)||(b-=a,c-=a);isNaN(b)||isNaN(c)||(e.style.left=b+"px",e.style.top=c+"px")},svgPathToVml:function(a){var b= +a.split(" ");a="";var c,d=Math.round,h;for(h=0;hthis.fontSize&&(this.ly=h/2-1);0p&&(p=A);w=w.height;w>r&&(r=w)}var A=r=0,B=f,D=0,C=0;for(x=0;xC&&(C=w.height);H+w.width>q&&0=l&&(A=0,r++,D=D+C+m,B=f,C=0);z.push(I)}w=z.getBBox();l=w.height+2*m-1;"left"==a||"right"==a?(n=w.width+2*f,k=n+b+c,g.style.width=k+"px",this.ieW=k):n=k-b-c-1;c=d.polygon(this.container,[0,n,n,0],[0,0,l,l],this.backgroundColor,this.backgroundAlpha,1,this.borderColor,this.borderAlpha);d.setCN(this.chart,c,"legend-bg");u.push(c);u.translate(b,e);c.toBack();b=f;if("top"==a||"bottom"==a||"absolute"==a||"outside"==a)"center"==this.align? +b=f+(n-w.width)/2:"right"==this.align&&(b=f+n-w.width);z.translate(b,m+1);this.titleHeight>l&&(l=this.titleHeight);a=l+e+h+1;0>a&&(a=0);a>this.chart.divRealHeight&&(g.style.top="0px");g.style.height=Math.round(a)+"px";t.setSize(this.divWidth,a)},createEntry:function(a){if(!1!==a.visibleInLegend){var b=this.chart,c=a.markerType;a.legendEntryWidth=this.markerSize;c||(c=this.markerType);var e=a.color,h=a.alpha;a.legendKeyColor&&(e=a.legendKeyColor());a.legendKeyAlpha&&(h=a.legendKeyAlpha());var f;!0=== +a.hidden&&(f=e=this.markerDisabledColor);var g=a.pattern,k=a.customMarker;k||(k=this.customMarker);var l=this.container,m=this.markerSize,n=0,q=0,p=m/2;if(this.useGraphSettings){c=a.type;this.switchType=void 0;if("line"==c||"step"==c||"smoothedLine"==c||"ohlc"==c)g=l.set(),a.hidden||(e=a.lineColorR,f=a.bulletBorderColorR),n=d.line(l,[0,2*m],[m/2,m/2],e,a.lineAlpha,a.lineThickness,a.dashLength),d.setCN(b,n,"graph-stroke"),g.push(n),a.bullet&&(a.hidden||(e=a.bulletColorR),n=d.bullet(l,a.bullet,a.bulletSize, +e,a.bulletAlpha,a.bulletBorderThickness,f,a.bulletBorderAlpha))&&(d.setCN(b,n,"graph-bullet"),n.translate(m+1,m/2),g.push(n)),p=0,n=m,q=m/3;else{var r;a.getGradRotation&&(r=a.getGradRotation());n=a.fillColorsR;!0===a.hidden&&(n=e);if(g=this.createMarker("rectangle",n,a.fillAlphas,a.lineThickness,e,a.lineAlpha,r,g))p=m,g.translate(p,m/2);n=m}d.setCN(b,g,"graph-"+c);d.setCN(b,g,"graph-"+a.id)}else k?g=l.image(k,0,0,m,m):(g=this.createMarker(c,e,h,void 0,void 0,void 0,void 0,g))&&g.translate(m/2,m/2); +d.setCN(b,g,"legend-marker");this.addListeners(g,a);l=l.set([g]);this.switchable&&a.switchable&&l.setAttr("cursor","pointer");void 0!==a.id&&d.setCN(b,l,"legend-item-"+a.id);d.setCN(b,l,a.className,!0);(f=this.switchType)&&"none"!=f&&0c&&(d="00"+c);10<=c&&100>c&&(d="0"+c);a=a.replace(/fff/g,d)}return a};d.extractPeriod=function(a){var b=d.stripNumbers(a),c=1;b!=a&&(c=Number(a.slice(0,a.indexOf(b))));return{period:b,count:c}};d.getDate=function(a,b,c){return a instanceof Date?d.newDate(a,c):b&&isNaN(a)?d.stringToDate(a,b):new Date(a)};d.newDate=function(a,b){return b&&"fff"!=b?new Date(a):d.useUTC? +new Date(a.getUTCFullYear(),a.getUTCMonth(),a.getUTCDate(),a.getUTCHours(),a.getUTCMinutes(),a.getUTCSeconds(),a.getUTCMilliseconds()):new Date(a.getFullYear(),a.getMonth(),a.getDate(),a.getHours(),a.getMinutes(),a.getSeconds(),a.getMilliseconds())};d.resetDateToMin=function(a,b,c,e){void 0===e&&(e=1);var h,f,g,k,l,m,n;d.useUTC?(h=a.getUTCFullYear(),f=a.getUTCMonth(),g=a.getUTCDate(),k=a.getUTCHours(),l=a.getUTCMinutes(),m=a.getUTCSeconds(),n=a.getUTCMilliseconds(),a=a.getUTCDay()):(h=a.getFullYear(), +f=a.getMonth(),g=a.getDate(),k=a.getHours(),l=a.getMinutes(),m=a.getSeconds(),n=a.getMilliseconds(),a=a.getDay());switch(b){case "YYYY":h=Math.floor(h/c)*c;f=0;g=1;n=m=l=k=0;break;case "MM":f=Math.floor(f/c)*c;g=1;n=m=l=k=0;break;case "WW":g=a>=e?g-a+e:g-(7+a)+e;n=m=l=k=0;break;case "DD":n=m=l=k=0;break;case "hh":k=Math.floor(k/c)*c;n=m=l=0;break;case "mm":l=Math.floor(l/c)*c;n=m=0;break;case "ss":m=Math.floor(m/c)*c;n=0;break;case "fff":n=Math.floor(n/c)*c}d.useUTC?(a=new Date,a.setUTCFullYear(h, +f,g),a.setUTCHours(k,l,m,n)):a=new Date(h,f,g,k,l,m,n);return a};d.getPeriodDuration=function(a,b){void 0===b&&(b=1);var c;switch(a){case "YYYY":c=316224E5;break;case "MM":c=26784E5;break;case "WW":c=6048E5;break;case "DD":c=864E5;break;case "hh":c=36E5;break;case "mm":c=6E4;break;case "ss":c=1E3;break;case "fff":c=1}return c*b};d.intervals={s:{nextInterval:"ss",contains:1E3},ss:{nextInterval:"mm",contains:60,count:0},mm:{nextInterval:"hh",contains:60,count:1},hh:{nextInterval:"DD",contains:24,count:2}, +DD:{nextInterval:"",contains:Infinity,count:3}};d.getMaxInterval=function(a,b){var c=d.intervals;return a>=c[b].contains?(a=Math.round(a/c[b].contains),b=c[b].nextInterval,d.getMaxInterval(a,b)):"ss"==b?c[b].nextInterval:b};d.dayNames="Sunday Monday Tuesday Wednesday Thursday Friday Saturday".split(" ");d.shortDayNames="Sun Mon Tue Wed Thu Fri Sat".split(" ");d.monthNames="January February March April May June July August September October November December".split(" ");d.shortMonthNames="Jan Feb Mar Apr May Jun Jul Aug Sep Oct Nov Dec".split(" "); +d.getWeekNumber=function(a){a=new Date(a);a.setHours(0,0,0);a.setDate(a.getDate()+4-(a.getDay()||7));var b=new Date(a.getFullYear(),0,1);return Math.ceil(((a-b)/864E5+1)/7)};d.stringToDate=function(a,b){var c={},e=[{pattern:"YYYY",period:"year"},{pattern:"YY",period:"year"},{pattern:"MM",period:"month"},{pattern:"M",period:"month"},{pattern:"DD",period:"date"},{pattern:"D",period:"date"},{pattern:"JJ",period:"hours"},{pattern:"J",period:"hours"},{pattern:"HH",period:"hours"},{pattern:"H",period:"hours"}, +{pattern:"KK",period:"hours"},{pattern:"K",period:"hours"},{pattern:"LL",period:"hours"},{pattern:"L",period:"hours"},{pattern:"NN",period:"minutes"},{pattern:"N",period:"minutes"},{pattern:"SS",period:"seconds"},{pattern:"S",period:"seconds"},{pattern:"QQQ",period:"milliseconds"},{pattern:"QQ",period:"milliseconds"},{pattern:"Q",period:"milliseconds"}],h=!0,f=b.indexOf("AA");-1!=f&&(a.substr(f,2),"pm"==a.toLowerCase&&(h=!1));var f=b,g,k,l;for(l=0;lh&&(p="0"+ +p);var r="0"+g;b=b.replace(/W/g,n);n=k;24==n&&(n=0);var t=n;10>t&&(t="0"+t);b=b.replace(/JJ/g,t);b=b.replace(/J/g,n);t=k;0===t&&(t=24,-1!=b.indexOf("H")&&f--);n=f;10>f&&(n="0"+f);var u=t;10>u&&(u="0"+u);b=b.replace(/HH/g,u);b=b.replace(/H/g,t);t=k;11u&&(u="0"+u);b=b.replace(/KK/g,u);b=b.replace(/K/g,t);t=k;0===t&&(t=12);12u&&(u="0"+u);b=b.replace(/LL/g,u);b=b.replace(/L/g,t);t=l;10>t&&(t="0"+t);b=b.replace(/NN/g,t);b=b.replace(/N/g,l);l=m;10>l&&(l="0"+l);b=b.replace(/SS/g, +l);b=b.replace(/S/g,m);m=a;10>m&&(m="00"+m);100>m&&(m="0"+m);l=a;10>l&&(l="00"+l);b=b.replace(/QQQ/g,m);b=b.replace(/QQ/g,l);b=b.replace(/Q/g,a);b=12>k?b.replace(/A/g,"am"):b.replace(/A/g,"pm");b=b.replace(/YYYY/g,"@IIII@");b=b.replace(/YY/g,"@II@");b=b.replace(/MMMM/g,"@XXXX@");b=b.replace(/MMM/g,"@XXX@");b=b.replace(/MM/g,"@XX@");b=b.replace(/M/g,"@X@");b=b.replace(/DD/g,"@RR@");b=b.replace(/D/g,"@R@");b=b.replace(/EEEE/g,"@PPPP@");b=b.replace(/EEE/g,"@PPP@");b=b.replace(/EE/g,"@PP@");b=b.replace(/E/g, +"@P@");b=b.replace(/@IIII@/g,e);b=b.replace(/@II@/g,q);b=b.replace(/@XXXX@/g,c.monthNames[h]);b=b.replace(/@XXX@/g,c.shortMonthNames[h]);b=b.replace(/@XX@/g,p);b=b.replace(/@X@/g,h+1);b=b.replace(/@RR@/g,n);b=b.replace(/@R@/g,f);b=b.replace(/@PPPP@/g,c.dayNames[g]);b=b.replace(/@PPP@/g,c.shortDayNames[g]);b=b.replace(/@PP@/g,r);return b=b.replace(/@P@/g,g)};d.changeDate=function(a,b,c,e,h){if(d.useUTC)return d.changeUTCDate(a,b,c,e,h);var f=-1;void 0===e&&(e=!0);void 0===h&&(h=!1);!0===e&&(f=1);switch(b){case "YYYY":a.setFullYear(a.getFullYear()+ +c*f);e||h||a.setDate(a.getDate()+1);break;case "MM":b=a.getMonth();a.setMonth(a.getMonth()+c*f);a.getMonth()>b+c*f&&a.setDate(a.getDate()-1);e||h||a.setDate(a.getDate()+1);break;case "DD":a.setDate(a.getDate()+c*f);break;case "WW":a.setDate(a.getDate()+c*f*7);break;case "hh":a.setHours(a.getHours()+c*f);break;case "mm":a.setMinutes(a.getMinutes()+c*f);break;case "ss":a.setSeconds(a.getSeconds()+c*f);break;case "fff":a.setMilliseconds(a.getMilliseconds()+c*f)}return a};d.changeUTCDate=function(a,b, +c,d,h){var f=-1;void 0===d&&(d=!0);void 0===h&&(h=!1);!0===d&&(f=1);switch(b){case "YYYY":a.setUTCFullYear(a.getUTCFullYear()+c*f);d||h||a.setUTCDate(a.getUTCDate()+1);break;case "MM":b=a.getUTCMonth();a.setUTCMonth(a.getUTCMonth()+c*f);a.getUTCMonth()>b+c*f&&a.setUTCDate(a.getUTCDate()-1);d||h||a.setUTCDate(a.getUTCDate()+1);break;case "DD":a.setUTCDate(a.getUTCDate()+c*f);break;case "WW":a.setUTCDate(a.getUTCDate()+c*f*7);break;case "hh":a.setUTCHours(a.getUTCHours()+c*f);break;case "mm":a.setUTCMinutes(a.getUTCMinutes()+ +c*f);break;case "ss":a.setUTCSeconds(a.getUTCSeconds()+c*f);break;case "fff":a.setUTCMilliseconds(a.getUTCMilliseconds()+c*f)}return a}})(); \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/changeLog.txt b/ResoursesManager/ResoursesManager/amcharts/changeLog.txt new file mode 100644 index 0000000..15603b2 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/changeLog.txt @@ -0,0 +1,1071 @@ +############################################################################################################################### + +Since version 3.4.3, change log moved to: http://www.amcharts.com/javascript-charts/changelog/ + +#### 3.4.2 #################################################################################################################### + +Bug fix: if pie slice had no label, the external method rollOverSlice(index) was not working + +Bug fix: x switch of the legend position adjusted + +Bug fix: when autoWrap for category axis was set to true, in some cases axis title was cut. + +markPeriodChange was set to true in CategoryAxesSettings. + +#### 3.4.1 #################################################################################################################### + +"patterns" theme added. + +themes were updated a bit. + +labels of angular gauge axis adjusted. + +when scrolling serial/stock charts with mousewheel (chart.mouseWheelScrollEnabled must be set to true), if user press shift +button, the chart will zoom-in or zoom-out; + +adjustment property added to ChartCursor. Default value is 0, if you set it to -1, the balloon will show near previous, if +you set it to 1 - near next data point. + +#### 3.4.0 #################################################################################################################### + +Link to amCharts.com site in a free version was made less noticable - it uses chart's font color and font size and you can +adjust it's position using creditsPosition property of AmChart. Possible values are: top-left, top-right, bottom-right and +bottom-left. This will help you to achieve better layout of a chart. + +We fixed typo in chart cursors property - it was showNextAvalable and now is showNextAvailable. The old one won't work. + +Since now you can scroll serial and stock charts with mouse wheel. To enable this, set chart.mouseWheelScrollEnabled = true +(default is false) + +moved event added to chart cursor. It is dispatched every time the mouse is moved. The event object has the following +properties: x, y (coordinates of the cursor), target (reference to cursor), chart, zooming. + +axisX and axisY properties added to AxisBase. They are read-only and returns x and y positions of the axis. + +unit and unitPosition (with possible values left and right) added to GaugeAxis class. + +autoWrap property added to CategoryAxis, with default value false. If you set it to true, the axis labels will be wrapped +if they won't fit in the allocated space. + +minHorizontalGap (default 75) and minVerticalGap (35) properties added to AxisBase. They are used to calculate the number of +gridLines when autoGridCount is true. You can modify these values to have more or less grid lines. + + +#### 3.3.6 #################################################################################################################### + +# Bug fix - charts with legend could fail if there was a google analytics script in the page. + +# stepDirection property added to AmGraph. If you set it to "left", step line graph will draw the step to the left of the +date/category. + +#### 3.3.5 #################################################################################################################### + +# Bug fix - 3D pie chart was not rendered in IE8 and older (since 3.3.4 version only) + +# Candlestick graphs can display patterns + +# Old listeners are removed automatically if the same listener was added, this helps to avoid duplicate calls of event +handlers + +# \n in labelText of AmGraph is now properly displayed as new line. + +#### 3.3.4 #################################################################################################################### + +# export as image script fixed - bullets of charts with scrollbars were not exported. + +# dataContext property added to SerialDataItem. It holds reference to original data object and might be used when using +labelFunction to format custom balloon text and in some other cases. + +# XY chart can display bullets with patterns (if valueField is set). + + +#### 3.3.3 #################################################################################################################### + +# hideBalloonTime property added to AmChart class, default value is 150 (milliseconds). It sets time after which balloon is +hidden if user rolls-out of the object. Increasing the time might help to prevent balloon flickering while moving the +mouse over the object. + +# useLineColorForBulletBorder property added to AmGraph. Might help in some situations, especially when using themes. + +# 3D charts now look a lot better with patterns. + +# endWidth property added to GaugeArrow (default 0). This will allow having more modern, rectangular arrows. + +# facePattern property added to AmAngularGauge. You can fill gauge's face with some pattern using it. + +# bug fix: new lines were ignored in balloons + +#### 3.3.2 #################################################################################################################### + +# You can now set theme for all the charts on your page by setting: +AmCharts.theme = AmCharts.themes.light; // or some other theme +If you are creating charts using JavaScript API, not JSON, then this is quite a comfortable way, as you won't need to +pass theme to each object you create. + +# bug fix: rendered event was fired only on first render, now it is fired each time the chart is rendered after +chart.validateNow(); method is called. This bug caused the export buttons to dissapear after the validateNow() method. + +# chartCursror.showNextAvalable property added (default is false). If true, the graph will display balloon on next +available data point if currently hovered item doesn't have value for this graph. + +# graph.periodSpan property added (default is 1). This property can be used by step graphs - you can set how many periods +one horizontal line should span. + +# "end" option added to graph.pointPosition property. + + +#### 3.3.1 #################################################################################################################### + +# bug fix - \n was replaced with
in category axis and the tag was displayed +# bug fix - if lineColorField or dashLengthField or fillColorsField was set, the graph could loose the setting if zoomed. + +#### 3.3.0 #################################################################################################################### + +# Since this version amCharts and amMap support themes. This means that instead of seting every property for each graph +or axis or any other object, you can set new defaults in a theme file. This will make devs' life a lot easier. + +Currently you can find three themes in amcharts/themes folder - dark.js, light.js and chalk.js To set a theme for a chart, +simply set theme property to the name of the file: theme:"light". Note, this will work only if you are creating chart +using JSON config. If you do it in old way (JSON config is supported since v 3.2.0), you should pass theme object for +each new object you build, for example: var graph = new AmCharts.AmGraph(AmCharts.themes.light); + +We will be adding more themes soon. Check _usingThemes.html file in samples folder to see themes in action. + +# patterns property added to AmSlicedChart and AmCoordinateChart - instead of setting a pattern for a slice/graph, you can +pass array of patterns using this property. + +# you can now control zoom-out buttons with the following new properties of AmRectangularChart: + + zoomOutButtonImageSize + zoomOutButtonImage + zoomOutButtonColor + zoomOutButtonAlpha + zoomOutButtonRollOverAlpha + zoomOutButtonPadding + +# some minor bugs fixed + +#### 3.2.0 #################################################################################################################### + + +# AmCharts.makeChart(divID, chartConfig); method added. divID is id of a div where your chart should appear. chartConfig is +JSON object with chart configuration. Check examples with _JSON_ prefix in samples folder to see this in action. + +# type property added to AmChart class. It is required to specify type to one of the following, when creating charts from +JSON config: serial, xy, radar, pie, gauge, funnel, map, stock + +# a possibility to export charts as image/pdf/svg added for all modern browsers except IE9 (IE10 is supported). The +exporting doesn't require any server side software and is made using js libraries only. Check samples with +_exporting_ prefix to see this in action. Exporting to SVG doesn't work very properly with stock chart or charts with +legend (will offer saving multiple files). + +# You can set any legend items via legend.data property, for example: +legend.data = [{title:"first", color:"#CC0000", value:50}, {title:"second", color:"#00CC00", value:100}]; +This allows creating any legend items you want. Call chart.legend.validateNow(); if you change legend's data at run time. + +# AmAngularGauge supports legend now + +# bug fix - if a chart with scrollbar was rotated after the chart is created, the scrollbar's graph was shifted to a wrong +position. + +# bug fix - column graph type wasn't displayed in chart scrollbar (since 3.1.0) + +# gridAboveGraphs property added to AmCoordinate chart. This allow to show grid lines above your graphs, as world-famous +data visualization guru Edward Tufte suggests. Note, this won't work properly with 3D charts. + +# negative axis labels rotation possible. You can use values from -90 to -1 for labelRotation property since now. + +# bug fix: step line with changing line color was rendered incorrectly if some values were missing. + +# bug fix: labelPosition "inside" and "middle" for bar charts fixed. + +# bug fix: AmAngularGauge chart wasn't firing "rendered" event. + + +#### 3.1.1 #################################################################################################################### + +# FireFox error messages about style declarations fixed + +# Bug fix: maxWidth property of AmBalloon was ignored + +# Some other minor bugs fixed + + +#### 3.1.0 #################################################################################################################### + +Great new features added - charts now support patterns (can fill bars, lines and slices with images) and can simulate +hand drawn charts - the lines will be a bit distorted and produce a nice effect. Check our new inspiring samples at +http://www.amcharts.com/inspiration/ to see new possibilities in action. + +# patterns +Patterns can be set for entire graphs or for individual columns/slices. In case you want to set pattern for a graph, use +pattern property of AmGraph. If you want to set individual pattern for a column or slice, describe patterns in chart's +data and set patternField for a graph or pie/funnel chart. Value of pattern should be object with url, width, height of an +image, optionally it might have x, y, randomX and randomY values. For example: + +graph.pattern = {"url":"../amcharts/patterns/black/pattern1.png", "width":4, "height":4}; + +check amcharts/patterns folder for some patterns. You can create your own patterns and use them. + +Note, x, y, randomX and randomY properties won't work with IE8 and older. + +Check handDrawnChart.html, pieWithPatterns.html or columnWithPatterns.html examples to see this in action. + +Note, 3D bar/Pie charts won't work properly with patterns. + +# hand-drawn style +if you set chart.handDrawn = true, the lines of a chart will be distorted and will produce hand-drawn effect. +You can also modify chart.handDrawScatter (default value is 2) and chart.handDrawThickness (default value 1) values for +more scattered view. + +# offsetY and offsetX properties added to AmBalloon. Specifies the distance from the mouse position to balloon's pointer. +You might want to increase distance when using hand drawn style. + +# Some minor problems fixed + +#### 3.0.1 #################################################################################################################### + +Some very minor bugs which usually pop right after big release fixed. + +#### 3.0.0 #################################################################################################################### + +**** Several files **** + +As not all users require all type of charts, we spilt the js file into several files - one main amcharts.js file, plus +a separate js file for each chart type. This means you can include only the charts you need. If you are worried about +number of requests, you can simply copy/paste the source of the charts you use to the main file. + +**** Upgrading / 100% backwards compatibility **** + +Although we changed some default values in order to improve usability of the charts, the only thing you should worry +about when upgrading from v2 to v3 is the feature mention above – you should include two or more js files in order your +charts to work. If you don’t like the changed defaults, you can always set them to the previous values in your chart +setup. + +**** New chart types **** + +# Funnel / Pyramid chart. +Check funnelChart.html and pyramidChart.html examples. As this chart type has a lot of in common +with pie chart, we created one base class for these chart types - AmSlicedChart. AmPieChart and AmFunnelChart now extend +this class. Visit our online class reference for properties and methods of AmFunnelChart. + +# Angular Gauge +Supports multiple axes and multiple arrows. Check the following examples: angularGauge.html, +angularGaugeWithTwoAxes.html, clock.html, clockWithTwoFaces.html. Visit our online class reference for properties and +methods of classes used by this chart type. + +*** New chart types made with new possibilities of Serial/XY charts *** + +We added lots of new features to our charts and with these features you can create new chart types, like: + +# Horizontal or vertical bullet chart - bulletChart.html + +# Waterfall chart - waterFallChart.html + +# Step chart without risers - lineStepNoRisers.html + +# Error chart (both Serial and XY) - errorChart.html + +*** Other new features *** + +# Possibility to show minor grid for both Category and Value axis. minorGridEnabled (default value false) and +minorGridAlpha (default 0.07) properties added to AxisBase class. +Example: lineWithScrollAndZoom.html + + +# Possibility to change line graphs' line/fill color on any data point to create highlighted sections of the graph. +To achieve this, you should set lineColorField and/or fillColorsField for your graph and have a field in your data +which would contain color values at a point where you want the graph to change it's color. +Example: lineWithChangingColor.html + + +# Possibility to switch line from solid to dashed. Columns can also have dashed outline. To achieve this, you should set +dashLengthField for your graph and have a field in your data which would contain dashLength value at a point where you +want the graph to change from solid to dashed or vice versa. +Example: lineWithDifferentBulletSizes.html and columnAndLineMix.html + + +# Date strings in data now supported. Even if your chart parses dates, you can pass them as strings in your data – all you +need to do is to set data date format and the chart will parse dates to date objects. This means that now data for +date-based chart can be in legit JSON format. dataDateFormat property added to AmSerialChart and AmStockChart. +Example: lineWithChangingColor.html, lineWithTrendLines.html and some more. + + +# When moving chart cursor over the chart, hovered bullets can change their size. If a graph has bullets and you added +ChartCursor to the chart, bullets will become bigger when char cursor is over them. graphBulletSize property with +default value 1.7 added to ChartCursor. If you want to disable this feature, set the value to 1. +Example: lineWithLogarithmicValueAxis.html, lineWithScrollAndZoom.html and some more. + + +# Legend can now display period value. When user is not hovering the chart, legend can show sum, average, open, close, low +or high values of selected period. periodValueText added to AmLegend and legendPeriodValueText added to AmGraph to +achieve this. The tags should be made out of two parts - the name of a field (value / open / close / high / low) and the +value of the period you want to be show - open / close / high / low / sum / average / count. For example: [[value.sum]] +means that sum of all data points of value field in the selected period will be displayed. +Example: area100PercentStacked.html and areaStacked.html + +To achieve the same with stock chart, we added periodValueTextRegular and periodValueTextComparing proprties to +StockLegend. To show percent period values, you should add "percent." prefix for your tag, for example: +[[percents.value.close]] means that last percent value of a period will be displayed. +Example: stockMultiplePanels.html and stockMultipleDataSets.html + + +# Legend markers can now mirror graph’s settings, displaying a line and a real bullet as in the graph itself. +useGraphSettings property with default value false was added to AmLegend. Note, we also removed "line" and "dashedLine" +marker types because of this - use the useGraphSettings feature in case you need lines as markers in the legend. +Example: lineWithDifferentBulletSizes.html and lineWithMultipleValueAxes.html + + +# Legend now supports custom markers (images). customMarker property was added to AmGraph. You should set path to the image +which should be displayed in the legend. + + +# Diamond bullet type added. Set graph.bullet = "diamond" to use it. + + +# Dynamic bullet size based on value axis / Error chart. +Error chart is a regular serial or XY chart with bullet type set to "errorX" or "errorY". The graph should know which axis +should be used to determine the size of this bullet - that's when graph.bulletAxis property should be set. Besides that, +you should also set graph.errorField. You can also use other bullet types with this feature too. For example, if you set +bulletAxis for XY chart, the size of a bullet will change as you zoom the chart. +Example: errorChart.html + + +# You can specify custom column width for each graph individually. columnWidth property added to AmGraph. Note, you set +relative width here (0 - 1), not width in pixels. +Example: bulletChart.html + + +# Columns can be overlaid on other columns, without making axis as stacked. clustered property added to AmGraph. In case you +want to place graph's columns in front of other columns, set it to false. +Example: bulletChart.html + + +# Resize grips were made bigger to make life easier for users on touch devices. + + +# Balloons can now display any HTML and CSS inside them. This means you can add images, format text or display just about +any HTML/CSS content. Because of this new feature, we removed textShadow property of AmBalloon in this version. +Example: areaStacked.html, barStacked.html and many other. + + +# Balloon now can animate from point to point and also fade out when user moves away from the chart. animationDuration and +fadeOutDuration properties added to AmBalloon, with default values 0.3. animationDuration property was also added to +ChartCursor, so that the cursor line would also animate to its position. +Example: any chart with balloon. + + +# Balloon now can display shadow. shadowColor (default #000000) and shadowAlpha (default 0.4) added to AmBalloon. +Example: any chart with balloon. + + +# Some default values of AmBalloon changed for a better usability - adjustBorderColor to true, cornerRadius to 0, +pointerWidth to 6, color to #000000. +Example: any chart with balloon. + + +# Stock chart can display scrollbar on top of the chart. +Example: stockIntradayData.html + + + +******************************************************************************************************************************* +******************************************************************************************************************************* +******************************************************************************************************************************* + + + +2.11.3 +With IE8 and older, in some cases not all category axis labels were shown. + +2.11.2 +"drawn" event added to AmChart. Fired every time chart is drawn - on zoom, hide graph, etc. +bug fixed - in some cases last grid items of category axis were not drawn. + +2.11.1 +Bug fixed: if chart.usePrefixes was set to true, numbers near value axis grid could be rounded and duplicated. +This bug only occured in v 2.11.0. + +2.11.0 +Bug fixed: +FireFox 3.6 failed to show all columns of a graph. +NumberFormatter was ignored if usePrefixes was set to true. + +Features added: +baloonFunction added to AmGraph. If you set some function, the graph will call it and pass graphDataItem and graph object to it +this function should return a string which will be displayed in a balloon. + +Custom fields now supported in labels/balloons/legend of Pie and Radar chart. + +Guide.above property added, the guide will be placed above the graphs if set to true (default is false). + +2.10.8 +Bug with stacked step charts fixed. +categoryBalloonFunction property added to ChartCursor. It allows formatting any category balloon text you want. +The categoryBalloonFunction should return a string which will be displayed in a balloon. When categoryBalloonFunction +is called, category value (or date) is passed as an argument. + +2.10.7 +Bugs related to new behavior of CategoryAxis fixed. +CategoryAxis.centerLabelOnFullPeriod property added, with default value true. This setting works only when +parseDates is set to true and equalSpacing is set to false. In case you set it to false, +labels will never be centered between grid lines. + +2.10.6 +Some minor improvements. + +2.10.5 +CategoryAxis labeling, when parseDates is true was improved. +CategoryAxis.markPeriodChange property added, with default value set to true. If you set it to false, +the start of longer periods won't use a different date format and won't be bold. + + +2.10.4 + +charts can be rendered in "rtl" (right-to-left) mode. You have to set AmCharts.rtl = true in order this mode to be enabled. +categoryAxis.minPeriod now supports intervals like 15mm, 10ss (previously only equal intervals like ss, mm were supported). +some minor bugs fixed. + +2.10.3 + +milliseconds problem with firefox & IE fixed + +2.10.2 + +AmCharts.useUTC problems fixed. + +guide.color property added (changes text color of guide label). + +some other minor bugs fixed. + + +2.10.1 + +showHandOnHover property added to AmGraph. + +totalTextColor property added to ValueAxis. + +minimum and maximum properties added to ChartScrollbar class. In case your scrollbar has a graph, you can set +minimum and maximum values of scrollbar's value axis. + +"rendered" event added to AmChart class. fired only once, when chart is first rendered. + +bug with graph.negativeBase and line graph fixed. + +columnSpacing3D added to AmSerialChart. Allows setting space between 3d stacked columns. + +2.10.0 +****** +categoryFunction property added to CategoryAxis. It specifies a method that returns the value that should be +used as categoryValue for current item. If this property is set, the return value of the custom data function +takes precedence over categoryField. When a chart calls this method, it passes category value, data item from +chart's data provider and reference to categoryAxis: categoryFunction(category, dataItem, categoryAxis); +This method can be used both when category axis parses dates and when it doesn't. If axis parses dates, your +categoryFunction should return Date object. + +****** +labelFunction added to AxisBase. You can use it to format both Value and Category axis labels. If this function +is set for ValueAxis, it is called and these parameters are passed: labelFunction(value, valueText, valueAxis); +Where value is numeric value, valueText is formatted string and valueAxis is a reference to valueAxis object. + +If this function is set for CategoryAxis, then it is called with the following parameters passed: + +if dates are not parsed: +labelFunction(valueText, serialDataItem, categoryAxis) + +if dates are parsed: +labelFunction(valueText, date, categoryAxis) + +****** +fontSize property added to Guide. +position property added to Guide. + +****** +useMarkerColorForValues property added to AmLegend. + +****** +rightClickSlice event added to AmPieChart. + +****** +Some minor bugs fixed. + +************************************************************************************************************** + +2.9.2 + +Problem with lines not visible on XP+IE8 fixed. + +2.9.1 + +'selected' event of ChartCursor was added. It is fired when selectWithoutZooming is set to true and +user makes selection. + +Fixed XY chart external zoom (with valueAxis.zoomToValues() method) + +labelColorField added to AmGraph, it allows setting different color for individual data labels. + +forceShowField added to CategoryAxis. It allows setting which of the categories should +always be displayed. Works only when categoryAxis.parseDates = false + +rightClickGraphItem event added to AmCoordinateChart. + +"changed" event of chart cursor has a new property, called mostCloseGraph. It is +set if you are using chartCursor.oneBalloonOnly = true. + +Fix: IE used to hide legend of pie chart after validateNow() method was called. + +labelRadiusField property added to AmPieChart. It allows specifying the distance from pie +to data label manually. Note, if you set labelRadiusField, the chart won't try to +arrange labels so that they won't overlap. + + +2.9.0 + +Since this version, when setting zooming date-based chart, you have to set +exact "to" date. For example, if you want the chart to display one day only, +set from date as 2012,1,1 (first of February) and the to date as +new Date(2012,1,2) or new Date(2012,1,1,23,59,59). Previously you could set the +same date for start and end dates and the chart used to select one "minPeriod" +automatically, however this caused a lot of problems for charts displaying +monthly or yearly data. + +AmCharts.clear method added. Call this method if you want completely to remove all charts from a page. + +Memory leak fixed. + +Last item was not displayed if minPeriod was bigger than day. + +Switch of legend marker was in wrong position when marker size was quite small. + +validateData() method caused error when fillToGraph property was set. + +if valueAxis.minimum was set and values were smaller than this minimum, columns were not displayed. + +align property wasn't working when using external container for the legend. + +some other minor bugs fixed. + +2.8.5 + +above property added to Guide. If you set it to true, guides will be displayed above graphs. +Some minor bugs fixed. + +2.8.4 + +NEW FEATURE: +you can set a customly created div element as a container of your legend. To do this, +you should pass id or reference of the div in this method: + +chart.addLegend(legend, divID); + +FIXES: +balloon could be wrongly positioned in marginTop style was added directly to element. +chart.animateAgain(); worked only if validateNow() method was called after. +in some specific cases scrollbar could act icorrectly on IE8/IE7. + + +2.8.3 + +When panEventsEnabled was set to true, balloons over bullets were not shown. + +Text in balloons was not properly vertically aligned if verticalSpacing was set +to some different than default value. + +Balloon wasn't positioned properly if chart was in a scrollable div. + +Init event wasn't fired by AmPieChart. + +2.8.2 + +Step line's corners sometimes were not perfect (one extra pixel could be added +in the end of horizontal line) + +You couldn't change panEventsEnabled of AmChart class after the chart was +initialized. + +You couldn't chane legend's position after the chart was initialized. + +Step line chart was not correctly filled if Value axis was of some stacked type. + +Some other minor bugs fixed. + +2.8.1 + +hideXScrollbar and hideYScrollbar properties added to AmXYChart. This will +allow you to show one scrollbar only. + +2.8.0 + +New features: +you can pass dates as timestamps instead of date objects. + +ChartCursor.selectWithoutZooming property added which allows marking desired area +with chart cursor without zooming-in. + +graph.fillToGraph property added. This allows creating band or range graphs. +The area between graph and fillToGraph will be filled with a color if graph.fillAlphas +is set to > 0 value. Works with "line" graph type only. + +Bug fixes: + +Blurry lines on all browsers fixed + +right/bottom grid line was hidden if marginRight/marginBottom were set to 0 + +category balloon was shifted a bit since last version + +background image was incorrectly sized + +2.7.10 +Problem with balloon position in IE10 fixed. + +2.7.9 + +FIX: If you used to add/remove some graphs for several times, some graphs could disappear. + +FIX: balloon could be positioned in a wrong place in some specific cases with IE. + +Some other minor bugs fixed. + +2.7.8 + +url parameter added to chart.addLabel method + +Printing in IE8 fixed; + +Two typos in property names fixed: + +ValueAxis.minMaxMultiplier (instead of minMaxMultiplayer) +and +ValueAxis.synchronizationMultiplier (instead of synchronizationMultiplyer) + +We do not longer support old names with errors, so you should adjust names if you use +them in your scripts. Sorry for inconvenience. + +some other minor bugs fixed. + +2.7.7 + +ValueAxis.minMaxMultiplier was ignored if min (or max) value was equal to 0. +In some cases, when legend position was set to "left", chart might be positioned +incorrectly. + +2.7.6 + +chart.invalidateSize() method was fixed +charts used to ignore padding of a div. +chartCursor.showCursorAt(category) method added. It will make the cursor to +appear at specified cateogry or date. + +2.7.5 +Bug with smoothed line in scrollbar fixed. +minMaxMultiplayer property added to ValueAxis. Default value is 1. You can increase +min/max range using this property. Useful for bubble charts - prevents from bubbles +being cut. +Some other minor bugs fixed. + +2.7.4 +In case open and close values were equal, horizontal line wasn't drawn by candlestick chart. + +In case pie chart had one slice only, a tiny gap might be visible in IE8 and older. + +markerBorderColor of AmLegend was ignored. + +Ticks with no labels (when labelFrequency was > 1) were not hidden by categoryAxis. + +Balloons could overlap "show all" button preventing it from being clicked. + + +2.7.3 +new line symbol \n was ignored in some browsers. + +smaller than 1 numbers were formatted incorrectly in some cases. + +2.7.2 +Usabilty with touch devices improved - scrollbar's drag icons has a bigger hit area. + +Some bugs fixed. + +2.7.1 +chart.removeLegend() was not working properly. + +chart.startDate wasn't returning value. + +lineColorField added to graph's properties. + +2.7.0 +textAlign property added to AmBalloon. Possible values are left/middle/right, +default is "middle". + +behindColumns property added to AmGraph. If set to true, line graph will be +displayed behind column graphs. + +"init" event added to AmChart. Event is fired right after the chart is initialized +for the very first time. + +totalText property added to ValueAxis. Usage example: +valueAxis.totalText = "total: [[total]]" +It works only if the chart has column graphs and stackType is set to "regular" or "100%". + +showEntries property added to AmLegend. It might be used by StockChart - in case you want +legend as it displayes title of the chart but don't want legend entries to be visible. + +A bug with separate data provider set to graph fixed. + +2.6.13 +FIXES: +When viewing a page with a chart from iOS browser, console logged some errors + +gradientOrientation was ignored by area charts + +plotAreaGradientAngle property added to AmRectangularChart, can accept 0, 90, +180 and 270 values. + +2.6.12 +FIXES: +Pie chart data labels were hidden behind other slices if labelRadius < 0 + +If chart was in a div with scrollbar, cursor was displayed in wrong position after +scrolling with FF. + +Some other minor bugs fixed. + +2.6.11 +cursor and balloons were not shown on iPad when cursor.pan was set to true + +Labels near XY chart bullets were placed incorrectly (since last version only) + +some other minor bugs fixed + +2.6.10 +AmCharts.baseHref property added. Set it to true if you are using base href in your +HTML. This will help so solve svg/base href bug (clip paths are not working and +gradient fills are displayed as balck). + +Text can be wrapped again. Add \n in places you need new line in text. + +Some other minor bugs fixed. + +2.6.9 +AmCharts.useUTC property added, default value is false. Set it to true if you +create dates using timestamps, like new Date(1256953732) and wish dates to be +formatted usin UTC instead of local time. + +FIX: +If more than two colors were set for graph.fillColors, only two first colors +were used. + +FIX: +chartCursor.bulletsEnabled was ignored, even set to true. + +FIX: on IE8, if one slice was 100%, the circle wasn't displayed. + +FIX: custom fields in balloonText were not supported by XY chart. + +2.6.8 +pieAlpha property was ignored. +plotAreaBorderAlpha was ignored if plotAreaAlphas was 0 +column graph type was ignoring startEffect property. +chart property referencing to the chart object added to all event objects. + +2.6.7 +Pie slices became invisible if startAlpha was < 1 on <= IE8 browsers (since 2.6.6 only) +Performance with IE6 increased. + +2.6.6 +short year (YY) was incorrectly formatted in <= IE8 browsers +alphaField was ignored by column graph +chartScrollbar was not working properly when parseDates was set to false. +some other minor bugs fixed. + +2.6.5 +some minor bugs fixed. + +2.6.4 +minSelectedTime property added to AmSerialTime + +some minor bugs fixed. + +2.6.3 +zoom-out button wasn't working on iPad (only since 2.6.0) + +2.6.2 +Bug with paneEventsEnabled and older firefox (< 4) fixed + +////////////////////////////////////////////////////////////////////////////////////// +// IMPOTANT UPDATE /////////////////////////////////////////////////////////////////// +// 2.6.0 /////////////////////////////////////////////////////////////////// +////////////////////////////////////////////////////////////////////////////////////// + +amCharts is no longer using raphael drawing library. New drawing engine is included +inside amcharts.js file. The charts got a lot faster, the file size reduced by 70Kb! + +////////////////////////////////////////////////////////////////////////////////////// +2.5.5 +In new version of Chrome (17) a new bug was introduced - if touchEventsEnabled was set +to true, mouse events stopped working on normal browsers. Bug fixed in this version. + +////////////////////////////////////////////////////////////////////////////////////// +2.5.4 +Some minor bugs fixed + +////////////////////////////////////////////////////////////////////////////////////// +2.5.3 +Some minor bugs fixed + +////////////////////////////////////////////////////////////////////////////////////// +2.5.2 +Some minor bugs fixed + +////////////////////////////////////////////////////////////////////////////////////// +2.5.1 + +TrendLines are supported by XY chart from this version + +////////////////////////////////////////////////////////////////////////////////////// +// IMPORTANT UPDATE ////////////////////////////////////////////////////////////////// +// 2.5.0 ////////////////////////////////////////////////////////////////// +////////////////////////////////////////////////////////////////////////////////////// + +Since v 2.5 we no longer distribute our old flash charts in this package, we hope this +will help to avoid a lot of misunderstandings. If you still want to use flash charts, +download them in a separate package from www.amcharts.com/download/ + +We added a lot of new examples, to the "samples" folder. They are better structured, +source code commented. + +BIG NEW FEATURES: + +Automatic margins +margins of RectangularChart (Serial and XY charts) are calculated automatically now. +You can still work in old way by setting margins manually - set chart.autoMargins to +false. + +Axis titles +Previously you had to use addLabel method in order to give name to the axis. Since +this version we introduced title property for AxisBase, so you can name both Category +and Value Axes now much more easily. + +Chart title +Same as with axes titles - previously you had to use addLabel method to name a chart. +Now you can add any number of titles using +chart.addTitle(text, size, color, alpha, bold) method. Chart title is taken into account +when calculating margins, also position of pie/radar center. + +Trend lines +Chart can display Trend lines now. + +AmCharts.ready() method added so you don't need to use window.onload anymore. You can +use amCharts.ready as many times in one page as you want. + +NOT SO BIG NEW FEATURES: + +precision property added to ValueAxis. + +if chart.usePrefixes is set, prefixes will be used both in balloons and legend, not only +by valueAxis as before. + + +SOME OTHER THINGS TO MENTION: + +default value of autoGridCount property of AxisBase changed to true + +default value of textClickEnabled of AmLegend changed to false + +default value of hideResizeGrips of ChartScrollbar changed to false + +All margins of RectangularChart changed to 20, as they can still be used for sides +without axes. + + +////////////////////////////////////////////////////////////////////////////////////// +////////////////////////////////////////////////////////////////////////////////////// + +2.4.7 +FEATURE: +you can use custom tags like [[myCustomField]] in labelText / balloonText. If data item +from your data provider has such field, the tag will be replaced with this value. + +FIXES: +[[percents]] were not displayed in stacked chart labels. +labels on the 3D columns were positioned in wrong position in some cases. + +2.4.6 +FIXES: +if chartCursor.pan was set to true, mouse pointer didn't change back when off the area. + +in some cases balloon flashed in a wrong position (IE only) for a second. + +amFallback used to fail on older IE with set to false. + +Rollover balloons used to overlap when all of the datapoints were very near the top of +the plot area. + +Sometimes lines became blurry after window was resized. + +v16 of Chrome used to display warning about deprecated layerX and layerY properties + +guides on CategoryAxis with not date based values used not to work properly. + +Some other minor bugs fixed. + +FEATURES: + +boldPeriodBeginning property with default value true added to CoordinateAxis. +You can disable bolding of the beginning of a period (like year/month/etc) using +it. + +2.4.5 +some bugs fixed + +2.4.4 +some bugs fixed + +2.4.3 +labels added using addLabel method weren't rotated (this bug was since v 2.4.0) +Raphael.js updated to 2.0.1, some related issues in amCharts fixed. + +2.4.2 +equalWidths with default value true added to AmLegend. Allows to save space +in the legend. Won't look good if legend has more than one line. + +version property added to AmChart. Indicates current version of the chart script. + +FIXES: +If labelRotation was set to 90, some labels were hidden. + +It was impossible to drag chart scrollbar if the mouse was over text in scrollbar. +Chart cursor stayed visible sometimes even mouse wasn't over the chart. + +[[category]] metatag was ignored in legend value text. + +[[percents.value]] couldn't be displayed in value balloon. + +labelPosition was ignored with not stacked columns + + +2.4.1 +raphael.js file was updated in order to fix conflicts with mootools. + +some minor bugs fixed. + +2.4.0 +JavaScript version moved to newly released Raphael v.2 (raphael.js file was updated). + +some minor bugs fixed. + +2.3.0 +Fixes in Flash version: + +Since the release of Flash Player 11, calling setSettings could cause browser +crash. This problem fixed in this version. You only need to overwrite swf files. + +Fixes in JavaScript version: + +Rollover balloon with cornerRadius set to 0 was distorted when it's close to the +plot area's top. + +amClickGraphItem event wasn't working for Radar Chart. + +graph.showBalloon = false was ignored. + +The last item in chart.colors array was ignored. + +3D stacked bar charts had layer order problems. + +New features in JavaScript version: + +minBulletSize property added to AmGraph. Might be useful for XY chart. + +animateAgain() method added to all charts. Will trigger animation. + +2.2.1 +Changes were made in JavaScript version only. + +We used Google's Closure Compiler (http://closure-compiler.appspot.com/home) +app to optimize the code and now size of amCharts is less by ~13 KB! + +oneBalloonOnly property added to ChartCursor. If true, only one value balloon +at a time will be displayed. Default value is false. + +Some minor bugs were fixed. + +2.2.0 +JavaScript version of XY Chart is now available. +Code was optimized so even with this new chart the size of a file got smaller! +Some minor bugs fixed in JS version. +We decided to remove a possibility to have gradient fills of JS pie chart as this +might cause some unsolvable bugs. + +2.1.5 +Fix in JavaScript version: +Some garbage used to appear on plot area while zooming candlestick chart. + +2.1.4 +Fix in JavaScript version: +One i variable was't declared so it became global. This might cause some conflicts +with other scripts on a page. + +2.1.3 + +Fixes / tweaks in JavaScript version: + +If duration of ValueAxis is set, value balloons now also display duration. + +If a label was added with chart.addLabel method after the chart is created, these +labels used to dissapear after validateNow() methos was called. + +Some issues with positive/negative graph masking fixed. + +If graph type was column, startDuration was > 0, and there were values equal to 0, +an error used to happen with Chrome while animating. + +Legend marker type "bubble" wasn't working at all. + +Legend marker type "line" or "dashed line" wasn't registering clicks on the marker. + +2.1.0 +Radar/Polar chart added to JavaScript charts +Some bug fixes/tweaks in both flash and JavaScript versions. + + +2.0.7 +Memory leaks fixed and performance inproved for JavaScript version. + + +2.0.6 +Changes in JavaScript version: +We strongly recommend upgrading to this version, as it contains some important +updates and fixes. + +One important change which might affect chart behavior on touch devices was made. +As our charts have a possibility to zoom-in or scroll, we are capturing touch events +and zoom or pan or scroll the chart if such event happens. This means that if a +chart is on a page, and user is moving a page with a finger, the page won't move if +he touches the chart first. Understanding that in most cases moving a page is a +primary purpose of a user, we disabled our pan behaviors by default. If you think +that selecting or or panning the chart is a primary purpose of your chart users, +you should set: + +chart.panEventsEnabled = true; + +Another important fix - the charts were redrawing when browser was resized even +if chart containers size didn't changed. This affected performance a lot. + +Some other minor fixes were made. + + +2.0.5 +Changes in JavaScript version: +Some minor bugs fixed. + + +2.0.4 +Changes in JavaScript version: +gridPosition property with possible values "start" and "middle" added to CategroryAxis; +usePrefixes added to valueAxis; + + +2.0.3 +Changes in JavaScript version: +Mouse and text related problems which appeared in newly released IE9 were fixed. \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/funnel.js b/ResoursesManager/ResoursesManager/amcharts/funnel.js new file mode 100644 index 0000000..1666301 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/funnel.js @@ -0,0 +1,17 @@ +(function(){var a=window.AmCharts;a.AmFunnelChart=a.Class({inherits:a.AmSlicedChart,construct:function(p){this.type="funnel";a.AmFunnelChart.base.construct.call(this,p);this.cname="AmFunnelChart";this.startX=this.startY=0;this.baseWidth="100%";this.neckHeight=this.neckWidth=0;this.rotate=!1;this.valueRepresents="height";this.pullDistance=30;this.labelPosition="center";this.labelText="[[title]]: [[value]]";this.balloonText="[[title]]: [[value]]\n[[description]]";a.applyTheme(this,p,this.cname)},drawChart:function(){a.AmFunnelChart.base.drawChart.call(this); +var p=this.chartData;if(a.ifArray(p))if(0l&&(this.neckHeight=this.neckWidth= +0,f?g-=l/2:b-=l/2);var r=n-q-r,E=a.toCoordinate(this.baseWidth,r),I=a.toCoordinate(this.neckWidth,r),D=w-g-b,F=a.toCoordinate(this.neckHeight,D),y=b+D-F;f&&(b=w-g,y=b-D+F);this.firstSliceY=b;a.VML&&(this.startAlpha=1);for(var z=r/2+q,G=(D-F)/((E-I)/2),B=1,t=E/2,E=(D-F)*(E+I)/2+I*F,H=b,M=0,F=0;Fk&&(k=0);k=(Math.sqrt(k)- +K)/(2*u);if(!f&&b>=y||f&&b<=y)k=2*-C/I;else if(!f&&b+k>y||f&&b-ky||f&&b-ky&&(u=0),m.push(b,b,b+u,b+k,b+k,b+u,b)),K=!0):(A.push(z-t,z+t,z+C,z-C),f?m.push(b,b,b-k,b-k):m.push(b,b,b+k,b+k));u=c.set();0l?(m=C/t,A=-1,f||(A=1),isNaN(B)&&(B=0),A=(new a.Cuboid(c,2*t,A*k,e,l*B,h.color,h.alpha, +this.outlineThickness,this.outlineColor,this.outlineAlpha,90,0,!1,0,h.pattern,m)).set,A.translate(z-t,b-l/2*B),B*=m):A=a.polygon(c,A,m,h.color,h.alpha,this.outlineThickness,this.outlineColor,this.outlineAlpha);a.setCN(this,u,"funnel-item");a.setCN(this,A,"funnel-slice");a.setCN(this,u,h.className,!0);u.push(A);this.graphsSet.push(u);f||u.toBack();h.wedge=u;h.index=F;if(m=this.gradientRatio){var x=[],v;for(v=0;v=this.hideLabelsPercent&&(m=this.formatString(this.labelText,h),(A=this.labelFunction)&&(m=A(h,m)),x=h.labelColor,x||(x=this.color),A=this.labelPosition,v="left","center"==A&&(v="middle"),"left"==A&&(v="right"),""!==m&&(m=a.wrappedText(c,m,x,this.fontFamily,this.fontSize,v,!1,this.maxLabelWidth),a.setCN(this, +m,"funnel-label"),a.setCN(this,m,h.className,!0),m.node.style.pointerEvents="none",u.push(m),x=z,f?(v=b-k/2,h.ty0=v):(v=b+k/2,h.ty0=v,vw-g&&(v=w-g)),"right"==A&&(x=r+10+q,h.tx0=z+(t-k/2/G),K&&(h.tx0=z+C)),"left"==A&&(h.tx0=z-(t-k/2/G),K&&(h.tx0=z-C),x=q),h.label=m,h.labelX=x,h.labelY=v,h.labelHeight=m.getBBox().height,m.translate(x,v),t=m.getBBox(),H=a.rect(c,t.width+5,t.height+5,"#ffffff",.005),H.translate(x+t.x,v+t.y),u.push(H),h.hitRect=H,M=m.getBBox().height,H=v));(0===h.alpha|| +0g&&(b=e+l+5):g+r+5>e&&(b=e-5-r);e=b;l=r;w&&(w.translate(q,b),w=w.getBBox(),f.hitRect&&f.hitRect.translate(q+w.x,b+w.y));f.labelY=b;f.tx=q;f.ty=b;f.tx2=q}"center"!=this.labelPosition&&this.drawTicks()}})})();(function(){var a=window.AmCharts;a.Cuboid=a.Class({construct:function(a,e,l,c,d,f,n,w,g,q,r,b,E,I,D,F,y){this.set=a.set();this.container=a;this.h=Math.round(l);this.w=Math.round(e);this.dx=c;this.dy=d;this.colors=f;this.alpha=n;this.bwidth=w;this.bcolor=g;this.balpha=q;this.dashLength=I;this.topRadius=F;this.pattern=D;this.rotate=E;this.bcn=y;E?0>e&&0===r&&(r=180):0>l&&270==r&&(r=90);this.gradientRotation=r;0===c&&0===d&&(this.cornerRadius=b);this.draw()},draw:function(){var p=this.set;p.clear(); +var e=this.container,l=e.chart,c=this.w,d=this.h,f=this.dx,n=this.dy,w=this.colors,g=this.alpha,q=this.bwidth,r=this.bcolor,b=this.balpha,E=this.gradientRotation,I=this.cornerRadius,D=this.dashLength,F=this.pattern,y=this.topRadius,z=this.bcn,G=w,B=w;"object"==typeof w&&(G=w[0],B=w[w.length-1]);var t,H,M,h,u,A,m,k,C,K=g;F&&(g=0);var x,v,J,L,N=this.rotate;if(0Math.abs(d)&&(d=0);1>Math.abs(c)&&(c=0);!isNaN(y)&&(0d&&(q=" A"),g+=q+Math.round(c/2-J)+","+Math.round(d-L)+","+Math.round(c/2+J)+","+Math.round(d+L)+",0,"+d+","+c+","+d,g+=" L"+c+",0",g+=q+Math.round(c/ +2+x)+","+Math.round(v)+","+Math.round(c/2-x)+","+Math.round(-v)+","+c+",0,0,0"):(g+="A"+J+","+L+",0,0,0,"+(c-c/2*(1-y))+","+d+"L"+c+",0",g+="A"+x+","+v+",0,0,1,0,0"),x=180),e=e.path(g).attr(w),e.gradient("linearGradient",[G,a.adjustLuminosity(G,-.3),a.adjustLuminosity(G,-.3),G],x),N?e.translate(f/2,0):e.translate(0,n/2)):e=0===d?a.line(e,[0,c],[0,0],r,b,q,D):0===c?a.line(e,[0,0],[0,d],r,b,q,D):0d?[t, +C,H,M,h,u,A,m,k,e]:[m,k,H,M,h,u,t,C,A,e]:N?0d?[t,e,m]:[m,e,t];a.setCN(l,e,z+"front");a.setCN(l,H,z+"back");a.setCN(l,m,z+"top");a.setCN(l,t,z+"bottom");a.setCN(l,h,z+"left");a.setCN(l,u,z+"right");for(t=0;ta&&(a=e.width*n),e.height*n>h&&(h=e.height*n);(b=this.legend)&&b.invalidateSize();if(this.adjustSize&&!this.chartCreated){f&&(f=f.getBBox(),f.width>a&&(a=f.width),f.height>h&&(h=f.height));f=0;if(w>h||d>a)f=Math.min(w-h,d-a);0=this.totalFrames?d=b.value:(b.frame++,b.clockWiseOnly&&b.valuethis.maxLabelWidth&&(q=this.maxLabelWidth);this.labelText&&this.labelsEnabled||(x=q=0);y=void 0===this.pieX?(b-k-a)/2+k:e(this.pieX,this.realWidth);z=void 0===this.pieY?(m-v-n)/2+v:e(this.pieY,m);g=e(this.radius,b,m);g||(b=0<=x?b-k-a-2*q:b-k-a,m=m-v-n,g=Math.min(b,m),mb&&(g=b)),m=h.toCoordinate(this.pullOutRadius,g),g=(0<=x?g-1.8*(x+m):g-1.8*m)/2);g=g&&(e=g-1);n=h.fitToBounds(this.startAngle,0,360);0=this.hideLabelsPercent){var l=n+r/2;360=l&&0<=l?(D=0,C="start",w=8):90<=l&&180>l?(D=1,C="start",w=8):180<=l&&270>l?(D=2,C="end",w=-8):270<=l&&360>l&&(D=3,C="end",w=-8);a.labelQuarter=D}else C="middle";var l=this.formatString(this.labelText,a),u=this.labelFunction;u&&(l=u(a,l));u=a.labelColor;u||(u=this.color); +""!==l&&(l=h.wrappedText(c,l,u,this.fontFamily,this.fontSize,C,!1,this.maxLabelWidth),h.setCN(this,l,"pie-label"),h.setCN(this,l,a.className,!0),l.translate(r+1.5*w,B),l.node.style.pointerEvents="none",a.tx=r+1.5*w,a.ty=B,0<=t?(t=l.getBBox(),u=h.rect(c,t.width+5,t.height+5,"#FFFFFF",.005),u.translate(r+1.5*w+t.x,B+t.y),a.hitRect=u,p.push(l),p.push(u)):this.freeLabelsSet.push(l),a.label=l);a.tx=r;a.tx2=r+w;a.tx0=y+q*g;a.ty0=z+A*g}r=e+(g-e)/2;a.pulled&&(r+=this.pullOutRadiusReal);a.balloonX=q*r+y;a.balloonY= +A*r+z;a.startX=Math.round(q*v);a.startY=Math.round(A*v);a.pullX=Math.round(q*m);a.pullY=Math.round(A*m);this.graphsSet.push(p);(0===a.alpha||0c?b.toFront():180<=c&&b.toBack()}},arrangeLabels:function(){var d=this.chartData,f=d.length,c,b;for(b=f-1;0<=b;b--)c=d[b],0!==c.labelQuarter||c.hidden||this.checkOverlapping(b,c,0,!0,0);for(b=0;bh&&(e=f.ty+3*f.iy,f.ty=e,n.translate(f.tx2,e),f.hitRect&&(n=n.getBBox(),f.hitRect.translate(f.tx2+n.x,e+n.y)),this.checkOverlapping(d,f,c,b,h+1))}},checkOverlappingReal:function(d,f,c){var b=!1,m=d.label, +e=f.label;d.labelQuarter!=c||d.hidden||f.hidden||!e||(m=m.getBBox(),c={},c.width=m.width,c.height=m.height,c.y=d.ty,c.x=d.tx,d=e.getBBox(),e={},e.width=d.width,e.height=d.height,e.y=f.ty,e.x=f.tx,h.hitTest(c,e)&&(b=!0));return b}})})(); \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/dataloader.js b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/dataloader.js new file mode 100644 index 0000000..819171e --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/dataloader.js @@ -0,0 +1,634 @@ +/* +Plugin Name: amCharts Data Loader +Description: This plugin adds external data loading capabilities to all amCharts libraries. +Author: Martynas Majeris, amCharts +Version: 1.0.5 +Author URI: http://www.amcharts.com/ + +Copyright 2015 amCharts + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. + +Please note that the above license covers only this plugin. It by all means does +not apply to any other amCharts products that are covered by different licenses. +*/ + +/** + * TODO: + * incremental load + * XML support (?) + */ + +/* globals AmCharts, ActiveXObject */ +/* jshint -W061 */ + +/** + * Initialize language prompt container + */ +AmCharts.translations.dataLoader = {}; + +/** + * Set init handler + */ +AmCharts.addInitHandler( function( chart ) { + + /** + * Check if dataLoader is set (initialize it) + */ + if ( undefined === chart.dataLoader || !isObject( chart.dataLoader ) ) + chart.dataLoader = {}; + + /** + * Check charts version for compatibility: + * the first compatible version is 3.13 + */ + var version = chart.version.split( '.' ); + if ( ( Number( version[ 0 ] ) < 3 ) || ( 3 === Number( version[ 0 ] ) && ( Number( version[ 1 ] ) < 13 ) ) ) + return; + + /** + * Define object reference for easy access + */ + var l = chart.dataLoader; + l.remaining = 0; + + /** + * Set defaults + */ + var defaults = { + 'async': true, + 'format': 'json', + 'showErrors': true, + 'showCurtain': true, + 'noStyles': false, + 'reload': 0, + 'timestamp': false, + 'delimiter': ',', + 'skip': 0, + 'useColumnNames': false, + 'reverse': false, + 'reloading': false, + 'complete': false, + 'error': false, + 'chart': chart + }; + + /** + * Create a function that can be used to load data (or reload via API) + */ + l.loadData = function() { + + /** + * Load all files in a row + */ + if ( 'stock' === chart.type ) { + + // delay this a little bit so the chart has the chance to build itself + setTimeout( function() { + + // preserve animation + if ( 0 > chart.panelsSettings.startDuration ) { + l.startDuration = chart.panelsSettings.startDuration; + chart.panelsSettings.startDuration = 0; + } + + // cycle through all of the data sets + for ( var x = 0; x < chart.dataSets.length; x++ ) { + var ds = chart.dataSets[ x ]; + + // load data + if ( undefined !== ds.dataLoader && undefined !== ds.dataLoader.url ) { + + ds.dataProvider = []; + applyDefaults( ds.dataLoader ); + loadFile( ds.dataLoader.url, ds, ds.dataLoader, 'dataProvider' ); + + } + + // load events data + if ( undefined !== ds.eventDataLoader && undefined !== ds.eventDataLoader.url ) { + + ds.events = []; + applyDefaults( ds.eventDataLoader ); + loadFile( ds.eventDataLoader.url, ds, ds.eventDataLoader, 'stockEvents' ); + + } + } + + }, 100 ); + + } else { + + applyDefaults( l ); + + if ( undefined === l.url ) + return; + + // preserve animation + if ( undefined !== chart.startDuration && ( 0 < chart.startDuration ) ) { + l.startDuration = chart.startDuration; + chart.startDuration = 0; + } + + // set empty data set + if ( undefined === chart.dataProvider ) + chart.dataProvider = chart.type === 'map' ? {} : []; + + loadFile( l.url, chart, l, 'dataProvider' ); + + } + + }; + + /** + * Trigger load + */ + l.loadData(); + + /** + * Loads a file and determines correct parsing mechanism for it + */ + function loadFile( url, holder, options, providerKey ) { + + // set default providerKey + if ( undefined === providerKey ) + providerKey = 'dataProvider'; + + // show curtain + if ( options.showCurtain ) + showCurtain( undefined, options.noStyles ); + + // increment loader count + l.remaining++; + + // load the file + AmCharts.loadFile( url, options, function( response ) { + + // error? + if ( false === response ) { + callFunction( options.error, options, chart ); + raiseError( AmCharts.__( 'Error loading the file', chart.language ) + ': ' + url, false, options ); + } else { + + // determine the format + if ( undefined === options.format ) { + // TODO + options.format = 'json'; + } + + // lowercase + options.format = options.format.toLowerCase(); + + // invoke parsing function + switch ( options.format ) { + + case 'json': + + holder[ providerKey ] = AmCharts.parseJSON( response ); + + if ( false === holder[ providerKey ] ) { + callFunction( options.error, options, chart ); + raiseError( AmCharts.__( 'Error parsing JSON file', chart.language ) + ': ' + l.url, false, options ); + holder[ providerKey ] = []; + return; + } else { + holder[ providerKey ] = postprocess( holder[ providerKey ], options ); + callFunction( options.load, options, chart ); + } + + break; + + case 'csv': + + holder[ providerKey ] = AmCharts.parseCSV( response, options ); + + if ( false === holder[ providerKey ] ) { + callFunction( options.error, options, chart ); + raiseError( AmCharts.__( 'Error parsing CSV file', chart.language ) + ': ' + l.url, false, options ); + holder[ providerKey ] = []; + return; + } else { + holder[ providerKey ] = postprocess( holder[ providerKey ], options ); + callFunction( options.load, options, chart ); + } + + break; + + default: + callFunction( options.error, options, chart ); + raiseError( AmCharts.__( 'Unsupported data format', chart.language ) + ': ' + options.format, false, options.noStyles ); + return; + } + + // decrement remaining counter + l.remaining--; + + // we done? + if ( 0 === l.remaining ) { + + // callback + callFunction( options.complete, chart ); + + // take in the new data + if ( options.async ) { + + if ( 'map' === chart.type ) + chart.validateNow( true ); + else { + + // take in new data + chart.validateData(); + + // make the chart animate again + if ( l.startDuration ) { + if ( 'stock' === chart.type ) { + chart.panelsSettings.startDuration = l.startDuration; + for ( var x = 0; x < chart.panels.length; x++ ) { + chart.panels[ x ].startDuration = l.startDuration; + chart.panels[ x ].animateAgain(); + } + } else { + chart.startDuration = l.startDuration; + chart.animateAgain(); + } + } + } + } + + // restore default period + if ( 'stock' === chart.type && !options.reloading && undefined !== chart.periodSelector ) + chart.periodSelector.setDefaultPeriod(); + + // remove curtain + removeCurtain(); + } + + // schedule another load if necessary + if ( options.reload ) { + + if ( options.timeout ) + clearTimeout( options.timeout ); + + options.timeout = setTimeout( loadFile, 1000 * options.reload, url, holder, options ); + options.reloading = true; + + } + + } + + } ); + + } + + /** + * Checks if postProcess is set and invokes the handler + */ + function postprocess( data, options ) { + if ( undefined !== options.postProcess && isFunction( options.postProcess ) ) + try { + return options.postProcess.call( l, data, options, chart ); + } catch ( e ) { + raiseError( AmCharts.__( 'Error loading file', chart.language ) + ': ' + options.url, false, options ); + return data; + } else + return data; + } + + /** + * Returns true if argument is array + */ + function isObject( obj ) { + return 'object' === typeof( obj ); + } + + /** + * Returns true is argument is a function + */ + function isFunction( obj ) { + return 'function' === typeof( obj ); + } + + /** + * Applies defaults to config object + */ + function applyDefaults( obj ) { + for ( var x in defaults ) { + if ( defaults.hasOwnProperty( x ) ) + setDefault( obj, x, defaults[ x ] ); + } + } + + /** + * Checks if object property is set, sets with a default if it isn't + */ + function setDefault( obj, key, value ) { + if ( undefined === obj[ key ] ) + obj[ key ] = value; + } + + /** + * Raises an internal error (writes it out to console) + */ + function raiseError( msg, error, options ) { + + if ( options.showErrors ) + showCurtain( msg, options.noStyles ); + else { + removeCurtain(); + console.log( msg ); + } + + } + + /** + * Shows curtain over chart area + */ + function showCurtain( msg, noStyles ) { + + // remove previous curtain if there is one + removeCurtain(); + + // did we pass in the message? + if ( undefined === msg ) + msg = AmCharts.__( 'Loading data...', chart.language ); + + // create and populate curtain element + var curtain = document.createElement( 'div' ); + curtain.setAttribute( 'id', chart.div.id + '-curtain' ); + curtain.className = 'amcharts-dataloader-curtain'; + + if ( true !== noStyles ) { + curtain.style.position = 'absolute'; + curtain.style.top = 0; + curtain.style.left = 0; + curtain.style.width = ( undefined !== chart.realWidth ? chart.realWidth : chart.divRealWidth ) + 'px'; + curtain.style.height = ( undefined !== chart.realHeight ? chart.realHeight : chart.divRealHeight ) + 'px'; + curtain.style.textAlign = 'center'; + curtain.style.display = 'table'; + curtain.style.fontSize = '20px'; + try { + curtain.style.background = 'rgba(255, 255, 255, 0.3)'; + } + catch ( e ) { + curtain.style.background = 'rgb(255, 255, 255)'; + } + curtain.innerHTML = '
' + msg + '
'; + } else { + curtain.innerHTML = msg; + } + chart.containerDiv.appendChild( curtain ); + + l.curtain = curtain; + } + + /** + * Removes the curtain + */ + function removeCurtain() { + try { + if ( undefined !== l.curtain ) + chart.containerDiv.removeChild( l.curtain ); + } catch ( e ) { + // do nothing + } + + l.curtain = undefined; + + } + + /** + * Execute callback function + */ + function callFunction( func, param1, param2, param3 ) { + if ( 'function' === typeof func ) + func.call( l, param1, param2, param3 ); + } + +}, [ 'pie', 'serial', 'xy', 'funnel', 'radar', 'gauge', 'gantt', 'stock', 'map' ] ); + + +/** + * Returns prompt in a chart language (set by chart.language) if it is + * available + */ +if ( undefined === AmCharts.__ ) { + AmCharts.__ = function( msg, language ) { + if ( undefined !== language && undefined !== AmCharts.translations.dataLoader[ language ] && undefined !== AmCharts.translations.dataLoader[ language ][ msg ] ) + return AmCharts.translations.dataLoader[ language ][ msg ]; + else + return msg; + }; +} + +/** + * Loads a file from url and calls function handler with the result + */ +AmCharts.loadFile = function( url, options, handler ) { + + // create the request + var request; + if ( window.XMLHttpRequest ) { + // IE7+, Firefox, Chrome, Opera, Safari + request = new XMLHttpRequest(); + } else { + // code for IE6, IE5 + request = new ActiveXObject( 'Microsoft.XMLHTTP' ); + } + + // set handler for data if async loading + request.onreadystatechange = function() { + + if ( 4 === request.readyState && 404 === request.status ) + handler.call( this, false ); + + else if ( 4 === request.readyState && 200 === request.status ) + handler.call( this, request.responseText ); + + }; + + // load the file + try { + request.open( 'GET', options.timestamp ? AmCharts.timestampUrl( url ) : url, options.async ); + request.send(); + } catch ( e ) { + handler.call( this, false ); + } + +}; + +/** + * Parses JSON string into an object + */ +AmCharts.parseJSON = function( response ) { + try { + if ( undefined !== JSON ) + return JSON.parse( response ); + else + return eval( response ); + } catch ( e ) { + return false; + } +}; + +/** + * Prases CSV string into an object + */ +AmCharts.parseCSV = function( response, options ) { + + // parse CSV into array + var data = AmCharts.CSVToArray( response, options.delimiter ); + + // init resuling array + var res = []; + var cols = []; + var col, i; + + // first row holds column names? + if ( options.useColumnNames ) { + cols = data.shift(); + + // normalize column names + for ( var x = 0; x < cols.length; x++ ) { + // trim + col = cols[ x ].replace( /^\s+|\s+$/gm, '' ); + + // check for empty + if ( '' === col ) + col = 'col' + x; + + cols[ x ] = col; + } + + if ( 0 < options.skip ) + options.skip--; + } + + // skip rows + for ( i = 0; i < options.skip; i++ ) + data.shift(); + + // iterate through the result set + var row; + while ( ( row = options.reverse ? data.pop() : data.shift() ) ) { + var dataPoint = {}; + for ( i = 0; i < row.length; i++ ) { + col = undefined === cols[ i ] ? 'col' + i : cols[ i ]; + dataPoint[ col ] = row[ i ]; + } + res.push( dataPoint ); + } + + return res; +}; + +/** + * Parses CSV data into array + * Taken from here: (thanks!) + * http://www.bennadel.com/blog/1504-ask-ben-parsing-csv-strings-with-javascript-exec-regular-expression-command.htm + */ +AmCharts.CSVToArray = function( strData, strDelimiter ) { + // Check to see if the delimiter is defined. If not, + // then default to comma. + strDelimiter = ( strDelimiter || "," ); + + // Create a regular expression to parse the CSV values. + var objPattern = new RegExp( + ( + // Delimiters. + "(\\" + strDelimiter + "|\\r?\\n|\\r|^)" + + + // Quoted fields. + "(?:\"([^\"]*(?:\"\"[^\"]*)*)\"|" + + + // Standard fields. + "([^\"\\" + strDelimiter + "\\r\\n]*))" + ), + "gi" + ); + + + // Create an array to hold our data. Give the array + // a default empty first row. + var arrData = [ + [] + ]; + + // Create an array to hold our individual pattern + // matching groups. + var arrMatches = null; + + + // Keep looping over the regular expression matches + // until we can no longer find a match. + while ( ( arrMatches = objPattern.exec( strData ) ) ) { + + // Get the delimiter that was found. + var strMatchedDelimiter = arrMatches[ 1 ]; + + // Check to see if the given delimiter has a length + // (is not the start of string) and if it matches + // field delimiter. If id does not, then we know + // that this delimiter is a row delimiter. + if ( + strMatchedDelimiter.length && + ( strMatchedDelimiter !== strDelimiter ) + ) { + + // Since we have reached a new row of data, + // add an empty row to our data array. + arrData.push( [] ); + + } + + + // Now that we have our delimiter out of the way, + // let's check to see which kind of value we + // captured (quoted or unquoted). + var strMatchedValue; + if ( arrMatches[ 2 ] ) { + + // We found a quoted value. When we capture + // this value, unescape any double quotes. + strMatchedValue = arrMatches[ 2 ].replace( + new RegExp( "\"\"", "g" ), + "\"" + ); + + } else { + + // We found a non-quoted value. + strMatchedValue = arrMatches[ 3 ]; + + } + + + // Now that we have our value string, let's add + // it to the data array. + arrData[ arrData.length - 1 ].push( strMatchedValue ); + } + + // Return the parsed data. + return ( arrData ); +}; + +/** + * Appends timestamp to the url + */ +AmCharts.timestampUrl = function( url ) { + var p = url.split( '?' ); + if ( 1 === p.length ) + p[ 1 ] = new Date().getTime(); + else + p[ 1 ] += '&' + new Date().getTime(); + return p.join( '?' ); +}; \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/dataloader.min.js b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/dataloader.min.js new file mode 100644 index 0000000..492f68d --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/dataloader.min.js @@ -0,0 +1 @@ +AmCharts.translations.dataLoader={},AmCharts.addInitHandler(function(a){function e(b,d,g,h){void 0===h&&(h="dataProvider"),g.showCurtain&&l(void 0,g.noStyles),c.remaining++,AmCharts.loadFile(b,g,function(i){if(!1===i)n(g.error,g,a),k(AmCharts.__("Error loading the file",a.language)+": "+b,!1,g);else{switch(void 0===g.format&&(g.format="json"),g.format=g.format.toLowerCase(),g.format){case"json":if(d[h]=AmCharts.parseJSON(i),!1===d[h])return n(g.error,g,a),k(AmCharts.__("Error parsing JSON file",a.language)+": "+c.url,!1,g),d[h]=[],void 0;d[h]=f(d[h],g),n(g.load,g,a);break;case"csv":if(d[h]=AmCharts.parseCSV(i,g),!1===d[h])return n(g.error,g,a),k(AmCharts.__("Error parsing CSV file",a.language)+": "+c.url,!1,g),d[h]=[],void 0;d[h]=f(d[h],g),n(g.load,g,a);break;default:return n(g.error,g,a),k(AmCharts.__("Unsupported data format",a.language)+": "+g.format,!1,g.noStyles),void 0}if(c.remaining--,0===c.remaining){if(n(g.complete,a),g.async)if("map"===a.type)a.validateNow(!0);else if(a.validateData(),c.startDuration)if("stock"===a.type){a.panelsSettings.startDuration=c.startDuration;for(var j=0;j"}else e.innerHTML=b;a.containerDiv.appendChild(e),c.curtain=e}function m(){try{void 0!==c.curtain&&a.containerDiv.removeChild(c.curtain)}catch(b){}c.curtain=void 0}function n(a,b,d,e){"function"==typeof a&&a.call(c,b,d,e)}void 0!==a.dataLoader&&g(a.dataLoader)||(a.dataLoader={});var b=a.version.split(".");if(!(Number(b[0])<3||3===Number(b[0])&&Number(b[1])<13)){var c=a.dataLoader;c.remaining=0;var d={async:!0,format:"json",showErrors:!0,showCurtain:!0,noStyles:!1,reload:0,timestamp:!1,delimiter:",",skip:0,useColumnNames:!1,reverse:!1,reloading:!1,complete:!1,error:!1,chart:a};c.loadData=function(){if("stock"===a.type)setTimeout(function(){0>a.panelsSettings.startDuration&&(c.startDuration=a.panelsSettings.startDuration,a.panelsSettings.startDuration=0);for(var b=0;bTexas is the second most populous (after California) and the second largest of the 50 U.S. states (after Alaska) in the United States of America, and the largest state in the 48 contiguous United States. Geographically located in the south central part of the country, Texas shares an international border with the Mexican states of Chihuahua, Coahuila, Nuevo León, and Tamaulipas to the south and borders the U.S. states of New Mexico to the west, Oklahoma to the north, Arkansas to the northeast, and Louisiana to the east. Texas has an area of 268,820 square miles (696,200 km2) and a growing population of over 26.9 million residents (July 2014).

" + }, { + "id": "US-UT", + "value": 2233169 + }, { + "id": "US-VT", + "value": 608827 + }, { + "id": "US-VA", + "value": 7078515 + }, { + "id": "US-WA", + "value": 5894121 + }, { + "id": "US-WV", + "value": 1808344 + }, { + "id": "US-WI", + "value": 5363675 + }, { + "id": "US-WY", + "value": 493782 + }] +} \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/pie.csv b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/pie.csv new file mode 100644 index 0000000..bc9b44b --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/pie.csv @@ -0,0 +1,8 @@ +country,litres +"Czech Republic",156.9 +"Ireland",131.1 +"Germany",115.8 +"Australia",109.9 +"Austria",108.3 +"UK",65 +"Belgium",50 \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/pie.json b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/pie.json new file mode 100644 index 0000000..086497a --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/pie.json @@ -0,0 +1,22 @@ +[{ + "country": "Czech Republic", + "litres": 156.9 +}, { + "country": "Ireland", + "litres": 131.1 +}, { + "country": "Germany", + "litres": 115.8 +}, { + "country": "Australia", + "litres": 109.9 +}, { + "country": "Austria", + "litres": 108.3 +}, { + "country": "UK", + "litres": 65 +}, { + "country": "Belgium", + "litres": 50 +}] \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/serial.csv b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/serial.csv new file mode 100644 index 0000000..beb75e1 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/serial.csv @@ -0,0 +1,20 @@ +year,cars,motorcycles,bicycles +2000,1587,650,121 +1995,1567,683,146 +1996,1617,691,138 +1997,1630,642,127 +1998,1660,699,105 +1999,1683,721,109 +2000,1691,737,112 +2001,1298,680,101 +2002,1275,664,97 +2003,1246,648,93 +2004,1218,637,101 +2005,1213,633,87 +2006,1199,621,79 +2007,1110,210,81 +2008,1165,232,75 +2009,1145,219,88 +2010,1163,201,82 +2011,1180,285,87 +2012,1159,277,71 \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/serial.json b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/serial.json new file mode 100644 index 0000000..c62d345 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/serial.json @@ -0,0 +1,96 @@ +[{ + "year": 2000, + "cars": 1587, + "motorcycles": 650, + "bicycles": 121 +}, { + "year": 1995, + "cars": 1567, + "motorcycles": 683, + "bicycles": 146 +}, { + "year": 1996, + "cars": 1617, + "motorcycles": 691, + "bicycles": 138 +}, { + "year": 1997, + "cars": 1630, + "motorcycles": 642, + "bicycles": 127 +}, { + "year": 1998, + "cars": 1660, + "motorcycles": 699, + "bicycles": 105 +}, { + "year": 1999, + "cars": 1683, + "motorcycles": 721, + "bicycles": 109 +}, { + "year": 2000, + "cars": 1691, + "motorcycles": 737, + "bicycles": 112 +}, { + "year": 2001, + "cars": 1298, + "motorcycles": 680, + "bicycles": 101 +}, { + "year": 2002, + "cars": 1275, + "motorcycles": 664, + "bicycles": 97 +}, { + "year": 2003, + "cars": 1246, + "motorcycles": 648, + "bicycles": 93 +}, { + "year": 2004, + "cars": 1218, + "motorcycles": 637, + "bicycles": 101 +}, { + "year": 2005, + "cars": 1213, + "motorcycles": 633, + "bicycles": 87 +}, { + "year": 2006, + "cars": 1199, + "motorcycles": 621, + "bicycles": 79 +}, { + "year": 2007, + "cars": 1110, + "motorcycles": 210, + "bicycles": 81 +}, { + "year": 2008, + "cars": 1165, + "motorcycles": 232, + "bicycles": 75 +}, { + "year": 2009, + "cars": 1145, + "motorcycles": 219, + "bicycles": 88 +}, { + "year": 2010, + "cars": 1163, + "motorcycles": 201, + "bicycles": 82 +}, { + "year": 2011, + "cars": 1180, + "motorcycles": 285, + "bicycles": 87 +}, { + "year": 2012, + "cars": 1159, + "motorcycles": 277, + "bicycles": 71 +}] \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/serial2.json b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/serial2.json new file mode 100644 index 0000000..d17c8f3 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/data/serial2.json @@ -0,0 +1,21 @@ +[{ + "year": 2005, + "income": 23.5, + "expenses": 18.1 +}, { + "year": 2006, + "income": 26.2, + "expenses": 22.8 +}, { + "year": 2007, + "income": 30.1, + "expenses": 23.9 +}, { + "year": 2008, + "income": 29.5, + "expenses": 25.1 +}, { + "year": 2009, + "income": 24.6, + "expenses": 25 +}] \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/map_json.html b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/map_json.html new file mode 100644 index 0000000..6183e88 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/map_json.html @@ -0,0 +1,50 @@ + + + + + + + amCharts Responsive Example + + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/pie_csv.html b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/pie_csv.html new file mode 100644 index 0000000..96bf588 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/pie_csv.html @@ -0,0 +1,58 @@ + + + + + + + amCharts Data Loader Example + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/pie_json.html b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/pie_json.html new file mode 100644 index 0000000..9d9da85 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/pie_json.html @@ -0,0 +1,44 @@ + + + + + + + amCharts Data Loader Example + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/serial2_json.html b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/serial2_json.html new file mode 100644 index 0000000..a1b9bc9 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/serial2_json.html @@ -0,0 +1,85 @@ + + + + + + + amCharts Data Loader Example + + + + + + + + + +
+ + + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/serial_csv.html b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/serial_csv.html new file mode 100644 index 0000000..ae35ff4 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/serial_csv.html @@ -0,0 +1,112 @@ + + + + + + + amCharts Data Loader Example + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/serial_json.html b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/serial_json.html new file mode 100644 index 0000000..5e18745 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/serial_json.html @@ -0,0 +1,108 @@ + + + + + + + amCharts Data Loader Example + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/serial_with_dynamic_graphs.html b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/serial_with_dynamic_graphs.html new file mode 100644 index 0000000..a043508 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/serial_with_dynamic_graphs.html @@ -0,0 +1,100 @@ + + + + + + + amCharts Data Loader Example + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/stock_csv_data_and_events.html b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/stock_csv_data_and_events.html new file mode 100644 index 0000000..53d2348 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/examples/stock_csv_data_and_events.html @@ -0,0 +1,312 @@ + + + + + + + amCharts Data Loader Example + + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/lang/en.js b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/lang/en.js new file mode 100644 index 0000000..16d60dd --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/lang/en.js @@ -0,0 +1,6 @@ +AmCharts.translations.dataLoader.en = { + 'Error loading the file': 'Error loading the file', + 'Error parsing JSON file': 'Error parsing JSON file', + 'Unsupported data format': 'Unsupported data format', + 'Loading data...': 'Loading data...' +} \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/lang/lt.js b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/lang/lt.js new file mode 100644 index 0000000..455a502 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/lang/lt.js @@ -0,0 +1,6 @@ +AmCharts.translations.dataLoader.lt = { + 'Error loading the file': 'Nepavyko užkrauti failo', + 'Error parsing JSON file': 'Skaitant JSON failą įvyko klaida', + 'Unsupported data format': 'Nepalaikomas duomenų formatas', + 'Loading data...': 'Kraunami duomenys...' +} \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/license.txt b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/license.txt new file mode 100644 index 0000000..9c8f3ea --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/license.txt @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "{}" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright {yyyy} {name of copyright owner} + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/readme.md b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/readme.md new file mode 100644 index 0000000..64b5e00 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/dataloader/readme.md @@ -0,0 +1,306 @@ +# amCharts Data Loader + +Version: 1.0.5 + + +## Description + +By default all amCharts libraries accept data in JSON format. It needs to be +there when the web page loads, defined in-line or loaded via custom code. + +This plugin introduces are native wrapper that enables automatic loading of data +from external data data sources in CSV and JSON formats. + +Most of the times you will just need to provide a URL of the external data +source - static file or dynamically generated - and it will do the rest. + + +## Important notice + +Due to security measures implemented in most of the browsers, the external data +loader will work only when the page with the chart or map is loaded via web +server. + +So, any of the examples loaded locally (file:///) will not work. + +The page needs to be loaded via web server (http://) in order to work properly. + +Loading data from another domain than the web page is loaded is possible but is +a subject for `Access-Control-Allow-Origin` policies defined by the web server +you are loading data from. + +For more about loading data across domains use the following thread: +http://stackoverflow.com/questions/1653308/access-control-allow-origin-multiple-origin-domains + + +## Usage + +### 1) Include the minified version of file of this plugin. I.e.: + +``` + +``` + +(this needs to go after all the other amCharts includes) + +### 2) Add data source properties to your chart configuration. + +Regular (Serial, Pie, etc.) charts: + +``` +AmCharts.makeChart( "chartdiv", { + ..., + "dataLoader": { + "url": "data.json", + "format": "json" + } +} ); +``` + +Stock chart: + +``` +AmCharts.makeChart( "chartdiv", { + ..., + "dataSets": [{ + ..., + "dataLoader": { + "url": "data.csv", + "format": "csv", + "delimiter": ",", // column separator + "useColumnNames": true, // use first row for column names + "skip": 1 // skip header row + } + }] +} ); +``` + +That's it. The plugin will make sure the files are loaded and dataProvider is +populated with their content *before* the chart is built. + +Some formats, like CSV, will require additional parameters needed to parse the +data, such as "separator". + +If the "format" is omitted, the plugin will assume JSON. + + +## Complete list of available dataLoader settings + +Property | Default | Description +-------- | ------- | ----------- +async | true | If set to false (not recommended) everything will wait until data is fully loaded +complete | | Callback function to execute when loader is done +delimiter | , | [CSV only] a delimiter for columns (use \t for tab delimiters) +error | | Callback function to execute if file load fails +format | json | Type of data: json, csv +load | | Callback function to execute when file is successfully loaded (might be invoked multiple times) +noStyles | false | If set to true no styles will be applied to "Data loading" curtain +postProcess | | If set to function reference, that function will be called to "post-process" loaded data before passing it on to chart +showErrors | true | Show loading errors in a chart curtain +showCurtain | true| Show curtain over the chart area when loading data +reload | 0 | Reload data every X seconds +reverse | false | [CSV only] add data points in revers order +skip | 0 | [CSV only] skip X first rows in data (includes first row if useColumnNames is used) +timestamp | false | Add current timestamp to data URLs (to avoid caching) +useColumnNames | false | [CSV only] Use first row in data as column names when parsing + + +## Using in JavaScript Stock Chart + +In JavaScript Stock Chart it works exactly the same as in other chart types, +with the exception that `dataLoader` is set as a property to the data set +definition. I.e.: + +``` +var chart = AmCharts.makeChart("chartdiv", { + "type": "stock", + ... + "dataSets": [{ + "title": "MSFT", + "fieldMappings": [{ + "fromField": "Open", + "toField": "open" + }, { + "fromField": "High", + "toField": "high" + }, { + "fromField": "Low", + "toField": "low" + }, { + "fromField": "Close", + "toField": "close" + }, { + "fromField": "Volume", + "toField": "volume" + }], + "compared": false, + "categoryField": "Date", + "dataLoader": { + "url": "data/MSFT.csv", + "format": "csv", + "showCurtain": true, + "showErrors": true, + "async": true, + "reverse": true, + "delimiter": ",", + "useColumnNames": true + } + } + }] +}); +``` + +### Can I also load event data the same way? + +Sure. You just add a `eventDataLoader` object to your data set. All the same +settings apply. + + +## Manually triggering a reload of all data + +Once chart is initialized, you can trigger the reload of all data manually by +calling `chart.dataLoader.loadData()` function. (replace "chart" with the actual +variable that holds reference to your chart object) + +## Using callback functions + +Data Loader can call your own function when certain event happens, like data +loading is complete, error occurs, etc. + +To set custom event handlers, use these config options: + +* "complete" + +Example: + +``` +AmCharts.makeChart( "chartdiv", { + ..., + "dataSets": [{ + ..., + "dataLoader": { + "url": "data.json", + "load": function ( options, chart ) { + console.log( 'Loaded file: ' + options.url ); + }, + "complete": function ( chart ) { + console.log( 'Woohoo! Finished loading' ); + }, + "error": function ( options, chart ) { + console.log( 'Ummm something went wrong loading this file: ' + options.url ); + } + } + }] +} ); +``` + + +## Translating into other languages + +Depending on configuration options the plugin will display a small number of +text prompts, like 'Data loading...'. + +Plugin will try matching chart's `language` property and display text prompts in +a corresponding language. For that the plugin needs to have the translations. + +Some of the plugin translations are in **lang** subdirectory. Simply include the +one you need. + +If there is no translation to your language readily available, just grab en.js, +copy it and translate. + +The structure is simple: + +``` +'The phrase in English': 'Translation' +``` + +The phrase in English must be left intact. + +When you're done, you can include your language as a JavaScript file. + +P.S. send us your translation so we can include it for the benefits of other +users. Thanks! + + +## Requirements + +This plugin requires at least 3.13 version of JavaScript Charts, JavaScript +Stock Chart or JavaScript Maps. + + +## Demos + +They're all in subdirectory /examples. + + +## Extending this plugin + +You're encouraged to modify, extend and make derivative plugins out of this +plugin. + +You can modify files, included in this archive or, better yet, fork this project +on GitHub: + +https://github.com/amcharts/dataloader + +We're curious types. Please let us know (contact@amcharts.com) if you do create +something new out of this plugin. + + +## License + +This plugin is licensed under Apache License 2.0. + +This basically means you're free to use or modify this plugin, even make your +own versions or completely different products out of it. + +Please see attached file "license.txt" for the complete license or online here: + +http://www.apache.org/licenses/LICENSE-2.0 + + +## Contact us + +* Email:contact@amcharts.com +* Web: http://www.amcharts.com/ +* Facebook: https://www.facebook.com/amcharts +* Twitter: https://twitter.com/amcharts + + +## Changelog + +### 1.0.5 +* Fixed JS error if periodSelector was not defined in chart config +* Now all callback functions (complete, error, load) receive additional parameter: chart +* postProcess function will now have "this" context set to Data Loader object as well as receive chart reference as third paramater + +### 1.0.4 +* Added chart.dataLoader.loadData() function which can be used to manually trigger all data reload + +### 1.0.3 +* Fixed the bug where defaults were not being applied properly +* Fixed the bug with translations not being applied properly +* Cleaned up the code (to pass JSHint validation) + +### 1.0.2 +* Fixed the issue with modified Array prototypes + +### 1.0.1 +* Added "complete", "load" and "error" properties that can be set with function handlers to be invoked on load completion, successful file load or failed load respectively +* Fixed language container initialization bug +* Fixed bug that was causing parse errors not be displayed + +### 1.0 +* Added GANTT chart support + +### 0.9.2 +* Added global data load methods that can be used to load and parse data by code outside plugin +* Trim CSV column names +* Translation added: Lithuanian + +### 0.9.1 +* Fix chart animations not playing after asynchronous load + +### 0.9 +* Initial release \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/LICENSE b/ResoursesManager/ResoursesManager/amcharts/plugins/export/LICENSE new file mode 100644 index 0000000..8f71f43 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/LICENSE @@ -0,0 +1,202 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "{}" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright {yyyy} {name of copyright owner} + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. + diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/README.md b/ResoursesManager/ResoursesManager/amcharts/plugins/export/README.md new file mode 100644 index 0000000..1198af9 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/README.md @@ -0,0 +1,830 @@ +# amCharts Export + +Version: 1.1.8 + + +## Description + +This plugin adds export capabilities to all amCharts products - charts and maps. + +It allows annotating and exporting chart or related data to various bitmap, +vector, document or data formats, such as PNG, JPG, PDF, SVG, JSON, XLSX and +many more. + + +## Important notice + +Please note that due to security measures implemented in modern browsers, some +or all export options might not work if the web page is loaded locally (via +file:///) or contain images loaded from different host than the web page itself. + + +## Usage + +### 1) Include the minified version of file of this plugin as well as the +bundled CSS file. I.e.: + +``` + + +``` + +Or if you'd rather use amCharts CDN: + +``` + + +``` + +(this needs to go after all the other amCharts includes) + +### 2) Enable `export` with default options: + +``` +AmCharts.makeChart( "chartdiv", { + ..., + "export": { + "enabled": true + } +} ); +``` + +### ... OR set your own custom options: + +``` +AmCharts.makeChart( "chartdiv", { + ..., + "export": { + "enabled": true, + "menu": [ { + "class": "export-main", + "menu": [ { + "label": "Download", + "menu": [ "PNG", "JPG", "CSV" ] + }, { + "label": "Annotate", + "action": "draw", + "menu": [ { + "class": "export-drawing", + "menu": [ "PNG", "JPG" ] + } ] + } ] + } ] + } +} ); +``` + + +## Loading external libraries needed for operation of this plugin + +The plugin relies on a number of different libraries, to export images, draw +annotations or generate download files. + +Those libraries need to be loaded for the plugin to work properly. + +There are two ways to load them. Choose the one that is right: + +### 1) Automatic (preferred) + +All libraries required for plugin operation are included withing plugins */libs* +subdirectory. + +If you want the plugin to load them on-demand (when it's needed for a certain +operation), make sure you've set the [`path`](http://docs.amcharts.com/3/javascriptcharts/AmSerialChart#path) property in your chart setup. + +If you are using relative url, note that it is relative to the web page you are +displaying your chart on, not the export.js library. + +In case you've moved the libs folder you need to tell the plugin where it is +`"libs": { "path": "../libs/" }` + +### 2) Manual + +You can also load all those JavaScript libraries by ` + + + + + + + + + + + +
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/gantt.html b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/gantt.html new file mode 100644 index 0000000..056f3b1 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/gantt.html @@ -0,0 +1,311 @@ + + + + + + + + + + + + + + + + + + + + +
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/gauge.html b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/gauge.html new file mode 100644 index 0000000..48cca2d --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/gauge.html @@ -0,0 +1,77 @@ + + + + + + + + + + + + + + + + + + +
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/images/bicycle.png b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/images/bicycle.png new file mode 100644 index 0000000..0873bf9 Binary files /dev/null and b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/images/bicycle.png differ diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/images/car.png b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/images/car.png new file mode 100644 index 0000000..4214fb7 Binary files /dev/null and b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/images/car.png differ diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/images/motorcycle.png b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/images/motorcycle.png new file mode 100644 index 0000000..47c6ce8 Binary files /dev/null and b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/images/motorcycle.png differ diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/index.html b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/index.html new file mode 100644 index 0000000..247f555 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/index.html @@ -0,0 +1,62 @@ + + + + + + + + + + + + + +
+ + +
+ + + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/map.html b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/map.html new file mode 100644 index 0000000..4af3af6 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/map.html @@ -0,0 +1,209 @@ + + + + + + + + + + + + + + + + + + +
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/pie1.html b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/pie1.html new file mode 100644 index 0000000..a184752 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/pie1.html @@ -0,0 +1,72 @@ + + + + + + + + + + + + + + + + + + + +
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/pie2.html b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/pie2.html new file mode 100644 index 0000000..2300038 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/pie2.html @@ -0,0 +1,97 @@ + + + + + + + + + + + + + + + + + + + +
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/pie3.html b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/pie3.html new file mode 100644 index 0000000..7a30af3 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/pie3.html @@ -0,0 +1,84 @@ + + + + + + + + + + + + + + + + + + + +
+
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/pie4.html b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/pie4.html new file mode 100644 index 0000000..0b5dfbb --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/pie4.html @@ -0,0 +1,101 @@ + + + + + + + + + + + + + + + + + + + +
+
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/radar.html b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/radar.html new file mode 100644 index 0000000..9ac65e1 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/radar.html @@ -0,0 +1,92 @@ + + + + + + + + + + + + + + + + + + + +
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/serial1.html b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/serial1.html new file mode 100644 index 0000000..cce7d8a --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/serial1.html @@ -0,0 +1,213 @@ + + + + + + + + + + + + + + + + + + + + + +
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/serial2.html b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/serial2.html new file mode 100644 index 0000000..f00af31 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/serial2.html @@ -0,0 +1,98 @@ + + + + + + + + + + + + + + + + + + + + +
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/serial3.html b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/serial3.html new file mode 100644 index 0000000..9c05934 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/serial3.html @@ -0,0 +1,112 @@ + + + + + + + + + + + + + + + + + + + +
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/stock.html b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/stock.html new file mode 100644 index 0000000..48ab207 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/stock.html @@ -0,0 +1,230 @@ + + + + + + + + + + + + + + + + + + + + +
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/xy.html b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/xy.html new file mode 100644 index 0000000..c103126 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/examples/xy.html @@ -0,0 +1,139 @@ + + + + + + + + + + + + + + + + + + + +
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/export.css b/ResoursesManager/ResoursesManager/amcharts/plugins/export/export.css new file mode 100644 index 0000000..e7e5be1 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/export.css @@ -0,0 +1,305 @@ +/** + * Drawing mode + */ +.amcharts-export-canvas { + position: absolute; + display: none; + z-index: 1; + top: 0; + right: 0; + bottom: 0; + left: 0; + background-color: #fff; +} +.amcharts-export-canvas.active { + display: block; +} + +/** + * Menu; Rest state + */ +.amcharts-export-menu { + position: absolute; + z-index: 2; + opacity: 0.5; + -webkit-transition: all 0.5s ease-out; + -moz-transition: all 0.5s ease-out; + -ms-transition: all 0.5s ease-out; + -o-transition: all 0.5s ease-out; + transition: all 0.5s ease-out; + color: #000; +} +.amcharts-main-div:hover .amcharts-export-menu, .amcharts-stock-div:hover .amcharts-export-menu { + opacity: 1; +} +.amcharts-export-menu-top-left > ul > li > ul:after { + content: ""; + position: absolute; + top: 13px; + right: 100%; + z-index: 1000; + border-top: 7px solid transparent; + border-left: 7px solid transparent; + border-right: 7px solid #fff; + border-bottom: 7px solid transparent; +} +.amcharts-export-menu-top-left > ul > li > ul > li:first-child > a:after { + content: ""; + position: absolute; + top: 12px; + right: 100%; + z-index: 1001; + border-top: 8px solid transparent; + border-left: 8px solid transparent; + border-right: 8px solid #e2e2e2; + border-bottom: 8px solid transparent; +} +.amcharts-export-menu-top-right > ul > li > ul:after { + content: ""; + position: absolute; + top: 13px; + left: 100%; + z-index: 1000; + border-top: 7px solid transparent; + border-left: 7px solid #fff; + border-right: 7px solid transparent; + border-bottom: 7px solid transparent; +} +.amcharts-export-menu-top-right > ul > li > ul > li:first-child > a:after { + content: ""; + position: absolute; + top: 12px; + left: 100%; + z-index: 1001; + border-top: 8px solid transparent; + border-left: 8px solid #e2e2e2; + border-right: 8px solid transparent; + border-bottom: 8px solid transparent; +} +.amcharts-export-menu-bottom-left > ul > li > ul:after { + content: ""; + position: absolute; + bottom: 13px; + right: 100%; + z-index: 1000; + border-top: 7px solid transparent; + border-left: 7px solid transparent; + border-right: 7px solid #fff; + border-bottom: 7px solid transparent; +} +.amcharts-export-menu-bottom-left > ul > li > ul > li:last-child > a:after { + content: ""; + position: absolute; + bottom: 12px; + right: 100%; + z-index: 1001; + border-top: 8px solid transparent; + border-left: 8px solid transparent; + border-right: 8px solid #e2e2e2; + border-bottom: 8px solid transparent; +} +.amcharts-export-menu-bottom-right > ul > li > ul:after { + content: ""; + position: absolute; + bottom: 13px; + left: 100%; + z-index: 1000; + border-top: 7px solid transparent; + border-left: 7px solid #fff; + border-right: 7px solid transparent; + border-bottom: 7px solid transparent; +} +.amcharts-export-menu-bottom-right > ul > li > ul > li:last-child > a:after { + content: ""; + position: absolute; + bottom: 12px; + left: 100%; + z-index: 1001; + border-top: 8px solid transparent; + border-left: 8px solid #e2e2e2; + border-right: 8px solid transparent; + border-bottom: 8px solid transparent; +} +.amcharts-export-menu ul { + list-style: none; + margin: 0; + padding: 0; +} +.amcharts-export-menu li { + position: relative; + display: block; + z-index: 1; +} +.amcharts-export-menu li > ul { + position: absolute; + display: none; + border: 1px solid #e2e2e2; + margin-top: -1px; + background: #fff; +} +.amcharts-export-menu li > a { + position: relative; + display: block; + color: #000; + text-decoration: none; + padding: 12px 12px; + z-index: 2; + white-space: nowrap; + border-bottom: 1px solid #f2f2f2; +} +.amcharts-export-menu li:last-child > a { + border-bottom: none; +} +.amcharts-export-menu li > a > img { + border: none; +} +.amcharts-export-menu-top-left { + top: 0; + left: 0; +} +.amcharts-export-menu-bottom-left { + bottom: 0; + left: 0; +} +.amcharts-export-menu-top-right { + top: 0; + right: 0; +} +.amcharts-export-menu-bottom-right { + bottom: 0; + right: 0; +} + +/** + * Menu; Hover state + */ +.amcharts-export-menu li:hover > ul { + display: block; +} +.amcharts-export-menu li:hover > a { + color: #fff; + background-color: #636363; +} +.amcharts-export-menu-top-left li:hover > ul { + left: 100%; + top: 0; +} +.amcharts-export-menu-bottom-left li:hover > ul { + left: 100%; + bottom: 0; +} +.amcharts-export-menu-top-right li:hover > ul { + top: 0; + right: 100%; +} +.amcharts-export-menu-bottom-right li:hover > ul { + bottom: 0; + right: 100%; +} + +/** + * Menu; custom class + */ +.amcharts-export-menu .export-main { + margin: 4px; +} +.amcharts-export-menu .export-main > a, .amcharts-export-menu .export-drawing > a, .amcharts-export-menu .export-delayed-capturing > a { + text-indent: -13333337px; + width: 36px; + height: 36px; + padding: 0; + background-repeat: no-repeat; + background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAA0AAAAQCAYAAADNo/U5AAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA4ZpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMDE0IDc5LjE1Njc5NywgMjAxNC8wOC8yMC0wOTo1MzowMiAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDo4M2Q5NDllYS1lMjE3LTQ3Y2QtYTU1Ni04MTQ3NmRjNWEwYWQiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6RjJDMzE5OUFERDIwMTFFNEE3MUI4OTEyNEFENjEzQjQiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6RjJDMzE5OTlERDIwMTFFNEE3MUI4OTEyNEFENjEzQjQiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCkiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDpiYjc1MTkyYi0yZTY4LTQ5YWUtYTgxOS01ZmM1OTI2YmVjNzYiIHN0UmVmOmRvY3VtZW50SUQ9ImFkb2JlOmRvY2lkOnBob3Rvc2hvcDoxODYwYzBkYy0xZDk5LTExNzgtYWI2Yi1lZWQ1ZWU2MWI5YmEiLz4gPC9yZGY6RGVzY3JpcHRpb24+IDwvcmRmOlJERj4gPC94OnhtcG1ldGE+IDw/eHBhY2tldCBlbmQ9InIiPz7MkIPxAAAAhUlEQVR42mIsKytjIBUwYRF7CMT/kfBDYjSRZdMg1FQCxO+gWAZNjQySHEgdAwtUogeIvwPxRCy2g/h8QJwPxFPRnQcSCAPiH2iafkDFp+Ly0zogdgPi91D+eyh/HaGAOAzEtkB8DEofRlfAgiOArgKxNVWDHGbTfxL0MFJkEyMpmgACDADF7RquHJcLdAAAAABJRU5ErkJggg==); + background-color: #fff; + background-position: center; + -webkit-box-shadow: 1px 1px 3px 0px rgba(0,0,0,0.5); + -moz-box-shadow: 1px 1px 3px 0px rgba(0,0,0,0.5); + box-shadow: 1px 1px 3px 0px rgba(0,0,0,0.5); + border-radius: 18px; + margin: 8px 8px 0 10px; +} +.amcharts-export-menu .export-drawing > a { + background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAA8AAAAPCAYAAAA71pVKAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAyhpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNS1jMDIxIDc5LjE1NTc3MiwgMjAxNC8wMS8xMy0xOTo0NDowMCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCkiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6MTJBQjFEODJEQUFBMTFFNEI4MTNBOENFRThBOEEwQzgiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6MTJBQjFEODNEQUFBMTFFNEI4MTNBOENFRThBOEEwQzgiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDozRTcyRDlGRkRBQTkxMUU0QjgxM0E4Q0VFOEE4QTBDOCIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDozRTcyREEwMERBQTkxMUU0QjgxM0E4Q0VFOEE4QTBDOCIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PmmQcJUAAAD2SURBVHjaYiwrK2MgAugD8Xog/gjEIUB8FyTIRIRGPSDeDcSKQGwAxIeBWI0YzSAb9wCxKJKYJBDvBWIVJgIad6NphAEZIF6FS7MBFhvRAT8TDo0gG0XwaAQFXDi6ZkOojYQ0ugDxGRYkQVmoRiFiNKKHdioQHwDiQCD+TUgjCMBsBhmSAMSRQHwUiK8AsS6SPIZGZJs9gPg/EB+D8o2gKQkEPmDTiKw5GYjlgLgPiBmB2AqIo6EaXbFphGkWA2IfKL8AiB8C8WogvgGNtjO4Qg/kp3ggZoMG0jYgngXEO4H4L6FED9JsDcQVQLwAiF8ykAAAAgwACUIvtAo9owUAAAAASUVORK5CYII=); +} +.amcharts-export-menu .export-main:hover, .amcharts-export-menu .export-drawing:hover { + padding-bottom: 100px; +} +.amcharts-export-menu.amcharts-export-menu-bottom-left .export-main:hover, .amcharts-export-menu.amcharts-export-menu-bottom-left .export-drawing:hover, .amcharts-export-menu.amcharts-export-menu-bottom-right .export-main:hover, .amcharts-export-menu.amcharts-export-menu-bottom-right .export-drawing:hover { + padding-bottom: 0; + padding-top: 100px; +} +.amcharts-export-menu .export-main:hover > a { + background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAA0AAAAQCAYAAADNo/U5AAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAA3BpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNi1jMDE0IDc5LjE1Njc5NywgMjAxNC8wOC8yMC0wOTo1MzowMiAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wTU09Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9tbS8iIHhtbG5zOnN0UmVmPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VSZWYjIiB4bWxuczp4bXA9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC8iIHhtcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD0ieG1wLmRpZDo4M2Q5NDllYS1lMjE3LTQ3Y2QtYTU1Ni04MTQ3NmRjNWEwYWQiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6NEQ4NjQ4NDlERDI3MTFFNEE1RThDQkM0MTU3NkJCQUIiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6NEQ4NjQ4NDhERDI3MTFFNEE1RThDQkM0MTU3NkJCQUIiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCkiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDpGMkMzMTk5OUREMjAxMUU0QTcxQjg5MTI0QUQ2MTNCNCIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDpGMkMzMTk5QUREMjAxMUU0QTcxQjg5MTI0QUQ2MTNCNCIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/PrFJGbMAAAB9SURBVHjaYvz//z8DqYAJi9hDIP6PhB8So4ksmwaRJgZQ6AFxCRC/g+K//1HBXyS5EnBoQzWBcDYQ//mPHfyByjOgawLhICD+jqbhO1ScAZcmELaFOuU/lLZFV4NNEwhrA/FRKI0hz0itZEQQsMBCngQ9jBTZxEiKJoAAAwDA0OlvgOoZkQAAAABJRU5ErkJggg==); +} +.amcharts-export-menu .export-drawing:hover > a { + background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAA8AAAAPCAYAAAA71pVKAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAyhpVFh0WE1MOmNvbS5hZG9iZS54bXAAAAAAADw/eHBhY2tldCBiZWdpbj0i77u/IiBpZD0iVzVNME1wQ2VoaUh6cmVTek5UY3prYzlkIj8+IDx4OnhtcG1ldGEgeG1sbnM6eD0iYWRvYmU6bnM6bWV0YS8iIHg6eG1wdGs9IkFkb2JlIFhNUCBDb3JlIDUuNS1jMDIxIDc5LjE1NTc3MiwgMjAxNC8wMS8xMy0xOTo0NDowMCAgICAgICAgIj4gPHJkZjpSREYgeG1sbnM6cmRmPSJodHRwOi8vd3d3LnczLm9yZy8xOTk5LzAyLzIyLXJkZi1zeW50YXgtbnMjIj4gPHJkZjpEZXNjcmlwdGlvbiByZGY6YWJvdXQ9IiIgeG1sbnM6eG1wPSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvIiB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiIHhtcDpDcmVhdG9yVG9vbD0iQWRvYmUgUGhvdG9zaG9wIENDIDIwMTQgKE1hY2ludG9zaCkiIHhtcE1NOkluc3RhbmNlSUQ9InhtcC5paWQ6MTJBQjFEODZEQUFBMTFFNEI4MTNBOENFRThBOEEwQzgiIHhtcE1NOkRvY3VtZW50SUQ9InhtcC5kaWQ6MTJBQjFEODdEQUFBMTFFNEI4MTNBOENFRThBOEEwQzgiPiA8eG1wTU06RGVyaXZlZEZyb20gc3RSZWY6aW5zdGFuY2VJRD0ieG1wLmlpZDoxMkFCMUQ4NERBQUExMUU0QjgxM0E4Q0VFOEE4QTBDOCIgc3RSZWY6ZG9jdW1lbnRJRD0ieG1wLmRpZDoxMkFCMUQ4NURBQUExMUU0QjgxM0E4Q0VFOEE4QTBDOCIvPiA8L3JkZjpEZXNjcmlwdGlvbj4gPC9yZGY6UkRGPiA8L3g6eG1wbWV0YT4gPD94cGFja2V0IGVuZD0iciI/Prwb/VYAAADaSURBVHjaYvj//z8DEVgfiO8B8XkgVoaJE6NRD4hf/UeAZ0CsRoxmfTSNMPAYiFXI0QgD55gYsAMDIN4DxKIMuAE/NhsNgPj1f/zgAxCboGs0BOI3xGhEDzBZIH5LrEYQRvZzKhAfAOJAIP6NxY8fgdgFiM/ARaCmMAHxIyC2hvLPAfFvXDaiJxIvIH4IxIxIkv5Qje+xaUTWvBaqsB9qgBUQr8KnEaZZDIh/IjkR5PynQNwExPL4UiCIKIVq+gXEG6BeYCYmw4CcuAEYbseBeAEQv2QgAQAEGACNAGwIYqHBngAAAABJRU5ErkJggg==); +} +.amcharts-export-menu .export-close > a, +.amcharts-export-menu .export-close:hover > a { + background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAA0AAAAQCAYAAADNo/U5AAAACXBIWXMAAAsTAAALEwEAmpwYAABBsGlUWHRYTUw6Y29tLmFkb2JlLnhtcAAAAAAAPD94cGFja2V0IGJlZ2luPSLvu78iIGlkPSJXNU0wTXBDZWhpSHpyZVN6TlRjemtjOWQiPz4KPHg6eG1wbWV0YSB4bWxuczp4PSJhZG9iZTpuczptZXRhLyIgeDp4bXB0az0iQWRvYmUgWE1QIENvcmUgNS41LWMwMjEgNzkuMTU1NzcyLCAyMDE0LzAxLzEzLTE5OjQ0OjAwICAgICAgICAiPgogICA8cmRmOlJERiB4bWxuczpyZGY9Imh0dHA6Ly93d3cudzMub3JnLzE5OTkvMDIvMjItcmRmLXN5bnRheC1ucyMiPgogICAgICA8cmRmOkRlc2NyaXB0aW9uIHJkZjphYm91dD0iIgogICAgICAgICAgICB4bWxuczp4bXBNTT0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wL21tLyIKICAgICAgICAgICAgeG1sbnM6c3RSZWY9Imh0dHA6Ly9ucy5hZG9iZS5jb20veGFwLzEuMC9zVHlwZS9SZXNvdXJjZVJlZiMiCiAgICAgICAgICAgIHhtbG5zOnN0RXZ0PSJodHRwOi8vbnMuYWRvYmUuY29tL3hhcC8xLjAvc1R5cGUvUmVzb3VyY2VFdmVudCMiCiAgICAgICAgICAgIHhtbG5zOnhtcD0iaHR0cDovL25zLmFkb2JlLmNvbS94YXAvMS4wLyIKICAgICAgICAgICAgeG1sbnM6ZGM9Imh0dHA6Ly9wdXJsLm9yZy9kYy9lbGVtZW50cy8xLjEvIgogICAgICAgICAgICB4bWxuczpwaG90b3Nob3A9Imh0dHA6Ly9ucy5hZG9iZS5jb20vcGhvdG9zaG9wLzEuMC8iCiAgICAgICAgICAgIHhtbG5zOnRpZmY9Imh0dHA6Ly9ucy5hZG9iZS5jb20vdGlmZi8xLjAvIgogICAgICAgICAgICB4bWxuczpleGlmPSJodHRwOi8vbnMuYWRvYmUuY29tL2V4aWYvMS4wLyI+CiAgICAgICAgIDx4bXBNTTpPcmlnaW5hbERvY3VtZW50SUQ+eG1wLmRpZDo4M2Q5NDllYS1lMjE3LTQ3Y2QtYTU1Ni04MTQ3NmRjNWEwYWQ8L3htcE1NOk9yaWdpbmFsRG9jdW1lbnRJRD4KICAgICAgICAgPHhtcE1NOkRvY3VtZW50SUQ+YWRvYmU6ZG9jaWQ6cGhvdG9zaG9wOjZhMTQ5MTc1LTNiODItMTE3OC05ZjZmLWY0MWMwNTYyYzQxYTwveG1wTU06RG9jdW1lbnRJRD4KICAgICAgICAgPHhtcE1NOkluc3RhbmNlSUQ+eG1wLmlpZDpkZGFhNTJkMi1mZDRiLTRkMmMtODEzOC01ZTEzNmQ4NGFjMDE8L3htcE1NOkluc3RhbmNlSUQ+CiAgICAgICAgIDx4bXBNTTpEZXJpdmVkRnJvbSByZGY6cGFyc2VUeXBlPSJSZXNvdXJjZSI+CiAgICAgICAgICAgIDxzdFJlZjppbnN0YW5jZUlEPnhtcC5paWQ6MDdhZmI1Y2UtYzQ1OS00YzQxLWJkMjItMTllMDJlMGE5YzVjPC9zdFJlZjppbnN0YW5jZUlEPgogICAgICAgICAgICA8c3RSZWY6ZG9jdW1lbnRJRD54bXAuZGlkOjA3YWZiNWNlLWM0NTktNGM0MS1iZDIyLTE5ZTAyZTBhOWM1Yzwvc3RSZWY6ZG9jdW1lbnRJRD4KICAgICAgICAgICAgPHN0UmVmOm9yaWdpbmFsRG9jdW1lbnRJRD54bXAuZGlkOjgzZDk0OWVhLWUyMTctNDdjZC1hNTU2LTgxNDc2ZGM1YTBhZDwvc3RSZWY6b3JpZ2luYWxEb2N1bWVudElEPgogICAgICAgICA8L3htcE1NOkRlcml2ZWRGcm9tPgogICAgICAgICA8eG1wTU06SGlzdG9yeT4KICAgICAgICAgICAgPHJkZjpTZXE+CiAgICAgICAgICAgICAgIDxyZGY6bGkgcmRmOnBhcnNlVHlwZT0iUmVzb3VyY2UiPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6YWN0aW9uPnNhdmVkPC9zdEV2dDphY3Rpb24+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDppbnN0YW5jZUlEPnhtcC5paWQ6YmY3ZmRlNGYtZDk2MS00Njk4LWI0ZjAtMDJlYjEwOWE4OTA4PC9zdEV2dDppbnN0YW5jZUlEPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6d2hlbj4yMDE1LTA1LTE1VDEzOjE3OjQ5KzAyOjAwPC9zdEV2dDp3aGVuPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6c29mdHdhcmVBZ2VudD5BZG9iZSBQaG90b3Nob3AgQ0MgMjAyMSAoTWFjaW50b3NoKTwvc3RFdnQ6c29mdHdhcmVBZ2VudD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmNoYW5nZWQ+Lzwvc3RFdnQ6Y2hhbmdlZD4KICAgICAgICAgICAgICAgPC9yZGY6bGk+CiAgICAgICAgICAgICAgIDxyZGY6bGkgcmRmOnBhcnNlVHlwZT0iUmVzb3VyY2UiPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6YWN0aW9uPmNvbnZlcnRlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6cGFyYW1ldGVycz5mcm9tIGltYWdlL3BuZyB0byBhcHBsaWNhdGlvbi92bmQuYWRvYmUucGhvdG9zaG9wPC9zdEV2dDpwYXJhbWV0ZXJzPgogICAgICAgICAgICAgICA8L3JkZjpsaT4KICAgICAgICAgICAgICAgPHJkZjpsaSByZGY6cGFyc2VUeXBlPSJSZXNvdXJjZSI+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDphY3Rpb24+ZGVyaXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6cGFyYW1ldGVycz5jb252ZXJ0ZWQgZnJvbSBpbWFnZS9wbmcgdG8gYXBwbGljYXRpb24vdm5kLmFkb2JlLnBob3Rvc2hvcDwvc3RFdnQ6cGFyYW1ldGVycz4KICAgICAgICAgICAgICAgPC9yZGY6bGk+CiAgICAgICAgICAgICAgIDxyZGY6bGkgcmRmOnBhcnNlVHlwZT0iUmVzb3VyY2UiPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6YWN0aW9uPnNhdmVkPC9zdEV2dDphY3Rpb24+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDppbnN0YW5jZUlEPnhtcC5paWQ6MDdhZmI1Y2UtYzQ1OS00YzQxLWJkMjItMTllMDJlMGE5YzVjPC9zdEV2dDppbnN0YW5jZUlEPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6d2hlbj4yMDE1LTA1LTE1VDEzOjE3OjQ5KzAyOjAwPC9zdEV2dDp3aGVuPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6c29mdHdhcmVBZ2VudD5BZG9iZSBQaG90b3Nob3AgQ0MgMjAyMSAoTWFjaW50b3NoKTwvc3RFdnQ6c29mdHdhcmVBZ2VudD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmNoYW5nZWQ+Lzwvc3RFdnQ6Y2hhbmdlZD4KICAgICAgICAgICAgICAgPC9yZGY6bGk+CiAgICAgICAgICAgICAgIDxyZGY6bGkgcmRmOnBhcnNlVHlwZT0iUmVzb3VyY2UiPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6YWN0aW9uPmRlcml2ZWQ8L3N0RXZ0OmFjdGlvbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnBhcmFtZXRlcnM+Y29udmVydGVkIGZyb20gYXBwbGljYXRpb24vdm5kLmFkb2JlLnBob3Rvc2hvcCB0byBpbWFnZS9wbmc8L3N0RXZ0OnBhcmFtZXRlcnM+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICAgICA8cmRmOmxpIHJkZjpwYXJzZVR5cGU9IlJlc291cmNlIj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OmFjdGlvbj5zYXZlZDwvc3RFdnQ6YWN0aW9uPgogICAgICAgICAgICAgICAgICA8c3RFdnQ6aW5zdGFuY2VJRD54bXAuaWlkOmRkYWE1MmQyLWZkNGItNGQyYy04MTM4LTVlMTM2ZDg0YWMwMTwvc3RFdnQ6aW5zdGFuY2VJRD4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OndoZW4+MjAxNS0wNS0xNVQxMzoyMToyMSswMjowMDwvc3RFdnQ6d2hlbj4KICAgICAgICAgICAgICAgICAgPHN0RXZ0OnNvZnR3YXJlQWdlbnQ+QWRvYmUgUGhvdG9zaG9wIENDIDIwMjEgKE1hY2ludG9zaCk8L3N0RXZ0OnNvZnR3YXJlQWdlbnQ+CiAgICAgICAgICAgICAgICAgIDxzdEV2dDpjaGFuZ2VkPi88L3N0RXZ0OmNoYW5nZWQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICA8L3JkZjpTZXE+CiAgICAgICAgIDwveG1wTU06SGlzdG9yeT4KICAgICAgICAgPHhtcDpDcmVhdG9yVG9vbD5BZG9iZSBQaG90b3Nob3AgQ0MgMjAxNCAoTWFjaW50b3NoKTwveG1wOkNyZWF0b3JUb29sPgogICAgICAgICA8eG1wOkNyZWF0ZURhdGU+MjAxNS0wNS0xNVQxMzoxMzoxNyswMjowMDwveG1wOkNyZWF0ZURhdGU+CiAgICAgICAgIDx4bXA6TW9kaWZ5RGF0ZT4yMDE1LTA1LTE1VDEzOjIxOjIxKzAyOjAwPC94bXA6TW9kaWZ5RGF0ZT4KICAgICAgICAgPHhtcDpNZXRhZGF0YURhdGU+MjAxNS0wNS0xNVQxMzoyMToyMSswMjowMDwveG1wOk1ldGFkYXRhRGF0ZT4KICAgICAgICAgPGRjOmZvcm1hdD5pbWFnZS9wbmc8L2RjOmZvcm1hdD4KICAgICAgICAgPHBob3Rvc2hvcDpDb2xvck1vZGU+MzwvcGhvdG9zaG9wOkNvbG9yTW9kZT4KICAgICAgICAgPHBob3Rvc2hvcDpUZXh0TGF5ZXJzPgogICAgICAgICAgICA8cmRmOkJhZz4KICAgICAgICAgICAgICAgPHJkZjpsaSByZGY6cGFyc2VUeXBlPSJSZXNvdXJjZSI+CiAgICAgICAgICAgICAgICAgIDxwaG90b3Nob3A6TGF5ZXJOYW1lPlg8L3Bob3Rvc2hvcDpMYXllck5hbWU+CiAgICAgICAgICAgICAgICAgIDxwaG90b3Nob3A6TGF5ZXJUZXh0Plg8L3Bob3Rvc2hvcDpMYXllclRleHQ+CiAgICAgICAgICAgICAgIDwvcmRmOmxpPgogICAgICAgICAgICA8L3JkZjpCYWc+CiAgICAgICAgIDwvcGhvdG9zaG9wOlRleHRMYXllcnM+CiAgICAgICAgIDx0aWZmOk9yaWVudGF0aW9uPjE8L3RpZmY6T3JpZW50YXRpb24+CiAgICAgICAgIDx0aWZmOlhSZXNvbHV0aW9uPjcyMDAwMC8xMDAwMDwvdGlmZjpYUmVzb2x1dGlvbj4KICAgICAgICAgPHRpZmY6WVJlc29sdXRpb24+NzIwMDAwLzEwMDAwPC90aWZmOllSZXNvbHV0aW9uPgogICAgICAgICA8dGlmZjpSZXNvbHV0aW9uVW5pdD4yPC90aWZmOlJlc29sdXRpb25Vbml0PgogICAgICAgICA8ZXhpZjpDb2xvclNwYWNlPjY1NTM1PC9leGlmOkNvbG9yU3BhY2U+CiAgICAgICAgIDxleGlmOlBpeGVsWERpbWVuc2lvbj4xMzwvZXhpZjpQaXhlbFhEaW1lbnNpb24+CiAgICAgICAgIDxleGlmOlBpeGVsWURpbWVuc2lvbj4xNjwvZXhpZjpQaXhlbFlEaW1lbnNpb24+CiAgICAgIDwvcmRmOkRlc2NyaXB0aW9uPgogICA8L3JkZjpSREY+CjwveDp4bXBtZXRhPgogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIAogICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgCiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAKICAgICAgICAgICAgICAgICAgICAgICAgICAgIAo8P3hwYWNrZXQgZW5kPSJ3Ij8+HyMp+AAAACBjSFJNAAB6JQAAgIMAAPn/AACA6QAAdTAAAOpgAAA6mAAAF2+SX8VGAAAA3UlEQVR42rSSXZECQQyEPygMrIVFAidhkQASQEIjYVsCSOAksBJAAlhAwvKSWcJBUQVVl6fM5Ke7k4z6vudTG/OFTQAktcAs/ja2TyVBUgVsgQq42F5PItYBCn8PTFNjAYvw5wM92x3gCNSSFCh1araLvAdNBi53VgMtgCuweRqE7RyogAPQxHsdcQBGf0cuaZ80APzaXn468urtniQ1CaXoayStct5AL4QfgToKfoBzIF2BadGVkVZRkIU7UdQDkqRZoDwJl3ROzea2u4LUvtpHOavkty9H/m9XfhsA0l9VuzQDWrIAAAAASUVORK5CYII=); +} + +/** + * Menu; Color picker + */ + +.amcharts-export-menu .export-drawing-color { + background: #000; + width: 35px; +} +.amcharts-export-menu .export-drawing-color a { + display: block; + overflow: hidden; + text-indent: -99999999px; +} +.amcharts-export-menu .export-drawing-color-red { + background: #f00; +} +.amcharts-export-menu .export-drawing-color-green { + background: #0f0; +} +.amcharts-export-menu .export-drawing-color-blue { + background: #00f; +} +.amcharts-export-menu .export-drawing-color-white { + background: #fff; +} + +/* +** Fallback +*/ +.amcharts-export-fallback { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + background-color: #fff; +} +.amcharts-export-fallback textarea { + border: none; + outline: none; + position: absolute; + overflow: hidden; + width: 100%; + height: 100%; + padding: 20px; +} +.amcharts-export-fallback-message { + position: absolute; + z-index: 1; + padding: 20px; + width: 100%; + background-color: #fff; +} + +/* +** DELAYED CAPTURING +*/ +.amcharts-export-menu .export-delayed-capturing > a { + text-indent: 0px; + line-height: 36px; + vertical-align: middle; + text-align: center; + background-image: none; +} \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/export.js b/ResoursesManager/ResoursesManager/amcharts/plugins/export/export.js new file mode 100644 index 0000000..519bb3a --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/export.js @@ -0,0 +1,1825 @@ +/* +Plugin Name: amCharts Export +Description: Adds export capabilities to amCharts products +Author: Benjamin Maertz, amCharts +Version: 1.1.8 +Author URI: http://www.amcharts.com/ + +Copyright 2015 amCharts + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. + +Please note that the above license covers only this plugin. It by all means does +not apply to any other amCharts products that are covered by different licenses. +*/ + +/* + ** Polyfill translation + */ +if ( !AmCharts.translations[ "export" ] ) { + AmCharts.translations[ "export" ] = {} +} +if ( !AmCharts.translations[ "export" ][ "en" ] ) { + AmCharts.translations[ "export" ][ "en" ] = { + "fallback.save.text": "CTRL + C to copy the data into the clipboard.", + "fallback.save.image": "Rightclick -> Save picture as... to save the image.", + "capturing.delayed.menu.label": "{{duration}}", + "capturing.delayed.menu.title": "Click to cancel" + } +} + +/** + * Set init handler + */ +AmCharts.addInitHandler( function( chart ) { + var _this = { + name: "export", + version: "1.1.8", + libs: { + async: true, + autoLoad: true, + reload: false, + path: ( ( chart.path || "" ) + "plugins/export/libs/" ), + resources: [ { + "pdfmake/pdfmake.js": [ "pdfmake/vfs_fonts.js" ], + "jszip/jszip.js": [ "xlsx/xlsx.js" ] + }, "fabric.js/fabric.js", "FileSaver.js/FileSaver.js" ] + }, + config: {}, + setup: { + hasBlob: false + }, + drawing: { + enabled: false, + actions: [ "undo", "redo", "done", "cancel" ], + undos: [], + undo: function() { + var item = _this.drawing.undos.pop(); + if ( item ) { + _this.drawing.redos.push( item ); + if ( item.action == "added" ) { + item.target.known = true; + _this.setup.fabric.remove( item.target ); + } + item.target.setOptions( JSON.parse( item.options ) ); + _this.setup.fabric.renderAll(); + } + }, + redos: [], + redo: function() { + var item = _this.drawing.redos.pop(); + if ( item ) { + _this.drawing.undos.push( item ); + if ( item.action == "added" ) { + item.target.known = true; + _this.setup.fabric.add( item.target ); + } + item.target.setOptions( JSON.parse( item.options ) ); + _this.setup.fabric.renderAll(); + } + }, + done: function() { + _this.drawing.enabled = false; + _this.drawing.undos = []; + _this.drawing.redos = []; + _this.createMenu( _this.config.menu ); + _this.setup.wrapper.setAttribute( "class", _this.setup.chart.classNamePrefix + "-export-canvas" ); + } + }, + defaults: { + position: "top-right", + fileName: "amCharts", + action: "download", + formats: { + JPG: { + mimeType: "image/jpg", + extension: "jpg", + capture: true + }, + PNG: { + mimeType: "image/png", + extension: "png", + capture: true + }, + SVG: { + mimeType: "text/xml", + extension: "svg", + capture: true + }, + PDF: { + mimeType: "application/pdf", + extension: "pdf", + capture: true + }, + CSV: { + mimeType: "text/plain", + extension: "csv" + }, + JSON: { + mimeType: "text/plain", + extension: "json" + }, + XLSX: { + mimeType: "application/octet-stream", + extension: "xlsx" + } + }, + fabric: { + backgroundColor: "#FFFFFF", + isDrawingMode: false, + selection: false, + removeImages: true + }, + pdfMake: { + pageSize: "A4", + pageOrientation: "portrait", + images: {}, + content: [ { + image: "reference", + fit: [ 523.28, 769.89 ] + } ] + }, + divId: null, + menuReviver: null, + menuWalker: null, + menu: [ { + "class": "export-main", + label: "Export", + menu: [ { + label: "Download as ...", + menu: [ "PNG", "JPG", "SVG", { + format: "PDF", + content: [ "Saved from:", window.location.href, { + image: "reference", + fit: [ 523.28, 769.89 ] // FIT IMAGE TO A4 + } ] + } ] + }, { + label: "Save data ...", + menu: [ "CSV", "XLSX", "JSON" ] + }, { + label: "Annotate", + action: "draw", + menu: [ { + "class": "export-drawing", + menu: [ { + label: "Color ...", + menu: [ { + "class": "export-drawing-color export-drawing-color-black", + label: "Black", + click: function() { + this.setup.fabric.freeDrawingBrush.color = "#000"; + } + }, { + "class": "export-drawing-color export-drawing-color-white", + label: "White", + click: function() { + this.setup.fabric.freeDrawingBrush.color = "#fff"; + } + }, { + "class": "export-drawing-color export-drawing-color-red", + label: "Red", + click: function() { + this.setup.fabric.freeDrawingBrush.color = "#f00"; + } + }, { + "class": "export-drawing-color export-drawing-color-green", + label: "Green", + click: function() { + this.setup.fabric.freeDrawingBrush.color = "#0f0"; + } + }, { + "class": "export-drawing-color export-drawing-color-blue", + label: "Blue", + click: function() { + this.setup.fabric.freeDrawingBrush.color = "#00f"; + } + } ] + }, "UNDO", "REDO", { + label: "Save as ...", + menu: [ "PNG", "JPG", "SVG", { + format: "PDF", + content: [ "Saved from:", window.location.href, { + image: "reference", + fit: [ 523.28, 769.89 ] // FIT IMAGE TO A4 + } ] + } ] + }, { + format: "PRINT", + label: "Print" + }, "CANCEL" ] + } ] + }, { + format: "PRINT", + label: "Print" + } ] + } ], + fallback: true + }, + + /** + * Returns translated message, takes english as default + */ + i18l: function( key, language ) { + var catalog = AmCharts.translations[ "export" ][ language ] || AmCharts.translations[ "export" ][ "en" ]; + return catalog[ key ] || key; + }, + + /** + * Generates download file; if unsupported offers fallback to save manually + */ + download: function( data, type, filename ) { + // SAVE + if ( window.saveAs && _this.setup.hasBlob ) { + var blob = _this.toBlob( { + data: data, + type: type + }, function( data ) { + saveAs( data, filename ); + } ); + + // FALLBACK TEXTAREA + } else if ( _this.config.fallback && type == "text/plain" ) { + var div = document.createElement( "div" ); + var msg = document.createElement( "div" ); + var textarea = document.createElement( "textarea" ); + + msg.innerHTML = _this.i18l( "fallback.save.text", _this.setup.chart.language ); + + div.appendChild( msg ); + div.appendChild( textarea ); + msg.setAttribute( "class", "amcharts-export-fallback-message" ); + div.setAttribute( "class", "amcharts-export-fallback" ); + _this.setup.chart.containerDiv.appendChild( div ); + + // FULFILL TEXTAREA AND PRESELECT + textarea.setAttribute( "readonly", "" ); + textarea.value = data; + textarea.focus(); + textarea.select(); + + // UPDATE MENU + _this.createMenu( [ { + "class": "export-main export-close", + label: "Done", + click: function() { + _this.createMenu( _this.config.menu ); + _this.setup.chart.containerDiv.removeChild( div ); + } + } ] ); + + // FALLBACK IMAGE + } else if ( _this.config.fallback && type.split( "/" )[ 0 ] == "image" ) { + var div = document.createElement( "div" ); + var msg = document.createElement( "div" ); + var img = _this.toImage( { + data: data + } ); + + msg.innerHTML = _this.i18l( "fallback.save.image", _this.setup.chart.language ); + + // FULFILL TEXTAREA AND PRESELECT + div.appendChild( msg ); + div.appendChild( img ); + msg.setAttribute( "class", "amcharts-export-fallback-message" ); + div.setAttribute( "class", "amcharts-export-fallback" ); + _this.setup.chart.containerDiv.appendChild( div ); + + // UPDATE MENU + _this.createMenu( [ { + "class": "export-main export-close", + label: "Done", + click: function() { + _this.createMenu( _this.config.menu ); + _this.setup.chart.containerDiv.removeChild( div ); + } + } ] ); + + // ERROR + } else { + throw new Error( "Unable to create file. Ensure saveAs (FileSaver.js) is supported." ); + } + return data; + }, + + /** + * Generates script, links tags and places them into the document's head + * In case of reload it replaces the node to force the download + */ + loadResource: function( src, addons ) { + var i1, exist, node, item, check, type; + var url = src.indexOf( "//" ) != -1 ? src : [ _this.libs.path, src ].join( "" ); + + function callback() { + if ( addons ) { + for ( i1 = 0; i1 < addons.length; i1++ ) { + _this.loadResource( addons[ i1 ] ); + } + } + } + + if ( src.indexOf( ".js" ) != -1 ) { + node = document.createElement( "script" ); + node.setAttribute( "type", "text/javascript" ); + node.setAttribute( "src", url ); + if ( _this.libs.async ) { + node.setAttribute( "async", "" ); + } + + } else if ( src.indexOf( ".css" ) != -1 ) { + node = document.createElement( "link" ); + node.setAttribute( "type", "text/css" ); + node.setAttribute( "rel", "stylesheet" ); + node.setAttribute( "href", url ); + } + + for ( i1 = 0; i1 < document.head.childNodes.length; i1++ ) { + item = document.head.childNodes[ i1 ]; + check = item ? ( item.src || item.href ) : false; + type = item ? item.tagName : false; + + if ( item && check && check.indexOf( src ) != -1 ) { + if ( _this.libs.reload ) { + document.head.removeChild( item ); + } + exist = true; + break; + } + } + + if ( !exist || _this.libs.reload ) { + node.addEventListener( "load", callback ); + document.head.appendChild( node ); + } + + }, + + /** + * Walker to generate the script,link tags + */ + loadDependencies: function() { + var i1, i2; + if ( _this.libs.autoLoad ) { + for ( i1 = 0; i1 < _this.libs.resources.length; i1++ ) { + if ( _this.libs.resources[ i1 ] instanceof Object ) { + for ( i2 in _this.libs.resources[ i1 ] ) { + _this.loadResource( i2, _this.libs.resources[ i1 ][ i2 ] ); + } + } else { + _this.loadResource( _this.libs.resources[ i1 ] ); + } + } + } + }, + + /** + * Converts string to number + */ + pxToNumber: function( attr ) { + return Number( String( attr ).replace( "px", "" ) ) || 0; + }, + + /** + * Converts number to string + */ + numberToPx: function( attr ) { + return String( attr ) + "px"; + }, + + /** + * Recursive method to merge the given objects together + * Overwrite flag replaces the value instead to crawl through + */ + deepMerge: function( a, b, overwrite ) { + var i1, v, type = b instanceof Array ? "array" : "object"; + + for ( i1 in b ) { + // PREVENT METHODS + if ( type == "array" && isNaN( i1 ) ) { + continue; + } + + v = b[ i1 ]; + + // NEW + if ( a[ i1 ] == undefined || overwrite ) { + if ( v instanceof Array ) { + a[ i1 ] = new Array(); + } else if ( v instanceof Function ) { + a[ i1 ] = new Function(); + } else if ( v instanceof Date ) { + a[ i1 ] = new Date(); + } else if ( v instanceof Object ) { + a[ i1 ] = new Object(); + } else if ( v instanceof Number ) { + a[ i1 ] = new Number(); + } else if ( v instanceof String ) { + a[ i1 ] = new String(); + } + } + + if ( !( v instanceof Function || v instanceof Date || _this.isElement( v ) ) && ( v instanceof Object || v instanceof Array ) ) { + _this.deepMerge( a[ i1 ], v, overwrite ); + } else { + if ( a instanceof Array && !overwrite ) { + a.push( v ); + } else { + a[ i1 ] = v; + } + } + } + return a; + }, + + /** + * Checks if given argument is a valid node + */ + isElement: function( thingy ) { + return thingy instanceof Object && thingy && thingy.nodeType === 1; + }, + + /** + * Checks if given source is within the current origin + */ + isTainted: function( source ) { + var origin = String( window.location.origin || window.location.protocol + "//" + window.location.hostname + ( window.location.port ? ':' + window.location.port : '' ) ); + + // CHECK IF TAINTED + if ( + source && + source.indexOf( "//" ) != -1 && + source.indexOf( origin.replace( /.*:/, "" ) ) == -1 + ) { + return true; + } + return false; + }, + + /** + * Recursive method which crawls upwards to gather the request attribute + */ + gatherAttribute: function( elm, attr, limit, lvl ) { + var value, lvl = lvl ? lvl : 0, + limit = limit ? limit : 3; + if ( elm ) { + value = elm.getAttribute( attr ); + + if ( !value && lvl < limit ) { + return _this.gatherAttribute( elm.parentNode, attr, limit, lvl + 1 ); + } + } + return value + }, + + /** + * Collects the clip-paths and patterns + */ + gatherElements: function( group, cfg, images ) { + var i1, i2; + for ( i1 = 0; i1 < group.children.length; i1++ ) { + var childNode = group.children[ i1 ]; + + // CLIPPATH + if ( childNode.tagName == "clipPath" ) { + for ( i2 = 0; i2 < childNode.childNodes.length; i2++ ) { + childNode.childNodes[ i2 ].setAttribute( "fill", "transparent" ); + } + group.clippings[ childNode.id ] = childNode; + + // PATTERN + } else if ( childNode.tagName == "pattern" ) { + var props = { + node: childNode, + source: childNode.getAttribute( "xlink:href" ), + width: Number( childNode.getAttribute( "width" ) ), + height: Number( childNode.getAttribute( "height" ) ), + repeat: "repeat" + } + + // GATHER BACKGROUND COLOR + for ( i2 = 0; i2 < childNode.childNodes.length; i2++ ) { + if ( childNode.childNodes[ i2 ].tagName == "rect" ) { + props.fill = childNode.childNodes[ i2 ].getAttribute( "fill" ); + } + } + + // TAINTED + if ( cfg.removeImages && _this.isTainted( props.source ) ) { + group.patterns[ childNode.id ] = props.fill ? props.fill : "transparent"; + } else { + images.included++; + + // LOAD IMAGE MANUALLY; TO RERENDER THE CANVAS + fabric.Image.fromURL( props.source, ( function( props ) { + return function( img ) { + images.loaded++; + + var patternSourceCanvas = new fabric.StaticCanvas( undefined, { + backgroundColor: props.fill + } ); + patternSourceCanvas.add( img ); + + var pattern = new fabric.Pattern( { + source: function() { + patternSourceCanvas.setDimensions( { + width: props.width, + height: props.height + } ); + return patternSourceCanvas.getElement(); + }, + repeat: 'repeat' + } ); + + group.patterns[ props.node.id ] = pattern; + } + } )( props ) ); + } + + // IMAGES + } else if ( childNode.tagName == "image" ) { + images.included++; + + // LOAD IMAGE MANUALLY; TO RERENDER THE CANVAS + fabric.Image.fromURL( childNode.getAttribute( "xlink:href" ), function( img ) { + images.loaded++; + } ); + } + } + return group; + }, + + /** + * Method to capture the current state of the chart + */ + capture: function( options, callback ) { + var i1; + var cfg = _this.deepMerge( _this.deepMerge( {}, _this.config.fabric ), options || {} ); + var groups = []; + var offset = { + x: 0, + y: 0, + width: _this.setup.chart.divRealWidth, + height: _this.setup.chart.divRealHeight + }; + var images = { + loaded: 0, + included: 0 + } + + // GATHER SVGS + var svgs = _this.setup.chart.containerDiv.getElementsByTagName( "svg" ); + for ( i1 = 0; i1 < svgs.length; i1++ ) { + var group = { + svg: svgs[ i1 ], + parent: svgs[ i1 ].parentNode, + children: svgs[ i1 ].getElementsByTagName( "*" ), + offset: { + x: 0, + y: 0 + }, + patterns: {}, + clippings: {} + } + + // GATHER ELEMENTS + group = _this.gatherElements( group, cfg, images ); + + // APPEND GROUP + groups.push( group ); + } + + // GATHER EXTERNAL LEGEND + if ( _this.config.legend && _this.setup.chart.legend && _this.setup.chart.legend.position == "outside" ) { + var group = { + svg: _this.setup.chart.legend.container.container, + parent: _this.setup.chart.legend.container.container.parentNode, + children: _this.setup.chart.legend.container.container.getElementsByTagName( "*" ), + offset: { + x: 0, + y: 0 + }, + legend: { + type: [ "top", "left" ].indexOf( _this.config.legend.position ) != -1 ? "unshift" : "push", + position: _this.config.legend.position, + width: _this.config.legend.width ? _this.config.legend.width : _this.setup.chart.legend.container.width, + height: _this.config.legend.height ? _this.config.legend.height : _this.setup.chart.legend.container.height + }, + patterns: {}, + clippings: {} + } + + // ADAPT CANVAS DIMENSIONS + if ( [ "left", "right" ].indexOf( group.legend.position ) != -1 ) { + offset.width += group.legend.width; + offset.height = group.legend.height > offset.height ? group.legend.height : offset.height; + } else if ( [ "top", "bottom" ].indexOf( group.legend.position ) != -1 ) { + offset.height += group.legend.height; + } + + // GATHER ELEMENTS + group = _this.gatherElements( group, cfg, images ); + + // PRE/APPEND SVG + groups[ group.legend.type ]( group ); + } + + // CLEAR IF EXIST + _this.drawing.enabled = cfg.isDrawingMode = ( cfg.drawing && cfg.drawing.enabled ) ? true : cfg.action == "draw"; + + if ( !_this.setup.wrapper ) { + _this.setup.wrapper = document.createElement( "div" ); + _this.setup.wrapper.setAttribute( "class", _this.setup.chart.classNamePrefix + "-export-canvas" ); + _this.setup.chart.containerDiv.appendChild( _this.setup.wrapper ); + } else { + _this.setup.wrapper.innerHTML = ""; + } + + // STOCK CHART + if ( _this.setup.chart.type == "stock" ) { + var padding = { + top: 0, + right: 0, + bottom: 0, + left: 0 + } + if ( _this.setup.chart.leftContainer ) { + offset.width -= _this.setup.chart.leftContainer.offsetWidth; + padding.left = _this.setup.chart.leftContainer.offsetWidth + ( _this.setup.chart.panelsSettings.panelSpacing * 2 ); + } + if ( _this.setup.chart.rightContainer ) { + offset.width -= _this.setup.chart.rightContainer.offsetWidth; + padding.right = _this.setup.chart.rightContainer.offsetWidth + ( _this.setup.chart.panelsSettings.panelSpacing * 2 ); + } + if ( _this.setup.chart.periodSelector && [ "top", "bottom" ].indexOf( _this.setup.chart.periodSelector.position ) != -1 ) { + offset.height -= _this.setup.chart.periodSelector.offsetHeight + _this.setup.chart.panelsSettings.panelSpacing; + padding[ _this.setup.chart.periodSelector.position ] += _this.setup.chart.periodSelector.offsetHeight + _this.setup.chart.panelsSettings.panelSpacing; + } + if ( _this.setup.chart.dataSetSelector && [ "top", "bottom" ].indexOf( _this.setup.chart.dataSetSelector.position ) != -1 ) { + offset.height -= _this.setup.chart.dataSetSelector.offsetHeight; + padding[ _this.setup.chart.dataSetSelector.position ] += _this.setup.chart.dataSetSelector.offsetHeight; + } + // APPLY OFFSET ON WRAPPER + _this.setup.wrapper.style.paddingTop = _this.numberToPx( padding.top ); + _this.setup.wrapper.style.paddingRight = _this.numberToPx( padding.right ); + _this.setup.wrapper.style.paddingBottom = _this.numberToPx( padding.bottom ); + _this.setup.wrapper.style.paddingLeft = _this.numberToPx( padding.left ); + } + + // CREATE CANVAS + _this.setup.canvas = document.createElement( "canvas" ); + _this.setup.wrapper.appendChild( _this.setup.canvas ); + _this.setup.fabric = new fabric.Canvas( _this.setup.canvas, _this.deepMerge( { + width: offset.width, + height: offset.height + }, cfg ) ); + + // REAPPLY FOR SOME REASON + _this.deepMerge( _this.setup.fabric, cfg ); + + // OBSERVE OBJECT CREATION + _this.setup.fabric.on( "object:added", function( e ) { + var item = e.target; + var state = JSON.stringify( item.originalState ); + if ( item.selectable && !item.known ) { + _this.drawing.undos.push( { + action: "added", + target: item, + options: state + } ); + _this.drawing.redos = []; + } + } ); + + // OBSERVE OBJECT MODIFICATIONS + _this.setup.fabric.on( "object:modified", function( e ) { + var item = e.target; + var state = JSON.stringify( item.saveState().originalState ); + if ( item.selectable ) { + _this.drawing.undos.push( { + action: "modified", + target: item, + options: state + } ); + } + } ); + + // DRAWING + if ( _this.drawing.enabled ) { + _this.setup.wrapper.setAttribute( "class", _this.setup.chart.classNamePrefix + "-export-canvas active" ); + _this.setup.wrapper.style.backgroundColor = cfg.backgroundColor; + } else { + _this.setup.wrapper.setAttribute( "class", _this.setup.chart.classNamePrefix + "-export-canvas" ); + } + + for ( i1 = 0; i1 < groups.length; i1++ ) { + var group = groups[ i1 ]; + + // GATHER POSITION + if ( group.parent.style.top || group.parent.style.left ) { + group.offset.y = _this.pxToNumber( group.parent.style.top ); + group.offset.x = _this.pxToNumber( group.parent.style.left ); + } else { + // EXTERNAL LEGEND + if ( group.legend ) { + if ( group.legend.position == "left" ) { + offset.x += group.legend.width; + } else if ( group.legend.position == "right" ) { + group.offset.x += offset.width - group.legend.width; + } else if ( group.legend.position == "top" ) { + offset.y += group.legend.height; + } else if ( group.legend.position == "bottom" ) { + group.offset.y += offset.height - group.legend.height; // OFFSET.Y + } + + // NORMAL + } else { + group.offset.x = offset.x; + group.offset.y = offset.y; + offset.y += _this.pxToNumber( group.parent.style.height ); + } + + // PANEL + if ( group.parent && ( group.parent.getAttribute( "class" ) || "" ).split( " " ).indexOf( "amChartsLegend" ) != -1 ) { + offset.y += _this.pxToNumber( group.parent.parentNode.parentNode.style.marginTop ); + group.offset.y += _this.pxToNumber( group.parent.parentNode.parentNode.style.marginTop ); + } + } + + // BEFORE CAPTURING + _this.handleCallback( cfg.beforeCapture, cfg ); + + // ADD TO CANVAS + fabric.parseSVGDocument( group.svg, ( function( group ) { + return function( objects, options ) { + var i1; + var g = fabric.util.groupSVGElements( objects, options ); + var tmp = { + top: group.offset.y, + left: group.offset.x, + selectable: false + }; + + for ( i1 = 0; i1 < g.paths.length; i1++ ) { + + // OPACITY; TODO: DISTINGUISH OPACITY TYPES + if ( g.paths[ i1 ] ) { + + // CHECK ORIGIN; REMOVE TAINTED + if ( cfg.removeImages && _this.isTainted( g.paths[ i1 ][ "xlink:href" ] ) ) { + g.paths.splice( i1, 1 ); + continue; + } + + // SET OPACITY + if ( g.paths[ i1 ].fill instanceof Object ) { + + // MISINTERPRETATION OF FABRIC + if ( g.paths[ i1 ].fill.type == "radial" ) { + g.paths[ i1 ].fill.coords.r2 = g.paths[ i1 ].fill.coords.r1 * -1; + g.paths[ i1 ].fill.coords.r1 = 0; + } + + g.paths[ i1 ].set( { + opacity: g.paths[ i1 ].fillOpacity + } ); + + // PATTERN; TODO: DISTINGUISH OPACITY TYPES + } else if ( String( g.paths[ i1 ].fill ).slice( 0, 3 ) == "url" ) { + var PID = g.paths[ i1 ].fill.slice( 5, -1 ); + if ( group.patterns && group.patterns[ PID ] ) { + g.paths[ i1 ].set( { + fill: group.patterns[ PID ], + opacity: g.paths[ i1 ].fillOpacity + } ); + } + } + + // CLIPPATH; + if ( String( g.paths[ i1 ].clipPath ).slice( 0, 3 ) == "url" ) { + var PID = g.paths[ i1 ].clipPath.slice( 5, -1 ); + + if ( group.clippings[ PID ] ) { + var mask = group.clippings[ PID ].childNodes[ 0 ]; + var transform = g.paths[ i1 ].svg.getAttribute( "transform" ) || "translate(0,0)"; + + transform = transform.slice( 10, -1 ).split( "," ); + + g.paths[ i1 ].set( { + clipTo: ( function( mask, transform ) { + return function( ctx ) { + var width = Number( mask.getAttribute( "width" ) || "0" ); + var height = Number( mask.getAttribute( "height" ) || "0" ); + var x = Number( mask.getAttribute( "x" ) || "0" ); + var y = Number( mask.getAttribute( "y" ) || "0" ); + + ctx.rect( Number( transform[ 0 ] ) * -1 + x, Number( transform[ 1 ] ) * -1 + y, width, height ); + } + } )( mask, transform ) + } ); + } + } + + // TODO; WAIT FOR TSPAN SUPPORT FROM FABRICJS SIDE + if ( g.paths[ i1 ].originalBBox ) { + var bb = g.paths[ i1 ].originalBBox; + if ( g.paths[ i1 ].textAlign == "left" ) { + g.paths[ i1 ].set( { + left: bb.left + ( g.paths[ i1 ].width / 2 ) + } ); + } else { + g.paths[ i1 ].set( { + left: bb.left - ( g.paths[ i1 ].width / 2 ) + } ); + } + } + } + } + + g.set( tmp ); + + _this.setup.fabric.add( g ); + + // ADD BALLOONS + if ( group.svg.parentNode && group.svg.parentNode.getElementsByTagName ) { + var balloons = group.svg.parentNode.getElementsByClassName( _this.setup.chart.classNamePrefix + "-balloon-div" ); + for ( i1 = 0; i1 < balloons.length; i1++ ) { + if ( cfg.balloonFunction instanceof Function ) { + cfg.balloonFunction.apply( _this, [ balloons[ i1 ], group ] ); + } else { + var parent = balloons[ i1 ]; + var text = parent.childNodes[ 0 ]; + var label = new fabric.Text( text.innerText || text.innerHTML, { + fontSize: _this.pxToNumber( text.style.fontSize ), + fontFamily: text.style.fontFamily, + fill: text.style.color, + top: _this.pxToNumber( parent.style.top ) + group.offset.y, + left: _this.pxToNumber( parent.style.left ) + group.offset.x, + selectable: false + } ); + + _this.setup.fabric.add( label ); + } + } + } + if ( group.svg.nextSibling && group.svg.nextSibling.tagName == "A" ) { + var label = new fabric.Text( group.svg.nextSibling.innerText || group.svg.nextSibling.innerHTML, { + fontSize: _this.pxToNumber( group.svg.nextSibling.style.fontSize ), + fontFamily: group.svg.nextSibling.style.fontFamily, + fill: group.svg.nextSibling.style.color, + top: _this.pxToNumber( group.svg.nextSibling.style.top ) + group.offset.y, + left: _this.pxToNumber( group.svg.nextSibling.style.left ) + group.offset.x + } ); + _this.setup.fabric.add( label ); + } + + groups.pop(); + + // TRIGGER CALLBACK WITH SAFETY DELAY + if ( !groups.length ) { + var timer = setInterval( function() { + if ( images.loaded == images.included ) { + clearTimeout( timer ); + _this.handleCallback( cfg.afterCapture, cfg ); + _this.setup.fabric.renderAll(); + _this.handleCallback( callback, cfg ); + } + }, AmCharts.updateRate ); + } + } + + // IDENTIFY ELEMENTS THROUGH CLASSNAMES + } )( group ), function( svg, obj ) { + var i1; + var className = _this.gatherAttribute( svg, "class" ); + var visibility = _this.gatherAttribute( svg, "visibility" ); + var clipPath = _this.gatherAttribute( svg, "clip-path" ); + + obj.className = className; + obj.clipPath = clipPath; + obj.svg = svg; + + // TODO; WAIT FOR TSPAN SUPPORT FROM FABRICJS SIDE + if ( svg.tagName == "text" && svg.childNodes.length > 1 ) { + var lines = []; + var textAnchor = svg.getAttribute( "text-anchor" ) || "left"; + var anchorMap = { + "start": "left", + "middle": "center", + "end": "right" + } + + for ( i1 = 0; i1 < svg.childNodes.length; i1++ ) { + lines.push( svg.childNodes[ i1 ].textContent ); + } + + if ( obj.className == _this.setup.chart.classNamePrefix + "-label" ) { + obj.originalBBox = obj.getBoundingRect() + } + obj.set( { + top: obj.top + ( ( obj.height / 2 ) * ( lines.length - 1 ) ), + text: lines.join( "\n" ), + textAlign: anchorMap[ textAnchor ] + } ); + } + + // HIDE HIDDEN ELEMENTS; TODO: FIND A BETTER WAY TO HANDLE THAT + if ( visibility == "hidden" ) { + obj.opacity = 0; + + // WALKTHROUGH ELEMENTS + } else { + + // TRANSPORT FILL/STROKE OPACITY + var attrs = [ "fill", "stroke" ]; + for ( i1 = 0; i1 < attrs.length; i1++ ) { + var attr = attrs[ i1 ] + var attrVal = String( svg.getAttribute( attr ) || "" ); + var attrOpacity = Number( svg.getAttribute( attr + "-opacity" ) || "1" ); + var attrRGBA = fabric.Color.fromHex( attrVal ).getSource(); + + // EXCEPTION + if ( obj.className == _this.setup.chart.classNamePrefix + "-guide-fill" && !attrVal ) { + attrOpacity = 0; + attrRGBA = fabric.Color.fromHex( "#000000" ).getSource(); + } + + if ( attrRGBA ) { + attrRGBA.pop(); + attrRGBA.push( attrOpacity ) + obj[ attr ] = "rgba(" + attrRGBA.join() + ")"; + obj[ _this.capitalize( attr + "-opacity" ) ] = attrOpacity; + } + } + } + + // REVIVER + _this.handleCallback(cfg.reviver, obj, svg); + } ); + } + }, + + /** + * Returns the current canvas + */ + toCanvas: function( options, callback ) { + var cfg = _this.deepMerge( { + // NUFFIN + }, options || {} ); + var data = _this.setup.canvas; + + _this.handleCallback( callback, data ); + + return data; + }, + + /** + * Returns an image; by default PNG + */ + toImage: function( options, callback ) { + var cfg = _this.deepMerge( { + format: "png", + quality: 1, + multiplier: 1 + }, options || {} ); + var data = cfg.data; + var img = document.createElement( "img" ); + + if ( !cfg.data ) { + if ( cfg.lossless || cfg.format == "svg" ) { + data = _this.toSVG( _this.deepMerge( cfg, { + getBase64: true + } ) ); + } else { + data = _this.setup.fabric.toDataURL( cfg ); + } + } + + img.setAttribute( "src", data ); + + _this.handleCallback( callback, img ); + + return img; + }, + + /** + * Generates a blob instance image; returns base64 datastring + */ + toBlob: function( options, callback ) { + var cfg = _this.deepMerge( { + data: "empty", + type: "text/plain" + }, options || {} ); + var isBase64 = /^data:.+;base64,(.*)$/.exec( cfg.data ); + + // GATHER BODY + if ( isBase64 ) { + cfg.data = isBase64[ 0 ]; + cfg.type = cfg.data.slice( 5, cfg.data.indexOf( "," ) - 7 ); + cfg.data = _this.toByteArray( { + data: cfg.data.slice( cfg.data.indexOf( "," ) + 1, cfg.data.length ) + } ); + } + + if ( cfg.getByteArray ) { + data = cfg.data; + } else { + data = new Blob( [ cfg.data ], { + type: cfg.type + } ); + } + + _this.handleCallback( callback, data ); + + return data; + }, + + /** + * Generates JPG image; returns base64 datastring + */ + toJPG: function( options, callback ) { + var cfg = _this.deepMerge( { + format: "jpeg", + quality: 1, + multiplier: 1 + }, options || {} ); + var data = _this.setup.fabric.toDataURL( cfg ); + + _this.handleCallback( callback, data ); + + return data; + }, + + /** + * Generates PNG image; returns base64 datastring + */ + toPNG: function( options, callback ) { + var cfg = _this.deepMerge( { + format: "png", + quality: 1, + multiplier: 1 + }, options || {} ); + var data = _this.setup.fabric.toDataURL( cfg ); + + _this.handleCallback( callback, data ); + + return data; + }, + + /** + * Generates SVG image; returns base64 datastring + */ + toSVG: function( options, callback ) { + var cfg = _this.deepMerge( { + // NOTHING IN HERE + }, options || {} ); + var data = _this.setup.fabric.toSVG( cfg ); + + if ( cfg.getBase64 ) { + data = "data:image/svg+xml;base64," + btoa( data ); + } + + _this.handleCallback( callback, data ); + + return data; + }, + + /** + * Generates PDF; returns base64 datastring + */ + toPDF: function( options, callback ) { + var cfg = _this.deepMerge( _this.deepMerge( { + multiplier: 2 + }, _this.config.pdfMake ), options || {}, true ); + cfg.images.reference = _this.toPNG( cfg ); + var data = new pdfMake.createPdf( cfg ); + + if ( callback ) { + data.getDataUrl( ( function( callback ) { + return function() { + callback.apply( _this, arguments ); + } + } )( callback ) ); + } + + return data; + }, + + /** + * Generates an image; hides all elements on page to trigger native print method + */ + toPRINT: function( options, callback ) { + var i1; + var cfg = _this.deepMerge( { + delay: 1, + lossless: false + }, options || {} ); + var data = _this.toImage( cfg ); + var states = []; + var items = document.body.childNodes; + + data.setAttribute( "style", "width: 100%; max-height: 100%;" ); + + for ( i1 = 0; i1 < items.length; i1++ ) { + if ( _this.isElement( items[ i1 ] ) ) { + states[ i1 ] = items[ i1 ].style.display; + items[ i1 ].style.display = "none"; + } + } + + document.body.appendChild( data ); + window.print(); + + setTimeout( function() { + for ( i1 = 0; i1 < items.length; i1++ ) { + if ( _this.isElement( items[ i1 ] ) ) { + items[ i1 ].style.display = states[ i1 ]; + } + } + document.body.removeChild( data ); + _this.handleCallback( callback, data ); + }, cfg.delay ); + + return data; + }, + + /** + * Generates JSON string + */ + toJSON: function( options, callback ) { + var cfg = _this.deepMerge( { + data: _this.getChartData() + }, options || {}, true ); + var data = JSON.stringify( cfg.data, undefined, "\t" ); + + _this.handleCallback( callback, data ); + + return data; + }, + + /** + * Generates CSV string + */ + toCSV: function( options, callback ) { + var row, col; + var cfg = _this.deepMerge( { + data: _this.getChartData(), + delimiter: ",", + quotes: true, + escape: true, + dateFields: [], + dateFormat: _this.setup.chart.dataDateFormat || "YYYY-MM-DD" + }, options || {}, true ); + var data = ""; + var cols = []; + var buffer = []; + + if ( _this.setup.chart.categoryAxis && _this.setup.chart.categoryAxis.parseDates && _this.setup.chart.categoryField ) { + cfg.dateFields.push( _this.setup.chart.categoryField ); + } + + function enchant( value, column ) { + + // STRING + if ( typeof value === "string" ) { + value = value; + + // DATE FORMAT + } else if ( column && cfg.dateFormat && value instanceof Date && cfg.dateFields.indexOf( column ) != -1 ) { + value = AmCharts.formatDate( value, cfg.dateFormat ); + } + + // WRAP IN QUOTES + if ( typeof value === "string" ) { + if ( cfg.escape ) { + value = value.replace( '"', '""' ); + } + if ( cfg.quotes ) { + value = [ '"', value, '"' ].join( "" ); + } + } + + return value; + } + + // HEADER + for ( value in cfg.data[ 0 ] ) { + buffer.push( enchant( value ) ); + cols.push( value ); + } + data += buffer.join( cfg.delimiter ) + "\n"; + + // BODY + for ( row in cfg.data ) { + buffer = []; + if ( !isNaN( row ) ) { + for ( col in cols ) { + if ( !isNaN( col ) ) { + var column = cols[ col ]; + var value = cfg.data[ row ][ column ]; + + buffer.push( enchant( value, column ) ); + } + } + data += buffer.join( cfg.delimiter ) + "\n"; + } + } + + _this.handleCallback( callback, data ); + + return data; + }, + + /** + * Generates excel sheet; returns base64 datastring + */ + toXLSX: function( options, callback ) { + var cfg = _this.deepMerge( { + data: _this.getChartData(), + name: "amCharts", + withHeader: true + }, options || {}, true ); + var data = ""; + var wb = { + SheetNames: [], + Sheets: {} + } + + function datenum( v, date1904 ) { + if ( date1904 ) v += 1462; + var epoch = Date.parse( v ); + return ( epoch - new Date( Date.UTC( 1899, 11, 30 ) ) ) / ( 24 * 60 * 60 * 1000 ); + } + + function sheet_from_array_of_arrays( data, opts ) { + var ws = {}; + var range = { + s: { + c: 10000000, + r: 10000000 + }, + e: { + c: 0, + r: 0 + } + }; + for ( var R = 0; R != data.length; ++R ) { + for ( var C = 0; C != data[ R ].length; ++C ) { + if ( range.s.r > R ) range.s.r = R; + if ( range.s.c > C ) range.s.c = C; + if ( range.e.r < R ) range.e.r = R; + if ( range.e.c < C ) range.e.c = C; + var cell = { + v: data[ R ][ C ] + }; + if ( cell.v == null ) continue; + var cell_ref = XLSX.utils.encode_cell( { + c: C, + r: R + } ); + + if ( typeof cell.v === "number" ) cell.t = "n"; + else if ( typeof cell.v === "boolean" ) cell.t = "b"; + else if ( cell.v instanceof Date ) { + cell.t = "n"; + cell.z = XLSX.SSF._table[ 14 ]; + cell.v = datenum( cell.v ); + } else cell.t = "s"; + + ws[ cell_ref ] = cell; + } + } + if ( range.s.c < 10000000 ) ws[ "!ref" ] = XLSX.utils.encode_range( range ); + return ws; + } + + wb.SheetNames.push( cfg.name ); + wb.Sheets[ cfg.name ] = sheet_from_array_of_arrays( _this.toArray( cfg ) ); + + data = XLSX.write( wb, { + bookType: "xlsx", + bookSST: true, + type: "base64" + } ); + + data = "data:application/vnd.openxmlformats-officedocument.spreadsheetml.sheet;base64," + data; + + _this.handleCallback( callback, data ); + + return data; + }, + + /** + * Generates an array of arrays + */ + toArray: function( options, callback ) { + var row, col; + var cfg = _this.deepMerge( { + data: _this.getChartData(), + dateFields: [], + dateFormat: false, + withHeader: false + }, options || {}, true ); + var data = []; + var cols = []; + + // HEADER + if ( cfg.withHeader ) { + for ( col in cfg.data[ 0 ] ) { + cols.push( col ); + } + data.push( cols ); + } + + // BODY + for ( row in cfg.data ) { + var buffer = []; + if ( !isNaN( row ) ) { + for ( col in cols ) { + var col = cols[ col ]; + var value = cfg.data[ row ][ col ] || ""; + + if ( cfg.dateFormat && value instanceof Date && cfg.dateFields.indexOf( col ) != -1 ) { + value = AmCharts.formatDate( value, cfg.dateFormat ); + } else { + value = String( value ) + } + + buffer.push( value ); + } + data.push( buffer ); + } + } + + _this.handleCallback( callback, data ); + + return data; + }, + + /** + * Generates byte array with given base64 datastring; returns byte array + */ + toByteArray: function( options, callback ) { + var cfg = _this.deepMerge( { + // NUFFIN + }, options || {} ); + var Arr = ( typeof Uint8Array !== 'undefined' ) ? Uint8Array : Array + var PLUS = '+'.charCodeAt( 0 ) + var SLASH = '/'.charCodeAt( 0 ) + var NUMBER = '0'.charCodeAt( 0 ) + var LOWER = 'a'.charCodeAt( 0 ) + var UPPER = 'A'.charCodeAt( 0 ) + var data = b64ToByteArray( cfg.data ); + + function decode( elt ) { + var code = elt.charCodeAt( 0 ) + if ( code === PLUS ) + return 62 // '+' + if ( code === SLASH ) + return 63 // '/' + if ( code < NUMBER ) + return -1 //no match + if ( code < NUMBER + 10 ) + return code - NUMBER + 26 + 26 + if ( code < UPPER + 26 ) + return code - UPPER + if ( code < LOWER + 26 ) + return code - LOWER + 26 + } + + function b64ToByteArray( b64 ) { + var i, j, l, tmp, placeHolders, arr + + if ( b64.length % 4 > 0 ) { + throw new Error( 'Invalid string. Length must be a multiple of 4' ) + } + + // THE NUMBER OF EQUAL SIGNS (PLACE HOLDERS) + // IF THERE ARE TWO PLACEHOLDERS, THAN THE TWO CHARACTERS BEFORE IT + // REPRESENT ONE BYTE + // IF THERE IS ONLY ONE, THEN THE THREE CHARACTERS BEFORE IT REPRESENT 2 BYTES + // THIS IS JUST A CHEAP HACK TO NOT DO INDEXOF TWICE + var len = b64.length + placeHolders = '=' === b64.charAt( len - 2 ) ? 2 : '=' === b64.charAt( len - 1 ) ? 1 : 0 + + // BASE64 IS 4/3 + UP TO TWO CHARACTERS OF THE ORIGINAL DATA + arr = new Arr( b64.length * 3 / 4 - placeHolders ) + + // IF THERE ARE PLACEHOLDERS, ONLY GET UP TO THE LAST COMPLETE 4 CHARS + l = placeHolders > 0 ? b64.length - 4 : b64.length + + var L = 0 + + function push( v ) { + arr[ L++ ] = v + } + + for ( i = 0, j = 0; i < l; i += 4, j += 3 ) { + tmp = ( decode( b64.charAt( i ) ) << 18 ) | ( decode( b64.charAt( i + 1 ) ) << 12 ) | ( decode( b64.charAt( i + 2 ) ) << 6 ) | decode( b64.charAt( i + 3 ) ) + push( ( tmp & 0xFF0000 ) >> 16 ) + push( ( tmp & 0xFF00 ) >> 8 ) + push( tmp & 0xFF ) + } + + if ( placeHolders === 2 ) { + tmp = ( decode( b64.charAt( i ) ) << 2 ) | ( decode( b64.charAt( i + 1 ) ) >> 4 ) + push( tmp & 0xFF ) + } else if ( placeHolders === 1 ) { + tmp = ( decode( b64.charAt( i ) ) << 10 ) | ( decode( b64.charAt( i + 1 ) ) << 4 ) | ( decode( b64.charAt( i + 2 ) ) >> 2 ) + push( ( tmp >> 8 ) & 0xFF ) + push( tmp & 0xFF ) + } + + return arr + } + + _this.handleCallback( callback, data ); + + return data; + }, + + /** + * Callback handler; injects additional arguments to callback + */ + handleCallback: function( callback ) { + var i1, data = Array(); + if ( callback && callback instanceof Function ) { + for ( i1 = 0; i1 < arguments.length; i1++ ) { + if ( i1 > 0 ) { + data.push(arguments[i1]); + } + } + callback.apply( _this, data ); + } + }, + + /** + * Gathers chart data according to its type + */ + getChartData: function() { + var i1, i2, i3; + var data = []; + + if ( _this.setup.chart.type == "stock" ) { + data = _this.setup.chart.mainDataSet.dataProvider; + } else if ( _this.setup.chart.type == "gantt" ) { + var segmentsField = _this.setup.chart.segmentsField; + for ( i1 = 0; i1 < _this.setup.chart.dataProvider.length; i1++ ) { + if ( _this.setup.chart.dataProvider[ i1 ][ segmentsField ] ) { + for ( i2 = 0; i2 < _this.setup.chart.dataProvider[ i1 ][ segmentsField ].length; i2++ ) { + data.push( _this.setup.chart.dataProvider[ i1 ][ segmentsField ][ i2 ] ) + } + } + } + } else { + data = _this.setup.chart.dataProvider; + } + + return data; + }, + + /** + * Prettifies string + */ + capitalize: function( string ) { + return string.charAt( 0 ).toUpperCase() + string.slice( 1 ).toLowerCase(); + }, + + /** + * Generates export menu; returns UL node + */ + createMenu: function( list, container ) { + var div; + + function buildList( list, container ) { + var i1, ul = document.createElement( "ul" ); + for ( i1 = 0; i1 < list.length; i1++ ) { + var item = typeof list[ i1 ] === "string" ? { + format: list[ i1 ] + } : list[ i1 ]; + var li = document.createElement( "li" ); + var a = document.createElement( "a" ); + var img = document.createElement( "img" ); + var span = document.createElement( "span" ); + var action = String( item.action ? item.action : item.format ).toLowerCase(); + + item.format = String( item.format ).toUpperCase(); + + // MERGE WITH GIVEN FORMAT + if ( _this.config.formats[ item.format ] ) { + item = _this.deepMerge( { + label: item.icon ? "" : item.format, + format: item.format, + mimeType: _this.config.formats[ item.format ].mimeType, + extension: _this.config.formats[ item.format ].extension, + capture: _this.config.formats[ item.format ].capture, + action: _this.config.action, + fileName: _this.config.fileName + }, item ); + } else if ( !item.menu && !item.items ) { + item.label = item.label ? item.label : _this.capitalize( action ); + } + + // FILTER; TOGGLE FLAG + if ( [ "CSV", "JSON", "XLSX" ].indexOf( item.format ) != -1 && [ "map", "gauge" ].indexOf( _this.setup.chart.type ) != -1 ) { + continue; + + // BLOB EXCEPTION + } else if ( !_this.setup.hasBlob && item.format != "UNDEFINED" ) { + if ( item.mimeType && item.mimeType.split( "/" )[ 0 ] != "image" && item.mimeType != "text/plain" ) { + continue; + } + } + + // ADD CLICK HANDLER + if ( !item.click && !item.menu && !item.items ) { + + // DRAWING METHODS + if ( _this.drawing.actions.indexOf( action ) != -1 ) { + item.action = action; + item.click = ( function( item ) { + return function() { + this.drawing[ item.action ](); + } + } )( item ); + + // DRAWING + } else if ( _this.drawing.enabled ) { + item.click = ( function( item ) { + return function() { + this[ "to" + item.format ]( item, function( data ) { + this.drawing.done(); + if ( item.action != "print" && item.format != "PRINT" ) { + this.download( data, item.mimeType, [ item.fileName, item.extension ].join( "." ) ); + } + } ); + } + } )( item ); + + // REGULAR + } else if ( item.format != "UNDEFINED" ) { + item.click = ( function( item ) { + return function() { + if ( item.capture || ( item.action == "print" || item.format == "PRINT" ) ) { + this.capture( item, function() { + this[ "to" + item.format ]( item, function( data ) { + if ( item.action == "download" ) { + this.download( data, item.mimeType, [ item.fileName, item.extension ].join( "." ) ); + } + } ); + } ) + + } else if ( this[ "to" + item.format ] ) { + this[ "to" + item.format ]( item, function( data ) { + this.download( data, item.mimeType, [ item.fileName, item.extension ].join( "." ) ); + } ); + } else { + throw new Error( 'Invalid format. Could not determine output type.' ); + } + } + } )( item ); + } + // DRAWING + } else if ( item.action == "draw" ) { + item.click = ( function( item ) { + return function() { + this.capture( item, function() { + this.createMenu( item.menu ); + } ); + } + } )( item ); + } + + // ADD LINK ATTR + a.setAttribute( "href", "#" ); + a.addEventListener( "click", ( function( callback, item ) { + return function( e ) { + e.preventDefault(); + + // DELAYED + item.delay = item.delay ? item.delay : _this.config.delay; + if ( item.delay ) { + _this.delay( item, callback ); + return; + } + callback.apply( _this, arguments ); + } + } )( item.click || function( e ) { + e.preventDefault(); + }, item ) ); + li.appendChild( a ); + + // ADD LABEL + span.innerHTML = item.label; + + // APPEND ITEMS + if ( item[ "class" ] ) { + li.className = item[ "class" ]; + } + if ( item.icon ) { + img.setAttribute( "src", ( item.icon.slice( 0, 10 ).indexOf( "//" ) == -1 ? chart.pathToImages : "" ) + item.icon ); + a.appendChild( img ); + } + if ( item.label ) { + a.appendChild( span ); + } + if ( item.title ) { + a.setAttribute( "title", item.title ); + } + + // CALLBACK; REVIVER FOR MENU ITEMS + if ( _this.config.menuReviver ) { + li = _this.config.menuReviver.apply( _this, [ item, li ] ); + } + + // ADD SUBLIST; JUST WITH ENTRIES + if ( ( item.menu || item.items ) && item.action != "draw" ) { + if ( buildList( item.menu || item.items, li ).childNodes.length ) { + ul.appendChild( li ); + } + } else { + ul.appendChild( li ); + } + } + + // JUST ADD THOSE WITH ENTRIES + return container.appendChild( ul ); + } + + // DETERMINE CONTAINER + if ( !container ) { + if ( typeof _this.config.divId == "string" ) { + _this.config.divId = container = document.getElementById( _this.config.divId ); + } else if ( _this.isElement( _this.config.divId ) ) { + container = _this.config.divId; + } else { + container = _this.setup.chart.containerDiv; + } + } + + // CREATE / RESET MENU CONTAINER + if ( _this.isElement( _this.setup.menu ) ) { + _this.setup.menu.innerHTML = ""; + } else { + _this.setup.menu = document.createElement( "div" ); + } + _this.setup.menu.setAttribute( "class", _this.setup.chart.classNamePrefix + "-export-menu " + _this.setup.chart.classNamePrefix + "-export-menu-" + _this.config.position + " amExportButton" ); + + // CALLBACK; REPLACES THE MENU WALKER + if ( _this.config.menuWalker ) { + buildList = _this.config.menuWalker; + } + buildList.apply( this, [ list, _this.setup.menu ] ); + + container.appendChild( _this.setup.menu ); + + return _this.setup.menu; + }, + + /** + * Method to trigger the callback delayed + */ + delay: function( options, callback ) { + var cfg = _this.deepMerge( { + delay: 3, + precision: 2 + }, options || {} ); + var t1, t2, start = Number( new Date() ); + var menu = _this.createMenu( [ { + label: _this.i18l( "capturing.delayed.menu.label" ).replace( "{{duration}}", AmCharts.toFixed( cfg.delay, cfg.precision ) ), + title: _this.i18l( "capturing.delayed.menu.title" ), + "class": "export-delayed-capturing", + click: function() { + clearTimeout( t1 ); + clearTimeout( t2 ); + _this.createMenu( _this.config.menu ); + } + } ] ); + var label = menu.getElementsByTagName( "a" )[ 0 ]; + + // MENU UPDATE + t1 = setInterval( function() { + var diff = cfg.delay - ( Number( new Date() ) - start ) / 1000; + if ( diff <= 0 ) { + clearTimeout( t1 ); + if ( cfg.action != "draw" ) { + _this.createMenu( _this.config.menu ); + } + } else if ( label ) { + label.innerHTML = _this.i18l( "capturing.delayed.menu.label" ).replace( "{{duration}}", AmCharts.toFixed( diff, 2 ) ); + } + }, 10 ); + + // CALLBACK + t2 = setTimeout( function() { + callback.apply( _this, arguments ); + }, cfg.delay * 1000 ); + }, + + /** + * Migration method to support old export setup + */ + migrateSetup: function( chart ) { + if ( chart.amExport || chart.exportConfig ) { + var config = _this.deepMerge( { + enabled: true, + migrated: true, + libs: { + autoLoad: false + } + }, _this.deepMerge( _this.defaults, { + menu: [] + }, true ) ); + + function crawler( object ) { + var key; + for ( key in object ) { + var value = object[ key ]; + + if ( key.slice( 0, 6 ) == "export" && value ) { + config.menu.push( key.slice( 6 ) ); + } else if ( key == "userCFG" ) { + crawler( value ); + } else if ( key == "menuItems" ) { + config.menu = value; + } else if ( key == "libs" ) { + config.libs = value; + } else if ( typeof key == "string" ) { + config[ key ] = value; + } + } + } + crawler( chart.amExport || chart.exportConfig ); + chart[ "export" ] = config; + } + return chart; + }, + + /** + * Initiate export instance; waits for chart container to place menu + */ + init: function() { + clearTimeout( _this.timer ); + _this.timer = setInterval( function() { + if ( _this.setup.chart.containerDiv ) { + clearTimeout( _this.timer ); + _this.setup.chart.AmExport = _this; + + // WORK AROUND TO BYPASS FILESAVER CHECK TRYING TO OPEN THE BLOB URL IN SAFARI BROWSER + window.safari = window.safari ? window.safari : {}; + + _this.createMenu( _this.config.menu ); + } + }, AmCharts.updateRate ); + } + } + + // EXTEND DRAWING TO SUPPORT "CANCEL" MENU ACTION + _this.drawing.cancel = _this.drawing.done; + + // MIRGRATE + _this.setup.chart = _this.migrateSetup( chart ); + + // ENABLED-I-O? + if ( undefined === _this.setup.chart[ "export" ] || !_this.setup.chart[ "export" ].enabled ) { + return; + } + + // CHECK BLOB CONSTRUCTOR + try { + _this.setup.hasBlob = !!new Blob; + } catch ( e ) {} + + // MERGE SETTINGS + _this.deepMerge( _this.libs, _this.setup.chart[ "export" ].libs || {}, true ); + _this.deepMerge( _this.defaults.pdfMake, _this.setup.chart[ "export" ] ); + _this.deepMerge( _this.defaults.fabric, _this.setup.chart[ "export" ] ); + _this.config = _this.deepMerge( _this.defaults, _this.setup.chart[ "export" ], true ); + + // SUPPORT IE ONLY IF WE'VE ACCESS TO THE HEAD + if ( AmCharts.isIE && AmCharts.IEversion <= 9 ) { + if ( !document.head || _this.config.fallback === false ) { + return; + } + } + + // REPLACE CONFIG WITH INSTANCE; ENABLE ADDCLASSNAMES + _this.setup.chart[ "export" ] = _this; + _this.setup.chart.addClassNames = true; + + // LOAD DEPENDENCIES + _this.loadDependencies( _this.libs.resources, _this.libs.reload ); + + // INIT + _this.init(); + +}, [ "pie", "serial", "xy", "funnel", "radar", "gauge", "stock", "map", "gantt" ] ); \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/export.min.js b/ResoursesManager/ResoursesManager/amcharts/plugins/export/export.min.js new file mode 100644 index 0000000..90760cf --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/export.min.js @@ -0,0 +1 @@ +AmCharts.translations["export"]||(AmCharts.translations["export"]={}),AmCharts.translations["export"].en||(AmCharts.translations["export"].en={"fallback.save.text":"CTRL + C to copy the data into the clipboard.","fallback.save.image":"Rightclick -> Save picture as... to save the image.","capturing.delayed.menu.label":"{{duration}}","capturing.delayed.menu.title":"Click to cancel"}),AmCharts.addInitHandler(function(a){var b={name:"export",version:"1.1.8",libs:{async:!0,autoLoad:!0,reload:!1,path:(a.path||"")+"plugins/export/libs/",resources:[{"pdfmake/pdfmake.js":["pdfmake/vfs_fonts.js"],"jszip/jszip.js":["xlsx/xlsx.js"]},"fabric.js/fabric.js","FileSaver.js/FileSaver.js"]},config:{},setup:{hasBlob:!1},drawing:{enabled:!1,actions:["undo","redo","done","cancel"],undos:[],undo:function(){var a=b.drawing.undos.pop();a&&(b.drawing.redos.push(a),"added"==a.action&&(a.target.known=!0,b.setup.fabric.remove(a.target)),a.target.setOptions(JSON.parse(a.options)),b.setup.fabric.renderAll())},redos:[],redo:function(){var a=b.drawing.redos.pop();a&&(b.drawing.undos.push(a),"added"==a.action&&(a.target.known=!0,b.setup.fabric.add(a.target)),a.target.setOptions(JSON.parse(a.options)),b.setup.fabric.renderAll())},done:function(){b.drawing.enabled=!1,b.drawing.undos=[],b.drawing.redos=[],b.createMenu(b.config.menu),b.setup.wrapper.setAttribute("class",b.setup.chart.classNamePrefix+"-export-canvas")}},defaults:{position:"top-right",fileName:"amCharts",action:"download",formats:{JPG:{mimeType:"image/jpg",extension:"jpg",capture:!0},PNG:{mimeType:"image/png",extension:"png",capture:!0},SVG:{mimeType:"text/xml",extension:"svg",capture:!0},PDF:{mimeType:"application/pdf",extension:"pdf",capture:!0},CSV:{mimeType:"text/plain",extension:"csv"},JSON:{mimeType:"text/plain",extension:"json"},XLSX:{mimeType:"application/octet-stream",extension:"xlsx"}},fabric:{backgroundColor:"#FFFFFF",isDrawingMode:!1,selection:!1,removeImages:!0},pdfMake:{pageSize:"A4",pageOrientation:"portrait",images:{},content:[{image:"reference",fit:[523.28,769.89]}]},divId:null,menuReviver:null,menuWalker:null,menu:[{"class":"export-main",label:"Export",menu:[{label:"Download as ...",menu:["PNG","JPG","SVG",{format:"PDF",content:["Saved from:",window.location.href,{image:"reference",fit:[523.28,769.89]}]}]},{label:"Save data ...",menu:["CSV","XLSX","JSON"]},{label:"Annotate",action:"draw",menu:[{"class":"export-drawing",menu:[{label:"Color ...",menu:[{"class":"export-drawing-color export-drawing-color-black",label:"Black",click:function(){this.setup.fabric.freeDrawingBrush.color="#000"}},{"class":"export-drawing-color export-drawing-color-white",label:"White",click:function(){this.setup.fabric.freeDrawingBrush.color="#fff"}},{"class":"export-drawing-color export-drawing-color-red",label:"Red",click:function(){this.setup.fabric.freeDrawingBrush.color="#f00"}},{"class":"export-drawing-color export-drawing-color-green",label:"Green",click:function(){this.setup.fabric.freeDrawingBrush.color="#0f0"}},{"class":"export-drawing-color export-drawing-color-blue",label:"Blue",click:function(){this.setup.fabric.freeDrawingBrush.color="#00f"}}]},"UNDO","REDO",{label:"Save as ...",menu:["PNG","JPG","SVG",{format:"PDF",content:["Saved from:",window.location.href,{image:"reference",fit:[523.28,769.89]}]}]},{format:"PRINT",label:"Print"},"CANCEL"]}]},{format:"PRINT",label:"Print"}]}],fallback:!0},i18l:function(a,b){var c=AmCharts.translations["export"][b]||AmCharts.translations["export"].en;return c[a]||a},download:function(a,c,d){if(window.saveAs&&b.setup.hasBlob)b.toBlob({data:a,type:c},function(a){saveAs(a,d)});else if(b.config.fallback&&"text/plain"==c){var f=document.createElement("div"),g=document.createElement("div"),h=document.createElement("textarea");g.innerHTML=b.i18l("fallback.save.text",b.setup.chart.language),f.appendChild(g),f.appendChild(h),g.setAttribute("class","amcharts-export-fallback-message"),f.setAttribute("class","amcharts-export-fallback"),b.setup.chart.containerDiv.appendChild(f),h.setAttribute("readonly",""),h.value=a,h.focus(),h.select(),b.createMenu([{"class":"export-main export-close",label:"Done",click:function(){b.createMenu(b.config.menu),b.setup.chart.containerDiv.removeChild(f)}}])}else{if(!b.config.fallback||"image"!=c.split("/")[0])throw new Error("Unable to create file. Ensure saveAs (FileSaver.js) is supported.");var f=document.createElement("div"),g=document.createElement("div"),i=b.toImage({data:a});g.innerHTML=b.i18l("fallback.save.image",b.setup.chart.language),f.appendChild(g),f.appendChild(i),g.setAttribute("class","amcharts-export-fallback-message"),f.setAttribute("class","amcharts-export-fallback"),b.setup.chart.containerDiv.appendChild(f),b.createMenu([{"class":"export-main export-close",label:"Done",click:function(){b.createMenu(b.config.menu),b.setup.chart.containerDiv.removeChild(f)}}])}return a},loadResource:function(a,c){function k(){if(c)for(d=0;de)?b.gatherAttribute(a.parentNode,c,d,e+1):f},gatherElements:function(a,c,d){var e,f;for(e=0;eg.height?j.legend.height:g.height):-1!=["top","bottom"].indexOf(j.legend.position)&&(g.height+=j.legend.height),j=b.gatherElements(j,e,h),f[j.legend.type](j)}if(b.drawing.enabled=e.isDrawingMode=e.drawing&&e.drawing.enabled?!0:"draw"==e.action,b.setup.wrapper?b.setup.wrapper.innerHTML="":(b.setup.wrapper=document.createElement("div"),b.setup.wrapper.setAttribute("class",b.setup.chart.classNamePrefix+"-export-canvas"),b.setup.chart.containerDiv.appendChild(b.setup.wrapper)),"stock"==b.setup.chart.type){var k={top:0,right:0,bottom:0,left:0};b.setup.chart.leftContainer&&(g.width-=b.setup.chart.leftContainer.offsetWidth,k.left=b.setup.chart.leftContainer.offsetWidth+2*b.setup.chart.panelsSettings.panelSpacing),b.setup.chart.rightContainer&&(g.width-=b.setup.chart.rightContainer.offsetWidth,k.right=b.setup.chart.rightContainer.offsetWidth+2*b.setup.chart.panelsSettings.panelSpacing),b.setup.chart.periodSelector&&-1!=["top","bottom"].indexOf(b.setup.chart.periodSelector.position)&&(g.height-=b.setup.chart.periodSelector.offsetHeight+b.setup.chart.panelsSettings.panelSpacing,k[b.setup.chart.periodSelector.position]+=b.setup.chart.periodSelector.offsetHeight+b.setup.chart.panelsSettings.panelSpacing),b.setup.chart.dataSetSelector&&-1!=["top","bottom"].indexOf(b.setup.chart.dataSetSelector.position)&&(g.height-=b.setup.chart.dataSetSelector.offsetHeight,k[b.setup.chart.dataSetSelector.position]+=b.setup.chart.dataSetSelector.offsetHeight),b.setup.wrapper.style.paddingTop=b.numberToPx(k.top),b.setup.wrapper.style.paddingRight=b.numberToPx(k.right),b.setup.wrapper.style.paddingBottom=b.numberToPx(k.bottom),b.setup.wrapper.style.paddingLeft=b.numberToPx(k.left)}for(b.setup.canvas=document.createElement("canvas"),b.setup.wrapper.appendChild(b.setup.canvas),b.setup.fabric=new fabric.Canvas(b.setup.canvas,b.deepMerge({width:g.width,height:g.height},e)),b.deepMerge(b.setup.fabric,e),b.setup.fabric.on("object:added",function(a){var c=a.target,d=JSON.stringify(c.originalState);c.selectable&&!c.known&&(b.drawing.undos.push({action:"added",target:c,options:d}),b.drawing.redos=[])}),b.setup.fabric.on("object:modified",function(a){var c=a.target,d=JSON.stringify(c.saveState().originalState);c.selectable&&b.drawing.undos.push({action:"modified",target:c,options:d})}),b.drawing.enabled?(b.setup.wrapper.setAttribute("class",b.setup.chart.classNamePrefix+"-export-canvas active"),b.setup.wrapper.style.backgroundColor=e.backgroundColor):b.setup.wrapper.setAttribute("class",b.setup.chart.classNamePrefix+"-export-canvas"),d=0;d1){var i=[],j=a.getAttribute("text-anchor")||"left",k={start:"left",middle:"center",end:"right"};for(d=0;de&&(d.s.r=e),d.s.c>f&&(d.s.c=f),d.e.rb?-1:h+10>b?b-h+26+26:j+26>b?b-j:i+26>b?b-i+26:void 0}function m(a){function k(a){h[j++]=a}var b,c,d,f,g,h;if(a.length%4>0)throw new Error("Invalid string. Length must be a multiple of 4");var i=a.length;g="="===a.charAt(i-2)?2:"="===a.charAt(i-1)?1:0,h=new e(3*a.length/4-g),d=g>0?a.length-4:a.length;var j=0;for(b=0,c=0;d>b;b+=4,c+=3)f=l(a.charAt(b))<<18|l(a.charAt(b+1))<<12|l(a.charAt(b+2))<<6|l(a.charAt(b+3)),k((16711680&f)>>16),k((65280&f)>>8),k(255&f);return 2===g?(f=l(a.charAt(b))<<2|l(a.charAt(b+1))>>4,k(255&f)):1===g&&(f=l(a.charAt(b))<<10|l(a.charAt(b+1))<<4|l(a.charAt(b+2))>>2,k(255&f>>8),k(255&f)),h}var d=b.deepMerge({},a||{}),e="undefined"!=typeof Uint8Array?Uint8Array:Array,f="+".charCodeAt(0),g="/".charCodeAt(0),h="0".charCodeAt(0),i="a".charCodeAt(0),j="A".charCodeAt(0),k=m(d.data);return b.handleCallback(c,k),k},handleCallback:function(a){var c,d=Array();if(a&&a instanceof Function){for(c=0;c0&&d.push(arguments[c]);a.apply(b,d)}},getChartData:function(){var a,c,e=[];if("stock"==b.setup.chart.type)e=b.setup.chart.mainDataSet.dataProvider;else if("gantt"==b.setup.chart.type){var f=b.setup.chart.segmentsField;for(a=0;a=a?(clearTimeout(e),"draw"!=d.action&&b.createMenu(b.config.menu)):i&&(i.innerHTML=b.i18l("capturing.delayed.menu.label").replace("{{duration}}",AmCharts.toFixed(a,2)))},10),f=setTimeout(function(){c.apply(b,arguments)},1e3*d.delay)},migrateSetup:function(a){function d(a){var b;for(b in a){var e=a[b];"export"==b.slice(0,6)&&e?c.menu.push(b.slice(6)):"userCFG"==b?d(e):"menuItems"==b?c.menu=e:"libs"==b?c.libs=e:"string"==typeof b&&(c[b]=e)}}if(a.amExport||a.exportConfig){var c=b.deepMerge({enabled:!0,migrated:!0,libs:{autoLoad:!1}},b.deepMerge(b.defaults,{menu:[]},!0));d(a.amExport||a.exportConfig),a["export"]=c}return a},init:function(){clearTimeout(b.timer),b.timer=setInterval(function(){b.setup.chart.containerDiv&&(clearTimeout(b.timer),b.setup.chart.AmExport=b,window.safari=window.safari?window.safari:{},b.createMenu(b.config.menu))},AmCharts.updateRate)}};if(b.drawing.cancel=b.drawing.done,b.setup.chart=b.migrateSetup(a),void 0!==b.setup.chart["export"]&&b.setup.chart["export"].enabled){try{b.setup.hasBlob=!!new Blob}catch(c){}b.deepMerge(b.libs,b.setup.chart["export"].libs||{},!0),b.deepMerge(b.defaults.pdfMake,b.setup.chart["export"]),b.deepMerge(b.defaults.fabric,b.setup.chart["export"]),b.config=b.deepMerge(b.defaults,b.setup.chart["export"],!0),(!(AmCharts.isIE&&AmCharts.IEversion<=9)||document.head&&b.config.fallback!==!1)&&(b.setup.chart["export"]=b,b.setup.chart.addClassNames=!0,b.loadDependencies(b.libs.resources,b.libs.reload),b.init())}},["pie","serial","xy","funnel","radar","gauge","stock","map","gantt"]); \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/lang/de.js b/ResoursesManager/ResoursesManager/amcharts/plugins/export/lang/de.js new file mode 100644 index 0000000..3151f79 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/lang/de.js @@ -0,0 +1,6 @@ +AmCharts.translations[ "export" ][ "de" ] = { + "fallback.save.text": "CTRL + C um die Daten in die Zwischenablage zu kopieren.", + "fallback.save.image": "Rechtsklick -> Bild speichern unter... um das Bild zu speichern.", + "capturing.delayed.menu.label": "{{duration}}", + "capturing.delayed.menu.title": "Klicken zum Abbrechen." +} \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/lang/en.js b/ResoursesManager/ResoursesManager/amcharts/plugins/export/lang/en.js new file mode 100644 index 0000000..654befc --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/lang/en.js @@ -0,0 +1,6 @@ +AmCharts.translations[ "export" ][ "en" ] = { + "fallback.save.text": "CTRL + C to copy the data into the clipboard.", + "fallback.save.image": "Rightclick -> Save picture as... to save the image.", + "capturing.delayed.menu.label": "{{duration}}", + "capturing.delayed.menu.title": "Click to cancel" +} \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/lang/lt.js b/ResoursesManager/ResoursesManager/amcharts/plugins/export/lang/lt.js new file mode 100644 index 0000000..72bfb5d --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/lang/lt.js @@ -0,0 +1,6 @@ +AmCharts.translations[ "export" ][ "lt" ] = { + "fallback.save.text": "Spauskite CTRL + C jei norite nukopijuoti paveiksliuką.", + "fallback.save.image": "Spragtelkite dešinį klavišą ir pasirinkite \"Save picture as...\" jei norite išsaugoti paveiksliuką.", + "capturing.delayed.menu.label": "{{duration}}", + "capturing.delayed.menu.title": "Nutraukti" +} \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/FileSaver.js/FileSaver.js b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/FileSaver.js/FileSaver.js new file mode 100644 index 0000000..11081a8 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/FileSaver.js/FileSaver.js @@ -0,0 +1,253 @@ +/* FileSaver.js + * A saveAs() FileSaver implementation. + * 2015-05-07.2 + * + * By Eli Grey, http://eligrey.com + * License: X11/MIT + * See https://github.com/eligrey/FileSaver.js/blob/master/LICENSE.md + */ + +/*global self */ +/*jslint bitwise: true, indent: 4, laxbreak: true, laxcomma: true, smarttabs: true, plusplus: true */ + +/*! @source http://purl.eligrey.com/github/FileSaver.js/blob/master/FileSaver.js */ + +var saveAs = saveAs || (function(view) { + "use strict"; + // IE <10 is explicitly unsupported + if (typeof navigator !== "undefined" && /MSIE [1-9]\./.test(navigator.userAgent)) { + return; + } + var + doc = view.document + // only get URL when necessary in case Blob.js hasn't overridden it yet + , get_URL = function() { + return view.URL || view.webkitURL || view; + } + , save_link = doc.createElementNS("http://www.w3.org/1999/xhtml", "a") + , can_use_save_link = "download" in save_link + , click = function(node) { + var event = doc.createEvent("MouseEvents"); + event.initMouseEvent( + "click", true, false, view, 0, 0, 0, 0, 0 + , false, false, false, false, 0, null + ); + node.dispatchEvent(event); + } + , webkit_req_fs = view.webkitRequestFileSystem + , req_fs = view.requestFileSystem || webkit_req_fs || view.mozRequestFileSystem + , throw_outside = function(ex) { + (view.setImmediate || view.setTimeout)(function() { + throw ex; + }, 0); + } + , force_saveable_type = "application/octet-stream" + , fs_min_size = 0 + // See https://code.google.com/p/chromium/issues/detail?id=375297#c7 and + // https://github.com/eligrey/FileSaver.js/commit/485930a#commitcomment-8768047 + // for the reasoning behind the timeout and revocation flow + , arbitrary_revoke_timeout = 500 // in ms + , revoke = function(file) { + var revoker = function() { + if (typeof file === "string") { // file is an object URL + get_URL().revokeObjectURL(file); + } else { // file is a File + file.remove(); + } + }; + if (view.chrome) { + revoker(); + } else { + setTimeout(revoker, arbitrary_revoke_timeout); + } + } + , dispatch = function(filesaver, event_types, event) { + event_types = [].concat(event_types); + var i = event_types.length; + while (i--) { + var listener = filesaver["on" + event_types[i]]; + if (typeof listener === "function") { + try { + listener.call(filesaver, event || filesaver); + } catch (ex) { + throw_outside(ex); + } + } + } + } + , auto_bom = function(blob) { + // prepend BOM for UTF-8 XML and text/* types (including HTML) + if (/^\s*(?:text\/\S*|application\/xml|\S*\/\S*\+xml)\s*;.*charset\s*=\s*utf-8/i.test(blob.type)) { + return new Blob(["\ufeff", blob], {type: blob.type}); + } + return blob; + } + , FileSaver = function(blob, name) { + blob = auto_bom(blob); + // First try a.download, then web filesystem, then object URLs + var + filesaver = this + , type = blob.type + , blob_changed = false + , object_url + , target_view + , dispatch_all = function() { + dispatch(filesaver, "writestart progress write writeend".split(" ")); + } + // on any filesys errors revert to saving with object URLs + , fs_error = function() { + // don't create more object URLs than needed + if (blob_changed || !object_url) { + object_url = get_URL().createObjectURL(blob); + } + if (target_view) { + target_view.location.href = object_url; + } else { + var new_tab = view.open(object_url, "_blank"); + if (new_tab == undefined && typeof safari !== "undefined") { + //Apple do not allow window.open, see http://bit.ly/1kZffRI + view.location.href = object_url + } + } + filesaver.readyState = filesaver.DONE; + dispatch_all(); + revoke(object_url); + } + , abortable = function(func) { + return function() { + if (filesaver.readyState !== filesaver.DONE) { + return func.apply(this, arguments); + } + }; + } + , create_if_not_found = {create: true, exclusive: false} + , slice + ; + filesaver.readyState = filesaver.INIT; + if (!name) { + name = "download"; + } + if (can_use_save_link) { + object_url = get_URL().createObjectURL(blob); + save_link.href = object_url; + save_link.download = name; + click(save_link); + filesaver.readyState = filesaver.DONE; + dispatch_all(); + revoke(object_url); + return; + } + // Object and web filesystem URLs have a problem saving in Google Chrome when + // viewed in a tab, so I force save with application/octet-stream + // http://code.google.com/p/chromium/issues/detail?id=91158 + // Update: Google errantly closed 91158, I submitted it again: + // https://code.google.com/p/chromium/issues/detail?id=389642 + if (view.chrome && type && type !== force_saveable_type) { + slice = blob.slice || blob.webkitSlice; + blob = slice.call(blob, 0, blob.size, force_saveable_type); + blob_changed = true; + } + // Since I can't be sure that the guessed media type will trigger a download + // in WebKit, I append .download to the filename. + // https://bugs.webkit.org/show_bug.cgi?id=65440 + if (webkit_req_fs && name !== "download") { + name += ".download"; + } + if (type === force_saveable_type || webkit_req_fs) { + target_view = view; + } + if (!req_fs) { + fs_error(); + return; + } + fs_min_size += blob.size; + req_fs(view.TEMPORARY, fs_min_size, abortable(function(fs) { + fs.root.getDirectory("saved", create_if_not_found, abortable(function(dir) { + var save = function() { + dir.getFile(name, create_if_not_found, abortable(function(file) { + file.createWriter(abortable(function(writer) { + writer.onwriteend = function(event) { + target_view.location.href = file.toURL(); + filesaver.readyState = filesaver.DONE; + dispatch(filesaver, "writeend", event); + revoke(file); + }; + writer.onerror = function() { + var error = writer.error; + if (error.code !== error.ABORT_ERR) { + fs_error(); + } + }; + "writestart progress write abort".split(" ").forEach(function(event) { + writer["on" + event] = filesaver["on" + event]; + }); + writer.write(blob); + filesaver.abort = function() { + writer.abort(); + filesaver.readyState = filesaver.DONE; + }; + filesaver.readyState = filesaver.WRITING; + }), fs_error); + }), fs_error); + }; + dir.getFile(name, {create: false}, abortable(function(file) { + // delete file if it already exists + file.remove(); + save(); + }), abortable(function(ex) { + if (ex.code === ex.NOT_FOUND_ERR) { + save(); + } else { + fs_error(); + } + })); + }), fs_error); + }), fs_error); + } + , FS_proto = FileSaver.prototype + , saveAs = function(blob, name) { + return new FileSaver(blob, name); + } + ; + // IE 10+ (native saveAs) + if (typeof navigator !== "undefined" && navigator.msSaveOrOpenBlob) { + return function(blob, name) { + return navigator.msSaveOrOpenBlob(auto_bom(blob), name); + }; + } + + FS_proto.abort = function() { + var filesaver = this; + filesaver.readyState = filesaver.DONE; + dispatch(filesaver, "abort"); + }; + FS_proto.readyState = FS_proto.INIT = 0; + FS_proto.WRITING = 1; + FS_proto.DONE = 2; + + FS_proto.error = + FS_proto.onwritestart = + FS_proto.onprogress = + FS_proto.onwrite = + FS_proto.onabort = + FS_proto.onerror = + FS_proto.onwriteend = + null; + + return saveAs; +}( + typeof self !== "undefined" && self + || typeof window !== "undefined" && window + || this.content +)); +// `self` is undefined in Firefox for Android content script context +// while `this` is nsIContentFrameMessageManager +// with an attribute `content` that corresponds to the window + +if (typeof module !== "undefined" && module.exports) { + module.exports.saveAs = saveAs; +} else if ((typeof define !== "undefined" && define !== null) && (define.amd != null)) { + define([], function() { + return saveAs; + }); +} \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/FileSaver.js/FileSaver.min.js b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/FileSaver.js/FileSaver.min.js new file mode 100644 index 0000000..c079233 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/FileSaver.js/FileSaver.min.js @@ -0,0 +1,2 @@ +/*! @source http://purl.eligrey.com/github/FileSaver.js/blob/master/FileSaver.js */ +var saveAs=saveAs||function(e){"use strict";if("undefined"==typeof navigator||!/MSIE [1-9]\./.test(navigator.userAgent)){var t=e.document,n=function(){return e.URL||e.webkitURL||e},o=t.createElementNS("http://www.w3.org/1999/xhtml","a"),r="download"in o,i=function(n){var o=t.createEvent("MouseEvents");o.initMouseEvent("click",!0,!1,e,0,0,0,0,0,!1,!1,!1,!1,0,null),n.dispatchEvent(o)},a=e.webkitRequestFileSystem,c=e.requestFileSystem||a||e.mozRequestFileSystem,u=function(t){(e.setImmediate||e.setTimeout)(function(){throw t},0)},f="application/octet-stream",s=0,d=500,l=function(t){var o=function(){"string"==typeof t?n().revokeObjectURL(t):t.remove()};e.chrome?o():setTimeout(o,d)},v=function(e,t,n){t=[].concat(t);for(var o=t.length;o--;){var r=e["on"+t[o]];if("function"==typeof r)try{r.call(e,n||e)}catch(i){u(i)}}},p=function(e){return/^\s*(?:text\/\S*|application\/xml|\S*\/\S*\+xml)\s*;.*charset\s*=\s*utf-8/i.test(e.type)?new Blob(["\ufeff",e],{type:e.type}):e},w=function(t,u){t=p(t);var d,w,y,m=this,S=t.type,h=!1,O=function(){v(m,"writestart progress write writeend".split(" "))},E=function(){if((h||!d)&&(d=n().createObjectURL(t)),w)w.location.href=d;else{var o=e.open(d,"_blank");void 0==o&&"undefined"!=typeof safari&&(e.location.href=d)}m.readyState=m.DONE,O(),l(d)},R=function(e){return function(){return m.readyState!==m.DONE?e.apply(this,arguments):void 0}},b={create:!0,exclusive:!1};return m.readyState=m.INIT,u||(u="download"),r?(d=n().createObjectURL(t),o.href=d,o.download=u,i(o),m.readyState=m.DONE,O(),void l(d)):(e.chrome&&S&&S!==f&&(y=t.slice||t.webkitSlice,t=y.call(t,0,t.size,f),h=!0),a&&"download"!==u&&(u+=".download"),(S===f||a)&&(w=e),c?(s+=t.size,void c(e.TEMPORARY,s,R(function(e){e.root.getDirectory("saved",b,R(function(e){var n=function(){e.getFile(u,b,R(function(e){e.createWriter(R(function(n){n.onwriteend=function(t){w.location.href=e.toURL(),m.readyState=m.DONE,v(m,"writeend",t),l(e)},n.onerror=function(){var e=n.error;e.code!==e.ABORT_ERR&&E()},"writestart progress write abort".split(" ").forEach(function(e){n["on"+e]=m["on"+e]}),n.write(t),m.abort=function(){n.abort(),m.readyState=m.DONE},m.readyState=m.WRITING}),E)}),E)};e.getFile(u,{create:!1},R(function(e){e.remove(),n()}),R(function(e){e.code===e.NOT_FOUND_ERR?n():E()}))}),E)}),E)):void E())},y=w.prototype,m=function(e,t){return new w(e,t)};return"undefined"!=typeof navigator&&navigator.msSaveOrOpenBlob?function(e,t){return navigator.msSaveOrOpenBlob(p(e),t)}:(y.abort=function(){var e=this;e.readyState=e.DONE,v(e,"abort")},y.readyState=y.INIT=0,y.WRITING=1,y.DONE=2,y.error=y.onwritestart=y.onprogress=y.onwrite=y.onabort=y.onerror=y.onwriteend=null,m)}}("undefined"!=typeof self&&self||"undefined"!=typeof window&&window||this.content);"undefined"!=typeof module&&module.exports?module.exports.saveAs=saveAs:"undefined"!=typeof define&&null!==define&&null!=define.amd&&define([],function(){return saveAs}); \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/blob.js/blob.js b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/blob.js/blob.js new file mode 100644 index 0000000..b4dda85 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/blob.js/blob.js @@ -0,0 +1,211 @@ +/* Blob.js + * A Blob implementation. + * 2014-07-24 + * + * By Eli Grey, http://eligrey.com + * By Devin Samarin, https://github.com/dsamarin + * License: X11/MIT + * See https://github.com/eligrey/Blob.js/blob/master/LICENSE.md + */ + +/*global self, unescape */ +/*jslint bitwise: true, regexp: true, confusion: true, es5: true, vars: true, white: true, + plusplus: true */ + +/*! @source http://purl.eligrey.com/github/Blob.js/blob/master/Blob.js */ + +(function (view) { + "use strict"; + + view.URL = view.URL || view.webkitURL; + + if (view.Blob && view.URL) { + try { + new Blob; + return; + } catch (e) {} + } + + // Internally we use a BlobBuilder implementation to base Blob off of + // in order to support older browsers that only have BlobBuilder + var BlobBuilder = view.BlobBuilder || view.WebKitBlobBuilder || view.MozBlobBuilder || (function(view) { + var + get_class = function(object) { + return Object.prototype.toString.call(object).match(/^\[object\s(.*)\]$/)[1]; + } + , FakeBlobBuilder = function BlobBuilder() { + this.data = []; + } + , FakeBlob = function Blob(data, type, encoding) { + this.data = data; + this.size = data.length; + this.type = type; + this.encoding = encoding; + } + , FBB_proto = FakeBlobBuilder.prototype + , FB_proto = FakeBlob.prototype + , FileReaderSync = view.FileReaderSync + , FileException = function(type) { + this.code = this[this.name = type]; + } + , file_ex_codes = ( + "NOT_FOUND_ERR SECURITY_ERR ABORT_ERR NOT_READABLE_ERR ENCODING_ERR " + + "NO_MODIFICATION_ALLOWED_ERR INVALID_STATE_ERR SYNTAX_ERR" + ).split(" ") + , file_ex_code = file_ex_codes.length + , real_URL = view.URL || view.webkitURL || view + , real_create_object_URL = real_URL.createObjectURL + , real_revoke_object_URL = real_URL.revokeObjectURL + , URL = real_URL + , btoa = view.btoa + , atob = view.atob + + , ArrayBuffer = view.ArrayBuffer + , Uint8Array = view.Uint8Array + + , origin = /^[\w-]+:\/*\[?[\w\.:-]+\]?(?::[0-9]+)?/ + ; + FakeBlob.fake = FB_proto.fake = true; + while (file_ex_code--) { + FileException.prototype[file_ex_codes[file_ex_code]] = file_ex_code + 1; + } + // Polyfill URL + if (!real_URL.createObjectURL) { + URL = view.URL = function(uri) { + var + uri_info = document.createElementNS("http://www.w3.org/1999/xhtml", "a") + , uri_origin + ; + uri_info.href = uri; + if (!("origin" in uri_info)) { + if (uri_info.protocol.toLowerCase() === "data:") { + uri_info.origin = null; + } else { + uri_origin = uri.match(origin); + uri_info.origin = uri_origin && uri_origin[1]; + } + } + return uri_info; + }; + } + URL.createObjectURL = function(blob) { + var + type = blob.type + , data_URI_header + ; + if (type === null) { + type = "application/octet-stream"; + } + if (blob instanceof FakeBlob) { + data_URI_header = "data:" + type; + if (blob.encoding === "base64") { + return data_URI_header + ";base64," + blob.data; + } else if (blob.encoding === "URI") { + return data_URI_header + "," + decodeURIComponent(blob.data); + } if (btoa) { + return data_URI_header + ";base64," + btoa(blob.data); + } else { + return data_URI_header + "," + encodeURIComponent(blob.data); + } + } else if (real_create_object_URL) { + return real_create_object_URL.call(real_URL, blob); + } + }; + URL.revokeObjectURL = function(object_URL) { + if (object_URL.substring(0, 5) !== "data:" && real_revoke_object_URL) { + real_revoke_object_URL.call(real_URL, object_URL); + } + }; + FBB_proto.append = function(data/*, endings*/) { + var bb = this.data; + // decode data to a binary string + if (Uint8Array && (data instanceof ArrayBuffer || data instanceof Uint8Array)) { + var + str = "" + , buf = new Uint8Array(data) + , i = 0 + , buf_len = buf.length + ; + for (; i < buf_len; i++) { + str += String.fromCharCode(buf[i]); + } + bb.push(str); + } else if (get_class(data) === "Blob" || get_class(data) === "File") { + if (FileReaderSync) { + var fr = new FileReaderSync; + bb.push(fr.readAsBinaryString(data)); + } else { + // async FileReader won't work as BlobBuilder is sync + throw new FileException("NOT_READABLE_ERR"); + } + } else if (data instanceof FakeBlob) { + if (data.encoding === "base64" && atob) { + bb.push(atob(data.data)); + } else if (data.encoding === "URI") { + bb.push(decodeURIComponent(data.data)); + } else if (data.encoding === "raw") { + bb.push(data.data); + } + } else { + if (typeof data !== "string") { + data += ""; // convert unsupported types to strings + } + // decode UTF-16 to binary string + bb.push(unescape(encodeURIComponent(data))); + } + }; + FBB_proto.getBlob = function(type) { + if (!arguments.length) { + type = null; + } + return new FakeBlob(this.data.join(""), type, "raw"); + }; + FBB_proto.toString = function() { + return "[object BlobBuilder]"; + }; + FB_proto.slice = function(start, end, type) { + var args = arguments.length; + if (args < 3) { + type = null; + } + return new FakeBlob( + this.data.slice(start, args > 1 ? end : this.data.length) + , type + , this.encoding + ); + }; + FB_proto.toString = function() { + return "[object Blob]"; + }; + FB_proto.close = function() { + this.size = 0; + delete this.data; + }; + return FakeBlobBuilder; + }(view)); + + view.Blob = function(blobParts, options) { + var type = options ? (options.type || "") : ""; + var builder = new BlobBuilder(); + if (blobParts) { + for (var i = 0, len = blobParts.length; i < len; i++) { + if (Uint8Array && blobParts[i] instanceof Uint8Array) { + builder.append(blobParts[i].buffer); + } + else { + builder.append(blobParts[i]); + } + } + } + var blob = builder.getBlob(type); + if (!blob.slice && blob.webkitSlice) { + blob.slice = blob.webkitSlice; + } + return blob; + }; + + var getPrototypeOf = Object.getPrototypeOf || function(object) { + return object.__proto__; + }; + view.Blob.prototype = getPrototypeOf(new view.Blob()); +}(typeof self !== "undefined" && self || typeof window !== "undefined" && window || this.content || this)); \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/fabric.js/.travis.yml b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/fabric.js/.travis.yml new file mode 100644 index 0000000..116d504 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/fabric.js/.travis.yml @@ -0,0 +1,10 @@ +language: node_js +node_js: + - "0.10" +script: 'npm run-script build && npm test && jscs src' +before_install: + - sudo apt-get update -qq + - sudo apt-get install -qq libgif-dev libpng-dev libjpeg8-dev libpango1.0-dev libcairo2-dev + - '[ "${TRAVIS_NODE_VERSION}" = "0.6" ] && npm conf set strict-ssl false || true' + - "IOJS_VERSION=v1.0.1; wget https://iojs.org/dist/${IOJS_VERSION}/iojs-${IOJS_VERSION}-linux-x64.tar.xz && tar xvfJ iojs-${IOJS_VERSION}-linux-x64.tar.xz && sudo mv iojs-${IOJS_VERSION}-linux-x64/bin/iojs /usr/local/bin" + diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/fabric.js/fabric.js b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/fabric.js/fabric.js new file mode 100644 index 0000000..b2dcba5 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/fabric.js/fabric.js @@ -0,0 +1,23452 @@ +/* build: `node build.js modules=ALL exclude=json,gestures minifier=uglifyjs` */ +/*! Fabric.js Copyright 2008-2015, Printio (Juriy Zaytsev, Maxim Chernyak) */ + +var fabric = fabric || { version: "1.5.0" }; +if (typeof exports !== 'undefined') { + exports.fabric = fabric; +} + +if (typeof document !== 'undefined' && typeof window !== 'undefined') { + fabric.document = document; + fabric.window = window; + // ensure globality even if entire library were function wrapped (as in Meteor.js packaging system) + window.fabric = fabric; +} +else { + // assume we're running under node.js when document/window are not present + fabric.document = require("jsdom") + .jsdom(""); + + if (fabric.document.createWindow) { + fabric.window = fabric.document.createWindow(); + } else { + fabric.window = fabric.document.parentWindow; + } +} + +/** + * True when in environment that supports touch events + * @type boolean + */ +fabric.isTouchSupported = "ontouchstart" in fabric.document.documentElement; + +/** + * True when in environment that's probably Node.js + * @type boolean + */ +fabric.isLikelyNode = typeof Buffer !== 'undefined' && + typeof window === 'undefined'; + +/* _FROM_SVG_START_ */ +/** + * Attributes parsed from all SVG elements + * @type array + */ +fabric.SHARED_ATTRIBUTES = [ + "display", + "transform", + "fill", "fill-opacity", "fill-rule", + "opacity", + "stroke", "stroke-dasharray", "stroke-linecap", + "stroke-linejoin", "stroke-miterlimit", + "stroke-opacity", "stroke-width" +]; +/* _FROM_SVG_END_ */ + +/** + * Pixel per Inch as a default value set to 96. Can be changed for more realistic conversion. + */ +fabric.DPI = 96; +fabric.reNum = '(?:[-+]?(?:\\d+|\\d*\\.\\d+)(?:e[-+]?\\d+)?)'; + + +(function() { + + /** + * @private + * @param {String} eventName + * @param {Function} handler + */ + function _removeEventListener(eventName, handler) { + if (!this.__eventListeners[eventName]) { + return; + } + + if (handler) { + fabric.util.removeFromArray(this.__eventListeners[eventName], handler); + } + else { + this.__eventListeners[eventName].length = 0; + } + } + + /** + * Observes specified event + * @deprecated `observe` deprecated since 0.8.34 (use `on` instead) + * @memberOf fabric.Observable + * @alias on + * @param {String|Object} eventName Event name (eg. 'after:render') or object with key/value pairs (eg. {'after:render': handler, 'selection:cleared': handler}) + * @param {Function} handler Function that receives a notification when an event of the specified type occurs + * @return {Self} thisArg + * @chainable + */ + function observe(eventName, handler) { + if (!this.__eventListeners) { + this.__eventListeners = { }; + } + // one object with key/value pairs was passed + if (arguments.length === 1) { + for (var prop in eventName) { + this.on(prop, eventName[prop]); + } + } + else { + if (!this.__eventListeners[eventName]) { + this.__eventListeners[eventName] = [ ]; + } + this.__eventListeners[eventName].push(handler); + } + return this; + } + + /** + * Stops event observing for a particular event handler. Calling this method + * without arguments removes all handlers for all events + * @deprecated `stopObserving` deprecated since 0.8.34 (use `off` instead) + * @memberOf fabric.Observable + * @alias off + * @param {String|Object} eventName Event name (eg. 'after:render') or object with key/value pairs (eg. {'after:render': handler, 'selection:cleared': handler}) + * @param {Function} handler Function to be deleted from EventListeners + * @return {Self} thisArg + * @chainable + */ + function stopObserving(eventName, handler) { + if (!this.__eventListeners) { + return; + } + + // remove all key/value pairs (event name -> event handler) + if (arguments.length === 0) { + this.__eventListeners = { }; + } + // one object with key/value pairs was passed + else if (arguments.length === 1 && typeof arguments[0] === 'object') { + for (var prop in eventName) { + _removeEventListener.call(this, prop, eventName[prop]); + } + } + else { + _removeEventListener.call(this, eventName, handler); + } + return this; + } + + /** + * Fires event with an optional options object + * @deprecated `fire` deprecated since 1.0.7 (use `trigger` instead) + * @memberOf fabric.Observable + * @alias trigger + * @param {String} eventName Event name to fire + * @param {Object} [options] Options object + * @return {Self} thisArg + * @chainable + */ + function fire(eventName, options) { + if (!this.__eventListeners) { + return; + } + + var listenersForEvent = this.__eventListeners[eventName]; + if (!listenersForEvent) { + return; + } + + for (var i = 0, len = listenersForEvent.length; i < len; i++) { + // avoiding try/catch for perf. reasons + listenersForEvent[i].call(this, options || { }); + } + return this; + } + + /** + * @namespace fabric.Observable + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2/#events} + * @see {@link http://fabricjs.com/events/|Events demo} + */ + fabric.Observable = { + observe: observe, + stopObserving: stopObserving, + fire: fire, + + on: observe, + off: stopObserving, + trigger: fire + }; +})(); + + +/** + * @namespace fabric.Collection + */ +fabric.Collection = { + + /** + * Adds objects to collection, then renders canvas (if `renderOnAddRemove` is not `false`) + * Objects should be instances of (or inherit from) fabric.Object + * @param {...fabric.Object} object Zero or more fabric instances + * @return {Self} thisArg + */ + add: function () { + this._objects.push.apply(this._objects, arguments); + for (var i = 0, length = arguments.length; i < length; i++) { + this._onObjectAdded(arguments[i]); + } + this.renderOnAddRemove && this.renderAll(); + return this; + }, + + /** + * Inserts an object into collection at specified index, then renders canvas (if `renderOnAddRemove` is not `false`) + * An object should be an instance of (or inherit from) fabric.Object + * @param {Object} object Object to insert + * @param {Number} index Index to insert object at + * @param {Boolean} nonSplicing When `true`, no splicing (shifting) of objects occurs + * @return {Self} thisArg + * @chainable + */ + insertAt: function (object, index, nonSplicing) { + var objects = this.getObjects(); + if (nonSplicing) { + objects[index] = object; + } + else { + objects.splice(index, 0, object); + } + this._onObjectAdded(object); + this.renderOnAddRemove && this.renderAll(); + return this; + }, + + /** + * Removes objects from a collection, then renders canvas (if `renderOnAddRemove` is not `false`) + * @param {...fabric.Object} object Zero or more fabric instances + * @return {Self} thisArg + * @chainable + */ + remove: function() { + var objects = this.getObjects(), + index; + + for (var i = 0, length = arguments.length; i < length; i++) { + index = objects.indexOf(arguments[i]); + + // only call onObjectRemoved if an object was actually removed + if (index !== -1) { + objects.splice(index, 1); + this._onObjectRemoved(arguments[i]); + } + } + + this.renderOnAddRemove && this.renderAll(); + return this; + }, + + /** + * Executes given function for each object in this group + * @param {Function} callback + * Callback invoked with current object as first argument, + * index - as second and an array of all objects - as third. + * Iteration happens in reverse order (for performance reasons). + * Callback is invoked in a context of Global Object (e.g. `window`) + * when no `context` argument is given + * + * @param {Object} context Context (aka thisObject) + * @return {Self} thisArg + */ + forEachObject: function(callback, context) { + var objects = this.getObjects(), + i = objects.length; + while (i--) { + callback.call(context, objects[i], i, objects); + } + return this; + }, + + /** + * Returns an array of children objects of this instance + * Type parameter introduced in 1.3.10 + * @param {String} [type] When specified, only objects of this type are returned + * @return {Array} + */ + getObjects: function(type) { + if (typeof type === 'undefined') { + return this._objects; + } + return this._objects.filter(function(o) { + return o.type === type; + }); + }, + + /** + * Returns object at specified index + * @param {Number} index + * @return {Self} thisArg + */ + item: function (index) { + return this.getObjects()[index]; + }, + + /** + * Returns true if collection contains no objects + * @return {Boolean} true if collection is empty + */ + isEmpty: function () { + return this.getObjects().length === 0; + }, + + /** + * Returns a size of a collection (i.e: length of an array containing its objects) + * @return {Number} Collection size + */ + size: function() { + return this.getObjects().length; + }, + + /** + * Returns true if collection contains an object + * @param {Object} object Object to check against + * @return {Boolean} `true` if collection contains an object + */ + contains: function(object) { + return this.getObjects().indexOf(object) > -1; + }, + + /** + * Returns number representation of a collection complexity + * @return {Number} complexity + */ + complexity: function () { + return this.getObjects().reduce(function (memo, current) { + memo += current.complexity ? current.complexity() : 0; + return memo; + }, 0); + } +}; + + +(function(global) { + + var sqrt = Math.sqrt, + atan2 = Math.atan2, + PiBy180 = Math.PI / 180; + + /** + * @namespace fabric.util + */ + fabric.util = { + + /** + * Removes value from an array. + * Presence of value (and its position in an array) is determined via `Array.prototype.indexOf` + * @static + * @memberOf fabric.util + * @param {Array} array + * @param {Any} value + * @return {Array} original array + */ + removeFromArray: function(array, value) { + var idx = array.indexOf(value); + if (idx !== -1) { + array.splice(idx, 1); + } + return array; + }, + + /** + * Returns random number between 2 specified ones. + * @static + * @memberOf fabric.util + * @param {Number} min lower limit + * @param {Number} max upper limit + * @return {Number} random value (between min and max) + */ + getRandomInt: function(min, max) { + return Math.floor(Math.random() * (max - min + 1)) + min; + }, + + /** + * Transforms degrees to radians. + * @static + * @memberOf fabric.util + * @param {Number} degrees value in degrees + * @return {Number} value in radians + */ + degreesToRadians: function(degrees) { + return degrees * PiBy180; + }, + + /** + * Transforms radians to degrees. + * @static + * @memberOf fabric.util + * @param {Number} radians value in radians + * @return {Number} value in degrees + */ + radiansToDegrees: function(radians) { + return radians / PiBy180; + }, + + /** + * Rotates `point` around `origin` with `radians` + * @static + * @memberOf fabric.util + * @param {fabric.Point} point The point to rotate + * @param {fabric.Point} origin The origin of the rotation + * @param {Number} radians The radians of the angle for the rotation + * @return {fabric.Point} The new rotated point + */ + rotatePoint: function(point, origin, radians) { + var sin = Math.sin(radians), + cos = Math.cos(radians); + + point.subtractEquals(origin); + + var rx = point.x * cos - point.y * sin, + ry = point.x * sin + point.y * cos; + + return new fabric.Point(rx, ry).addEquals(origin); + }, + + /** + * Apply transform t to point p + * @static + * @memberOf fabric.util + * @param {fabric.Point} p The point to transform + * @param {Array} t The transform + * @param {Boolean} [ignoreOffset] Indicates that the offset should not be applied + * @return {fabric.Point} The transformed point + */ + transformPoint: function(p, t, ignoreOffset) { + if (ignoreOffset) { + return new fabric.Point( + t[0] * p.x + t[2] * p.y, + t[1] * p.x + t[3] * p.y + ); + } + return new fabric.Point( + t[0] * p.x + t[2] * p.y + t[4], + t[1] * p.x + t[3] * p.y + t[5] + ); + }, + + /** + * Invert transformation t + * @static + * @memberOf fabric.util + * @param {Array} t The transform + * @return {Array} The inverted transform + */ + invertTransform: function(t) { + var r = t.slice(), + a = 1 / (t[0] * t[3] - t[1] * t[2]); + r = [a * t[3], -a * t[1], -a * t[2], a * t[0], 0, 0]; + var o = fabric.util.transformPoint({ x: t[4], y: t[5] }, r); + r[4] = -o.x; + r[5] = -o.y; + return r; + }, + + /** + * A wrapper around Number#toFixed, which contrary to native method returns number, not string. + * @static + * @memberOf fabric.util + * @param {Number|String} number number to operate on + * @param {Number} fractionDigits number of fraction digits to "leave" + * @return {Number} + */ + toFixed: function(number, fractionDigits) { + return parseFloat(Number(number).toFixed(fractionDigits)); + }, + + /** + * Converts from attribute value to pixel value if applicable. + * Returns converted pixels or original value not converted. + * @param {Number|String} value number to operate on + * @return {Number|String} + */ + parseUnit: function(value, fontSize) { + var unit = /\D{0,2}$/.exec(value), + number = parseFloat(value); + if (!fontSize) { + fontSize = fabric.Text.DEFAULT_SVG_FONT_SIZE; + } + switch (unit[0]) { + case 'mm': + return number * fabric.DPI / 25.4; + + case 'cm': + return number * fabric.DPI / 2.54; + + case 'in': + return number * fabric.DPI; + + case 'pt': + return number * fabric.DPI / 72; // or * 4 / 3 + + case 'pc': + return number * fabric.DPI / 72 * 12; // or * 16 + + case 'em': + return number * fontSize; + + default: + return number; + } + }, + + /** + * Function which always returns `false`. + * @static + * @memberOf fabric.util + * @return {Boolean} + */ + falseFunction: function() { + return false; + }, + + /** + * Returns klass "Class" object of given namespace + * @memberOf fabric.util + * @param {String} type Type of object (eg. 'circle') + * @param {String} namespace Namespace to get klass "Class" object from + * @return {Object} klass "Class" + */ + getKlass: function(type, namespace) { + // capitalize first letter only + type = fabric.util.string.camelize(type.charAt(0).toUpperCase() + type.slice(1)); + return fabric.util.resolveNamespace(namespace)[type]; + }, + + /** + * Returns object of given namespace + * @memberOf fabric.util + * @param {String} namespace Namespace string e.g. 'fabric.Image.filter' or 'fabric' + * @return {Object} Object for given namespace (default fabric) + */ + resolveNamespace: function(namespace) { + if (!namespace) { + return fabric; + } + + var parts = namespace.split('.'), + len = parts.length, + obj = global || fabric.window; + + for (var i = 0; i < len; ++i) { + obj = obj[parts[i]]; + } + + return obj; + }, + + /** + * Loads image element from given url and passes it to a callback + * @memberOf fabric.util + * @param {String} url URL representing an image + * @param {Function} callback Callback; invoked with loaded image + * @param {Any} [context] Context to invoke callback in + * @param {Object} [crossOrigin] crossOrigin value to set image element to + */ + loadImage: function(url, callback, context, crossOrigin) { + if (!url) { + callback && callback.call(context, url); + return; + } + + var img = fabric.util.createImage(); + + /** @ignore */ + img.onload = function () { + callback && callback.call(context, img); + img = img.onload = img.onerror = null; + }; + + /** @ignore */ + img.onerror = function() { + fabric.log('Error loading ' + img.src); + callback && callback.call(context, null, true); + img = img.onload = img.onerror = null; + }; + + // data-urls appear to be buggy with crossOrigin + // https://github.com/kangax/fabric.js/commit/d0abb90f1cd5c5ef9d2a94d3fb21a22330da3e0a#commitcomment-4513767 + // see https://code.google.com/p/chromium/issues/detail?id=315152 + // https://bugzilla.mozilla.org/show_bug.cgi?id=935069 + if (url.indexOf('data') !== 0 && typeof crossOrigin !== 'undefined') { + img.crossOrigin = crossOrigin; + } + + img.src = url; + }, + + /** + * Creates corresponding fabric instances from their object representations + * @static + * @memberOf fabric.util + * @param {Array} objects Objects to enliven + * @param {Function} callback Callback to invoke when all objects are created + * @param {String} namespace Namespace to get klass "Class" object from + * @param {Function} reviver Method for further parsing of object elements, + * called after each fabric object created. + */ + enlivenObjects: function(objects, callback, namespace, reviver) { + objects = objects || [ ]; + + function onLoaded() { + if (++numLoadedObjects === numTotalObjects) { + callback && callback(enlivenedObjects); + } + } + + var enlivenedObjects = [ ], + numLoadedObjects = 0, + numTotalObjects = objects.length; + + if (!numTotalObjects) { + callback && callback(enlivenedObjects); + return; + } + + objects.forEach(function (o, index) { + // if sparse array + if (!o || !o.type) { + onLoaded(); + return; + } + var klass = fabric.util.getKlass(o.type, namespace); + if (klass.async) { + klass.fromObject(o, function (obj, error) { + if (!error) { + enlivenedObjects[index] = obj; + reviver && reviver(o, enlivenedObjects[index]); + } + onLoaded(); + }); + } + else { + enlivenedObjects[index] = klass.fromObject(o); + reviver && reviver(o, enlivenedObjects[index]); + onLoaded(); + } + }); + }, + + /** + * Groups SVG elements (usually those retrieved from SVG document) + * @static + * @memberOf fabric.util + * @param {Array} elements SVG elements to group + * @param {Object} [options] Options object + * @return {fabric.Object|fabric.PathGroup} + */ + groupSVGElements: function(elements, options, path) { + var object; + + object = new fabric.PathGroup(elements, options); + + if (typeof path !== 'undefined') { + object.setSourcePath(path); + } + return object; + }, + + /** + * Populates an object with properties of another object + * @static + * @memberOf fabric.util + * @param {Object} source Source object + * @param {Object} destination Destination object + * @return {Array} properties Propertie names to include + */ + populateWithProperties: function(source, destination, properties) { + if (properties && Object.prototype.toString.call(properties) === '[object Array]') { + for (var i = 0, len = properties.length; i < len; i++) { + if (properties[i] in source) { + destination[properties[i]] = source[properties[i]]; + } + } + } + }, + + /** + * Draws a dashed line between two points + * + * This method is used to draw dashed line around selection area. + * See dotted stroke in canvas + * + * @param {CanvasRenderingContext2D} ctx context + * @param {Number} x start x coordinate + * @param {Number} y start y coordinate + * @param {Number} x2 end x coordinate + * @param {Number} y2 end y coordinate + * @param {Array} da dash array pattern + */ + drawDashedLine: function(ctx, x, y, x2, y2, da) { + var dx = x2 - x, + dy = y2 - y, + len = sqrt(dx * dx + dy * dy), + rot = atan2(dy, dx), + dc = da.length, + di = 0, + draw = true; + + ctx.save(); + ctx.translate(x, y); + ctx.moveTo(0, 0); + ctx.rotate(rot); + + x = 0; + while (len > x) { + x += da[di++ % dc]; + if (x > len) { + x = len; + } + ctx[draw ? 'lineTo' : 'moveTo'](x, 0); + draw = !draw; + } + + ctx.restore(); + }, + + /** + * Creates canvas element and initializes it via excanvas if necessary + * @static + * @memberOf fabric.util + * @param {CanvasElement} [canvasEl] optional canvas element to initialize; + * when not given, element is created implicitly + * @return {CanvasElement} initialized canvas element + */ + createCanvasElement: function(canvasEl) { + canvasEl || (canvasEl = fabric.document.createElement('canvas')); + //jscs:disable requireCamelCaseOrUpperCaseIdentifiers + if (!canvasEl.getContext && typeof G_vmlCanvasManager !== 'undefined') { + G_vmlCanvasManager.initElement(canvasEl); + } + //jscs:enable requireCamelCaseOrUpperCaseIdentifiers + return canvasEl; + }, + + /** + * Creates image element (works on client and node) + * @static + * @memberOf fabric.util + * @return {HTMLImageElement} HTML image element + */ + createImage: function() { + return fabric.isLikelyNode + ? new (require('canvas').Image)() + : fabric.document.createElement('img'); + }, + + /** + * Creates accessors (getXXX, setXXX) for a "class", based on "stateProperties" array + * @static + * @memberOf fabric.util + * @param {Object} klass "Class" to create accessors for + */ + createAccessors: function(klass) { + var proto = klass.prototype; + + for (var i = proto.stateProperties.length; i--; ) { + + var propName = proto.stateProperties[i], + capitalizedPropName = propName.charAt(0).toUpperCase() + propName.slice(1), + setterName = 'set' + capitalizedPropName, + getterName = 'get' + capitalizedPropName; + + // using `new Function` for better introspection + if (!proto[getterName]) { + proto[getterName] = (function(property) { + return new Function('return this.get("' + property + '")'); + })(propName); + } + if (!proto[setterName]) { + proto[setterName] = (function(property) { + return new Function('value', 'return this.set("' + property + '", value)'); + })(propName); + } + } + }, + + /** + * @static + * @memberOf fabric.util + * @param {fabric.Object} receiver Object implementing `clipTo` method + * @param {CanvasRenderingContext2D} ctx Context to clip + */ + clipContext: function(receiver, ctx) { + ctx.save(); + ctx.beginPath(); + receiver.clipTo(ctx); + ctx.clip(); + }, + + /** + * Multiply matrix A by matrix B to nest transformations + * @static + * @memberOf fabric.util + * @param {Array} a First transformMatrix + * @param {Array} b Second transformMatrix + * @return {Array} The product of the two transform matrices + */ + multiplyTransformMatrices: function(a, b) { + // Matrix multiply a * b + return [ + a[0] * b[0] + a[2] * b[1], + a[1] * b[0] + a[3] * b[1], + a[0] * b[2] + a[2] * b[3], + a[1] * b[2] + a[3] * b[3], + a[0] * b[4] + a[2] * b[5] + a[4], + a[1] * b[4] + a[3] * b[5] + a[5] + ]; + }, + + /** + * Returns string representation of function body + * @param {Function} fn Function to get body of + * @return {String} Function body + */ + getFunctionBody: function(fn) { + return (String(fn).match(/function[^{]*\{([\s\S]*)\}/) || {})[1]; + }, + + /** + * Returns true if context has transparent pixel + * at specified location (taking tolerance into account) + * @param {CanvasRenderingContext2D} ctx context + * @param {Number} x x coordinate + * @param {Number} y y coordinate + * @param {Number} tolerance Tolerance + */ + isTransparent: function(ctx, x, y, tolerance) { + + // If tolerance is > 0 adjust start coords to take into account. + // If moves off Canvas fix to 0 + if (tolerance > 0) { + if (x > tolerance) { + x -= tolerance; + } + else { + x = 0; + } + if (y > tolerance) { + y -= tolerance; + } + else { + y = 0; + } + } + + var _isTransparent = true, + imageData = ctx.getImageData(x, y, (tolerance * 2) || 1, (tolerance * 2) || 1); + + // Split image data - for tolerance > 1, pixelDataSize = 4; + for (var i = 3, l = imageData.data.length; i < l; i += 4) { + var temp = imageData.data[i]; + _isTransparent = temp <= 0; + if (_isTransparent === false) { + break; // Stop if colour found + } + } + + imageData = null; + + return _isTransparent; + } + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function() { + + var arcToSegmentsCache = { }, + segmentToBezierCache = { }, + boundsOfCurveCache = { }, + _join = Array.prototype.join; + + /* Adapted from http://dxr.mozilla.org/mozilla-central/source/content/svg/content/src/nsSVGPathDataParser.cpp + * by Andrea Bogazzi code is under MPL. if you don't have a copy of the license you can take it here + * http://mozilla.org/MPL/2.0/ + */ + function arcToSegments(toX, toY, rx, ry, large, sweep, rotateX) { + var argsString = _join.call(arguments); + if (arcToSegmentsCache[argsString]) { + return arcToSegmentsCache[argsString]; + } + + var PI = Math.PI, th = rotateX * PI / 180, + sinTh = Math.sin(th), + cosTh = Math.cos(th), + fromX = 0, fromY = 0; + + rx = Math.abs(rx); + ry = Math.abs(ry); + + var px = -cosTh * toX * 0.5 - sinTh * toY * 0.5, + py = -cosTh * toY * 0.5 + sinTh * toX * 0.5, + rx2 = rx * rx, ry2 = ry * ry, py2 = py * py, px2 = px * px, + pl = rx2 * ry2 - rx2 * py2 - ry2 * px2, + root = 0; + + if (pl < 0) { + var s = Math.sqrt(1 - pl/(rx2 * ry2)); + rx *= s; + ry *= s; + } + else { + root = (large === sweep ? -1.0 : 1.0) * + Math.sqrt( pl /(rx2 * py2 + ry2 * px2)); + } + + var cx = root * rx * py / ry, + cy = -root * ry * px / rx, + cx1 = cosTh * cx - sinTh * cy + toX * 0.5, + cy1 = sinTh * cx + cosTh * cy + toY * 0.5, + mTheta = calcVectorAngle(1, 0, (px - cx) / rx, (py - cy) / ry), + dtheta = calcVectorAngle((px - cx) / rx, (py - cy) / ry, (-px - cx) / rx, (-py - cy) / ry); + + if (sweep === 0 && dtheta > 0) { + dtheta -= 2 * PI; + } + else if (sweep === 1 && dtheta < 0) { + dtheta += 2 * PI; + } + + // Convert into cubic bezier segments <= 90deg + var segments = Math.ceil(Math.abs(dtheta / PI * 2)), + result = [], mDelta = dtheta / segments, + mT = 8 / 3 * Math.sin(mDelta / 4) * Math.sin(mDelta / 4) / Math.sin(mDelta / 2), + th3 = mTheta + mDelta; + + for (var i = 0; i < segments; i++) { + result[i] = segmentToBezier(mTheta, th3, cosTh, sinTh, rx, ry, cx1, cy1, mT, fromX, fromY); + fromX = result[i][4]; + fromY = result[i][5]; + mTheta = th3; + th3 += mDelta; + } + arcToSegmentsCache[argsString] = result; + return result; + } + + function segmentToBezier(th2, th3, cosTh, sinTh, rx, ry, cx1, cy1, mT, fromX, fromY) { + var argsString2 = _join.call(arguments); + if (segmentToBezierCache[argsString2]) { + return segmentToBezierCache[argsString2]; + } + + var costh2 = Math.cos(th2), + sinth2 = Math.sin(th2), + costh3 = Math.cos(th3), + sinth3 = Math.sin(th3), + toX = cosTh * rx * costh3 - sinTh * ry * sinth3 + cx1, + toY = sinTh * rx * costh3 + cosTh * ry * sinth3 + cy1, + cp1X = fromX + mT * ( - cosTh * rx * sinth2 - sinTh * ry * costh2), + cp1Y = fromY + mT * ( - sinTh * rx * sinth2 + cosTh * ry * costh2), + cp2X = toX + mT * ( cosTh * rx * sinth3 + sinTh * ry * costh3), + cp2Y = toY + mT * ( sinTh * rx * sinth3 - cosTh * ry * costh3); + + segmentToBezierCache[argsString2] = [ + cp1X, cp1Y, + cp2X, cp2Y, + toX, toY + ]; + return segmentToBezierCache[argsString2]; + } + + /* + * Private + */ + function calcVectorAngle(ux, uy, vx, vy) { + var ta = Math.atan2(uy, ux), + tb = Math.atan2(vy, vx); + if (tb >= ta) { + return tb - ta; + } + else { + return 2 * Math.PI - (ta - tb); + } + } + + /** + * Draws arc + * @param {CanvasRenderingContext2D} ctx + * @param {Number} fx + * @param {Number} fy + * @param {Array} coords + */ + fabric.util.drawArc = function(ctx, fx, fy, coords) { + var rx = coords[0], + ry = coords[1], + rot = coords[2], + large = coords[3], + sweep = coords[4], + tx = coords[5], + ty = coords[6], + segs = [[ ], [ ], [ ], [ ]], + segsNorm = arcToSegments(tx - fx, ty - fy, rx, ry, large, sweep, rot); + + for (var i = 0, len = segsNorm.length; i < len; i++) { + segs[i][0] = segsNorm[i][0] + fx; + segs[i][1] = segsNorm[i][1] + fy; + segs[i][2] = segsNorm[i][2] + fx; + segs[i][3] = segsNorm[i][3] + fy; + segs[i][4] = segsNorm[i][4] + fx; + segs[i][5] = segsNorm[i][5] + fy; + ctx.bezierCurveTo.apply(ctx, segs[i]); + } + }; + + /** + * Calculate bounding box of a elliptic-arc + * @param {Number} fx start point of arc + * @param {Number} fy + * @param {Number} rx horizontal radius + * @param {Number} ry vertical radius + * @param {Number} rot angle of horizontal axe + * @param {Number} large 1 or 0, whatever the arc is the big or the small on the 2 points + * @param {Number} sweep 1 or 0, 1 clockwise or counterclockwise direction + * @param {Number} tx end point of arc + * @param {Number} ty + */ + fabric.util.getBoundsOfArc = function(fx, fy, rx, ry, rot, large, sweep, tx, ty) { + + var fromX = 0, fromY = 0, bound = [ ], bounds = [ ], + segs = arcToSegments(tx - fx, ty - fy, rx, ry, large, sweep, rot), + boundCopy = [[ ], [ ]]; + + for (var i = 0, len = segs.length; i < len; i++) { + bound = getBoundsOfCurve(fromX, fromY, segs[i][0], segs[i][1], segs[i][2], segs[i][3], segs[i][4], segs[i][5]); + boundCopy[0].x = bound[0].x + fx; + boundCopy[0].y = bound[0].y + fy; + boundCopy[1].x = bound[1].x + fx; + boundCopy[1].y = bound[1].y + fy; + bounds.push(boundCopy[0]); + bounds.push(boundCopy[1]); + fromX = segs[i][4]; + fromY = segs[i][5]; + } + return bounds; + }; + + /** + * Calculate bounding box of a beziercurve + * @param {Number} x0 starting point + * @param {Number} y0 + * @param {Number} x1 first control point + * @param {Number} y1 + * @param {Number} x2 secondo control point + * @param {Number} y2 + * @param {Number} x3 end of beizer + * @param {Number} y3 + */ + // taken from http://jsbin.com/ivomiq/56/edit no credits available for that. + function getBoundsOfCurve(x0, y0, x1, y1, x2, y2, x3, y3) { + var argsString = _join.call(arguments); + if (boundsOfCurveCache[argsString]) { + return boundsOfCurveCache[argsString]; + } + + var sqrt = Math.sqrt, + min = Math.min, max = Math.max, + abs = Math.abs, tvalues = [ ], + bounds = [[ ], [ ]], + a, b, c, t, t1, t2, b2ac, sqrtb2ac; + + b = 6 * x0 - 12 * x1 + 6 * x2; + a = -3 * x0 + 9 * x1 - 9 * x2 + 3 * x3; + c = 3 * x1 - 3 * x0; + + for (var i = 0; i < 2; ++i) { + if (i > 0) { + b = 6 * y0 - 12 * y1 + 6 * y2; + a = -3 * y0 + 9 * y1 - 9 * y2 + 3 * y3; + c = 3 * y1 - 3 * y0; + } + + if (abs(a) < 1e-12) { + if (abs(b) < 1e-12) { + continue; + } + t = -c / b; + if (0 < t && t < 1) { + tvalues.push(t); + } + continue; + } + b2ac = b * b - 4 * c * a; + if (b2ac < 0) { + continue; + } + sqrtb2ac = sqrt(b2ac); + t1 = (-b + sqrtb2ac) / (2 * a); + if (0 < t1 && t1 < 1) { + tvalues.push(t1); + } + t2 = (-b - sqrtb2ac) / (2 * a); + if (0 < t2 && t2 < 1) { + tvalues.push(t2); + } + } + + var x, y, j = tvalues.length, jlen = j, mt; + while (j--) { + t = tvalues[j]; + mt = 1 - t; + x = (mt * mt * mt * x0) + (3 * mt * mt * t * x1) + (3 * mt * t * t * x2) + (t * t * t * x3); + bounds[0][j] = x; + + y = (mt * mt * mt * y0) + (3 * mt * mt * t * y1) + (3 * mt * t * t * y2) + (t * t * t * y3); + bounds[1][j] = y; + } + + bounds[0][jlen] = x0; + bounds[1][jlen] = y0; + bounds[0][jlen + 1] = x3; + bounds[1][jlen + 1] = y3; + var result = [ + { + x: min.apply(null, bounds[0]), + y: min.apply(null, bounds[1]) + }, + { + x: max.apply(null, bounds[0]), + y: max.apply(null, bounds[1]) + } + ]; + boundsOfCurveCache[argsString] = result; + return result; + } + + fabric.util.getBoundsOfCurve = getBoundsOfCurve; + +})(); + + +(function() { + + var slice = Array.prototype.slice; + + /* _ES5_COMPAT_START_ */ + + if (!Array.prototype.indexOf) { + /** + * Finds index of an element in an array + * @param {Any} searchElement + * @param {Number} [fromIndex] + * @return {Number} + */ + Array.prototype.indexOf = function (searchElement /*, fromIndex */ ) { + if (this === void 0 || this === null) { + throw new TypeError(); + } + var t = Object(this), len = t.length >>> 0; + if (len === 0) { + return -1; + } + var n = 0; + if (arguments.length > 0) { + n = Number(arguments[1]); + if (n !== n) { // shortcut for verifying if it's NaN + n = 0; + } + else if (n !== 0 && n !== Number.POSITIVE_INFINITY && n !== Number.NEGATIVE_INFINITY) { + n = (n > 0 || -1) * Math.floor(Math.abs(n)); + } + } + if (n >= len) { + return -1; + } + var k = n >= 0 ? n : Math.max(len - Math.abs(n), 0); + for (; k < len; k++) { + if (k in t && t[k] === searchElement) { + return k; + } + } + return -1; + }; + } + + if (!Array.prototype.forEach) { + /** + * Iterates an array, invoking callback for each element + * @param {Function} fn Callback to invoke for each element + * @param {Object} [context] Context to invoke callback in + * @return {Array} + */ + Array.prototype.forEach = function(fn, context) { + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this) { + fn.call(context, this[i], i, this); + } + } + }; + } + + if (!Array.prototype.map) { + /** + * Returns a result of iterating over an array, invoking callback for each element + * @param {Function} fn Callback to invoke for each element + * @param {Object} [context] Context to invoke callback in + * @return {Array} + */ + Array.prototype.map = function(fn, context) { + var result = [ ]; + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this) { + result[i] = fn.call(context, this[i], i, this); + } + } + return result; + }; + } + + if (!Array.prototype.every) { + /** + * Returns true if a callback returns truthy value for all elements in an array + * @param {Function} fn Callback to invoke for each element + * @param {Object} [context] Context to invoke callback in + * @return {Boolean} + */ + Array.prototype.every = function(fn, context) { + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this && !fn.call(context, this[i], i, this)) { + return false; + } + } + return true; + }; + } + + if (!Array.prototype.some) { + /** + * Returns true if a callback returns truthy value for at least one element in an array + * @param {Function} fn Callback to invoke for each element + * @param {Object} [context] Context to invoke callback in + * @return {Boolean} + */ + Array.prototype.some = function(fn, context) { + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this && fn.call(context, this[i], i, this)) { + return true; + } + } + return false; + }; + } + + if (!Array.prototype.filter) { + /** + * Returns the result of iterating over elements in an array + * @param {Function} fn Callback to invoke for each element + * @param {Object} [context] Context to invoke callback in + * @return {Array} + */ + Array.prototype.filter = function(fn, context) { + var result = [ ], val; + for (var i = 0, len = this.length >>> 0; i < len; i++) { + if (i in this) { + val = this[i]; // in case fn mutates this + if (fn.call(context, val, i, this)) { + result.push(val); + } + } + } + return result; + }; + } + + if (!Array.prototype.reduce) { + /** + * Returns "folded" (reduced) result of iterating over elements in an array + * @param {Function} fn Callback to invoke for each element + * @param {Object} [initial] Object to use as the first argument to the first call of the callback + * @return {Any} + */ + Array.prototype.reduce = function(fn /*, initial*/) { + var len = this.length >>> 0, + i = 0, + rv; + + if (arguments.length > 1) { + rv = arguments[1]; + } + else { + do { + if (i in this) { + rv = this[i++]; + break; + } + // if array contains no values, no initial value to return + if (++i >= len) { + throw new TypeError(); + } + } + while (true); + } + for (; i < len; i++) { + if (i in this) { + rv = fn.call(null, rv, this[i], i, this); + } + } + return rv; + }; + } + + /* _ES5_COMPAT_END_ */ + + /** + * Invokes method on all items in a given array + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} method Name of a method to invoke + * @return {Array} + */ + function invoke(array, method) { + var args = slice.call(arguments, 2), result = [ ]; + for (var i = 0, len = array.length; i < len; i++) { + result[i] = args.length ? array[i][method].apply(array[i], args) : array[i][method].call(array[i]); + } + return result; + } + + /** + * Finds maximum value in array (not necessarily "first" one) + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} byProperty + * @return {Any} + */ + function max(array, byProperty) { + return find(array, byProperty, function(value1, value2) { + return value1 >= value2; + }); + } + + /** + * Finds minimum value in array (not necessarily "first" one) + * @memberOf fabric.util.array + * @param {Array} array Array to iterate over + * @param {String} byProperty + * @return {Any} + */ + function min(array, byProperty) { + return find(array, byProperty, function(value1, value2) { + return value1 < value2; + }); + } + + /** + * @private + */ + function find(array, byProperty, condition) { + if (!array || array.length === 0) { + return; + } + + var i = array.length - 1, + result = byProperty ? array[i][byProperty] : array[i]; + if (byProperty) { + while (i--) { + if (condition(array[i][byProperty], result)) { + result = array[i][byProperty]; + } + } + } + else { + while (i--) { + if (condition(array[i], result)) { + result = array[i]; + } + } + } + return result; + } + + /** + * @namespace fabric.util.array + */ + fabric.util.array = { + invoke: invoke, + min: min, + max: max + }; + +})(); + + +(function() { + + /** + * Copies all enumerable properties of one object to another + * @memberOf fabric.util.object + * @param {Object} destination Where to copy to + * @param {Object} source Where to copy from + * @return {Object} + */ + function extend(destination, source) { + // JScript DontEnum bug is not taken care of + for (var property in source) { + destination[property] = source[property]; + } + return destination; + } + + /** + * Creates an empty object and copies all enumerable properties of another object to it + * @memberOf fabric.util.object + * @param {Object} object Object to clone + * @return {Object} + */ + function clone(object) { + return extend({ }, object); + } + + /** @namespace fabric.util.object */ + fabric.util.object = { + extend: extend, + clone: clone + }; + +})(); + + +(function() { + + /* _ES5_COMPAT_START_ */ + if (!String.prototype.trim) { + /** + * Trims a string (removing whitespace from the beginning and the end) + * @function external:String#trim + * @see String#trim on MDN + */ + String.prototype.trim = function () { + // this trim is not fully ES3 or ES5 compliant, but it should cover most cases for now + return this.replace(/^[\s\xA0]+/, '').replace(/[\s\xA0]+$/, ''); + }; + } + /* _ES5_COMPAT_END_ */ + + /** + * Camelizes a string + * @memberOf fabric.util.string + * @param {String} string String to camelize + * @return {String} Camelized version of a string + */ + function camelize(string) { + return string.replace(/-+(.)?/g, function(match, character) { + return character ? character.toUpperCase() : ''; + }); + } + + /** + * Capitalizes a string + * @memberOf fabric.util.string + * @param {String} string String to capitalize + * @param {Boolean} [firstLetterOnly] If true only first letter is capitalized + * and other letters stay untouched, if false first letter is capitalized + * and other letters are converted to lowercase. + * @return {String} Capitalized version of a string + */ + function capitalize(string, firstLetterOnly) { + return string.charAt(0).toUpperCase() + + (firstLetterOnly ? string.slice(1) : string.slice(1).toLowerCase()); + } + + /** + * Escapes XML in a string + * @memberOf fabric.util.string + * @param {String} string String to escape + * @return {String} Escaped version of a string + */ + function escapeXml(string) { + return string.replace(/&/g, '&') + .replace(/"/g, '"') + .replace(/'/g, ''') + .replace(//g, '>'); + } + + /** + * String utilities + * @namespace fabric.util.string + */ + fabric.util.string = { + camelize: camelize, + capitalize: capitalize, + escapeXml: escapeXml + }; +}()); + + +/* _ES5_COMPAT_START_ */ +(function() { + + var slice = Array.prototype.slice, + apply = Function.prototype.apply, + Dummy = function() { }; + + if (!Function.prototype.bind) { + /** + * Cross-browser approximation of ES5 Function.prototype.bind (not fully spec conforming) + * @see Function#bind on MDN + * @param {Object} thisArg Object to bind function to + * @param {Any[]} [...] Values to pass to a bound function + * @return {Function} + */ + Function.prototype.bind = function(thisArg) { + var _this = this, args = slice.call(arguments, 1), bound; + if (args.length) { + bound = function() { + return apply.call(_this, this instanceof Dummy ? this : thisArg, args.concat(slice.call(arguments))); + }; + } + else { + /** @ignore */ + bound = function() { + return apply.call(_this, this instanceof Dummy ? this : thisArg, arguments); + }; + } + Dummy.prototype = this.prototype; + bound.prototype = new Dummy(); + + return bound; + }; + } + +})(); +/* _ES5_COMPAT_END_ */ + + +(function() { + + var slice = Array.prototype.slice, emptyFunction = function() { }, + + IS_DONTENUM_BUGGY = (function() { + for (var p in { toString: 1 }) { + if (p === 'toString') { + return false; + } + } + return true; + })(), + + /** @ignore */ + addMethods = function(klass, source, parent) { + for (var property in source) { + + if (property in klass.prototype && + typeof klass.prototype[property] === 'function' && + (source[property] + '').indexOf('callSuper') > -1) { + + klass.prototype[property] = (function(property) { + return function() { + + var superclass = this.constructor.superclass; + this.constructor.superclass = parent; + var returnValue = source[property].apply(this, arguments); + this.constructor.superclass = superclass; + + if (property !== 'initialize') { + return returnValue; + } + }; + })(property); + } + else { + klass.prototype[property] = source[property]; + } + + if (IS_DONTENUM_BUGGY) { + if (source.toString !== Object.prototype.toString) { + klass.prototype.toString = source.toString; + } + if (source.valueOf !== Object.prototype.valueOf) { + klass.prototype.valueOf = source.valueOf; + } + } + } + }; + + function Subclass() { } + + function callSuper(methodName) { + var fn = this.constructor.superclass.prototype[methodName]; + return (arguments.length > 1) + ? fn.apply(this, slice.call(arguments, 1)) + : fn.call(this); + } + + /** + * Helper for creation of "classes". + * @memberOf fabric.util + * @param {Function} [parent] optional "Class" to inherit from + * @param {Object} [properties] Properties shared by all instances of this class + * (be careful modifying objects defined here as this would affect all instances) + */ + function createClass() { + var parent = null, + properties = slice.call(arguments, 0); + + if (typeof properties[0] === 'function') { + parent = properties.shift(); + } + function klass() { + this.initialize.apply(this, arguments); + } + + klass.superclass = parent; + klass.subclasses = [ ]; + + if (parent) { + Subclass.prototype = parent.prototype; + klass.prototype = new Subclass(); + parent.subclasses.push(klass); + } + for (var i = 0, length = properties.length; i < length; i++) { + addMethods(klass, properties[i], parent); + } + if (!klass.prototype.initialize) { + klass.prototype.initialize = emptyFunction; + } + klass.prototype.constructor = klass; + klass.prototype.callSuper = callSuper; + return klass; + } + + fabric.util.createClass = createClass; +})(); + + +(function () { + + var unknown = 'unknown'; + + /* EVENT HANDLING */ + + function areHostMethods(object) { + var methodNames = Array.prototype.slice.call(arguments, 1), + t, i, len = methodNames.length; + for (i = 0; i < len; i++) { + t = typeof object[methodNames[i]]; + if (!(/^(?:function|object|unknown)$/).test(t)) { + return false; + } + } + return true; + } + + /** @ignore */ + var getElement, + setElement, + getUniqueId = (function () { + var uid = 0; + return function (element) { + return element.__uniqueID || (element.__uniqueID = 'uniqueID__' + uid++); + }; + })(); + + (function () { + var elements = { }; + /** @ignore */ + getElement = function (uid) { + return elements[uid]; + }; + /** @ignore */ + setElement = function (uid, element) { + elements[uid] = element; + }; + })(); + + function createListener(uid, handler) { + return { + handler: handler, + wrappedHandler: createWrappedHandler(uid, handler) + }; + } + + function createWrappedHandler(uid, handler) { + return function (e) { + handler.call(getElement(uid), e || fabric.window.event); + }; + } + + function createDispatcher(uid, eventName) { + return function (e) { + if (handlers[uid] && handlers[uid][eventName]) { + var handlersForEvent = handlers[uid][eventName]; + for (var i = 0, len = handlersForEvent.length; i < len; i++) { + handlersForEvent[i].call(this, e || fabric.window.event); + } + } + }; + } + + var shouldUseAddListenerRemoveListener = ( + areHostMethods(fabric.document.documentElement, 'addEventListener', 'removeEventListener') && + areHostMethods(fabric.window, 'addEventListener', 'removeEventListener')), + + shouldUseAttachEventDetachEvent = ( + areHostMethods(fabric.document.documentElement, 'attachEvent', 'detachEvent') && + areHostMethods(fabric.window, 'attachEvent', 'detachEvent')), + + // IE branch + listeners = { }, + + // DOM L0 branch + handlers = { }, + + addListener, removeListener; + + if (shouldUseAddListenerRemoveListener) { + /** @ignore */ + addListener = function (element, eventName, handler) { + element.addEventListener(eventName, handler, false); + }; + /** @ignore */ + removeListener = function (element, eventName, handler) { + element.removeEventListener(eventName, handler, false); + }; + } + + else if (shouldUseAttachEventDetachEvent) { + /** @ignore */ + addListener = function (element, eventName, handler) { + var uid = getUniqueId(element); + setElement(uid, element); + if (!listeners[uid]) { + listeners[uid] = { }; + } + if (!listeners[uid][eventName]) { + listeners[uid][eventName] = [ ]; + + } + var listener = createListener(uid, handler); + listeners[uid][eventName].push(listener); + element.attachEvent('on' + eventName, listener.wrappedHandler); + }; + /** @ignore */ + removeListener = function (element, eventName, handler) { + var uid = getUniqueId(element), listener; + if (listeners[uid] && listeners[uid][eventName]) { + for (var i = 0, len = listeners[uid][eventName].length; i < len; i++) { + listener = listeners[uid][eventName][i]; + if (listener && listener.handler === handler) { + element.detachEvent('on' + eventName, listener.wrappedHandler); + listeners[uid][eventName][i] = null; + } + } + } + }; + } + else { + /** @ignore */ + addListener = function (element, eventName, handler) { + var uid = getUniqueId(element); + if (!handlers[uid]) { + handlers[uid] = { }; + } + if (!handlers[uid][eventName]) { + handlers[uid][eventName] = [ ]; + var existingHandler = element['on' + eventName]; + if (existingHandler) { + handlers[uid][eventName].push(existingHandler); + } + element['on' + eventName] = createDispatcher(uid, eventName); + } + handlers[uid][eventName].push(handler); + }; + /** @ignore */ + removeListener = function (element, eventName, handler) { + var uid = getUniqueId(element); + if (handlers[uid] && handlers[uid][eventName]) { + var handlersForEvent = handlers[uid][eventName]; + for (var i = 0, len = handlersForEvent.length; i < len; i++) { + if (handlersForEvent[i] === handler) { + handlersForEvent.splice(i, 1); + } + } + } + }; + } + + /** + * Adds an event listener to an element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {String} eventName + * @param {Function} handler + */ + fabric.util.addListener = addListener; + + /** + * Removes an event listener from an element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {String} eventName + * @param {Function} handler + */ + fabric.util.removeListener = removeListener; + + /** + * Cross-browser wrapper for getting event's coordinates + * @memberOf fabric.util + * @param {Event} event Event object + * @param {HTMLCanvasElement} upperCanvasEl <canvas> element on which object selection is drawn + */ + function getPointer(event, upperCanvasEl) { + event || (event = fabric.window.event); + + var element = event.target || + (typeof event.srcElement !== unknown ? event.srcElement : null), + + scroll = fabric.util.getScrollLeftTop(element, upperCanvasEl); + + return { + x: pointerX(event) + scroll.left, + y: pointerY(event) + scroll.top + }; + } + + var pointerX = function(event) { + // looks like in IE (<9) clientX at certain point (apparently when mouseup fires on VML element) + // is represented as COM object, with all the consequences, like "unknown" type and error on [[Get]] + // need to investigate later + return (typeof event.clientX !== unknown ? event.clientX : 0); + }, + + pointerY = function(event) { + return (typeof event.clientY !== unknown ? event.clientY : 0); + }; + + function _getPointer(event, pageProp, clientProp) { + var touchProp = event.type === 'touchend' ? 'changedTouches' : 'touches'; + + return (event[touchProp] && event[touchProp][0] + ? (event[touchProp][0][pageProp] - (event[touchProp][0][pageProp] - event[touchProp][0][clientProp])) + || event[clientProp] + : event[clientProp]); + } + + if (fabric.isTouchSupported) { + pointerX = function(event) { + return _getPointer(event, 'pageX', 'clientX'); + }; + pointerY = function(event) { + return _getPointer(event, 'pageY', 'clientY'); + }; + } + + fabric.util.getPointer = getPointer; + + fabric.util.object.extend(fabric.util, fabric.Observable); + +})(); + + +(function () { + + /** + * Cross-browser wrapper for setting element's style + * @memberOf fabric.util + * @param {HTMLElement} element + * @param {Object} styles + * @return {HTMLElement} Element that was passed as a first argument + */ + function setStyle(element, styles) { + var elementStyle = element.style; + if (!elementStyle) { + return element; + } + if (typeof styles === 'string') { + element.style.cssText += ';' + styles; + return styles.indexOf('opacity') > -1 + ? setOpacity(element, styles.match(/opacity:\s*(\d?\.?\d*)/)[1]) + : element; + } + for (var property in styles) { + if (property === 'opacity') { + setOpacity(element, styles[property]); + } + else { + var normalizedProperty = (property === 'float' || property === 'cssFloat') + ? (typeof elementStyle.styleFloat === 'undefined' ? 'cssFloat' : 'styleFloat') + : property; + elementStyle[normalizedProperty] = styles[property]; + } + } + return element; + } + + var parseEl = fabric.document.createElement('div'), + supportsOpacity = typeof parseEl.style.opacity === 'string', + supportsFilters = typeof parseEl.style.filter === 'string', + reOpacity = /alpha\s*\(\s*opacity\s*=\s*([^\)]+)\)/, + + /** @ignore */ + setOpacity = function (element) { return element; }; + + if (supportsOpacity) { + /** @ignore */ + setOpacity = function(element, value) { + element.style.opacity = value; + return element; + }; + } + else if (supportsFilters) { + /** @ignore */ + setOpacity = function(element, value) { + var es = element.style; + if (element.currentStyle && !element.currentStyle.hasLayout) { + es.zoom = 1; + } + if (reOpacity.test(es.filter)) { + value = value >= 0.9999 ? '' : ('alpha(opacity=' + (value * 100) + ')'); + es.filter = es.filter.replace(reOpacity, value); + } + else { + es.filter += ' alpha(opacity=' + (value * 100) + ')'; + } + return element; + }; + } + + fabric.util.setStyle = setStyle; + +})(); + + +(function() { + + var _slice = Array.prototype.slice; + + /** + * Takes id and returns an element with that id (if one exists in a document) + * @memberOf fabric.util + * @param {String|HTMLElement} id + * @return {HTMLElement|null} + */ + function getById(id) { + return typeof id === 'string' ? fabric.document.getElementById(id) : id; + } + + var sliceCanConvertNodelists, + /** + * Converts an array-like object (e.g. arguments or NodeList) to an array + * @memberOf fabric.util + * @param {Object} arrayLike + * @return {Array} + */ + toArray = function(arrayLike) { + return _slice.call(arrayLike, 0); + }; + + try { + sliceCanConvertNodelists = toArray(fabric.document.childNodes) instanceof Array; + } + catch (err) { } + + if (!sliceCanConvertNodelists) { + toArray = function(arrayLike) { + var arr = new Array(arrayLike.length), i = arrayLike.length; + while (i--) { + arr[i] = arrayLike[i]; + } + return arr; + }; + } + + /** + * Creates specified element with specified attributes + * @memberOf fabric.util + * @param {String} tagName Type of an element to create + * @param {Object} [attributes] Attributes to set on an element + * @return {HTMLElement} Newly created element + */ + function makeElement(tagName, attributes) { + var el = fabric.document.createElement(tagName); + for (var prop in attributes) { + if (prop === 'class') { + el.className = attributes[prop]; + } + else if (prop === 'for') { + el.htmlFor = attributes[prop]; + } + else { + el.setAttribute(prop, attributes[prop]); + } + } + return el; + } + + /** + * Adds class to an element + * @memberOf fabric.util + * @param {HTMLElement} element Element to add class to + * @param {String} className Class to add to an element + */ + function addClass(element, className) { + if (element && (' ' + element.className + ' ').indexOf(' ' + className + ' ') === -1) { + element.className += (element.className ? ' ' : '') + className; + } + } + + /** + * Wraps element with another element + * @memberOf fabric.util + * @param {HTMLElement} element Element to wrap + * @param {HTMLElement|String} wrapper Element to wrap with + * @param {Object} [attributes] Attributes to set on a wrapper + * @return {HTMLElement} wrapper + */ + function wrapElement(element, wrapper, attributes) { + if (typeof wrapper === 'string') { + wrapper = makeElement(wrapper, attributes); + } + if (element.parentNode) { + element.parentNode.replaceChild(wrapper, element); + } + wrapper.appendChild(element); + return wrapper; + } + + /** + * Returns element scroll offsets + * @memberOf fabric.util + * @param {HTMLElement} element Element to operate on + * @param {HTMLElement} upperCanvasEl Upper canvas element + * @return {Object} Object with left/top values + */ + function getScrollLeftTop(element, upperCanvasEl) { + + var firstFixedAncestor, + origElement, + left = 0, + top = 0, + docElement = fabric.document.documentElement, + body = fabric.document.body || { + scrollLeft: 0, scrollTop: 0 + }; + + origElement = element; + + while (element && element.parentNode && !firstFixedAncestor) { + + element = element.parentNode; + + if (element.nodeType === 1 && + fabric.util.getElementStyle(element, 'position') === 'fixed') { + firstFixedAncestor = element; + } + + if (element.nodeType === 1 && + origElement !== upperCanvasEl && + fabric.util.getElementStyle(element, 'position') === 'absolute') { + left = 0; + top = 0; + } + else if (element === fabric.document) { + left = body.scrollLeft || docElement.scrollLeft || 0; + top = body.scrollTop || docElement.scrollTop || 0; + } + else { + left += element.scrollLeft || 0; + top += element.scrollTop || 0; + } + } + + return { left: left, top: top }; + } + + /** + * Returns offset for a given element + * @function + * @memberOf fabric.util + * @param {HTMLElement} element Element to get offset for + * @return {Object} Object with "left" and "top" properties + */ + function getElementOffset(element) { + var docElem, + doc = element && element.ownerDocument, + box = { left: 0, top: 0 }, + offset = { left: 0, top: 0 }, + scrollLeftTop, + offsetAttributes = { + borderLeftWidth: 'left', + borderTopWidth: 'top', + paddingLeft: 'left', + paddingTop: 'top' + }; + + if (!doc) { + return { left: 0, top: 0 }; + } + + for (var attr in offsetAttributes) { + offset[offsetAttributes[attr]] += parseInt(getElementStyle(element, attr), 10) || 0; + } + + docElem = doc.documentElement; + if ( typeof element.getBoundingClientRect !== 'undefined' ) { + box = element.getBoundingClientRect(); + } + + scrollLeftTop = fabric.util.getScrollLeftTop(element, null); + + return { + left: box.left + scrollLeftTop.left - (docElem.clientLeft || 0) + offset.left, + top: box.top + scrollLeftTop.top - (docElem.clientTop || 0) + offset.top + }; + } + + /** + * Returns style attribute value of a given element + * @memberOf fabric.util + * @param {HTMLElement} element Element to get style attribute for + * @param {String} attr Style attribute to get for element + * @return {String} Style attribute value of the given element. + */ + var getElementStyle; + if (fabric.document.defaultView && fabric.document.defaultView.getComputedStyle) { + getElementStyle = function(element, attr) { + var style = fabric.document.defaultView.getComputedStyle(element, null); + return style ? style[attr] : undefined; + }; + } + else { + getElementStyle = function(element, attr) { + var value = element.style[attr]; + if (!value && element.currentStyle) { + value = element.currentStyle[attr]; + } + return value; + }; + } + + (function () { + var style = fabric.document.documentElement.style, + selectProp = 'userSelect' in style + ? 'userSelect' + : 'MozUserSelect' in style + ? 'MozUserSelect' + : 'WebkitUserSelect' in style + ? 'WebkitUserSelect' + : 'KhtmlUserSelect' in style + ? 'KhtmlUserSelect' + : ''; + + /** + * Makes element unselectable + * @memberOf fabric.util + * @param {HTMLElement} element Element to make unselectable + * @return {HTMLElement} Element that was passed in + */ + function makeElementUnselectable(element) { + if (typeof element.onselectstart !== 'undefined') { + element.onselectstart = fabric.util.falseFunction; + } + if (selectProp) { + element.style[selectProp] = 'none'; + } + else if (typeof element.unselectable === 'string') { + element.unselectable = 'on'; + } + return element; + } + + /** + * Makes element selectable + * @memberOf fabric.util + * @param {HTMLElement} element Element to make selectable + * @return {HTMLElement} Element that was passed in + */ + function makeElementSelectable(element) { + if (typeof element.onselectstart !== 'undefined') { + element.onselectstart = null; + } + if (selectProp) { + element.style[selectProp] = ''; + } + else if (typeof element.unselectable === 'string') { + element.unselectable = ''; + } + return element; + } + + fabric.util.makeElementUnselectable = makeElementUnselectable; + fabric.util.makeElementSelectable = makeElementSelectable; + })(); + + (function() { + + /** + * Inserts a script element with a given url into a document; invokes callback, when that script is finished loading + * @memberOf fabric.util + * @param {String} url URL of a script to load + * @param {Function} callback Callback to execute when script is finished loading + */ + function getScript(url, callback) { + var headEl = fabric.document.getElementsByTagName('head')[0], + scriptEl = fabric.document.createElement('script'), + loading = true; + + /** @ignore */ + scriptEl.onload = /** @ignore */ scriptEl.onreadystatechange = function(e) { + if (loading) { + if (typeof this.readyState === 'string' && + this.readyState !== 'loaded' && + this.readyState !== 'complete') { + return; + } + loading = false; + callback(e || fabric.window.event); + scriptEl = scriptEl.onload = scriptEl.onreadystatechange = null; + } + }; + scriptEl.src = url; + headEl.appendChild(scriptEl); + // causes issue in Opera + // headEl.removeChild(scriptEl); + } + + fabric.util.getScript = getScript; + })(); + + fabric.util.getById = getById; + fabric.util.toArray = toArray; + fabric.util.makeElement = makeElement; + fabric.util.addClass = addClass; + fabric.util.wrapElement = wrapElement; + fabric.util.getScrollLeftTop = getScrollLeftTop; + fabric.util.getElementOffset = getElementOffset; + fabric.util.getElementStyle = getElementStyle; + +})(); + + +(function() { + + function addParamToUrl(url, param) { + return url + (/\?/.test(url) ? '&' : '?') + param; + } + + var makeXHR = (function() { + var factories = [ + function() { return new ActiveXObject('Microsoft.XMLHTTP'); }, + function() { return new ActiveXObject('Msxml2.XMLHTTP'); }, + function() { return new ActiveXObject('Msxml2.XMLHTTP.3.0'); }, + function() { return new XMLHttpRequest(); } + ]; + for (var i = factories.length; i--; ) { + try { + var req = factories[i](); + if (req) { + return factories[i]; + } + } + catch (err) { } + } + })(); + + function emptyFn() { } + + /** + * Cross-browser abstraction for sending XMLHttpRequest + * @memberOf fabric.util + * @param {String} url URL to send XMLHttpRequest to + * @param {Object} [options] Options object + * @param {String} [options.method="GET"] + * @param {Function} options.onComplete Callback to invoke when request is completed + * @return {XMLHttpRequest} request + */ + function request(url, options) { + + options || (options = { }); + + var method = options.method ? options.method.toUpperCase() : 'GET', + onComplete = options.onComplete || function() { }, + xhr = makeXHR(), + body; + + /** @ignore */ + xhr.onreadystatechange = function() { + if (xhr.readyState === 4) { + onComplete(xhr); + xhr.onreadystatechange = emptyFn; + } + }; + + if (method === 'GET') { + body = null; + if (typeof options.parameters === 'string') { + url = addParamToUrl(url, options.parameters); + } + } + + xhr.open(method, url, true); + + if (method === 'POST' || method === 'PUT') { + xhr.setRequestHeader('Content-Type', 'application/x-www-form-urlencoded'); + } + + xhr.send(body); + return xhr; + } + + fabric.util.request = request; +})(); + + +/** + * Wrapper around `console.log` (when available) + * @param {Any} [values] Values to log + */ +fabric.log = function() { }; + +/** + * Wrapper around `console.warn` (when available) + * @param {Any} [values] Values to log as a warning + */ +fabric.warn = function() { }; + +if (typeof console !== 'undefined') { + + ['log', 'warn'].forEach(function(methodName) { + + if (typeof console[methodName] !== 'undefined' && + typeof console[methodName].apply === 'function') { + + fabric[methodName] = function() { + return console[methodName].apply(console, arguments); + }; + } + }); +} + + +(function() { + + /** + * Changes value from one to another within certain period of time, invoking callbacks as value is being changed. + * @memberOf fabric.util + * @param {Object} [options] Animation options + * @param {Function} [options.onChange] Callback; invoked on every value change + * @param {Function} [options.onComplete] Callback; invoked when value change is completed + * @param {Number} [options.startValue=0] Starting value + * @param {Number} [options.endValue=100] Ending value + * @param {Number} [options.byValue=100] Value to modify the property by + * @param {Function} [options.easing] Easing function + * @param {Number} [options.duration=500] Duration of change (in ms) + */ + function animate(options) { + + requestAnimFrame(function(timestamp) { + options || (options = { }); + + var start = timestamp || +new Date(), + duration = options.duration || 500, + finish = start + duration, time, + onChange = options.onChange || function() { }, + abort = options.abort || function() { return false; }, + easing = options.easing || function(t, b, c, d) {return -c * Math.cos(t / d * (Math.PI / 2)) + c + b;}, + startValue = 'startValue' in options ? options.startValue : 0, + endValue = 'endValue' in options ? options.endValue : 100, + byValue = options.byValue || endValue - startValue; + + options.onStart && options.onStart(); + + (function tick(ticktime) { + time = ticktime || +new Date(); + var currentTime = time > finish ? duration : (time - start); + if (abort()) { + options.onComplete && options.onComplete(); + return; + } + onChange(easing(currentTime, startValue, byValue, duration)); + if (time > finish) { + options.onComplete && options.onComplete(); + return; + } + requestAnimFrame(tick); + })(start); + }); + + } + + var _requestAnimFrame = fabric.window.requestAnimationFrame || + fabric.window.webkitRequestAnimationFrame || + fabric.window.mozRequestAnimationFrame || + fabric.window.oRequestAnimationFrame || + fabric.window.msRequestAnimationFrame || + function(callback) { + fabric.window.setTimeout(callback, 1000 / 60); + }; + /** + * requestAnimationFrame polyfill based on http://paulirish.com/2011/requestanimationframe-for-smart-animating/ + * In order to get a precise start time, `requestAnimFrame` should be called as an entry into the method + * @memberOf fabric.util + * @param {Function} callback Callback to invoke + * @param {DOMElement} element optional Element to associate with animation + */ + function requestAnimFrame() { + return _requestAnimFrame.apply(fabric.window, arguments); + } + + fabric.util.animate = animate; + fabric.util.requestAnimFrame = requestAnimFrame; + +})(); + + +(function() { + + function normalize(a, c, p, s) { + if (a < Math.abs(c)) { + a = c; + s = p / 4; + } + else { + s = p / (2 * Math.PI) * Math.asin(c / a); + } + return { a: a, c: c, p: p, s: s }; + } + + function elastic(opts, t, d) { + return opts.a * + Math.pow(2, 10 * (t -= 1)) * + Math.sin( (t * d - opts.s) * (2 * Math.PI) / opts.p ); + } + + /** + * Cubic easing out + * @memberOf fabric.util.ease + */ + function easeOutCubic(t, b, c, d) { + return c * ((t = t / d - 1) * t * t + 1) + b; + } + + /** + * Cubic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutCubic(t, b, c, d) { + t /= d/2; + if (t < 1) { + return c / 2 * t * t * t + b; + } + return c / 2 * ((t -= 2) * t * t + 2) + b; + } + + /** + * Quartic easing in + * @memberOf fabric.util.ease + */ + function easeInQuart(t, b, c, d) { + return c * (t /= d) * t * t * t + b; + } + + /** + * Quartic easing out + * @memberOf fabric.util.ease + */ + function easeOutQuart(t, b, c, d) { + return -c * ((t = t / d - 1) * t * t * t - 1) + b; + } + + /** + * Quartic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutQuart(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t * t * t + b; + } + return -c / 2 * ((t -= 2) * t * t * t - 2) + b; + } + + /** + * Quintic easing in + * @memberOf fabric.util.ease + */ + function easeInQuint(t, b, c, d) { + return c * (t /= d) * t * t * t * t + b; + } + + /** + * Quintic easing out + * @memberOf fabric.util.ease + */ + function easeOutQuint(t, b, c, d) { + return c * ((t = t / d - 1) * t * t * t * t + 1) + b; + } + + /** + * Quintic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutQuint(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return c / 2 * t * t * t * t * t + b; + } + return c / 2 * ((t -= 2) * t * t * t * t + 2) + b; + } + + /** + * Sinusoidal easing in + * @memberOf fabric.util.ease + */ + function easeInSine(t, b, c, d) { + return -c * Math.cos(t / d * (Math.PI / 2)) + c + b; + } + + /** + * Sinusoidal easing out + * @memberOf fabric.util.ease + */ + function easeOutSine(t, b, c, d) { + return c * Math.sin(t / d * (Math.PI / 2)) + b; + } + + /** + * Sinusoidal easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutSine(t, b, c, d) { + return -c / 2 * (Math.cos(Math.PI * t / d) - 1) + b; + } + + /** + * Exponential easing in + * @memberOf fabric.util.ease + */ + function easeInExpo(t, b, c, d) { + return (t === 0) ? b : c * Math.pow(2, 10 * (t / d - 1)) + b; + } + + /** + * Exponential easing out + * @memberOf fabric.util.ease + */ + function easeOutExpo(t, b, c, d) { + return (t === d) ? b + c : c * (-Math.pow(2, -10 * t / d) + 1) + b; + } + + /** + * Exponential easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutExpo(t, b, c, d) { + if (t === 0) { + return b; + } + if (t === d) { + return b + c; + } + t /= d / 2; + if (t < 1) { + return c / 2 * Math.pow(2, 10 * (t - 1)) + b; + } + return c / 2 * (-Math.pow(2, -10 * --t) + 2) + b; + } + + /** + * Circular easing in + * @memberOf fabric.util.ease + */ + function easeInCirc(t, b, c, d) { + return -c * (Math.sqrt(1 - (t /= d) * t) - 1) + b; + } + + /** + * Circular easing out + * @memberOf fabric.util.ease + */ + function easeOutCirc(t, b, c, d) { + return c * Math.sqrt(1 - (t = t / d - 1) * t) + b; + } + + /** + * Circular easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutCirc(t, b, c, d) { + t /= d / 2; + if (t < 1) { + return -c / 2 * (Math.sqrt(1 - t * t) - 1) + b; + } + return c / 2 * (Math.sqrt(1 - (t -= 2) * t) + 1) + b; + } + + /** + * Elastic easing in + * @memberOf fabric.util.ease + */ + function easeInElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d; + if (t === 1) { + return b + c; + } + if (!p) { + p = d * 0.3; + } + var opts = normalize(a, c, p, s); + return -elastic(opts, t, d) + b; + } + + /** + * Elastic easing out + * @memberOf fabric.util.ease + */ + function easeOutElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d; + if (t === 1) { + return b + c; + } + if (!p) { + p = d * 0.3; + } + var opts = normalize(a, c, p, s); + return opts.a * Math.pow(2, -10 * t) * Math.sin((t * d - opts.s) * (2 * Math.PI) / opts.p ) + opts.c + b; + } + + /** + * Elastic easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutElastic(t, b, c, d) { + var s = 1.70158, p = 0, a = c; + if (t === 0) { + return b; + } + t /= d / 2; + if (t === 2) { + return b + c; + } + if (!p) { + p = d * (0.3 * 1.5); + } + var opts = normalize(a, c, p, s); + if (t < 1) { + return -0.5 * elastic(opts, t, d) + b; + } + return opts.a * Math.pow(2, -10 * (t -= 1)) * + Math.sin((t * d - opts.s) * (2 * Math.PI) / opts.p ) * 0.5 + opts.c + b; + } + + /** + * Backwards easing in + * @memberOf fabric.util.ease + */ + function easeInBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + return c * (t /= d) * t * ((s + 1) * t - s) + b; + } + + /** + * Backwards easing out + * @memberOf fabric.util.ease + */ + function easeOutBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + return c * ((t = t / d - 1) * t * ((s + 1) * t + s) + 1) + b; + } + + /** + * Backwards easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutBack(t, b, c, d, s) { + if (s === undefined) { + s = 1.70158; + } + t /= d / 2; + if (t < 1) { + return c / 2 * (t * t * (((s *= (1.525)) + 1) * t - s)) + b; + } + return c / 2 * ((t -= 2) * t * (((s *= (1.525)) + 1) * t + s) + 2) + b; + } + + /** + * Bouncing easing in + * @memberOf fabric.util.ease + */ + function easeInBounce(t, b, c, d) { + return c - easeOutBounce (d - t, 0, c, d) + b; + } + + /** + * Bouncing easing out + * @memberOf fabric.util.ease + */ + function easeOutBounce(t, b, c, d) { + if ((t /= d) < (1 / 2.75)) { + return c * (7.5625 * t * t) + b; + } + else if (t < (2/2.75)) { + return c * (7.5625 * (t -= (1.5 / 2.75)) * t + 0.75) + b; + } + else if (t < (2.5/2.75)) { + return c * (7.5625 * (t -= (2.25 / 2.75)) * t + 0.9375) + b; + } + else { + return c * (7.5625 * (t -= (2.625 / 2.75)) * t + 0.984375) + b; + } + } + + /** + * Bouncing easing in and out + * @memberOf fabric.util.ease + */ + function easeInOutBounce(t, b, c, d) { + if (t < d / 2) { + return easeInBounce (t * 2, 0, c, d) * 0.5 + b; + } + return easeOutBounce(t * 2 - d, 0, c, d) * 0.5 + c * 0.5 + b; + } + + /** + * Easing functions + * See Easing Equations by Robert Penner + * @namespace fabric.util.ease + */ + fabric.util.ease = { + + /** + * Quadratic easing in + * @memberOf fabric.util.ease + */ + easeInQuad: function(t, b, c, d) { + return c * (t /= d) * t + b; + }, + + /** + * Quadratic easing out + * @memberOf fabric.util.ease + */ + easeOutQuad: function(t, b, c, d) { + return -c * (t /= d) * (t - 2) + b; + }, + + /** + * Quadratic easing in and out + * @memberOf fabric.util.ease + */ + easeInOutQuad: function(t, b, c, d) { + t /= (d / 2); + if (t < 1) { + return c / 2 * t * t + b; + } + return -c / 2 * ((--t) * (t - 2) - 1) + b; + }, + + /** + * Cubic easing in + * @memberOf fabric.util.ease + */ + easeInCubic: function(t, b, c, d) { + return c * (t /= d) * t * t + b; + }, + + easeOutCubic: easeOutCubic, + easeInOutCubic: easeInOutCubic, + easeInQuart: easeInQuart, + easeOutQuart: easeOutQuart, + easeInOutQuart: easeInOutQuart, + easeInQuint: easeInQuint, + easeOutQuint: easeOutQuint, + easeInOutQuint: easeInOutQuint, + easeInSine: easeInSine, + easeOutSine: easeOutSine, + easeInOutSine: easeInOutSine, + easeInExpo: easeInExpo, + easeOutExpo: easeOutExpo, + easeInOutExpo: easeInOutExpo, + easeInCirc: easeInCirc, + easeOutCirc: easeOutCirc, + easeInOutCirc: easeInOutCirc, + easeInElastic: easeInElastic, + easeOutElastic: easeOutElastic, + easeInOutElastic: easeInOutElastic, + easeInBack: easeInBack, + easeOutBack: easeOutBack, + easeInOutBack: easeInOutBack, + easeInBounce: easeInBounce, + easeOutBounce: easeOutBounce, + easeInOutBounce: easeInOutBounce + }; + +}()); + + +(function(global) { + + 'use strict'; + + /** + * @name fabric + * @namespace + */ + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + capitalize = fabric.util.string.capitalize, + clone = fabric.util.object.clone, + toFixed = fabric.util.toFixed, + parseUnit = fabric.util.parseUnit, + multiplyTransformMatrices = fabric.util.multiplyTransformMatrices, + + attributesMap = { + cx: 'left', + x: 'left', + r: 'radius', + cy: 'top', + y: 'top', + display: 'visible', + visibility: 'visible', + transform: 'transformMatrix', + 'fill-opacity': 'fillOpacity', + 'fill-rule': 'fillRule', + 'font-family': 'fontFamily', + 'font-size': 'fontSize', + 'font-style': 'fontStyle', + 'font-weight': 'fontWeight', + 'stroke-dasharray': 'strokeDashArray', + 'stroke-linecap': 'strokeLineCap', + 'stroke-linejoin': 'strokeLineJoin', + 'stroke-miterlimit': 'strokeMiterLimit', + 'stroke-opacity': 'strokeOpacity', + 'stroke-width': 'strokeWidth', + 'text-decoration': 'textDecoration', + 'text-anchor': 'originX' + }, + + colorAttributes = { + stroke: 'strokeOpacity', + fill: 'fillOpacity' + }; + + fabric.cssRules = { }; + fabric.gradientDefs = { }; + + function normalizeAttr(attr) { + // transform attribute names + if (attr in attributesMap) { + return attributesMap[attr]; + } + return attr; + } + + function normalizeValue(attr, value, parentAttributes, fontSize) { + var isArray = Object.prototype.toString.call(value) === '[object Array]', + parsed; + + if ((attr === 'fill' || attr === 'stroke') && value === 'none') { + value = ''; + } + else if (attr === 'strokeDashArray') { + value = value.replace(/,/g, ' ').split(/\s+/).map(function(n) { + return parseFloat(n); + }); + } + else if (attr === 'transformMatrix') { + if (parentAttributes && parentAttributes.transformMatrix) { + value = multiplyTransformMatrices( + parentAttributes.transformMatrix, fabric.parseTransformAttribute(value)); + } + else { + value = fabric.parseTransformAttribute(value); + } + } + else if (attr === 'visible') { + value = (value === 'none' || value === 'hidden') ? false : true; + // display=none on parent element always takes precedence over child element + if (parentAttributes && parentAttributes.visible === false) { + value = false; + } + } + else if (attr === 'originX' /* text-anchor */) { + value = value === 'start' ? 'left' : value === 'end' ? 'right' : 'center'; + } + else { + parsed = isArray ? value.map(parseUnit) : parseUnit(value, fontSize); + } + + return (!isArray && isNaN(parsed) ? value : parsed); + } + + /** + * @private + * @param {Object} attributes Array of attributes to parse + */ + function _setStrokeFillOpacity(attributes) { + for (var attr in colorAttributes) { + + if (!attributes[attr] || typeof attributes[colorAttributes[attr]] === 'undefined') { + continue; + } + + if (attributes[attr].indexOf('url(') === 0) { + continue; + } + + var color = new fabric.Color(attributes[attr]); + attributes[attr] = color.setAlpha(toFixed(color.getAlpha() * attributes[colorAttributes[attr]], 2)).toRgba(); + } + return attributes; + } + + /** + * Parses "transform" attribute, returning an array of values + * @static + * @function + * @memberOf fabric + * @param {String} attributeValue String containing attribute value + * @return {Array} Array of 6 elements representing transformation matrix + */ + fabric.parseTransformAttribute = (function() { + function rotateMatrix(matrix, args) { + var angle = args[0]; + + matrix[0] = Math.cos(angle); + matrix[1] = Math.sin(angle); + matrix[2] = -Math.sin(angle); + matrix[3] = Math.cos(angle); + } + + function scaleMatrix(matrix, args) { + var multiplierX = args[0], + multiplierY = (args.length === 2) ? args[1] : args[0]; + + matrix[0] = multiplierX; + matrix[3] = multiplierY; + } + + function skewXMatrix(matrix, args) { + matrix[2] = Math.tan(fabric.util.degreesToRadians(args[0])); + } + + function skewYMatrix(matrix, args) { + matrix[1] = Math.tan(fabric.util.degreesToRadians(args[0])); + } + + function translateMatrix(matrix, args) { + matrix[4] = args[0]; + if (args.length === 2) { + matrix[5] = args[1]; + } + } + + // identity matrix + var iMatrix = [ + 1, // a + 0, // b + 0, // c + 1, // d + 0, // e + 0 // f + ], + + // == begin transform regexp + number = fabric.reNum, + + commaWsp = '(?:\\s+,?\\s*|,\\s*)', + + skewX = '(?:(skewX)\\s*\\(\\s*(' + number + ')\\s*\\))', + + skewY = '(?:(skewY)\\s*\\(\\s*(' + number + ')\\s*\\))', + + rotate = '(?:(rotate)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + ')' + + commaWsp + '(' + number + '))?\\s*\\))', + + scale = '(?:(scale)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + '))?\\s*\\))', + + translate = '(?:(translate)\\s*\\(\\s*(' + number + ')(?:' + + commaWsp + '(' + number + '))?\\s*\\))', + + matrix = '(?:(matrix)\\s*\\(\\s*' + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + commaWsp + + '(' + number + ')' + + '\\s*\\))', + + transform = '(?:' + + matrix + '|' + + translate + '|' + + scale + '|' + + rotate + '|' + + skewX + '|' + + skewY + + ')', + + transforms = '(?:' + transform + '(?:' + commaWsp + transform + ')*' + ')', + + transformList = '^\\s*(?:' + transforms + '?)\\s*$', + + // http://www.w3.org/TR/SVG/coords.html#TransformAttribute + reTransformList = new RegExp(transformList), + // == end transform regexp + + reTransform = new RegExp(transform, 'g'); + + return function(attributeValue) { + + // start with identity matrix + var matrix = iMatrix.concat(), + matrices = [ ]; + + // return if no argument was given or + // an argument does not match transform attribute regexp + if (!attributeValue || (attributeValue && !reTransformList.test(attributeValue))) { + return matrix; + } + + attributeValue.replace(reTransform, function(match) { + + var m = new RegExp(transform).exec(match).filter(function (match) { + return (match !== '' && match != null); + }), + operation = m[1], + args = m.slice(2).map(parseFloat); + + switch (operation) { + case 'translate': + translateMatrix(matrix, args); + break; + case 'rotate': + args[0] = fabric.util.degreesToRadians(args[0]); + rotateMatrix(matrix, args); + break; + case 'scale': + scaleMatrix(matrix, args); + break; + case 'skewX': + skewXMatrix(matrix, args); + break; + case 'skewY': + skewYMatrix(matrix, args); + break; + case 'matrix': + matrix = args; + break; + } + + // snapshot current matrix into matrices array + matrices.push(matrix.concat()); + // reset + matrix = iMatrix.concat(); + }); + + var combinedMatrix = matrices[0]; + while (matrices.length > 1) { + matrices.shift(); + combinedMatrix = fabric.util.multiplyTransformMatrices(combinedMatrix, matrices[0]); + } + return combinedMatrix; + }; + })(); + + /** + * @private + */ + function parseStyleString(style, oStyle) { + var attr, value; + style.replace(/;$/, '').split(';').forEach(function (chunk) { + var pair = chunk.split(':'); + + attr = normalizeAttr(pair[0].trim().toLowerCase()); + value = normalizeValue(attr, pair[1].trim()); + + oStyle[attr] = value; + }); + } + + /** + * @private + */ + function parseStyleObject(style, oStyle) { + var attr, value; + for (var prop in style) { + if (typeof style[prop] === 'undefined') { + continue; + } + + attr = normalizeAttr(prop.toLowerCase()); + value = normalizeValue(attr, style[prop]); + + oStyle[attr] = value; + } + } + + /** + * @private + */ + function getGlobalStylesForElement(element, svgUid) { + var styles = { }; + for (var rule in fabric.cssRules[svgUid]) { + if (elementMatchesRule(element, rule.split(' '))) { + for (var property in fabric.cssRules[svgUid][rule]) { + styles[property] = fabric.cssRules[svgUid][rule][property]; + } + } + } + return styles; + } + + /** + * @private + */ + function elementMatchesRule(element, selectors) { + var firstMatching, parentMatching = true; + //start from rightmost selector. + firstMatching = selectorMatches(element, selectors.pop()); + if (firstMatching && selectors.length) { + parentMatching = doesSomeParentMatch(element, selectors); + } + return firstMatching && parentMatching && (selectors.length === 0); + } + + function doesSomeParentMatch(element, selectors) { + var selector, parentMatching = true; + while (element.parentNode && element.parentNode.nodeType === 1 && selectors.length) { + if (parentMatching) { + selector = selectors.pop(); + } + element = element.parentNode; + parentMatching = selectorMatches(element, selector); + } + return selectors.length === 0; + } + /** + * @private + */ + function selectorMatches(element, selector) { + var nodeName = element.nodeName, + classNames = element.getAttribute('class'), + id = element.getAttribute('id'), matcher; + // i check if a selector matches slicing away part from it. + // if i get empty string i should match + matcher = new RegExp('^' + nodeName, 'i'); + selector = selector.replace(matcher, ''); + if (id && selector.length) { + matcher = new RegExp('#' + id + '(?![a-zA-Z\\-]+)', 'i'); + selector = selector.replace(matcher, ''); + } + if (classNames && selector.length) { + classNames = classNames.split(' '); + for (var i = classNames.length; i--;) { + matcher = new RegExp('\\.' + classNames[i] + '(?![a-zA-Z\\-]+)', 'i'); + selector = selector.replace(matcher, ''); + } + } + return selector.length === 0; + } + + /** + * @private + */ + function parseUseDirectives(doc) { + var nodelist = doc.getElementsByTagName('use'); + while (nodelist.length) { + var el = nodelist[0], + xlink = el.getAttribute('xlink:href').substr(1), + x = el.getAttribute('x') || 0, + y = el.getAttribute('y') || 0, + el2 = doc.getElementById(xlink).cloneNode(true), + currentTrans = (el2.getAttribute('transform') || '') + ' translate(' + x + ', ' + y + ')', + parentNode; + + for (var j = 0, attrs = el.attributes, l = attrs.length; j < l; j++) { + var attr = attrs.item(j); + if (attr.nodeName === 'x' || attr.nodeName === 'y' || attr.nodeName === 'xlink:href') { + continue; + } + + if (attr.nodeName === 'transform') { + currentTrans = attr.nodeValue + ' ' + currentTrans; + } + else { + el2.setAttribute(attr.nodeName, attr.nodeValue); + } + } + + el2.setAttribute('transform', currentTrans); + el2.setAttribute('instantiated_by_use', '1'); + el2.removeAttribute('id'); + parentNode = el.parentNode; + parentNode.replaceChild(el2, el); + } + } + + // http://www.w3.org/TR/SVG/coords.html#ViewBoxAttribute + // matches, e.g.: +14.56e-12, etc. + var reViewBoxAttrValue = new RegExp( + '^' + + '\\s*(' + fabric.reNum + '+)\\s*,?' + + '\\s*(' + fabric.reNum + '+)\\s*,?' + + '\\s*(' + fabric.reNum + '+)\\s*,?' + + '\\s*(' + fabric.reNum + '+)\\s*' + + '$' + ); + + /** + * Add a element that envelop all child elements and makes the viewbox transformMatrix descend on all elements + */ + function addVBTransform(element, widthAttr, heightAttr) { + + var viewBoxAttr = element.getAttribute('viewBox'), + scaleX = 1, + scaleY = 1, + minX = 0, + minY = 0, + viewBoxWidth, viewBoxHeight, matrix, el; + + if (viewBoxAttr && (viewBoxAttr = viewBoxAttr.match(reViewBoxAttrValue))) { + minX = -parseFloat(viewBoxAttr[1]), + minY = -parseFloat(viewBoxAttr[2]), + viewBoxWidth = parseFloat(viewBoxAttr[3]), + viewBoxHeight = parseFloat(viewBoxAttr[4]); + } + else { + return; + } + if (widthAttr && widthAttr !== viewBoxWidth) { + scaleX = widthAttr / viewBoxWidth; + } + if (heightAttr && heightAttr !== viewBoxHeight) { + scaleY = heightAttr / viewBoxHeight; + } + + // default is to preserve aspect ratio + // preserveAspectRatio attribute to be implemented + scaleY = scaleX = (scaleX > scaleY ? scaleY : scaleX); + + if (!(scaleX !== 1 || scaleY !== 1 || minX !== 0 || minY !== 0)) { + return; + } + matrix = ' matrix(' + scaleX + + ' 0' + + ' 0 ' + + scaleY + ' ' + + (minX * scaleX) + ' ' + + (minY * scaleY) + ') '; + + if (element.tagName === 'svg') { + el = element.ownerDocument.createElement('g'); + while (element.firstChild != null) { + el.appendChild(element.firstChild); + } + element.appendChild(el); + } + else { + el = element; + matrix = el.getAttribute('transform') + matrix; + } + + el.setAttribute('transform', matrix); + } + + /** + * Parses an SVG document, converts it to an array of corresponding fabric.* instances and passes them to a callback + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @param {Function} callback Callback to call when parsing is finished; It's being passed an array of elements (parsed from a document). + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + */ + fabric.parseSVGDocument = (function() { + + var reAllowedSVGTagNames = /^(path|circle|polygon|polyline|ellipse|rect|line|image|text)$/, + reViewBoxTagNames = /^(symbol|image|marker|pattern|view)$/; + + function hasAncestorWithNodeName(element, nodeName) { + while (element && (element = element.parentNode)) { + if (nodeName.test(element.nodeName) && !element.getAttribute('instantiated_by_use')) { + return true; + } + } + return false; + } + + return function(doc, callback, reviver) { + if (!doc) { + return; + } + + parseUseDirectives(doc); + + var startTime = new Date(), + svgUid = fabric.Object.__uid++, + widthAttr, heightAttr, toBeParsed = false; + + if (doc.getAttribute('width') && doc.getAttribute('width') !== '100%') { + widthAttr = parseUnit(doc.getAttribute('width')); + } + if (doc.getAttribute('height') && doc.getAttribute('height') !== '100%') { + heightAttr = parseUnit(doc.getAttribute('height')); + } + + if (!widthAttr || !heightAttr) { + var viewBoxAttr = doc.getAttribute('viewBox'); + if (viewBoxAttr && (viewBoxAttr = viewBoxAttr.match(reViewBoxAttrValue))) { + widthAttr = parseFloat(viewBoxAttr[3]), + heightAttr = parseFloat(viewBoxAttr[4]); + } + else { + toBeParsed = true; + } + } + + addVBTransform(doc, widthAttr, heightAttr); + + var descendants = fabric.util.toArray(doc.getElementsByTagName('*')); + + if (descendants.length === 0 && fabric.isLikelyNode) { + // we're likely in node, where "o3-xml" library fails to gEBTN("*") + // https://github.com/ajaxorg/node-o3-xml/issues/21 + descendants = doc.selectNodes('//*[name(.)!="svg"]'); + var arr = [ ]; + for (var i = 0, len = descendants.length; i < len; i++) { + arr[i] = descendants[i]; + } + descendants = arr; + } + + var elements = descendants.filter(function(el) { + reViewBoxTagNames.test(el.tagName) && addVBTransform(el, 0, 0); + return reAllowedSVGTagNames.test(el.tagName) && + !hasAncestorWithNodeName(el, /^(?:pattern|defs|symbol)$/); // http://www.w3.org/TR/SVG/struct.html#DefsElement + }); + + if (!elements || (elements && !elements.length)) { + callback && callback([], {}); + return; + } + + var options = { + width: widthAttr, + height: heightAttr, + svgUid: svgUid, + toBeParsed: toBeParsed + }; + + fabric.gradientDefs[svgUid] = fabric.getGradientDefs(doc); + fabric.cssRules[svgUid] = fabric.getCSSRules(doc); + // Precedence of rules: style > class > attribute + fabric.parseElements(elements, function(instances) { + fabric.documentParsingTime = new Date() - startTime; + if (callback) { + callback(instances, options); + } + }, clone(options), reviver); + }; + })(); + + /** + * Used for caching SVG documents (loaded via `fabric.Canvas#loadSVGFromURL`) + * @namespace + */ + var svgCache = { + + /** + * @param {String} name + * @param {Function} callback + */ + has: function (name, callback) { + callback(false); + }, + + get: function () { + /* NOOP */ + }, + + set: function () { + /* NOOP */ + } + }; + + /** + * @private + */ + function _enlivenCachedObject(cachedObject) { + + var objects = cachedObject.objects, + options = cachedObject.options; + + objects = objects.map(function (o) { + return fabric[capitalize(o.type)].fromObject(o); + }); + + return ({ objects: objects, options: options }); + } + + /** + * @private + */ + function _createSVGPattern(markup, canvas, property) { + if (canvas[property] && canvas[property].toSVG) { + markup.push( + '', + '' + ); + } + } + + var reFontDeclaration = new RegExp( + '(normal|italic)?\\s*(normal|small-caps)?\\s*' + + '(normal|bold|bolder|lighter|100|200|300|400|500|600|700|800|900)?\\s*(' + + fabric.reNum + + '(?:px|cm|mm|em|pt|pc|in)*)(?:\\/(normal|' + fabric.reNum + '))?\\s+(.*)'); + + extend(fabric, { + /** + * Parses a short font declaration, building adding its properties to a style object + * @static + * @function + * @memberOf fabric + * @param {String} value font declaration + * @param {Object} oStyle definition + */ + parseFontDeclaration: function(value, oStyle) { + var match = value.match(reFontDeclaration); + + if (!match) { + return; + } + var fontStyle = match[1], + // font variant is not used + // fontVariant = match[2], + fontWeight = match[3], + fontSize = match[4], + lineHeight = match[5], + fontFamily = match[6]; + + if (fontStyle) { + oStyle.fontStyle = fontStyle; + } + if (fontWeight) { + oStyle.fontWeight = isNaN(parseFloat(fontWeight)) ? fontWeight : parseFloat(fontWeight); + } + if (fontSize) { + oStyle.fontSize = parseUnit(fontSize); + } + if (fontFamily) { + oStyle.fontFamily = fontFamily; + } + if (lineHeight) { + oStyle.lineHeight = lineHeight === 'normal' ? 1 : lineHeight; + } + }, + + /** + * Parses an SVG document, returning all of the gradient declarations found in it + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @return {Object} Gradient definitions; key corresponds to element id, value -- to gradient definition element + */ + getGradientDefs: function(doc) { + var linearGradientEls = doc.getElementsByTagName('linearGradient'), + radialGradientEls = doc.getElementsByTagName('radialGradient'), + el, i, j = 0, id, xlink, elList = [ ], + gradientDefs = { }, idsToXlinkMap = { }; + + elList.length = linearGradientEls.length + radialGradientEls.length; + i = linearGradientEls.length; + while (i--) { + elList[j++] = linearGradientEls[i]; + } + i = radialGradientEls.length; + while (i--) { + elList[j++] = radialGradientEls[i]; + } + + while (j--) { + el = elList[j]; + xlink = el.getAttribute('xlink:href'); + id = el.getAttribute('id'); + if (xlink) { + idsToXlinkMap[id] = xlink.substr(1); + } + gradientDefs[id] = el; + } + + for (id in idsToXlinkMap) { + var el2 = gradientDefs[idsToXlinkMap[id]].cloneNode(true); + el = gradientDefs[id]; + while (el2.firstChild) { + el.appendChild(el2.firstChild); + } + } + return gradientDefs; + }, + + /** + * Returns an object of attributes' name/value, given element and an array of attribute names; + * Parses parent "g" nodes recursively upwards. + * @static + * @memberOf fabric + * @param {DOMElement} element Element to parse + * @param {Array} attributes Array of attributes to parse + * @return {Object} object containing parsed attributes' names/values + */ + parseAttributes: function(element, attributes, svgUid) { + + if (!element) { + return; + } + + var value, + parentAttributes = { }, + fontSize; + + if (typeof svgUid === 'undefined') { + svgUid = element.getAttribute('svgUid'); + } + // if there's a parent container (`g` or `a` or `symbol` node), parse its attributes recursively upwards + if (element.parentNode && /^symbol|[g|a]$/i.test(element.parentNode.nodeName)) { + parentAttributes = fabric.parseAttributes(element.parentNode, attributes, svgUid); + } + fontSize = (parentAttributes && parentAttributes.fontSize ) || + element.getAttribute('font-size') || fabric.Text.DEFAULT_SVG_FONT_SIZE; + + var ownAttributes = attributes.reduce(function(memo, attr) { + value = element.getAttribute(attr); + if (value) { + attr = normalizeAttr(attr); + value = normalizeValue(attr, value, parentAttributes, fontSize); + + memo[attr] = value; + } + return memo; + }, { }); + + // add values parsed from style, which take precedence over attributes + // (see: http://www.w3.org/TR/SVG/styling.html#UsingPresentationAttributes) + ownAttributes = extend(ownAttributes, + extend(getGlobalStylesForElement(element, svgUid), fabric.parseStyleAttribute(element))); + if (ownAttributes.font) { + fabric.parseFontDeclaration(ownAttributes.font, ownAttributes); + } + return _setStrokeFillOpacity(extend(parentAttributes, ownAttributes)); + }, + + /** + * Transforms an array of svg elements to corresponding fabric.* instances + * @static + * @memberOf fabric + * @param {Array} elements Array of elements to parse + * @param {Function} callback Being passed an array of fabric instances (transformed from SVG elements) + * @param {Object} [options] Options object + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + */ + parseElements: function(elements, callback, options, reviver) { + new fabric.ElementsParser(elements, callback, options, reviver).parse(); + }, + + /** + * Parses "style" attribute, retuning an object with values + * @static + * @memberOf fabric + * @param {SVGElement} element Element to parse + * @return {Object} Objects with values parsed from style attribute of an element + */ + parseStyleAttribute: function(element) { + var oStyle = { }, + style = element.getAttribute('style'); + + if (!style) { + return oStyle; + } + + if (typeof style === 'string') { + parseStyleString(style, oStyle); + } + else { + parseStyleObject(style, oStyle); + } + + return oStyle; + }, + + /** + * Parses "points" attribute, returning an array of values + * @static + * @memberOf fabric + * @param {String} points points attribute string + * @return {Array} array of points + */ + parsePointsAttribute: function(points) { + + // points attribute is required and must not be empty + if (!points) { + return null; + } + + // replace commas with whitespace and remove bookending whitespace + points = points.replace(/,/g, ' ').trim(); + + points = points.split(/\s+/); + var parsedPoints = [ ], i, len; + + i = 0; + len = points.length; + for (; i < len; i+=2) { + parsedPoints.push({ + x: parseFloat(points[i]), + y: parseFloat(points[i + 1]) + }); + } + + // odd number of points is an error + // if (parsedPoints.length % 2 !== 0) { + // return null; + // } + + return parsedPoints; + }, + + /** + * Returns CSS rules for a given SVG document + * @static + * @function + * @memberOf fabric + * @param {SVGDocument} doc SVG document to parse + * @return {Object} CSS rules of this document + */ + getCSSRules: function(doc) { + var styles = doc.getElementsByTagName('style'), + allRules = { }, rules; + + // very crude parsing of style contents + for (var i = 0, len = styles.length; i < len; i++) { + var styleContents = styles[i].textContent; + + // remove comments + styleContents = styleContents.replace(/\/\*[\s\S]*?\*\//g, ''); + if (styleContents.trim() === '') { + continue; + } + rules = styleContents.match(/[^{]*\{[\s\S]*?\}/g); + rules = rules.map(function(rule) { return rule.trim(); }); + + rules.forEach(function(rule) { + + var match = rule.match(/([\s\S]*?)\s*\{([^}]*)\}/), + ruleObj = { }, declaration = match[2].trim(), + propertyValuePairs = declaration.replace(/;$/, '').split(/\s*;\s*/); + + for (var i = 0, len = propertyValuePairs.length; i < len; i++) { + var pair = propertyValuePairs[i].split(/\s*:\s*/), + property = normalizeAttr(pair[0]), + value = normalizeValue(property, pair[1], pair[0]); + ruleObj[property] = value; + } + rule = match[1]; + rule.split(',').forEach(function(_rule) { + _rule = _rule.replace(/^svg/i, '').trim(); + if (_rule === '') { + return; + } + allRules[_rule] = fabric.util.object.clone(ruleObj); + }); + }); + } + return allRules; + }, + + /** + * Takes url corresponding to an SVG document, and parses it into a set of fabric objects. Note that SVG is fetched via XMLHttpRequest, so it needs to conform to SOP (Same Origin Policy) + * @memberof fabric + * @param {String} url + * @param {Function} callback + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + */ + loadSVGFromURL: function(url, callback, reviver) { + + url = url.replace(/^\n\s*/, '').trim(); + svgCache.has(url, function (hasUrl) { + if (hasUrl) { + svgCache.get(url, function (value) { + var enlivedRecord = _enlivenCachedObject(value); + callback(enlivedRecord.objects, enlivedRecord.options); + }); + } + else { + new fabric.util.request(url, { + method: 'get', + onComplete: onComplete + }); + } + }); + + function onComplete(r) { + + var xml = r.responseXML; + if (xml && !xml.documentElement && fabric.window.ActiveXObject && r.responseText) { + xml = new ActiveXObject('Microsoft.XMLDOM'); + xml.async = 'false'; + //IE chokes on DOCTYPE + xml.loadXML(r.responseText.replace(//i, '')); + } + if (!xml || !xml.documentElement) { + return; + } + + fabric.parseSVGDocument(xml.documentElement, function (results, options) { + svgCache.set(url, { + objects: fabric.util.array.invoke(results, 'toObject'), + options: options + }); + callback(results, options); + }, reviver); + } + }, + + /** + * Takes string corresponding to an SVG document, and parses it into a set of fabric objects + * @memberof fabric + * @param {String} string + * @param {Function} callback + * @param {Function} [reviver] Method for further parsing of SVG elements, called after each fabric object created. + */ + loadSVGFromString: function(string, callback, reviver) { + string = string.trim(); + var doc; + if (typeof DOMParser !== 'undefined') { + var parser = new DOMParser(); + if (parser && parser.parseFromString) { + doc = parser.parseFromString(string, 'text/xml'); + } + } + else if (fabric.window.ActiveXObject) { + doc = new ActiveXObject('Microsoft.XMLDOM'); + doc.async = 'false'; + // IE chokes on DOCTYPE + doc.loadXML(string.replace(//i, '')); + } + + fabric.parseSVGDocument(doc.documentElement, function (results, options) { + callback(results, options); + }, reviver); + }, + + /** + * Creates markup containing SVG font faces + * @param {Array} objects Array of fabric objects + * @return {String} + */ + createSVGFontFacesMarkup: function(objects) { + var markup = ''; + + for (var i = 0, len = objects.length; i < len; i++) { + if (objects[i].type !== 'text' || !objects[i].path) { + continue; + } + + markup += [ + //jscs:disable validateIndentation + '@font-face {', + 'font-family: ', objects[i].fontFamily, '; ', + 'src: url(\'', objects[i].path, '\')', + '}' + //jscs:enable validateIndentation + ].join(''); + } + + if (markup) { + markup = [ + //jscs:disable validateIndentation + '' + //jscs:enable validateIndentation + ].join(''); + } + + return markup; + }, + + /** + * Creates markup containing SVG referenced elements like patterns, gradients etc. + * @param {fabric.Canvas} canvas instance of fabric.Canvas + * @return {String} + */ + createSVGRefElementsMarkup: function(canvas) { + var markup = [ ]; + + _createSVGPattern(markup, canvas, 'backgroundColor'); + _createSVGPattern(markup, canvas, 'overlayColor'); + + return markup.join(''); + } + }); + +})(typeof exports !== 'undefined' ? exports : this); + + +fabric.ElementsParser = function(elements, callback, options, reviver) { + this.elements = elements; + this.callback = callback; + this.options = options; + this.reviver = reviver; + this.svgUid = (options && options.svgUid) || 0; +}; + +fabric.ElementsParser.prototype.parse = function() { + this.instances = new Array(this.elements.length); + this.numElements = this.elements.length; + + this.createObjects(); +}; + +fabric.ElementsParser.prototype.createObjects = function() { + for (var i = 0, len = this.elements.length; i < len; i++) { + this.elements[i].setAttribute('svgUid', this.svgUid); + (function(_this, i) { + setTimeout(function() { + _this.createObject(_this.elements[i], i); + }, 0); + })(this, i); + } +}; + +fabric.ElementsParser.prototype.createObject = function(el, index) { + var klass = fabric[fabric.util.string.capitalize(el.tagName)]; + if (klass && klass.fromElement) { + try { + this._createObject(klass, el, index); + } + catch (err) { + fabric.log(err); + } + } + else { + this.checkIfDone(); + } +}; + +fabric.ElementsParser.prototype._createObject = function(klass, el, index) { + if (klass.async) { + klass.fromElement(el, this.createCallback(index, el), this.options); + } + else { + var obj = klass.fromElement(el, this.options); + this.resolveGradient(obj, 'fill'); + this.resolveGradient(obj, 'stroke'); + this.reviver && this.reviver(el, obj); + this.instances[index] = obj; + this.checkIfDone(); + } +}; + +fabric.ElementsParser.prototype.createCallback = function(index, el) { + var _this = this; + return function(obj) { + _this.resolveGradient(obj, 'fill'); + _this.resolveGradient(obj, 'stroke'); + _this.reviver && _this.reviver(el, obj); + _this.instances[index] = obj; + _this.checkIfDone(); + }; +}; + +fabric.ElementsParser.prototype.resolveGradient = function(obj, property) { + + var instanceFillValue = obj.get(property); + if (!(/^url\(/).test(instanceFillValue)) { + return; + } + var gradientId = instanceFillValue.slice(5, instanceFillValue.length - 1); + if (fabric.gradientDefs[this.svgUid][gradientId]) { + obj.set(property, + fabric.Gradient.fromElement(fabric.gradientDefs[this.svgUid][gradientId], obj)); + } +}; + +fabric.ElementsParser.prototype.checkIfDone = function() { + if (--this.numElements === 0) { + this.instances = this.instances.filter(function(el) { + return el != null; + }); + this.callback(this.instances); + } +}; + + +(function(global) { + + 'use strict'; + + /* Adaptation of work of Kevin Lindsey (kevin@kevlindev.com) */ + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Point) { + fabric.warn('fabric.Point is already defined'); + return; + } + + fabric.Point = Point; + + /** + * Point class + * @class fabric.Point + * @memberOf fabric + * @constructor + * @param {Number} x + * @param {Number} y + * @return {fabric.Point} thisArg + */ + function Point(x, y) { + this.x = x; + this.y = y; + } + + Point.prototype = /** @lends fabric.Point.prototype */ { + + constructor: Point, + + /** + * Adds another point to this one and returns another one + * @param {fabric.Point} that + * @return {fabric.Point} new Point instance with added values + */ + add: function (that) { + return new Point(this.x + that.x, this.y + that.y); + }, + + /** + * Adds another point to this one + * @param {fabric.Point} that + * @return {fabric.Point} thisArg + */ + addEquals: function (that) { + this.x += that.x; + this.y += that.y; + return this; + }, + + /** + * Adds value to this point and returns a new one + * @param {Number} scalar + * @return {fabric.Point} new Point with added value + */ + scalarAdd: function (scalar) { + return new Point(this.x + scalar, this.y + scalar); + }, + + /** + * Adds value to this point + * @param {Number} scalar + * @return {fabric.Point} thisArg + */ + scalarAddEquals: function (scalar) { + this.x += scalar; + this.y += scalar; + return this; + }, + + /** + * Subtracts another point from this point and returns a new one + * @param {fabric.Point} that + * @return {fabric.Point} new Point object with subtracted values + */ + subtract: function (that) { + return new Point(this.x - that.x, this.y - that.y); + }, + + /** + * Subtracts another point from this point + * @param {fabric.Point} that + * @return {fabric.Point} thisArg + */ + subtractEquals: function (that) { + this.x -= that.x; + this.y -= that.y; + return this; + }, + + /** + * Subtracts value from this point and returns a new one + * @param {Number} scalar + * @return {fabric.Point} + */ + scalarSubtract: function (scalar) { + return new Point(this.x - scalar, this.y - scalar); + }, + + /** + * Subtracts value from this point + * @param {Number} scalar + * @return {fabric.Point} thisArg + */ + scalarSubtractEquals: function (scalar) { + this.x -= scalar; + this.y -= scalar; + return this; + }, + + /** + * Miltiplies this point by a value and returns a new one + * @param {Number} scalar + * @return {fabric.Point} + */ + multiply: function (scalar) { + return new Point(this.x * scalar, this.y * scalar); + }, + + /** + * Miltiplies this point by a value + * @param {Number} scalar + * @return {fabric.Point} thisArg + */ + multiplyEquals: function (scalar) { + this.x *= scalar; + this.y *= scalar; + return this; + }, + + /** + * Divides this point by a value and returns a new one + * @param {Number} scalar + * @return {fabric.Point} + */ + divide: function (scalar) { + return new Point(this.x / scalar, this.y / scalar); + }, + + /** + * Divides this point by a value + * @param {Number} scalar + * @return {fabric.Point} thisArg + */ + divideEquals: function (scalar) { + this.x /= scalar; + this.y /= scalar; + return this; + }, + + /** + * Returns true if this point is equal to another one + * @param {fabric.Point} that + * @return {Boolean} + */ + eq: function (that) { + return (this.x === that.x && this.y === that.y); + }, + + /** + * Returns true if this point is less than another one + * @param {fabric.Point} that + * @return {Boolean} + */ + lt: function (that) { + return (this.x < that.x && this.y < that.y); + }, + + /** + * Returns true if this point is less than or equal to another one + * @param {fabric.Point} that + * @return {Boolean} + */ + lte: function (that) { + return (this.x <= that.x && this.y <= that.y); + }, + + /** + + * Returns true if this point is greater another one + * @param {fabric.Point} that + * @return {Boolean} + */ + gt: function (that) { + return (this.x > that.x && this.y > that.y); + }, + + /** + * Returns true if this point is greater than or equal to another one + * @param {fabric.Point} that + * @return {Boolean} + */ + gte: function (that) { + return (this.x >= that.x && this.y >= that.y); + }, + + /** + * Returns new point which is the result of linear interpolation with this one and another one + * @param {fabric.Point} that + * @param {Number} t + * @return {fabric.Point} + */ + lerp: function (that, t) { + return new Point(this.x + (that.x - this.x) * t, this.y + (that.y - this.y) * t); + }, + + /** + * Returns distance from this point and another one + * @param {fabric.Point} that + * @return {Number} + */ + distanceFrom: function (that) { + var dx = this.x - that.x, + dy = this.y - that.y; + return Math.sqrt(dx * dx + dy * dy); + }, + + /** + * Returns the point between this point and another one + * @param {fabric.Point} that + * @return {fabric.Point} + */ + midPointFrom: function (that) { + return new Point(this.x + (that.x - this.x)/2, this.y + (that.y - this.y)/2); + }, + + /** + * Returns a new point which is the min of this and another one + * @param {fabric.Point} that + * @return {fabric.Point} + */ + min: function (that) { + return new Point(Math.min(this.x, that.x), Math.min(this.y, that.y)); + }, + + /** + * Returns a new point which is the max of this and another one + * @param {fabric.Point} that + * @return {fabric.Point} + */ + max: function (that) { + return new Point(Math.max(this.x, that.x), Math.max(this.y, that.y)); + }, + + /** + * Returns string representation of this point + * @return {String} + */ + toString: function () { + return this.x + ',' + this.y; + }, + + /** + * Sets x/y of this point + * @param {Number} x + * @param {Number} y + */ + setXY: function (x, y) { + this.x = x; + this.y = y; + }, + + /** + * Sets x/y of this point from another point + * @param {fabric.Point} that + */ + setFromPoint: function (that) { + this.x = that.x; + this.y = that.y; + }, + + /** + * Swaps x/y of this point and another point + * @param {fabric.Point} that + */ + swap: function (that) { + var x = this.x, + y = this.y; + this.x = that.x; + this.y = that.y; + that.x = x; + that.y = y; + } + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + /* Adaptation of work of Kevin Lindsey (kevin@kevlindev.com) */ + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Intersection) { + fabric.warn('fabric.Intersection is already defined'); + return; + } + + /** + * Intersection class + * @class fabric.Intersection + * @memberOf fabric + * @constructor + */ + function Intersection(status) { + this.status = status; + this.points = []; + } + + fabric.Intersection = Intersection; + + fabric.Intersection.prototype = /** @lends fabric.Intersection.prototype */ { + + /** + * Appends a point to intersection + * @param {fabric.Point} point + */ + appendPoint: function (point) { + this.points.push(point); + }, + + /** + * Appends points to intersection + * @param {Array} points + */ + appendPoints: function (points) { + this.points = this.points.concat(points); + } + }; + + /** + * Checks if one line intersects another + * @static + * @param {fabric.Point} a1 + * @param {fabric.Point} a2 + * @param {fabric.Point} b1 + * @param {fabric.Point} b2 + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectLineLine = function (a1, a2, b1, b2) { + var result, + uaT = (b2.x - b1.x) * (a1.y - b1.y) - (b2.y - b1.y) * (a1.x - b1.x), + ubT = (a2.x - a1.x) * (a1.y - b1.y) - (a2.y - a1.y) * (a1.x - b1.x), + uB = (b2.y - b1.y) * (a2.x - a1.x) - (b2.x - b1.x) * (a2.y - a1.y); + if (uB !== 0) { + var ua = uaT / uB, + ub = ubT / uB; + if (0 <= ua && ua <= 1 && 0 <= ub && ub <= 1) { + result = new Intersection('Intersection'); + result.points.push(new fabric.Point(a1.x + ua * (a2.x - a1.x), a1.y + ua * (a2.y - a1.y))); + } + else { + result = new Intersection(); + } + } + else { + if (uaT === 0 || ubT === 0) { + result = new Intersection('Coincident'); + } + else { + result = new Intersection('Parallel'); + } + } + return result; + }; + + /** + * Checks if line intersects polygon + * @static + * @param {fabric.Point} a1 + * @param {fabric.Point} a2 + * @param {Array} points + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectLinePolygon = function(a1, a2, points) { + var result = new Intersection(), + length = points.length; + + for (var i = 0; i < length; i++) { + var b1 = points[i], + b2 = points[(i + 1) % length], + inter = Intersection.intersectLineLine(a1, a2, b1, b2); + + result.appendPoints(inter.points); + } + if (result.points.length > 0) { + result.status = 'Intersection'; + } + return result; + }; + + /** + * Checks if polygon intersects another polygon + * @static + * @param {Array} points1 + * @param {Array} points2 + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectPolygonPolygon = function (points1, points2) { + var result = new Intersection(), + length = points1.length; + + for (var i = 0; i < length; i++) { + var a1 = points1[i], + a2 = points1[(i + 1) % length], + inter = Intersection.intersectLinePolygon(a1, a2, points2); + + result.appendPoints(inter.points); + } + if (result.points.length > 0) { + result.status = 'Intersection'; + } + return result; + }; + + /** + * Checks if polygon intersects rectangle + * @static + * @param {Array} points + * @param {Number} r1 + * @param {Number} r2 + * @return {fabric.Intersection} + */ + fabric.Intersection.intersectPolygonRectangle = function (points, r1, r2) { + var min = r1.min(r2), + max = r1.max(r2), + topRight = new fabric.Point(max.x, min.y), + bottomLeft = new fabric.Point(min.x, max.y), + inter1 = Intersection.intersectLinePolygon(min, topRight, points), + inter2 = Intersection.intersectLinePolygon(topRight, max, points), + inter3 = Intersection.intersectLinePolygon(max, bottomLeft, points), + inter4 = Intersection.intersectLinePolygon(bottomLeft, min, points), + result = new Intersection(); + + result.appendPoints(inter1.points); + result.appendPoints(inter2.points); + result.appendPoints(inter3.points); + result.appendPoints(inter4.points); + + if (result.points.length > 0) { + result.status = 'Intersection'; + } + return result; + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Color) { + fabric.warn('fabric.Color is already defined.'); + return; + } + + /** + * Color class + * The purpose of {@link fabric.Color} is to abstract and encapsulate common color operations; + * {@link fabric.Color} is a constructor and creates instances of {@link fabric.Color} objects. + * + * @class fabric.Color + * @param {String} color optional in hex or rgb(a) format + * @return {fabric.Color} thisArg + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2/#colors} + */ + function Color(color) { + if (!color) { + this.setSource([0, 0, 0, 1]); + } + else { + this._tryParsingColor(color); + } + } + + fabric.Color = Color; + + fabric.Color.prototype = /** @lends fabric.Color.prototype */ { + + /** + * @private + * @param {String|Array} color Color value to parse + */ + _tryParsingColor: function(color) { + var source; + + if (color in Color.colorNameMap) { + color = Color.colorNameMap[color]; + } + + if (color === 'transparent') { + this.setSource([255, 255, 255, 0]); + return; + } + + source = Color.sourceFromHex(color); + + if (!source) { + source = Color.sourceFromRgb(color); + } + if (!source) { + source = Color.sourceFromHsl(color); + } + if (source) { + this.setSource(source); + } + }, + + /** + * Adapted from https://github.com/mjijackson + * @private + * @param {Number} r Red color value + * @param {Number} g Green color value + * @param {Number} b Blue color value + * @return {Array} Hsl color + */ + _rgbToHsl: function(r, g, b) { + r /= 255, g /= 255, b /= 255; + + var h, s, l, + max = fabric.util.array.max([r, g, b]), + min = fabric.util.array.min([r, g, b]); + + l = (max + min) / 2; + + if (max === min) { + h = s = 0; // achromatic + } + else { + var d = max - min; + s = l > 0.5 ? d / (2 - max - min) : d / (max + min); + switch (max) { + case r: + h = (g - b) / d + (g < b ? 6 : 0); + break; + case g: + h = (b - r) / d + 2; + break; + case b: + h = (r - g) / d + 4; + break; + } + h /= 6; + } + + return [ + Math.round(h * 360), + Math.round(s * 100), + Math.round(l * 100) + ]; + }, + + /** + * Returns source of this color (where source is an array representation; ex: [200, 200, 100, 1]) + * @return {Array} + */ + getSource: function() { + return this._source; + }, + + /** + * Sets source of this color (where source is an array representation; ex: [200, 200, 100, 1]) + * @param {Array} source + */ + setSource: function(source) { + this._source = source; + }, + + /** + * Returns color represenation in RGB format + * @return {String} ex: rgb(0-255,0-255,0-255) + */ + toRgb: function() { + var source = this.getSource(); + return 'rgb(' + source[0] + ',' + source[1] + ',' + source[2] + ')'; + }, + + /** + * Returns color represenation in RGBA format + * @return {String} ex: rgba(0-255,0-255,0-255,0-1) + */ + toRgba: function() { + var source = this.getSource(); + return 'rgba(' + source[0] + ',' + source[1] + ',' + source[2] + ',' + source[3] + ')'; + }, + + /** + * Returns color represenation in HSL format + * @return {String} ex: hsl(0-360,0%-100%,0%-100%) + */ + toHsl: function() { + var source = this.getSource(), + hsl = this._rgbToHsl(source[0], source[1], source[2]); + + return 'hsl(' + hsl[0] + ',' + hsl[1] + '%,' + hsl[2] + '%)'; + }, + + /** + * Returns color represenation in HSLA format + * @return {String} ex: hsla(0-360,0%-100%,0%-100%,0-1) + */ + toHsla: function() { + var source = this.getSource(), + hsl = this._rgbToHsl(source[0], source[1], source[2]); + + return 'hsla(' + hsl[0] + ',' + hsl[1] + '%,' + hsl[2] + '%,' + source[3] + ')'; + }, + + /** + * Returns color represenation in HEX format + * @return {String} ex: FF5555 + */ + toHex: function() { + var source = this.getSource(), r, g, b; + + r = source[0].toString(16); + r = (r.length === 1) ? ('0' + r) : r; + + g = source[1].toString(16); + g = (g.length === 1) ? ('0' + g) : g; + + b = source[2].toString(16); + b = (b.length === 1) ? ('0' + b) : b; + + return r.toUpperCase() + g.toUpperCase() + b.toUpperCase(); + }, + + /** + * Gets value of alpha channel for this color + * @return {Number} 0-1 + */ + getAlpha: function() { + return this.getSource()[3]; + }, + + /** + * Sets value of alpha channel for this color + * @param {Number} alpha Alpha value 0-1 + * @return {fabric.Color} thisArg + */ + setAlpha: function(alpha) { + var source = this.getSource(); + source[3] = alpha; + this.setSource(source); + return this; + }, + + /** + * Transforms color to its grayscale representation + * @return {fabric.Color} thisArg + */ + toGrayscale: function() { + var source = this.getSource(), + average = parseInt((source[0] * 0.3 + source[1] * 0.59 + source[2] * 0.11).toFixed(0), 10), + currentAlpha = source[3]; + this.setSource([average, average, average, currentAlpha]); + return this; + }, + + /** + * Transforms color to its black and white representation + * @param {Number} threshold + * @return {fabric.Color} thisArg + */ + toBlackWhite: function(threshold) { + var source = this.getSource(), + average = (source[0] * 0.3 + source[1] * 0.59 + source[2] * 0.11).toFixed(0), + currentAlpha = source[3]; + + threshold = threshold || 127; + + average = (Number(average) < Number(threshold)) ? 0 : 255; + this.setSource([average, average, average, currentAlpha]); + return this; + }, + + /** + * Overlays color with another color + * @param {String|fabric.Color} otherColor + * @return {fabric.Color} thisArg + */ + overlayWith: function(otherColor) { + if (!(otherColor instanceof Color)) { + otherColor = new Color(otherColor); + } + + var result = [], + alpha = this.getAlpha(), + otherAlpha = 0.5, + source = this.getSource(), + otherSource = otherColor.getSource(); + + for (var i = 0; i < 3; i++) { + result.push(Math.round((source[i] * (1 - otherAlpha)) + (otherSource[i] * otherAlpha))); + } + + result[3] = alpha; + this.setSource(result); + return this; + } + }; + + /** + * Regex matching color in RGB or RGBA formats (ex: rgb(0, 0, 0), rgba(255, 100, 10, 0.5), rgba( 255 , 100 , 10 , 0.5 ), rgb(1,1,1), rgba(100%, 60%, 10%, 0.5)) + * @static + * @field + * @memberOf fabric.Color + */ + fabric.Color.reRGBa = /^rgba?\(\s*(\d{1,3}(?:\.\d+)?\%?)\s*,\s*(\d{1,3}(?:\.\d+)?\%?)\s*,\s*(\d{1,3}(?:\.\d+)?\%?)\s*(?:\s*,\s*(\d+(?:\.\d+)?)\s*)?\)$/; + + /** + * Regex matching color in HSL or HSLA formats (ex: hsl(200, 80%, 10%), hsla(300, 50%, 80%, 0.5), hsla( 300 , 50% , 80% , 0.5 )) + * @static + * @field + * @memberOf fabric.Color + */ + fabric.Color.reHSLa = /^hsla?\(\s*(\d{1,3})\s*,\s*(\d{1,3}\%)\s*,\s*(\d{1,3}\%)\s*(?:\s*,\s*(\d+(?:\.\d+)?)\s*)?\)$/; + + /** + * Regex matching color in HEX format (ex: #FF5555, 010155, aff) + * @static + * @field + * @memberOf fabric.Color + */ + fabric.Color.reHex = /^#?([0-9a-f]{6}|[0-9a-f]{3})$/i; + + /** + * Map of the 17 basic color names with HEX code + * @static + * @field + * @memberOf fabric.Color + * @see: http://www.w3.org/TR/CSS2/syndata.html#color-units + */ + fabric.Color.colorNameMap = { + aqua: '#00FFFF', + black: '#000000', + blue: '#0000FF', + fuchsia: '#FF00FF', + gray: '#808080', + green: '#008000', + lime: '#00FF00', + maroon: '#800000', + navy: '#000080', + olive: '#808000', + orange: '#FFA500', + purple: '#800080', + red: '#FF0000', + silver: '#C0C0C0', + teal: '#008080', + white: '#FFFFFF', + yellow: '#FFFF00' + }; + + /** + * @private + * @param {Number} p + * @param {Number} q + * @param {Number} t + * @return {Number} + */ + function hue2rgb(p, q, t) { + if (t < 0) { + t += 1; + } + if (t > 1) { + t -= 1; + } + if (t < 1/6) { + return p + (q - p) * 6 * t; + } + if (t < 1/2) { + return q; + } + if (t < 2/3) { + return p + (q - p) * (2/3 - t) * 6; + } + return p; + } + + /** + * Returns new color object, when given a color in RGB format + * @memberOf fabric.Color + * @param {String} color Color value ex: rgb(0-255,0-255,0-255) + * @return {fabric.Color} + */ + fabric.Color.fromRgb = function(color) { + return Color.fromSource(Color.sourceFromRgb(color)); + }; + + /** + * Returns array represenatation (ex: [100, 100, 200, 1]) of a color that's in RGB or RGBA format + * @memberOf fabric.Color + * @param {String} color Color value ex: rgb(0-255,0-255,0-255), rgb(0%-100%,0%-100%,0%-100%) + * @return {Array} source + */ + fabric.Color.sourceFromRgb = function(color) { + var match = color.match(Color.reRGBa); + if (match) { + var r = parseInt(match[1], 10) / (/%$/.test(match[1]) ? 100 : 1) * (/%$/.test(match[1]) ? 255 : 1), + g = parseInt(match[2], 10) / (/%$/.test(match[2]) ? 100 : 1) * (/%$/.test(match[2]) ? 255 : 1), + b = parseInt(match[3], 10) / (/%$/.test(match[3]) ? 100 : 1) * (/%$/.test(match[3]) ? 255 : 1); + + return [ + parseInt(r, 10), + parseInt(g, 10), + parseInt(b, 10), + match[4] ? parseFloat(match[4]) : 1 + ]; + } + }; + + /** + * Returns new color object, when given a color in RGBA format + * @static + * @function + * @memberOf fabric.Color + * @param {String} color + * @return {fabric.Color} + */ + fabric.Color.fromRgba = Color.fromRgb; + + /** + * Returns new color object, when given a color in HSL format + * @param {String} color Color value ex: hsl(0-260,0%-100%,0%-100%) + * @memberOf fabric.Color + * @return {fabric.Color} + */ + fabric.Color.fromHsl = function(color) { + return Color.fromSource(Color.sourceFromHsl(color)); + }; + + /** + * Returns array represenatation (ex: [100, 100, 200, 1]) of a color that's in HSL or HSLA format. + * Adapted from https://github.com/mjijackson + * @memberOf fabric.Color + * @param {String} color Color value ex: hsl(0-360,0%-100%,0%-100%) or hsla(0-360,0%-100%,0%-100%, 0-1) + * @return {Array} source + * @see http://http://www.w3.org/TR/css3-color/#hsl-color + */ + fabric.Color.sourceFromHsl = function(color) { + var match = color.match(Color.reHSLa); + if (!match) { + return; + } + + var h = (((parseFloat(match[1]) % 360) + 360) % 360) / 360, + s = parseFloat(match[2]) / (/%$/.test(match[2]) ? 100 : 1), + l = parseFloat(match[3]) / (/%$/.test(match[3]) ? 100 : 1), + r, g, b; + + if (s === 0) { + r = g = b = l; + } + else { + var q = l <= 0.5 ? l * (s + 1) : l + s - l * s, + p = l * 2 - q; + + r = hue2rgb(p, q, h + 1/3); + g = hue2rgb(p, q, h); + b = hue2rgb(p, q, h - 1/3); + } + + return [ + Math.round(r * 255), + Math.round(g * 255), + Math.round(b * 255), + match[4] ? parseFloat(match[4]) : 1 + ]; + }; + + /** + * Returns new color object, when given a color in HSLA format + * @static + * @function + * @memberOf fabric.Color + * @param {String} color + * @return {fabric.Color} + */ + fabric.Color.fromHsla = Color.fromHsl; + + /** + * Returns new color object, when given a color in HEX format + * @static + * @memberOf fabric.Color + * @param {String} color Color value ex: FF5555 + * @return {fabric.Color} + */ + fabric.Color.fromHex = function(color) { + return Color.fromSource(Color.sourceFromHex(color)); + }; + + /** + * Returns array represenatation (ex: [100, 100, 200, 1]) of a color that's in HEX format + * @static + * @memberOf fabric.Color + * @param {String} color ex: FF5555 + * @return {Array} source + */ + fabric.Color.sourceFromHex = function(color) { + if (color.match(Color.reHex)) { + var value = color.slice(color.indexOf('#') + 1), + isShortNotation = (value.length === 3), + r = isShortNotation ? (value.charAt(0) + value.charAt(0)) : value.substring(0, 2), + g = isShortNotation ? (value.charAt(1) + value.charAt(1)) : value.substring(2, 4), + b = isShortNotation ? (value.charAt(2) + value.charAt(2)) : value.substring(4, 6); + + return [ + parseInt(r, 16), + parseInt(g, 16), + parseInt(b, 16), + 1 + ]; + } + }; + + /** + * Returns new color object, when given color in array representation (ex: [200, 100, 100, 0.5]) + * @static + * @memberOf fabric.Color + * @param {Array} source + * @return {fabric.Color} + */ + fabric.Color.fromSource = function(source) { + var oColor = new Color(); + oColor.setSource(source); + return oColor; + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function() { + + /* _FROM_SVG_START_ */ + function getColorStop(el) { + var style = el.getAttribute('style'), + offset = el.getAttribute('offset'), + color, colorAlpha, opacity; + + // convert percents to absolute values + offset = parseFloat(offset) / (/%$/.test(offset) ? 100 : 1); + offset = offset < 0 ? 0 : offset > 1 ? 1 : offset; + if (style) { + var keyValuePairs = style.split(/\s*;\s*/); + + if (keyValuePairs[keyValuePairs.length - 1] === '') { + keyValuePairs.pop(); + } + + for (var i = keyValuePairs.length; i--; ) { + + var split = keyValuePairs[i].split(/\s*:\s*/), + key = split[0].trim(), + value = split[1].trim(); + + if (key === 'stop-color') { + color = value; + } + else if (key === 'stop-opacity') { + opacity = value; + } + } + } + + if (!color) { + color = el.getAttribute('stop-color') || 'rgb(0,0,0)'; + } + if (!opacity) { + opacity = el.getAttribute('stop-opacity'); + } + + color = new fabric.Color(color); + colorAlpha = color.getAlpha(); + opacity = isNaN(parseFloat(opacity)) ? 1 : parseFloat(opacity); + opacity *= colorAlpha; + + return { + offset: offset, + color: color.toRgb(), + opacity: opacity + }; + } + + function getLinearCoords(el) { + return { + x1: el.getAttribute('x1') || 0, + y1: el.getAttribute('y1') || 0, + x2: el.getAttribute('x2') || '100%', + y2: el.getAttribute('y2') || 0 + }; + } + + function getRadialCoords(el) { + return { + x1: el.getAttribute('fx') || el.getAttribute('cx') || '50%', + y1: el.getAttribute('fy') || el.getAttribute('cy') || '50%', + r1: 0, + x2: el.getAttribute('cx') || '50%', + y2: el.getAttribute('cy') || '50%', + r2: el.getAttribute('r') || '50%' + }; + } + /* _FROM_SVG_END_ */ + + /** + * Gradient class + * @class fabric.Gradient + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2/#gradients} + * @see {@link fabric.Gradient#initialize} for constructor definition + */ + fabric.Gradient = fabric.util.createClass(/** @lends fabric.Gradient.prototype */ { + + /** + * Horizontal offset for aligning gradients coming from SVG when outside pathgroups + * @type Number + * @default 0 + */ + offsetX: 0, + + /** + * Vertical offset for aligning gradients coming from SVG when outside pathgroups + * @type Number + * @default 0 + */ + offsetY: 0, + + /** + * Constructor + * @param {Object} [options] Options object with type, coords, gradientUnits and colorStops + * @return {fabric.Gradient} thisArg + */ + initialize: function(options) { + options || (options = { }); + + var coords = { }; + + this.id = fabric.Object.__uid++; + this.type = options.type || 'linear'; + + coords = { + x1: options.coords.x1 || 0, + y1: options.coords.y1 || 0, + x2: options.coords.x2 || 0, + y2: options.coords.y2 || 0 + }; + + if (this.type === 'radial') { + coords.r1 = options.coords.r1 || 0; + coords.r2 = options.coords.r2 || 0; + } + this.coords = coords; + this.colorStops = options.colorStops.slice(); + if (options.gradientTransform) { + this.gradientTransform = options.gradientTransform; + } + this.offsetX = options.offsetX || this.offsetX; + this.offsetY = options.offsetY || this.offsetY; + }, + + /** + * Adds another colorStop + * @param {Object} colorStop Object with offset and color + * @return {fabric.Gradient} thisArg + */ + addColorStop: function(colorStop) { + for (var position in colorStop) { + var color = new fabric.Color(colorStop[position]); + this.colorStops.push({ + offset: position, + color: color.toRgb(), + opacity: color.getAlpha() + }); + } + return this; + }, + + /** + * Returns object representation of a gradient + * @return {Object} + */ + toObject: function() { + return { + type: this.type, + coords: this.coords, + colorStops: this.colorStops, + offsetX: this.offsetX, + offsetY: this.offsetY + }; + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an gradient + * @param {Object} object Object to create a gradient for + * @param {Boolean} normalize Whether coords should be normalized + * @return {String} SVG representation of an gradient (linear/radial) + */ + toSVG: function(object) { + var coords = fabric.util.object.clone(this.coords), + markup, commonAttributes; + + // colorStops must be sorted ascending + this.colorStops.sort(function(a, b) { + return a.offset - b.offset; + }); + + if (!(object.group && object.group.type === 'path-group')) { + for (var prop in coords) { + if (prop === 'x1' || prop === 'x2' || prop === 'r2') { + coords[prop] += this.offsetX - object.width / 2; + } + else if (prop === 'y1' || prop === 'y2') { + coords[prop] += this.offsetY - object.height / 2; + } + } + } + + commonAttributes = 'id="SVGID_' + this.id + + '" gradientUnits="userSpaceOnUse"'; + if (this.gradientTransform) { + commonAttributes += ' gradientTransform="matrix(' + this.gradientTransform.join(' ') + ')" '; + } + if (this.type === 'linear') { + markup = [ + //jscs:disable validateIndentation + '\n' + //jscs:enable validateIndentation + ]; + } + else if (this.type === 'radial') { + markup = [ + //jscs:disable validateIndentation + '\n' + //jscs:enable validateIndentation + ]; + } + + for (var i = 0; i < this.colorStops.length; i++) { + markup.push( + //jscs:disable validateIndentation + '\n' + //jscs:enable validateIndentation + ); + } + + markup.push((this.type === 'linear' ? '\n' : '\n')); + + return markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns an instance of CanvasGradient + * @param {CanvasRenderingContext2D} ctx Context to render on + * @return {CanvasGradient} + */ + toLive: function(ctx, object) { + var gradient, prop, coords = fabric.util.object.clone(this.coords); + + if (!this.type) { + return; + } + + if (object.group && object.group.type === 'path-group') { + for (prop in coords) { + if (prop === 'x1' || prop === 'x2') { + coords[prop] += -this.offsetX + object.width / 2; + } + else if (prop === 'y1' || prop === 'y2') { + coords[prop] += -this.offsetY + object.height / 2; + } + } + } + + if (object.type === 'text' || object.type === 'i-text') { + for (prop in coords) { + if (prop === 'x1' || prop === 'x2') { + coords[prop] -= object.width / 2; + } + else if (prop === 'y1' || prop === 'y2') { + coords[prop] -= object.height / 2; + } + } + } + + if (this.type === 'linear') { + gradient = ctx.createLinearGradient( + coords.x1, coords.y1, coords.x2, coords.y2); + } + else if (this.type === 'radial') { + gradient = ctx.createRadialGradient( + coords.x1, coords.y1, coords.r1, coords.x2, coords.y2, coords.r2); + } + + for (var i = 0, len = this.colorStops.length; i < len; i++) { + var color = this.colorStops[i].color, + opacity = this.colorStops[i].opacity, + offset = this.colorStops[i].offset; + + if (typeof opacity !== 'undefined') { + color = new fabric.Color(color).setAlpha(opacity).toRgba(); + } + gradient.addColorStop(parseFloat(offset), color); + } + + return gradient; + } + }); + + fabric.util.object.extend(fabric.Gradient, { + + /* _FROM_SVG_START_ */ + /** + * Returns {@link fabric.Gradient} instance from an SVG element + * @static + * @memberof fabric.Gradient + * @param {SVGGradientElement} el SVG gradient element + * @param {fabric.Object} instance + * @return {fabric.Gradient} Gradient instance + * @see http://www.w3.org/TR/SVG/pservers.html#LinearGradientElement + * @see http://www.w3.org/TR/SVG/pservers.html#RadialGradientElement + */ + fromElement: function(el, instance) { + + /** + * @example: + * + * + * + * + * + * + * OR + * + * + * + * + * + * + * OR + * + * + * + * + * + * + * + * OR + * + * + * + * + * + * + * + */ + + var colorStopEls = el.getElementsByTagName('stop'), + type = (el.nodeName === 'linearGradient' ? 'linear' : 'radial'), + gradientUnits = el.getAttribute('gradientUnits') || 'objectBoundingBox', + gradientTransform = el.getAttribute('gradientTransform'), + colorStops = [], + coords = { }, ellipseMatrix; + + if (type === 'linear') { + coords = getLinearCoords(el); + } + else if (type === 'radial') { + coords = getRadialCoords(el); + } + + for (var i = colorStopEls.length; i--; ) { + colorStops.push(getColorStop(colorStopEls[i])); + } + + ellipseMatrix = _convertPercentUnitsToValues(instance, coords, gradientUnits); + + var gradient = new fabric.Gradient({ + type: type, + coords: coords, + colorStops: colorStops, + offsetX: -instance.left, + offsetY: -instance.top + }); + + if (gradientTransform || ellipseMatrix !== '') { + gradient.gradientTransform = fabric.parseTransformAttribute((gradientTransform || '') + ellipseMatrix); + } + return gradient; + }, + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Gradient} instance from its object representation + * @static + * @memberof fabric.Gradient + * @param {Object} obj + * @param {Object} [options] Options object + */ + forObject: function(obj, options) { + options || (options = { }); + _convertPercentUnitsToValues(obj, options.coords, 'userSpaceOnUse'); + return new fabric.Gradient(options); + } + }); + + /** + * @private + */ + function _convertPercentUnitsToValues(object, options, gradientUnits) { + var propValue, addFactor = 0, multFactor = 1, ellipseMatrix = ''; + for (var prop in options) { + propValue = parseFloat(options[prop], 10); + if (typeof options[prop] === 'string' && /^\d+%$/.test(options[prop])) { + multFactor = 0.01; + } + else { + multFactor = 1; + } + if (prop === 'x1' || prop === 'x2' || prop === 'r2') { + multFactor *= gradientUnits === 'objectBoundingBox' ? object.width : 1; + addFactor = gradientUnits === 'objectBoundingBox' ? object.left || 0 : 0; + } + else if (prop === 'y1' || prop === 'y2') { + multFactor *= gradientUnits === 'objectBoundingBox' ? object.height : 1; + addFactor = gradientUnits === 'objectBoundingBox' ? object.top || 0 : 0; + } + options[prop] = propValue * multFactor + addFactor; + } + if (object.type === 'ellipse' && + options.r2 !== null && + gradientUnits === 'objectBoundingBox' && + object.rx !== object.ry) { + + var scaleFactor = object.ry/object.rx; + ellipseMatrix = ' scale(1, ' + scaleFactor + ')'; + if (options.y1) { + options.y1 /= scaleFactor; + } + if (options.y2) { + options.y2 /= scaleFactor; + } + } + return ellipseMatrix; + } +})(); + + +/** + * Pattern class + * @class fabric.Pattern + * @see {@link http://fabricjs.com/patterns/|Pattern demo} + * @see {@link http://fabricjs.com/dynamic-patterns/|DynamicPattern demo} + * @see {@link fabric.Pattern#initialize} for constructor definition + */ +fabric.Pattern = fabric.util.createClass(/** @lends fabric.Pattern.prototype */ { + + /** + * Repeat property of a pattern (one of repeat, repeat-x, repeat-y or no-repeat) + * @type String + * @default + */ + repeat: 'repeat', + + /** + * Pattern horizontal offset from object's left/top corner + * @type Number + * @default + */ + offsetX: 0, + + /** + * Pattern vertical offset from object's left/top corner + * @type Number + * @default + */ + offsetY: 0, + + /** + * Constructor + * @param {Object} [options] Options object + * @return {fabric.Pattern} thisArg + */ + initialize: function(options) { + options || (options = { }); + + this.id = fabric.Object.__uid++; + + if (options.source) { + if (typeof options.source === 'string') { + // function string + if (typeof fabric.util.getFunctionBody(options.source) !== 'undefined') { + this.source = new Function(fabric.util.getFunctionBody(options.source)); + } + else { + // img src string + var _this = this; + this.source = fabric.util.createImage(); + fabric.util.loadImage(options.source, function(img) { + _this.source = img; + }); + } + } + else { + // img element + this.source = options.source; + } + } + if (options.repeat) { + this.repeat = options.repeat; + } + if (options.offsetX) { + this.offsetX = options.offsetX; + } + if (options.offsetY) { + this.offsetY = options.offsetY; + } + }, + + /** + * Returns object representation of a pattern + * @return {Object} Object representation of a pattern instance + */ + toObject: function() { + + var source; + + // callback + if (typeof this.source === 'function') { + source = String(this.source); + } + // element + else if (typeof this.source.src === 'string') { + source = this.source.src; + } + + return { + source: source, + repeat: this.repeat, + offsetX: this.offsetX, + offsetY: this.offsetY + }; + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of a pattern + * @param {fabric.Object} object + * @return {String} SVG representation of a pattern + */ + toSVG: function(object) { + var patternSource = typeof this.source === 'function' ? this.source() : this.source, + patternWidth = patternSource.width / object.getWidth(), + patternHeight = patternSource.height / object.getHeight(), + patternOffsetX = this.offsetX / object.getWidth(), + patternOffsetY = this.offsetY / object.getHeight(), + patternImgSrc = ''; + if (this.repeat === 'repeat-x' || this.repeat === 'no-repeat') { + patternHeight = 1; + } + if (this.repeat === 'repeat-y' || this.repeat === 'no-repeat') { + patternWidth = 1; + } + if (patternSource.src) { + patternImgSrc = patternSource.src; + } + else if (patternSource.toDataURL) { + patternImgSrc = patternSource.toDataURL(); + } + + return '\n' + + '\n' + + '\n'; + }, + /* _TO_SVG_END_ */ + + /** + * Returns an instance of CanvasPattern + * @param {CanvasRenderingContext2D} ctx Context to create pattern + * @return {CanvasPattern} + */ + toLive: function(ctx) { + var source = typeof this.source === 'function' + ? this.source() + : this.source; + + // if the image failed to load, return, and allow rest to continue loading + if (!source) { + return ''; + } + + // if an image + if (typeof source.src !== 'undefined') { + if (!source.complete) { + return ''; + } + if (source.naturalWidth === 0 || source.naturalHeight === 0) { + return ''; + } + } + return ctx.createPattern(source, this.repeat); + } +}); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + toFixed = fabric.util.toFixed; + + if (fabric.Shadow) { + fabric.warn('fabric.Shadow is already defined.'); + return; + } + + /** + * Shadow class + * @class fabric.Shadow + * @see {@link http://fabricjs.com/shadows/|Shadow demo} + * @see {@link fabric.Shadow#initialize} for constructor definition + */ + fabric.Shadow = fabric.util.createClass(/** @lends fabric.Shadow.prototype */ { + + /** + * Shadow color + * @type String + * @default + */ + color: 'rgb(0,0,0)', + + /** + * Shadow blur + * @type Number + */ + blur: 0, + + /** + * Shadow horizontal offset + * @type Number + * @default + */ + offsetX: 0, + + /** + * Shadow vertical offset + * @type Number + * @default + */ + offsetY: 0, + + /** + * Whether the shadow should affect stroke operations + * @type Boolean + * @default + */ + affectStroke: false, + + /** + * Indicates whether toObject should include default values + * @type Boolean + * @default + */ + includeDefaultValues: true, + + /** + * Constructor + * @param {Object|String} [options] Options object with any of color, blur, offsetX, offsetX properties or string (e.g. "rgba(0,0,0,0.2) 2px 2px 10px, "2px 2px 10px rgba(0,0,0,0.2)") + * @return {fabric.Shadow} thisArg + */ + initialize: function(options) { + + if (typeof options === 'string') { + options = this._parseShadow(options); + } + + for (var prop in options) { + this[prop] = options[prop]; + } + + this.id = fabric.Object.__uid++; + }, + + /** + * @private + * @param {String} shadow Shadow value to parse + * @return {Object} Shadow object with color, offsetX, offsetY and blur + */ + _parseShadow: function(shadow) { + var shadowStr = shadow.trim(), + offsetsAndBlur = fabric.Shadow.reOffsetsAndBlur.exec(shadowStr) || [ ], + color = shadowStr.replace(fabric.Shadow.reOffsetsAndBlur, '') || 'rgb(0,0,0)'; + + return { + color: color.trim(), + offsetX: parseInt(offsetsAndBlur[1], 10) || 0, + offsetY: parseInt(offsetsAndBlur[2], 10) || 0, + blur: parseInt(offsetsAndBlur[3], 10) || 0 + }; + }, + + /** + * Returns a string representation of an instance + * @see http://www.w3.org/TR/css-text-decor-3/#text-shadow + * @return {String} Returns CSS3 text-shadow declaration + */ + toString: function() { + return [this.offsetX, this.offsetY, this.blur, this.color].join('px '); + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of a shadow + * @param {fabric.Object} object + * @return {String} SVG representation of a shadow + */ + toSVG: function(object) { + var mode = 'SourceAlpha', fBoxX = 40, fBoxY = 40; + + if (object && (object.fill === this.color || object.stroke === this.color)) { + mode = 'SourceGraphic'; + } + + if (object.width && object.height) { + //http://www.w3.org/TR/SVG/filters.html#FilterEffectsRegion + // we add some extra space to filter box to contain the blur ( 20 ) + fBoxX = toFixed(Math.abs(this.offsetX / object.getWidth()), 2) * 100 + 20; + fBoxY = toFixed(Math.abs(this.offsetY / object.getHeight()), 2) * 100 + 20; + } + + return ( + '\n' + + '\t\n' + + '\t\n' + + '\t\n' + + '\t\n' + + '\t\t\n' + + '\t\t\n' + + '\t\n' + + '\n'); + }, + /* _TO_SVG_END_ */ + + /** + * Returns object representation of a shadow + * @return {Object} Object representation of a shadow instance + */ + toObject: function() { + if (this.includeDefaultValues) { + return { + color: this.color, + blur: this.blur, + offsetX: this.offsetX, + offsetY: this.offsetY + }; + } + var obj = { }, proto = fabric.Shadow.prototype; + if (this.color !== proto.color) { + obj.color = this.color; + } + if (this.blur !== proto.blur) { + obj.blur = this.blur; + } + if (this.offsetX !== proto.offsetX) { + obj.offsetX = this.offsetX; + } + if (this.offsetY !== proto.offsetY) { + obj.offsetY = this.offsetY; + } + return obj; + } + }); + + /** + * Regex matching shadow offsetX, offsetY and blur (ex: "2px 2px 10px rgba(0,0,0,0.2)", "rgb(0,255,0) 2px 2px") + * @static + * @field + * @memberOf fabric.Shadow + */ + fabric.Shadow.reOffsetsAndBlur = /(?:\s|^)(-?\d+(?:px)?(?:\s?|$))?(-?\d+(?:px)?(?:\s?|$))?(\d+(?:px)?)?(?:\s?|$)(?:$|\s)/; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function () { + + 'use strict'; + + if (fabric.StaticCanvas) { + fabric.warn('fabric.StaticCanvas is already defined.'); + return; + } + + // aliases for faster resolution + var extend = fabric.util.object.extend, + getElementOffset = fabric.util.getElementOffset, + removeFromArray = fabric.util.removeFromArray, + + CANVAS_INIT_ERROR = new Error('Could not initialize `canvas` element'); + + /** + * Static canvas class + * @class fabric.StaticCanvas + * @mixes fabric.Collection + * @mixes fabric.Observable + * @see {@link http://fabricjs.com/static_canvas/|StaticCanvas demo} + * @see {@link fabric.StaticCanvas#initialize} for constructor definition + * @fires before:render + * @fires after:render + * @fires canvas:cleared + * @fires object:added + * @fires object:removed + */ + fabric.StaticCanvas = fabric.util.createClass(/** @lends fabric.StaticCanvas.prototype */ { + + /** + * Constructor + * @param {HTMLElement | String} el <canvas> element to initialize instance on + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(el, options) { + options || (options = { }); + + this._initStatic(el, options); + fabric.StaticCanvas.activeInstance = this; + }, + + /** + * Background color of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setBackgroundColor}. + * @type {(String|fabric.Pattern)} + * @default + */ + backgroundColor: '', + + /** + * Background image of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setBackgroundImage}. + * Backwards incompatibility note: The "backgroundImageOpacity" + * and "backgroundImageStretch" properties are deprecated since 1.3.9. + * Use {@link fabric.Image#opacity}, {@link fabric.Image#width} and {@link fabric.Image#height}. + * @type fabric.Image + * @default + */ + backgroundImage: null, + + /** + * Overlay color of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setOverlayColor} + * @since 1.3.9 + * @type {(String|fabric.Pattern)} + * @default + */ + overlayColor: '', + + /** + * Overlay image of canvas instance. + * Should be set via {@link fabric.StaticCanvas#setOverlayImage}. + * Backwards incompatibility note: The "overlayImageLeft" + * and "overlayImageTop" properties are deprecated since 1.3.9. + * Use {@link fabric.Image#left} and {@link fabric.Image#top}. + * @type fabric.Image + * @default + */ + overlayImage: null, + + /** + * Indicates whether toObject/toDatalessObject should include default values + * @type Boolean + * @default + */ + includeDefaultValues: true, + + /** + * Indicates whether objects' state should be saved + * @type Boolean + * @default + */ + stateful: true, + + /** + * Indicates whether {@link fabric.Collection.add}, {@link fabric.Collection.insertAt} and {@link fabric.Collection.remove} should also re-render canvas. + * Disabling this option could give a great performance boost when adding/removing a lot of objects to/from canvas at once + * (followed by a manual rendering after addition/deletion) + * @type Boolean + * @default + */ + renderOnAddRemove: true, + + /** + * Function that determines clipping of entire canvas area + * Being passed context as first argument. See clipping canvas area in {@link https://github.com/kangax/fabric.js/wiki/FAQ} + * @type Function + * @default + */ + clipTo: null, + + /** + * Indicates whether object controls (borders/controls) are rendered above overlay image + * @type Boolean + * @default + */ + controlsAboveOverlay: false, + + /** + * Indicates whether the browser can be scrolled when using a touchscreen and dragging on the canvas + * @type Boolean + * @default + */ + allowTouchScrolling: false, + + /** + * Indicates whether this canvas will use image smoothing, this is on by default in browsers + * @type Boolean + * @default + */ + imageSmoothingEnabled: true, + + /** + * Indicates whether objects should remain in current stack position when selected. When false objects are brought to top and rendered as part of the selection group + * @type Boolean + * @default + */ + preserveObjectStacking: false, + + /** + * The transformation (in the format of Canvas transform) which focuses the viewport + * @type Array + * @default + */ + viewportTransform: [1, 0, 0, 1, 0, 0], + + /** + * Callback; invoked right before object is about to be scaled/rotated + */ + onBeforeScaleRotate: function () { + /* NOOP */ + }, + + /** + * @private + * @param {HTMLElement | String} el <canvas> element to initialize instance on + * @param {Object} [options] Options object + */ + _initStatic: function(el, options) { + this._objects = []; + + this._createLowerCanvas(el); + this._initOptions(options); + this._setImageSmoothing(); + + if (options.overlayImage) { + this.setOverlayImage(options.overlayImage, this.renderAll.bind(this)); + } + if (options.backgroundImage) { + this.setBackgroundImage(options.backgroundImage, this.renderAll.bind(this)); + } + if (options.backgroundColor) { + this.setBackgroundColor(options.backgroundColor, this.renderAll.bind(this)); + } + if (options.overlayColor) { + this.setOverlayColor(options.overlayColor, this.renderAll.bind(this)); + } + this.calcOffset(); + }, + + /** + * Calculates canvas element offset relative to the document + * This method is also attached as "resize" event handler of window + * @return {fabric.Canvas} instance + * @chainable + */ + calcOffset: function () { + this._offset = getElementOffset(this.lowerCanvasEl); + return this; + }, + + /** + * Sets {@link fabric.StaticCanvas#overlayImage|overlay image} for this canvas + * @param {(fabric.Image|String)} image fabric.Image instance or URL of an image to set overlay to + * @param {Function} callback callback to invoke when image is loaded and set as an overlay + * @param {Object} [options] Optional options to set for the {@link fabric.Image|overlay image}. + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/MnzHT/|jsFiddle demo} + * @example Normal overlayImage with left/top = 0 + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * // Needed to position overlayImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + * @example overlayImage with different properties + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * opacity: 0.5, + * angle: 45, + * left: 400, + * top: 400, + * originX: 'left', + * originY: 'top' + * }); + * @example Stretched overlayImage #1 - width/height correspond to canvas width/height + * fabric.Image.fromURL('http://fabricjs.com/assets/jail_cell_bars.png', function(img) { + * img.set({width: canvas.width, height: canvas.height, originX: 'left', originY: 'top'}); + * canvas.setOverlayImage(img, canvas.renderAll.bind(canvas)); + * }); + * @example Stretched overlayImage #2 - width/height correspond to canvas width/height + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * width: canvas.width, + * height: canvas.height, + * // Needed to position overlayImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + * @example overlayImage loaded from cross-origin + * canvas.setOverlayImage('http://fabricjs.com/assets/jail_cell_bars.png', canvas.renderAll.bind(canvas), { + * opacity: 0.5, + * angle: 45, + * left: 400, + * top: 400, + * originX: 'left', + * originY: 'top', + * crossOrigin: 'anonymous' + * }); + */ + setOverlayImage: function (image, callback, options) { + return this.__setBgOverlayImage('overlayImage', image, callback, options); + }, + + /** + * Sets {@link fabric.StaticCanvas#backgroundImage|background image} for this canvas + * @param {(fabric.Image|String)} image fabric.Image instance or URL of an image to set background to + * @param {Function} callback Callback to invoke when image is loaded and set as background + * @param {Object} [options] Optional options to set for the {@link fabric.Image|background image}. + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/YH9yD/|jsFiddle demo} + * @example Normal backgroundImage with left/top = 0 + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * // Needed to position backgroundImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + * @example backgroundImage with different properties + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * opacity: 0.5, + * angle: 45, + * left: 400, + * top: 400, + * originX: 'left', + * originY: 'top' + * }); + * @example Stretched backgroundImage #1 - width/height correspond to canvas width/height + * fabric.Image.fromURL('http://fabricjs.com/assets/honey_im_subtle.png', function(img) { + * img.set({width: canvas.width, height: canvas.height, originX: 'left', originY: 'top'}); + * canvas.setBackgroundImage(img, canvas.renderAll.bind(canvas)); + * }); + * @example Stretched backgroundImage #2 - width/height correspond to canvas width/height + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * width: canvas.width, + * height: canvas.height, + * // Needed to position backgroundImage at 0/0 + * originX: 'left', + * originY: 'top' + * }); + * @example backgroundImage loaded from cross-origin + * canvas.setBackgroundImage('http://fabricjs.com/assets/honey_im_subtle.png', canvas.renderAll.bind(canvas), { + * opacity: 0.5, + * angle: 45, + * left: 400, + * top: 400, + * originX: 'left', + * originY: 'top', + * crossOrigin: 'anonymous' + * }); + */ + setBackgroundImage: function (image, callback, options) { + return this.__setBgOverlayImage('backgroundImage', image, callback, options); + }, + + /** + * Sets {@link fabric.StaticCanvas#overlayColor|background color} for this canvas + * @param {(String|fabric.Pattern)} overlayColor Color or pattern to set background color to + * @param {Function} callback Callback to invoke when background color is set + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/pB55h/|jsFiddle demo} + * @example Normal overlayColor - color value + * canvas.setOverlayColor('rgba(255, 73, 64, 0.6)', canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as overlayColor + * canvas.setOverlayColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png' + * }, canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as overlayColor with repeat and offset + * canvas.setOverlayColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png', + * repeat: 'repeat', + * offsetX: 200, + * offsetY: 100 + * }, canvas.renderAll.bind(canvas)); + */ + setOverlayColor: function(overlayColor, callback) { + return this.__setBgOverlayColor('overlayColor', overlayColor, callback); + }, + + /** + * Sets {@link fabric.StaticCanvas#backgroundColor|background color} for this canvas + * @param {(String|fabric.Pattern)} backgroundColor Color or pattern to set background color to + * @param {Function} callback Callback to invoke when background color is set + * @return {fabric.Canvas} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/hXzvk/|jsFiddle demo} + * @example Normal backgroundColor - color value + * canvas.setBackgroundColor('rgba(255, 73, 64, 0.6)', canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as backgroundColor + * canvas.setBackgroundColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png' + * }, canvas.renderAll.bind(canvas)); + * @example fabric.Pattern used as backgroundColor with repeat and offset + * canvas.setBackgroundColor({ + * source: 'http://fabricjs.com/assets/escheresque_ste.png', + * repeat: 'repeat', + * offsetX: 200, + * offsetY: 100 + * }, canvas.renderAll.bind(canvas)); + */ + setBackgroundColor: function(backgroundColor, callback) { + return this.__setBgOverlayColor('backgroundColor', backgroundColor, callback); + }, + + /** + * @private + * @see {@link http://www.whatwg.org/specs/web-apps/current-work/multipage/the-canvas-element.html#dom-context-2d-imagesmoothingenabled|WhatWG Canvas Standard} + */ + _setImageSmoothing: function() { + var ctx = this.getContext(); + + ctx.imageSmoothingEnabled = this.imageSmoothingEnabled; + ctx.webkitImageSmoothingEnabled = this.imageSmoothingEnabled; + ctx.mozImageSmoothingEnabled = this.imageSmoothingEnabled; + ctx.msImageSmoothingEnabled = this.imageSmoothingEnabled; + ctx.oImageSmoothingEnabled = this.imageSmoothingEnabled; + }, + + /** + * @private + * @param {String} property Property to set ({@link fabric.StaticCanvas#backgroundImage|backgroundImage} + * or {@link fabric.StaticCanvas#overlayImage|overlayImage}) + * @param {(fabric.Image|String|null)} image fabric.Image instance, URL of an image or null to set background or overlay to + * @param {Function} callback Callback to invoke when image is loaded and set as background or overlay + * @param {Object} [options] Optional options to set for the {@link fabric.Image|image}. + */ + __setBgOverlayImage: function(property, image, callback, options) { + if (typeof image === 'string') { + fabric.util.loadImage(image, function(img) { + this[property] = new fabric.Image(img, options); + callback && callback(); + }, this, options && options.crossOrigin); + } + else { + options && image.setOptions(options); + this[property] = image; + callback && callback(); + } + + return this; + }, + + /** + * @private + * @param {String} property Property to set ({@link fabric.StaticCanvas#backgroundColor|backgroundColor} + * or {@link fabric.StaticCanvas#overlayColor|overlayColor}) + * @param {(Object|String|null)} color Object with pattern information, color value or null + * @param {Function} [callback] Callback is invoked when color is set + */ + __setBgOverlayColor: function(property, color, callback) { + if (color && color.source) { + var _this = this; + fabric.util.loadImage(color.source, function(img) { + _this[property] = new fabric.Pattern({ + source: img, + repeat: color.repeat, + offsetX: color.offsetX, + offsetY: color.offsetY + }); + callback && callback(); + }); + } + else { + this[property] = color; + callback && callback(); + } + + return this; + }, + + /** + * @private + */ + _createCanvasElement: function() { + var element = fabric.document.createElement('canvas'); + if (!element.style) { + element.style = { }; + } + if (!element) { + throw CANVAS_INIT_ERROR; + } + this._initCanvasElement(element); + return element; + }, + + /** + * @private + * @param {HTMLElement} element + */ + _initCanvasElement: function(element) { + fabric.util.createCanvasElement(element); + + if (typeof element.getContext === 'undefined') { + throw CANVAS_INIT_ERROR; + } + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initOptions: function (options) { + for (var prop in options) { + this[prop] = options[prop]; + } + + this.width = this.width || parseInt(this.lowerCanvasEl.width, 10) || 0; + this.height = this.height || parseInt(this.lowerCanvasEl.height, 10) || 0; + + if (!this.lowerCanvasEl.style) { + return; + } + + this.lowerCanvasEl.width = this.width; + this.lowerCanvasEl.height = this.height; + + this.lowerCanvasEl.style.width = this.width + 'px'; + this.lowerCanvasEl.style.height = this.height + 'px'; + + this.viewportTransform = this.viewportTransform.slice(); + }, + + /** + * Creates a bottom canvas + * @private + * @param {HTMLElement} [canvasEl] + */ + _createLowerCanvas: function (canvasEl) { + this.lowerCanvasEl = fabric.util.getById(canvasEl) || this._createCanvasElement(); + this._initCanvasElement(this.lowerCanvasEl); + + fabric.util.addClass(this.lowerCanvasEl, 'lower-canvas'); + + if (this.interactive) { + this._applyCanvasStyle(this.lowerCanvasEl); + } + + this.contextContainer = this.lowerCanvasEl.getContext('2d'); + }, + + /** + * Returns canvas width (in px) + * @return {Number} + */ + getWidth: function () { + return this.width; + }, + + /** + * Returns canvas height (in px) + * @return {Number} + */ + getHeight: function () { + return this.height; + }, + + /** + * Sets width of this canvas instance + * @param {Number|String} value Value to set width to + * @param {Object} [options] Options object + * @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions + * @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions + * @return {fabric.Canvas} instance + * @chainable true + */ + setWidth: function (value, options) { + return this.setDimensions({ width: value }, options); + }, + + /** + * Sets height of this canvas instance + * @param {Number|String} value Value to set height to + * @param {Object} [options] Options object + * @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions + * @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions + * @return {fabric.Canvas} instance + * @chainable true + */ + setHeight: function (value, options) { + return this.setDimensions({ height: value }, options); + }, + + /** + * Sets dimensions (width, height) of this canvas instance. when options.cssOnly flag active you should also supply the unit of measure (px/%/em) + * @param {Object} dimensions Object with width/height properties + * @param {Number|String} [dimensions.width] Width of canvas element + * @param {Number|String} [dimensions.height] Height of canvas element + * @param {Object} [options] Options object + * @param {Boolean} [options.backstoreOnly=false] Set the given dimensions only as canvas backstore dimensions + * @param {Boolean} [options.cssOnly=false] Set the given dimensions only as css dimensions + * @return {fabric.Canvas} thisArg + * @chainable + */ + setDimensions: function (dimensions, options) { + var cssValue; + + options = options || {}; + + for (var prop in dimensions) { + cssValue = dimensions[prop]; + + if (!options.cssOnly) { + this._setBackstoreDimension(prop, dimensions[prop]); + cssValue += 'px'; + } + + if (!options.backstoreOnly) { + this._setCssDimension(prop, cssValue); + } + } + + if (!options.cssOnly) { + this.renderAll(); + } + + this.calcOffset(); + + return this; + }, + + /** + * Helper for setting width/height + * @private + * @param {String} prop property (width|height) + * @param {Number} value value to set property to + * @return {fabric.Canvas} instance + * @chainable true + */ + _setBackstoreDimension: function (prop, value) { + this.lowerCanvasEl[prop] = value; + + if (this.upperCanvasEl) { + this.upperCanvasEl[prop] = value; + } + + if (this.cacheCanvasEl) { + this.cacheCanvasEl[prop] = value; + } + + this[prop] = value; + + return this; + }, + + /** + * Helper for setting css width/height + * @private + * @param {String} prop property (width|height) + * @param {String} value value to set property to + * @return {fabric.Canvas} instance + * @chainable true + */ + _setCssDimension: function (prop, value) { + this.lowerCanvasEl.style[prop] = value; + + if (this.upperCanvasEl) { + this.upperCanvasEl.style[prop] = value; + } + + if (this.wrapperEl) { + this.wrapperEl.style[prop] = value; + } + + return this; + }, + + /** + * Returns canvas zoom level + * @return {Number} + */ + getZoom: function () { + return Math.sqrt(this.viewportTransform[0] * this.viewportTransform[3]); + }, + + /** + * Sets viewport transform of this canvas instance + * @param {Array} vpt the transform in the form of context.transform + * @return {fabric.Canvas} instance + * @chainable true + */ + setViewportTransform: function (vpt) { + var activeGroup = this.getActiveGroup(); + this.viewportTransform = vpt; + this.renderAll(); + for (var i = 0, len = this._objects.length; i < len; i++) { + this._objects[i].setCoords(); + } + if (activeGroup) { + activeGroup.setCoords(); + } + return this; + }, + + /** + * Sets zoom level of this canvas instance, zoom centered around point + * @param {fabric.Point} point to zoom with respect to + * @param {Number} value to set zoom to, less than 1 zooms out + * @return {fabric.Canvas} instance + * @chainable true + */ + zoomToPoint: function (point, value) { + // TODO: just change the scale, preserve other transformations + var before = point; + point = fabric.util.transformPoint(point, fabric.util.invertTransform(this.viewportTransform)); + this.viewportTransform[0] = value; + this.viewportTransform[3] = value; + var after = fabric.util.transformPoint(point, this.viewportTransform); + this.viewportTransform[4] += before.x - after.x; + this.viewportTransform[5] += before.y - after.y; + this.renderAll(); + for (var i = 0, len = this._objects.length; i < len; i++) { + this._objects[i].setCoords(); + } + return this; + }, + + /** + * Sets zoom level of this canvas instance + * @param {Number} value to set zoom to, less than 1 zooms out + * @return {fabric.Canvas} instance + * @chainable true + */ + setZoom: function (value) { + this.zoomToPoint(new fabric.Point(0, 0), value); + return this; + }, + + /** + * Pan viewport so as to place point at top left corner of canvas + * @param {fabric.Point} point to move to + * @return {fabric.Canvas} instance + * @chainable true + */ + absolutePan: function (point) { + this.viewportTransform[4] = -point.x; + this.viewportTransform[5] = -point.y; + this.renderAll(); + for (var i = 0, len = this._objects.length; i < len; i++) { + this._objects[i].setCoords(); + } + return this; + }, + + /** + * Pans viewpoint relatively + * @param {fabric.Point} point (position vector) to move by + * @return {fabric.Canvas} instance + * @chainable true + */ + relativePan: function (point) { + return this.absolutePan(new fabric.Point( + -point.x - this.viewportTransform[4], + -point.y - this.viewportTransform[5] + )); + }, + + /** + * Returns <canvas> element corresponding to this instance + * @return {HTMLCanvasElement} + */ + getElement: function () { + return this.lowerCanvasEl; + }, + + /** + * Returns currently selected object, if any + * @return {fabric.Object} + */ + getActiveObject: function() { + return null; + }, + + /** + * Returns currently selected group of object, if any + * @return {fabric.Group} + */ + getActiveGroup: function() { + return null; + }, + + /** + * Given a context, renders an object on that context + * @param {CanvasRenderingContext2D} ctx Context to render object on + * @param {fabric.Object} object Object to render + * @private + */ + _draw: function (ctx, object) { + if (!object) { + return; + } + + ctx.save(); + var v = this.viewportTransform; + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + if (this._shouldRenderObject(object)) { + object.render(ctx); + } + ctx.restore(); + if (!this.controlsAboveOverlay) { + object._renderControls(ctx); + } + }, + + _shouldRenderObject: function(object) { + if (!object) { + return false; + } + return (object !== this.getActiveGroup() || !this.preserveObjectStacking); + }, + + /** + * @private + * @param {fabric.Object} obj Object that was added + */ + _onObjectAdded: function(obj) { + this.stateful && obj.setupState(); + obj.canvas = this; + obj.setCoords(); + this.fire('object:added', { target: obj }); + obj.fire('added'); + }, + + /** + * @private + * @param {fabric.Object} obj Object that was removed + */ + _onObjectRemoved: function(obj) { + // removing active object should fire "selection:cleared" events + if (this.getActiveObject() === obj) { + this.fire('before:selection:cleared', { target: obj }); + this._discardActiveObject(); + this.fire('selection:cleared'); + } + + this.fire('object:removed', { target: obj }); + obj.fire('removed'); + }, + + /** + * Clears specified context of canvas element + * @param {CanvasRenderingContext2D} ctx Context to clear + * @return {fabric.Canvas} thisArg + * @chainable + */ + clearContext: function(ctx) { + ctx.clearRect(0, 0, this.width, this.height); + return this; + }, + + /** + * Returns context of canvas where objects are drawn + * @return {CanvasRenderingContext2D} + */ + getContext: function () { + return this.contextContainer; + }, + + /** + * Clears all contexts (background, main, top) of an instance + * @return {fabric.Canvas} thisArg + * @chainable + */ + clear: function () { + this._objects.length = 0; + if (this.discardActiveGroup) { + this.discardActiveGroup(); + } + if (this.discardActiveObject) { + this.discardActiveObject(); + } + this.clearContext(this.contextContainer); + if (this.contextTop) { + this.clearContext(this.contextTop); + } + this.fire('canvas:cleared'); + this.renderAll(); + return this; + }, + + /** + * Renders both the top canvas and the secondary container canvas. + * @param {Boolean} [allOnTop] Whether we want to force all images to be rendered on the top canvas + * @return {fabric.Canvas} instance + * @chainable + */ + renderAll: function (allOnTop) { + var canvasToDrawOn = this[(allOnTop === true && this.interactive) ? 'contextTop' : 'contextContainer'], + activeGroup = this.getActiveGroup(); + + if (this.contextTop && this.selection && !this._groupSelector) { + this.clearContext(this.contextTop); + } + + if (!allOnTop) { + this.clearContext(canvasToDrawOn); + } + + this.fire('before:render'); + + if (this.clipTo) { + fabric.util.clipContext(this, canvasToDrawOn); + } + + this._renderBackground(canvasToDrawOn); + this._renderObjects(canvasToDrawOn, activeGroup); + this._renderActiveGroup(canvasToDrawOn, activeGroup); + + if (this.clipTo) { + canvasToDrawOn.restore(); + } + + this._renderOverlay(canvasToDrawOn); + + if (this.controlsAboveOverlay && this.interactive) { + this.drawControls(canvasToDrawOn); + } + + this.fire('after:render'); + + return this; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {fabric.Group} activeGroup + */ + _renderObjects: function(ctx, activeGroup) { + var i, length; + + // fast path + if (!activeGroup || this.preserveObjectStacking) { + for (i = 0, length = this._objects.length; i < length; ++i) { + this._draw(ctx, this._objects[i]); + } + } + else { + for (i = 0, length = this._objects.length; i < length; ++i) { + if (this._objects[i] && !activeGroup.contains(this._objects[i])) { + this._draw(ctx, this._objects[i]); + } + } + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {fabric.Group} activeGroup + */ + _renderActiveGroup: function(ctx, activeGroup) { + + // delegate rendering to group selection (if one exists) + if (activeGroup) { + + //Store objects in group preserving order, then replace + var sortedObjects = []; + this.forEachObject(function (object) { + if (activeGroup.contains(object)) { + sortedObjects.push(object); + } + }); + activeGroup._set('objects', sortedObjects); + this._draw(ctx, activeGroup); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderBackground: function(ctx) { + if (this.backgroundColor) { + ctx.fillStyle = this.backgroundColor.toLive + ? this.backgroundColor.toLive(ctx) + : this.backgroundColor; + + ctx.fillRect( + this.backgroundColor.offsetX || 0, + this.backgroundColor.offsetY || 0, + this.width, + this.height); + } + if (this.backgroundImage) { + this._draw(ctx, this.backgroundImage); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderOverlay: function(ctx) { + if (this.overlayColor) { + ctx.fillStyle = this.overlayColor.toLive + ? this.overlayColor.toLive(ctx) + : this.overlayColor; + + ctx.fillRect( + this.overlayColor.offsetX || 0, + this.overlayColor.offsetY || 0, + this.width, + this.height); + } + if (this.overlayImage) { + this._draw(ctx, this.overlayImage); + } + }, + + /** + * Method to render only the top canvas. + * Also used to render the group selection box. + * @return {fabric.Canvas} thisArg + * @chainable + */ + renderTop: function () { + var ctx = this.contextTop || this.contextContainer; + this.clearContext(ctx); + + // we render the top context - last object + if (this.selection && this._groupSelector) { + this._drawSelection(); + } + + // delegate rendering to group selection if one exists + // used for drawing selection borders/controls + var activeGroup = this.getActiveGroup(); + if (activeGroup) { + activeGroup.render(ctx); + } + + this._renderOverlay(ctx); + + this.fire('after:render'); + + return this; + }, + + /** + * Returns coordinates of a center of canvas. + * Returned value is an object with top and left properties + * @return {Object} object with "top" and "left" number values + */ + getCenter: function () { + return { + top: this.getHeight() / 2, + left: this.getWidth() / 2 + }; + }, + + /** + * Centers object horizontally. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @param {fabric.Object} object Object to center horizontally + * @return {fabric.Canvas} thisArg + */ + centerObjectH: function (object) { + this._centerObject(object, new fabric.Point(this.getCenter().left, object.getCenterPoint().y)); + this.renderAll(); + return this; + }, + + /** + * Centers object vertically. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @param {fabric.Object} object Object to center vertically + * @return {fabric.Canvas} thisArg + * @chainable + */ + centerObjectV: function (object) { + this._centerObject(object, new fabric.Point(object.getCenterPoint().x, this.getCenter().top)); + this.renderAll(); + return this; + }, + + /** + * Centers object vertically and horizontally. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @param {fabric.Object} object Object to center vertically and horizontally + * @return {fabric.Canvas} thisArg + * @chainable + */ + centerObject: function(object) { + var center = this.getCenter(); + + this._centerObject(object, new fabric.Point(center.left, center.top)); + this.renderAll(); + return this; + }, + + /** + * @private + * @param {fabric.Object} object Object to center + * @param {fabric.Point} center Center point + * @return {fabric.Canvas} thisArg + * @chainable + */ + _centerObject: function(object, center) { + object.setPositionByOrigin(center, 'center', 'center'); + return this; + }, + + /** + * Returs dataless JSON representation of canvas + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {String} json string + */ + toDatalessJSON: function (propertiesToInclude) { + return this.toDatalessObject(propertiesToInclude); + }, + + /** + * Returns object representation of canvas + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function (propertiesToInclude) { + return this._toObjectMethod('toObject', propertiesToInclude); + }, + + /** + * Returns dataless object representation of canvas + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toDatalessObject: function (propertiesToInclude) { + return this._toObjectMethod('toDatalessObject', propertiesToInclude); + }, + + /** + * @private + */ + _toObjectMethod: function (methodName, propertiesToInclude) { + + var data = { + objects: this._toObjects(methodName, propertiesToInclude) + }; + + extend(data, this.__serializeBgOverlay()); + + fabric.util.populateWithProperties(this, data, propertiesToInclude); + + return data; + }, + + /** + * @private + */ + _toObjects: function(methodName, propertiesToInclude) { + return this.getObjects().map(function(instance) { + return this._toObject(instance, methodName, propertiesToInclude); + }, this); + }, + + /** + * @private + */ + _toObject: function(instance, methodName, propertiesToInclude) { + var originalValue; + + if (!this.includeDefaultValues) { + originalValue = instance.includeDefaultValues; + instance.includeDefaultValues = false; + } + + //If the object is part of the current selection group, it should + //be transformed appropriately + //i.e. it should be serialised as it would appear if the selection group + //were to be destroyed. + var originalProperties = this._realizeGroupTransformOnObject(instance), + object = instance[methodName](propertiesToInclude); + if (!this.includeDefaultValues) { + instance.includeDefaultValues = originalValue; + } + + //Undo the damage we did by changing all of its properties + this._unwindGroupTransformOnObject(instance, originalProperties); + + return object; + }, + + /** + * Realises an object's group transformation on it + * @private + * @param {fabric.Object} [instance] the object to transform (gets mutated) + * @returns the original values of instance which were changed + */ + _realizeGroupTransformOnObject: function(instance) { + var layoutProps = ['angle', 'flipX', 'flipY', 'height', 'left', 'scaleX', 'scaleY', 'top', 'width']; + if (instance.group && instance.group === this.getActiveGroup()) { + //Copy all the positionally relevant properties across now + var originalValues = {}; + layoutProps.forEach(function(prop) { + originalValues[prop] = instance[prop]; + }); + this.getActiveGroup().realizeTransform(instance); + return originalValues; + } + else { + return null; + } + }, + + /* + * Restores the changed properties of instance + * @private + * @param {fabric.Object} [instance] the object to un-transform (gets mutated) + * @param {Object} [originalValues] the original values of instance, as returned by _realizeGroupTransformOnObject + */ + _unwindGroupTransformOnObject: function(instance, originalValues) { + if (originalValues) { + instance.set(originalValues); + } + }, + + /** + * @private + */ + __serializeBgOverlay: function() { + var data = { + background: (this.backgroundColor && this.backgroundColor.toObject) + ? this.backgroundColor.toObject() + : this.backgroundColor + }; + + if (this.overlayColor) { + data.overlay = this.overlayColor.toObject + ? this.overlayColor.toObject() + : this.overlayColor; + } + if (this.backgroundImage) { + data.backgroundImage = this.backgroundImage.toObject(); + } + if (this.overlayImage) { + data.overlayImage = this.overlayImage.toObject(); + } + + return data; + }, + + /* _TO_SVG_START_ */ + /** + * When true, getSvgTransform() will apply the StaticCanvas.viewportTransform to the SVG transformation. When true, + * a zoomed canvas will then produce zoomed SVG output. + * @type Boolean + * @default + */ + svgViewportTransformation: true, + + /** + * Returns SVG representation of canvas + * @function + * @param {Object} [options] Options object for SVG output + * @param {Boolean} [options.suppressPreamble=false] If true xml tag is not included + * @param {Object} [options.viewBox] SVG viewbox object + * @param {Number} [options.viewBox.x] x-cooridnate of viewbox + * @param {Number} [options.viewBox.y] y-coordinate of viewbox + * @param {Number} [options.viewBox.width] Width of viewbox + * @param {Number} [options.viewBox.height] Height of viewbox + * @param {String} [options.encoding=UTF-8] Encoding of SVG output + * @param {Function} [reviver] Method for further parsing of svg elements, called after each fabric object converted into svg representation. + * @return {String} SVG string + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3/#serialization} + * @see {@link http://jsfiddle.net/fabricjs/jQ3ZZ/|jsFiddle demo} + * @example Normal SVG output + * var svg = canvas.toSVG(); + * @example SVG output without preamble (without <?xml ../>) + * var svg = canvas.toSVG({suppressPreamble: true}); + * @example SVG output with viewBox attribute + * var svg = canvas.toSVG({ + * viewBox: { + * x: 100, + * y: 100, + * width: 200, + * height: 300 + * } + * }); + * @example SVG output with different encoding (default: UTF-8) + * var svg = canvas.toSVG({encoding: 'ISO-8859-1'}); + * @example Modify SVG output with reviver function + * var svg = canvas.toSVG(null, function(svg) { + * return svg.replace('stroke-dasharray: ; stroke-linecap: butt; stroke-linejoin: miter; stroke-miterlimit: 10; ', ''); + * }); + */ + toSVG: function(options, reviver) { + options || (options = { }); + + var markup = []; + + this._setSVGPreamble(markup, options); + this._setSVGHeader(markup, options); + + this._setSVGBgOverlayColor(markup, 'backgroundColor'); + this._setSVGBgOverlayImage(markup, 'backgroundImage'); + + this._setSVGObjects(markup, reviver); + + this._setSVGBgOverlayColor(markup, 'overlayColor'); + this._setSVGBgOverlayImage(markup, 'overlayImage'); + + markup.push(''); + + return markup.join(''); + }, + + /** + * @private + */ + _setSVGPreamble: function(markup, options) { + if (!options.suppressPreamble) { + markup.push( + '', + '\n' + ); + } + }, + + /** + * @private + */ + _setSVGHeader: function(markup, options) { + var width, height, vpt; + + if (options.viewBox) { + width = options.viewBox.width; + height = options.viewBox.height; + } + else { + width = this.width; + height = this.height; + if (!this.svgViewportTransformation) { + vpt = this.viewportTransform; + width /= vpt[0]; + height /= vpt[3]; + } + } + + markup.push( + '', + 'Created with Fabric.js ', fabric.version, '', + '', + fabric.createSVGFontFacesMarkup(this.getObjects()), + fabric.createSVGRefElementsMarkup(this), + '' + ); + }, + + /** + * @private + */ + _setSVGObjects: function(markup, reviver) { + for (var i = 0, objects = this.getObjects(), len = objects.length; i < len; i++) { + var instance = objects[i], + //If the object is in a selection group, simulate what would happen to that + //object when the group is deselected + originalProperties = this._realizeGroupTransformOnObject(instance); + markup.push(instance.toSVG(reviver)); + this._unwindGroupTransformOnObject(instance, originalProperties); + } + }, + + /** + * @private + */ + _setSVGBgOverlayImage: function(markup, property) { + if (this[property] && this[property].toSVG) { + markup.push(this[property].toSVG()); + } + }, + + /** + * @private + */ + _setSVGBgOverlayColor: function(markup, property) { + if (this[property] && this[property].source) { + markup.push( + '' + ); + } + else if (this[property] && property === 'overlayColor') { + markup.push( + '' + ); + } + }, + /* _TO_SVG_END_ */ + + /** + * Moves an object to the bottom of the stack of drawn objects + * @param {fabric.Object} object Object to send to back + * @return {fabric.Canvas} thisArg + * @chainable + */ + sendToBack: function (object) { + removeFromArray(this._objects, object); + this._objects.unshift(object); + return this.renderAll && this.renderAll(); + }, + + /** + * Moves an object to the top of the stack of drawn objects + * @param {fabric.Object} object Object to send + * @return {fabric.Canvas} thisArg + * @chainable + */ + bringToFront: function (object) { + removeFromArray(this._objects, object); + this._objects.push(object); + return this.renderAll && this.renderAll(); + }, + + /** + * Moves an object down in stack of drawn objects + * @param {fabric.Object} object Object to send + * @param {Boolean} [intersecting] If `true`, send object behind next lower intersecting object + * @return {fabric.Canvas} thisArg + * @chainable + */ + sendBackwards: function (object, intersecting) { + var idx = this._objects.indexOf(object); + + // if object is not on the bottom of stack + if (idx !== 0) { + var newIdx = this._findNewLowerIndex(object, idx, intersecting); + + removeFromArray(this._objects, object); + this._objects.splice(newIdx, 0, object); + this.renderAll && this.renderAll(); + } + return this; + }, + + /** + * @private + */ + _findNewLowerIndex: function(object, idx, intersecting) { + var newIdx; + + if (intersecting) { + newIdx = idx; + + // traverse down the stack looking for the nearest intersecting object + for (var i = idx - 1; i >= 0; --i) { + + var isIntersecting = object.intersectsWithObject(this._objects[i]) || + object.isContainedWithinObject(this._objects[i]) || + this._objects[i].isContainedWithinObject(object); + + if (isIntersecting) { + newIdx = i; + break; + } + } + } + else { + newIdx = idx - 1; + } + + return newIdx; + }, + + /** + * Moves an object up in stack of drawn objects + * @param {fabric.Object} object Object to send + * @param {Boolean} [intersecting] If `true`, send object in front of next upper intersecting object + * @return {fabric.Canvas} thisArg + * @chainable + */ + bringForward: function (object, intersecting) { + var idx = this._objects.indexOf(object); + + // if object is not on top of stack (last item in an array) + if (idx !== this._objects.length - 1) { + var newIdx = this._findNewUpperIndex(object, idx, intersecting); + + removeFromArray(this._objects, object); + this._objects.splice(newIdx, 0, object); + this.renderAll && this.renderAll(); + } + return this; + }, + + /** + * @private + */ + _findNewUpperIndex: function(object, idx, intersecting) { + var newIdx; + + if (intersecting) { + newIdx = idx; + + // traverse up the stack looking for the nearest intersecting object + for (var i = idx + 1; i < this._objects.length; ++i) { + + var isIntersecting = object.intersectsWithObject(this._objects[i]) || + object.isContainedWithinObject(this._objects[i]) || + this._objects[i].isContainedWithinObject(object); + + if (isIntersecting) { + newIdx = i; + break; + } + } + } + else { + newIdx = idx + 1; + } + + return newIdx; + }, + + /** + * Moves an object to specified level in stack of drawn objects + * @param {fabric.Object} object Object to send + * @param {Number} index Position to move to + * @return {fabric.Canvas} thisArg + * @chainable + */ + moveTo: function (object, index) { + removeFromArray(this._objects, object); + this._objects.splice(index, 0, object); + return this.renderAll && this.renderAll(); + }, + + /** + * Clears a canvas element and removes all event listeners + * @return {fabric.Canvas} thisArg + * @chainable + */ + dispose: function () { + this.clear(); + this.interactive && this.removeListeners(); + return this; + }, + + /** + * Returns a string representation of an instance + * @return {String} string representation of an instance + */ + toString: function () { + return '#'; + } + }); + + extend(fabric.StaticCanvas.prototype, fabric.Observable); + extend(fabric.StaticCanvas.prototype, fabric.Collection); + extend(fabric.StaticCanvas.prototype, fabric.DataURLExporter); + + extend(fabric.StaticCanvas, /** @lends fabric.StaticCanvas */ { + + /** + * @static + * @type String + * @default + */ + EMPTY_JSON: '{"objects": [], "background": "white"}', + + /** + * Provides a way to check support of some of the canvas methods + * (either those of HTMLCanvasElement itself, or rendering context) + * + * @param {String} methodName Method to check support for; + * Could be one of "getImageData", "toDataURL", "toDataURLWithQuality" or "setLineDash" + * @return {Boolean | null} `true` if method is supported (or at least exists), + * `null` if canvas element or context can not be initialized + */ + supports: function (methodName) { + var el = fabric.util.createCanvasElement(); + + if (!el || !el.getContext) { + return null; + } + + var ctx = el.getContext('2d'); + if (!ctx) { + return null; + } + + switch (methodName) { + + case 'getImageData': + return typeof ctx.getImageData !== 'undefined'; + + case 'setLineDash': + return typeof ctx.setLineDash !== 'undefined'; + + case 'toDataURL': + return typeof el.toDataURL !== 'undefined'; + + case 'toDataURLWithQuality': + try { + el.toDataURL('image/jpeg', 0); + return true; + } + catch (e) { } + return false; + + default: + return null; + } + } + }); + + /** + * Returns JSON representation of canvas + * @function + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {String} JSON string + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3/#serialization} + * @see {@link http://jsfiddle.net/fabricjs/pec86/|jsFiddle demo} + * @example JSON without additional properties + * var json = canvas.toJSON(); + * @example JSON with additional properties included + * var json = canvas.toJSON(['lockMovementX', 'lockMovementY', 'lockRotation', 'lockScalingX', 'lockScalingY', 'lockUniScaling']); + * @example JSON without default values + * canvas.includeDefaultValues = false; + * var json = canvas.toJSON(); + */ + fabric.StaticCanvas.prototype.toJSON = fabric.StaticCanvas.prototype.toObject; + +})(); + + +/** + * BaseBrush class + * @class fabric.BaseBrush + * @see {@link http://fabricjs.com/freedrawing/|Freedrawing demo} + */ +fabric.BaseBrush = fabric.util.createClass(/** @lends fabric.BaseBrush.prototype */ { + + /** + * Color of a brush + * @type String + * @default + */ + color: 'rgb(0, 0, 0)', + + /** + * Width of a brush + * @type Number + * @default + */ + width: 1, + + /** + * Shadow object representing shadow of this shape. + * Backwards incompatibility note: This property replaces "shadowColor" (String), "shadowOffsetX" (Number), + * "shadowOffsetY" (Number) and "shadowBlur" (Number) since v1.2.12 + * @type fabric.Shadow + * @default + */ + shadow: null, + + /** + * Line endings style of a brush (one of "butt", "round", "square") + * @type String + * @default + */ + strokeLineCap: 'round', + + /** + * Corner style of a brush (one of "bevil", "round", "miter") + * @type String + * @default + */ + strokeLineJoin: 'round', + + /** + * Stroke Dash Array. + * @type Array + * @default + */ + strokeDashArray: null, + + /** + * Sets shadow of an object + * @param {Object|String} [options] Options object or string (e.g. "2px 2px 10px rgba(0,0,0,0.2)") + * @return {fabric.Object} thisArg + * @chainable + */ + setShadow: function(options) { + this.shadow = new fabric.Shadow(options); + return this; + }, + + /** + * Sets brush styles + * @private + */ + _setBrushStyles: function() { + var ctx = this.canvas.contextTop; + + ctx.strokeStyle = this.color; + ctx.lineWidth = this.width; + ctx.lineCap = this.strokeLineCap; + ctx.lineJoin = this.strokeLineJoin; + if (this.strokeDashArray && fabric.StaticCanvas.supports('setLineDash')) { + ctx.setLineDash(this.strokeDashArray); + } + }, + + /** + * Sets brush shadow styles + * @private + */ + _setShadow: function() { + if (!this.shadow) { + return; + } + + var ctx = this.canvas.contextTop; + + ctx.shadowColor = this.shadow.color; + ctx.shadowBlur = this.shadow.blur; + ctx.shadowOffsetX = this.shadow.offsetX; + ctx.shadowOffsetY = this.shadow.offsetY; + }, + + /** + * Removes brush shadow styles + * @private + */ + _resetShadow: function() { + var ctx = this.canvas.contextTop; + + ctx.shadowColor = ''; + ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0; + } +}); + + +(function() { + + /** + * PencilBrush class + * @class fabric.PencilBrush + * @extends fabric.BaseBrush + */ + fabric.PencilBrush = fabric.util.createClass(fabric.BaseBrush, /** @lends fabric.PencilBrush.prototype */ { + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.PencilBrush} Instance of a pencil brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this._points = [ ]; + }, + + /** + * Inovoked on mouse down + * @param {Object} pointer + */ + onMouseDown: function(pointer) { + this._prepareForDrawing(pointer); + // capture coordinates immediately + // this allows to draw dots (when movement never occurs) + this._captureDrawingPath(pointer); + this._render(); + }, + + /** + * Inovoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer) { + this._captureDrawingPath(pointer); + // redraw curve + // clear top canvas + this.canvas.clearContext(this.canvas.contextTop); + this._render(); + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function() { + this._finalizeAndAddPath(); + }, + + /** + * @private + * @param {Object} pointer Actual mouse position related to the canvas. + */ + _prepareForDrawing: function(pointer) { + + var p = new fabric.Point(pointer.x, pointer.y); + + this._reset(); + this._addPoint(p); + + this.canvas.contextTop.moveTo(p.x, p.y); + }, + + /** + * @private + * @param {fabric.Point} point Point to be added to points array + */ + _addPoint: function(point) { + this._points.push(point); + }, + + /** + * Clear points array and set contextTop canvas style. + * @private + */ + _reset: function() { + this._points.length = 0; + + this._setBrushStyles(); + this._setShadow(); + }, + + /** + * @private + * @param {Object} pointer Actual mouse position related to the canvas. + */ + _captureDrawingPath: function(pointer) { + var pointerPoint = new fabric.Point(pointer.x, pointer.y); + this._addPoint(pointerPoint); + }, + + /** + * Draw a smooth path on the topCanvas using quadraticCurveTo + * @private + */ + _render: function() { + var ctx = this.canvas.contextTop, + v = this.canvas.viewportTransform, + p1 = this._points[0], + p2 = this._points[1]; + + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + ctx.beginPath(); + + //if we only have 2 points in the path and they are the same + //it means that the user only clicked the canvas without moving the mouse + //then we should be drawing a dot. A path isn't drawn between two identical dots + //that's why we set them apart a bit + if (this._points.length === 2 && p1.x === p2.x && p1.y === p2.y) { + p1.x -= 0.5; + p2.x += 0.5; + } + ctx.moveTo(p1.x, p1.y); + + for (var i = 1, len = this._points.length; i < len; i++) { + // we pick the point between pi + 1 & pi + 2 as the + // end point and p1 as our control point. + var midPoint = p1.midPointFrom(p2); + ctx.quadraticCurveTo(p1.x, p1.y, midPoint.x, midPoint.y); + + p1 = this._points[i]; + p2 = this._points[i + 1]; + } + // Draw last line as a straight line while + // we wait for the next point to be able to calculate + // the bezier control point + ctx.lineTo(p1.x, p1.y); + ctx.stroke(); + ctx.restore(); + }, + + /** + * Converts points to SVG path + * @param {Array} points Array of points + * @param {Number} minX + * @param {Number} minY + * @return {String} SVG path + */ + convertPointsToSVGPath: function(points) { + var path = [], + p1 = new fabric.Point(points[0].x, points[0].y), + p2 = new fabric.Point(points[1].x, points[1].y); + + path.push('M ', points[0].x, ' ', points[0].y, ' '); + for (var i = 1, len = points.length; i < len; i++) { + var midPoint = p1.midPointFrom(p2); + // p1 is our bezier control point + // midpoint is our endpoint + // start point is p(i-1) value. + path.push('Q ', p1.x, ' ', p1.y, ' ', midPoint.x, ' ', midPoint.y, ' '); + p1 = new fabric.Point(points[i].x, points[i].y); + if ((i + 1) < points.length) { + p2 = new fabric.Point(points[i + 1].x, points[i + 1].y); + } + } + path.push('L ', p1.x, ' ', p1.y, ' '); + return path; + }, + + /** + * Creates fabric.Path object to add on canvas + * @param {String} pathData Path data + * @return {fabric.Path} Path to add on canvas + */ + createPath: function(pathData) { + var path = new fabric.Path(pathData, { + fill: null, + stroke: this.color, + strokeWidth: this.width, + strokeLineCap: this.strokeLineCap, + strokeLineJoin: this.strokeLineJoin, + strokeDashArray: this.strokeDashArray, + originX: 'center', + originY: 'center' + }); + + if (this.shadow) { + this.shadow.affectStroke = true; + path.setShadow(this.shadow); + } + + return path; + }, + + /** + * On mouseup after drawing the path on contextTop canvas + * we use the points captured to create an new fabric path object + * and add it to the fabric canvas. + */ + _finalizeAndAddPath: function() { + var ctx = this.canvas.contextTop; + ctx.closePath(); + + var pathData = this.convertPointsToSVGPath(this._points).join(''); + if (pathData === 'M 0 0 Q 0 0 0 0 L 0 0') { + // do not create 0 width/height paths, as they are + // rendered inconsistently across browsers + // Firefox 4, for example, renders a dot, + // whereas Chrome 10 renders nothing + this.canvas.renderAll(); + return; + } + + var path = this.createPath(pathData); + + this.canvas.add(path); + path.setCoords(); + + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderAll(); + + // fire event 'path' created + this.canvas.fire('path:created', { path: path }); + } + }); +})(); + + +/** + * CircleBrush class + * @class fabric.CircleBrush + */ +fabric.CircleBrush = fabric.util.createClass(fabric.BaseBrush, /** @lends fabric.CircleBrush.prototype */ { + + /** + * Width of a brush + * @type Number + * @default + */ + width: 10, + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.CircleBrush} Instance of a circle brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this.points = [ ]; + }, + /** + * Invoked inside on mouse down and mouse move + * @param {Object} pointer + */ + drawDot: function(pointer) { + var point = this.addPoint(pointer), + ctx = this.canvas.contextTop, + v = this.canvas.viewportTransform; + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + + ctx.fillStyle = point.fill; + ctx.beginPath(); + ctx.arc(point.x, point.y, point.radius, 0, Math.PI * 2, false); + ctx.closePath(); + ctx.fill(); + + ctx.restore(); + }, + + /** + * Invoked on mouse down + */ + onMouseDown: function(pointer) { + this.points.length = 0; + this.canvas.clearContext(this.canvas.contextTop); + this._setShadow(); + this.drawDot(pointer); + }, + + /** + * Invoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer) { + this.drawDot(pointer); + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function() { + var originalRenderOnAddRemove = this.canvas.renderOnAddRemove; + this.canvas.renderOnAddRemove = false; + + var circles = [ ]; + + for (var i = 0, len = this.points.length; i < len; i++) { + var point = this.points[i], + circle = new fabric.Circle({ + radius: point.radius, + left: point.x, + top: point.y, + originX: 'center', + originY: 'center', + fill: point.fill + }); + + this.shadow && circle.setShadow(this.shadow); + + circles.push(circle); + } + var group = new fabric.Group(circles, { originX: 'center', originY: 'center' }); + group.canvas = this.canvas; + + this.canvas.add(group); + this.canvas.fire('path:created', { path: group }); + + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderOnAddRemove = originalRenderOnAddRemove; + this.canvas.renderAll(); + }, + + /** + * @param {Object} pointer + * @return {fabric.Point} Just added pointer point + */ + addPoint: function(pointer) { + var pointerPoint = new fabric.Point(pointer.x, pointer.y), + + circleRadius = fabric.util.getRandomInt( + Math.max(0, this.width - 20), this.width + 20) / 2, + + circleColor = new fabric.Color(this.color) + .setAlpha(fabric.util.getRandomInt(0, 100) / 100) + .toRgba(); + + pointerPoint.radius = circleRadius; + pointerPoint.fill = circleColor; + + this.points.push(pointerPoint); + + return pointerPoint; + } +}); + + +/** + * SprayBrush class + * @class fabric.SprayBrush + */ +fabric.SprayBrush = fabric.util.createClass( fabric.BaseBrush, /** @lends fabric.SprayBrush.prototype */ { + + /** + * Width of a spray + * @type Number + * @default + */ + width: 10, + + /** + * Density of a spray (number of dots per chunk) + * @type Number + * @default + */ + density: 20, + + /** + * Width of spray dots + * @type Number + * @default + */ + dotWidth: 1, + + /** + * Width variance of spray dots + * @type Number + * @default + */ + dotWidthVariance: 1, + + /** + * Whether opacity of a dot should be random + * @type Boolean + * @default + */ + randomOpacity: false, + + /** + * Whether overlapping dots (rectangles) should be removed (for performance reasons) + * @type Boolean + * @default + */ + optimizeOverlapping: true, + + /** + * Constructor + * @param {fabric.Canvas} canvas + * @return {fabric.SprayBrush} Instance of a spray brush + */ + initialize: function(canvas) { + this.canvas = canvas; + this.sprayChunks = [ ]; + }, + + /** + * Invoked on mouse down + * @param {Object} pointer + */ + onMouseDown: function(pointer) { + this.sprayChunks.length = 0; + this.canvas.clearContext(this.canvas.contextTop); + this._setShadow(); + + this.addSprayChunk(pointer); + this.render(); + }, + + /** + * Invoked on mouse move + * @param {Object} pointer + */ + onMouseMove: function(pointer) { + this.addSprayChunk(pointer); + this.render(); + }, + + /** + * Invoked on mouse up + */ + onMouseUp: function() { + var originalRenderOnAddRemove = this.canvas.renderOnAddRemove; + this.canvas.renderOnAddRemove = false; + + var rects = [ ]; + + for (var i = 0, ilen = this.sprayChunks.length; i < ilen; i++) { + var sprayChunk = this.sprayChunks[i]; + + for (var j = 0, jlen = sprayChunk.length; j < jlen; j++) { + + var rect = new fabric.Rect({ + width: sprayChunk[j].width, + height: sprayChunk[j].width, + left: sprayChunk[j].x + 1, + top: sprayChunk[j].y + 1, + originX: 'center', + originY: 'center', + fill: this.color + }); + + this.shadow && rect.setShadow(this.shadow); + rects.push(rect); + } + } + + if (this.optimizeOverlapping) { + rects = this._getOptimizedRects(rects); + } + + var group = new fabric.Group(rects, { originX: 'center', originY: 'center' }); + group.canvas = this.canvas; + + this.canvas.add(group); + this.canvas.fire('path:created', { path: group }); + + this.canvas.clearContext(this.canvas.contextTop); + this._resetShadow(); + this.canvas.renderOnAddRemove = originalRenderOnAddRemove; + this.canvas.renderAll(); + }, + + /** + * @private + * @param {Array} rects + */ + _getOptimizedRects: function(rects) { + + // avoid creating duplicate rects at the same coordinates + var uniqueRects = { }, key; + + for (var i = 0, len = rects.length; i < len; i++) { + key = rects[i].left + '' + rects[i].top; + if (!uniqueRects[key]) { + uniqueRects[key] = rects[i]; + } + } + var uniqueRectsArray = [ ]; + for (key in uniqueRects) { + uniqueRectsArray.push(uniqueRects[key]); + } + + return uniqueRectsArray; + }, + + /** + * Renders brush + */ + render: function() { + var ctx = this.canvas.contextTop; + ctx.fillStyle = this.color; + + var v = this.canvas.viewportTransform; + ctx.save(); + ctx.transform(v[0], v[1], v[2], v[3], v[4], v[5]); + + for (var i = 0, len = this.sprayChunkPoints.length; i < len; i++) { + var point = this.sprayChunkPoints[i]; + if (typeof point.opacity !== 'undefined') { + ctx.globalAlpha = point.opacity; + } + ctx.fillRect(point.x, point.y, point.width, point.width); + } + ctx.restore(); + }, + + /** + * @param {Object} pointer + */ + addSprayChunk: function(pointer) { + this.sprayChunkPoints = [ ]; + + var x, y, width, radius = this.width / 2; + + for (var i = 0; i < this.density; i++) { + + x = fabric.util.getRandomInt(pointer.x - radius, pointer.x + radius); + y = fabric.util.getRandomInt(pointer.y - radius, pointer.y + radius); + + if (this.dotWidthVariance) { + width = fabric.util.getRandomInt( + // bottom clamp width to 1 + Math.max(1, this.dotWidth - this.dotWidthVariance), + this.dotWidth + this.dotWidthVariance); + } + else { + width = this.dotWidth; + } + + var point = new fabric.Point(x, y); + point.width = width; + + if (this.randomOpacity) { + point.opacity = fabric.util.getRandomInt(0, 100) / 100; + } + + this.sprayChunkPoints.push(point); + } + + this.sprayChunks.push(this.sprayChunkPoints); + } +}); + + +/** + * PatternBrush class + * @class fabric.PatternBrush + * @extends fabric.BaseBrush + */ +fabric.PatternBrush = fabric.util.createClass(fabric.PencilBrush, /** @lends fabric.PatternBrush.prototype */ { + + getPatternSrc: function() { + + var dotWidth = 20, + dotDistance = 5, + patternCanvas = fabric.document.createElement('canvas'), + patternCtx = patternCanvas.getContext('2d'); + + patternCanvas.width = patternCanvas.height = dotWidth + dotDistance; + + patternCtx.fillStyle = this.color; + patternCtx.beginPath(); + patternCtx.arc(dotWidth / 2, dotWidth / 2, dotWidth / 2, 0, Math.PI * 2, false); + patternCtx.closePath(); + patternCtx.fill(); + + return patternCanvas; + }, + + getPatternSrcFunction: function() { + return String(this.getPatternSrc).replace('this.color', '"' + this.color + '"'); + }, + + /** + * Creates "pattern" instance property + */ + getPattern: function() { + return this.canvas.contextTop.createPattern(this.source || this.getPatternSrc(), 'repeat'); + }, + + /** + * Sets brush styles + */ + _setBrushStyles: function() { + this.callSuper('_setBrushStyles'); + this.canvas.contextTop.strokeStyle = this.getPattern(); + }, + + /** + * Creates path + */ + createPath: function(pathData) { + var path = this.callSuper('createPath', pathData); + path.stroke = new fabric.Pattern({ + source: this.source || this.getPatternSrcFunction() + }); + return path; + } +}); + + +(function() { + + var getPointer = fabric.util.getPointer, + degreesToRadians = fabric.util.degreesToRadians, + radiansToDegrees = fabric.util.radiansToDegrees, + atan2 = Math.atan2, + abs = Math.abs, + + STROKE_OFFSET = 0.5; + + /** + * Canvas class + * @class fabric.Canvas + * @extends fabric.StaticCanvas + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1/#canvas} + * @see {@link fabric.Canvas#initialize} for constructor definition + * + * @fires object:modified + * @fires object:rotating + * @fires object:scaling + * @fires object:moving + * @fires object:selected + * + * @fires before:selection:cleared + * @fires selection:cleared + * @fires selection:created + * + * @fires path:created + * @fires mouse:down + * @fires mouse:move + * @fires mouse:up + * @fires mouse:over + * @fires mouse:out + * + */ + fabric.Canvas = fabric.util.createClass(fabric.StaticCanvas, /** @lends fabric.Canvas.prototype */ { + + /** + * Constructor + * @param {HTMLElement | String} el <canvas> element to initialize instance on + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(el, options) { + options || (options = { }); + + this._initStatic(el, options); + this._initInteractive(); + this._createCacheCanvas(); + + fabric.Canvas.activeInstance = this; + }, + + /** + * When true, objects can be transformed by one side (unproportionally) + * @type Boolean + * @default + */ + uniScaleTransform: false, + + /** + * When true, objects use center point as the origin of scale transformation. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredScaling: false, + + /** + * When true, objects use center point as the origin of rotate transformation. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredRotation: false, + + /** + * Indicates that canvas is interactive. This property should not be changed. + * @type Boolean + * @default + */ + interactive: true, + + /** + * Indicates whether group selection should be enabled + * @type Boolean + * @default + */ + selection: true, + + /** + * Color of selection + * @type String + * @default + */ + selectionColor: 'rgba(100, 100, 255, 0.3)', // blue + + /** + * Default dash array pattern + * If not empty the selection border is dashed + * @type Array + */ + selectionDashArray: [ ], + + /** + * Color of the border of selection (usually slightly darker than color of selection itself) + * @type String + * @default + */ + selectionBorderColor: 'rgba(255, 255, 255, 0.3)', + + /** + * Width of a line used in object/group selection + * @type Number + * @default + */ + selectionLineWidth: 1, + + /** + * Default cursor value used when hovering over an object on canvas + * @type String + * @default + */ + hoverCursor: 'move', + + /** + * Default cursor value used when moving an object on canvas + * @type String + * @default + */ + moveCursor: 'move', + + /** + * Default cursor value used for the entire canvas + * @type String + * @default + */ + defaultCursor: 'default', + + /** + * Cursor value used during free drawing + * @type String + * @default + */ + freeDrawingCursor: 'crosshair', + + /** + * Cursor value used for rotation point + * @type String + * @default + */ + rotationCursor: 'crosshair', + + /** + * Default element class that's given to wrapper (div) element of canvas + * @type String + * @default + */ + containerClass: 'canvas-container', + + /** + * When true, object detection happens on per-pixel basis rather than on per-bounding-box + * @type Boolean + * @default + */ + perPixelTargetFind: false, + + /** + * Number of pixels around target pixel to tolerate (consider active) during object detection + * @type Number + * @default + */ + targetFindTolerance: 0, + + /** + * When true, target detection is skipped when hovering over canvas. This can be used to improve performance. + * @type Boolean + * @default + */ + skipTargetFind: false, + + /** + * @private + */ + _initInteractive: function() { + this._currentTransform = null; + this._groupSelector = null; + this._initWrapperElement(); + this._createUpperCanvas(); + this._initEventListeners(); + + this.freeDrawingBrush = fabric.PencilBrush && new fabric.PencilBrush(this); + + this.calcOffset(); + }, + + /** + * Resets the current transform to its original values and chooses the type of resizing based on the event + * @private + * @param {Event} e Event object fired on mousemove + */ + _resetCurrentTransform: function(e) { + var t = this._currentTransform; + + t.target.set({ + scaleX: t.original.scaleX, + scaleY: t.original.scaleY, + left: t.original.left, + top: t.original.top + }); + + if (this._shouldCenterTransform(e, t.target)) { + if (t.action === 'rotate') { + this._setOriginToCenter(t.target); + } + else { + if (t.originX !== 'center') { + if (t.originX === 'right') { + t.mouseXSign = -1; + } + else { + t.mouseXSign = 1; + } + } + if (t.originY !== 'center') { + if (t.originY === 'bottom') { + t.mouseYSign = -1; + } + else { + t.mouseYSign = 1; + } + } + + t.originX = 'center'; + t.originY = 'center'; + } + } + else { + t.originX = t.original.originX; + t.originY = t.original.originY; + } + }, + + /** + * Checks if point is contained within an area of given object + * @param {Event} e Event object + * @param {fabric.Object} target Object to test against + * @return {Boolean} true if point is contained within an area of given object + */ + containsPoint: function (e, target) { + var pointer = this.getPointer(e, true), + xy = this._normalizePointer(target, pointer); + + // http://www.geog.ubc.ca/courses/klink/gis.notes/ncgia/u32.html + // http://idav.ucdavis.edu/~okreylos/TAship/Spring2000/PointInPolygon.html + return (target.containsPoint(xy) || target._findTargetCorner(pointer)); + }, + + /** + * @private + */ + _normalizePointer: function (object, pointer) { + var activeGroup = this.getActiveGroup(), + x = pointer.x, + y = pointer.y, + isObjectInGroup = ( + activeGroup && + object.type !== 'group' && + activeGroup.contains(object)), + lt; + + if (isObjectInGroup) { + lt = new fabric.Point(activeGroup.left, activeGroup.top); + lt = fabric.util.transformPoint(lt, this.viewportTransform, true); + x -= lt.x; + y -= lt.y; + } + return { x: x, y: y }; + }, + + /** + * Returns true if object is transparent at a certain location + * @param {fabric.Object} target Object to check + * @param {Number} x Left coordinate + * @param {Number} y Top coordinate + * @return {Boolean} + */ + isTargetTransparent: function (target, x, y) { + var hasBorders = target.hasBorders, + transparentCorners = target.transparentCorners; + + target.hasBorders = target.transparentCorners = false; + + this._draw(this.contextCache, target); + + target.hasBorders = hasBorders; + target.transparentCorners = transparentCorners; + + var isTransparent = fabric.util.isTransparent( + this.contextCache, x, y, this.targetFindTolerance); + + this.clearContext(this.contextCache); + + return isTransparent; + }, + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + */ + _shouldClearSelection: function (e, target) { + var activeGroup = this.getActiveGroup(), + activeObject = this.getActiveObject(); + + return ( + !target + || + (target && + activeGroup && + !activeGroup.contains(target) && + activeGroup !== target && + !e.shiftKey) + || + (target && !target.evented) + || + (target && + !target.selectable && + activeObject && + activeObject !== target) + ); + }, + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + */ + _shouldCenterTransform: function (e, target) { + if (!target) { + return; + } + + var t = this._currentTransform, + centerTransform; + + if (t.action === 'scale' || t.action === 'scaleX' || t.action === 'scaleY') { + centerTransform = this.centeredScaling || target.centeredScaling; + } + else if (t.action === 'rotate') { + centerTransform = this.centeredRotation || target.centeredRotation; + } + + return centerTransform ? !e.altKey : e.altKey; + }, + + /** + * @private + */ + _getOriginFromCorner: function(target, corner) { + var origin = { + x: target.originX, + y: target.originY + }; + + if (corner === 'ml' || corner === 'tl' || corner === 'bl') { + origin.x = 'right'; + } + else if (corner === 'mr' || corner === 'tr' || corner === 'br') { + origin.x = 'left'; + } + + if (corner === 'tl' || corner === 'mt' || corner === 'tr') { + origin.y = 'bottom'; + } + else if (corner === 'bl' || corner === 'mb' || corner === 'br') { + origin.y = 'top'; + } + + return origin; + }, + + /** + * @private + */ + _getActionFromCorner: function(target, corner) { + var action = 'drag'; + if (corner) { + action = (corner === 'ml' || corner === 'mr') + ? 'scaleX' + : (corner === 'mt' || corner === 'mb') + ? 'scaleY' + : corner === 'mtr' + ? 'rotate' + : 'scale'; + } + return action; + }, + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + */ + _setupCurrentTransform: function (e, target) { + if (!target) { + return; + } + + var pointer = this.getPointer(e), + corner = target._findTargetCorner(this.getPointer(e, true)), + action = this._getActionFromCorner(target, corner), + origin = this._getOriginFromCorner(target, corner); + + this._currentTransform = { + target: target, + action: action, + scaleX: target.scaleX, + scaleY: target.scaleY, + offsetX: pointer.x - target.left, + offsetY: pointer.y - target.top, + originX: origin.x, + originY: origin.y, + ex: pointer.x, + ey: pointer.y, + left: target.left, + top: target.top, + theta: degreesToRadians(target.angle), + width: target.width * target.scaleX, + mouseXSign: 1, + mouseYSign: 1 + }; + + this._currentTransform.original = { + left: target.left, + top: target.top, + scaleX: target.scaleX, + scaleY: target.scaleY, + originX: origin.x, + originY: origin.y + }; + + this._resetCurrentTransform(e); + }, + + /** + * Translates object by "setting" its left/top + * @private + * @param {Number} x pointer's x coordinate + * @param {Number} y pointer's y coordinate + */ + _translateObject: function (x, y) { + var target = this._currentTransform.target; + + if (!target.get('lockMovementX')) { + target.set('left', x - this._currentTransform.offsetX); + } + if (!target.get('lockMovementY')) { + target.set('top', y - this._currentTransform.offsetY); + } + }, + + /** + * Scales object by invoking its scaleX/scaleY methods + * @private + * @param {Number} x pointer's x coordinate + * @param {Number} y pointer's y coordinate + * @param {String} by Either 'x' or 'y' - specifies dimension constraint by which to scale an object. + * When not provided, an object is scaled by both dimensions equally + */ + _scaleObject: function (x, y, by) { + var t = this._currentTransform, + target = t.target, + lockScalingX = target.get('lockScalingX'), + lockScalingY = target.get('lockScalingY'), + lockScalingFlip = target.get('lockScalingFlip'); + + if (lockScalingX && lockScalingY) { + return; + } + + // Get the constraint point + var constraintPosition = target.translateToOriginPoint(target.getCenterPoint(), t.originX, t.originY), + localMouse = target.toLocalPoint(new fabric.Point(x, y), t.originX, t.originY); + + this._setLocalMouse(localMouse, t); + + // Actually scale the object + this._setObjectScale(localMouse, t, lockScalingX, lockScalingY, by, lockScalingFlip); + + // Make sure the constraints apply + target.setPositionByOrigin(constraintPosition, t.originX, t.originY); + }, + + /** + * @private + */ + _setObjectScale: function(localMouse, transform, lockScalingX, lockScalingY, by, lockScalingFlip) { + var target = transform.target, forbidScalingX = false, forbidScalingY = false, + strokeWidth = target.stroke ? target.strokeWidth : 0; + + transform.newScaleX = localMouse.x / (target.width + strokeWidth / 2); + transform.newScaleY = localMouse.y / (target.height + strokeWidth / 2); + + if (lockScalingFlip && transform.newScaleX <= 0 && transform.newScaleX < target.scaleX) { + forbidScalingX = true; + } + + if (lockScalingFlip && transform.newScaleY <= 0 && transform.newScaleY < target.scaleY) { + forbidScalingY = true; + } + + if (by === 'equally' && !lockScalingX && !lockScalingY) { + forbidScalingX || forbidScalingY || this._scaleObjectEqually(localMouse, target, transform); + } + else if (!by) { + forbidScalingX || lockScalingX || target.set('scaleX', transform.newScaleX); + forbidScalingY || lockScalingY || target.set('scaleY', transform.newScaleY); + } + else if (by === 'x' && !target.get('lockUniScaling')) { + forbidScalingX || lockScalingX || target.set('scaleX', transform.newScaleX); + } + else if (by === 'y' && !target.get('lockUniScaling')) { + forbidScalingY || lockScalingY || target.set('scaleY', transform.newScaleY); + } + + forbidScalingX || forbidScalingY || this._flipObject(transform, by); + + }, + + /** + * @private + */ + _scaleObjectEqually: function(localMouse, target, transform) { + + var dist = localMouse.y + localMouse.x, + strokeWidth = target.stroke ? target.strokeWidth : 0, + lastDist = (target.height + (strokeWidth / 2)) * transform.original.scaleY + + (target.width + (strokeWidth / 2)) * transform.original.scaleX; + + // We use transform.scaleX/Y instead of target.scaleX/Y + // because the object may have a min scale and we'll loose the proportions + transform.newScaleX = transform.original.scaleX * dist / lastDist; + transform.newScaleY = transform.original.scaleY * dist / lastDist; + + target.set('scaleX', transform.newScaleX); + target.set('scaleY', transform.newScaleY); + }, + + /** + * @private + */ + _flipObject: function(transform, by) { + if (transform.newScaleX < 0 && by !== 'y') { + if (transform.originX === 'left') { + transform.originX = 'right'; + } + else if (transform.originX === 'right') { + transform.originX = 'left'; + } + } + + if (transform.newScaleY < 0 && by !== 'x') { + if (transform.originY === 'top') { + transform.originY = 'bottom'; + } + else if (transform.originY === 'bottom') { + transform.originY = 'top'; + } + } + }, + + /** + * @private + */ + _setLocalMouse: function(localMouse, t) { + var target = t.target; + + if (t.originX === 'right') { + localMouse.x *= -1; + } + else if (t.originX === 'center') { + localMouse.x *= t.mouseXSign * 2; + + if (localMouse.x < 0) { + t.mouseXSign = -t.mouseXSign; + } + } + + if (t.originY === 'bottom') { + localMouse.y *= -1; + } + else if (t.originY === 'center') { + localMouse.y *= t.mouseYSign * 2; + + if (localMouse.y < 0) { + t.mouseYSign = -t.mouseYSign; + } + } + + // adjust the mouse coordinates when dealing with padding + if (abs(localMouse.x) > target.padding) { + if (localMouse.x < 0) { + localMouse.x += target.padding; + } + else { + localMouse.x -= target.padding; + } + } + else { // mouse is within the padding, set to 0 + localMouse.x = 0; + } + + if (abs(localMouse.y) > target.padding) { + if (localMouse.y < 0) { + localMouse.y += target.padding; + } + else { + localMouse.y -= target.padding; + } + } + else { + localMouse.y = 0; + } + }, + + /** + * Rotates object by invoking its rotate method + * @private + * @param {Number} x pointer's x coordinate + * @param {Number} y pointer's y coordinate + */ + _rotateObject: function (x, y) { + + var t = this._currentTransform; + + if (t.target.get('lockRotation')) { + return; + } + + var lastAngle = atan2(t.ey - t.top, t.ex - t.left), + curAngle = atan2(y - t.top, x - t.left), + angle = radiansToDegrees(curAngle - lastAngle + t.theta); + + // normalize angle to positive value + if (angle < 0) { + angle = 360 + angle; + } + + t.target.angle = angle % 360; + }, + + /** + * Set the cursor type of the canvas element + * @param {String} value Cursor type of the canvas element. + * @see http://www.w3.org/TR/css3-ui/#cursor + */ + setCursor: function (value) { + this.upperCanvasEl.style.cursor = value; + }, + + /** + * @private + */ + _resetObjectTransform: function (target) { + target.scaleX = 1; + target.scaleY = 1; + target.setAngle(0); + }, + + /** + * @private + */ + _drawSelection: function () { + var ctx = this.contextTop, + groupSelector = this._groupSelector, + left = groupSelector.left, + top = groupSelector.top, + aleft = abs(left), + atop = abs(top); + + ctx.fillStyle = this.selectionColor; + + ctx.fillRect( + groupSelector.ex - ((left > 0) ? 0 : -left), + groupSelector.ey - ((top > 0) ? 0 : -top), + aleft, + atop + ); + + ctx.lineWidth = this.selectionLineWidth; + ctx.strokeStyle = this.selectionBorderColor; + + // selection border + if (this.selectionDashArray.length > 1) { + + var px = groupSelector.ex + STROKE_OFFSET - ((left > 0) ? 0: aleft), + py = groupSelector.ey + STROKE_OFFSET - ((top > 0) ? 0: atop); + + ctx.beginPath(); + + fabric.util.drawDashedLine(ctx, px, py, px + aleft, py, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px, py + atop - 1, px + aleft, py + atop - 1, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px, py, px, py + atop, this.selectionDashArray); + fabric.util.drawDashedLine(ctx, px + aleft - 1, py, px + aleft - 1, py + atop, this.selectionDashArray); + + ctx.closePath(); + ctx.stroke(); + } + else { + ctx.strokeRect( + groupSelector.ex + STROKE_OFFSET - ((left > 0) ? 0 : aleft), + groupSelector.ey + STROKE_OFFSET - ((top > 0) ? 0 : atop), + aleft, + atop + ); + } + }, + + /** + * @private + */ + _isLastRenderedObject: function(e) { + return ( + this.controlsAboveOverlay && + this.lastRenderedObjectWithControlsAboveOverlay && + this.lastRenderedObjectWithControlsAboveOverlay.visible && + this.containsPoint(e, this.lastRenderedObjectWithControlsAboveOverlay) && + this.lastRenderedObjectWithControlsAboveOverlay._findTargetCorner(this.getPointer(e, true))); + }, + + /** + * Method that determines what object we are clicking on + * @param {Event} e mouse event + * @param {Boolean} skipGroup when true, group is skipped and only objects are traversed through + */ + findTarget: function (e, skipGroup) { + if (this.skipTargetFind) { + return; + } + + if (this._isLastRenderedObject(e)) { + return this.lastRenderedObjectWithControlsAboveOverlay; + } + + // first check current group (if one exists) + var activeGroup = this.getActiveGroup(); + if (activeGroup && !skipGroup && this.containsPoint(e, activeGroup)) { + return activeGroup; + } + + var target = this._searchPossibleTargets(e); + this._fireOverOutEvents(target); + + return target; + }, + + /** + * @private + */ + _fireOverOutEvents: function(target) { + if (target) { + if (this._hoveredTarget !== target) { + this.fire('mouse:over', { target: target }); + target.fire('mouseover'); + if (this._hoveredTarget) { + this.fire('mouse:out', { target: this._hoveredTarget }); + this._hoveredTarget.fire('mouseout'); + } + this._hoveredTarget = target; + } + } + else if (this._hoveredTarget) { + this.fire('mouse:out', { target: this._hoveredTarget }); + this._hoveredTarget.fire('mouseout'); + this._hoveredTarget = null; + } + }, + + /** + * @private + */ + _checkTarget: function(e, obj, pointer) { + if (obj && + obj.visible && + obj.evented && + this.containsPoint(e, obj)){ + if ((this.perPixelTargetFind || obj.perPixelTargetFind) && !obj.isEditing) { + var isTransparent = this.isTargetTransparent(obj, pointer.x, pointer.y); + if (!isTransparent) { + return true; + } + } + else { + return true; + } + } + }, + + /** + * @private + */ + _searchPossibleTargets: function(e) { + + // Cache all targets where their bounding box contains point. + var target, + pointer = this.getPointer(e, true), + i = this._objects.length; + // Do not check for currently grouped objects, since we check the parent group itself. + while (i--) { + if (!this._objects[i].group && this._checkTarget(e, this._objects[i], pointer)){ + this.relatedTarget = this._objects[i]; + target = this._objects[i]; + break; + } + } + + return target; + }, + + /** + * Returns pointer coordinates relative to canvas. + * @param {Event} e + * @return {Object} object with "x" and "y" number values + */ + getPointer: function (e, ignoreZoom, upperCanvasEl) { + if (!upperCanvasEl) { + upperCanvasEl = this.upperCanvasEl; + } + var pointer = getPointer(e, upperCanvasEl), + bounds = upperCanvasEl.getBoundingClientRect(), + boundsWidth = bounds.width || 0, + boundsHeight = bounds.height || 0, + cssScale; + + if (!boundsWidth || !boundsHeight ) { + if ('top' in bounds && 'bottom' in bounds) { + boundsHeight = Math.abs( bounds.top - bounds.bottom ); + } + if ('right' in bounds && 'left' in bounds) { + boundsWidth = Math.abs( bounds.right - bounds.left ); + } + } + + this.calcOffset(); + + pointer.x = pointer.x - this._offset.left; + pointer.y = pointer.y - this._offset.top; + if (!ignoreZoom) { + pointer = fabric.util.transformPoint( + pointer, + fabric.util.invertTransform(this.viewportTransform) + ); + } + + if (boundsWidth === 0 || boundsHeight === 0) { + // If bounds are not available (i.e. not visible), do not apply scale. + cssScale = { width: 1, height: 1 }; + } + else { + cssScale = { + width: upperCanvasEl.width / boundsWidth, + height: upperCanvasEl.height / boundsHeight + }; + } + + return { + x: pointer.x * cssScale.width, + y: pointer.y * cssScale.height + }; + }, + + /** + * @private + * @throws {CANVAS_INIT_ERROR} If canvas can not be initialized + */ + _createUpperCanvas: function () { + var lowerCanvasClass = this.lowerCanvasEl.className.replace(/\s*lower-canvas\s*/, ''); + + this.upperCanvasEl = this._createCanvasElement(); + fabric.util.addClass(this.upperCanvasEl, 'upper-canvas ' + lowerCanvasClass); + + this.wrapperEl.appendChild(this.upperCanvasEl); + + this._copyCanvasStyle(this.lowerCanvasEl, this.upperCanvasEl); + this._applyCanvasStyle(this.upperCanvasEl); + this.contextTop = this.upperCanvasEl.getContext('2d'); + }, + + /** + * @private + */ + _createCacheCanvas: function () { + this.cacheCanvasEl = this._createCanvasElement(); + this.cacheCanvasEl.setAttribute('width', this.width); + this.cacheCanvasEl.setAttribute('height', this.height); + this.contextCache = this.cacheCanvasEl.getContext('2d'); + }, + + /** + * @private + */ + _initWrapperElement: function () { + this.wrapperEl = fabric.util.wrapElement(this.lowerCanvasEl, 'div', { + 'class': this.containerClass + }); + fabric.util.setStyle(this.wrapperEl, { + width: this.getWidth() + 'px', + height: this.getHeight() + 'px', + position: 'relative' + }); + fabric.util.makeElementUnselectable(this.wrapperEl); + }, + + /** + * @private + * @param {HTMLElement} element canvas element to apply styles on + */ + _applyCanvasStyle: function (element) { + var width = this.getWidth() || element.width, + height = this.getHeight() || element.height; + + fabric.util.setStyle(element, { + position: 'absolute', + width: width + 'px', + height: height + 'px', + left: 0, + top: 0 + }); + element.width = width; + element.height = height; + fabric.util.makeElementUnselectable(element); + }, + + /** + * Copys the the entire inline style from one element (fromEl) to another (toEl) + * @private + * @param {Element} fromEl Element style is copied from + * @param {Element} toEl Element copied style is applied to + */ + _copyCanvasStyle: function (fromEl, toEl) { + toEl.style.cssText = fromEl.style.cssText; + }, + + /** + * Returns context of canvas where object selection is drawn + * @return {CanvasRenderingContext2D} + */ + getSelectionContext: function() { + return this.contextTop; + }, + + /** + * Returns <canvas> element on which object selection is drawn + * @return {HTMLCanvasElement} + */ + getSelectionElement: function () { + return this.upperCanvasEl; + }, + + /** + * @private + * @param {Object} object + */ + _setActiveObject: function(object) { + if (this._activeObject) { + this._activeObject.set('active', false); + } + this._activeObject = object; + object.set('active', true); + }, + + /** + * Sets given object as the only active object on canvas + * @param {fabric.Object} object Object to set as an active one + * @param {Event} [e] Event (passed along when firing "object:selected") + * @return {fabric.Canvas} thisArg + * @chainable + */ + setActiveObject: function (object, e) { + this._setActiveObject(object); + this.renderAll(); + this.fire('object:selected', { target: object, e: e }); + object.fire('selected', { e: e }); + return this; + }, + + /** + * Returns currently active object + * @return {fabric.Object} active object + */ + getActiveObject: function () { + return this._activeObject; + }, + + /** + * @private + */ + _discardActiveObject: function() { + if (this._activeObject) { + this._activeObject.set('active', false); + } + this._activeObject = null; + }, + + /** + * Discards currently active object + * @return {fabric.Canvas} thisArg + * @chainable + */ + discardActiveObject: function (e) { + this._discardActiveObject(); + this.renderAll(); + this.fire('selection:cleared', { e: e }); + return this; + }, + + /** + * @private + * @param {fabric.Group} group + */ + _setActiveGroup: function(group) { + this._activeGroup = group; + if (group) { + group.set('active', true); + } + }, + + /** + * Sets active group to a speicified one + * @param {fabric.Group} group Group to set as a current one + * @return {fabric.Canvas} thisArg + * @chainable + */ + setActiveGroup: function (group, e) { + this._setActiveGroup(group); + if (group) { + this.fire('object:selected', { target: group, e: e }); + group.fire('selected', { e: e }); + } + return this; + }, + + /** + * Returns currently active group + * @return {fabric.Group} Current group + */ + getActiveGroup: function () { + return this._activeGroup; + }, + + /** + * @private + */ + _discardActiveGroup: function() { + var g = this.getActiveGroup(); + if (g) { + g.destroy(); + } + this.setActiveGroup(null); + }, + + /** + * Discards currently active group + * @return {fabric.Canvas} thisArg + */ + discardActiveGroup: function (e) { + this._discardActiveGroup(); + this.fire('selection:cleared', { e: e }); + return this; + }, + + /** + * Deactivates all objects on canvas, removing any active group or object + * @return {fabric.Canvas} thisArg + */ + deactivateAll: function () { + var allObjects = this.getObjects(), + i = 0, + len = allObjects.length; + for ( ; i < len; i++) { + allObjects[i].set('active', false); + } + this._discardActiveGroup(); + this._discardActiveObject(); + return this; + }, + + /** + * Deactivates all objects and dispatches appropriate events + * @return {fabric.Canvas} thisArg + */ + deactivateAllWithDispatch: function (e) { + var activeObject = this.getActiveGroup() || this.getActiveObject(); + if (activeObject) { + this.fire('before:selection:cleared', { target: activeObject, e: e }); + } + this.deactivateAll(); + if (activeObject) { + this.fire('selection:cleared', { e: e }); + } + return this; + }, + + /** + * Draws objects' controls (borders/controls) + * @param {CanvasRenderingContext2D} ctx Context to render controls on + */ + drawControls: function(ctx) { + var activeGroup = this.getActiveGroup(); + if (activeGroup) { + this._drawGroupControls(ctx, activeGroup); + } + else { + this._drawObjectsControls(ctx); + } + }, + + /** + * @private + */ + _drawGroupControls: function(ctx, activeGroup) { + activeGroup._renderControls(ctx); + }, + + /** + * @private + */ + _drawObjectsControls: function(ctx) { + for (var i = 0, len = this._objects.length; i < len; ++i) { + if (!this._objects[i] || !this._objects[i].active) { + continue; + } + this._objects[i]._renderControls(ctx); + this.lastRenderedObjectWithControlsAboveOverlay = this._objects[i]; + } + } + }); + + // copying static properties manually to work around Opera's bug, + // where "prototype" property is enumerable and overrides existing prototype + for (var prop in fabric.StaticCanvas) { + if (prop !== 'prototype') { + fabric.Canvas[prop] = fabric.StaticCanvas[prop]; + } + } + + if (fabric.isTouchSupported) { + /** @ignore */ + fabric.Canvas.prototype._setCursorFromEvent = function() { }; + } + + /** + * @class fabric.Element + * @alias fabric.Canvas + * @deprecated Use {@link fabric.Canvas} instead. + * @constructor + */ + fabric.Element = fabric.Canvas; +})(); + + +(function() { + + var cursorOffset = { + mt: 0, // n + tr: 1, // ne + mr: 2, // e + br: 3, // se + mb: 4, // s + bl: 5, // sw + ml: 6, // w + tl: 7 // nw + }, + addListener = fabric.util.addListener, + removeListener = fabric.util.removeListener; + + fabric.util.object.extend(fabric.Canvas.prototype, /** @lends fabric.Canvas.prototype */ { + + /** + * Map of cursor style values for each of the object controls + * @private + */ + cursorMap: [ + 'n-resize', + 'ne-resize', + 'e-resize', + 'se-resize', + 's-resize', + 'sw-resize', + 'w-resize', + 'nw-resize' + ], + + /** + * Adds mouse listeners to canvas + * @private + */ + _initEventListeners: function () { + + this._bindEvents(); + + addListener(fabric.window, 'resize', this._onResize); + + // mouse events + addListener(this.upperCanvasEl, 'mousedown', this._onMouseDown); + addListener(this.upperCanvasEl, 'mousemove', this._onMouseMove); + addListener(this.upperCanvasEl, 'mousewheel', this._onMouseWheel); + + // touch events + addListener(this.upperCanvasEl, 'touchstart', this._onMouseDown); + addListener(this.upperCanvasEl, 'touchmove', this._onMouseMove); + + if (typeof eventjs !== 'undefined' && 'add' in eventjs) { + eventjs.add(this.upperCanvasEl, 'gesture', this._onGesture); + eventjs.add(this.upperCanvasEl, 'drag', this._onDrag); + eventjs.add(this.upperCanvasEl, 'orientation', this._onOrientationChange); + eventjs.add(this.upperCanvasEl, 'shake', this._onShake); + eventjs.add(this.upperCanvasEl, 'longpress', this._onLongPress); + } + }, + + /** + * @private + */ + _bindEvents: function() { + this._onMouseDown = this._onMouseDown.bind(this); + this._onMouseMove = this._onMouseMove.bind(this); + this._onMouseUp = this._onMouseUp.bind(this); + this._onResize = this._onResize.bind(this); + this._onGesture = this._onGesture.bind(this); + this._onDrag = this._onDrag.bind(this); + this._onShake = this._onShake.bind(this); + this._onLongPress = this._onLongPress.bind(this); + this._onOrientationChange = this._onOrientationChange.bind(this); + this._onMouseWheel = this._onMouseWheel.bind(this); + }, + + /** + * Removes all event listeners + */ + removeListeners: function() { + removeListener(fabric.window, 'resize', this._onResize); + + removeListener(this.upperCanvasEl, 'mousedown', this._onMouseDown); + removeListener(this.upperCanvasEl, 'mousemove', this._onMouseMove); + removeListener(this.upperCanvasEl, 'mousewheel', this._onMouseWheel); + + removeListener(this.upperCanvasEl, 'touchstart', this._onMouseDown); + removeListener(this.upperCanvasEl, 'touchmove', this._onMouseMove); + + if (typeof eventjs !== 'undefined' && 'remove' in eventjs) { + eventjs.remove(this.upperCanvasEl, 'gesture', this._onGesture); + eventjs.remove(this.upperCanvasEl, 'drag', this._onDrag); + eventjs.remove(this.upperCanvasEl, 'orientation', this._onOrientationChange); + eventjs.remove(this.upperCanvasEl, 'shake', this._onShake); + eventjs.remove(this.upperCanvasEl, 'longpress', this._onLongPress); + } + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js gesture + * @param {Event} [self] Inner Event object + */ + _onGesture: function(e, self) { + this.__onTransformGesture && this.__onTransformGesture(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js drag + * @param {Event} [self] Inner Event object + */ + _onDrag: function(e, self) { + this.__onDrag && this.__onDrag(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js wheel event + * @param {Event} [self] Inner Event object + */ + _onMouseWheel: function(e, self) { + this.__onMouseWheel && this.__onMouseWheel(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js orientation change + * @param {Event} [self] Inner Event object + */ + _onOrientationChange: function(e, self) { + this.__onOrientationChange && this.__onOrientationChange(e, self); + }, + + /** + * @private + * @param {Event} [e] Event object fired on Event.js shake + * @param {Event} [self] Inner Event object + */ + _onShake: function(e, self) { + this.__onShake && this.__onShake(e, self); + }, + /** + * @private + * @param {Event} [e] Event object fired on Event.js shake + * @param {Event} [self] Inner Event object + */ + _onLongPress: function(e, self) { + this.__onLongPress && this.__onLongPress(e, self); + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onMouseDown: function (e) { + this.__onMouseDown(e); + + addListener(fabric.document, 'touchend', this._onMouseUp); + addListener(fabric.document, 'touchmove', this._onMouseMove); + + removeListener(this.upperCanvasEl, 'mousemove', this._onMouseMove); + removeListener(this.upperCanvasEl, 'touchmove', this._onMouseMove); + + if (e.type === 'touchstart') { + // Unbind mousedown to prevent double triggers from touch devices + removeListener(this.upperCanvasEl, 'mousedown', this._onMouseDown); + } + else { + addListener(fabric.document, 'mouseup', this._onMouseUp); + addListener(fabric.document, 'mousemove', this._onMouseMove); + } + }, + + /** + * @private + * @param {Event} e Event object fired on mouseup + */ + _onMouseUp: function (e) { + this.__onMouseUp(e); + + removeListener(fabric.document, 'mouseup', this._onMouseUp); + removeListener(fabric.document, 'touchend', this._onMouseUp); + + removeListener(fabric.document, 'mousemove', this._onMouseMove); + removeListener(fabric.document, 'touchmove', this._onMouseMove); + + addListener(this.upperCanvasEl, 'mousemove', this._onMouseMove); + addListener(this.upperCanvasEl, 'touchmove', this._onMouseMove); + + if (e.type === 'touchend') { + // Wait 400ms before rebinding mousedown to prevent double triggers + // from touch devices + var _this = this; + setTimeout(function() { + addListener(_this.upperCanvasEl, 'mousedown', _this._onMouseDown); + }, 400); + } + }, + + /** + * @private + * @param {Event} e Event object fired on mousemove + */ + _onMouseMove: function (e) { + !this.allowTouchScrolling && e.preventDefault && e.preventDefault(); + this.__onMouseMove(e); + }, + + /** + * @private + */ + _onResize: function () { + this.calcOffset(); + }, + + /** + * Decides whether the canvas should be redrawn in mouseup and mousedown events. + * @private + * @param {Object} target + * @param {Object} pointer + */ + _shouldRender: function(target, pointer) { + var activeObject = this.getActiveGroup() || this.getActiveObject(); + + return !!( + (target && ( + target.isMoving || + target !== activeObject)) + || + (!target && !!activeObject) + || + (!target && !activeObject && !this._groupSelector) + || + (pointer && + this._previousPointer && + this.selection && ( + pointer.x !== this._previousPointer.x || + pointer.y !== this._previousPointer.y)) + ); + }, + + /** + * Method that defines the actions when mouse is released on canvas. + * The method resets the currentTransform parameters, store the image corner + * position in the image object and render the canvas on top. + * @private + * @param {Event} e Event object fired on mouseup + */ + __onMouseUp: function (e) { + var target; + + if (this.isDrawingMode && this._isCurrentlyDrawing) { + this._onMouseUpInDrawingMode(e); + return; + } + + if (this._currentTransform) { + this._finalizeCurrentTransform(); + target = this._currentTransform.target; + } + else { + target = this.findTarget(e, true); + } + + var shouldRender = this._shouldRender(target, this.getPointer(e)); + + this._maybeGroupObjects(e); + + if (target) { + target.isMoving = false; + } + + shouldRender && this.renderAll(); + + this._handleCursorAndEvent(e, target); + }, + + _handleCursorAndEvent: function(e, target) { + this._setCursorFromEvent(e, target); + + // TODO: why are we doing this? + var _this = this; + setTimeout(function () { + _this._setCursorFromEvent(e, target); + }, 50); + + this.fire('mouse:up', { target: target, e: e }); + target && target.fire('mouseup', { e: e }); + }, + + /** + * @private + */ + _finalizeCurrentTransform: function() { + + var transform = this._currentTransform, + target = transform.target; + + if (target._scaling) { + target._scaling = false; + } + + target.setCoords(); + + // only fire :modified event if target coordinates were changed during mousedown-mouseup + if (this.stateful && target.hasStateChanged()) { + this.fire('object:modified', { target: target }); + target.fire('modified'); + } + + this._restoreOriginXY(target); + }, + + /** + * @private + * @param {Object} target Object to restore + */ + _restoreOriginXY: function(target) { + if (this._previousOriginX && this._previousOriginY) { + + var originPoint = target.translateToOriginPoint( + target.getCenterPoint(), + this._previousOriginX, + this._previousOriginY); + + target.originX = this._previousOriginX; + target.originY = this._previousOriginY; + + target.left = originPoint.x; + target.top = originPoint.y; + + this._previousOriginX = null; + this._previousOriginY = null; + } + }, + + /** + * @private + * @param {Event} e Event object fired on mousedown + */ + _onMouseDownInDrawingMode: function(e) { + this._isCurrentlyDrawing = true; + this.discardActiveObject(e).renderAll(); + if (this.clipTo) { + fabric.util.clipContext(this, this.contextTop); + } + var ivt = fabric.util.invertTransform(this.viewportTransform), + pointer = fabric.util.transformPoint(this.getPointer(e, true), ivt); + this.freeDrawingBrush.onMouseDown(pointer); + this.fire('mouse:down', { e: e }); + + var target = this.findTarget(e); + if (typeof target !== 'undefined') { + target.fire('mousedown', { e: e, target: target }); + } + }, + + /** + * @private + * @param {Event} e Event object fired on mousemove + */ + _onMouseMoveInDrawingMode: function(e) { + if (this._isCurrentlyDrawing) { + var ivt = fabric.util.invertTransform(this.viewportTransform), + pointer = fabric.util.transformPoint(this.getPointer(e, true), ivt); + this.freeDrawingBrush.onMouseMove(pointer); + } + this.setCursor(this.freeDrawingCursor); + this.fire('mouse:move', { e: e }); + + var target = this.findTarget(e); + if (typeof target !== 'undefined') { + target.fire('mousemove', { e: e, target: target }); + } + }, + + /** + * @private + * @param {Event} e Event object fired on mouseup + */ + _onMouseUpInDrawingMode: function(e) { + this._isCurrentlyDrawing = false; + if (this.clipTo) { + this.contextTop.restore(); + } + this.freeDrawingBrush.onMouseUp(); + this.fire('mouse:up', { e: e }); + + var target = this.findTarget(e); + if (typeof target !== 'undefined') { + target.fire('mouseup', { e: e, target: target }); + } + }, + + /** + * Method that defines the actions when mouse is clic ked on canvas. + * The method inits the currentTransform parameters and renders all the + * canvas so the current image can be placed on the top canvas and the rest + * in on the container one. + * @private + * @param {Event} e Event object fired on mousedown + */ + __onMouseDown: function (e) { + + // accept only left clicks + var isLeftClick = 'which' in e ? e.which === 1 : e.button === 1; + if (!isLeftClick && !fabric.isTouchSupported) { + return; + } + + if (this.isDrawingMode) { + this._onMouseDownInDrawingMode(e); + return; + } + + // ignore if some object is being transformed at this moment + if (this._currentTransform) { + return; + } + + var target = this.findTarget(e), + pointer = this.getPointer(e, true); + + // save pointer for check in __onMouseUp event + this._previousPointer = pointer; + + var shouldRender = this._shouldRender(target, pointer), + shouldGroup = this._shouldGroup(e, target); + + if (this._shouldClearSelection(e, target)) { + this._clearSelection(e, target, pointer); + } + else if (shouldGroup) { + this._handleGrouping(e, target); + target = this.getActiveGroup(); + } + + if (target && target.selectable && !shouldGroup) { + this._beforeTransform(e, target); + this._setupCurrentTransform(e, target); + } + // we must renderAll so that active image is placed on the top canvas + shouldRender && this.renderAll(); + + this.fire('mouse:down', { target: target, e: e }); + target && target.fire('mousedown', { e: e }); + }, + + /** + * @private + */ + _beforeTransform: function(e, target) { + this.stateful && target.saveState(); + + // determine if it's a drag or rotate case + if (target._findTargetCorner(this.getPointer(e))) { + this.onBeforeScaleRotate(target); + } + + if (target !== this.getActiveGroup() && target !== this.getActiveObject()) { + this.deactivateAll(); + this.setActiveObject(target, e); + } + }, + + /** + * @private + */ + _clearSelection: function(e, target, pointer) { + this.deactivateAllWithDispatch(e); + + if (target && target.selectable) { + this.setActiveObject(target, e); + } + else if (this.selection) { + this._groupSelector = { + ex: pointer.x, + ey: pointer.y, + top: 0, + left: 0 + }; + } + }, + + /** + * @private + * @param {Object} target Object for that origin is set to center + */ + _setOriginToCenter: function(target) { + this._previousOriginX = this._currentTransform.target.originX; + this._previousOriginY = this._currentTransform.target.originY; + + var center = target.getCenterPoint(); + + target.originX = 'center'; + target.originY = 'center'; + + target.left = center.x; + target.top = center.y; + + this._currentTransform.left = target.left; + this._currentTransform.top = target.top; + }, + + /** + * @private + * @param {Object} target Object for that center is set to origin + */ + _setCenterToOrigin: function(target) { + var originPoint = target.translateToOriginPoint( + target.getCenterPoint(), + this._previousOriginX, + this._previousOriginY); + + target.originX = this._previousOriginX; + target.originY = this._previousOriginY; + + target.left = originPoint.x; + target.top = originPoint.y; + + this._previousOriginX = null; + this._previousOriginY = null; + }, + + /** + * Method that defines the actions when mouse is hovering the canvas. + * The currentTransform parameter will definde whether the user is rotating/scaling/translating + * an image or neither of them (only hovering). A group selection is also possible and would cancel + * all any other type of action. + * In case of an image transformation only the top canvas will be rendered. + * @private + * @param {Event} e Event object fired on mousemove + */ + __onMouseMove: function (e) { + + var target, pointer; + + if (this.isDrawingMode) { + this._onMouseMoveInDrawingMode(e); + return; + } + if (typeof e.touches !== 'undefined' && e.touches.length > 1) { + return; + } + + var groupSelector = this._groupSelector; + + // We initially clicked in an empty area, so we draw a box for multiple selection + if (groupSelector) { + pointer = this.getPointer(e, true); + + groupSelector.left = pointer.x - groupSelector.ex; + groupSelector.top = pointer.y - groupSelector.ey; + + this.renderTop(); + } + else if (!this._currentTransform) { + + target = this.findTarget(e); + + if (!target || target && !target.selectable) { + this.setCursor(this.defaultCursor); + } + else { + this._setCursorFromEvent(e, target); + } + } + else { + this._transformObject(e); + } + + this.fire('mouse:move', { target: target, e: e }); + target && target.fire('mousemove', { e: e }); + }, + + /** + * @private + * @param {Event} e Event fired on mousemove + */ + _transformObject: function(e) { + var pointer = this.getPointer(e), + transform = this._currentTransform; + + transform.reset = false, + transform.target.isMoving = true; + + this._beforeScaleTransform(e, transform); + this._performTransformAction(e, transform, pointer); + + this.renderAll(); + }, + + /** + * @private + */ + _performTransformAction: function(e, transform, pointer) { + var x = pointer.x, + y = pointer.y, + target = transform.target, + action = transform.action; + + if (action === 'rotate') { + this._rotateObject(x, y); + this._fire('rotating', target, e); + } + else if (action === 'scale') { + this._onScale(e, transform, x, y); + this._fire('scaling', target, e); + } + else if (action === 'scaleX') { + this._scaleObject(x, y, 'x'); + this._fire('scaling', target, e); + } + else if (action === 'scaleY') { + this._scaleObject(x, y, 'y'); + this._fire('scaling', target, e); + } + else { + this._translateObject(x, y); + this._fire('moving', target, e); + this.setCursor(this.moveCursor); + } + }, + + /** + * @private + */ + _fire: function(eventName, target, e) { + this.fire('object:' + eventName, { target: target, e: e }); + target.fire(eventName, { e: e }); + }, + + /** + * @private + */ + _beforeScaleTransform: function(e, transform) { + if (transform.action === 'scale' || transform.action === 'scaleX' || transform.action === 'scaleY') { + var centerTransform = this._shouldCenterTransform(e, transform.target); + + // Switch from a normal resize to center-based + if ((centerTransform && (transform.originX !== 'center' || transform.originY !== 'center')) || + // Switch from center-based resize to normal one + (!centerTransform && transform.originX === 'center' && transform.originY === 'center') + ) { + this._resetCurrentTransform(e); + transform.reset = true; + } + } + }, + + /** + * @private + */ + _onScale: function(e, transform, x, y) { + // rotate object only if shift key is not pressed + // and if it is not a group we are transforming + if ((e.shiftKey || this.uniScaleTransform) && !transform.target.get('lockUniScaling')) { + transform.currentAction = 'scale'; + this._scaleObject(x, y); + } + else { + // Switch from a normal resize to proportional + if (!transform.reset && transform.currentAction === 'scale') { + this._resetCurrentTransform(e, transform.target); + } + + transform.currentAction = 'scaleEqually'; + this._scaleObject(x, y, 'equally'); + } + }, + + /** + * Sets the cursor depending on where the canvas is being hovered. + * Note: very buggy in Opera + * @param {Event} e Event object + * @param {Object} target Object that the mouse is hovering, if so. + */ + _setCursorFromEvent: function (e, target) { + if (!target || !target.selectable) { + this.setCursor(this.defaultCursor); + return false; + } + else { + var activeGroup = this.getActiveGroup(), + // only show proper corner when group selection is not active + corner = target._findTargetCorner + && (!activeGroup || !activeGroup.contains(target)) + && target._findTargetCorner(this.getPointer(e, true)); + + if (!corner) { + this.setCursor(target.hoverCursor || this.hoverCursor); + } + else { + this._setCornerCursor(corner, target); + } + } + return true; + }, + + /** + * @private + */ + _setCornerCursor: function(corner, target) { + if (corner in cursorOffset) { + this.setCursor(this._getRotatedCornerCursor(corner, target)); + } + else if (corner === 'mtr' && target.hasRotatingPoint) { + this.setCursor(this.rotationCursor); + } + else { + this.setCursor(this.defaultCursor); + return false; + } + }, + + /** + * @private + */ + _getRotatedCornerCursor: function(corner, target) { + var n = Math.round((target.getAngle() % 360) / 45); + + if (n < 0) { + n += 8; // full circle ahead + } + n += cursorOffset[corner]; + // normalize n to be from 0 to 7 + n %= 8; + + return this.cursorMap[n]; + } + }); +})(); + + +(function() { + + var min = Math.min, + max = Math.max; + + fabric.util.object.extend(fabric.Canvas.prototype, /** @lends fabric.Canvas.prototype */ { + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + * @return {Boolean} + */ + _shouldGroup: function(e, target) { + var activeObject = this.getActiveObject(); + return e.shiftKey && + (this.getActiveGroup() || (activeObject && activeObject !== target)) + && this.selection; + }, + + /** + * @private + * @param {Event} e Event object + * @param {fabric.Object} target + */ + _handleGrouping: function (e, target) { + + if (target === this.getActiveGroup()) { + + // if it's a group, find target again, this time skipping group + target = this.findTarget(e, true); + + // if even object is not found, bail out + if (!target || target.isType('group')) { + return; + } + } + if (this.getActiveGroup()) { + this._updateActiveGroup(target, e); + } + else { + this._createActiveGroup(target, e); + } + + if (this._activeGroup) { + this._activeGroup.saveCoords(); + } + }, + + /** + * @private + */ + _updateActiveGroup: function(target, e) { + var activeGroup = this.getActiveGroup(); + + if (activeGroup.contains(target)) { + + activeGroup.removeWithUpdate(target); + this._resetObjectTransform(activeGroup); + target.set('active', false); + + if (activeGroup.size() === 1) { + // remove group alltogether if after removal it only contains 1 object + this.discardActiveGroup(e); + // activate last remaining object + this.setActiveObject(activeGroup.item(0)); + return; + } + } + else { + activeGroup.addWithUpdate(target); + this._resetObjectTransform(activeGroup); + } + this.fire('selection:created', { target: activeGroup, e: e }); + activeGroup.set('active', true); + }, + + /** + * @private + */ + _createActiveGroup: function(target, e) { + + if (this._activeObject && target !== this._activeObject) { + + var group = this._createGroup(target); + group.addWithUpdate(); + + this.setActiveGroup(group); + this._activeObject = null; + + this.fire('selection:created', { target: group, e: e }); + } + + target.set('active', true); + }, + + /** + * @private + * @param {Object} target + */ + _createGroup: function(target) { + + var objects = this.getObjects(), + isActiveLower = objects.indexOf(this._activeObject) < objects.indexOf(target), + groupObjects = isActiveLower + ? [ this._activeObject, target ] + : [ target, this._activeObject ]; + + return new fabric.Group(groupObjects, { + canvas: this + }); + }, + + /** + * @private + * @param {Event} e mouse event + */ + _groupSelectedObjects: function (e) { + + var group = this._collectObjects(); + + // do not create group for 1 element only + if (group.length === 1) { + this.setActiveObject(group[0], e); + } + else if (group.length > 1) { + group = new fabric.Group(group.reverse(), { + canvas: this + }); + group.addWithUpdate(); + this.setActiveGroup(group, e); + group.saveCoords(); + this.fire('selection:created', { target: group }); + this.renderAll(); + } + }, + + /** + * @private + */ + _collectObjects: function() { + var group = [ ], + currentObject, + x1 = this._groupSelector.ex, + y1 = this._groupSelector.ey, + x2 = x1 + this._groupSelector.left, + y2 = y1 + this._groupSelector.top, + selectionX1Y1 = new fabric.Point(min(x1, x2), min(y1, y2)), + selectionX2Y2 = new fabric.Point(max(x1, x2), max(y1, y2)), + isClick = x1 === x2 && y1 === y2; + + for (var i = this._objects.length; i--; ) { + currentObject = this._objects[i]; + + if (!currentObject || !currentObject.selectable || !currentObject.visible) { + continue; + } + + if (currentObject.intersectsWithRect(selectionX1Y1, selectionX2Y2) || + currentObject.isContainedWithinRect(selectionX1Y1, selectionX2Y2) || + currentObject.containsPoint(selectionX1Y1) || + currentObject.containsPoint(selectionX2Y2) + ) { + currentObject.set('active', true); + group.push(currentObject); + + // only add one object if it's a click + if (isClick) { + break; + } + } + } + + return group; + }, + + /** + * @private + */ + _maybeGroupObjects: function(e) { + if (this.selection && this._groupSelector) { + this._groupSelectedObjects(e); + } + + var activeGroup = this.getActiveGroup(); + if (activeGroup) { + activeGroup.setObjectsCoords().setCoords(); + activeGroup.isMoving = false; + this.setCursor(this.defaultCursor); + } + + // clear selection and current transformation + this._groupSelector = null; + this._currentTransform = null; + } + }); + +})(); + + +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Exports canvas element to a dataurl image. Note that when multiplier is used, cropping is scaled appropriately + * @param {Object} [options] Options object + * @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png" + * @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg. + * @param {Number} [options.multiplier=1] Multiplier to scale by + * @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14 + * @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14 + * @param {Number} [options.width] Cropping width. Introduced in v1.2.14 + * @param {Number} [options.height] Cropping height. Introduced in v1.2.14 + * @return {String} Returns a data: URL containing a representation of the object in the format specified by options.format + * @see {@link http://jsfiddle.net/fabricjs/NfZVb/|jsFiddle demo} + * @example Generate jpeg dataURL with lower quality + * var dataURL = canvas.toDataURL({ + * format: 'jpeg', + * quality: 0.8 + * }); + * @example Generate cropped png dataURL (clipping of canvas) + * var dataURL = canvas.toDataURL({ + * format: 'png', + * left: 100, + * top: 100, + * width: 200, + * height: 200 + * }); + * @example Generate double scaled png dataURL + * var dataURL = canvas.toDataURL({ + * format: 'png', + * multiplier: 2 + * }); + */ + toDataURL: function (options) { + options || (options = { }); + + var format = options.format || 'png', + quality = options.quality || 1, + multiplier = options.multiplier || 1, + cropping = { + left: options.left, + top: options.top, + width: options.width, + height: options.height + }; + + if (multiplier !== 1) { + return this.__toDataURLWithMultiplier(format, quality, cropping, multiplier); + } + else { + return this.__toDataURL(format, quality, cropping); + } + }, + + /** + * @private + */ + __toDataURL: function(format, quality, cropping) { + + this.renderAll(true); + + var canvasEl = this.upperCanvasEl || this.lowerCanvasEl, + croppedCanvasEl = this.__getCroppedCanvas(canvasEl, cropping); + + // to avoid common confusion https://github.com/kangax/fabric.js/issues/806 + if (format === 'jpg') { + format = 'jpeg'; + } + + var data = (fabric.StaticCanvas.supports('toDataURLWithQuality')) + ? (croppedCanvasEl || canvasEl).toDataURL('image/' + format, quality) + : (croppedCanvasEl || canvasEl).toDataURL('image/' + format); + + this.contextTop && this.clearContext(this.contextTop); + this.renderAll(); + + if (croppedCanvasEl) { + croppedCanvasEl = null; + } + + return data; + }, + + /** + * @private + */ + __getCroppedCanvas: function(canvasEl, cropping) { + + var croppedCanvasEl, + croppedCtx, + shouldCrop = 'left' in cropping || + 'top' in cropping || + 'width' in cropping || + 'height' in cropping; + + if (shouldCrop) { + + croppedCanvasEl = fabric.util.createCanvasElement(); + croppedCtx = croppedCanvasEl.getContext('2d'); + + croppedCanvasEl.width = cropping.width || this.width; + croppedCanvasEl.height = cropping.height || this.height; + + croppedCtx.drawImage(canvasEl, -cropping.left || 0, -cropping.top || 0); + } + + return croppedCanvasEl; + }, + + /** + * @private + */ + __toDataURLWithMultiplier: function(format, quality, cropping, multiplier) { + + var origWidth = this.getWidth(), + origHeight = this.getHeight(), + scaledWidth = origWidth * multiplier, + scaledHeight = origHeight * multiplier, + activeObject = this.getActiveObject(), + activeGroup = this.getActiveGroup(), + + ctx = this.contextTop || this.contextContainer; + + if (multiplier > 1) { + this.setWidth(scaledWidth).setHeight(scaledHeight); + } + ctx.scale(multiplier, multiplier); + + if (cropping.left) { + cropping.left *= multiplier; + } + if (cropping.top) { + cropping.top *= multiplier; + } + if (cropping.width) { + cropping.width *= multiplier; + } + else if (multiplier < 1) { + cropping.width = scaledWidth; + } + if (cropping.height) { + cropping.height *= multiplier; + } + else if (multiplier < 1) { + cropping.height = scaledHeight; + } + + if (activeGroup) { + // not removing group due to complications with restoring it with correct state afterwords + this._tempRemoveBordersControlsFromGroup(activeGroup); + } + else if (activeObject && this.deactivateAll) { + this.deactivateAll(); + } + + this.renderAll(true); + + var data = this.__toDataURL(format, quality, cropping); + + // restoring width, height for `renderAll` to draw + // background properly (while context is scaled) + this.width = origWidth; + this.height = origHeight; + + ctx.scale(1 / multiplier, 1 / multiplier); + this.setWidth(origWidth).setHeight(origHeight); + + if (activeGroup) { + this._restoreBordersControlsOnGroup(activeGroup); + } + else if (activeObject && this.setActiveObject) { + this.setActiveObject(activeObject); + } + + this.contextTop && this.clearContext(this.contextTop); + this.renderAll(); + + return data; + }, + + /** + * Exports canvas element to a dataurl image (allowing to change image size via multiplier). + * @deprecated since 1.0.13 + * @param {String} format (png|jpeg) + * @param {Number} multiplier + * @param {Number} quality (0..1) + * @return {String} + */ + toDataURLWithMultiplier: function (format, multiplier, quality) { + return this.toDataURL({ + format: format, + multiplier: multiplier, + quality: quality + }); + }, + + /** + * @private + */ + _tempRemoveBordersControlsFromGroup: function(group) { + group.origHasControls = group.hasControls; + group.origBorderColor = group.borderColor; + + group.hasControls = true; + group.borderColor = 'rgba(0,0,0,0)'; + + group.forEachObject(function(o) { + o.origBorderColor = o.borderColor; + o.borderColor = 'rgba(0,0,0,0)'; + }); + }, + + /** + * @private + */ + _restoreBordersControlsOnGroup: function(group) { + group.hideControls = group.origHideControls; + group.borderColor = group.origBorderColor; + + group.forEachObject(function(o) { + o.borderColor = o.origBorderColor; + delete o.origBorderColor; + }); + } +}); + + +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Populates canvas with data from the specified dataless JSON. + * JSON format must conform to the one of {@link fabric.Canvas#toDatalessJSON} + * @deprecated since 1.2.2 + * @param {String|Object} json JSON string or object + * @param {Function} callback Callback, invoked when json is parsed + * and corresponding objects (e.g: {@link fabric.Image}) + * are initialized + * @param {Function} [reviver] Method for further parsing of JSON elements, called after each fabric object created. + * @return {fabric.Canvas} instance + * @chainable + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3/#deserialization} + */ + loadFromDatalessJSON: function (json, callback, reviver) { + return this.loadFromJSON(json, callback, reviver); + }, + + /** + * Populates canvas with data from the specified JSON. + * JSON format must conform to the one of {@link fabric.Canvas#toJSON} + * @param {String|Object} json JSON string or object + * @param {Function} callback Callback, invoked when json is parsed + * and corresponding objects (e.g: {@link fabric.Image}) + * are initialized + * @param {Function} [reviver] Method for further parsing of JSON elements, called after each fabric object created. + * @return {fabric.Canvas} instance + * @chainable + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3/#deserialization} + * @see {@link http://jsfiddle.net/fabricjs/fmgXt/|jsFiddle demo} + * @example loadFromJSON + * canvas.loadFromJSON(json, canvas.renderAll.bind(canvas)); + * @example loadFromJSON with reviver + * canvas.loadFromJSON(json, canvas.renderAll.bind(canvas), function(o, object) { + * // `o` = json object + * // `object` = fabric.Object instance + * // ... do some stuff ... + * }); + */ + loadFromJSON: function (json, callback, reviver) { + if (!json) { + return; + } + + // serialize if it wasn't already + var serialized = (typeof json === 'string') + ? JSON.parse(json) + : json; + + this.clear(); + + var _this = this; + this._enlivenObjects(serialized.objects, function () { + _this._setBgOverlay(serialized, callback); + }, reviver); + + return this; + }, + + /** + * @private + * @param {Object} serialized Object with background and overlay information + * @param {Function} callback Invoked after all background and overlay images/patterns loaded + */ + _setBgOverlay: function(serialized, callback) { + var _this = this, + loaded = { + backgroundColor: false, + overlayColor: false, + backgroundImage: false, + overlayImage: false + }; + + if (!serialized.backgroundImage && !serialized.overlayImage && !serialized.background && !serialized.overlay) { + callback && callback(); + return; + } + + var cbIfLoaded = function () { + if (loaded.backgroundImage && loaded.overlayImage && loaded.backgroundColor && loaded.overlayColor) { + _this.renderAll(); + callback && callback(); + } + }; + + this.__setBgOverlay('backgroundImage', serialized.backgroundImage, loaded, cbIfLoaded); + this.__setBgOverlay('overlayImage', serialized.overlayImage, loaded, cbIfLoaded); + this.__setBgOverlay('backgroundColor', serialized.background, loaded, cbIfLoaded); + this.__setBgOverlay('overlayColor', serialized.overlay, loaded, cbIfLoaded); + + cbIfLoaded(); + }, + + /** + * @private + * @param {String} property Property to set (backgroundImage, overlayImage, backgroundColor, overlayColor) + * @param {(Object|String)} value Value to set + * @param {Object} loaded Set loaded property to true if property is set + * @param {Object} callback Callback function to invoke after property is set + */ + __setBgOverlay: function(property, value, loaded, callback) { + var _this = this; + + if (!value) { + loaded[property] = true; + return; + } + + if (property === 'backgroundImage' || property === 'overlayImage') { + fabric.Image.fromObject(value, function(img) { + _this[property] = img; + loaded[property] = true; + callback && callback(); + }); + } + else { + this['set' + fabric.util.string.capitalize(property, true)](value, function() { + loaded[property] = true; + callback && callback(); + }); + } + }, + + /** + * @private + * @param {Array} objects + * @param {Function} callback + * @param {Function} [reviver] + */ + _enlivenObjects: function (objects, callback, reviver) { + var _this = this; + + if (!objects || objects.length === 0) { + callback && callback(); + return; + } + + var renderOnAddRemove = this.renderOnAddRemove; + this.renderOnAddRemove = false; + + fabric.util.enlivenObjects(objects, function(enlivenedObjects) { + enlivenedObjects.forEach(function(obj, index) { + _this.insertAt(obj, index, true); + }); + + _this.renderOnAddRemove = renderOnAddRemove; + callback && callback(); + }, null, reviver); + }, + + /** + * @private + * @param {String} format + * @param {Function} callback + */ + _toDataURL: function (format, callback) { + this.clone(function (clone) { + callback(clone.toDataURL(format)); + }); + }, + + /** + * @private + * @param {String} format + * @param {Number} multiplier + * @param {Function} callback + */ + _toDataURLWithMultiplier: function (format, multiplier, callback) { + this.clone(function (clone) { + callback(clone.toDataURLWithMultiplier(format, multiplier)); + }); + }, + + /** + * Clones canvas instance + * @param {Object} [callback] Receives cloned instance as a first argument + * @param {Array} [properties] Array of properties to include in the cloned canvas and children + */ + clone: function (callback, properties) { + var data = JSON.stringify(this.toJSON(properties)); + this.cloneWithoutData(function(clone) { + clone.loadFromJSON(data, function() { + callback && callback(clone); + }); + }); + }, + + /** + * Clones canvas instance without cloning existing data. + * This essentially copies canvas dimensions, clipping properties, etc. + * but leaves data empty (so that you can populate it with your own) + * @param {Object} [callback] Receives cloned instance as a first argument + */ + cloneWithoutData: function(callback) { + var el = fabric.document.createElement('canvas'); + + el.width = this.getWidth(); + el.height = this.getHeight(); + + var clone = new fabric.Canvas(el); + clone.clipTo = this.clipTo; + if (this.backgroundImage) { + clone.setBackgroundImage(this.backgroundImage.src, function() { + clone.renderAll(); + callback && callback(clone); + }); + clone.backgroundImageOpacity = this.backgroundImageOpacity; + clone.backgroundImageStretch = this.backgroundImageStretch; + } + else { + callback && callback(clone); + } + } +}); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + toFixed = fabric.util.toFixed, + capitalize = fabric.util.string.capitalize, + degreesToRadians = fabric.util.degreesToRadians, + supportsLineDash = fabric.StaticCanvas.supports('setLineDash'); + + if (fabric.Object) { + return; + } + + /** + * Root object class from which all 2d shape classes inherit from + * @class fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1/#objects} + * @see {@link fabric.Object#initialize} for constructor definition + * + * @fires added + * @fires removed + * + * @fires selected + * @fires modified + * @fires rotating + * @fires scaling + * @fires moving + * + * @fires mousedown + * @fires mouseup + */ + fabric.Object = fabric.util.createClass(/** @lends fabric.Object.prototype */ { + + /** + * Retrieves object's {@link fabric.Object#clipTo|clipping function} + * @method getClipTo + * @memberOf fabric.Object.prototype + * @return {Function} + */ + + /** + * Sets object's {@link fabric.Object#clipTo|clipping function} + * @method setClipTo + * @memberOf fabric.Object.prototype + * @param {Function} clipTo Clipping function + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#transformMatrix|transformMatrix} + * @method getTransformMatrix + * @memberOf fabric.Object.prototype + * @return {Array} transformMatrix + */ + + /** + * Sets object's {@link fabric.Object#transformMatrix|transformMatrix} + * @method setTransformMatrix + * @memberOf fabric.Object.prototype + * @param {Array} transformMatrix + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#visible|visible} state + * @method getVisible + * @memberOf fabric.Object.prototype + * @return {Boolean} True if visible + */ + + /** + * Sets object's {@link fabric.Object#visible|visible} state + * @method setVisible + * @memberOf fabric.Object.prototype + * @param {Boolean} value visible value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#shadow|shadow} + * @method getShadow + * @memberOf fabric.Object.prototype + * @return {Object} Shadow instance + */ + + /** + * Retrieves object's {@link fabric.Object#stroke|stroke} + * @method getStroke + * @memberOf fabric.Object.prototype + * @return {String} stroke value + */ + + /** + * Sets object's {@link fabric.Object#stroke|stroke} + * @method setStroke + * @memberOf fabric.Object.prototype + * @param {String} value stroke value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#strokeWidth|strokeWidth} + * @method getStrokeWidth + * @memberOf fabric.Object.prototype + * @return {Number} strokeWidth value + */ + + /** + * Sets object's {@link fabric.Object#strokeWidth|strokeWidth} + * @method setStrokeWidth + * @memberOf fabric.Object.prototype + * @param {Number} value strokeWidth value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#originX|originX} + * @method getOriginX + * @memberOf fabric.Object.prototype + * @return {String} originX value + */ + + /** + * Sets object's {@link fabric.Object#originX|originX} + * @method setOriginX + * @memberOf fabric.Object.prototype + * @param {String} value originX value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#originY|originY} + * @method getOriginY + * @memberOf fabric.Object.prototype + * @return {String} originY value + */ + + /** + * Sets object's {@link fabric.Object#originY|originY} + * @method setOriginY + * @memberOf fabric.Object.prototype + * @param {String} value originY value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#fill|fill} + * @method getFill + * @memberOf fabric.Object.prototype + * @return {String} Fill value + */ + + /** + * Sets object's {@link fabric.Object#fill|fill} + * @method setFill + * @memberOf fabric.Object.prototype + * @param {String} value Fill value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#opacity|opacity} + * @method getOpacity + * @memberOf fabric.Object.prototype + * @return {Number} Opacity value (0-1) + */ + + /** + * Sets object's {@link fabric.Object#opacity|opacity} + * @method setOpacity + * @memberOf fabric.Object.prototype + * @param {Number} value Opacity value (0-1) + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#angle|angle} (in degrees) + * @method getAngle + * @memberOf fabric.Object.prototype + * @return {Number} + */ + + /** + * Retrieves object's {@link fabric.Object#top|top position} + * @method getTop + * @memberOf fabric.Object.prototype + * @return {Number} Top value (in pixels) + */ + + /** + * Sets object's {@link fabric.Object#top|top position} + * @method setTop + * @memberOf fabric.Object.prototype + * @param {Number} value Top value (in pixels) + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#left|left position} + * @method getLeft + * @memberOf fabric.Object.prototype + * @return {Number} Left value (in pixels) + */ + + /** + * Sets object's {@link fabric.Object#left|left position} + * @method setLeft + * @memberOf fabric.Object.prototype + * @param {Number} value Left value (in pixels) + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#scaleX|scaleX} value + * @method getScaleX + * @memberOf fabric.Object.prototype + * @return {Number} scaleX value + */ + + /** + * Sets object's {@link fabric.Object#scaleX|scaleX} value + * @method setScaleX + * @memberOf fabric.Object.prototype + * @param {Number} value scaleX value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#scaleY|scaleY} value + * @method getScaleY + * @memberOf fabric.Object.prototype + * @return {Number} scaleY value + */ + + /** + * Sets object's {@link fabric.Object#scaleY|scaleY} value + * @method setScaleY + * @memberOf fabric.Object.prototype + * @param {Number} value scaleY value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#flipX|flipX} value + * @method getFlipX + * @memberOf fabric.Object.prototype + * @return {Boolean} flipX value + */ + + /** + * Sets object's {@link fabric.Object#flipX|flipX} value + * @method setFlipX + * @memberOf fabric.Object.prototype + * @param {Boolean} value flipX value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Retrieves object's {@link fabric.Object#flipY|flipY} value + * @method getFlipY + * @memberOf fabric.Object.prototype + * @return {Boolean} flipY value + */ + + /** + * Sets object's {@link fabric.Object#flipY|flipY} value + * @method setFlipY + * @memberOf fabric.Object.prototype + * @param {Boolean} value flipY value + * @return {fabric.Object} thisArg + * @chainable + */ + + /** + * Type of an object (rect, circle, path, etc.). + * Note that this property is meant to be read-only and not meant to be modified. + * If you modify, certain parts of Fabric (such as JSON loading) won't work correctly. + * @type String + * @default + */ + type: 'object', + + /** + * Horizontal origin of transformation of an object (one of "left", "right", "center") + * See http://jsfiddle.net/1ow02gea/40/ on how originX/originY affect objects in groups + * @type String + * @default + */ + originX: 'left', + + /** + * Vertical origin of transformation of an object (one of "top", "bottom", "center") + * See http://jsfiddle.net/1ow02gea/40/ on how originX/originY affect objects in groups + * @type String + * @default + */ + originY: 'top', + + /** + * Top position of an object. Note that by default it's relative to object center. You can change this by setting originY={top/center/bottom} + * @type Number + * @default + */ + top: 0, + + /** + * Left position of an object. Note that by default it's relative to object center. You can change this by setting originX={left/center/right} + * @type Number + * @default + */ + left: 0, + + /** + * Object width + * @type Number + * @default + */ + width: 0, + + /** + * Object height + * @type Number + * @default + */ + height: 0, + + /** + * Object scale factor (horizontal) + * @type Number + * @default + */ + scaleX: 1, + + /** + * Object scale factor (vertical) + * @type Number + * @default + */ + scaleY: 1, + + /** + * When true, an object is rendered as flipped horizontally + * @type Boolean + * @default + */ + flipX: false, + + /** + * When true, an object is rendered as flipped vertically + * @type Boolean + * @default + */ + flipY: false, + + /** + * Opacity of an object + * @type Number + * @default + */ + opacity: 1, + + /** + * Angle of rotation of an object (in degrees) + * @type Number + * @default + */ + angle: 0, + + /** + * Size of object's controlling corners (in pixels) + * @type Number + * @default + */ + cornerSize: 12, + + /** + * When true, object's controlling corners are rendered as transparent inside (i.e. stroke instead of fill) + * @type Boolean + * @default + */ + transparentCorners: true, + + /** + * Default cursor value used when hovering over this object on canvas + * @type String + * @default + */ + hoverCursor: null, + + /** + * Padding between object and its controlling borders (in pixels) + * @type Number + * @default + */ + padding: 0, + + /** + * Color of controlling borders of an object (when it's active) + * @type String + * @default + */ + borderColor: 'rgba(102,153,255,0.75)', + + /** + * Color of controlling corners of an object (when it's active) + * @type String + * @default + */ + cornerColor: 'rgba(102,153,255,0.5)', + + /** + * When true, this object will use center point as the origin of transformation + * when being scaled via the controls. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredScaling: false, + + /** + * When true, this object will use center point as the origin of transformation + * when being rotated via the controls. + * Backwards incompatibility note: This property replaces "centerTransform" (Boolean). + * @since 1.3.4 + * @type Boolean + * @default + */ + centeredRotation: true, + + /** + * Color of object's fill + * @type String + * @default + */ + fill: 'rgb(0,0,0)', + + /** + * Fill rule used to fill an object + * accepted values are nonzero, evenodd + * Backwards incompatibility note: This property was used for setting globalCompositeOperation until v1.4.12 (use `fabric.Object#globalCompositeOperation` instead) + * @type String + * @default + */ + fillRule: 'nonzero', + + /** + * Composite rule used for canvas globalCompositeOperation + * @type String + * @default + */ + globalCompositeOperation: 'source-over', + + /** + * Background color of an object. Only works with text objects at the moment. + * @type String + * @default + */ + backgroundColor: '', + + /** + * When defined, an object is rendered via stroke and this property specifies its color + * @type String + * @default + */ + stroke: null, + + /** + * Width of a stroke used to render this object + * @type Number + * @default + */ + strokeWidth: 1, + + /** + * Array specifying dash pattern of an object's stroke (stroke must be defined) + * @type Array + */ + strokeDashArray: null, + + /** + * Line endings style of an object's stroke (one of "butt", "round", "square") + * @type String + * @default + */ + strokeLineCap: 'butt', + + /** + * Corner style of an object's stroke (one of "bevil", "round", "miter") + * @type String + * @default + */ + strokeLineJoin: 'miter', + + /** + * Maximum miter length (used for strokeLineJoin = "miter") of an object's stroke + * @type Number + * @default + */ + strokeMiterLimit: 10, + + /** + * Shadow object representing shadow of this shape + * @type fabric.Shadow + * @default + */ + shadow: null, + + /** + * Opacity of object's controlling borders when object is active and moving + * @type Number + * @default + */ + borderOpacityWhenMoving: 0.4, + + /** + * Scale factor of object's controlling borders + * @type Number + * @default + */ + borderScaleFactor: 1, + + /** + * Transform matrix (similar to SVG's transform matrix) + * @type Array + */ + transformMatrix: null, + + /** + * Minimum allowed scale value of an object + * @type Number + * @default + */ + minScaleLimit: 0.01, + + /** + * When set to `false`, an object can not be selected for modification (using either point-click-based or group-based selection). + * But events still fire on it. + * @type Boolean + * @default + */ + selectable: true, + + /** + * When set to `false`, an object can not be a target of events. All events propagate through it. Introduced in v1.3.4 + * @type Boolean + * @default + */ + evented: true, + + /** + * When set to `false`, an object is not rendered on canvas + * @type Boolean + * @default + */ + visible: true, + + /** + * When set to `false`, object's controls are not displayed and can not be used to manipulate object + * @type Boolean + * @default + */ + hasControls: true, + + /** + * When set to `false`, object's controlling borders are not rendered + * @type Boolean + * @default + */ + hasBorders: true, + + /** + * When set to `false`, object's controlling rotating point will not be visible or selectable + * @type Boolean + * @default + */ + hasRotatingPoint: true, + + /** + * Offset for object's controlling rotating point (when enabled via `hasRotatingPoint`) + * @type Number + * @default + */ + rotatingPointOffset: 40, + + /** + * When set to `true`, objects are "found" on canvas on per-pixel basis rather than according to bounding box + * @type Boolean + * @default + */ + perPixelTargetFind: false, + + /** + * When `false`, default object's values are not included in its serialization + * @type Boolean + * @default + */ + includeDefaultValues: true, + + /** + * Function that determines clipping of an object (context is passed as a first argument) + * Note that context origin is at the object's center point (not left/top corner) + * @type Function + */ + clipTo: null, + + /** + * When `true`, object horizontal movement is locked + * @type Boolean + * @default + */ + lockMovementX: false, + + /** + * When `true`, object vertical movement is locked + * @type Boolean + * @default + */ + lockMovementY: false, + + /** + * When `true`, object rotation is locked + * @type Boolean + * @default + */ + lockRotation: false, + + /** + * When `true`, object horizontal scaling is locked + * @type Boolean + * @default + */ + lockScalingX: false, + + /** + * When `true`, object vertical scaling is locked + * @type Boolean + * @default + */ + lockScalingY: false, + + /** + * When `true`, object non-uniform scaling is locked + * @type Boolean + * @default + */ + lockUniScaling: false, + + /** + * When `true`, object cannot be flipped by scaling into negative values + * @type Boolean + * @default + */ + + lockScalingFlip: false, + /** + * List of properties to consider when checking if state + * of an object is changed (fabric.Object#hasStateChanged) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: ( + 'top left width height scaleX scaleY flipX flipY originX originY transformMatrix ' + + 'stroke strokeWidth strokeDashArray strokeLineCap strokeLineJoin strokeMiterLimit ' + + 'angle opacity fill fillRule globalCompositeOperation shadow clipTo visible backgroundColor' + ).split(' '), + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + if (options) { + this.setOptions(options); + } + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initGradient: function(options) { + if (options.fill && options.fill.colorStops && !(options.fill instanceof fabric.Gradient)) { + this.set('fill', new fabric.Gradient(options.fill)); + } + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initPattern: function(options) { + if (options.fill && options.fill.source && !(options.fill instanceof fabric.Pattern)) { + this.set('fill', new fabric.Pattern(options.fill)); + } + if (options.stroke && options.stroke.source && !(options.stroke instanceof fabric.Pattern)) { + this.set('stroke', new fabric.Pattern(options.stroke)); + } + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initClipping: function(options) { + if (!options.clipTo || typeof options.clipTo !== 'string') { + return; + } + + var functionBody = fabric.util.getFunctionBody(options.clipTo); + if (typeof functionBody !== 'undefined') { + this.clipTo = new Function('ctx', functionBody); + } + }, + + /** + * Sets object's properties from options + * @param {Object} [options] Options object + */ + setOptions: function(options) { + for (var prop in options) { + this.set(prop, options[prop]); + } + this._initGradient(options); + this._initPattern(options); + this._initClipping(options); + }, + + /** + * Transforms context when rendering an object + * @param {CanvasRenderingContext2D} ctx Context + * @param {Boolean} fromLeft When true, context is transformed to object's top/left corner. This is used when rendering text on Node + */ + transform: function(ctx, fromLeft) { + var center = fromLeft ? this._getLeftTopCoords() : this.getCenterPoint(); + ctx.translate(center.x, center.y); + ctx.rotate(degreesToRadians(this.angle)); + ctx.scale( + this.scaleX * (this.flipX ? -1 : 1), + this.scaleY * (this.flipY ? -1 : 1) + ); + }, + + /** + * Returns an object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + var NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, + + object = { + type: this.type, + originX: this.originX, + originY: this.originY, + left: toFixed(this.left, NUM_FRACTION_DIGITS), + top: toFixed(this.top, NUM_FRACTION_DIGITS), + width: toFixed(this.width, NUM_FRACTION_DIGITS), + height: toFixed(this.height, NUM_FRACTION_DIGITS), + fill: (this.fill && this.fill.toObject) ? this.fill.toObject() : this.fill, + stroke: (this.stroke && this.stroke.toObject) ? this.stroke.toObject() : this.stroke, + strokeWidth: toFixed(this.strokeWidth, NUM_FRACTION_DIGITS), + strokeDashArray: this.strokeDashArray, + strokeLineCap: this.strokeLineCap, + strokeLineJoin: this.strokeLineJoin, + strokeMiterLimit: toFixed(this.strokeMiterLimit, NUM_FRACTION_DIGITS), + scaleX: toFixed(this.scaleX, NUM_FRACTION_DIGITS), + scaleY: toFixed(this.scaleY, NUM_FRACTION_DIGITS), + angle: toFixed(this.getAngle(), NUM_FRACTION_DIGITS), + flipX: this.flipX, + flipY: this.flipY, + opacity: toFixed(this.opacity, NUM_FRACTION_DIGITS), + shadow: (this.shadow && this.shadow.toObject) ? this.shadow.toObject() : this.shadow, + visible: this.visible, + clipTo: this.clipTo && String(this.clipTo), + backgroundColor: this.backgroundColor, + fillRule: this.fillRule, + globalCompositeOperation: this.globalCompositeOperation + }; + + if (!this.includeDefaultValues) { + object = this._removeDefaultValues(object); + } + + fabric.util.populateWithProperties(this, object, propertiesToInclude); + + return object; + }, + + /** + * Returns (dataless) object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + // will be overwritten by subclasses + return this.toObject(propertiesToInclude); + }, + + /** + * @private + * @param {Object} object + */ + _removeDefaultValues: function(object) { + var prototype = fabric.util.getKlass(object.type).prototype, + stateProperties = prototype.stateProperties; + + stateProperties.forEach(function(prop) { + if (object[prop] === prototype[prop]) { + delete object[prop]; + } + }); + + return object; + }, + + /** + * Returns a string representation of an instance + * @return {String} + */ + toString: function() { + return '#'; + }, + + /** + * Basic getter + * @param {String} property Property name + * @return {Any} value of a property + */ + get: function(property) { + return this[property]; + }, + + /** + * @private + */ + _setObject: function(obj) { + for (var prop in obj) { + this._set(prop, obj[prop]); + } + }, + + /** + * Sets property to a given value. When changing position/dimension -related properties (left, top, scale, angle, etc.) `set` does not update position of object's borders/controls. If you need to update those, call `setCoords()`. + * @param {String|Object} key Property name or object (if object, iterate over the object properties) + * @param {Object|Function} value Property value (if function, the value is passed into it and its return value is used as a new one) + * @return {fabric.Object} thisArg + * @chainable + */ + set: function(key, value) { + if (typeof key === 'object') { + this._setObject(key); + } + else { + if (typeof value === 'function' && key !== 'clipTo') { + this._set(key, value(this.get(key))); + } + else { + this._set(key, value); + } + } + return this; + }, + + /** + * @private + * @param {String} key + * @param {Any} value + * @return {fabric.Object} thisArg + */ + _set: function(key, value) { + var shouldConstrainValue = (key === 'scaleX' || key === 'scaleY'); + + if (shouldConstrainValue) { + value = this._constrainScale(value); + } + if (key === 'scaleX' && value < 0) { + this.flipX = !this.flipX; + value *= -1; + } + else if (key === 'scaleY' && value < 0) { + this.flipY = !this.flipY; + value *= -1; + } + else if (key === 'width' || key === 'height') { + this.minScaleLimit = toFixed(Math.min(0.1, 1/Math.max(this.width, this.height)), 2); + } + else if (key === 'shadow' && value && !(value instanceof fabric.Shadow)) { + value = new fabric.Shadow(value); + } + + this[key] = value; + + return this; + }, + + /** + * Toggles specified property from `true` to `false` or from `false` to `true` + * @param {String} property Property to toggle + * @return {fabric.Object} thisArg + * @chainable + */ + toggle: function(property) { + var value = this.get(property); + if (typeof value === 'boolean') { + this.set(property, !value); + } + return this; + }, + + /** + * Sets sourcePath of an object + * @param {String} value Value to set sourcePath to + * @return {fabric.Object} thisArg + * @chainable + */ + setSourcePath: function(value) { + this.sourcePath = value; + return this; + }, + + /** + * Retrieves viewportTransform from Object's canvas if possible + * @method getViewportTransform + * @memberOf fabric.Object.prototype + * @return {Boolean} flipY value // TODO + */ + getViewportTransform: function() { + if (this.canvas && this.canvas.viewportTransform) { + return this.canvas.viewportTransform; + } + return [1, 0, 0, 1, 0, 0]; + }, + + /** + * Renders an object on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + render: function(ctx, noTransform) { + // do not render if width/height are zeros or object is not visible + if ((this.width === 0 && this.height === 0) || !this.visible) { + return; + } + + ctx.save(); + + //setup fill rule for current object + this._setupCompositeOperation(ctx); + if (!noTransform) { + this.transform(ctx); + } + this._setStrokeStyles(ctx); + this._setFillStyles(ctx); + if (this.transformMatrix) { + ctx.transform.apply(ctx, this.transformMatrix); + } + this._setOpacity(ctx); + this._setShadow(ctx); + this.clipTo && fabric.util.clipContext(this, ctx); + this._render(ctx, noTransform); + this.clipTo && ctx.restore(); + this._removeShadow(ctx); + this._restoreCompositeOperation(ctx); + + ctx.restore(); + }, + + /* @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _setOpacity: function(ctx) { + if (this.group) { + this.group._setOpacity(ctx); + } + ctx.globalAlpha *= this.opacity; + }, + + _setStrokeStyles: function(ctx) { + if (this.stroke) { + ctx.lineWidth = this.strokeWidth; + ctx.lineCap = this.strokeLineCap; + ctx.lineJoin = this.strokeLineJoin; + ctx.miterLimit = this.strokeMiterLimit; + ctx.strokeStyle = this.stroke.toLive + ? this.stroke.toLive(ctx, this) + : this.stroke; + } + }, + + _setFillStyles: function(ctx) { + if (this.fill) { + ctx.fillStyle = this.fill.toLive + ? this.fill.toLive(ctx, this) + : this.fill; + } + }, + + /** + * Renders controls and borders for the object + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + _renderControls: function(ctx, noTransform) { + if (!this.active || noTransform) { + return; + } + var vpt = this.getViewportTransform(); + ctx.save(); + var center; + if (this.group) { + center = fabric.util.transformPoint(this.group.getCenterPoint(), vpt); + ctx.translate(center.x, center.y); + ctx.rotate(degreesToRadians(this.group.angle)); + } + center = fabric.util.transformPoint(this.getCenterPoint(), vpt, null != this.group); + if (this.group) { + center.x *= this.group.scaleX; + center.y *= this.group.scaleY; + } + ctx.translate(center.x, center.y); + ctx.rotate(degreesToRadians(this.angle)); + this.drawBorders(ctx); + this.drawControls(ctx); + ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _setShadow: function(ctx) { + if (!this.shadow) { + return; + } + + var multX = (this.canvas && this.canvas.viewportTransform[0]) || 1, + multY = (this.canvas && this.canvas.viewportTransform[3]) || 1; + + ctx.shadowColor = this.shadow.color; + ctx.shadowBlur = this.shadow.blur * (multX + multY) * (this.scaleX + this.scaleY) / 4; + ctx.shadowOffsetX = this.shadow.offsetX * multX * this.scaleX; + ctx.shadowOffsetY = this.shadow.offsetY * multY * this.scaleY; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _removeShadow: function(ctx) { + if (!this.shadow) { + return; + } + + ctx.shadowColor = ''; + ctx.shadowBlur = ctx.shadowOffsetX = ctx.shadowOffsetY = 0; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderFill: function(ctx) { + if (!this.fill) { + return; + } + + ctx.save(); + if (this.fill.gradientTransform) { + var g = this.fill.gradientTransform; + ctx.transform.apply(ctx, g); + } + if (this.fill.toLive) { + ctx.translate( + -this.width / 2 + this.fill.offsetX || 0, + -this.height / 2 + this.fill.offsetY || 0); + } + if (this.fillRule === 'evenodd') { + ctx.fill('evenodd'); + } + else { + ctx.fill(); + } + ctx.restore(); + if (this.shadow && !this.shadow.affectStroke) { + this._removeShadow(ctx); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderStroke: function(ctx) { + if (!this.stroke || this.strokeWidth === 0) { + return; + } + + ctx.save(); + if (this.strokeDashArray) { + // Spec requires the concatenation of two copies the dash list when the number of elements is odd + if (1 & this.strokeDashArray.length) { + this.strokeDashArray.push.apply(this.strokeDashArray, this.strokeDashArray); + } + if (supportsLineDash) { + ctx.setLineDash(this.strokeDashArray); + this._stroke && this._stroke(ctx); + } + else { + this._renderDashedStroke && this._renderDashedStroke(ctx); + } + ctx.stroke(); + } + else { + if (this.stroke.gradientTransform) { + var g = this.stroke.gradientTransform; + ctx.transform.apply(ctx, g); + } + this._stroke ? this._stroke(ctx) : ctx.stroke(); + } + this._removeShadow(ctx); + ctx.restore(); + }, + + /** + * Clones an instance + * @param {Function} callback Callback is invoked with a clone as a first argument + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {fabric.Object} clone of an instance + */ + clone: function(callback, propertiesToInclude) { + if (this.constructor.fromObject) { + return this.constructor.fromObject(this.toObject(propertiesToInclude), callback); + } + return new fabric.Object(this.toObject(propertiesToInclude)); + }, + + /** + * Creates an instance of fabric.Image out of an object + * @param {Function} callback callback, invoked with an instance as a first argument + * @return {fabric.Object} thisArg + */ + cloneAsImage: function(callback) { + var dataUrl = this.toDataURL(); + fabric.util.loadImage(dataUrl, function(img) { + if (callback) { + callback(new fabric.Image(img)); + } + }); + return this; + }, + + /** + * Converts an object into a data-url-like string + * @param {Object} options Options object + * @param {String} [options.format=png] The format of the output image. Either "jpeg" or "png" + * @param {Number} [options.quality=1] Quality level (0..1). Only used for jpeg. + * @param {Number} [options.multiplier=1] Multiplier to scale by + * @param {Number} [options.left] Cropping left offset. Introduced in v1.2.14 + * @param {Number} [options.top] Cropping top offset. Introduced in v1.2.14 + * @param {Number} [options.width] Cropping width. Introduced in v1.2.14 + * @param {Number} [options.height] Cropping height. Introduced in v1.2.14 + * @return {String} Returns a data: URL containing a representation of the object in the format specified by options.format + */ + toDataURL: function(options) { + options || (options = { }); + + var el = fabric.util.createCanvasElement(), + boundingRect = this.getBoundingRect(); + + el.width = boundingRect.width; + el.height = boundingRect.height; + + fabric.util.wrapElement(el, 'div'); + var canvas = new fabric.StaticCanvas(el); + + // to avoid common confusion https://github.com/kangax/fabric.js/issues/806 + if (options.format === 'jpg') { + options.format = 'jpeg'; + } + + if (options.format === 'jpeg') { + canvas.backgroundColor = '#fff'; + } + + var origParams = { + active: this.get('active'), + left: this.getLeft(), + top: this.getTop() + }; + + this.set('active', false); + this.setPositionByOrigin(new fabric.Point(el.width / 2, el.height / 2), 'center', 'center'); + + var originalCanvas = this.canvas; + canvas.add(this); + var data = canvas.toDataURL(options); + + this.set(origParams).setCoords(); + this.canvas = originalCanvas; + + canvas.dispose(); + canvas = null; + + return data; + }, + + /** + * Returns true if specified type is identical to the type of an instance + * @param {String} type Type to check against + * @return {Boolean} + */ + isType: function(type) { + return this.type === type; + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return 0; + }, + + /** + * Returns a JSON representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} JSON + */ + toJSON: function(propertiesToInclude) { + // delegate, not alias + return this.toObject(propertiesToInclude); + }, + + /** + * Sets gradient (fill or stroke) of an object + * Backwards incompatibility note: This method was named "setGradientFill" until v1.1.0 + * @param {String} property Property name 'stroke' or 'fill' + * @param {Object} [options] Options object + * @param {String} [options.type] Type of gradient 'radial' or 'linear' + * @param {Number} [options.x1=0] x-coordinate of start point + * @param {Number} [options.y1=0] y-coordinate of start point + * @param {Number} [options.x2=0] x-coordinate of end point + * @param {Number} [options.y2=0] y-coordinate of end point + * @param {Number} [options.r1=0] Radius of start point (only for radial gradients) + * @param {Number} [options.r2=0] Radius of end point (only for radial gradients) + * @param {Object} [options.colorStops] Color stops object eg. {0: 'ff0000', 1: '000000'} + * @return {fabric.Object} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/58y8b/|jsFiddle demo} + * @example Set linear gradient + * object.setGradient('fill', { + * type: 'linear', + * x1: -object.width / 2, + * y1: 0, + * x2: object.width / 2, + * y2: 0, + * colorStops: { + * 0: 'red', + * 0.5: '#005555', + * 1: 'rgba(0,0,255,0.5)' + * } + * }); + * canvas.renderAll(); + * @example Set radial gradient + * object.setGradient('fill', { + * type: 'radial', + * x1: 0, + * y1: 0, + * x2: 0, + * y2: 0, + * r1: object.width / 2, + * r2: 10, + * colorStops: { + * 0: 'red', + * 0.5: '#005555', + * 1: 'rgba(0,0,255,0.5)' + * } + * }); + * canvas.renderAll(); + */ + setGradient: function(property, options) { + options || (options = { }); + + var gradient = { colorStops: [] }; + + gradient.type = options.type || (options.r1 || options.r2 ? 'radial' : 'linear'); + gradient.coords = { + x1: options.x1, + y1: options.y1, + x2: options.x2, + y2: options.y2 + }; + + if (options.r1 || options.r2) { + gradient.coords.r1 = options.r1; + gradient.coords.r2 = options.r2; + } + + for (var position in options.colorStops) { + var color = new fabric.Color(options.colorStops[position]); + gradient.colorStops.push({ + offset: position, + color: color.toRgb(), + opacity: color.getAlpha() + }); + } + + return this.set(property, fabric.Gradient.forObject(this, gradient)); + }, + + /** + * Sets pattern fill of an object + * @param {Object} options Options object + * @param {(String|HTMLImageElement)} options.source Pattern source + * @param {String} [options.repeat=repeat] Repeat property of a pattern (one of repeat, repeat-x, repeat-y or no-repeat) + * @param {Number} [options.offsetX=0] Pattern horizontal offset from object's left/top corner + * @param {Number} [options.offsetY=0] Pattern vertical offset from object's left/top corner + * @return {fabric.Object} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/QT3pa/|jsFiddle demo} + * @example Set pattern + * fabric.util.loadImage('http://fabricjs.com/assets/escheresque_ste.png', function(img) { + * object.setPatternFill({ + * source: img, + * repeat: 'repeat' + * }); + * canvas.renderAll(); + * }); + */ + setPatternFill: function(options) { + return this.set('fill', new fabric.Pattern(options)); + }, + + /** + * Sets {@link fabric.Object#shadow|shadow} of an object + * @param {Object|String} [options] Options object or string (e.g. "2px 2px 10px rgba(0,0,0,0.2)") + * @param {String} [options.color=rgb(0,0,0)] Shadow color + * @param {Number} [options.blur=0] Shadow blur + * @param {Number} [options.offsetX=0] Shadow horizontal offset + * @param {Number} [options.offsetY=0] Shadow vertical offset + * @return {fabric.Object} thisArg + * @chainable + * @see {@link http://jsfiddle.net/fabricjs/7gvJG/|jsFiddle demo} + * @example Set shadow with string notation + * object.setShadow('2px 2px 10px rgba(0,0,0,0.2)'); + * canvas.renderAll(); + * @example Set shadow with object notation + * object.setShadow({ + * color: 'red', + * blur: 10, + * offsetX: 20, + * offsetY: 20 + * }); + * canvas.renderAll(); + */ + setShadow: function(options) { + return this.set('shadow', options ? new fabric.Shadow(options) : null); + }, + + /** + * Sets "color" of an instance (alias of `set('fill', …)`) + * @param {String} color Color value + * @return {fabric.Object} thisArg + * @chainable + */ + setColor: function(color) { + this.set('fill', color); + return this; + }, + + /** + * Sets "angle" of an instance + * @param {Number} angle Angle value (in degrees) + * @return {fabric.Object} thisArg + * @chainable + */ + setAngle: function(angle) { + var shouldCenterOrigin = (this.originX !== 'center' || this.originY !== 'center') && this.centeredRotation; + + if (shouldCenterOrigin) { + this._setOriginToCenter(); + } + + this.set('angle', angle); + + if (shouldCenterOrigin) { + this._resetOrigin(); + } + + return this; + }, + + /** + * Centers object horizontally on canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + centerH: function () { + this.canvas.centerObjectH(this); + return this; + }, + + /** + * Centers object vertically on canvas to which it was added last. + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + centerV: function () { + this.canvas.centerObjectV(this); + return this; + }, + + /** + * Centers object vertically and horizontally on canvas to which is was added last + * You might need to call `setCoords` on an object after centering, to update controls area. + * @return {fabric.Object} thisArg + * @chainable + */ + center: function () { + this.canvas.centerObject(this); + return this; + }, + + /** + * Removes object from canvas to which it was added last + * @return {fabric.Object} thisArg + * @chainable + */ + remove: function() { + this.canvas.remove(this); + return this; + }, + + /** + * Returns coordinates of a pointer relative to an object + * @param {Event} e Event to operate upon + * @param {Object} [pointer] Pointer to operate upon (instead of event) + * @return {Object} Coordinates of a pointer (x, y) + */ + getLocalPointer: function(e, pointer) { + pointer = pointer || this.canvas.getPointer(e); + var objectLeftTop = this.translateToOriginPoint(this.getCenterPoint(), 'left', 'top'); + return { + x: pointer.x - objectLeftTop.x, + y: pointer.y - objectLeftTop.y + }; + }, + + /** + * Sets canvas globalCompositeOperation for specific object + * custom composition operation for the particular object can be specifed using globalCompositeOperation property + * @param {CanvasRenderingContext2D} ctx Rendering canvas context + */ + _setupCompositeOperation: function (ctx) { + if (this.globalCompositeOperation) { + this._prevGlobalCompositeOperation = ctx.globalCompositeOperation; + ctx.globalCompositeOperation = this.globalCompositeOperation; + } + }, + + /** + * Restores previously saved canvas globalCompositeOperation after obeject rendering + * @param {CanvasRenderingContext2D} ctx Rendering canvas context + */ + _restoreCompositeOperation: function (ctx) { + if (this.globalCompositeOperation && this._prevGlobalCompositeOperation) { + ctx.globalCompositeOperation = this._prevGlobalCompositeOperation; + } + } + }); + + fabric.util.createAccessors(fabric.Object); + + /** + * Alias for {@link fabric.Object.prototype.setAngle} + * @alias rotate -> setAngle + * @memberof fabric.Object + */ + fabric.Object.prototype.rotate = fabric.Object.prototype.setAngle; + + extend(fabric.Object.prototype, fabric.Observable); + + /** + * Defines the number of fraction digits to use when serializing object values. + * You can use it to increase/decrease precision of such values like left, top, scaleX, scaleY, etc. + * @static + * @memberof fabric.Object + * @constant + * @type Number + */ + fabric.Object.NUM_FRACTION_DIGITS = 2; + + /** + * Unique id used internally when creating SVG elements + * @static + * @memberof fabric.Object + * @type Number + */ + fabric.Object.__uid = 0; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function() { + + var degreesToRadians = fabric.util.degreesToRadians; + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Translates the coordinates from origin to center coordinates (based on the object's dimensions) + * @param {fabric.Point} point The point which corresponds to the originX and originY params + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + translateToCenterPoint: function(point, originX, originY) { + var cx = point.x, + cy = point.y, + strokeWidth = this.stroke ? this.strokeWidth : 0; + + if (originX === 'left') { + cx = point.x + (this.getWidth() + strokeWidth * this.scaleX) / 2; + } + else if (originX === 'right') { + cx = point.x - (this.getWidth() + strokeWidth * this.scaleX) / 2; + } + + if (originY === 'top') { + cy = point.y + (this.getHeight() + strokeWidth * this.scaleY) / 2; + } + else if (originY === 'bottom') { + cy = point.y - (this.getHeight() + strokeWidth * this.scaleY) / 2; + } + + // Apply the reverse rotation to the point (it's already scaled properly) + return fabric.util.rotatePoint(new fabric.Point(cx, cy), point, degreesToRadians(this.angle)); + }, + + /** + * Translates the coordinates from center to origin coordinates (based on the object's dimensions) + * @param {fabric.Point} center The point which corresponds to center of the object + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + translateToOriginPoint: function(center, originX, originY) { + var x = center.x, + y = center.y, + strokeWidth = this.stroke ? this.strokeWidth : 0; + + // Get the point coordinates + if (originX === 'left') { + x = center.x - (this.getWidth() + strokeWidth * this.scaleX) / 2; + } + else if (originX === 'right') { + x = center.x + (this.getWidth() + strokeWidth * this.scaleX) / 2; + } + if (originY === 'top') { + y = center.y - (this.getHeight() + strokeWidth * this.scaleY) / 2; + } + else if (originY === 'bottom') { + y = center.y + (this.getHeight() + strokeWidth * this.scaleY) / 2; + } + + // Apply the rotation to the point (it's already scaled properly) + return fabric.util.rotatePoint(new fabric.Point(x, y), center, degreesToRadians(this.angle)); + }, + + /** + * Returns the real center coordinates of the object + * @return {fabric.Point} + */ + getCenterPoint: function() { + var leftTop = new fabric.Point(this.left, this.top); + return this.translateToCenterPoint(leftTop, this.originX, this.originY); + }, + + /** + * Returns the coordinates of the object based on center coordinates + * @param {fabric.Point} point The point which corresponds to the originX and originY params + * @return {fabric.Point} + */ + // getOriginPoint: function(center) { + // return this.translateToOriginPoint(center, this.originX, this.originY); + // }, + + /** + * Returns the coordinates of the object as if it has a different origin + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + getPointByOrigin: function(originX, originY) { + var center = this.getCenterPoint(); + return this.translateToOriginPoint(center, originX, originY); + }, + + /** + * Returns the point in local coordinates + * @param {fabric.Point} point The point relative to the global coordinate system + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {fabric.Point} + */ + toLocalPoint: function(point, originX, originY) { + var center = this.getCenterPoint(), + strokeWidth = this.stroke ? this.strokeWidth : 0, + x, y; + + if (originX && originY) { + if (originX === 'left') { + x = center.x - (this.getWidth() + strokeWidth * this.scaleX) / 2; + } + else if (originX === 'right') { + x = center.x + (this.getWidth() + strokeWidth * this.scaleX) / 2; + } + else { + x = center.x; + } + + if (originY === 'top') { + y = center.y - (this.getHeight() + strokeWidth * this.scaleY) / 2; + } + else if (originY === 'bottom') { + y = center.y + (this.getHeight() + strokeWidth * this.scaleY) / 2; + } + else { + y = center.y; + } + } + else { + x = this.left; + y = this.top; + } + + return fabric.util.rotatePoint(new fabric.Point(point.x, point.y), center, -degreesToRadians(this.angle)) + .subtractEquals(new fabric.Point(x, y)); + }, + + /** + * Returns the point in global coordinates + * @param {fabric.Point} The point relative to the local coordinate system + * @return {fabric.Point} + */ + // toGlobalPoint: function(point) { + // return fabric.util.rotatePoint(point, this.getCenterPoint(), degreesToRadians(this.angle)).addEquals(new fabric.Point(this.left, this.top)); + // }, + + /** + * Sets the position of the object taking into consideration the object's origin + * @param {fabric.Point} pos The new position of the object + * @param {String} originX Horizontal origin: 'left', 'center' or 'right' + * @param {String} originY Vertical origin: 'top', 'center' or 'bottom' + * @return {void} + */ + setPositionByOrigin: function(pos, originX, originY) { + var center = this.translateToCenterPoint(pos, originX, originY), + position = this.translateToOriginPoint(center, this.originX, this.originY); + + this.set('left', position.x); + this.set('top', position.y); + }, + + /** + * @param {String} to One of 'left', 'center', 'right' + */ + adjustPosition: function(to) { + var angle = degreesToRadians(this.angle), + hypotHalf = this.getWidth() / 2, + xHalf = Math.cos(angle) * hypotHalf, + yHalf = Math.sin(angle) * hypotHalf, + hypotFull = this.getWidth(), + xFull = Math.cos(angle) * hypotFull, + yFull = Math.sin(angle) * hypotFull; + + if (this.originX === 'center' && to === 'left' || + this.originX === 'right' && to === 'center') { + // move half left + this.left -= xHalf; + this.top -= yHalf; + } + else if (this.originX === 'left' && to === 'center' || + this.originX === 'center' && to === 'right') { + // move half right + this.left += xHalf; + this.top += yHalf; + } + else if (this.originX === 'left' && to === 'right') { + // move full right + this.left += xFull; + this.top += yFull; + } + else if (this.originX === 'right' && to === 'left') { + // move full left + this.left -= xFull; + this.top -= yFull; + } + + this.setCoords(); + this.originX = to; + }, + + /** + * Sets the origin/position of the object to it's center point + * @private + * @return {void} + */ + _setOriginToCenter: function() { + this._originalOriginX = this.originX; + this._originalOriginY = this.originY; + + var center = this.getCenterPoint(); + + this.originX = 'center'; + this.originY = 'center'; + + this.left = center.x; + this.top = center.y; + }, + + /** + * Resets the origin/position of the object to it's original origin + * @private + * @return {void} + */ + _resetOrigin: function() { + var originPoint = this.translateToOriginPoint( + this.getCenterPoint(), + this._originalOriginX, + this._originalOriginY); + + this.originX = this._originalOriginX; + this.originY = this._originalOriginY; + + this.left = originPoint.x; + this.top = originPoint.y; + + this._originalOriginX = null; + this._originalOriginY = null; + }, + + /** + * @private + */ + _getLeftTopCoords: function() { + return this.translateToOriginPoint(this.getCenterPoint(), 'left', 'center'); + } + }); + +})(); + + +(function() { + + var degreesToRadians = fabric.util.degreesToRadians; + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Object containing coordinates of object's controls + * @type Object + * @default + */ + oCoords: null, + + /** + * Checks if object intersects with an area formed by 2 points + * @param {Object} pointTL top-left point of area + * @param {Object} pointBR bottom-right point of area + * @return {Boolean} true if object intersects with an area formed by 2 points + */ + intersectsWithRect: function(pointTL, pointBR) { + var oCoords = this.oCoords, + tl = new fabric.Point(oCoords.tl.x, oCoords.tl.y), + tr = new fabric.Point(oCoords.tr.x, oCoords.tr.y), + bl = new fabric.Point(oCoords.bl.x, oCoords.bl.y), + br = new fabric.Point(oCoords.br.x, oCoords.br.y), + intersection = fabric.Intersection.intersectPolygonRectangle( + [tl, tr, br, bl], + pointTL, + pointBR + ); + return intersection.status === 'Intersection'; + }, + + /** + * Checks if object intersects with another object + * @param {Object} other Object to test + * @return {Boolean} true if object intersects with another object + */ + intersectsWithObject: function(other) { + // extracts coords + function getCoords(oCoords) { + return { + tl: new fabric.Point(oCoords.tl.x, oCoords.tl.y), + tr: new fabric.Point(oCoords.tr.x, oCoords.tr.y), + bl: new fabric.Point(oCoords.bl.x, oCoords.bl.y), + br: new fabric.Point(oCoords.br.x, oCoords.br.y) + }; + } + var thisCoords = getCoords(this.oCoords), + otherCoords = getCoords(other.oCoords), + intersection = fabric.Intersection.intersectPolygonPolygon( + [thisCoords.tl, thisCoords.tr, thisCoords.br, thisCoords.bl], + [otherCoords.tl, otherCoords.tr, otherCoords.br, otherCoords.bl] + ); + + return intersection.status === 'Intersection'; + }, + + /** + * Checks if object is fully contained within area of another object + * @param {Object} other Object to test + * @return {Boolean} true if object is fully contained within area of another object + */ + isContainedWithinObject: function(other) { + var boundingRect = other.getBoundingRect(), + point1 = new fabric.Point(boundingRect.left, boundingRect.top), + point2 = new fabric.Point(boundingRect.left + boundingRect.width, boundingRect.top + boundingRect.height); + + return this.isContainedWithinRect(point1, point2); + }, + + /** + * Checks if object is fully contained within area formed by 2 points + * @param {Object} pointTL top-left point of area + * @param {Object} pointBR bottom-right point of area + * @return {Boolean} true if object is fully contained within area formed by 2 points + */ + isContainedWithinRect: function(pointTL, pointBR) { + var boundingRect = this.getBoundingRect(); + + return ( + boundingRect.left >= pointTL.x && + boundingRect.left + boundingRect.width <= pointBR.x && + boundingRect.top >= pointTL.y && + boundingRect.top + boundingRect.height <= pointBR.y + ); + }, + + /** + * Checks if point is inside the object + * @param {fabric.Point} point Point to check against + * @return {Boolean} true if point is inside the object + */ + containsPoint: function(point) { + var lines = this._getImageLines(this.oCoords), + xPoints = this._findCrossPoints(point, lines); + + // if xPoints is odd then point is inside the object + return (xPoints !== 0 && xPoints % 2 === 1); + }, + + /** + * Method that returns an object with the object edges in it, given the coordinates of the corners + * @private + * @param {Object} oCoords Coordinates of the object corners + */ + _getImageLines: function(oCoords) { + return { + topline: { + o: oCoords.tl, + d: oCoords.tr + }, + rightline: { + o: oCoords.tr, + d: oCoords.br + }, + bottomline: { + o: oCoords.br, + d: oCoords.bl + }, + leftline: { + o: oCoords.bl, + d: oCoords.tl + } + }; + }, + + /** + * Helper method to determine how many cross points are between the 4 object edges + * and the horizontal line determined by a point on canvas + * @private + * @param {fabric.Point} point Point to check + * @param {Object} oCoords Coordinates of the object being evaluated + */ + _findCrossPoints: function(point, oCoords) { + var b1, b2, a1, a2, xi, yi, + xcount = 0, + iLine; + + for (var lineKey in oCoords) { + iLine = oCoords[lineKey]; + // optimisation 1: line below point. no cross + if ((iLine.o.y < point.y) && (iLine.d.y < point.y)) { + continue; + } + // optimisation 2: line above point. no cross + if ((iLine.o.y >= point.y) && (iLine.d.y >= point.y)) { + continue; + } + // optimisation 3: vertical line case + if ((iLine.o.x === iLine.d.x) && (iLine.o.x >= point.x)) { + xi = iLine.o.x; + yi = point.y; + } + // calculate the intersection point + else { + b1 = 0; + b2 = (iLine.d.y - iLine.o.y) / (iLine.d.x - iLine.o.x); + a1 = point.y - b1 * point.x; + a2 = iLine.o.y - b2 * iLine.o.x; + + xi = - (a1 - a2) / (b1 - b2); + yi = a1 + b1 * xi; + } + // dont count xi < point.x cases + if (xi >= point.x) { + xcount += 1; + } + // optimisation 4: specific for square images + if (xcount === 2) { + break; + } + } + return xcount; + }, + + /** + * Returns width of an object's bounding rectangle + * @deprecated since 1.0.4 + * @return {Number} width value + */ + getBoundingRectWidth: function() { + return this.getBoundingRect().width; + }, + + /** + * Returns height of an object's bounding rectangle + * @deprecated since 1.0.4 + * @return {Number} height value + */ + getBoundingRectHeight: function() { + return this.getBoundingRect().height; + }, + + /** + * Returns coordinates of object's bounding rectangle (left, top, width, height) + * @return {Object} Object with left, top, width, height properties + */ + getBoundingRect: function() { + this.oCoords || this.setCoords(); + + var xCoords = [this.oCoords.tl.x, this.oCoords.tr.x, this.oCoords.br.x, this.oCoords.bl.x], + minX = fabric.util.array.min(xCoords), + maxX = fabric.util.array.max(xCoords), + width = Math.abs(minX - maxX), + + yCoords = [this.oCoords.tl.y, this.oCoords.tr.y, this.oCoords.br.y, this.oCoords.bl.y], + minY = fabric.util.array.min(yCoords), + maxY = fabric.util.array.max(yCoords), + height = Math.abs(minY - maxY); + + return { + left: minX, + top: minY, + width: width, + height: height + }; + }, + + /** + * Returns width of an object + * @return {Number} width value + */ + getWidth: function() { + return this.width * this.scaleX; + }, + + /** + * Returns height of an object + * @return {Number} height value + */ + getHeight: function() { + return this.height * this.scaleY; + }, + + /** + * Makes sure the scale is valid and modifies it if necessary + * @private + * @param {Number} value + * @return {Number} + */ + _constrainScale: function(value) { + if (Math.abs(value) < this.minScaleLimit) { + if (value < 0) { + return -this.minScaleLimit; + } + else { + return this.minScaleLimit; + } + } + return value; + }, + + /** + * Scales an object (equally by x and y) + * @param {Number} value Scale factor + * @return {fabric.Object} thisArg + * @chainable + */ + scale: function(value) { + value = this._constrainScale(value); + + if (value < 0) { + this.flipX = !this.flipX; + this.flipY = !this.flipY; + value *= -1; + } + + this.scaleX = value; + this.scaleY = value; + this.setCoords(); + return this; + }, + + /** + * Scales an object to a given width, with respect to bounding box (scaling by x/y equally) + * @param {Number} value New width value + * @return {fabric.Object} thisArg + * @chainable + */ + scaleToWidth: function(value) { + // adjust to bounding rect factor so that rotated shapes would fit as well + var boundingRectFactor = this.getBoundingRectWidth() / this.getWidth(); + return this.scale(value / this.width / boundingRectFactor); + }, + + /** + * Scales an object to a given height, with respect to bounding box (scaling by x/y equally) + * @param {Number} value New height value + * @return {fabric.Object} thisArg + * @chainable + */ + scaleToHeight: function(value) { + // adjust to bounding rect factor so that rotated shapes would fit as well + var boundingRectFactor = this.getBoundingRectHeight() / this.getHeight(); + return this.scale(value / this.height / boundingRectFactor); + }, + + /** + * Sets corner position coordinates based on current angle, width and height + * See https://github.com/kangax/fabric.js/wiki/When-to-call-setCoords + * @return {fabric.Object} thisArg + * @chainable + */ + setCoords: function() { + var theta = degreesToRadians(this.angle), + vpt = this.getViewportTransform(), + f = function (p) { + return fabric.util.transformPoint(p, vpt); + }, + p = this._calculateCurrentDimensions(false), + currentWidth = p.x, currentHeight = p.y; + + // If width is negative, make postive. Fixes path selection issue + if (currentWidth < 0) { + currentWidth = Math.abs(currentWidth); + } + + var _hypotenuse = Math.sqrt( + Math.pow(currentWidth / 2, 2) + + Math.pow(currentHeight / 2, 2)), + + _angle = Math.atan( + isFinite(currentHeight / currentWidth) + ? currentHeight / currentWidth + : 0), + + // offset added for rotate and scale actions + offsetX = Math.cos(_angle + theta) * _hypotenuse, + offsetY = Math.sin(_angle + theta) * _hypotenuse, + sinTh = Math.sin(theta), + cosTh = Math.cos(theta), + coords = this.getCenterPoint(), + wh = new fabric.Point(currentWidth, currentHeight), + _tl = new fabric.Point(coords.x - offsetX, coords.y - offsetY), + _tr = new fabric.Point(_tl.x + (wh.x * cosTh), _tl.y + (wh.x * sinTh)), + bl = f(new fabric.Point(_tl.x - (wh.y * sinTh), _tl.y + (wh.y * cosTh))), + br = f(new fabric.Point(_tr.x - (wh.y * sinTh), _tr.y + (wh.y * cosTh))), + tl = f(_tl), + tr = f(_tr), + ml = new fabric.Point((tl.x + bl.x)/2, (tl.y + bl.y)/2), + mt = new fabric.Point((tr.x + tl.x)/2, (tr.y + tl.y)/2), + mr = new fabric.Point((br.x + tr.x)/2, (br.y + tr.y)/2), + mb = new fabric.Point((br.x + bl.x)/2, (br.y + bl.y)/2), + mtr = new fabric.Point(mt.x + sinTh * this.rotatingPointOffset, mt.y - cosTh * this.rotatingPointOffset); + // debugging + + /* setTimeout(function() { + canvas.contextTop.fillStyle = 'green'; + canvas.contextTop.fillRect(mb.x, mb.y, 3, 3); + canvas.contextTop.fillRect(bl.x, bl.y, 3, 3); + canvas.contextTop.fillRect(br.x, br.y, 3, 3); + canvas.contextTop.fillRect(tl.x, tl.y, 3, 3); + canvas.contextTop.fillRect(tr.x, tr.y, 3, 3); + canvas.contextTop.fillRect(ml.x, ml.y, 3, 3); + canvas.contextTop.fillRect(mr.x, mr.y, 3, 3); + canvas.contextTop.fillRect(mt.x, mt.y, 3, 3); + canvas.contextTop.fillRect(mtr.x, mtr.y, 3, 3); + }, 50); */ + + this.oCoords = { + // corners + tl: tl, tr: tr, br: br, bl: bl, + // middle + ml: ml, mt: mt, mr: mr, mb: mb, + // rotating point + mtr: mtr + }; + + // set coordinates of the draggable boxes in the corners used to scale/rotate the image + this._setCornerCoords && this._setCornerCoords(); + + return this; + } + }); +})(); + + +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Moves an object to the bottom of the stack of drawn objects + * @return {fabric.Object} thisArg + * @chainable + */ + sendToBack: function() { + if (this.group) { + fabric.StaticCanvas.prototype.sendToBack.call(this.group, this); + } + else { + this.canvas.sendToBack(this); + } + return this; + }, + + /** + * Moves an object to the top of the stack of drawn objects + * @return {fabric.Object} thisArg + * @chainable + */ + bringToFront: function() { + if (this.group) { + fabric.StaticCanvas.prototype.bringToFront.call(this.group, this); + } + else { + this.canvas.bringToFront(this); + } + return this; + }, + + /** + * Moves an object down in stack of drawn objects + * @param {Boolean} [intersecting] If `true`, send object behind next lower intersecting object + * @return {fabric.Object} thisArg + * @chainable + */ + sendBackwards: function(intersecting) { + if (this.group) { + fabric.StaticCanvas.prototype.sendBackwards.call(this.group, this, intersecting); + } + else { + this.canvas.sendBackwards(this, intersecting); + } + return this; + }, + + /** + * Moves an object up in stack of drawn objects + * @param {Boolean} [intersecting] If `true`, send object in front of next upper intersecting object + * @return {fabric.Object} thisArg + * @chainable + */ + bringForward: function(intersecting) { + if (this.group) { + fabric.StaticCanvas.prototype.bringForward.call(this.group, this, intersecting); + } + else { + this.canvas.bringForward(this, intersecting); + } + return this; + }, + + /** + * Moves an object to specified level in stack of drawn objects + * @param {Number} index New position of object + * @return {fabric.Object} thisArg + * @chainable + */ + moveTo: function(index) { + if (this.group) { + fabric.StaticCanvas.prototype.moveTo.call(this.group, this, index); + } + else { + this.canvas.moveTo(this, index); + } + return this; + } +}); + + +/* _TO_SVG_START_ */ +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Returns styles-string for svg-export + * @return {String} + */ + getSvgStyles: function() { + + var fill = this.fill + ? (this.fill.toLive ? 'url(#SVGID_' + this.fill.id + ')' : this.fill) + : 'none', + fillRule = this.fillRule, + stroke = this.stroke + ? (this.stroke.toLive ? 'url(#SVGID_' + this.stroke.id + ')' : this.stroke) + : 'none', + + strokeWidth = this.strokeWidth ? this.strokeWidth : '0', + strokeDashArray = this.strokeDashArray ? this.strokeDashArray.join(' ') : '', + strokeLineCap = this.strokeLineCap ? this.strokeLineCap : 'butt', + strokeLineJoin = this.strokeLineJoin ? this.strokeLineJoin : 'miter', + strokeMiterLimit = this.strokeMiterLimit ? this.strokeMiterLimit : '4', + opacity = typeof this.opacity !== 'undefined' ? this.opacity : '1', + + visibility = this.visible ? '' : ' visibility: hidden;', + filter = this.shadow ? 'filter: url(#SVGID_' + this.shadow.id + ');' : ''; + + return [ + 'stroke: ', stroke, '; ', + 'stroke-width: ', strokeWidth, '; ', + 'stroke-dasharray: ', strokeDashArray, '; ', + 'stroke-linecap: ', strokeLineCap, '; ', + 'stroke-linejoin: ', strokeLineJoin, '; ', + 'stroke-miterlimit: ', strokeMiterLimit, '; ', + 'fill: ', fill, '; ', + 'fill-rule: ', fillRule, '; ', + 'opacity: ', opacity, ';', + filter, + visibility + ].join(''); + }, + + /** + * Returns transform-string for svg-export + * @return {String} + */ + getSvgTransform: function() { + if (this.group && this.group.type === 'path-group') { + return ''; + } + var toFixed = fabric.util.toFixed, + angle = this.getAngle(), + vpt = !this.canvas || this.canvas.svgViewportTransformation ? this.getViewportTransform() : [1, 0, 0, 1, 0, 0], + center = fabric.util.transformPoint(this.getCenterPoint(), vpt), + + NUM_FRACTION_DIGITS = fabric.Object.NUM_FRACTION_DIGITS, + + translatePart = this.type === 'path-group' ? '' : 'translate(' + + toFixed(center.x, NUM_FRACTION_DIGITS) + + ' ' + + toFixed(center.y, NUM_FRACTION_DIGITS) + + ')', + + anglePart = angle !== 0 + ? (' rotate(' + toFixed(angle, NUM_FRACTION_DIGITS) + ')') + : '', + + scalePart = (this.scaleX === 1 && this.scaleY === 1 && vpt[0] === 1 && vpt[3] === 1) + ? '' : + (' scale(' + + toFixed(this.scaleX * vpt[0], NUM_FRACTION_DIGITS) + + ' ' + + toFixed(this.scaleY * vpt[3], NUM_FRACTION_DIGITS) + + ')'), + + addTranslateX = this.type === 'path-group' ? this.width * vpt[0] : 0, + + flipXPart = this.flipX ? ' matrix(-1 0 0 1 ' + addTranslateX + ' 0) ' : '', + + addTranslateY = this.type === 'path-group' ? this.height * vpt[3] : 0, + + flipYPart = this.flipY ? ' matrix(1 0 0 -1 0 ' + addTranslateY + ')' : ''; + + return [ + translatePart, anglePart, scalePart, flipXPart, flipYPart + ].join(''); + }, + + /** + * Returns transform-string for svg-export from the transform matrix of single elements + * @return {String} + */ + getSvgTransformMatrix: function() { + return this.transformMatrix ? ' matrix(' + this.transformMatrix.join(' ') + ') ' : ''; + }, + + /** + * @private + */ + _createBaseSVGMarkup: function() { + var markup = [ ]; + + if (this.fill && this.fill.toLive) { + markup.push(this.fill.toSVG(this, false)); + } + if (this.stroke && this.stroke.toLive) { + markup.push(this.stroke.toSVG(this, false)); + } + if (this.shadow) { + markup.push(this.shadow.toSVG(this)); + } + return markup; + } +}); +/* _TO_SVG_END_ */ + + +/* + Depends on `stateProperties` +*/ +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * Returns true if object state (one of its state properties) was changed + * @return {Boolean} true if instance' state has changed since `{@link fabric.Object#saveState}` was called + */ + hasStateChanged: function() { + return this.stateProperties.some(function(prop) { + return this.get(prop) !== this.originalState[prop]; + }, this); + }, + + /** + * Saves state of an object + * @param {Object} [options] Object with additional `stateProperties` array to include when saving state + * @return {fabric.Object} thisArg + */ + saveState: function(options) { + this.stateProperties.forEach(function(prop) { + this.originalState[prop] = this.get(prop); + }, this); + + if (options && options.stateProperties) { + options.stateProperties.forEach(function(prop) { + this.originalState[prop] = this.get(prop); + }, this); + } + + return this; + }, + + /** + * Setups state of an object + * @return {fabric.Object} thisArg + */ + setupState: function() { + this.originalState = { }; + this.saveState(); + + return this; + } +}); + + +(function() { + + var degreesToRadians = fabric.util.degreesToRadians, + //jscs:disable requireCamelCaseOrUpperCaseIdentifiers + isVML = function() { return typeof G_vmlCanvasManager !== 'undefined'; }; + //jscs:enable requireCamelCaseOrUpperCaseIdentifiers + + fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * The object interactivity controls. + * @private + */ + _controlsVisibility: null, + + /** + * Determines which corner has been clicked + * @private + * @param {Object} pointer The pointer indicating the mouse position + * @return {String|Boolean} corner code (tl, tr, bl, br, etc.), or false if nothing is found + */ + _findTargetCorner: function(pointer) { + if (!this.hasControls || !this.active) { + return false; + } + + var ex = pointer.x, + ey = pointer.y, + xPoints, + lines; + + for (var i in this.oCoords) { + + if (!this.isControlVisible(i)) { + continue; + } + + if (i === 'mtr' && !this.hasRotatingPoint) { + continue; + } + + if (this.get('lockUniScaling') && + (i === 'mt' || i === 'mr' || i === 'mb' || i === 'ml')) { + continue; + } + + lines = this._getImageLines(this.oCoords[i].corner); + + // debugging + + // canvas.contextTop.fillRect(lines.bottomline.d.x, lines.bottomline.d.y, 2, 2); + // canvas.contextTop.fillRect(lines.bottomline.o.x, lines.bottomline.o.y, 2, 2); + + // canvas.contextTop.fillRect(lines.leftline.d.x, lines.leftline.d.y, 2, 2); + // canvas.contextTop.fillRect(lines.leftline.o.x, lines.leftline.o.y, 2, 2); + + // canvas.contextTop.fillRect(lines.topline.d.x, lines.topline.d.y, 2, 2); + // canvas.contextTop.fillRect(lines.topline.o.x, lines.topline.o.y, 2, 2); + + // canvas.contextTop.fillRect(lines.rightline.d.x, lines.rightline.d.y, 2, 2); + // canvas.contextTop.fillRect(lines.rightline.o.x, lines.rightline.o.y, 2, 2); + + xPoints = this._findCrossPoints({ x: ex, y: ey }, lines); + if (xPoints !== 0 && xPoints % 2 === 1) { + this.__corner = i; + return i; + } + } + return false; + }, + + /** + * Sets the coordinates of the draggable boxes in the corners of + * the image used to scale/rotate it. + * @private + */ + _setCornerCoords: function() { + var coords = this.oCoords, + newTheta = degreesToRadians(45 - this.angle), + cornerHypotenuse = Math.sqrt(2 * Math.pow(this.cornerSize, 2)) / 2, + cosHalfOffset = cornerHypotenuse * Math.cos(newTheta), + sinHalfOffset = cornerHypotenuse * Math.sin(newTheta), + x, y; + + for (var point in coords) { + x = coords[point].x; + y = coords[point].y; + coords[point].corner = { + tl: { + x: x - sinHalfOffset, + y: y - cosHalfOffset + }, + tr: { + x: x + cosHalfOffset, + y: y - sinHalfOffset + }, + bl: { + x: x - cosHalfOffset, + y: y + sinHalfOffset + }, + br: { + x: x + sinHalfOffset, + y: y + cosHalfOffset + } + }; + } + }, + + _calculateCurrentDimensions: function(shouldTransform) { + var vpt = this.getViewportTransform(), + strokeWidth = this.strokeWidth, + w = this.width, + h = this.height, + capped = this.strokeLineCap === 'round' || this.strokeLineCap === 'square', + vLine = this.type === 'line' && this.width === 0, + hLine = this.type === 'line' && this.height === 0, + sLine = vLine || hLine, + strokeW = (capped && hLine) || !sLine, + strokeH = (capped && vLine) || !sLine; + + if (vLine) { + w = strokeWidth; + } + else if (hLine) { + h = strokeWidth; + } + if (strokeW) { + w += (w < 0 ? -strokeWidth : strokeWidth); + } + if (strokeH) { + h += (h < 0 ? -strokeWidth : strokeWidth); + } + + w = w * this.scaleX + 2 * this.padding; + h = h * this.scaleY + 2 * this.padding; + + if (shouldTransform) { + return fabric.util.transformPoint(new fabric.Point(w, h), vpt, true); + } + return { x: w, y: h }; + }, + + /** + * Draws borders of an object's bounding box. + * Requires public properties: width, height + * Requires public options: padding, borderColor + * @param {CanvasRenderingContext2D} ctx Context to draw on + * @return {fabric.Object} thisArg + * @chainable + */ + drawBorders: function(ctx) { + if (!this.hasBorders) { + return this; + } + + ctx.save(); + + ctx.globalAlpha = this.isMoving ? this.borderOpacityWhenMoving : 1; + ctx.strokeStyle = this.borderColor; + ctx.lineWidth = 1 / this.borderScaleFactor; + + var wh = this._calculateCurrentDimensions(true), + width = wh.x, + height = wh.y; + if (this.group) { + width = width * this.group.scaleX; + height = height * this.group.scaleY; + } + + ctx.strokeRect( + ~~(-(width / 2)) - 0.5, // offset needed to make lines look sharper + ~~(-(height / 2)) - 0.5, + ~~(width) + 1, // double offset needed to make lines look sharper + ~~(height) + 1 + ); + + if (this.hasRotatingPoint && this.isControlVisible('mtr') && !this.get('lockRotation') && this.hasControls) { + + var rotateHeight = -height / 2; + + ctx.beginPath(); + ctx.moveTo(0, rotateHeight); + ctx.lineTo(0, rotateHeight - this.rotatingPointOffset); + ctx.closePath(); + ctx.stroke(); + } + + ctx.restore(); + return this; + }, + + /** + * Draws corners of an object's bounding box. + * Requires public properties: width, height + * Requires public options: cornerSize, padding + * @param {CanvasRenderingContext2D} ctx Context to draw on + * @return {fabric.Object} thisArg + * @chainable + */ + drawControls: function(ctx) { + if (!this.hasControls) { + return this; + } + + var wh = this._calculateCurrentDimensions(true), + width = wh.x, + height = wh.y, + left = -(width / 2), + top = -(height / 2), + scaleOffset = this.cornerSize / 2, + methodName = this.transparentCorners ? 'strokeRect' : 'fillRect'; + + ctx.save(); + + ctx.lineWidth = 1; + + ctx.globalAlpha = this.isMoving ? this.borderOpacityWhenMoving : 1; + ctx.strokeStyle = ctx.fillStyle = this.cornerColor; + + // top-left + this._drawControl('tl', ctx, methodName, + left - scaleOffset, + top - scaleOffset); + + // top-right + this._drawControl('tr', ctx, methodName, + left + width - scaleOffset, + top - scaleOffset); + + // bottom-left + this._drawControl('bl', ctx, methodName, + left - scaleOffset, + top + height - scaleOffset); + + // bottom-right + this._drawControl('br', ctx, methodName, + left + width - scaleOffset, + top + height - scaleOffset); + + if (!this.get('lockUniScaling')) { + + // middle-top + this._drawControl('mt', ctx, methodName, + left + width/2 - scaleOffset, + top - scaleOffset); + + // middle-bottom + this._drawControl('mb', ctx, methodName, + left + width/2 - scaleOffset, + top + height - scaleOffset); + + // middle-right + this._drawControl('mr', ctx, methodName, + left + width - scaleOffset, + top + height/2 - scaleOffset); + + // middle-left + this._drawControl('ml', ctx, methodName, + left - scaleOffset, + top + height/2 - scaleOffset); + } + + // middle-top-rotate + if (this.hasRotatingPoint) { + this._drawControl('mtr', ctx, methodName, + left + width/2 - scaleOffset, + top - this.rotatingPointOffset - scaleOffset); + } + + ctx.restore(); + + return this; + }, + + /** + * @private + */ + _drawControl: function(control, ctx, methodName, left, top) { + if (!this.isControlVisible(control)) { + return; + } + var size = this.cornerSize; + isVML() || this.transparentCorners || ctx.clearRect(left, top, size, size); + ctx[methodName](left, top, size, size); + }, + + /** + * Returns true if the specified control is visible, false otherwise. + * @param {String} controlName The name of the control. Possible values are 'tl', 'tr', 'br', 'bl', 'ml', 'mt', 'mr', 'mb', 'mtr'. + * @returns {Boolean} true if the specified control is visible, false otherwise + */ + isControlVisible: function(controlName) { + return this._getControlsVisibility()[controlName]; + }, + + /** + * Sets the visibility of the specified control. + * @param {String} controlName The name of the control. Possible values are 'tl', 'tr', 'br', 'bl', 'ml', 'mt', 'mr', 'mb', 'mtr'. + * @param {Boolean} visible true to set the specified control visible, false otherwise + * @return {fabric.Object} thisArg + * @chainable + */ + setControlVisible: function(controlName, visible) { + this._getControlsVisibility()[controlName] = visible; + return this; + }, + + /** + * Sets the visibility state of object controls. + * @param {Object} [options] Options object + * @param {Boolean} [options.bl] true to enable the bottom-left control, false to disable it + * @param {Boolean} [options.br] true to enable the bottom-right control, false to disable it + * @param {Boolean} [options.mb] true to enable the middle-bottom control, false to disable it + * @param {Boolean} [options.ml] true to enable the middle-left control, false to disable it + * @param {Boolean} [options.mr] true to enable the middle-right control, false to disable it + * @param {Boolean} [options.mt] true to enable the middle-top control, false to disable it + * @param {Boolean} [options.tl] true to enable the top-left control, false to disable it + * @param {Boolean} [options.tr] true to enable the top-right control, false to disable it + * @param {Boolean} [options.mtr] true to enable the middle-top-rotate control, false to disable it + * @return {fabric.Object} thisArg + * @chainable + */ + setControlsVisibility: function(options) { + options || (options = { }); + + for (var p in options) { + this.setControlVisible(p, options[p]); + } + return this; + }, + + /** + * Returns the instance of the control visibility set for this object. + * @private + * @returns {Object} + */ + _getControlsVisibility: function() { + if (!this._controlsVisibility) { + this._controlsVisibility = { + tl: true, + tr: true, + br: true, + bl: true, + ml: true, + mt: true, + mr: true, + mb: true, + mtr: true + }; + } + return this._controlsVisibility; + } + }); +})(); + + +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Animation duration (in ms) for fx* methods + * @type Number + * @default + */ + FX_DURATION: 500, + + /** + * Centers object horizontally with animation. + * @param {fabric.Object} object Object to center + * @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxCenterObjectH: function (object, callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: object.get('left'), + endValue: this.getCenter().left, + duration: this.FX_DURATION, + onChange: function(value) { + object.set('left', value); + _this.renderAll(); + onChange(); + }, + onComplete: function() { + object.setCoords(); + onComplete(); + } + }); + + return this; + }, + + /** + * Centers object vertically with animation. + * @param {fabric.Object} object Object to center + * @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxCenterObjectV: function (object, callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: object.get('top'), + endValue: this.getCenter().top, + duration: this.FX_DURATION, + onChange: function(value) { + object.set('top', value); + _this.renderAll(); + onChange(); + }, + onComplete: function() { + object.setCoords(); + onComplete(); + } + }); + + return this; + }, + + /** + * Same as `fabric.Canvas#remove` but animated + * @param {fabric.Object} object Object to remove + * @param {Object} [callbacks] Callbacks object with optional "onComplete" and/or "onChange" properties + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxRemove: function (object, callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: object.get('opacity'), + endValue: 0, + duration: this.FX_DURATION, + onStart: function() { + object.set('active', false); + }, + onChange: function(value) { + object.set('opacity', value); + _this.renderAll(); + onChange(); + }, + onComplete: function () { + _this.remove(object); + onComplete(); + } + }); + + return this; + } +}); + +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + /** + * Animates object's properties + * @param {String|Object} property Property to animate (if string) or properties to animate (if object) + * @param {Number|Object} value Value to animate property to (if string was given first) or options object + * @return {fabric.Object} thisArg + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2/#animation} + * @chainable + * + * As object — multiple properties + * + * object.animate({ left: ..., top: ... }); + * object.animate({ left: ..., top: ... }, { duration: ... }); + * + * As string — one property + * + * object.animate('left', ...); + * object.animate('left', { duration: ... }); + * + */ + animate: function() { + if (arguments[0] && typeof arguments[0] === 'object') { + var propsToAnimate = [ ], prop, skipCallbacks; + for (prop in arguments[0]) { + propsToAnimate.push(prop); + } + for (var i = 0, len = propsToAnimate.length; i < len; i++) { + prop = propsToAnimate[i]; + skipCallbacks = i !== len - 1; + this._animate(prop, arguments[0][prop], arguments[1], skipCallbacks); + } + } + else { + this._animate.apply(this, arguments); + } + return this; + }, + + /** + * @private + * @param {String} property Property to animate + * @param {String} to Value to animate to + * @param {Object} [options] Options object + * @param {Boolean} [skipCallbacks] When true, callbacks like onchange and oncomplete are not invoked + */ + _animate: function(property, to, options, skipCallbacks) { + var _this = this, propPair; + + to = to.toString(); + + if (!options) { + options = { }; + } + else { + options = fabric.util.object.clone(options); + } + + if (~property.indexOf('.')) { + propPair = property.split('.'); + } + + var currentValue = propPair + ? this.get(propPair[0])[propPair[1]] + : this.get(property); + + if (!('from' in options)) { + options.from = currentValue; + } + + if (~to.indexOf('=')) { + to = currentValue + parseFloat(to.replace('=', '')); + } + else { + to = parseFloat(to); + } + + fabric.util.animate({ + startValue: options.from, + endValue: to, + byValue: options.by, + easing: options.easing, + duration: options.duration, + abort: options.abort && function() { + return options.abort.call(_this); + }, + onChange: function(value) { + if (propPair) { + _this[propPair[0]][propPair[1]] = value; + } + else { + _this.set(property, value); + } + if (skipCallbacks) { + return; + } + options.onChange && options.onChange(); + }, + onComplete: function() { + if (skipCallbacks) { + return; + } + + _this.setCoords(); + options.onComplete && options.onComplete(); + } + }); + } +}); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + coordProps = { x1: 1, x2: 1, y1: 1, y2: 1 }, + supportsLineDash = fabric.StaticCanvas.supports('setLineDash'); + + if (fabric.Line) { + fabric.warn('fabric.Line is already defined'); + return; + } + + /** + * Line class + * @class fabric.Line + * @extends fabric.Object + * @see {@link fabric.Line#initialize} for constructor definition + */ + fabric.Line = fabric.util.createClass(fabric.Object, /** @lends fabric.Line.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'line', + + /** + * x value or first line edge + * @type Number + * @default + */ + x1: 0, + + /** + * y value or first line edge + * @type Number + * @default + */ + y1: 0, + + /** + * x value or second line edge + * @type Number + * @default + */ + x2: 0, + + /** + * y value or second line edge + * @type Number + * @default + */ + y2: 0, + + /** + * Constructor + * @param {Array} [points] Array of points + * @param {Object} [options] Options object + * @return {fabric.Line} thisArg + */ + initialize: function(points, options) { + options = options || { }; + + if (!points) { + points = [0, 0, 0, 0]; + } + + this.callSuper('initialize', options); + + this.set('x1', points[0]); + this.set('y1', points[1]); + this.set('x2', points[2]); + this.set('y2', points[3]); + + this._setWidthHeight(options); + }, + + /** + * @private + * @param {Object} [options] Options + */ + _setWidthHeight: function(options) { + options || (options = { }); + + this.width = Math.abs(this.x2 - this.x1); + this.height = Math.abs(this.y2 - this.y1); + + this.left = 'left' in options + ? options.left + : this._getLeftToOriginX(); + + this.top = 'top' in options + ? options.top + : this._getTopToOriginY(); + }, + + /** + * @private + * @param {String} key + * @param {Any} value + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + if (typeof coordProps[key] !== 'undefined') { + this._setWidthHeight(); + } + return this; + }, + + /** + * @private + * @return {Number} leftToOriginX Distance from left edge of canvas to originX of Line. + */ + _getLeftToOriginX: makeEdgeToOriginGetter( + { // property names + origin: 'originX', + axis1: 'x1', + axis2: 'x2', + dimension: 'width' + }, + { // possible values of origin + nearest: 'left', + center: 'center', + farthest: 'right' + } + ), + + /** + * @private + * @return {Number} topToOriginY Distance from top edge of canvas to originY of Line. + */ + _getTopToOriginY: makeEdgeToOriginGetter( + { // property names + origin: 'originY', + axis1: 'y1', + axis2: 'y2', + dimension: 'height' + }, + { // possible values of origin + nearest: 'top', + center: 'center', + farthest: 'bottom' + } + ), + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx, noTransform) { + ctx.beginPath(); + + if (noTransform) { + // Line coords are distances from left-top of canvas to origin of line. + // To render line in a path-group, we need to translate them to + // distances from center of path-group to center of line. + var cp = this.getCenterPoint(); + ctx.translate( + cp.x - this.strokeWidth / 2, + cp.y - this.strokeWidth / 2 + ); + } + + if (!this.strokeDashArray || this.strokeDashArray && supportsLineDash) { + // move from center (of virtual box) to its left/top corner + // we can't assume x1, y1 is top left and x2, y2 is bottom right + var p = this.calcLinePoints(); + ctx.moveTo(p.x1, p.y1); + ctx.lineTo(p.x2, p.y2); + } + + ctx.lineWidth = this.strokeWidth; + + // TODO: test this + // make sure setting "fill" changes color of a line + // (by copying fillStyle to strokeStyle, since line is stroked, not filled) + var origStrokeStyle = ctx.strokeStyle; + ctx.strokeStyle = this.stroke || ctx.fillStyle; + this.stroke && this._renderStroke(ctx); + ctx.strokeStyle = origStrokeStyle; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var p = this.calcLinePoints(); + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, p.x1, p.y1, p.x2, p.y2, this.strokeDashArray); + ctx.closePath(); + }, + + /** + * Returns object representation of an instance + * @methd toObject + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), this.calcLinePoints()); + }, + + /** + * Recalculates line points given width and height + * @private + */ + calcLinePoints: function() { + var xMult = this.x1 <= this.x2 ? -1 : 1, + yMult = this.y1 <= this.y2 ? -1 : 1, + x1 = (xMult * this.width * 0.5), + y1 = (yMult * this.height * 0.5), + x2 = (xMult * this.width * -0.5), + y2 = (yMult * this.height * -0.5); + + return { + x1: x1, + x2: x2, + y1: y1, + y2: y2 + }; + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), + p = { x1: this.x1, x2: this.x2, y1: this.y1, y2: this.y2 }; + + if (!(this.group && this.group.type === 'path-group')) { + p = this.calcLinePoints(); + } + markup.push( + '\n' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns complexity of an instance + * @return {Number} complexity + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Line.fromElement}) + * @static + * @memberOf fabric.Line + * @see http://www.w3.org/TR/SVG/shapes.html#LineElement + */ + fabric.Line.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x1 y1 x2 y2'.split(' ')); + + /** + * Returns fabric.Line instance from an SVG element + * @static + * @memberOf fabric.Line + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Line} instance of fabric.Line + */ + fabric.Line.fromElement = function(element, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Line.ATTRIBUTE_NAMES), + points = [ + parsedAttributes.x1 || 0, + parsedAttributes.y1 || 0, + parsedAttributes.x2 || 0, + parsedAttributes.y2 || 0 + ]; + return new fabric.Line(points, extend(parsedAttributes, options)); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Line instance from an object representation + * @static + * @memberOf fabric.Line + * @param {Object} object Object to create an instance from + * @return {fabric.Line} instance of fabric.Line + */ + fabric.Line.fromObject = function(object) { + var points = [object.x1, object.y1, object.x2, object.y2]; + return new fabric.Line(points, object); + }; + + /** + * Produces a function that calculates distance from canvas edge to Line origin. + */ + function makeEdgeToOriginGetter(propertyNames, originValues) { + var origin = propertyNames.origin, + axis1 = propertyNames.axis1, + axis2 = propertyNames.axis2, + dimension = propertyNames.dimension, + nearest = originValues.nearest, + center = originValues.center, + farthest = originValues.farthest; + + return function() { + switch (this.get(origin)) { + case nearest: + return Math.min(this.get(axis1), this.get(axis2)); + case center: + return Math.min(this.get(axis1), this.get(axis2)) + (0.5 * this.get(dimension)); + case farthest: + return Math.max(this.get(axis1), this.get(axis2)); + } + }; + + } + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + pi = Math.PI, + extend = fabric.util.object.extend; + + if (fabric.Circle) { + fabric.warn('fabric.Circle is already defined.'); + return; + } + + /** + * Circle class + * @class fabric.Circle + * @extends fabric.Object + * @see {@link fabric.Circle#initialize} for constructor definition + */ + fabric.Circle = fabric.util.createClass(fabric.Object, /** @lends fabric.Circle.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'circle', + + /** + * Radius of this circle + * @type Number + * @default + */ + radius: 0, + + /** + * Start angle of the circle, moving clockwise + * @type Number + * @default 0 + */ + startAngle: 0, + + /** + * End angle of the circle + * @type Number + * @default 2Pi + */ + endAngle: pi * 2, + + /** + * Constructor + * @param {Object} [options] Options object + * @return {fabric.Circle} thisArg + */ + initialize: function(options) { + options = options || { }; + + this.callSuper('initialize', options); + this.set('radius', options.radius || 0); + this.startAngle = options.startAngle || this.startAngle; + this.endAngle = options.endAngle || this.endAngle; + }, + + /** + * @private + * @param {String} key + * @param {Any} value + * @return {fabric.Circle} thisArg + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + + if (key === 'radius') { + this.setRadius(value); + } + + return this; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + radius: this.get('radius'), + startAngle: this.startAngle, + endAngle: this.endAngle + }); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), x = 0, y = 0, + angle = (this.endAngle - this.startAngle) % ( 2 * pi); + + if (angle === 0) { + if (this.group && this.group.type === 'path-group') { + x = this.left + this.radius; + y = this.top + this.radius; + } + markup.push( + '\n' + ); + } + else { + var startX = Math.cos(this.startAngle) * this.radius, + startY = Math.sin(this.startAngle) * this.radius, + endX = Math.cos(this.endAngle) * this.radius, + endY = Math.sin(this.endAngle) * this.radius, + largeFlag = angle > pi ? '1' : '0'; + + markup.push( + '\n' + ); + } + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + _render: function(ctx, noTransform) { + ctx.beginPath(); + ctx.arc(noTransform ? this.left + this.radius : 0, + noTransform ? this.top + this.radius : 0, + this.radius, + this.startAngle, + this.endAngle, false); + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * Returns horizontal radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRadiusX: function() { + return this.get('radius') * this.get('scaleX'); + }, + + /** + * Returns vertical radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRadiusY: function() { + return this.get('radius') * this.get('scaleY'); + }, + + /** + * Sets radius of an object (and updates width accordingly) + * @return {Number} + */ + setRadius: function(value) { + this.radius = value; + this.set('width', value * 2).set('height', value * 2); + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Circle.fromElement}) + * @static + * @memberOf fabric.Circle + * @see: http://www.w3.org/TR/SVG/shapes.html#CircleElement + */ + fabric.Circle.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('cx cy r'.split(' ')); + + /** + * Returns {@link fabric.Circle} instance from an SVG element + * @static + * @memberOf fabric.Circle + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @throws {Error} If value of `r` attribute is missing or invalid + * @return {fabric.Circle} Instance of fabric.Circle + */ + fabric.Circle.fromElement = function(element, options) { + options || (options = { }); + + var parsedAttributes = fabric.parseAttributes(element, fabric.Circle.ATTRIBUTE_NAMES); + + if (!isValidRadius(parsedAttributes)) { + throw new Error('value of `r` attribute is required and can not be negative'); + } + + parsedAttributes.left = parsedAttributes.left || 0; + parsedAttributes.top = parsedAttributes.top || 0; + + var obj = new fabric.Circle(extend(parsedAttributes, options)); + + obj.left -= obj.radius; + obj.top -= obj.radius; + return obj; + }; + + /** + * @private + */ + function isValidRadius(attributes) { + return (('radius' in attributes) && (attributes.radius >= 0)); + } + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Circle} instance from an object representation + * @static + * @memberOf fabric.Circle + * @param {Object} object Object to create an instance from + * @return {Object} Instance of fabric.Circle + */ + fabric.Circle.fromObject = function(object) { + return new fabric.Circle(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Triangle) { + fabric.warn('fabric.Triangle is already defined'); + return; + } + + /** + * Triangle class + * @class fabric.Triangle + * @extends fabric.Object + * @return {fabric.Triangle} thisArg + * @see {@link fabric.Triangle#initialize} for constructor definition + */ + fabric.Triangle = fabric.util.createClass(fabric.Object, /** @lends fabric.Triangle.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'triangle', + + /** + * Constructor + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(options) { + options = options || { }; + + this.callSuper('initialize', options); + + this.set('width', options.width || 100) + .set('height', options.height || 100); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + var widthBy2 = this.width / 2, + heightBy2 = this.height / 2; + + ctx.beginPath(); + ctx.moveTo(-widthBy2, heightBy2); + ctx.lineTo(0, -heightBy2); + ctx.lineTo(widthBy2, heightBy2); + ctx.closePath(); + + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var widthBy2 = this.width / 2, + heightBy2 = this.height / 2; + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, -widthBy2, heightBy2, 0, -heightBy2, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, 0, -heightBy2, widthBy2, heightBy2, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, widthBy2, heightBy2, -widthBy2, heightBy2, this.strokeDashArray); + ctx.closePath(); + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), + widthBy2 = this.width / 2, + heightBy2 = this.height / 2, + points = [ + -widthBy2 + ' ' + heightBy2, + '0 ' + -heightBy2, + widthBy2 + ' ' + heightBy2 + ] + .join(','); + + markup.push( + '' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return 1; + } + }); + + /** + * Returns fabric.Triangle instance from an object representation + * @static + * @memberOf fabric.Triangle + * @param {Object} object Object to create an instance from + * @return {Object} instance of Canvas.Triangle + */ + fabric.Triangle.fromObject = function(object) { + return new fabric.Triangle(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + piBy2 = Math.PI * 2, + extend = fabric.util.object.extend; + + if (fabric.Ellipse) { + fabric.warn('fabric.Ellipse is already defined.'); + return; + } + + /** + * Ellipse class + * @class fabric.Ellipse + * @extends fabric.Object + * @return {fabric.Ellipse} thisArg + * @see {@link fabric.Ellipse#initialize} for constructor definition + */ + fabric.Ellipse = fabric.util.createClass(fabric.Object, /** @lends fabric.Ellipse.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'ellipse', + + /** + * Horizontal radius + * @type Number + * @default + */ + rx: 0, + + /** + * Vertical radius + * @type Number + * @default + */ + ry: 0, + + /** + * Constructor + * @param {Object} [options] Options object + * @return {fabric.Ellipse} thisArg + */ + initialize: function(options) { + options = options || { }; + + this.callSuper('initialize', options); + + this.set('rx', options.rx || 0); + this.set('ry', options.ry || 0); + }, + + /** + * @private + * @param {String} key + * @param {Any} value + * @return {fabric.Ellipse} thisArg + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + switch (key) { + + case 'rx': + this.rx = value; + this.set('width', value * 2); + break; + + case 'ry': + this.ry = value; + this.set('height', value * 2); + break; + + } + return this; + }, + + /** + * Returns horizontal radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRx: function() { + return this.get('rx') * this.get('scaleX'); + }, + + /** + * Returns Vertical radius of an object (according to how an object is scaled) + * @return {Number} + */ + getRy: function() { + return this.get('ry') * this.get('scaleY'); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + rx: this.get('rx'), + ry: this.get('ry') + }); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), x = 0, y = 0; + if (this.group && this.group.type === 'path-group') { + x = this.left + this.rx; + y = this.top + this.ry; + } + markup.push( + '\n' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + _render: function(ctx, noTransform) { + ctx.beginPath(); + ctx.save(); + ctx.transform(1, 0, 0, this.ry/this.rx, 0, 0); + ctx.arc( + noTransform ? this.left + this.rx : 0, + noTransform ? (this.top + this.ry) * this.rx/this.ry : 0, + this.rx, + 0, + piBy2, + false); + ctx.restore(); + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Ellipse.fromElement}) + * @static + * @memberOf fabric.Ellipse + * @see http://www.w3.org/TR/SVG/shapes.html#EllipseElement + */ + fabric.Ellipse.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('cx cy rx ry'.split(' ')); + + /** + * Returns {@link fabric.Ellipse} instance from an SVG element + * @static + * @memberOf fabric.Ellipse + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Ellipse} + */ + fabric.Ellipse.fromElement = function(element, options) { + options || (options = { }); + + var parsedAttributes = fabric.parseAttributes(element, fabric.Ellipse.ATTRIBUTE_NAMES); + + parsedAttributes.left = parsedAttributes.left || 0; + parsedAttributes.top = parsedAttributes.top || 0; + + var ellipse = new fabric.Ellipse(extend(parsedAttributes, options)); + + ellipse.top -= ellipse.ry; + ellipse.left -= ellipse.rx; + return ellipse; + }; + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Ellipse} instance from an object representation + * @static + * @memberOf fabric.Ellipse + * @param {Object} object Object to create an instance from + * @return {fabric.Ellipse} + */ + fabric.Ellipse.fromObject = function(object) { + return new fabric.Ellipse(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend; + + if (fabric.Rect) { + console.warn('fabric.Rect is already defined'); + return; + } + + var stateProperties = fabric.Object.prototype.stateProperties.concat(); + stateProperties.push('rx', 'ry', 'x', 'y'); + + /** + * Rectangle class + * @class fabric.Rect + * @extends fabric.Object + * @return {fabric.Rect} thisArg + * @see {@link fabric.Rect#initialize} for constructor definition + */ + fabric.Rect = fabric.util.createClass(fabric.Object, /** @lends fabric.Rect.prototype */ { + + /** + * List of properties to consider when checking if state of an object is changed ({@link fabric.Object#hasStateChanged}) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: stateProperties, + + /** + * Type of an object + * @type String + * @default + */ + type: 'rect', + + /** + * Horizontal border radius + * @type Number + * @default + */ + rx: 0, + + /** + * Vertical border radius + * @type Number + * @default + */ + ry: 0, + + /** + * Used to specify dash pattern for stroke on this object + * @type Array + */ + strokeDashArray: null, + + /** + * Constructor + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(options) { + options = options || { }; + + this.callSuper('initialize', options); + this._initRxRy(); + + }, + + /** + * Initializes rx/ry attributes + * @private + */ + _initRxRy: function() { + if (this.rx && !this.ry) { + this.ry = this.rx; + } + else if (this.ry && !this.rx) { + this.rx = this.ry; + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx, noTransform) { + + // optimize 1x1 case (used in spray brush) + if (this.width === 1 && this.height === 1) { + ctx.fillRect(0, 0, 1, 1); + return; + } + + var rx = this.rx ? Math.min(this.rx, this.width / 2) : 0, + ry = this.ry ? Math.min(this.ry, this.height / 2) : 0, + w = this.width, + h = this.height, + x = noTransform ? this.left : -this.width / 2, + y = noTransform ? this.top : -this.height / 2, + isRounded = rx !== 0 || ry !== 0, + k = 1 - 0.5522847498 /* "magic number" for bezier approximations of arcs (http://itc.ktu.lt/itc354/Riskus354.pdf) */; + + ctx.beginPath(); + + ctx.moveTo(x + rx, y); + + ctx.lineTo(x + w - rx, y); + isRounded && ctx.bezierCurveTo(x + w - k * rx, y, x + w, y + k * ry, x + w, y + ry); + + ctx.lineTo(x + w, y + h - ry); + isRounded && ctx.bezierCurveTo(x + w, y + h - k * ry, x + w - k * rx, y + h, x + w - rx, y + h); + + ctx.lineTo(x + rx, y + h); + isRounded && ctx.bezierCurveTo(x + k * rx, y + h, x, y + h - k * ry, x, y + h - ry); + + ctx.lineTo(x, y + ry); + isRounded && ctx.bezierCurveTo(x, y + k * ry, x + k * rx, y, x + rx, y); + + ctx.closePath(); + + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var x = -this.width / 2, + y = -this.height / 2, + w = this.width, + h = this.height; + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, x, y, x + w, y, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y, x + w, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y + h, x, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x, y + h, x, y, this.strokeDashArray); + ctx.closePath(); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + var object = extend(this.callSuper('toObject', propertiesToInclude), { + rx: this.get('rx') || 0, + ry: this.get('ry') || 0 + }); + if (!this.includeDefaultValues) { + this._removeDefaultValues(object); + } + return object; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), x = this.left, y = this.top; + if (!(this.group && this.group.type === 'path-group')) { + x = -this.width / 2; + y = -this.height / 2; + } + markup.push( + '\n'); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns complexity of an instance + * @return {Number} complexity + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Rect.fromElement`) + * @static + * @memberOf fabric.Rect + * @see: http://www.w3.org/TR/SVG/shapes.html#RectElement + */ + fabric.Rect.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat('x y rx ry width height'.split(' ')); + + /** + * Returns {@link fabric.Rect} instance from an SVG element + * @static + * @memberOf fabric.Rect + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Rect} Instance of fabric.Rect + */ + fabric.Rect.fromElement = function(element, options) { + if (!element) { + return null; + } + options = options || { }; + + var parsedAttributes = fabric.parseAttributes(element, fabric.Rect.ATTRIBUTE_NAMES); + + parsedAttributes.left = parsedAttributes.left || 0; + parsedAttributes.top = parsedAttributes.top || 0; + var rect = new fabric.Rect(extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes)); + rect.visible = rect.width > 0 && rect.height > 0; + return rect; + }; + /* _FROM_SVG_END_ */ + + /** + * Returns {@link fabric.Rect} instance from an object representation + * @static + * @memberOf fabric.Rect + * @param {Object} object Object to create an instance from + * @return {Object} instance of fabric.Rect + */ + fabric.Rect.fromObject = function(object) { + return new fabric.Rect(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + if (fabric.Polyline) { + fabric.warn('fabric.Polyline is already defined'); + return; + } + + /** + * Polyline class + * @class fabric.Polyline + * @extends fabric.Object + * @see {@link fabric.Polyline#initialize} for constructor definition + */ + fabric.Polyline = fabric.util.createClass(fabric.Object, /** @lends fabric.Polyline.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'polyline', + + /** + * Points array + * @type Array + * @default + */ + points: null, + + /** + * Minimum X from points values, necessary to offset points + * @type Number + * @default + */ + minX: 0, + + /** + * Minimum Y from points values, necessary to offset points + * @type Number + * @default + */ + minY: 0, + + /** + * Constructor + * @param {Array} points Array of points (where each point is an object with x and y) + * @param {Object} [options] Options object + * @param {Boolean} [skipOffset] Whether points offsetting should be skipped + * @return {fabric.Polyline} thisArg + * @example + * var poly = new fabric.Polyline([ + * { x: 10, y: 10 }, + * { x: 50, y: 30 }, + * { x: 40, y: 70 }, + * { x: 60, y: 50 }, + * { x: 100, y: 150 }, + * { x: 40, y: 100 } + * ], { + * stroke: 'red', + * left: 100, + * top: 100 + * }); + */ + initialize: function(points, options) { + return fabric.Polygon.prototype.initialize.call(this, points, options); + }, + + /** + * @private + */ + _calcDimensions: function() { + return fabric.Polygon.prototype._calcDimensions.call(this); + }, + + /** + * @private + */ + _applyPointOffset: function() { + return fabric.Polygon.prototype._applyPointOffset.call(this); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + return fabric.Polygon.prototype.toObject.call(this, propertiesToInclude); + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + return fabric.Polygon.prototype.toSVG.call(this, reviver); + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + if (!fabric.Polygon.prototype.commonRender.call(this, ctx)) { + return; + } + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var p1, p2; + + ctx.beginPath(); + for (var i = 0, len = this.points.length; i < len; i++) { + p1 = this.points[i]; + p2 = this.points[i + 1] || p1; + fabric.util.drawDashedLine(ctx, p1.x, p1.y, p2.x, p2.y, this.strokeDashArray); + } + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return this.get('points').length; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Polyline.fromElement}) + * @static + * @memberOf fabric.Polyline + * @see: http://www.w3.org/TR/SVG/shapes.html#PolylineElement + */ + fabric.Polyline.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(); + + /** + * Returns fabric.Polyline instance from an SVG element + * @static + * @memberOf fabric.Polyline + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Polyline} Instance of fabric.Polyline + */ + fabric.Polyline.fromElement = function(element, options) { + if (!element) { + return null; + } + options || (options = { }); + + var points = fabric.parsePointsAttribute(element.getAttribute('points')), + parsedAttributes = fabric.parseAttributes(element, fabric.Polyline.ATTRIBUTE_NAMES); + + return new fabric.Polyline(points, fabric.util.object.extend(parsedAttributes, options)); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Polyline instance from an object representation + * @static + * @memberOf fabric.Polyline + * @param {Object} object Object to create an instance from + * @return {fabric.Polyline} Instance of fabric.Polyline + */ + fabric.Polyline.fromObject = function(object) { + var points = object.points; + return new fabric.Polyline(points, object, true); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + min = fabric.util.array.min, + max = fabric.util.array.max, + toFixed = fabric.util.toFixed; + + if (fabric.Polygon) { + fabric.warn('fabric.Polygon is already defined'); + return; + } + + /** + * Polygon class + * @class fabric.Polygon + * @extends fabric.Object + * @see {@link fabric.Polygon#initialize} for constructor definition + */ + fabric.Polygon = fabric.util.createClass(fabric.Object, /** @lends fabric.Polygon.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'polygon', + + /** + * Points array + * @type Array + * @default + */ + points: null, + + /** + * Minimum X from points values, necessary to offset points + * @type Number + * @default + */ + minX: 0, + + /** + * Minimum Y from points values, necessary to offset points + * @type Number + * @default + */ + minY: 0, + + /** + * Constructor + * @param {Array} points Array of points + * @param {Object} [options] Options object + * @return {fabric.Polygon} thisArg + */ + initialize: function(points, options) { + options = options || { }; + this.points = points || [ ]; + this.callSuper('initialize', options); + this._calcDimensions(); + if (!('top' in options)) { + this.top = this.minY; + } + if (!('left' in options)) { + this.left = this.minX; + } + }, + + /** + * @private + */ + _calcDimensions: function() { + + var points = this.points, + minX = min(points, 'x'), + minY = min(points, 'y'), + maxX = max(points, 'x'), + maxY = max(points, 'y'); + + this.width = (maxX - minX) || 0; + this.height = (maxY - minY) || 0; + + this.minX = minX || 0, + this.minY = minY || 0; + }, + + /** + * @private + */ + _applyPointOffset: function() { + // change points to offset polygon into a bounding box + // executed one time + this.points.forEach(function(p) { + p.x -= (this.minX + this.width / 2); + p.y -= (this.minY + this.height / 2); + }, this); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + points: this.points.concat() + }); + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var points = [], + markup = this._createBaseSVGMarkup(); + + for (var i = 0, len = this.points.length; i < len; i++) { + points.push(toFixed(this.points[i].x, 2), ',', toFixed(this.points[i].y, 2), ' '); + } + + markup.push( + '<', this.type, ' ', + 'points="', points.join(''), + '" style="', this.getSvgStyles(), + '" transform="', this.getSvgTransform(), + ' ', this.getSvgTransformMatrix(), + '"/>\n' + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + if (!this.commonRender(ctx)) { + return; + } + this._renderFill(ctx); + if (this.stroke || this.strokeDashArray) { + ctx.closePath(); + this._renderStroke(ctx); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + commonRender: function(ctx) { + var point, len = this.points.length; + + if (!len || isNaN(this.points[len - 1].y)) { + // do not draw if no points or odd points + // NaN comes from parseFloat of a empty string in parser + return false; + } + + ctx.beginPath(); + + if (this._applyPointOffset) { + if (!(this.group && this.group.type === 'path-group')) { + this._applyPointOffset(); + } + this._applyPointOffset = null; + } + + ctx.moveTo(this.points[0].x, this.points[0].y); + for (var i = 0; i < len; i++) { + point = this.points[i]; + ctx.lineTo(point.x, point.y); + } + return true; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + fabric.Polyline.prototype._renderDashedStroke.call(this, ctx); + ctx.closePath(); + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return this.points.length; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Polygon.fromElement`) + * @static + * @memberOf fabric.Polygon + * @see: http://www.w3.org/TR/SVG/shapes.html#PolygonElement + */ + fabric.Polygon.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(); + + /** + * Returns {@link fabric.Polygon} instance from an SVG element + * @static + * @memberOf fabric.Polygon + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Polygon} Instance of fabric.Polygon + */ + fabric.Polygon.fromElement = function(element, options) { + if (!element) { + return null; + } + + options || (options = { }); + + var points = fabric.parsePointsAttribute(element.getAttribute('points')), + parsedAttributes = fabric.parseAttributes(element, fabric.Polygon.ATTRIBUTE_NAMES); + + return new fabric.Polygon(points, extend(parsedAttributes, options)); + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Polygon instance from an object representation + * @static + * @memberOf fabric.Polygon + * @param {Object} object Object to create an instance from + * @return {fabric.Polygon} Instance of fabric.Polygon + */ + fabric.Polygon.fromObject = function(object) { + return new fabric.Polygon(object.points, object, true); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + min = fabric.util.array.min, + max = fabric.util.array.max, + extend = fabric.util.object.extend, + _toString = Object.prototype.toString, + drawArc = fabric.util.drawArc, + commandLengths = { + m: 2, + l: 2, + h: 1, + v: 1, + c: 6, + s: 4, + q: 4, + t: 2, + a: 7 + }, + repeatedCommands = { + m: 'l', + M: 'L' + }; + + if (fabric.Path) { + fabric.warn('fabric.Path is already defined'); + return; + } + + /** + * Path class + * @class fabric.Path + * @extends fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1/#path_and_pathgroup} + * @see {@link fabric.Path#initialize} for constructor definition + */ + fabric.Path = fabric.util.createClass(fabric.Object, /** @lends fabric.Path.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'path', + + /** + * Array of path points + * @type Array + * @default + */ + path: null, + + /** + * Minimum X from points values, necessary to offset points + * @type Number + * @default + */ + minX: 0, + + /** + * Minimum Y from points values, necessary to offset points + * @type Number + * @default + */ + minY: 0, + + /** + * Constructor + * @param {Array|String} path Path data (sequence of coordinates and corresponding "command" tokens) + * @param {Object} [options] Options object + * @return {fabric.Path} thisArg + */ + initialize: function(path, options) { + options = options || { }; + + this.setOptions(options); + + if (!path) { + throw new Error('`path` argument is required'); + } + + var fromArray = _toString.call(path) === '[object Array]'; + + this.path = fromArray + ? path + // one of commands (m,M,l,L,q,Q,c,C,etc.) followed by non-command characters (i.e. command values) + : path.match && path.match(/[mzlhvcsqta][^mzlhvcsqta]*/gi); + + if (!this.path) { + return; + } + + if (!fromArray) { + this.path = this._parsePath(); + } + + this._setPositionDimensions(); + + if (options.sourcePath) { + this.setSourcePath(options.sourcePath); + } + }, + + /** + * @private + */ + _setPositionDimensions: function() { + var calcDim = this._parseDimensions(); + + this.minX = calcDim.left; + this.minY = calcDim.top; + this.width = calcDim.width; + this.height = calcDim.height; + + calcDim.left += this.originX === 'center' + ? this.width / 2 + : this.originX === 'right' + ? this.width + : 0; + + calcDim.top += this.originY === 'center' + ? this.height / 2 + : this.originY === 'bottom' + ? this.height + : 0; + + this.top = this.top || calcDim.top; + this.left = this.left || calcDim.left; + + this.pathOffset = this.pathOffset || { + x: this.minX + this.width / 2, + y: this.minY + this.height / 2 + }; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx context to render path on + */ + _render: function(ctx) { + var current, // current instruction + previous = null, + subpathStartX = 0, + subpathStartY = 0, + x = 0, // current x + y = 0, // current y + controlX = 0, // current control point x + controlY = 0, // current control point y + tempX, + tempY, + l = -this.pathOffset.x, + t = -this.pathOffset.y; + + if (this.group && this.group.type === 'path-group') { + l = 0; + t = 0; + } + + ctx.beginPath(); + + for (var i = 0, len = this.path.length; i < len; ++i) { + + current = this.path[i]; + + switch (current[0]) { // first letter + + case 'l': // lineto, relative + x += current[1]; + y += current[2]; + ctx.lineTo(x + l, y + t); + break; + + case 'L': // lineto, absolute + x = current[1]; + y = current[2]; + ctx.lineTo(x + l, y + t); + break; + + case 'h': // horizontal lineto, relative + x += current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'H': // horizontal lineto, absolute + x = current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'v': // vertical lineto, relative + y += current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'V': // verical lineto, absolute + y = current[1]; + ctx.lineTo(x + l, y + t); + break; + + case 'm': // moveTo, relative + x += current[1]; + y += current[2]; + subpathStartX = x; + subpathStartY = y; + ctx.moveTo(x + l, y + t); + break; + + case 'M': // moveTo, absolute + x = current[1]; + y = current[2]; + subpathStartX = x; + subpathStartY = y; + ctx.moveTo(x + l, y + t); + break; + + case 'c': // bezierCurveTo, relative + tempX = x + current[5]; + tempY = y + current[6]; + controlX = x + current[3]; + controlY = y + current[4]; + ctx.bezierCurveTo( + x + current[1] + l, // x1 + y + current[2] + t, // y1 + controlX + l, // x2 + controlY + t, // y2 + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + break; + + case 'C': // bezierCurveTo, absolute + x = current[5]; + y = current[6]; + controlX = current[3]; + controlY = current[4]; + ctx.bezierCurveTo( + current[1] + l, + current[2] + t, + controlX + l, + controlY + t, + x + l, + y + t + ); + break; + + case 's': // shorthand cubic bezierCurveTo, relative + + // transform to absolute x,y + tempX = x + current[3]; + tempY = y + current[4]; + + if (previous[0].match(/[CcSs]/) === null) { + // If there is no previous command or if the previous command was not a C, c, S, or s, + // the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + + ctx.bezierCurveTo( + controlX + l, + controlY + t, + x + current[1] + l, + y + current[2] + t, + tempX + l, + tempY + t + ); + // set control point to 2nd one of this command + // "... the first control point is assumed to be + // the reflection of the second control point on + // the previous command relative to the current point." + controlX = x + current[1]; + controlY = y + current[2]; + + x = tempX; + y = tempY; + break; + + case 'S': // shorthand cubic bezierCurveTo, absolute + tempX = current[3]; + tempY = current[4]; + if (previous[0].match(/[CcSs]/) === null) { + // If there is no previous command or if the previous command was not a C, c, S, or s, + // the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + ctx.bezierCurveTo( + controlX + l, + controlY + t, + current[1] + l, + current[2] + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + + // set control point to 2nd one of this command + // "... the first control point is assumed to be + // the reflection of the second control point on + // the previous command relative to the current point." + controlX = current[1]; + controlY = current[2]; + + break; + + case 'q': // quadraticCurveTo, relative + // transform to absolute x,y + tempX = x + current[3]; + tempY = y + current[4]; + + controlX = x + current[1]; + controlY = y + current[2]; + + ctx.quadraticCurveTo( + controlX + l, + controlY + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + break; + + case 'Q': // quadraticCurveTo, absolute + tempX = current[3]; + tempY = current[4]; + + ctx.quadraticCurveTo( + current[1] + l, + current[2] + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + controlX = current[1]; + controlY = current[2]; + break; + + case 't': // shorthand quadraticCurveTo, relative + + // transform to absolute x,y + tempX = x + current[1]; + tempY = y + current[2]; + + if (previous[0].match(/[QqTt]/) === null) { + // If there is no previous command or if the previous command was not a Q, q, T or t, + // assume the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control point + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + + ctx.quadraticCurveTo( + controlX + l, + controlY + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + + break; + + case 'T': + tempX = current[1]; + tempY = current[2]; + + if (previous[0].match(/[QqTt]/) === null) { + // If there is no previous command or if the previous command was not a Q, q, T or t, + // assume the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control point + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + ctx.quadraticCurveTo( + controlX + l, + controlY + t, + tempX + l, + tempY + t + ); + x = tempX; + y = tempY; + break; + + case 'a': + // TODO: optimize this + drawArc(ctx, x + l, y + t, [ + current[1], + current[2], + current[3], + current[4], + current[5], + current[6] + x + l, + current[7] + y + t + ]); + x += current[6]; + y += current[7]; + break; + + case 'A': + // TODO: optimize this + drawArc(ctx, x + l, y + t, [ + current[1], + current[2], + current[3], + current[4], + current[5], + current[6] + l, + current[7] + t + ]); + x = current[6]; + y = current[7]; + break; + + case 'z': + case 'Z': + x = subpathStartX; + y = subpathStartY; + ctx.closePath(); + break; + } + previous = current; + } + this._renderFill(ctx); + this._renderStroke(ctx); + }, + + /** + * Returns string representation of an instance + * @return {String} string representation of an instance + */ + toString: function() { + return '#'; + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + var o = extend(this.callSuper('toObject', propertiesToInclude), { + path: this.path.map(function(item) { return item.slice() }), + pathOffset: this.pathOffset + }); + if (this.sourcePath) { + o.sourcePath = this.sourcePath; + } + if (this.transformMatrix) { + o.transformMatrix = this.transformMatrix; + } + return o; + }, + + /** + * Returns dataless object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + var o = this.toObject(propertiesToInclude); + if (this.sourcePath) { + o.path = this.sourcePath; + } + delete o.sourcePath; + return o; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var chunks = [], + markup = this._createBaseSVGMarkup(), addTransform = ''; + + for (var i = 0, len = this.path.length; i < len; i++) { + chunks.push(this.path[i].join(' ')); + } + var path = chunks.join(' '); + if (!(this.group && this.group.type === 'path-group')) { + addTransform = ' translate(' + (-this.pathOffset.x) + ', ' + (-this.pathOffset.y) + ') '; + } + markup.push( + //jscs:disable validateIndentation + '\n' + //jscs:enable validateIndentation + ); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns number representation of an instance complexity + * @return {Number} complexity of this instance + */ + complexity: function() { + return this.path.length; + }, + + /** + * @private + */ + _parsePath: function() { + var result = [ ], + coords = [ ], + currentPath, + parsed, + re = /([-+]?((\d+\.\d+)|((\d+)|(\.\d+)))(?:e[-+]?\d+)?)/ig, + match, + coordsStr; + + for (var i = 0, coordsParsed, len = this.path.length; i < len; i++) { + currentPath = this.path[i]; + + coordsStr = currentPath.slice(1).trim(); + coords.length = 0; + + while ((match = re.exec(coordsStr))) { + coords.push(match[0]); + } + + coordsParsed = [ currentPath.charAt(0) ]; + + for (var j = 0, jlen = coords.length; j < jlen; j++) { + parsed = parseFloat(coords[j]); + if (!isNaN(parsed)) { + coordsParsed.push(parsed); + } + } + + var command = coordsParsed[0], + commandLength = commandLengths[command.toLowerCase()], + repeatedCommand = repeatedCommands[command] || command; + + if (coordsParsed.length - 1 > commandLength) { + for (var k = 1, klen = coordsParsed.length; k < klen; k += commandLength) { + result.push([ command ].concat(coordsParsed.slice(k, k + commandLength))); + command = repeatedCommand; + } + } + else { + result.push(coordsParsed); + } + } + + return result; + }, + + /** + * @private + */ + _parseDimensions: function() { + + var aX = [], + aY = [], + current, // current instruction + previous = null, + subpathStartX = 0, + subpathStartY = 0, + x = 0, // current x + y = 0, // current y + controlX = 0, // current control point x + controlY = 0, // current control point y + tempX, + tempY, + bounds; + + for (var i = 0, len = this.path.length; i < len; ++i) { + + current = this.path[i]; + + switch (current[0]) { // first letter + + case 'l': // lineto, relative + x += current[1]; + y += current[2]; + bounds = [ ]; + break; + + case 'L': // lineto, absolute + x = current[1]; + y = current[2]; + bounds = [ ]; + break; + + case 'h': // horizontal lineto, relative + x += current[1]; + bounds = [ ]; + break; + + case 'H': // horizontal lineto, absolute + x = current[1]; + bounds = [ ]; + break; + + case 'v': // vertical lineto, relative + y += current[1]; + bounds = [ ]; + break; + + case 'V': // verical lineto, absolute + y = current[1]; + bounds = [ ]; + break; + + case 'm': // moveTo, relative + x += current[1]; + y += current[2]; + subpathStartX = x; + subpathStartY = y; + bounds = [ ]; + break; + + case 'M': // moveTo, absolute + x = current[1]; + y = current[2]; + subpathStartX = x; + subpathStartY = y; + bounds = [ ]; + break; + + case 'c': // bezierCurveTo, relative + tempX = x + current[5]; + tempY = y + current[6]; + controlX = x + current[3]; + controlY = y + current[4]; + bounds = fabric.util.getBoundsOfCurve(x, y, + x + current[1], // x1 + y + current[2], // y1 + controlX, // x2 + controlY, // y2 + tempX, + tempY + ); + x = tempX; + y = tempY; + break; + + case 'C': // bezierCurveTo, absolute + x = current[5]; + y = current[6]; + controlX = current[3]; + controlY = current[4]; + bounds = fabric.util.getBoundsOfCurve(x, y, + current[1], + current[2], + controlX, + controlY, + x, + y + ); + break; + + case 's': // shorthand cubic bezierCurveTo, relative + + // transform to absolute x,y + tempX = x + current[3]; + tempY = y + current[4]; + + if (previous[0].match(/[CcSs]/) === null) { + // If there is no previous command or if the previous command was not a C, c, S, or s, + // the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + x + current[1], + y + current[2], + tempX, + tempY + ); + // set control point to 2nd one of this command + // "... the first control point is assumed to be + // the reflection of the second control point on + // the previous command relative to the current point." + controlX = x + current[1]; + controlY = y + current[2]; + x = tempX; + y = tempY; + break; + + case 'S': // shorthand cubic bezierCurveTo, absolute + tempX = current[3]; + tempY = current[4]; + if (previous[0].match(/[CcSs]/) === null) { + // If there is no previous command or if the previous command was not a C, c, S, or s, + // the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control points + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + current[1], + current[2], + tempX, + tempY + ); + x = tempX; + y = tempY; + // set control point to 2nd one of this command + // "... the first control point is assumed to be + // the reflection of the second control point on + // the previous command relative to the current point." + controlX = current[1]; + controlY = current[2]; + break; + + case 'q': // quadraticCurveTo, relative + // transform to absolute x,y + tempX = x + current[3]; + tempY = y + current[4]; + controlX = x + current[1]; + controlY = y + current[2]; + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + controlX, + controlY, + tempX, + tempY + ); + x = tempX; + y = tempY; + break; + + case 'Q': // quadraticCurveTo, absolute + controlX = current[1]; + controlY = current[2]; + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + controlX, + controlY, + current[3], + current[4] + ); + x = current[3]; + y = current[4]; + break; + + case 't': // shorthand quadraticCurveTo, relative + // transform to absolute x,y + tempX = x + current[1]; + tempY = y + current[2]; + if (previous[0].match(/[QqTt]/) === null) { + // If there is no previous command or if the previous command was not a Q, q, T or t, + // assume the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control point + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + controlX, + controlY, + tempX, + tempY + ); + x = tempX; + y = tempY; + + break; + + case 'T': + tempX = current[1]; + tempY = current[2]; + + if (previous[0].match(/[QqTt]/) === null) { + // If there is no previous command or if the previous command was not a Q, q, T or t, + // assume the control point is coincident with the current point + controlX = x; + controlY = y; + } + else { + // calculate reflection of previous control point + controlX = 2 * x - controlX; + controlY = 2 * y - controlY; + } + bounds = fabric.util.getBoundsOfCurve(x, y, + controlX, + controlY, + controlX, + controlY, + tempX, + tempY + ); + x = tempX; + y = tempY; + break; + + case 'a': + // TODO: optimize this + bounds = fabric.util.getBoundsOfArc(x, y, + current[1], + current[2], + current[3], + current[4], + current[5], + current[6] + x, + current[7] + y + ); + x += current[6]; + y += current[7]; + break; + + case 'A': + // TODO: optimize this + bounds = fabric.util.getBoundsOfArc(x, y, + current[1], + current[2], + current[3], + current[4], + current[5], + current[6], + current[7] + ); + x = current[6]; + y = current[7]; + break; + + case 'z': + case 'Z': + x = subpathStartX; + y = subpathStartY; + break; + } + previous = current; + bounds.forEach(function (point) { + aX.push(point.x); + aY.push(point.y); + }); + aX.push(x); + aY.push(y); + } + + var minX = min(aX), + minY = min(aY), + maxX = max(aX), + maxY = max(aY), + deltaX = maxX - minX, + deltaY = maxY - minY, + + o = { + left: minX, + top: minY, + width: deltaX, + height: deltaY + }; + + return o; + } + }); + + /** + * Creates an instance of fabric.Path from an object + * @static + * @memberOf fabric.Path + * @param {Object} object + * @param {Function} callback Callback to invoke when an fabric.Path instance is created + */ + fabric.Path.fromObject = function(object, callback) { + if (typeof object.path === 'string') { + fabric.loadSVGFromURL(object.path, function (elements) { + var path = elements[0], + pathUrl = object.path; + + delete object.path; + + fabric.util.object.extend(path, object); + path.setSourcePath(pathUrl); + + callback(path); + }); + } + else { + callback(new fabric.Path(object.path, object)); + } + }; + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by `fabric.Path.fromElement`) + * @static + * @memberOf fabric.Path + * @see http://www.w3.org/TR/SVG/paths.html#PathElement + */ + fabric.Path.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat(['d']); + + /** + * Creates an instance of fabric.Path from an SVG element + * @static + * @memberOf fabric.Path + * @param {SVGElement} element to parse + * @param {Function} callback Callback to invoke when an fabric.Path instance is created + * @param {Object} [options] Options object + */ + fabric.Path.fromElement = function(element, callback, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Path.ATTRIBUTE_NAMES); + callback && callback(new fabric.Path(parsedAttributes.d, extend(parsedAttributes, options))); + }; + /* _FROM_SVG_END_ */ + + /** + * Indicates that instances of this type are async + * @static + * @memberOf fabric.Path + * @type Boolean + * @default + */ + fabric.Path.async = true; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + invoke = fabric.util.array.invoke, + parentToObject = fabric.Object.prototype.toObject; + + if (fabric.PathGroup) { + fabric.warn('fabric.PathGroup is already defined'); + return; + } + + /** + * Path group class + * @class fabric.PathGroup + * @extends fabric.Path + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1/#path_and_pathgroup} + * @see {@link fabric.PathGroup#initialize} for constructor definition + */ + fabric.PathGroup = fabric.util.createClass(fabric.Path, /** @lends fabric.PathGroup.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'path-group', + + /** + * Fill value + * @type String + * @default + */ + fill: '', + + /** + * Constructor + * @param {Array} paths + * @param {Object} [options] Options object + * @return {fabric.PathGroup} thisArg + */ + initialize: function(paths, options) { + + options = options || { }; + this.paths = paths || [ ]; + + for (var i = this.paths.length; i--;) { + this.paths[i].group = this; + } + + if (options.toBeParsed) { + this.parseDimensionsFromPaths(options); + delete options.toBeParsed; + } + this.setOptions(options); + this.setCoords(); + + if (options.sourcePath) { + this.setSourcePath(options.sourcePath); + } + }, + + /** + * Calculate width and height based on paths contained + */ + parseDimensionsFromPaths: function(options) { + var points, p, xC = [ ], yC = [ ], path, height, width, + m = this.transformMatrix; + for (var j = this.paths.length; j--;) { + path = this.paths[j]; + height = path.height + path.strokeWidth; + width = path.width + path.strokeWidth; + points = [ + { x: path.left, y: path.top }, + { x: path.left + width, y: path.top }, + { x: path.left, y: path.top + height }, + { x: path.left + width, y: path.top + height } + ]; + for (var i = 0; i < points.length; i++) { + p = points[i]; + if (m) { + p = fabric.util.transformPoint(p, m, false); + } + xC.push(p.x); + yC.push(p.y); + } + } + options.width = Math.max.apply(null, xC); + options.height = Math.max.apply(null, yC); + }, + + /** + * Renders this group on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render this instance on + */ + render: function(ctx) { + // do not render if object is not visible + if (!this.visible) { + return; + } + + ctx.save(); + + if (this.transformMatrix) { + ctx.transform.apply(ctx, this.transformMatrix); + } + this.transform(ctx); + + this._setShadow(ctx); + this.clipTo && fabric.util.clipContext(this, ctx); + ctx.translate(-this.width/2, -this.height/2); + for (var i = 0, l = this.paths.length; i < l; ++i) { + this.paths[i].render(ctx, true); + } + this.clipTo && ctx.restore(); + this._removeShadow(ctx); + ctx.restore(); + }, + + /** + * Sets certain property to a certain value + * @param {String} prop + * @param {Any} value + * @return {fabric.PathGroup} thisArg + */ + _set: function(prop, value) { + + if (prop === 'fill' && value && this.isSameColor()) { + var i = this.paths.length; + while (i--) { + this.paths[i]._set(prop, value); + } + } + + return this.callSuper('_set', prop, value); + }, + + /** + * Returns object representation of this path group + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + var o = extend(parentToObject.call(this, propertiesToInclude), { + paths: invoke(this.getObjects(), 'toObject', propertiesToInclude) + }); + if (this.sourcePath) { + o.sourcePath = this.sourcePath; + } + return o; + }, + + /** + * Returns dataless object representation of this path group + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} dataless object representation of an instance + */ + toDatalessObject: function(propertiesToInclude) { + var o = this.toObject(propertiesToInclude); + if (this.sourcePath) { + o.paths = this.sourcePath; + } + return o; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var objects = this.getObjects(), + p = this.getPointByOrigin('left', 'top'), + translatePart = 'translate(' + p.x + ' ' + p.y + ')', + markup = [ + //jscs:disable validateIndentation + '\n' + //jscs:enable validateIndentation + ]; + + for (var i = 0, len = objects.length; i < len; i++) { + markup.push(objects[i].toSVG(reviver)); + } + markup.push('\n'); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns a string representation of this path group + * @return {String} string representation of an object + */ + toString: function() { + return '#'; + }, + + /** + * Returns true if all paths in this group are of same color + * @return {Boolean} true if all paths are of the same color (`fill`) + */ + isSameColor: function() { + var firstPathFill = (this.getObjects()[0].get('fill') || '').toLowerCase(); + return this.getObjects().every(function(path) { + return (path.get('fill') || '').toLowerCase() === firstPathFill; + }); + }, + + /** + * Returns number representation of object's complexity + * @return {Number} complexity + */ + complexity: function() { + return this.paths.reduce(function(total, path) { + return total + ((path && path.complexity) ? path.complexity() : 0); + }, 0); + }, + + /** + * Returns all paths in this path group + * @return {Array} array of path objects included in this path group + */ + getObjects: function() { + return this.paths; + } + }); + + /** + * Creates fabric.PathGroup instance from an object representation + * @static + * @memberOf fabric.PathGroup + * @param {Object} object Object to create an instance from + * @param {Function} callback Callback to invoke when an fabric.PathGroup instance is created + */ + fabric.PathGroup.fromObject = function(object, callback) { + if (typeof object.paths === 'string') { + fabric.loadSVGFromURL(object.paths, function (elements) { + + var pathUrl = object.paths; + delete object.paths; + + var pathGroup = fabric.util.groupSVGElements(elements, object, pathUrl); + + callback(pathGroup); + }); + } + else { + fabric.util.enlivenObjects(object.paths, function(enlivenedObjects) { + delete object.paths; + callback(new fabric.PathGroup(enlivenedObjects, object)); + }); + } + }; + + /** + * Indicates that instances of this type are async + * @static + * @memberOf fabric.PathGroup + * @type Boolean + * @default + */ + fabric.PathGroup.async = true; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + min = fabric.util.array.min, + max = fabric.util.array.max, + invoke = fabric.util.array.invoke; + + if (fabric.Group) { + return; + } + + // lock-related properties, for use in fabric.Group#get + // to enable locking behavior on group + // when one of its objects has lock-related properties set + var _lockProperties = { + lockMovementX: true, + lockMovementY: true, + lockRotation: true, + lockScalingX: true, + lockScalingY: true, + lockUniScaling: true + }; + + /** + * Group class + * @class fabric.Group + * @extends fabric.Object + * @mixes fabric.Collection + * @tutorial {@link http://fabricjs.com/fabric-intro-part-3/#groups} + * @see {@link fabric.Group#initialize} for constructor definition + */ + fabric.Group = fabric.util.createClass(fabric.Object, fabric.Collection, /** @lends fabric.Group.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'group', + + /** + * Constructor + * @param {Object} objects Group objects + * @param {Object} [options] Options object + * @return {Object} thisArg + */ + initialize: function(objects, options) { + options = options || { }; + + this._objects = objects || []; + for (var i = this._objects.length; i--; ) { + this._objects[i].group = this; + } + + this.originalState = { }; + this.callSuper('initialize'); + + if (options.originX) { + this.originX = options.originX; + } + + if (options.originY) { + this.originY = options.originY; + } + + this._calcBounds(); + this._updateObjectsCoords(); + + this.callSuper('initialize', options); + + this.setCoords(); + this.saveCoords(); + }, + + /** + * @private + */ + _updateObjectsCoords: function() { + this.forEachObject(this._updateObjectCoords, this); + }, + + /** + * @private + */ + _updateObjectCoords: function(object) { + var objectLeft = object.getLeft(), + objectTop = object.getTop(), + center = this.getCenterPoint(); + + object.set({ + originalLeft: objectLeft, + originalTop: objectTop, + left: objectLeft - center.x, + top: objectTop - center.y + }); + + object.setCoords(); + + // do not display corners of objects enclosed in a group + object.__origHasControls = object.hasControls; + object.hasControls = false; + }, + + /** + * Returns string represenation of a group + * @return {String} + */ + toString: function() { + return '#'; + }, + + /** + * Adds an object to a group; Then recalculates group's dimension, position. + * @param {Object} object + * @return {fabric.Group} thisArg + * @chainable + */ + addWithUpdate: function(object) { + this._restoreObjectsState(); + if (object) { + this._objects.push(object); + object.group = this; + } + // since _restoreObjectsState set objects inactive + this.forEachObject(this._setObjectActive, this); + this._calcBounds(); + this._updateObjectsCoords(); + return this; + }, + + /** + * @private + */ + _setObjectActive: function(object) { + object.set('active', true); + object.group = this; + }, + + /** + * Removes an object from a group; Then recalculates group's dimension, position. + * @param {Object} object + * @return {fabric.Group} thisArg + * @chainable + */ + removeWithUpdate: function(object) { + this._moveFlippedObject(object); + this._restoreObjectsState(); + + // since _restoreObjectsState set objects inactive + this.forEachObject(this._setObjectActive, this); + + this.remove(object); + this._calcBounds(); + this._updateObjectsCoords(); + + return this; + }, + + /** + * @private + */ + _onObjectAdded: function(object) { + object.group = this; + }, + + /** + * @private + */ + _onObjectRemoved: function(object) { + delete object.group; + object.set('active', false); + }, + + /** + * Properties that are delegated to group objects when reading/writing + * @param {Object} delegatedProperties + */ + delegatedProperties: { + fill: true, + opacity: true, + fontFamily: true, + fontWeight: true, + fontSize: true, + fontStyle: true, + lineHeight: true, + textDecoration: true, + textAlign: true, + backgroundColor: true + }, + + /** + * @private + */ + _set: function(key, value) { + if (key in this.delegatedProperties) { + var i = this._objects.length; + while (i--) { + this._objects[i].set(key, value); + } + } + this.callSuper('_set', key, value); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + objects: invoke(this._objects, 'toObject', propertiesToInclude) + }); + }, + + /** + * Renders instance on a given context + * @param {CanvasRenderingContext2D} ctx context to render instance on + */ + render: function(ctx) { + // do not render if object is not visible + if (!this.visible) { + return; + } + + ctx.save(); + this.clipTo && fabric.util.clipContext(this, ctx); + this.transform(ctx); + // the array is now sorted in order of highest first, so start from end + for (var i = 0, len = this._objects.length; i < len; i++) { + this._renderObject(this._objects[i], ctx); + } + + this.clipTo && ctx.restore(); + + ctx.restore(); + }, + + /** + * Renders controls and borders for the object + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Boolean} [noTransform] When true, context is not transformed + */ + _renderControls: function(ctx, noTransform) { + this.callSuper('_renderControls', ctx, noTransform); + for (var i = 0, len = this._objects.length; i < len; i++) { + this._objects[i]._renderControls(ctx); + } + }, + + /** + * @private + */ + _renderObject: function(object, ctx) { + var originalHasRotatingPoint = object.hasRotatingPoint; + + // do not render if object is not visible + if (!object.visible) { + return; + } + + object.hasRotatingPoint = false; + + object.render(ctx); + + object.hasRotatingPoint = originalHasRotatingPoint; + }, + + /** + * Retores original state of each of group objects (original state is that which was before group was created). + * @private + * @return {fabric.Group} thisArg + * @chainable + */ + _restoreObjectsState: function() { + this._objects.forEach(this._restoreObjectState, this); + return this; + }, + + /** + * Realises the transform from this group onto the supplied object + * i.e. it tells you what would happen if the supplied object was in + * the group, and then the group was destroyed. It mutates the supplied + * object. + * @param {fabric.Object} object + * @return {fabric.Object} transformedObject + */ + realizeTransform: function(object) { + this._moveFlippedObject(object); + this._setObjectPosition(object); + return object; + }, + /** + * Moves a flipped object to the position where it's displayed + * @private + * @param {fabric.Object} object + * @return {fabric.Group} thisArg + */ + _moveFlippedObject: function(object) { + var oldOriginX = object.get('originX'), + oldOriginY = object.get('originY'), + center = object.getCenterPoint(); + + object.set({ + originX: 'center', + originY: 'center', + left: center.x, + top: center.y + }); + + this._toggleFlipping(object); + + var newOrigin = object.getPointByOrigin(oldOriginX, oldOriginY); + + object.set({ + originX: oldOriginX, + originY: oldOriginY, + left: newOrigin.x, + top: newOrigin.y + }); + + return this; + }, + + /** + * @private + */ + _toggleFlipping: function(object) { + if (this.flipX) { + object.toggle('flipX'); + object.set('left', -object.get('left')); + object.setAngle(-object.getAngle()); + } + if (this.flipY) { + object.toggle('flipY'); + object.set('top', -object.get('top')); + object.setAngle(-object.getAngle()); + } + }, + + /** + * Restores original state of a specified object in group + * @private + * @param {fabric.Object} object + * @return {fabric.Group} thisArg + */ + _restoreObjectState: function(object) { + this._setObjectPosition(object); + + object.setCoords(); + object.hasControls = object.__origHasControls; + delete object.__origHasControls; + object.set('active', false); + object.setCoords(); + delete object.group; + + return this; + }, + + /** + * @private + */ + _setObjectPosition: function(object) { + var center = this.getCenterPoint(), + rotated = this._getRotatedLeftTop(object); + + object.set({ + angle: object.getAngle() + this.getAngle(), + left: center.x + rotated.left, + top: center.y + rotated.top, + scaleX: object.get('scaleX') * this.get('scaleX'), + scaleY: object.get('scaleY') * this.get('scaleY') + }); + }, + + /** + * @private + */ + _getRotatedLeftTop: function(object) { + var groupAngle = this.getAngle() * (Math.PI / 180); + return { + left: (-Math.sin(groupAngle) * object.getTop() * this.get('scaleY') + + Math.cos(groupAngle) * object.getLeft() * this.get('scaleX')), + + top: (Math.cos(groupAngle) * object.getTop() * this.get('scaleY') + + Math.sin(groupAngle) * object.getLeft() * this.get('scaleX')) + }; + }, + + /** + * Destroys a group (restoring state of its objects) + * @return {fabric.Group} thisArg + * @chainable + */ + destroy: function() { + this._objects.forEach(this._moveFlippedObject, this); + return this._restoreObjectsState(); + }, + + /** + * Saves coordinates of this instance (to be used together with `hasMoved`) + * @saveCoords + * @return {fabric.Group} thisArg + * @chainable + */ + saveCoords: function() { + this._originalLeft = this.get('left'); + this._originalTop = this.get('top'); + return this; + }, + + /** + * Checks whether this group was moved (since `saveCoords` was called last) + * @return {Boolean} true if an object was moved (since fabric.Group#saveCoords was called) + */ + hasMoved: function() { + return this._originalLeft !== this.get('left') || + this._originalTop !== this.get('top'); + }, + + /** + * Sets coordinates of all group objects + * @return {fabric.Group} thisArg + * @chainable + */ + setObjectsCoords: function() { + this.forEachObject(function(object) { + object.setCoords(); + }); + return this; + }, + + /** + * @private + */ + _calcBounds: function(onlyWidthHeight) { + var aX = [], + aY = [], + o, prop, + props = ['tr', 'br', 'bl', 'tl']; + + for (var i = 0, len = this._objects.length; i < len; ++i) { + o = this._objects[i]; + o.setCoords(); + for (var j = 0; j < props.length; j++) { + prop = props[j]; + aX.push(o.oCoords[prop].x); + aY.push(o.oCoords[prop].y); + } + } + + this.set(this._getBounds(aX, aY, onlyWidthHeight)); + }, + + /** + * @private + */ + _getBounds: function(aX, aY, onlyWidthHeight) { + var ivt = fabric.util.invertTransform(this.getViewportTransform()), + minXY = fabric.util.transformPoint(new fabric.Point(min(aX), min(aY)), ivt), + maxXY = fabric.util.transformPoint(new fabric.Point(max(aX), max(aY)), ivt), + obj = { + width: (maxXY.x - minXY.x) || 0, + height: (maxXY.y - minXY.y) || 0 + }; + + if (!onlyWidthHeight) { + obj.left = minXY.x || 0; + obj.top = minXY.y || 0; + if (this.originX === 'center') { + obj.left += obj.width / 2; + } + if (this.originX === 'right') { + obj.left += obj.width; + } + if (this.originY === 'center') { + obj.top += obj.height / 2; + } + if (this.originY === 'bottom') { + obj.top += obj.height; + } + } + return obj; + }, + + /* _TO_SVG_START_ */ + /** + * Returns svg representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = [ + //jscs:disable validateIndentation + '\n' + //jscs:enable validateIndentation + ]; + + for (var i = 0, len = this._objects.length; i < len; i++) { + markup.push(this._objects[i].toSVG(reviver)); + } + + markup.push('\n'); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns requested property + * @param {String} prop Property to get + * @return {Any} + */ + get: function(prop) { + if (prop in _lockProperties) { + if (this[prop]) { + return this[prop]; + } + else { + for (var i = 0, len = this._objects.length; i < len; i++) { + if (this._objects[i][prop]) { + return true; + } + } + return false; + } + } + else { + if (prop in this.delegatedProperties) { + return this._objects[0] && this._objects[0].get(prop); + } + return this[prop]; + } + } + }); + + /** + * Returns {@link fabric.Group} instance from an object representation + * @static + * @memberOf fabric.Group + * @param {Object} object Object to create a group from + * @param {Function} [callback] Callback to invoke when an group instance is created + * @return {fabric.Group} An instance of fabric.Group + */ + fabric.Group.fromObject = function(object, callback) { + fabric.util.enlivenObjects(object.objects, function(enlivenedObjects) { + delete object.objects; + callback && callback(new fabric.Group(enlivenedObjects, object)); + }); + }; + + /** + * Indicates that instances of this type are async + * @static + * @memberOf fabric.Group + * @type Boolean + * @default + */ + fabric.Group.async = true; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var extend = fabric.util.object.extend; + + if (!global.fabric) { + global.fabric = { }; + } + + if (global.fabric.Image) { + fabric.warn('fabric.Image is already defined.'); + return; + } + + /** + * Image class + * @class fabric.Image + * @extends fabric.Object + * @tutorial {@link http://fabricjs.com/fabric-intro-part-1/#images} + * @see {@link fabric.Image#initialize} for constructor definition + */ + fabric.Image = fabric.util.createClass(fabric.Object, /** @lends fabric.Image.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'image', + + /** + * crossOrigin value (one of "", "anonymous", "allow-credentials") + * @see https://developer.mozilla.org/en-US/docs/HTML/CORS_settings_attributes + * @type String + * @default + */ + crossOrigin: '', + + /** + * AlignX value, part of preserveAspectRatio (one of "none", "mid", "min", "max") + * @see http://www.w3.org/TR/SVG/coords.html#PreserveAspectRatioAttribute + * This parameter defines how the picture is aligned to its viewport when image element width differs from image width. + * @type String + * @default + */ + alignX: 'none', + + /** + * AlignY value, part of preserveAspectRatio (one of "none", "mid", "min", "max") + * @see http://www.w3.org/TR/SVG/coords.html#PreserveAspectRatioAttribute + * This parameter defines how the picture is aligned to its viewport when image element height differs from image height. + * @type String + * @default + */ + alignY: 'none', + + /** + * meetOrSlice value, part of preserveAspectRatio (one of "meet", "slice"). + * if meet the image is always fully visibile, if slice the viewport is always filled with image. + * @see http://www.w3.org/TR/SVG/coords.html#PreserveAspectRatioAttribute + * @type String + * @default + */ + meetOrSlice: 'meet', + + /** + * private + * contains last value of scaleX to detect + * if the Image got resized after the last Render + * @type Number + */ + _lastScaleX: 1, + + /** + * private + * contains last value of scaleY to detect + * if the Image got resized after the last Render + * @type Number + */ + _lastScaleY: 1, + + /** + * Constructor + * @param {HTMLImageElement | String} element Image element + * @param {Object} [options] Options object + * @return {fabric.Image} thisArg + */ + initialize: function(element, options) { + options || (options = { }); + + this.filters = [ ]; + this.resizeFilters = [ ]; + this.callSuper('initialize', options); + + this._initElement(element, options); + this._initConfig(options); + + if (options.filters) { + this.filters = options.filters; + this.applyFilters(); + } + }, + + /** + * Returns image element which this instance if based on + * @return {HTMLImageElement} Image element + */ + getElement: function() { + return this._element; + }, + + /** + * Sets image element for this instance to a specified one. + * If filters defined they are applied to new image. + * You might need to call `canvas.renderAll` and `object.setCoords` after replacing, to render new image and update controls area. + * @param {HTMLImageElement} element + * @param {Function} [callback] Callback is invoked when all filters have been applied and new image is generated + * @param {Object} [options] Options object + * @return {fabric.Image} thisArg + * @chainable + */ + setElement: function(element, callback, options) { + this._element = element; + this._originalElement = element; + this._initConfig(options); + + if (this.filters.length !== 0) { + this.applyFilters(callback); + } + else if (callback) { + callback(); + } + + return this; + }, + + /** + * Sets crossOrigin value (on an instance and corresponding image element) + * @return {fabric.Image} thisArg + * @chainable + */ + setCrossOrigin: function(value) { + this.crossOrigin = value; + this._element.crossOrigin = value; + + return this; + }, + + /** + * Returns original size of an image + * @return {Object} Object with "width" and "height" properties + */ + getOriginalSize: function() { + var element = this.getElement(); + return { + width: element.width, + height: element.height + }; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _stroke: function(ctx) { + ctx.save(); + this._setStrokeStyles(ctx); + ctx.beginPath(); + ctx.strokeRect(-this.width / 2, -this.height / 2, this.width, this.height); + ctx.closePath(); + ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderDashedStroke: function(ctx) { + var x = -this.width / 2, + y = -this.height / 2, + w = this.width, + h = this.height; + + ctx.save(); + this._setStrokeStyles(ctx); + + ctx.beginPath(); + fabric.util.drawDashedLine(ctx, x, y, x + w, y, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y, x + w, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x + w, y + h, x, y + h, this.strokeDashArray); + fabric.util.drawDashedLine(ctx, x, y + h, x, y, this.strokeDashArray); + ctx.closePath(); + ctx.restore(); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + return extend(this.callSuper('toObject', propertiesToInclude), { + src: this._originalElement.src || this._originalElement._src, + filters: this.filters.map(function(filterObj) { + return filterObj && filterObj.toObject(); + }), + crossOrigin: this.crossOrigin, + alignX: this.alignX, + alignY: this.alignY, + meetOrSlice: this.meetOrSlice + }); + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = [], x = -this.width / 2, y = -this.height / 2, + preserveAspectRatio = 'none'; + if (this.group && this.group.type === 'path-group') { + x = this.left; + y = this.top; + } + if (this.alignX !== 'none' && this.alignY !== 'none') { + preserveAspectRatio = 'x' + this.alignX + 'Y' + this.alignY + ' ' + this.meetOrSlice; + } + markup.push( + '\n', + '\n' + ); + + if (this.stroke || this.strokeDashArray) { + var origFill = this.fill; + this.fill = null; + markup.push( + '\n' + ); + this.fill = origFill; + } + + markup.push('\n'); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + /* _TO_SVG_END_ */ + + /** + * Returns source of an image + * @return {String} Source of an image + */ + getSrc: function() { + if (this.getElement()) { + return this.getElement().src || this.getElement()._src; + } + }, + + /** + * Sets source of an image + * @param {String} src Source string (URL) + * @param {Function} [callback] Callback is invoked when image has been loaded (and all filters have been applied) + * @param {Object} [options] Options object + * @return {fabric.Image} thisArg + * @chainable + */ + setSrc: function(src, callback, options) { + fabric.util.loadImage(src, function(img) { + return this.setElement(img, callback, options); + }, this, options && options.crossOrigin); + }, + + /** + * Returns string representation of an instance + * @return {String} String representation of an instance + */ + toString: function() { + return '#'; + }, + + /** + * Returns a clone of an instance + * @param {Function} callback Callback is invoked with a clone as a first argument + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + */ + clone: function(callback, propertiesToInclude) { + this.constructor.fromObject(this.toObject(propertiesToInclude), callback); + }, + + /** + * Applies filters assigned to this image (from "filters" array) + * @method applyFilters + * @param {Function} callback Callback is invoked when all filters have been applied and new image is generated + * @return {fabric.Image} thisArg + * @chainable + */ + applyFilters: function(callback, filters, imgElement, forResizing) { + + filters = filters || this.filters; + imgElement = imgElement || this._originalElement; + + if (!imgElement) { + return; + } + + var imgEl = imgElement, + canvasEl = fabric.util.createCanvasElement(), + replacement = fabric.util.createImage(), + _this = this; + + canvasEl.width = imgEl.width; + canvasEl.height = imgEl.height; + canvasEl.getContext('2d').drawImage(imgEl, 0, 0, imgEl.width, imgEl.height); + + if (filters.length === 0) { + this._element = imgElement; + callback && callback(); + return canvasEl; + } + filters.forEach(function(filter) { + filter && filter.applyTo(canvasEl, filter.scaleX || _this.scaleX, filter.scaleY || _this.scaleY); + if (!forResizing && filter && filter.type === 'Resize') { + _this.width *= filter.scaleX; + _this.height *= filter.scaleY; + } + }); + + /** @ignore */ + replacement.width = canvasEl.width; + replacement.height = canvasEl.height; + + if (fabric.isLikelyNode) { + replacement.src = canvasEl.toBuffer(undefined, fabric.Image.pngCompression); + // onload doesn't fire in some node versions, so we invoke callback manually + _this._element = replacement; + !forResizing && (_this._filteredEl = replacement); + callback && callback(); + } + else { + replacement.onload = function() { + _this._element = replacement; + !forResizing && (_this._filteredEl = replacement); + callback && callback(); + replacement.onload = canvasEl = imgEl = null; + }; + replacement.src = canvasEl.toDataURL('image/png'); + } + return canvasEl; + }, + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx, noTransform) { + var x, y, imageMargins = this._findMargins(), elementToDraw; + + x = (noTransform ? this.left : -this.width / 2); + y = (noTransform ? this.top : -this.height / 2); + + if (this.meetOrSlice === 'slice') { + ctx.beginPath(); + ctx.rect(x, y, this.width, this.height); + ctx.clip(); + } + + if (this.isMoving === false && this.resizeFilters.length && this._needsResize()) { + this._lastScaleX = this.scaleX; + this._lastScaleY = this.scaleY; + elementToDraw = this.applyFilters(null, this.resizeFilters, this._filteredEl || this._originalElement, true); + } + else { + elementToDraw = this._element; + } + elementToDraw && ctx.drawImage(elementToDraw, + x + imageMargins.marginX, + y + imageMargins.marginY, + imageMargins.width, + imageMargins.height + ); + + this._renderStroke(ctx); + }, + /** + * @private, needed to check if image needs resize + */ + _needsResize: function() { + return (this.scaleX !== this._lastScaleX || this.scaleY !== this._lastScaleY); + }, + + /** + * @private + */ + _findMargins: function() { + var width = this.width, height = this.height, scales, + scale, marginX = 0, marginY = 0; + + if (this.alignX !== 'none' || this.alignY !== 'none') { + scales = [this.width / this._element.width, this.height / this._element.height]; + scale = this.meetOrSlice === 'meet' + ? Math.min.apply(null, scales) : Math.max.apply(null, scales); + width = this._element.width * scale; + height = this._element.height * scale; + if (this.alignX === 'Mid') { + marginX = (this.width - width) / 2; + } + if (this.alignX === 'Max') { + marginX = this.width - width; + } + if (this.alignY === 'Mid') { + marginY = (this.height - height) / 2; + } + if (this.alignY === 'Max') { + marginY = this.height - height; + } + } + return { + width: width, + height: height, + marginX: marginX, + marginY: marginY + }; + }, + + /** + * @private + */ + _resetWidthHeight: function() { + var element = this.getElement(); + + this.set('width', element.width); + this.set('height', element.height); + }, + + /** + * The Image class's initialization method. This method is automatically + * called by the constructor. + * @private + * @param {HTMLImageElement|String} element The element representing the image + */ + _initElement: function(element) { + this.setElement(fabric.util.getById(element)); + fabric.util.addClass(this.getElement(), fabric.Image.CSS_CANVAS); + }, + + /** + * @private + * @param {Object} [options] Options object + */ + _initConfig: function(options) { + options || (options = { }); + this.setOptions(options); + this._setWidthHeight(options); + if (this._element && this.crossOrigin) { + this._element.crossOrigin = this.crossOrigin; + } + }, + + /** + * @private + * @param {Object} object Object with filters property + * @param {Function} callback Callback to invoke when all fabric.Image.filters instances are created + */ + _initFilters: function(object, callback) { + if (object.filters && object.filters.length) { + fabric.util.enlivenObjects(object.filters, function(enlivenedObjects) { + callback && callback(enlivenedObjects); + }, 'fabric.Image.filters'); + } + else { + callback && callback(); + } + }, + + /** + * @private + * @param {Object} [options] Object with width/height properties + */ + _setWidthHeight: function(options) { + this.width = 'width' in options + ? options.width + : (this.getElement() + ? this.getElement().width || 0 + : 0); + + this.height = 'height' in options + ? options.height + : (this.getElement() + ? this.getElement().height || 0 + : 0); + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity of this instance + */ + complexity: function() { + return 1; + } + }); + + /** + * Default CSS class name for canvas + * @static + * @type String + * @default + */ + fabric.Image.CSS_CANVAS = 'canvas-img'; + + /** + * Alias for getSrc + * @static + */ + fabric.Image.prototype.getSvgSrc = fabric.Image.prototype.getSrc; + + /** + * Creates an instance of fabric.Image from its object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when an image instance is created + */ + fabric.Image.fromObject = function(object, callback) { + fabric.util.loadImage(object.src, function(img) { + fabric.Image.prototype._initFilters.call(object, object, function(filters) { + object.filters = filters || [ ]; + var instance = new fabric.Image(img, object); + callback && callback(instance); + }); + }, null, object.crossOrigin); + }; + + /** + * Creates an instance of fabric.Image from an URL string + * @static + * @param {String} url URL to create an image from + * @param {Function} [callback] Callback to invoke when image is created (newly created image is passed as a first argument) + * @param {Object} [imgOptions] Options object + */ + fabric.Image.fromURL = function(url, callback, imgOptions) { + fabric.util.loadImage(url, function(img) { + callback && callback(new fabric.Image(img, imgOptions)); + }, null, imgOptions && imgOptions.crossOrigin); + }; + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Image.fromElement}) + * @static + * @see {@link http://www.w3.org/TR/SVG/struct.html#ImageElement} + */ + fabric.Image.ATTRIBUTE_NAMES = + fabric.SHARED_ATTRIBUTES.concat('x y width height preserveAspectRatio xlink:href'.split(' ')); + + /** + * Returns {@link fabric.Image} instance from an SVG element + * @static + * @param {SVGElement} element Element to parse + * @param {Function} callback Callback to execute when fabric.Image object is created + * @param {Object} [options] Options object + * @return {fabric.Image} Instance of fabric.Image + */ + fabric.Image.fromElement = function(element, callback, options) { + var parsedAttributes = fabric.parseAttributes(element, fabric.Image.ATTRIBUTE_NAMES), + align = 'xMidYMid', meetOrSlice = 'meet', alignX, alignY, aspectRatioAttrs; + + if (parsedAttributes.preserveAspectRatio) { + aspectRatioAttrs = parsedAttributes.preserveAspectRatio.split(' '); + } + + if (aspectRatioAttrs && aspectRatioAttrs.length) { + meetOrSlice = aspectRatioAttrs.pop(); + if (meetOrSlice !== 'meet' && meetOrSlice !== 'slice') { + align = meetOrSlice; + meetOrSlice = 'meet'; + } + else if (aspectRatioAttrs.length) { + align = aspectRatioAttrs.pop(); + } + } + //divide align in alignX and alignY + alignX = align !== 'none' ? align.slice(1, 4) : 'none'; + alignY = align !== 'none' ? align.slice(5, 8) : 'none'; + parsedAttributes.alignX = alignX; + parsedAttributes.alignY = alignY; + parsedAttributes.meetOrSlice = meetOrSlice; + fabric.Image.fromURL(parsedAttributes['xlink:href'], callback, + extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes)); + }; + /* _FROM_SVG_END_ */ + + /** + * Indicates that instances of this type are async + * @static + * @type Boolean + * @default + */ + fabric.Image.async = true; + + /** + * Indicates compression level used when generating PNG under Node (in applyFilters). Any of 0-9 + * @static + * @type Number + * @default + */ + fabric.Image.pngCompression = 1; + +})(typeof exports !== 'undefined' ? exports : this); + + +fabric.util.object.extend(fabric.Object.prototype, /** @lends fabric.Object.prototype */ { + + /** + * @private + * @return {Number} angle value + */ + _getAngleValueForStraighten: function() { + var angle = this.getAngle() % 360; + if (angle > 0) { + return Math.round((angle - 1) / 90) * 90; + } + return Math.round(angle / 90) * 90; + }, + + /** + * Straightens an object (rotating it from current angle to one of 0, 90, 180, 270, etc. depending on which is closer) + * @return {fabric.Object} thisArg + * @chainable + */ + straighten: function() { + this.setAngle(this._getAngleValueForStraighten()); + return this; + }, + + /** + * Same as {@link fabric.Object.prototype.straighten} but with animation + * @param {Object} callbacks Object with callback functions + * @param {Function} [callbacks.onComplete] Invoked on completion + * @param {Function} [callbacks.onChange] Invoked on every step of animation + * @return {fabric.Object} thisArg + * @chainable + */ + fxStraighten: function(callbacks) { + callbacks = callbacks || { }; + + var empty = function() { }, + onComplete = callbacks.onComplete || empty, + onChange = callbacks.onChange || empty, + _this = this; + + fabric.util.animate({ + startValue: this.get('angle'), + endValue: this._getAngleValueForStraighten(), + duration: this.FX_DURATION, + onChange: function(value) { + _this.setAngle(value); + onChange(); + }, + onComplete: function() { + _this.setCoords(); + onComplete(); + }, + onStart: function() { + _this.set('active', false); + } + }); + + return this; + } +}); + +fabric.util.object.extend(fabric.StaticCanvas.prototype, /** @lends fabric.StaticCanvas.prototype */ { + + /** + * Straightens object, then rerenders canvas + * @param {fabric.Object} object Object to straighten + * @return {fabric.Canvas} thisArg + * @chainable + */ + straightenObject: function (object) { + object.straighten(); + this.renderAll(); + return this; + }, + + /** + * Same as {@link fabric.Canvas.prototype.straightenObject}, but animated + * @param {fabric.Object} object Object to straighten + * @return {fabric.Canvas} thisArg + * @chainable + */ + fxStraightenObject: function (object) { + object.fxStraighten({ + onChange: this.renderAll.bind(this) + }); + return this; + } +}); + + +/** + * @namespace fabric.Image.filters + * @memberOf fabric.Image + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2/#image_filters} + * @see {@link http://fabricjs.com/image-filters/|ImageFilters demo} + */ +fabric.Image.filters = fabric.Image.filters || { }; + +/** + * Root filter class from which all filter classes inherit from + * @class fabric.Image.filters.BaseFilter + * @memberOf fabric.Image.filters + */ +fabric.Image.filters.BaseFilter = fabric.util.createClass(/** @lends fabric.Image.filters.BaseFilter.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'BaseFilter', + + /** + * Constructor + * @param {Object} [options] Options object + */ + initialize: function(options) { + if (options) { + this.setOptions(options); + } + }, + + /** + * Sets filter's properties from options + * @param {Object} [options] Options object + */ + setOptions: function(options) { + for (var prop in options) { + this[prop] = options[prop]; + } + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return { type: this.type }; + }, + + /** + * Returns a JSON representation of an instance + * @return {Object} JSON + */ + toJSON: function() { + // delegate, not alias + return this.toObject(); + } +}); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend; + + /** + * Brightness filter class + * @class fabric.Image.filters.Brightness + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Brightness#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters/|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Brightness({ + * brightness: 200 + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + fabric.Image.filters.Brightness = fabric.util.createClass(fabric.Image.filters.BaseFilter, /** @lends fabric.Image.filters.Brightness.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Brightness', + + /** + * Constructor + * @memberOf fabric.Image.filters.Brightness.prototype + * @param {Object} [options] Options object + * @param {Number} [options.brightness=0] Value to brighten the image up (0..255) + */ + initialize: function(options) { + options = options || { }; + this.brightness = options.brightness || 0; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + brightness = this.brightness; + + for (var i = 0, len = data.length; i < len; i += 4) { + data[i] += brightness; + data[i + 1] += brightness; + data[i + 2] += brightness; + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + brightness: this.brightness + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.Brightness} Instance of fabric.Image.filters.Brightness + */ + fabric.Image.filters.Brightness.fromObject = function(object) { + return new fabric.Image.filters.Brightness(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend; + + /** + * Adapted from html5rocks article + * @class fabric.Image.filters.Convolute + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Convolute#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters/|ImageFilters demo} + * @example Sharpen filter + * var filter = new fabric.Image.filters.Convolute({ + * matrix: [ 0, -1, 0, + * -1, 5, -1, + * 0, -1, 0 ] + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + * @example Blur filter + * var filter = new fabric.Image.filters.Convolute({ + * matrix: [ 1/9, 1/9, 1/9, + * 1/9, 1/9, 1/9, + * 1/9, 1/9, 1/9 ] + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + * @example Emboss filter + * var filter = new fabric.Image.filters.Convolute({ + * matrix: [ 1, 1, 1, + * 1, 0.7, -1, + * -1, -1, -1 ] + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + * @example Emboss filter with opaqueness + * var filter = new fabric.Image.filters.Convolute({ + * opaque: true, + * matrix: [ 1, 1, 1, + * 1, 0.7, -1, + * -1, -1, -1 ] + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + fabric.Image.filters.Convolute = fabric.util.createClass(fabric.Image.filters.BaseFilter, /** @lends fabric.Image.filters.Convolute.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Convolute', + + /** + * Constructor + * @memberOf fabric.Image.filters.Convolute.prototype + * @param {Object} [options] Options object + * @param {Boolean} [options.opaque=false] Opaque value (true/false) + * @param {Array} [options.matrix] Filter matrix + */ + initialize: function(options) { + options = options || { }; + + this.opaque = options.opaque; + this.matrix = options.matrix || [ + 0, 0, 0, + 0, 1, 0, + 0, 0, 0 + ]; + + var canvasEl = fabric.util.createCanvasElement(); + this.tmpCtx = canvasEl.getContext('2d'); + }, + + /** + * @private + */ + _createImageData: function(w, h) { + return this.tmpCtx.createImageData(w, h); + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + + var weights = this.matrix, + context = canvasEl.getContext('2d'), + pixels = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + + side = Math.round(Math.sqrt(weights.length)), + halfSide = Math.floor(side/2), + src = pixels.data, + sw = pixels.width, + sh = pixels.height, + + // pad output by the convolution matrix + w = sw, + h = sh, + output = this._createImageData(w, h), + + dst = output.data, + + // go through the destination image pixels + alphaFac = this.opaque ? 1 : 0; + + for (var y = 0; y < h; y++) { + for (var x = 0; x < w; x++) { + var sy = y, + sx = x, + dstOff = (y * w + x) * 4, + // calculate the weighed sum of the source image pixels that + // fall under the convolution matrix + r = 0, g = 0, b = 0, a = 0; + + for (var cy = 0; cy < side; cy++) { + for (var cx = 0; cx < side; cx++) { + + var scy = sy + cy - halfSide, + scx = sx + cx - halfSide; + + /* jshint maxdepth:5 */ + if (scy < 0 || scy > sh || scx < 0 || scx > sw) { + continue; + } + + var srcOff = (scy * sw + scx) * 4, + wt = weights[cy * side + cx]; + + r += src[srcOff] * wt; + g += src[srcOff + 1] * wt; + b += src[srcOff + 2] * wt; + a += src[srcOff + 3] * wt; + } + } + dst[dstOff] = r; + dst[dstOff + 1] = g; + dst[dstOff + 2] = b; + dst[dstOff + 3] = a + alphaFac * (255 - a); + } + } + + context.putImageData(output, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + opaque: this.opaque, + matrix: this.matrix + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.Convolute} Instance of fabric.Image.filters.Convolute + */ + fabric.Image.filters.Convolute.fromObject = function(object) { + return new fabric.Image.filters.Convolute(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend; + + /** + * GradientTransparency filter class + * @class fabric.Image.filters.GradientTransparency + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.GradientTransparency#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters/|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.GradientTransparency({ + * threshold: 200 + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + fabric.Image.filters.GradientTransparency = fabric.util.createClass(fabric.Image.filters.BaseFilter, /** @lends fabric.Image.filters.GradientTransparency.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'GradientTransparency', + + /** + * Constructor + * @memberOf fabric.Image.filters.GradientTransparency.prototype + * @param {Object} [options] Options object + * @param {Number} [options.threshold=100] Threshold value + */ + initialize: function(options) { + options = options || { }; + this.threshold = options.threshold || 100; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + threshold = this.threshold, + total = data.length; + + for (var i = 0, len = data.length; i < len; i += 4) { + data[i + 3] = threshold + 255 * (total - i) / total; + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + threshold: this.threshold + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.GradientTransparency} Instance of fabric.Image.filters.GradientTransparency + */ + fabric.Image.filters.GradientTransparency.fromObject = function(object) { + return new fabric.Image.filters.GradientTransparency(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + /** + * Grayscale image filter class + * @class fabric.Image.filters.Grayscale + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters/|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Grayscale(); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + fabric.Image.filters.Grayscale = fabric.util.createClass(fabric.Image.filters.BaseFilter, /** @lends fabric.Image.filters.Grayscale.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Grayscale', + + /** + * Applies filter to canvas element + * @memberOf fabric.Image.filters.Grayscale.prototype + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + len = imageData.width * imageData.height * 4, + index = 0, + average; + + while (index < len) { + average = (data[index] + data[index + 1] + data[index + 2]) / 3; + data[index] = average; + data[index + 1] = average; + data[index + 2] = average; + index += 4; + } + + context.putImageData(imageData, 0, 0); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @return {fabric.Image.filters.Grayscale} Instance of fabric.Image.filters.Grayscale + */ + fabric.Image.filters.Grayscale.fromObject = function() { + return new fabric.Image.filters.Grayscale(); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + /** + * Invert filter class + * @class fabric.Image.filters.Invert + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters/|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Invert(); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + fabric.Image.filters.Invert = fabric.util.createClass(fabric.Image.filters.BaseFilter, /** @lends fabric.Image.filters.Invert.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Invert', + + /** + * Applies filter to canvas element + * @memberOf fabric.Image.filters.Invert.prototype + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + iLen = data.length, i; + + for (i = 0; i < iLen; i+=4) { + data[i] = 255 - data[i]; + data[i + 1] = 255 - data[i + 1]; + data[i + 2] = 255 - data[i + 2]; + } + + context.putImageData(imageData, 0, 0); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @return {fabric.Image.filters.Invert} Instance of fabric.Image.filters.Invert + */ + fabric.Image.filters.Invert.fromObject = function() { + return new fabric.Image.filters.Invert(); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend; + + /** + * Mask filter class + * See http://resources.aleph-1.com/mask/ + * @class fabric.Image.filters.Mask + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Mask#initialize} for constructor definition + */ + fabric.Image.filters.Mask = fabric.util.createClass(fabric.Image.filters.BaseFilter, /** @lends fabric.Image.filters.Mask.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Mask', + + /** + * Constructor + * @memberOf fabric.Image.filters.Mask.prototype + * @param {Object} [options] Options object + * @param {fabric.Image} [options.mask] Mask image object + * @param {Number} [options.channel=0] Rgb channel (0, 1, 2 or 3) + */ + initialize: function(options) { + options = options || { }; + + this.mask = options.mask; + this.channel = [ 0, 1, 2, 3 ].indexOf(options.channel) > -1 ? options.channel : 0; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + if (!this.mask) { + return; + } + + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + maskEl = this.mask.getElement(), + maskCanvasEl = fabric.util.createCanvasElement(), + channel = this.channel, + i, + iLen = imageData.width * imageData.height * 4; + + maskCanvasEl.width = maskEl.width; + maskCanvasEl.height = maskEl.height; + + maskCanvasEl.getContext('2d').drawImage(maskEl, 0, 0, maskEl.width, maskEl.height); + + var maskImageData = maskCanvasEl.getContext('2d').getImageData(0, 0, maskEl.width, maskEl.height), + maskData = maskImageData.data; + + for (i = 0; i < iLen; i += 4) { + data[i + 3] = maskData[i + channel]; + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + mask: this.mask.toObject(), + channel: this.channel + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @param {Function} [callback] Callback to invoke when a mask filter instance is created + */ + fabric.Image.filters.Mask.fromObject = function(object, callback) { + fabric.util.loadImage(object.mask.src, function(img) { + object.mask = new fabric.Image(img, object.mask); + callback && callback(new fabric.Image.filters.Mask(object)); + }); + }; + + /** + * Indicates that instances of this type are async + * @static + * @type Boolean + * @default + */ + fabric.Image.filters.Mask.async = true; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend; + + /** + * Noise filter class + * @class fabric.Image.filters.Noise + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Noise#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters/|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Noise({ + * noise: 700 + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + fabric.Image.filters.Noise = fabric.util.createClass(fabric.Image.filters.BaseFilter, /** @lends fabric.Image.filters.Noise.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Noise', + + /** + * Constructor + * @memberOf fabric.Image.filters.Noise.prototype + * @param {Object} [options] Options object + * @param {Number} [options.noise=0] Noise value + */ + initialize: function(options) { + options = options || { }; + this.noise = options.noise || 0; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + noise = this.noise, rand; + + for (var i = 0, len = data.length; i < len; i += 4) { + + rand = (0.5 - Math.random()) * noise; + + data[i] += rand; + data[i + 1] += rand; + data[i + 2] += rand; + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + noise: this.noise + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.Noise} Instance of fabric.Image.filters.Noise + */ + fabric.Image.filters.Noise.fromObject = function(object) { + return new fabric.Image.filters.Noise(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend; + + /** + * Pixelate filter class + * @class fabric.Image.filters.Pixelate + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Pixelate#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters/|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Pixelate({ + * blocksize: 8 + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + fabric.Image.filters.Pixelate = fabric.util.createClass(fabric.Image.filters.BaseFilter, /** @lends fabric.Image.filters.Pixelate.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Pixelate', + + /** + * Constructor + * @memberOf fabric.Image.filters.Pixelate.prototype + * @param {Object} [options] Options object + * @param {Number} [options.blocksize=4] Blocksize for pixelate + */ + initialize: function(options) { + options = options || { }; + this.blocksize = options.blocksize || 4; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + iLen = imageData.height, + jLen = imageData.width, + index, i, j, r, g, b, a; + + for (i = 0; i < iLen; i += this.blocksize) { + for (j = 0; j < jLen; j += this.blocksize) { + + index = (i * 4) * jLen + (j * 4); + + r = data[index]; + g = data[index + 1]; + b = data[index + 2]; + a = data[index + 3]; + + /* + blocksize: 4 + + [1,x,x,x,1] + [x,x,x,x,1] + [x,x,x,x,1] + [x,x,x,x,1] + [1,1,1,1,1] + */ + + for (var _i = i, _ilen = i + this.blocksize; _i < _ilen; _i++) { + for (var _j = j, _jlen = j + this.blocksize; _j < _jlen; _j++) { + index = (_i * 4) * jLen + (_j * 4); + data[index] = r; + data[index + 1] = g; + data[index + 2] = b; + data[index + 3] = a; + } + } + } + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + blocksize: this.blocksize + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.Pixelate} Instance of fabric.Image.filters.Pixelate + */ + fabric.Image.filters.Pixelate.fromObject = function(object) { + return new fabric.Image.filters.Pixelate(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend; + + /** + * Remove white filter class + * @class fabric.Image.filters.RemoveWhite + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.RemoveWhite#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters/|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.RemoveWhite({ + * threshold: 40, + * distance: 140 + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + fabric.Image.filters.RemoveWhite = fabric.util.createClass(fabric.Image.filters.BaseFilter, /** @lends fabric.Image.filters.RemoveWhite.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'RemoveWhite', + + /** + * Constructor + * @memberOf fabric.Image.filters.RemoveWhite.prototype + * @param {Object} [options] Options object + * @param {Number} [options.threshold=30] Threshold value + * @param {Number} [options.distance=20] Distance value + */ + initialize: function(options) { + options = options || { }; + this.threshold = options.threshold || 30; + this.distance = options.distance || 20; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + threshold = this.threshold, + distance = this.distance, + limit = 255 - threshold, + abs = Math.abs, + r, g, b; + + for (var i = 0, len = data.length; i < len; i += 4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + + if (r > limit && + g > limit && + b > limit && + abs(r - g) < distance && + abs(r - b) < distance && + abs(g - b) < distance + ) { + data[i + 3] = 1; + } + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + threshold: this.threshold, + distance: this.distance + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.RemoveWhite} Instance of fabric.Image.filters.RemoveWhite + */ + fabric.Image.filters.RemoveWhite.fromObject = function(object) { + return new fabric.Image.filters.RemoveWhite(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + /** + * Sepia filter class + * @class fabric.Image.filters.Sepia + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters/|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Sepia(); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + fabric.Image.filters.Sepia = fabric.util.createClass(fabric.Image.filters.BaseFilter, /** @lends fabric.Image.filters.Sepia.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Sepia', + + /** + * Applies filter to canvas element + * @memberOf fabric.Image.filters.Sepia.prototype + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + iLen = data.length, i, avg; + + for (i = 0; i < iLen; i+=4) { + avg = 0.3 * data[i] + 0.59 * data[i + 1] + 0.11 * data[i + 2]; + data[i] = avg + 100; + data[i + 1] = avg + 50; + data[i + 2] = avg + 255; + } + + context.putImageData(imageData, 0, 0); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @return {fabric.Image.filters.Sepia} Instance of fabric.Image.filters.Sepia + */ + fabric.Image.filters.Sepia.fromObject = function() { + return new fabric.Image.filters.Sepia(); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }); + + /** + * Sepia2 filter class + * @class fabric.Image.filters.Sepia2 + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters/|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Sepia2(); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + fabric.Image.filters.Sepia2 = fabric.util.createClass(fabric.Image.filters.BaseFilter, /** @lends fabric.Image.filters.Sepia2.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Sepia2', + + /** + * Applies filter to canvas element + * @memberOf fabric.Image.filters.Sepia.prototype + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + iLen = data.length, i, r, g, b; + + for (i = 0; i < iLen; i+=4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + + data[i] = (r * 0.393 + g * 0.769 + b * 0.189 ) / 1.351; + data[i + 1] = (r * 0.349 + g * 0.686 + b * 0.168 ) / 1.203; + data[i + 2] = (r * 0.272 + g * 0.534 + b * 0.131 ) / 2.140; + } + + context.putImageData(imageData, 0, 0); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @return {fabric.Image.filters.Sepia2} Instance of fabric.Image.filters.Sepia2 + */ + fabric.Image.filters.Sepia2.fromObject = function() { + return new fabric.Image.filters.Sepia2(); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend; + + /** + * Tint filter class + * Adapted from https://github.com/mezzoblue/PaintbrushJS + * @class fabric.Image.filters.Tint + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link fabric.Image.filters.Tint#initialize} for constructor definition + * @see {@link http://fabricjs.com/image-filters/|ImageFilters demo} + * @example Tint filter with hex color and opacity + * var filter = new fabric.Image.filters.Tint({ + * color: '#3513B0', + * opacity: 0.5 + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + * @example Tint filter with rgba color + * var filter = new fabric.Image.filters.Tint({ + * color: 'rgba(53, 21, 176, 0.5)' + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + fabric.Image.filters.Tint = fabric.util.createClass(fabric.Image.filters.BaseFilter, /** @lends fabric.Image.filters.Tint.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Tint', + + /** + * Constructor + * @memberOf fabric.Image.filters.Tint.prototype + * @param {Object} [options] Options object + * @param {String} [options.color=#000000] Color to tint the image with + * @param {Number} [options.opacity] Opacity value that controls the tint effect's transparency (0..1) + */ + initialize: function(options) { + options = options || { }; + + this.color = options.color || '#000000'; + this.opacity = typeof options.opacity !== 'undefined' + ? options.opacity + : new fabric.Color(this.color).getAlpha(); + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + iLen = data.length, i, + tintR, tintG, tintB, + r, g, b, alpha1, + source; + + source = new fabric.Color(this.color).getSource(); + + tintR = source[0] * this.opacity; + tintG = source[1] * this.opacity; + tintB = source[2] * this.opacity; + + alpha1 = 1 - this.opacity; + + for (i = 0; i < iLen; i+=4) { + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + + // alpha compositing + data[i] = tintR + r * alpha1; + data[i + 1] = tintG + g * alpha1; + data[i + 2] = tintB + b * alpha1; + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + color: this.color, + opacity: this.opacity + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.Tint} Instance of fabric.Image.filters.Tint + */ + fabric.Image.filters.Tint.fromObject = function(object) { + return new fabric.Image.filters.Tint(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend; + + /** + * Multiply filter class + * Adapted from http://www.laurenscorijn.com/articles/colormath-basics + * @class fabric.Image.filters.Multiply + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @example Multiply filter with hex color + * var filter = new fabric.Image.filters.Multiply({ + * color: '#F0F' + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + * @example Multiply filter with rgb color + * var filter = new fabric.Image.filters.Multiply({ + * color: 'rgb(53, 21, 176)' + * }); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + fabric.Image.filters.Multiply = fabric.util.createClass(fabric.Image.filters.BaseFilter, /** @lends fabric.Image.filters.Multiply.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Multiply', + + /** + * Constructor + * @memberOf fabric.Image.filters.Multiply.prototype + * @param {Object} [options] Options object + * @param {String} [options.color=#000000] Color to multiply the image pixels with + */ + initialize: function(options) { + options = options || { }; + + this.color = options.color || '#000000'; + }, + + /** + * Applies filter to canvas element + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + iLen = data.length, i, + source; + + source = new fabric.Color(this.color).getSource(); + + for (i = 0; i < iLen; i+=4) { + data[i] *= source[0] / 255; + data[i + 1] *= source[1] / 255; + data[i + 2] *= source[2] / 255; + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return extend(this.callSuper('toObject'), { + color: this.color + }); + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @param {Object} object Object to create an instance from + * @return {fabric.Image.filters.Multiply} Instance of fabric.Image.filters.Multiply + */ + fabric.Image.filters.Multiply.fromObject = function(object) { + return new fabric.Image.filters.Multiply(object); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + 'use strict'; + + var fabric = global.fabric; + + /** + * Color Blend filter class + * @class fabric.Image.filter.Blend + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @example + * var filter = new fabric.Image.filters.Blend({ + * color: '#000', + * mode: 'multiply' + * }); + * + * var filter = new fabric.Image.filters.Blend({ + * image: fabricImageObject, + * mode: 'multiply', + * alpha: 0.5 + * }); + + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + fabric.Image.filters.Blend = fabric.util.createClass({ + type: 'Blend', + + initialize: function(options) { + options = options || {}; + this.color = options.color || '#000'; + this.image = options.image || false; + this.mode = options.mode || 'multiply'; + this.alpha = options.alpha || 1; + }, + + applyTo: function(canvasEl) { + var context = canvasEl.getContext('2d'), + imageData = context.getImageData(0, 0, canvasEl.width, canvasEl.height), + data = imageData.data, + tr, tg, tb, + r, g, b, + _r, _g, _b, + source, + isImage = false; + + if (this.image) { + // Blend images + isImage = true; + + var _el = fabric.util.createCanvasElement(); + _el.width = this.image.width; + _el.height = this.image.height; + + var tmpCanvas = new fabric.StaticCanvas(_el); + tmpCanvas.add(this.image); + var context2 = tmpCanvas.getContext('2d'); + source = context2.getImageData(0, 0, tmpCanvas.width, tmpCanvas.height).data; + } + else { + // Blend color + source = new fabric.Color(this.color).getSource(); + + tr = source[0] * this.alpha; + tg = source[1] * this.alpha; + tb = source[2] * this.alpha; + } + + for (var i = 0, len = data.length; i < len; i += 4) { + + r = data[i]; + g = data[i + 1]; + b = data[i + 2]; + + if (isImage) { + tr = source[i] * this.alpha; + tg = source[i + 1] * this.alpha; + tb = source[i + 2] * this.alpha; + } + + switch (this.mode) { + case 'multiply': + data[i] = r * tr / 255; + data[i + 1] = g * tg / 255; + data[i + 2] = b * tb / 255; + break; + case 'screen': + data[i] = 1 - (1 - r) * (1 - tr); + data[i + 1] = 1 - (1 - g) * (1 - tg); + data[i + 2] = 1 - (1 - b) * (1 - tb); + break; + case 'add': + data[i] = Math.min(255, r + tr); + data[i + 1] = Math.min(255, g + tg); + data[i + 2] = Math.min(255, b + tb); + break; + case 'diff': + case 'difference': + data[i] = Math.abs(r - tr); + data[i + 1] = Math.abs(g - tg); + data[i + 2] = Math.abs(b - tb); + break; + case 'subtract': + _r = r - tr; + _g = g - tg; + _b = b - tb; + + data[i] = (_r < 0) ? 0 : _r; + data[i + 1] = (_g < 0) ? 0 : _g; + data[i + 2] = (_b < 0) ? 0 : _b; + break; + case 'darken': + data[i] = Math.min(r, tr); + data[i + 1] = Math.min(g, tg); + data[i + 2] = Math.min(b, tb); + break; + case 'lighten': + data[i] = Math.max(r, tr); + data[i + 1] = Math.max(g, tg); + data[i + 2] = Math.max(b, tb); + break; + } + } + + context.putImageData(imageData, 0, 0); + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return { + color: this.color, + image: this.image, + mode: this.mode, + alpha: this.alpha + }; + } + }); + + fabric.Image.filters.Blend.fromObject = function(object) { + return new fabric.Image.filters.Blend(object); + }; +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), pow = Math.pow, floor = Math.floor, + sqrt = Math.sqrt, abs = Math.abs, max = Math.max, round = Math.round, sin = Math.sin, + ceil = Math.ceil; + + /** + * Resize image filter class + * @class fabric.Image.filters.Resize + * @memberOf fabric.Image.filters + * @extends fabric.Image.filters.BaseFilter + * @see {@link http://fabricjs.com/image-filters/|ImageFilters demo} + * @example + * var filter = new fabric.Image.filters.Resize(); + * object.filters.push(filter); + * object.applyFilters(canvas.renderAll.bind(canvas)); + */ + fabric.Image.filters.Resize = fabric.util.createClass(fabric.Image.filters.BaseFilter, /** @lends fabric.Image.filters.Resize.prototype */ { + + /** + * Filter type + * @param {String} type + * @default + */ + type: 'Resize', + + /** + * Resize type + * @param {String} resizeType + * @default + */ + resizeType: 'hermite', + + /** + * Scale factor for resizing, x axis + * @param {Number} scaleX + * @default + */ + scaleX: 0, + + /** + * Scale factor for resizing, y axis + * @param {Number} scaleY + * @default + */ + scaleY: 0, + + /** + * LanczosLobes parameter for lanczos filter + * @param {Number} lanczosLobes + * @default + */ + lanczosLobes: 3, + + /** + * Applies filter to canvas element + * @memberOf fabric.Image.filters.Resize.prototype + * @param {Object} canvasEl Canvas element to apply filter to + */ + applyTo: function(canvasEl, scaleX, scaleY) { + + this.rcpScaleX = 1 / scaleX; + this.rcpScaleY = 1 / scaleY; + + var oW = canvasEl.width, oH = canvasEl.height, + dW = round(oW * scaleX), dH = round(oH * scaleY), + imageData; + + if (this.resizeType === 'sliceHack') { + imageData = this.sliceByTwo(canvasEl, oW, oH, dW, dH); + } + if (this.resizeType === 'hermite') { + imageData = this.hermiteFastResize(canvasEl, oW, oH, dW, dH); + } + if (this.resizeType === 'bilinear') { + imageData = this.bilinearFiltering(canvasEl, oW, oH, dW, dH); + } + if (this.resizeType === 'lanczos') { + imageData = this.lanczosResize(canvasEl, oW, oH, dW, dH); + } + canvasEl.width = dW; + canvasEl.height = dH; + canvasEl.getContext('2d').putImageData(imageData, 0, 0); + }, + + sliceByTwo: function(canvasEl, width, height, newWidth, newHeight) { + var context = canvasEl.getContext('2d'), imageData, + multW = 0.5, multH = 0.5, signW = 1, signH = 1, + doneW = false, doneH = false, stepW = width, stepH = height, + tmpCanvas = fabric.util.createCanvasElement(), + tmpCtx = tmpCanvas.getContext('2d'); + newWidth = floor(newWidth); + newHeight = floor(newHeight); + tmpCanvas.width = max(newWidth, width); + tmpCanvas.height = max(newHeight, height); + + if (newWidth > width) { + multW = 2; + signW = -1; + } + if (newHeight > height) { + multH = 2; + signH = -1; + } + imageData = context.getImageData(0, 0, width, height); + canvasEl.width = max(newWidth, width); + canvasEl.height = max(newHeight, height); + context.putImageData(imageData, 0, 0); + + while (!doneW || !doneH) { + width = stepW; + height = stepH; + if (newWidth * signW < floor(stepW * multW * signW)) { + stepW = floor(stepW * multW); + } + else { + stepW = newWidth; + doneW = true; + } + if (newHeight * signH < floor(stepH * multH * signH)) { + stepH = floor(stepH * multH); + } + else { + stepH = newHeight; + doneH = true; + } + imageData = context.getImageData(0, 0, width, height); + tmpCtx.putImageData(imageData, 0, 0); + context.clearRect(0, 0, stepW, stepH); + context.drawImage(tmpCanvas, 0, 0, width, height, 0, 0, stepW, stepH); + } + return context.getImageData(0, 0, newWidth, newHeight); + }, + + lanczosResize: function(canvasEl, oW, oH, dW, dH) { + + function lanczosCreate(lobes) { + return function(x) { + if (x > lobes) { + return 0; + } + x *= Math.PI; + if (abs(x) < 1e-16) { + return 1; + } + var xx = x / lobes; + return sin(x) * sin(xx) / x / xx; + }; + } + + function process(u) { + var v, i, weight, idx, a, red, green, + blue, alpha, fX, fY; + center.x = (u + 0.5) * ratioX; + icenter.x = floor(center.x); + for (v = 0; v < dH; v++) { + center.y = (v + 0.5) * ratioY; + icenter.y = floor(center.y); + a = 0, red = 0, green = 0, blue = 0, alpha = 0; + for (i = icenter.x - range2X; i <= icenter.x + range2X; i++) { + if (i < 0 || i >= oW) { + continue; + } + fX = floor(1000 * abs(i - center.x)); + if (!cacheLanc[fX]) { + cacheLanc[fX] = { }; + } + for (var j = icenter.y - range2Y; j <= icenter.y + range2Y; j++) { + if (j < 0 || j >= oH) { + continue; + } + fY = floor(1000 * abs(j - center.y)); + if (!cacheLanc[fX][fY]) { + cacheLanc[fX][fY] = lanczos(sqrt(pow(fX * rcpRatioX, 2) + pow(fY * rcpRatioY, 2)) / 1000); + } + weight = cacheLanc[fX][fY]; + if (weight > 0) { + idx = (j * oW + i) * 4; + a += weight; + red += weight * srcData[idx]; + green += weight * srcData[idx + 1]; + blue += weight * srcData[idx + 2]; + alpha += weight * srcData[idx + 3]; + } + } + } + idx = (v * dW + u) * 4; + destData[idx] = red / a; + destData[idx + 1] = green / a; + destData[idx + 2] = blue / a; + destData[idx + 3] = alpha / a; + } + + if (++u < dW) { + return process(u); + } + else { + return destImg; + } + } + + var context = canvasEl.getContext('2d'), + srcImg = context.getImageData(0, 0, oW, oH), + destImg = context.getImageData(0, 0, dW, dH), + srcData = srcImg.data, destData = destImg.data, + lanczos = lanczosCreate(this.lanczosLobes), + ratioX = this.rcpScaleX, ratioY = this.rcpScaleY, + rcpRatioX = 2 / this.rcpScaleX, rcpRatioY = 2 / this.rcpScaleY, + range2X = ceil(ratioX * this.lanczosLobes / 2), + range2Y = ceil(ratioY * this.lanczosLobes / 2), + cacheLanc = { }, center = { }, icenter = { }; + + return process(0); + }, + + bilinearFiltering: function(canvasEl, w, h, w2, h2) { + var a, b, c, d, x, y, i, j, xDiff, yDiff, chnl, + color, offset = 0, origPix, ratioX = this.rcpScaleX, + ratioY = this.rcpScaleY, context = canvasEl.getContext('2d'), + w4 = 4 * (w - 1), img = context.getImageData(0, 0, w, h), + pixels = img.data, destImage = context.getImageData(0, 0, w2, h2), + destPixels = destImage.data; + for (i = 0; i < h2; i++) { + for (j = 0; j < w2; j++) { + x = floor(ratioX * j); + y = floor(ratioY * i); + xDiff = ratioX * j - x; + yDiff = ratioY * i - y; + origPix = 4 * (y * w + x); + + for (chnl = 0; chnl < 4; chnl++) { + a = pixels[origPix + chnl]; + b = pixels[origPix + 4 + chnl]; + c = pixels[origPix + w4 + chnl]; + d = pixels[origPix + w4 + 4 + chnl]; + color = a * (1 - xDiff) * (1 - yDiff) + b * xDiff * (1 - yDiff) + + c * yDiff * (1 - xDiff) + d * xDiff * yDiff; + destPixels[offset++] = color; + } + } + } + return destImage; + }, + + hermiteFastResize: function(canvasEl, oW, oH, dW, dH) { + var ratioW = this.rcpScaleX, ratioH = this.rcpScaleY, + ratioWHalf = ceil(ratioW / 2), + ratioHHalf = ceil(ratioH / 2), + context = canvasEl.getContext('2d'), + img = context.getImageData(0, 0, oW, oH), data = img.data, + img2 = context.getImageData(0, 0, dW, dH), data2 = img2.data; + for (var j = 0; j < dH; j++) { + for (var i = 0; i < dW; i++) { + var x2 = (i + j * dW) * 4, weight = 0, weights = 0, weightsAlpha = 0, + gxR = 0, gxG = 0, gxB = 0, gxA = 0, centerY = (j + 0.5) * ratioH; + for (var yy = floor(j * ratioH); yy < (j + 1) * ratioH; yy++) { + var dy = abs(centerY - (yy + 0.5)) / ratioHHalf, + centerX = (i + 0.5) * ratioW, w0 = dy * dy; + for (var xx = floor(i * ratioW); xx < (i + 1) * ratioW; xx++) { + var dx = abs(centerX - (xx + 0.5)) / ratioWHalf, + w = sqrt(w0 + dx * dx); + /*jshint maxdepth:5 */ + if (w > 1 && w < -1) { + continue; + } + //hermite filter + weight = 2 * w * w * w - 3 * w * w + 1; + if (weight > 0) { + dx = 4 * (xx + yy * oW); + //alpha + gxA += weight * data[dx + 3]; + weightsAlpha += weight; + //colors + /*jshint maxdepth:6 */ + if (data[dx + 3] < 255) { + weight = weight * data[dx + 3] / 250; + } + /*jshint maxdepth:5 */ + gxR += weight * data[dx]; + gxG += weight * data[dx + 1]; + gxB += weight * data[dx + 2]; + weights += weight; + } + /*jshint maxdepth:4 */ + } + } + data2[x2] = gxR / weights; + data2[x2 + 1] = gxG / weights; + data2[x2 + 2] = gxB / weights; + data2[x2 + 3] = gxA / weightsAlpha; + } + } + return img2; + }, + + /** + * Returns object representation of an instance + * @return {Object} Object representation of an instance + */ + toObject: function() { + return { + type: this.type, + scaleX: this.scaleX, + scaley: this.scaleY, + resizeType: this.resizeType, + lanczosLobes: this.lanczosLobes + }; + } + }); + + /** + * Returns filter instance from an object representation + * @static + * @return {fabric.Image.filters.Resize} Instance of fabric.Image.filters.Resize + */ + fabric.Image.filters.Resize.fromObject = function() { + return new fabric.Image.filters.Resize(); + }; + +})(typeof exports !== 'undefined' ? exports : this); + + +(function(global) { + + 'use strict'; + + var fabric = global.fabric || (global.fabric = { }), + extend = fabric.util.object.extend, + clone = fabric.util.object.clone, + toFixed = fabric.util.toFixed, + supportsLineDash = fabric.StaticCanvas.supports('setLineDash'); + + if (fabric.Text) { + fabric.warn('fabric.Text is already defined'); + return; + } + + var stateProperties = fabric.Object.prototype.stateProperties.concat(); + stateProperties.push( + 'fontFamily', + 'fontWeight', + 'fontSize', + 'text', + 'textDecoration', + 'textAlign', + 'fontStyle', + 'lineHeight', + 'textBackgroundColor' + ); + + /** + * Text class + * @class fabric.Text + * @extends fabric.Object + * @return {fabric.Text} thisArg + * @tutorial {@link http://fabricjs.com/fabric-intro-part-2/#text} + * @see {@link fabric.Text#initialize} for constructor definition + */ + fabric.Text = fabric.util.createClass(fabric.Object, /** @lends fabric.Text.prototype */ { + + /** + * Properties which when set cause object to change dimensions + * @type Object + * @private + */ + _dimensionAffectingProps: { + fontSize: true, + fontWeight: true, + fontFamily: true, + fontStyle: true, + lineHeight: true, + stroke: true, + strokeWidth: true, + text: true, + textAlign: true + }, + + /** + * @private + */ + _reNewline: /\r?\n/, + + /** + * Retrieves object's fontSize + * @method getFontSize + * @memberOf fabric.Text.prototype + * @return {String} Font size (in pixels) + */ + + /** + * Sets object's fontSize + * @method setFontSize + * @memberOf fabric.Text.prototype + * @param {Number} fontSize Font size (in pixels) + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's fontWeight + * @method getFontWeight + * @memberOf fabric.Text.prototype + * @return {(String|Number)} Font weight + */ + + /** + * Sets object's fontWeight + * @method setFontWeight + * @memberOf fabric.Text.prototype + * @param {(Number|String)} fontWeight Font weight + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's fontFamily + * @method getFontFamily + * @memberOf fabric.Text.prototype + * @return {String} Font family + */ + + /** + * Sets object's fontFamily + * @method setFontFamily + * @memberOf fabric.Text.prototype + * @param {String} fontFamily Font family + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's text + * @method getText + * @memberOf fabric.Text.prototype + * @return {String} text + */ + + /** + * Sets object's text + * @method setText + * @memberOf fabric.Text.prototype + * @param {String} text Text + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's textDecoration + * @method getTextDecoration + * @memberOf fabric.Text.prototype + * @return {String} Text decoration + */ + + /** + * Sets object's textDecoration + * @method setTextDecoration + * @memberOf fabric.Text.prototype + * @param {String} textDecoration Text decoration + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's fontStyle + * @method getFontStyle + * @memberOf fabric.Text.prototype + * @return {String} Font style + */ + + /** + * Sets object's fontStyle + * @method setFontStyle + * @memberOf fabric.Text.prototype + * @param {String} fontStyle Font style + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's lineHeight + * @method getLineHeight + * @memberOf fabric.Text.prototype + * @return {Number} Line height + */ + + /** + * Sets object's lineHeight + * @method setLineHeight + * @memberOf fabric.Text.prototype + * @param {Number} lineHeight Line height + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's textAlign + * @method getTextAlign + * @memberOf fabric.Text.prototype + * @return {String} Text alignment + */ + + /** + * Sets object's textAlign + * @method setTextAlign + * @memberOf fabric.Text.prototype + * @param {String} textAlign Text alignment + * @return {fabric.Text} + * @chainable + */ + + /** + * Retrieves object's textBackgroundColor + * @method getTextBackgroundColor + * @memberOf fabric.Text.prototype + * @return {String} Text background color + */ + + /** + * Sets object's textBackgroundColor + * @method setTextBackgroundColor + * @memberOf fabric.Text.prototype + * @param {String} textBackgroundColor Text background color + * @return {fabric.Text} + * @chainable + */ + + /** + * Type of an object + * @type String + * @default + */ + type: 'text', + + /** + * Font size (in pixels) + * @type Number + * @default + */ + fontSize: 40, + + /** + * Font weight (e.g. bold, normal, 400, 600, 800) + * @type {(Number|String)} + * @default + */ + fontWeight: 'normal', + + /** + * Font family + * @type String + * @default + */ + fontFamily: 'Times New Roman', + + /** + * Text decoration Possible values: "", "underline", "overline" or "line-through". + * @type String + * @default + */ + textDecoration: '', + + /** + * Text alignment. Possible values: "left", "center", or "right". + * @type String + * @default + */ + textAlign: 'left', + + /** + * Font style . Possible values: "", "normal", "italic" or "oblique". + * @type String + * @default + */ + fontStyle: '', + + /** + * Line height + * @type Number + * @default + */ + lineHeight: 1.16, + + /** + * Background color of text lines + * @type String + * @default + */ + textBackgroundColor: '', + + /** + * List of properties to consider when checking if + * state of an object is changed ({@link fabric.Object#hasStateChanged}) + * as well as for history (undo/redo) purposes + * @type Array + */ + stateProperties: stateProperties, + + /** + * When defined, an object is rendered via stroke and this property specifies its color. + * Backwards incompatibility note: This property was named "strokeStyle" until v1.1.6 + * @type String + * @default + */ + stroke: null, + + /** + * Shadow object representing shadow of this shape. + * Backwards incompatibility note: This property was named "textShadow" (String) until v1.2.11 + * @type fabric.Shadow + * @default + */ + shadow: null, + + /** + * @private + */ + _fontSizeFraction: 0.25, + + /** + * Text Line proportion to font Size (in pixels) + * @type Number + * @default + */ + _fontSizeMult: 1.13, + + /** + * Constructor + * @param {String} text Text string + * @param {Object} [options] Options object + * @return {fabric.Text} thisArg + */ + initialize: function(text, options) { + options = options || { }; + this.text = text; + this.__skipDimension = true; + this.setOptions(options); + this.__skipDimension = false; + this._initDimensions(); + }, + + /** + * Renders text object on offscreen canvas, so that it would get dimensions + * @private + */ + _initDimensions: function(ctx) { + if (this.__skipDimension) { + return; + } + if (!ctx) { + ctx = fabric.util.createCanvasElement().getContext('2d'); + this._setTextStyles(ctx); + } + this._textLines = this.text.split(this._reNewline); + this._clearCache(); + var currentTextAlign = this.textAlign; + this.textAlign = 'left'; + this.width = this._getTextWidth(ctx); + this.textAlign = currentTextAlign; + this.height = this._getTextHeight(ctx); + }, + + /** + * Returns string representation of an instance + * @return {String} String representation of text object + */ + toString: function() { + return '#'; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + + this.clipTo && fabric.util.clipContext(this, ctx); + + this._renderTextBackground(ctx); + this._renderText(ctx); + + this._renderTextDecoration(ctx); + this.clipTo && ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderText: function(ctx) { + ctx.save(); + this._translateForTextAlign(ctx); + this._setOpacity(ctx); + this._setShadow(ctx); + this._setupCompositeOperation(ctx); + this._renderTextFill(ctx); + this._renderTextStroke(ctx); + this._restoreCompositeOperation(ctx); + this._removeShadow(ctx); + ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _translateForTextAlign: function(ctx) { + if (this.textAlign !== 'left' && this.textAlign !== 'justify') { + ctx.translate(this.textAlign === 'center' ? (this.width / 2) : this.width, 0); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _setTextStyles: function(ctx) { + ctx.textBaseline = 'alphabetic'; + if (!this.skipTextAlign) { + ctx.textAlign = this.textAlign; + } + ctx.font = this._getFontDeclaration(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @return {Number} Height of fabric.Text object + */ + _getTextHeight: function() { + return this._textLines.length * this._getHeightOfLine(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @return {Number} Maximum width of fabric.Text object + */ + _getTextWidth: function(ctx) { + var maxWidth = this._getLineWidth(ctx, 0); + + for (var i = 1, len = this._textLines.length; i < len; i++) { + var currentLineWidth = this._getLineWidth(ctx, i); + if (currentLineWidth > maxWidth) { + maxWidth = currentLineWidth; + } + } + return maxWidth; + }, + + /** + * @private + * @param {String} method Method name ("fillText" or "strokeText") + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} chars Chars to render + * @param {Number} left Left position of text + * @param {Number} top Top position of text + */ + _renderChars: function(method, ctx, chars, left, top) { + ctx[method](chars, left, top); + }, + + /** + * @private + * @param {String} method Method name ("fillText" or "strokeText") + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} line Text to render + * @param {Number} left Left position of text + * @param {Number} top Top position of text + * @param {Number} lineIndex Index of a line in a text + */ + _renderTextLine: function(method, ctx, line, left, top, lineIndex) { + // lift the line by quarter of fontSize + top -= this.fontSize * this._fontSizeFraction; + + // short-circuit + if (this.textAlign !== 'justify') { + this._renderChars(method, ctx, line, left, top, lineIndex); + return; + } + + var lineWidth = this._getLineWidth(ctx, lineIndex), + totalWidth = this.width; + if (totalWidth >= lineWidth) { + // stretch the line + var words = line.split(/\s+/), + wordsWidth = this._getWidthOfWords(ctx, line, lineIndex), + widthDiff = totalWidth - wordsWidth, + numSpaces = words.length - 1, + spaceWidth = widthDiff / numSpaces, + leftOffset = 0; + + for (var i = 0, len = words.length; i < len; i++) { + this._renderChars(method, ctx, words[i], left + leftOffset, top, lineIndex); + leftOffset += ctx.measureText(words[i]).width + spaceWidth; + } + } + else { + this._renderChars(method, ctx, line, left, top, lineIndex); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Number} line + */ + _getWidthOfWords: function (ctx, line) { + return ctx.measureText(line.replace(/\s+/g, '')).width; + }, + + /** + * @private + * @return {Number} Left offset + */ + _getLeftOffset: function() { + return -this.width / 2; + }, + + /** + * @private + * @return {Number} Top offset + */ + _getTopOffset: function() { + return -this.height / 2; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextFill: function(ctx) { + if (!this.fill && !this._skipFillStrokeCheck) { + return; + } + + var lineHeights = 0; + + for (var i = 0, len = this._textLines.length; i < len; i++) { + var heightOfLine = this._getHeightOfLine(ctx, i), + maxHeight = heightOfLine / this.lineHeight; + + this._renderTextLine( + 'fillText', + ctx, + this._textLines[i], + this._getLeftOffset(), + this._getTopOffset() + lineHeights + maxHeight, + i + ); + lineHeights += heightOfLine; + } + if (this.shadow && !this.shadow.affectStroke) { + this._removeShadow(ctx); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextStroke: function(ctx) { + if ((!this.stroke || this.strokeWidth === 0) && !this._skipFillStrokeCheck) { + return; + } + + var lineHeights = 0; + + ctx.save(); + + if (this.strokeDashArray) { + // Spec requires the concatenation of two copies the dash list when the number of elements is odd + if (1 & this.strokeDashArray.length) { + this.strokeDashArray.push.apply(this.strokeDashArray, this.strokeDashArray); + } + supportsLineDash && ctx.setLineDash(this.strokeDashArray); + } + + ctx.beginPath(); + for (var i = 0, len = this._textLines.length; i < len; i++) { + var heightOfLine = this._getHeightOfLine(ctx, i), + maxHeight = heightOfLine / this.lineHeight; + + this._renderTextLine( + 'strokeText', + ctx, + this._textLines[i], + this._getLeftOffset(), + this._getTopOffset() + lineHeights + maxHeight, + i + ); + lineHeights += heightOfLine; + } + ctx.closePath(); + ctx.restore(); + }, + + _getHeightOfLine: function() { + return this.fontSize * this._fontSizeMult * this.lineHeight; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Array} textLines Array of all text lines + */ + _renderTextBackground: function(ctx) { + this._renderTextBoxBackground(ctx); + this._renderTextLinesBackground(ctx); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextBoxBackground: function(ctx) { + if (!this.backgroundColor) { + return; + } + + ctx.save(); + ctx.fillStyle = this.backgroundColor; + + ctx.fillRect( + this._getLeftOffset(), + this._getTopOffset(), + this.width, + this.height + ); + + ctx.restore(); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextLinesBackground: function(ctx) { + var lineTopOffset = 0, heightOfLine = this._getHeightOfLine(); + if (!this.textBackgroundColor) { + return; + } + + ctx.save(); + ctx.fillStyle = this.textBackgroundColor; + + for (var i = 0, len = this._textLines.length; i < len; i++) { + + if (this._textLines[i] !== '') { + + var lineWidth = this._getLineWidth(ctx, i), + lineLeftOffset = this._getLineLeftOffset(lineWidth); + + ctx.fillRect( + this._getLeftOffset() + lineLeftOffset, + this._getTopOffset() + lineTopOffset, + lineWidth, + this.fontSize * this._fontSizeMult + ); + } + lineTopOffset += heightOfLine; + } + ctx.restore(); + }, + + /** + * @private + * @param {Number} lineWidth Width of text line + * @return {Number} Line left offset + */ + _getLineLeftOffset: function(lineWidth) { + if (this.textAlign === 'center') { + return (this.width - lineWidth) / 2; + } + if (this.textAlign === 'right') { + return this.width - lineWidth; + } + return 0; + }, + + /** + * @private + */ + _clearCache: function() { + this.__lineWidths = [ ]; + this.__lineHeights = [ ]; + this.__lineOffsets = [ ]; + }, + + /** + * @private + */ + _shouldClearCache: function() { + var shouldClear = false; + for (var prop in this._dimensionAffectingProps) { + if (this['__' + prop] !== this[prop]) { + this['__' + prop] = this[prop]; + shouldClear = true; + } + } + return shouldClear; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @return {Number} Line width + */ + _getLineWidth: function(ctx, lineIndex) { + if (this.__lineWidths[lineIndex]) { + return this.__lineWidths[lineIndex]; + } + this.__lineWidths[lineIndex] = ctx.measureText(this._textLines[lineIndex]).width; + return this.__lineWidths[lineIndex]; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextDecoration: function(ctx) { + if (!this.textDecoration) { + return; + } + + var halfOfVerticalBox = this.height / 2, + _this = this, offsets = []; + + /** @ignore */ + function renderLinesAtOffset(offsets) { + var i, lineHeight = 0, len, j, oLen; + for (i = 0, len = _this._textLines.length; i < len; i++) { + + var lineWidth = _this._getLineWidth(ctx, i), + lineLeftOffset = _this._getLineLeftOffset(lineWidth), + heightOfLine = _this._getHeightOfLine(ctx, i); + + for (j = 0, oLen = offsets.length; j < oLen; j++) { + ctx.fillRect( + _this._getLeftOffset() + lineLeftOffset, + lineHeight + (_this._fontSizeMult - 1 + offsets[j] ) * _this.fontSize - halfOfVerticalBox, + lineWidth, + _this.fontSize / 15); + } + lineHeight += heightOfLine; + } + } + + if (this.textDecoration.indexOf('underline') > -1) { + offsets.push(0.85); // 1 - 3/16 + } + if (this.textDecoration.indexOf('line-through') > -1) { + offsets.push(0.43); + } + if (this.textDecoration.indexOf('overline') > -1) { + offsets.push(-0.12); + } + + if (offsets.length > 0) { + renderLinesAtOffset(offsets); + } + }, + + /** + * @private + */ + _getFontDeclaration: function() { + return [ + // node-canvas needs "weight style", while browsers need "style weight" + (fabric.isLikelyNode ? this.fontWeight : this.fontStyle), + (fabric.isLikelyNode ? this.fontStyle : this.fontWeight), + this.fontSize + 'px', + (fabric.isLikelyNode ? ('"' + this.fontFamily + '"') : this.fontFamily) + ].join(' '); + }, + + /** + * Renders text instance on a specified context + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + render: function(ctx, noTransform) { + // do not render if object is not visible + if (!this.visible) { + return; + } + + ctx.save(); + this._setTextStyles(ctx); + + if (this._shouldClearCache()) { + this._initDimensions(ctx); + } + if (!noTransform) { + this.transform(ctx); + } + this._setStrokeStyles(ctx); + this._setFillStyles(ctx); + if (this.transformMatrix) { + ctx.transform.apply(ctx, this.transformMatrix); + } + if (this.group && this.group.type === 'path-group') { + ctx.translate(this.left, this.top); + } + this._render(ctx); + ctx.restore(); + }, + + /** + * Returns object representation of an instance + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} Object representation of an instance + */ + toObject: function(propertiesToInclude) { + var object = extend(this.callSuper('toObject', propertiesToInclude), { + text: this.text, + fontSize: this.fontSize, + fontWeight: this.fontWeight, + fontFamily: this.fontFamily, + fontStyle: this.fontStyle, + lineHeight: this.lineHeight, + textDecoration: this.textDecoration, + textAlign: this.textAlign, + textBackgroundColor: this.textBackgroundColor + }); + if (!this.includeDefaultValues) { + this._removeDefaultValues(object); + } + return object; + }, + + /* _TO_SVG_START_ */ + /** + * Returns SVG representation of an instance + * @param {Function} [reviver] Method for further parsing of svg representation. + * @return {String} svg representation of an instance + */ + toSVG: function(reviver) { + var markup = this._createBaseSVGMarkup(), + offsets = this._getSVGLeftTopOffsets(this.ctx), + textAndBg = this._getSVGTextAndBg(offsets.textTop, offsets.textLeft); + this._wrapSVGTextAndBg(markup, textAndBg); + + return reviver ? reviver(markup.join('')) : markup.join(''); + }, + + /** + * @private + */ + _getSVGLeftTopOffsets: function(ctx) { + var lineTop = this._getHeightOfLine(ctx, 0), + textLeft = -this.width / 2, + textTop = 0; + + return { + textLeft: textLeft + (this.group && this.group.type === 'path-group' ? this.left : 0), + textTop: textTop + (this.group && this.group.type === 'path-group' ? -this.top : 0), + lineTop: lineTop + }; + }, + + /** + * @private + */ + _wrapSVGTextAndBg: function(markup, textAndBg) { + markup.push( + '\t\n', + textAndBg.textBgRects.join(''), + '\t\t', + textAndBg.textSpans.join(''), + '\n', + '\t\n' + ); + }, + + /** + * @private + * @param {Number} textTopOffset Text top offset + * @param {Number} textLeftOffset Text left offset + * @return {Object} + */ + _getSVGTextAndBg: function(textTopOffset, textLeftOffset) { + var textSpans = [ ], + textBgRects = [ ], + height = 0; + // bounding-box background + this._setSVGBg(textBgRects); + + // text and text-background + for (var i = 0, len = this._textLines.length; i < len; i++) { + if (this.textBackgroundColor) { + this._setSVGTextLineBg(textBgRects, i, textLeftOffset, textTopOffset, height); + } + this._setSVGTextLineText(i, textSpans, height, textLeftOffset, textTopOffset, textBgRects); + height += this._getHeightOfLine(this.ctx, i); + } + + return { + textSpans: textSpans, + textBgRects: textBgRects + }; + }, + + _setSVGTextLineText: function(i, textSpans, height, textLeftOffset, textTopOffset) { + var yPos = this.fontSize * (this._fontSizeMult - this._fontSizeFraction) + - textTopOffset + height - this.height / 2; + textSpans.push( + ' elements since setting opacity + // on containing one doesn't work in Illustrator + this._getFillAttributes(this.fill), '>', + fabric.util.string.escapeXml(this._textLines[i]), + '' + ); + }, + + _setSVGTextLineBg: function(textBgRects, i, textLeftOffset, textTopOffset, height) { + textBgRects.push( + '\t\t\n'); + }, + + _setSVGBg: function(textBgRects) { + if (this.backgroundColor) { + textBgRects.push( + '\t\t\n'); + } + }, + + /** + * Adobe Illustrator (at least CS5) is unable to render rgba()-based fill values + * we work around it by "moving" alpha channel into opacity attribute and setting fill's alpha to 1 + * + * @private + * @param {Any} value + * @return {String} + */ + _getFillAttributes: function(value) { + var fillColor = (value && typeof value === 'string') ? new fabric.Color(value) : ''; + if (!fillColor || !fillColor.getSource() || fillColor.getAlpha() === 1) { + return 'fill="' + value + '"'; + } + return 'opacity="' + fillColor.getAlpha() + '" fill="' + fillColor.setAlpha(1).toRgb() + '"'; + }, + /* _TO_SVG_END_ */ + + /** + * Sets specified property to a specified value + * @param {String} key + * @param {Any} value + * @return {fabric.Text} thisArg + * @chainable + */ + _set: function(key, value) { + this.callSuper('_set', key, value); + + if (key in this._dimensionAffectingProps) { + this._initDimensions(); + this.setCoords(); + } + }, + + /** + * Returns complexity of an instance + * @return {Number} complexity + */ + complexity: function() { + return 1; + } + }); + + /* _FROM_SVG_START_ */ + /** + * List of attribute names to account for when parsing SVG element (used by {@link fabric.Text.fromElement}) + * @static + * @memberOf fabric.Text + * @see: http://www.w3.org/TR/SVG/text.html#TextElement + */ + fabric.Text.ATTRIBUTE_NAMES = fabric.SHARED_ATTRIBUTES.concat( + 'x y dx dy font-family font-style font-weight font-size text-decoration text-anchor'.split(' ')); + + /** + * Default SVG font size + * @static + * @memberOf fabric.Text + */ + fabric.Text.DEFAULT_SVG_FONT_SIZE = 16; + + /** + * Returns fabric.Text instance from an SVG element (not yet implemented) + * @static + * @memberOf fabric.Text + * @param {SVGElement} element Element to parse + * @param {Object} [options] Options object + * @return {fabric.Text} Instance of fabric.Text + */ + fabric.Text.fromElement = function(element, options) { + if (!element) { + return null; + } + + var parsedAttributes = fabric.parseAttributes(element, fabric.Text.ATTRIBUTE_NAMES); + options = fabric.util.object.extend((options ? fabric.util.object.clone(options) : { }), parsedAttributes); + + options.top = options.top || 0; + options.left = options.left || 0; + if ('dx' in parsedAttributes) { + options.left += parsedAttributes.dx; + } + if ('dy' in parsedAttributes) { + options.top += parsedAttributes.dy; + } + if (!('fontSize' in options)) { + options.fontSize = fabric.Text.DEFAULT_SVG_FONT_SIZE; + } + + if (!options.originX) { + options.originX = 'left'; + } + var textContent = element.textContent.replace(/^\s+|\s+$|\n+/g, '').replace(/\s+/g, ' '), + text = new fabric.Text(textContent, options), + /* + Adjust positioning: + x/y attributes in SVG correspond to the bottom-left corner of text bounding box + top/left properties in Fabric correspond to center point of text bounding box + */ + offX = 0; + + if (text.originX === 'left') { + offX = text.getWidth() / 2; + } + if (text.originX === 'right') { + offX = -text.getWidth() / 2; + } + text.set({ + left: text.getLeft() + offX, + top: text.getTop() - text.getHeight() / 2 + text.fontSize * (0.18 + text._fontSizeFraction) /* 0.3 is the old lineHeight */ + }); + + return text; + }; + /* _FROM_SVG_END_ */ + + /** + * Returns fabric.Text instance from an object representation + * @static + * @memberOf fabric.Text + * @param {Object} object Object to create an instance from + * @return {fabric.Text} Instance of fabric.Text + */ + fabric.Text.fromObject = function(object) { + return new fabric.Text(object.text, clone(object)); + }; + + fabric.util.createAccessors(fabric.Text); + +})(typeof exports !== 'undefined' ? exports : this); + + +(function() { + + var clone = fabric.util.object.clone; + + /** + * IText class (introduced in v1.4) Events are also fired with "text:" + * prefix when observing canvas. + * @class fabric.IText + * @extends fabric.Text + * @mixes fabric.Observable + * + * @fires changed + * @fires selection:changed + * @fires editing:entered + * @fires editing:exited + * + * @return {fabric.IText} thisArg + * @see {@link fabric.IText#initialize} for constructor definition + * + *

Supported key combinations:

+ *
+   *   Move cursor:                    left, right, up, down
+   *   Select character:               shift + left, shift + right
+   *   Select text vertically:         shift + up, shift + down
+   *   Move cursor by word:            alt + left, alt + right
+   *   Select words:                   shift + alt + left, shift + alt + right
+   *   Move cursor to line start/end:  cmd + left, cmd + right or home, end
+   *   Select till start/end of line:  cmd + shift + left, cmd + shift + right or shift + home, shift + end
+   *   Jump to start/end of text:      cmd + up, cmd + down
+   *   Select till start/end of text:  cmd + shift + up, cmd + shift + down or shift + pgUp, shift + pgDown
+   *   Delete character:               backspace
+   *   Delete word:                    alt + backspace
+   *   Delete line:                    cmd + backspace
+   *   Forward delete:                 delete
+   *   Copy text:                      ctrl/cmd + c
+   *   Paste text:                     ctrl/cmd + v
+   *   Cut text:                       ctrl/cmd + x
+   *   Select entire text:             ctrl/cmd + a
+   *   Quit editing                    tab or esc
+   * 
+ * + *

Supported mouse/touch combination

+ *
+   *   Position cursor:                click/touch
+   *   Create selection:               click/touch & drag
+   *   Create selection:               click & shift + click
+   *   Select word:                    double click
+   *   Select line:                    triple click
+   * 
+ */ + fabric.IText = fabric.util.createClass(fabric.Text, fabric.Observable, /** @lends fabric.IText.prototype */ { + + /** + * Type of an object + * @type String + * @default + */ + type: 'i-text', + + /** + * Index where text selection starts (or where cursor is when there is no selection) + * @type Nubmer + * @default + */ + selectionStart: 0, + + /** + * Index where text selection ends + * @type Nubmer + * @default + */ + selectionEnd: 0, + + /** + * Color of text selection + * @type String + * @default + */ + selectionColor: 'rgba(17,119,255,0.3)', + + /** + * Indicates whether text is in editing mode + * @type Boolean + * @default + */ + isEditing: false, + + /** + * Indicates whether a text can be edited + * @type Boolean + * @default + */ + editable: true, + + /** + * Border color of text object while it's in editing mode + * @type String + * @default + */ + editingBorderColor: 'rgba(102,153,255,0.25)', + + /** + * Width of cursor (in px) + * @type Number + * @default + */ + cursorWidth: 2, + + /** + * Color of default cursor (when not overwritten by character style) + * @type String + * @default + */ + cursorColor: '#333', + + /** + * Delay between cursor blink (in ms) + * @type Number + * @default + */ + cursorDelay: 1000, + + /** + * Duration of cursor fadein (in ms) + * @type Number + * @default + */ + cursorDuration: 600, + + /** + * Object containing character styles + * (where top-level properties corresponds to line number and 2nd-level properties -- to char number in a line) + * @type Object + * @default + */ + styles: null, + + /** + * Indicates whether internal text char widths can be cached + * @type Boolean + * @default + */ + caching: true, + + /** + * @private + * @type Boolean + * @default + */ + _skipFillStrokeCheck: false, + + /** + * @private + */ + _reSpace: /\s|\n/, + + /** + * @private + */ + _currentCursorOpacity: 0, + + /** + * @private + */ + _selectionDirection: null, + + /** + * @private + */ + _abortCursorAnimation: false, + + /** + * @private + */ + _charWidthsCache: { }, + + /** + * Constructor + * @param {String} text Text string + * @param {Object} [options] Options object + * @return {fabric.IText} thisArg + */ + initialize: function(text, options) { + this.styles = options ? (options.styles || { }) : { }; + this.callSuper('initialize', text, options); + this.initBehavior(); + }, + + /** + * @private + */ + _clearCache: function() { + this.callSuper('_clearCache'); + this.__maxFontHeights = [ ]; + this.__widthOfSpace = [ ]; + }, + + /** + * Returns true if object has no styling + */ + isEmptyStyles: function() { + if (!this.styles) { + return true; + } + var obj = this.styles; + + for (var p1 in obj) { + for (var p2 in obj[p1]) { + /*jshint unused:false */ + for (var p3 in obj[p1][p2]) { + return false; + } + } + } + return true; + }, + + /** + * Sets selection start (left boundary of a selection) + * @param {Number} index Index to set selection start to + */ + setSelectionStart: function(index) { + index = Math.max(index, 0); + if (this.selectionStart !== index) { + this.fire('selection:changed'); + this.canvas && this.canvas.fire('text:selection:changed', { target: this }); + this.selectionStart = index; + } + this._updateTextarea(); + }, + + /** + * Sets selection end (right boundary of a selection) + * @param {Number} index Index to set selection end to + */ + setSelectionEnd: function(index) { + index = Math.min(index, this.text.length); + if (this.selectionEnd !== index) { + this.fire('selection:changed'); + this.canvas && this.canvas.fire('text:selection:changed', { target: this }); + this.selectionEnd = index; + } + this._updateTextarea(); + }, + + /** + * Gets style of a current selection/cursor (at the start position) + * @param {Number} [startIndex] Start index to get styles at + * @param {Number} [endIndex] End index to get styles at + * @return {Object} styles Style object at a specified (or current) index + */ + getSelectionStyles: function(startIndex, endIndex) { + + if (arguments.length === 2) { + var styles = [ ]; + for (var i = startIndex; i < endIndex; i++) { + styles.push(this.getSelectionStyles(i)); + } + return styles; + } + + var loc = this.get2DCursorLocation(startIndex); + if (this.styles[loc.lineIndex]) { + return this.styles[loc.lineIndex][loc.charIndex] || { }; + } + + return { }; + }, + + /** + * Sets style of a current selection + * @param {Object} [styles] Styles object + * @return {fabric.IText} thisArg + * @chainable + */ + setSelectionStyles: function(styles) { + if (this.selectionStart === this.selectionEnd) { + this._extendStyles(this.selectionStart, styles); + } + else { + for (var i = this.selectionStart; i < this.selectionEnd; i++) { + this._extendStyles(i, styles); + } + } + /* not included in _extendStyles to avoid clearing cache more than once */ + this._clearCache(); + return this; + }, + + /** + * @private + */ + _extendStyles: function(index, styles) { + var loc = this.get2DCursorLocation(index); + + if (!this.styles[loc.lineIndex]) { + this.styles[loc.lineIndex] = { }; + } + if (!this.styles[loc.lineIndex][loc.charIndex]) { + this.styles[loc.lineIndex][loc.charIndex] = { }; + } + fabric.util.object.extend(this.styles[loc.lineIndex][loc.charIndex], styles); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _render: function(ctx) { + this.callSuper('_render', ctx); + this.ctx = ctx; + this.isEditing && this.renderCursorOrSelection(); + }, + + /** + * Renders cursor or selection (depending on what exists) + */ + renderCursorOrSelection: function() { + if (!this.active) { + return; + } + + var chars = this.text.split(''), + boundaries, ctx; + + if (this.canvas.contextTop) { + ctx = this.canvas.contextTop; + ctx.save(); + ctx.transform.apply(ctx, this.canvas.viewportTransform); + this.transform(ctx); + } + else { + ctx = this.ctx; + ctx.save(); + } + + if (this.selectionStart === this.selectionEnd) { + boundaries = this._getCursorBoundaries(chars, 'cursor'); + this.renderCursor(boundaries, ctx); + } + else { + boundaries = this._getCursorBoundaries(chars, 'selection'); + this.renderSelection(chars, boundaries, ctx); + } + + ctx.restore(); + }, + + /** + * Returns 2d representation (lineIndex and charIndex) of cursor (or selection start) + * @param {Number} [selectionStart] Optional index. When not given, current selectionStart is used. + */ + get2DCursorLocation: function(selectionStart) { + if (typeof selectionStart === 'undefined') { + selectionStart = this.selectionStart; + } + var textBeforeCursor = this.text.slice(0, selectionStart), + linesBeforeCursor = textBeforeCursor.split(this._reNewline); + + return { + lineIndex: linesBeforeCursor.length - 1, + charIndex: linesBeforeCursor[linesBeforeCursor.length - 1].length + }; + }, + + /** + * Returns complete style of char at the current cursor + * @param {Number} lineIndex Line index + * @param {Number} charIndex Char index + * @return {Object} Character style + */ + getCurrentCharStyle: function(lineIndex, charIndex) { + var style = this.styles[lineIndex] && this.styles[lineIndex][charIndex === 0 ? 0 : (charIndex - 1)]; + + return { + fontSize: style && style.fontSize || this.fontSize, + fill: style && style.fill || this.fill, + textBackgroundColor: style && style.textBackgroundColor || this.textBackgroundColor, + textDecoration: style && style.textDecoration || this.textDecoration, + fontFamily: style && style.fontFamily || this.fontFamily, + fontWeight: style && style.fontWeight || this.fontWeight, + fontStyle: style && style.fontStyle || this.fontStyle, + stroke: style && style.stroke || this.stroke, + strokeWidth: style && style.strokeWidth || this.strokeWidth + }; + }, + + /** + * Returns fontSize of char at the current cursor + * @param {Number} lineIndex Line index + * @param {Number} charIndex Char index + * @return {Number} Character font size + */ + getCurrentCharFontSize: function(lineIndex, charIndex) { + return ( + this.styles[lineIndex] && + this.styles[lineIndex][charIndex === 0 ? 0 : (charIndex - 1)] && + this.styles[lineIndex][charIndex === 0 ? 0 : (charIndex - 1)].fontSize) || this.fontSize; + }, + + /** + * Returns color (fill) of char at the current cursor + * @param {Number} lineIndex Line index + * @param {Number} charIndex Char index + * @return {String} Character color (fill) + */ + getCurrentCharColor: function(lineIndex, charIndex) { + return ( + this.styles[lineIndex] && + this.styles[lineIndex][charIndex === 0 ? 0 : (charIndex - 1)] && + this.styles[lineIndex][charIndex === 0 ? 0 : (charIndex - 1)].fill) || this.cursorColor; + }, + + /** + * Returns cursor boundaries (left, top, leftOffset, topOffset) + * @private + * @param {Array} chars Array of characters + * @param {String} typeOfBoundaries + */ + _getCursorBoundaries: function(chars, typeOfBoundaries) { + + // left/top are left/top of entire text box + // leftOffset/topOffset are offset from that left/top point of a text box + + var left = Math.round(this._getLeftOffset()), + top = this._getTopOffset(), + + offsets = this._getCursorBoundariesOffsets( + chars, typeOfBoundaries); + + return { + left: left, + top: top, + leftOffset: offsets.left + offsets.lineLeft, + topOffset: offsets.top + }; + }, + + /** + * @private + */ + _getCursorBoundariesOffsets: function(chars, typeOfBoundaries) { + + var lineLeftOffset = 0, + + lineIndex = 0, + charIndex = 0, + topOffset = 0, + leftOffset = 0; + + for (var i = 0; i < this.selectionStart; i++) { + if (chars[i] === '\n') { + leftOffset = 0; + topOffset += this._getHeightOfLine(this.ctx, lineIndex); + + lineIndex++; + charIndex = 0; + } + else { + leftOffset += this._getWidthOfChar(this.ctx, chars[i], lineIndex, charIndex); + charIndex++; + } + + lineLeftOffset = this._getCachedLineOffset(lineIndex); + } + if (typeOfBoundaries === 'cursor') { + topOffset += (1 - this._fontSizeFraction) * this._getHeightOfLine(this.ctx, lineIndex) / this.lineHeight + - this.getCurrentCharFontSize(lineIndex, charIndex) * (1 - this._fontSizeFraction); + } + + return { + top: topOffset, + left: leftOffset, + lineLeft: lineLeftOffset + }; + }, + + /** + * @private + */ + _getCachedLineOffset: function(lineIndex) { + var widthOfLine = this._getLineWidth(this.ctx, lineIndex); + + return this.__lineOffsets[lineIndex] || + (this.__lineOffsets[lineIndex] = this._getLineLeftOffset(widthOfLine)); + }, + + /** + * Renders cursor + * @param {Object} boundaries + * @param {CanvasRenderingContext2D} ctx transformed context to draw on + */ + renderCursor: function(boundaries, ctx) { + + var cursorLocation = this.get2DCursorLocation(), + lineIndex = cursorLocation.lineIndex, + charIndex = cursorLocation.charIndex, + charHeight = this.getCurrentCharFontSize(lineIndex, charIndex), + leftOffset = (lineIndex === 0 && charIndex === 0) + ? this._getCachedLineOffset(lineIndex) + : boundaries.leftOffset; + + ctx.fillStyle = this.getCurrentCharColor(lineIndex, charIndex); + ctx.globalAlpha = this.__isMousedown ? 1 : this._currentCursorOpacity; + + ctx.fillRect( + boundaries.left + leftOffset, + boundaries.top + boundaries.topOffset, + this.cursorWidth / this.scaleX, + charHeight); + + }, + + /** + * Renders text selection + * @param {Array} chars Array of characters + * @param {Object} boundaries Object with left/top/leftOffset/topOffset + * @param {CanvasRenderingContext2D} ctx transformed context to draw on + */ + renderSelection: function(chars, boundaries, ctx) { + + ctx.fillStyle = this.selectionColor; + + var start = this.get2DCursorLocation(this.selectionStart), + end = this.get2DCursorLocation(this.selectionEnd), + startLine = start.lineIndex, + endLine = end.lineIndex; + + for (var i = startLine; i <= endLine; i++) { + var lineOffset = this._getCachedLineOffset(i) || 0, + lineHeight = this._getHeightOfLine(this.ctx, i), + boxWidth = 0, line = this._textLines[i]; + + if (i === startLine) { + for (var j = 0, len = line.length; j < len; j++) { + if (j >= start.charIndex && (i !== endLine || j < end.charIndex)) { + boxWidth += this._getWidthOfChar(ctx, line[j], i, j); + } + if (j < start.charIndex) { + lineOffset += this._getWidthOfChar(ctx, line[j], i, j); + } + } + } + else if (i > startLine && i < endLine) { + boxWidth += this._getLineWidth(ctx, i) || 5; + } + else if (i === endLine) { + for (var j2 = 0, j2len = end.charIndex; j2 < j2len; j2++) { + boxWidth += this._getWidthOfChar(ctx, line[j2], i, j2); + } + } + + ctx.fillRect( + boundaries.left + lineOffset, + boundaries.top + boundaries.topOffset, + boxWidth, + lineHeight); + + boundaries.topOffset += lineHeight; + } + }, + + /** + * @private + * @param {String} method + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderChars: function(method, ctx, line, left, top, lineIndex) { + + if (this.isEmptyStyles()) { + return this._renderCharsFast(method, ctx, line, left, top); + } + + this.skipTextAlign = true; + + // set proper box offset + left -= this.textAlign === 'center' + ? (this.width / 2) + : (this.textAlign === 'right') + ? this.width + : 0; + + // set proper line offset + var lineHeight = this._getHeightOfLine(ctx, lineIndex), + lineLeftOffset = this._getCachedLineOffset(lineIndex), + chars = line.split(''), + prevStyle, + charsToRender = ''; + + left += lineLeftOffset || 0; + + ctx.save(); + top -= lineHeight / this.lineHeight * this._fontSizeFraction; + for (var i = 0, len = chars.length; i <= len; i++) { + prevStyle = prevStyle || this.getCurrentCharStyle(lineIndex, i); + var thisStyle = this.getCurrentCharStyle(lineIndex, i + 1); + + if (this._hasStyleChanged(prevStyle, thisStyle) || i === len) { + this._renderChar(method, ctx, lineIndex, i - 1, charsToRender, left, top, lineHeight); + charsToRender = ''; + prevStyle = thisStyle; + } + charsToRender += chars[i]; + } + + ctx.restore(); + }, + + /** + * @private + * @param {String} method + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} line Content of the line + * @param {Number} left Left coordinate + * @param {Number} top Top coordinate + */ + _renderCharsFast: function(method, ctx, line, left, top) { + this.skipTextAlign = false; + + if (method === 'fillText' && this.fill) { + this.callSuper('_renderChars', method, ctx, line, left, top); + } + if (method === 'strokeText' && ((this.stroke && this.strokeWidth > 0) || this.skipFillStrokeCheck)) { + this.callSuper('_renderChars', method, ctx, line, left, top); + } + }, + + /** + * @private + * @param {String} method + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Number} lineIndex + * @param {Number} i + * @param {String} _char + * @param {Number} left Left coordinate + * @param {Number} top Top coordinate + * @param {Number} lineHeight Height of the line + */ + _renderChar: function(method, ctx, lineIndex, i, _char, left, top, lineHeight) { + var decl, charWidth, charHeight, + offset = this._fontSizeFraction * lineHeight / this.lineHeight; + + if (this.styles && this.styles[lineIndex] && (decl = this.styles[lineIndex][i])) { + + var shouldStroke = decl.stroke || this.stroke, + shouldFill = decl.fill || this.fill; + + ctx.save(); + charWidth = this._applyCharStylesGetWidth(ctx, _char, lineIndex, i, decl); + charHeight = this._getHeightOfChar(ctx, _char, lineIndex, i); + + if (shouldFill) { + ctx.fillText(_char, left, top); + } + if (shouldStroke) { + ctx.strokeText(_char, left, top); + } + + this._renderCharDecoration(ctx, decl, left, top, offset, charWidth, charHeight); + ctx.restore(); + + ctx.translate(charWidth, 0); + } + else { + if (method === 'strokeText' && this.stroke) { + ctx[method](_char, left, top); + } + if (method === 'fillText' && this.fill) { + ctx[method](_char, left, top); + } + charWidth = this._applyCharStylesGetWidth(ctx, _char, lineIndex, i); + this._renderCharDecoration(ctx, null, left, top, offset, charWidth, this.fontSize); + + ctx.translate(ctx.measureText(_char).width, 0); + } + }, + + /** + * @private + * @param {Object} prevStyle + * @param {Object} thisStyle + */ + _hasStyleChanged: function(prevStyle, thisStyle) { + return (prevStyle.fill !== thisStyle.fill || + prevStyle.fontSize !== thisStyle.fontSize || + prevStyle.textBackgroundColor !== thisStyle.textBackgroundColor || + prevStyle.textDecoration !== thisStyle.textDecoration || + prevStyle.fontFamily !== thisStyle.fontFamily || + prevStyle.fontWeight !== thisStyle.fontWeight || + prevStyle.fontStyle !== thisStyle.fontStyle || + prevStyle.stroke !== thisStyle.stroke || + prevStyle.strokeWidth !== thisStyle.strokeWidth + ); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderCharDecoration: function(ctx, styleDeclaration, left, top, offset, charWidth, charHeight) { + + var textDecoration = styleDeclaration + ? (styleDeclaration.textDecoration || this.textDecoration) + : this.textDecoration; + + if (!textDecoration) { + return; + } + + if (textDecoration.indexOf('underline') > -1) { + ctx.fillRect( + left, + top + charHeight / 10, + charWidth , + charHeight / 15 + ); + } + if (textDecoration.indexOf('line-through') > -1) { + ctx.fillRect( + left, + top - charHeight * (this._fontSizeFraction + this._fontSizeMult - 1) + charHeight / 15, + charWidth, + charHeight / 15 + ); + } + if (textDecoration.indexOf('overline') > -1) { + ctx.fillRect( + left, + top - (this._fontSizeMult - this._fontSizeFraction) * charHeight, + charWidth, + charHeight / 15 + ); + } + }, + + /** + * @private + * @param {String} method + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} line + */ + _renderTextLine: function(method, ctx, line, left, top, lineIndex) { + // to "cancel" this.fontSize subtraction in fabric.Text#_renderTextLine + // the adding 0.03 is just to align text with itext by overlap test + if (!this.isEmptyStyles()) { + top += this.fontSize * (this._fontSizeFraction + 0.03); + } + this.callSuper('_renderTextLine', method, ctx, line, left, top, lineIndex); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextDecoration: function(ctx) { + if (this.isEmptyStyles()) { + return this.callSuper('_renderTextDecoration', ctx); + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _renderTextLinesBackground: function(ctx) { + if (!this.textBackgroundColor && !this.styles) { + return; + } + + ctx.save(); + + if (this.textBackgroundColor) { + ctx.fillStyle = this.textBackgroundColor; + } + + var lineHeights = 0; + + for (var i = 0, len = this._textLines.length; i < len; i++) { + + var heightOfLine = this._getHeightOfLine(ctx, i); + if (this._textLines[i] === '') { + lineHeights += heightOfLine; + continue; + } + + var lineWidth = this._getLineWidth(ctx, i), + lineLeftOffset = this._getCachedLineOffset(i); + + if (this.textBackgroundColor) { + ctx.fillStyle = this.textBackgroundColor; + + ctx.fillRect( + this._getLeftOffset() + lineLeftOffset, + this._getTopOffset() + lineHeights, + lineWidth, + heightOfLine / this.lineHeight + ); + } + if (this.styles[i]) { + for (var j = 0, jlen = this._textLines[i].length; j < jlen; j++) { + if (this.styles[i] && this.styles[i][j] && this.styles[i][j].textBackgroundColor) { + + var _char = this._textLines[i][j]; + + ctx.fillStyle = this.styles[i][j].textBackgroundColor; + + ctx.fillRect( + this._getLeftOffset() + lineLeftOffset + this._getWidthOfCharsAt(ctx, i, j), + this._getTopOffset() + lineHeights, + this._getWidthOfChar(ctx, _char, i, j) + 1, + heightOfLine / this.lineHeight + ); + } + } + } + lineHeights += heightOfLine; + } + ctx.restore(); + }, + + /** + * @private + */ + _getCacheProp: function(_char, styleDeclaration) { + return _char + + styleDeclaration.fontFamily + + styleDeclaration.fontSize + + styleDeclaration.fontWeight + + styleDeclaration.fontStyle + + styleDeclaration.shadow; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {String} _char + * @param {Number} lineIndex + * @param {Number} charIndex + * @param {Object} [decl] + */ + _applyCharStylesGetWidth: function(ctx, _char, lineIndex, charIndex, decl) { + var styleDeclaration = decl || + (this.styles[lineIndex] && + this.styles[lineIndex][charIndex]); + + if (styleDeclaration) { + // cloning so that original style object is not polluted with following font declarations + styleDeclaration = clone(styleDeclaration); + } + else { + styleDeclaration = { }; + } + + this._applyFontStyles(styleDeclaration); + + var cacheProp = this._getCacheProp(_char, styleDeclaration); + + // short-circuit if no styles + if (this.isEmptyStyles() && this._charWidthsCache[cacheProp] && this.caching) { + return this._charWidthsCache[cacheProp]; + } + + if (typeof styleDeclaration.shadow === 'string') { + styleDeclaration.shadow = new fabric.Shadow(styleDeclaration.shadow); + } + + var fill = styleDeclaration.fill || this.fill; + ctx.fillStyle = fill.toLive + ? fill.toLive(ctx, this) + : fill; + + if (styleDeclaration.stroke) { + ctx.strokeStyle = (styleDeclaration.stroke && styleDeclaration.stroke.toLive) + ? styleDeclaration.stroke.toLive(ctx, this) + : styleDeclaration.stroke; + } + + ctx.lineWidth = styleDeclaration.strokeWidth || this.strokeWidth; + ctx.font = this._getFontDeclaration.call(styleDeclaration); + this._setShadow.call(styleDeclaration, ctx); + + if (!this.caching) { + return ctx.measureText(_char).width; + } + + if (!this._charWidthsCache[cacheProp]) { + this._charWidthsCache[cacheProp] = ctx.measureText(_char).width; + } + + return this._charWidthsCache[cacheProp]; + }, + + /** + * @private + * @param {Object} styleDeclaration + */ + _applyFontStyles: function(styleDeclaration) { + if (!styleDeclaration.fontFamily) { + styleDeclaration.fontFamily = this.fontFamily; + } + if (!styleDeclaration.fontSize) { + styleDeclaration.fontSize = this.fontSize; + } + if (!styleDeclaration.fontWeight) { + styleDeclaration.fontWeight = this.fontWeight; + } + if (!styleDeclaration.fontStyle) { + styleDeclaration.fontStyle = this.fontStyle; + } + }, + + /** + * @private + * @param {Number} lineIndex + * @param {Number} charIndex + */ + _getStyleDeclaration: function(lineIndex, charIndex) { + return (this.styles[lineIndex] && this.styles[lineIndex][charIndex]) + ? clone(this.styles[lineIndex][charIndex]) + : { }; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _getWidthOfChar: function(ctx, _char, lineIndex, charIndex) { + if (this.textAlign === 'justify' && /\s/.test(_char)) { + return this._getWidthOfSpace(ctx, lineIndex); + } + + var styleDeclaration = this._getStyleDeclaration(lineIndex, charIndex); + this._applyFontStyles(styleDeclaration); + var cacheProp = this._getCacheProp(_char, styleDeclaration); + + if (this._charWidthsCache[cacheProp] && this.caching) { + return this._charWidthsCache[cacheProp]; + } + else if (ctx) { + ctx.save(); + var width = this._applyCharStylesGetWidth(ctx, _char, lineIndex, charIndex); + ctx.restore(); + return width; + } + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _getHeightOfChar: function(ctx, _char, lineIndex, charIndex) { + if (this.styles[lineIndex] && this.styles[lineIndex][charIndex]) { + return this.styles[lineIndex][charIndex].fontSize || this.fontSize; + } + return this.fontSize; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _getHeightOfCharAt: function(ctx, lineIndex, charIndex) { + var _char = this._textLines[lineIndex][charIndex]; + return this._getHeightOfChar(ctx, _char, lineIndex, charIndex); + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _getWidthOfCharsAt: function(ctx, lineIndex, charIndex) { + var width = 0, i, _char; + for (i = 0; i < charIndex; i++) { + _char = this._textLines[lineIndex][i]; + width += this._getWidthOfChar(ctx, _char, lineIndex, i); + } + return width; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _getLineWidth: function(ctx, lineIndex) { + if (this.__lineWidths[lineIndex]) { + return this.__lineWidths[lineIndex]; + } + this.__lineWidths[lineIndex] = this._getWidthOfCharsAt(ctx, lineIndex, this._textLines[lineIndex].length); + return this.__lineWidths[lineIndex]; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Number} lineIndex + */ + _getWidthOfSpace: function (ctx, lineIndex) { + if (this.__widthOfSpace[lineIndex]) { + return this.__widthOfSpace[lineIndex]; + } + var line = this._textLines[lineIndex], + wordsWidth = this._getWidthOfWords(ctx, line, lineIndex), + widthDiff = this.width - wordsWidth, + numSpaces = line.length - line.replace(/\s+/g, '').length, + width = widthDiff / numSpaces; + this.__widthOfSpace[lineIndex] = width; + return width; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + * @param {Number} line + * @param {Number} lineIndex + */ + _getWidthOfWords: function (ctx, line, lineIndex) { + var width = 0; + + for (var charIndex = 0; charIndex < line.length; charIndex++) { + var _char = line[charIndex]; + + if (!_char.match(/\s/)) { + width += this._getWidthOfChar(ctx, _char, lineIndex, charIndex); + } + } + + return width; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _getHeightOfLine: function(ctx, lineIndex) { + if (this.__lineHeights[lineIndex]) { + return this.__lineHeights[lineIndex]; + } + + var line = this._textLines[lineIndex], + maxHeight = this._getHeightOfChar(ctx, line[0], lineIndex, 0); + + for (var i = 1, len = line.length; i < len; i++) { + var currentCharHeight = this._getHeightOfChar(ctx, line[i], lineIndex, i); + if (currentCharHeight > maxHeight) { + maxHeight = currentCharHeight; + } + } + this.__maxFontHeights[lineIndex] = maxHeight; + this.__lineHeights[lineIndex] = maxHeight * this.lineHeight * this._fontSizeMult; + return this.__lineHeights[lineIndex]; + }, + + /** + * @private + * @param {CanvasRenderingContext2D} ctx Context to render on + */ + _getTextHeight: function(ctx) { + var height = 0; + for (var i = 0, len = this._textLines.length; i < len; i++) { + height += this._getHeightOfLine(ctx, i); + } + return height; + }, + + /** + * This method is overwritten to account for different top offset + * @private + */ + _renderTextBoxBackground: function(ctx) { + if (!this.backgroundColor) { + return; + } + + ctx.save(); + ctx.fillStyle = this.backgroundColor; + + ctx.fillRect( + this._getLeftOffset(), + this._getTopOffset(), + this.width, + this.height + ); + + ctx.restore(); + }, + + /** + * Returns object representation of an instance + * @method toObject + * @param {Array} [propertiesToInclude] Any properties that you might want to additionally include in the output + * @return {Object} object representation of an instance + */ + toObject: function(propertiesToInclude) { + return fabric.util.object.extend(this.callSuper('toObject', propertiesToInclude), { + styles: clone(this.styles) + }); + } + }); + + /** + * Returns fabric.IText instance from an object representation + * @static + * @memberOf fabric.IText + * @param {Object} object Object to create an instance from + * @return {fabric.IText} instance of fabric.IText + */ + fabric.IText.fromObject = function(object) { + return new fabric.IText(object.text, clone(object)); + }; +})(); + + +(function() { + + var clone = fabric.util.object.clone; + + fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ { + + /** + * Initializes all the interactive behavior of IText + */ + initBehavior: function() { + this.initAddedHandler(); + this.initRemovedHandler(); + this.initCursorSelectionHandlers(); + this.initDoubleClickSimulation(); + }, + + /** + * Initializes "selected" event handler + */ + initSelectedHandler: function() { + this.on('selected', function() { + + var _this = this; + setTimeout(function() { + _this.selected = true; + }, 100); + }); + }, + + /** + * Initializes "added" event handler + */ + initAddedHandler: function() { + var _this = this; + this.on('added', function() { + if (this.canvas && !this.canvas._hasITextHandlers) { + this.canvas._hasITextHandlers = true; + this._initCanvasHandlers(); + } + + // Track IText instances per-canvas. Only register in this array once added + // to a canvas; we don't want to leak a reference to the instance forever + // simply because it existed at some point. + // + // (Might be added to a collection, but not on a canvas.) + if (_this.canvas) { + _this.canvas._iTextInstances = _this.canvas._iTextInstances || []; + _this.canvas._iTextInstances.push(_this); + } + }); + }, + + initRemovedHandler: function() { + var _this = this; + this.on('removed', function() { + // (Might be removed from a collection, but not on a canvas.) + if (_this.canvas) { + _this.canvas._iTextInstances = _this.canvas._iTextInstances || []; + fabric.util.removeFromArray(_this.canvas._iTextInstances, _this); + } + }); + }, + + /** + * @private + */ + _initCanvasHandlers: function() { + var _this = this; + + this.canvas.on('selection:cleared', function() { + fabric.IText.prototype.exitEditingOnOthers(_this.canvas); + }); + + this.canvas.on('mouse:up', function() { + if (_this.canvas._iTextInstances) { + _this.canvas._iTextInstances.forEach(function(obj) { + obj.__isMousedown = false; + }); + } + }); + + this.canvas.on('object:selected', function() { + fabric.IText.prototype.exitEditingOnOthers(_this.canvas); + }); + }, + + /** + * @private + */ + _tick: function() { + this._currentTickState = this._animateCursor(this, 1, this.cursorDuration, '_onTickComplete'); + }, + + /** + * @private + */ + _animateCursor: function(obj, targetOpacity, duration, completeMethod) { + + var tickState; + + tickState = { + isAborted: false, + abort: function() { + this.isAborted = true; + }, + }; + + obj.animate('_currentCursorOpacity', targetOpacity, { + duration: duration, + onComplete: function() { + if (!tickState.isAborted) { + obj[completeMethod](); + } + }, + onChange: function() { + if (obj.canvas) { + obj.canvas.clearContext(obj.canvas.contextTop || obj.ctx); + obj.renderCursorOrSelection(); + } + }, + abort: function() { + return tickState.isAborted; + } + }); + return tickState; + }, + + /** + * @private + */ + _onTickComplete: function() { + + var _this = this; + + if (this._cursorTimeout1) { + clearTimeout(this._cursorTimeout1); + } + this._cursorTimeout1 = setTimeout(function() { + _this._currentTickCompleteState = _this._animateCursor(_this, 0, this.cursorDuration / 2, '_tick'); + }, 100); + }, + + /** + * Initializes delayed cursor + */ + initDelayedCursor: function(restart) { + var _this = this, + delay = restart ? 0 : this.cursorDelay; + + this._currentTickState && this._currentTickState.abort(); + this._currentTickCompleteState && this._currentTickCompleteState.abort(); + clearTimeout(this._cursorTimeout1); + this._currentCursorOpacity = 1; + if (this.canvas) { + this.canvas.clearContext(this.canvas.contextTop || this.ctx); + this.renderCursorOrSelection(); + } + if (this._cursorTimeout2) { + clearTimeout(this._cursorTimeout2); + } + this._cursorTimeout2 = setTimeout(function() { + _this._tick(); + }, delay); + }, + + /** + * Aborts cursor animation and clears all timeouts + */ + abortCursorAnimation: function() { + this._currentTickState && this._currentTickState.abort(); + this._currentTickCompleteState && this._currentTickCompleteState.abort(); + + clearTimeout(this._cursorTimeout1); + clearTimeout(this._cursorTimeout2); + + this._currentCursorOpacity = 0; + this.canvas && this.canvas.clearContext(this.canvas.contextTop || this.ctx); + }, + + /** + * Selects entire text + */ + selectAll: function() { + this.setSelectionStart(0); + this.setSelectionEnd(this.text.length); + }, + + /** + * Returns selected text + * @return {String} + */ + getSelectedText: function() { + return this.text.slice(this.selectionStart, this.selectionEnd); + }, + + /** + * Find new selection index representing start of current word according to current selection index + * @param {Number} startFrom Surrent selection index + * @return {Number} New selection index + */ + findWordBoundaryLeft: function(startFrom) { + var offset = 0, index = startFrom - 1; + + // remove space before cursor first + if (this._reSpace.test(this.text.charAt(index))) { + while (this._reSpace.test(this.text.charAt(index))) { + offset++; + index--; + } + } + while (/\S/.test(this.text.charAt(index)) && index > -1) { + offset++; + index--; + } + + return startFrom - offset; + }, + + /** + * Find new selection index representing end of current word according to current selection index + * @param {Number} startFrom Current selection index + * @return {Number} New selection index + */ + findWordBoundaryRight: function(startFrom) { + var offset = 0, index = startFrom; + + // remove space after cursor first + if (this._reSpace.test(this.text.charAt(index))) { + while (this._reSpace.test(this.text.charAt(index))) { + offset++; + index++; + } + } + while (/\S/.test(this.text.charAt(index)) && index < this.text.length) { + offset++; + index++; + } + + return startFrom + offset; + }, + + /** + * Find new selection index representing start of current line according to current selection index + * @param {Number} startFrom Current selection index + * @return {Number} New selection index + */ + findLineBoundaryLeft: function(startFrom) { + var offset = 0, index = startFrom - 1; + + while (!/\n/.test(this.text.charAt(index)) && index > -1) { + offset++; + index--; + } + + return startFrom - offset; + }, + + /** + * Find new selection index representing end of current line according to current selection index + * @param {Number} startFrom Current selection index + * @return {Number} New selection index + */ + findLineBoundaryRight: function(startFrom) { + var offset = 0, index = startFrom; + + while (!/\n/.test(this.text.charAt(index)) && index < this.text.length) { + offset++; + index++; + } + + return startFrom + offset; + }, + + /** + * Returns number of newlines in selected text + * @return {Number} Number of newlines in selected text + */ + getNumNewLinesInSelectedText: function() { + var selectedText = this.getSelectedText(), + numNewLines = 0; + + for (var i = 0, chars = selectedText.split(''), len = chars.length; i < len; i++) { + if (chars[i] === '\n') { + numNewLines++; + } + } + return numNewLines; + }, + + /** + * Finds index corresponding to beginning or end of a word + * @param {Number} selectionStart Index of a character + * @param {Number} direction: 1 or -1 + * @return {Number} Index of the beginning or end of a word + */ + searchWordBoundary: function(selectionStart, direction) { + var index = this._reSpace.test(this.text.charAt(selectionStart)) ? selectionStart - 1 : selectionStart, + _char = this.text.charAt(index), + reNonWord = /[ \n\.,;!\?\-]/; + + while (!reNonWord.test(_char) && index > 0 && index < this.text.length) { + index += direction; + _char = this.text.charAt(index); + } + if (reNonWord.test(_char) && _char !== '\n') { + index += direction === 1 ? 0 : 1; + } + return index; + }, + + /** + * Selects a word based on the index + * @param {Number} selectionStart Index of a character + */ + selectWord: function(selectionStart) { + var newSelectionStart = this.searchWordBoundary(selectionStart, -1), /* search backwards */ + newSelectionEnd = this.searchWordBoundary(selectionStart, 1); /* search forward */ + + this.setSelectionStart(newSelectionStart); + this.setSelectionEnd(newSelectionEnd); + }, + + /** + * Selects a line based on the index + * @param {Number} selectionStart Index of a character + */ + selectLine: function(selectionStart) { + var newSelectionStart = this.findLineBoundaryLeft(selectionStart), + newSelectionEnd = this.findLineBoundaryRight(selectionStart); + + this.setSelectionStart(newSelectionStart); + this.setSelectionEnd(newSelectionEnd); + }, + + /** + * Enters editing state + * @return {fabric.IText} thisArg + * @chainable + */ + enterEditing: function() { + if (this.isEditing || !this.editable) { + return; + } + + if (this.canvas) { + this.exitEditingOnOthers(this.canvas); + } + + this.isEditing = true; + + this.initHiddenTextarea(); + this.hiddenTextarea.focus(); + this._updateTextarea(); + this._saveEditingProps(); + this._setEditingProps(); + + this._tick(); + this.fire('editing:entered'); + + if (!this.canvas) { + return this; + } + + this.canvas.renderAll(); + this.canvas.fire('text:editing:entered', { target: this }); + this.initMouseMoveHandler(); + return this; + }, + + exitEditingOnOthers: function(canvas) { + if (canvas._iTextInstances) { + canvas._iTextInstances.forEach(function(obj) { + obj.selected = false; + if (obj.isEditing) { + obj.exitEditing(); + } + }); + } + }, + + /** + * Initializes "mousemove" event handler + */ + initMouseMoveHandler: function() { + var _this = this; + this.canvas.on('mouse:move', function(options) { + if (!_this.__isMousedown || !_this.isEditing) { + return; + } + + var newSelectionStart = _this.getSelectionStartFromPointer(options.e); + if (newSelectionStart >= _this.__selectionStartOnMouseDown) { + _this.setSelectionStart(_this.__selectionStartOnMouseDown); + _this.setSelectionEnd(newSelectionStart); + } + else { + _this.setSelectionStart(newSelectionStart); + _this.setSelectionEnd(_this.__selectionStartOnMouseDown); + } + }); + }, + + /** + * @private + */ + _setEditingProps: function() { + this.hoverCursor = 'text'; + + if (this.canvas) { + this.canvas.defaultCursor = this.canvas.moveCursor = 'text'; + } + + this.borderColor = this.editingBorderColor; + + this.hasControls = this.selectable = false; + this.lockMovementX = this.lockMovementY = true; + }, + + /** + * @private + */ + _updateTextarea: function() { + if (!this.hiddenTextarea) { + return; + } + + this.hiddenTextarea.value = this.text; + this.hiddenTextarea.selectionStart = this.selectionStart; + this.hiddenTextarea.selectionEnd = this.selectionEnd; + }, + + /** + * @private + */ + _saveEditingProps: function() { + this._savedProps = { + hasControls: this.hasControls, + borderColor: this.borderColor, + lockMovementX: this.lockMovementX, + lockMovementY: this.lockMovementY, + hoverCursor: this.hoverCursor, + defaultCursor: this.canvas && this.canvas.defaultCursor, + moveCursor: this.canvas && this.canvas.moveCursor + }; + }, + + /** + * @private + */ + _restoreEditingProps: function() { + if (!this._savedProps) { + return; + } + + this.hoverCursor = this._savedProps.overCursor; + this.hasControls = this._savedProps.hasControls; + this.borderColor = this._savedProps.borderColor; + this.lockMovementX = this._savedProps.lockMovementX; + this.lockMovementY = this._savedProps.lockMovementY; + + if (this.canvas) { + this.canvas.defaultCursor = this._savedProps.defaultCursor; + this.canvas.moveCursor = this._savedProps.moveCursor; + } + }, + + /** + * Exits from editing state + * @return {fabric.IText} thisArg + * @chainable + */ + exitEditing: function() { + + this.selected = false; + this.isEditing = false; + this.selectable = true; + + this.selectionEnd = this.selectionStart; + this.hiddenTextarea && this.canvas && this.hiddenTextarea.parentNode.removeChild(this.hiddenTextarea); + this.hiddenTextarea = null; + + this.abortCursorAnimation(); + this._restoreEditingProps(); + this._currentCursorOpacity = 0; + + this.fire('editing:exited'); + this.canvas && this.canvas.fire('text:editing:exited', { target: this }); + + return this; + }, + + /** + * @private + */ + _removeExtraneousStyles: function() { + for (var prop in this.styles) { + if (!this._textLines[prop]) { + delete this.styles[prop]; + } + } + }, + + /** + * @private + */ + _removeCharsFromTo: function(start, end) { + + var i = end; + while (i !== start) { + + var prevIndex = this.get2DCursorLocation(i).charIndex; + i--; + + var index = this.get2DCursorLocation(i).charIndex, + isNewline = index > prevIndex; + + if (isNewline) { + this.removeStyleObject(isNewline, i + 1); + } + else { + this.removeStyleObject(this.get2DCursorLocation(i).charIndex === 0, i); + } + + } + + this.text = this.text.slice(0, start) + + this.text.slice(end); + this._clearCache(); + }, + + /** + * Inserts a character where cursor is (replacing selection if one exists) + * @param {String} _chars Characters to insert + */ + insertChars: function(_chars, useCopiedStyle) { + var isEndOfLine = this.text.slice(this.selectionStart, this.selectionStart + 1) === '\n'; + + this.text = this.text.slice(0, this.selectionStart) + + _chars + + this.text.slice(this.selectionEnd); + + if (this.selectionStart === this.selectionEnd) { + this.insertStyleObjects(_chars, isEndOfLine, useCopiedStyle); + } + // else if (this.selectionEnd - this.selectionStart > 1) { + // TODO: replace styles properly + // console.log('replacing MORE than 1 char'); + // } + this.setSelectionStart(this.selectionStart + _chars.length); + this.setSelectionEnd(this.selectionStart); + this._clearCache(); + this.canvas && this.canvas.renderAll(); + + this.setCoords(); + this.fire('changed'); + this.canvas && this.canvas.fire('text:changed', { target: this }); + }, + + /** + * Inserts new style object + * @param {Number} lineIndex Index of a line + * @param {Number} charIndex Index of a char + * @param {Boolean} isEndOfLine True if it's end of line + */ + insertNewlineStyleObject: function(lineIndex, charIndex, isEndOfLine) { + + this.shiftLineStyles(lineIndex, +1); + + if (!this.styles[lineIndex + 1]) { + this.styles[lineIndex + 1] = { }; + } + + var currentCharStyle = this.styles[lineIndex][charIndex - 1], + newLineStyles = { }; + + // if there's nothing after cursor, + // we clone current char style onto the next (otherwise empty) line + if (isEndOfLine) { + newLineStyles[0] = clone(currentCharStyle); + this.styles[lineIndex + 1] = newLineStyles; + } + // otherwise we clone styles of all chars + // after cursor onto the next line, from the beginning + else { + for (var index in this.styles[lineIndex]) { + if (parseInt(index, 10) >= charIndex) { + newLineStyles[parseInt(index, 10) - charIndex] = this.styles[lineIndex][index]; + // remove lines from the previous line since they're on a new line now + delete this.styles[lineIndex][index]; + } + } + this.styles[lineIndex + 1] = newLineStyles; + } + this._clearCache(); + }, + + /** + * Inserts style object for a given line/char index + * @param {Number} lineIndex Index of a line + * @param {Number} charIndex Index of a char + * @param {Object} [style] Style object to insert, if given + */ + insertCharStyleObject: function(lineIndex, charIndex, style) { + + var currentLineStyles = this.styles[lineIndex], + currentLineStylesCloned = clone(currentLineStyles); + + if (charIndex === 0 && !style) { + charIndex = 1; + } + + // shift all char styles by 1 forward + // 0,1,2,3 -> (charIndex=2) -> 0,1,3,4 -> (insert 2) -> 0,1,2,3,4 + for (var index in currentLineStylesCloned) { + var numericIndex = parseInt(index, 10); + if (numericIndex >= charIndex) { + currentLineStyles[numericIndex + 1] = currentLineStylesCloned[numericIndex]; + //delete currentLineStyles[index]; + } + } + + this.styles[lineIndex][charIndex] = + style || clone(currentLineStyles[charIndex - 1]); + this._clearCache(); + }, + + /** + * Inserts style object(s) + * @param {String} _chars Characters at the location where style is inserted + * @param {Boolean} isEndOfLine True if it's end of line + * @param {Boolean} [useCopiedStyle] Style to insert + */ + insertStyleObjects: function(_chars, isEndOfLine, useCopiedStyle) { + // removed shortcircuit over isEmptyStyles + + var cursorLocation = this.get2DCursorLocation(), + lineIndex = cursorLocation.lineIndex, + charIndex = cursorLocation.charIndex; + + if (!this.styles[lineIndex]) { + this.styles[lineIndex] = { }; + } + + if (_chars === '\n') { + this.insertNewlineStyleObject(lineIndex, charIndex, isEndOfLine); + } + else { + if (useCopiedStyle) { + this._insertStyles(this.copiedStyles); + } + else { + // TODO: support multiple style insertion if _chars.length > 1 + this.insertCharStyleObject(lineIndex, charIndex); + } + } + }, + + /** + * @private + */ + _insertStyles: function(styles) { + for (var i = 0, len = styles.length; i < len; i++) { + + var cursorLocation = this.get2DCursorLocation(this.selectionStart + i), + lineIndex = cursorLocation.lineIndex, + charIndex = cursorLocation.charIndex; + + this.insertCharStyleObject(lineIndex, charIndex, styles[i]); + } + }, + + /** + * Shifts line styles up or down + * @param {Number} lineIndex Index of a line + * @param {Number} offset Can be -1 or +1 + */ + shiftLineStyles: function(lineIndex, offset) { + // shift all line styles by 1 upward + var clonedStyles = clone(this.styles); + for (var line in this.styles) { + var numericLine = parseInt(line, 10); + if (numericLine > lineIndex) { + this.styles[numericLine + offset] = clonedStyles[numericLine]; + } + } + }, + + /** + * Removes style object + * @param {Boolean} isBeginningOfLine True if cursor is at the beginning of line + * @param {Number} [index] Optional index. When not given, current selectionStart is used. + */ + removeStyleObject: function(isBeginningOfLine, index) { + + var cursorLocation = this.get2DCursorLocation(index), + lineIndex = cursorLocation.lineIndex, + charIndex = cursorLocation.charIndex; + + if (isBeginningOfLine) { + + var textOnPreviousLine = this._textLines[lineIndex - 1], + newCharIndexOnPrevLine = textOnPreviousLine + ? textOnPreviousLine.length + : 0; + + if (!this.styles[lineIndex - 1]) { + this.styles[lineIndex - 1] = { }; + } + + for (charIndex in this.styles[lineIndex]) { + this.styles[lineIndex - 1][parseInt(charIndex, 10) + newCharIndexOnPrevLine] + = this.styles[lineIndex][charIndex]; + } + + this.shiftLineStyles(lineIndex, -1); + } + else { + var currentLineStyles = this.styles[lineIndex]; + + if (currentLineStyles) { + var offset = this.selectionStart === this.selectionEnd ? -1 : 0; + delete currentLineStyles[charIndex + offset]; + // console.log('deleting', lineIndex, charIndex + offset); + } + + var currentLineStylesCloned = clone(currentLineStyles); + + // shift all styles by 1 backwards + for (var i in currentLineStylesCloned) { + var numericIndex = parseInt(i, 10); + if (numericIndex >= charIndex && numericIndex !== 0) { + currentLineStyles[numericIndex - 1] = currentLineStylesCloned[numericIndex]; + delete currentLineStyles[numericIndex]; + } + } + } + }, + + /** + * Inserts new line + */ + insertNewline: function() { + this.insertChars('\n'); + } + }); +})(); + + +fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ { + /** + * Initializes "dbclick" event handler + */ + initDoubleClickSimulation: function() { + + // for double click + this.__lastClickTime = +new Date(); + + // for triple click + this.__lastLastClickTime = +new Date(); + + this.__lastPointer = { }; + + this.on('mousedown', this.onMouseDown.bind(this)); + }, + + onMouseDown: function(options) { + + this.__newClickTime = +new Date(); + var newPointer = this.canvas.getPointer(options.e); + + if (this.isTripleClick(newPointer)) { + this.fire('tripleclick', options); + this._stopEvent(options.e); + } + else if (this.isDoubleClick(newPointer)) { + this.fire('dblclick', options); + this._stopEvent(options.e); + } + + this.__lastLastClickTime = this.__lastClickTime; + this.__lastClickTime = this.__newClickTime; + this.__lastPointer = newPointer; + this.__lastIsEditing = this.isEditing; + this.__lastSelected = this.selected; + }, + + isDoubleClick: function(newPointer) { + return this.__newClickTime - this.__lastClickTime < 500 && + this.__lastPointer.x === newPointer.x && + this.__lastPointer.y === newPointer.y && this.__lastIsEditing; + }, + + isTripleClick: function(newPointer) { + return this.__newClickTime - this.__lastClickTime < 500 && + this.__lastClickTime - this.__lastLastClickTime < 500 && + this.__lastPointer.x === newPointer.x && + this.__lastPointer.y === newPointer.y; + }, + + /** + * @private + */ + _stopEvent: function(e) { + e.preventDefault && e.preventDefault(); + e.stopPropagation && e.stopPropagation(); + }, + + /** + * Initializes event handlers related to cursor or selection + */ + initCursorSelectionHandlers: function() { + this.initSelectedHandler(); + this.initMousedownHandler(); + this.initMouseupHandler(); + this.initClicks(); + }, + + /** + * Initializes double and triple click event handlers + */ + initClicks: function() { + this.on('dblclick', function(options) { + this.selectWord(this.getSelectionStartFromPointer(options.e)); + }); + this.on('tripleclick', function(options) { + this.selectLine(this.getSelectionStartFromPointer(options.e)); + }); + }, + + /** + * Initializes "mousedown" event handler + */ + initMousedownHandler: function() { + this.on('mousedown', function(options) { + + var pointer = this.canvas.getPointer(options.e); + + this.__mousedownX = pointer.x; + this.__mousedownY = pointer.y; + this.__isMousedown = true; + + if (this.hiddenTextarea && this.canvas) { + this.canvas.wrapperEl.appendChild(this.hiddenTextarea); + } + + if (this.selected) { + this.setCursorByClick(options.e); + } + + if (this.isEditing) { + this.__selectionStartOnMouseDown = this.selectionStart; + this.initDelayedCursor(true); + } + }); + }, + + /** + * @private + */ + _isObjectMoved: function(e) { + var pointer = this.canvas.getPointer(e); + + return this.__mousedownX !== pointer.x || + this.__mousedownY !== pointer.y; + }, + + /** + * Initializes "mouseup" event handler + */ + initMouseupHandler: function() { + this.on('mouseup', function(options) { + this.__isMousedown = false; + if (this._isObjectMoved(options.e)) { + return; + } + + if (this.__lastSelected) { + this.enterEditing(); + this.initDelayedCursor(true); + } + this.selected = true; + }); + }, + + /** + * Changes cursor location in a text depending on passed pointer (x/y) object + * @param {Event} e Event object + */ + setCursorByClick: function(e) { + var newSelectionStart = this.getSelectionStartFromPointer(e); + + if (e.shiftKey) { + if (newSelectionStart < this.selectionStart) { + this.setSelectionEnd(this.selectionStart); + this.setSelectionStart(newSelectionStart); + } + else { + this.setSelectionEnd(newSelectionStart); + } + } + else { + this.setSelectionStart(newSelectionStart); + this.setSelectionEnd(newSelectionStart); + } + }, + + /** + * @private + * @param {Event} e Event object + * @return {Object} Coordinates of a pointer (x, y) + */ + _getLocalRotatedPointer: function(e) { + var pointer = this.canvas.getPointer(e), + + pClicked = new fabric.Point(pointer.x, pointer.y), + pLeftTop = new fabric.Point(this.left, this.top), + + rotated = fabric.util.rotatePoint( + pClicked, pLeftTop, fabric.util.degreesToRadians(-this.angle)); + + return this.getLocalPointer(e, rotated); + }, + + /** + * Returns index of a character corresponding to where an object was clicked + * @param {Event} e Event object + * @return {Number} Index of a character + */ + getSelectionStartFromPointer: function(e) { + var mouseOffset = this._getLocalRotatedPointer(e), + prevWidth = 0, + width = 0, + height = 0, + charIndex = 0, + newSelectionStart, + line; + + for (var i = 0, len = this._textLines.length; i < len; i++) { + line = this._textLines[i].split(''); + height += this._getHeightOfLine(this.ctx, i) * this.scaleY; + + var widthOfLine = this._getLineWidth(this.ctx, i), + lineLeftOffset = this._getLineLeftOffset(widthOfLine); + + width = lineLeftOffset * this.scaleX; + + if (this.flipX) { + // when oject is horizontally flipped we reverse chars + this._textLines[i] = line.reverse().join(''); + } + + for (var j = 0, jlen = line.length; j < jlen; j++) { + + var _char = line[j]; + prevWidth = width; + + width += this._getWidthOfChar(this.ctx, _char, i, this.flipX ? jlen - j : j) * + this.scaleX; + + if (height <= mouseOffset.y || width <= mouseOffset.x) { + charIndex++; + continue; + } + + return this._getNewSelectionStartFromOffset( + mouseOffset, prevWidth, width, charIndex + i, jlen); + } + + if (mouseOffset.y < height) { + return this._getNewSelectionStartFromOffset( + mouseOffset, prevWidth, width, charIndex + i, jlen); + } + } + + // clicked somewhere after all chars, so set at the end + if (typeof newSelectionStart === 'undefined') { + return this.text.length; + } + }, + + /** + * @private + */ + _getNewSelectionStartFromOffset: function(mouseOffset, prevWidth, width, index, jlen) { + + var distanceBtwLastCharAndCursor = mouseOffset.x - prevWidth, + distanceBtwNextCharAndCursor = width - mouseOffset.x, + offset = distanceBtwNextCharAndCursor > distanceBtwLastCharAndCursor ? 0 : 1, + newSelectionStart = index + offset; + + // if object is horizontally flipped, mirror cursor location from the end + if (this.flipX) { + newSelectionStart = jlen - newSelectionStart; + } + + if (newSelectionStart > this.text.length) { + newSelectionStart = this.text.length; + } + + return newSelectionStart; + } +}); + + +fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ { + + /** + * Initializes hidden textarea (needed to bring up keyboard in iOS) + */ + initHiddenTextarea: function() { + this.hiddenTextarea = fabric.document.createElement('textarea'); + + this.hiddenTextarea.setAttribute('autocapitalize', 'off'); + this.hiddenTextarea.style.cssText = 'position: fixed; bottom: 20px; left: 0px; opacity: 0;' + + ' width: 0px; height: 0px; z-index: -999;'; + fabric.document.body.appendChild(this.hiddenTextarea); + + fabric.util.addListener(this.hiddenTextarea, 'keydown', this.onKeyDown.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'keypress', this.onKeyPress.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'copy', this.copy.bind(this)); + fabric.util.addListener(this.hiddenTextarea, 'paste', this.paste.bind(this)); + + if (!this._clickHandlerInitialized && this.canvas) { + fabric.util.addListener(this.canvas.upperCanvasEl, 'click', this.onClick.bind(this)); + this._clickHandlerInitialized = true; + } + }, + + /** + * @private + */ + _keysMap: { + 8: 'removeChars', + 9: 'exitEditing', + 27: 'exitEditing', + 13: 'insertNewline', + 33: 'moveCursorUp', + 34: 'moveCursorDown', + 35: 'moveCursorRight', + 36: 'moveCursorLeft', + 37: 'moveCursorLeft', + 38: 'moveCursorUp', + 39: 'moveCursorRight', + 40: 'moveCursorDown', + 46: 'forwardDelete' + }, + + /** + * @private + */ + _ctrlKeysMap: { + 65: 'selectAll', + 88: 'cut' + }, + + onClick: function() { + // No need to trigger click event here, focus is enough to have the keyboard appear on Android + this.hiddenTextarea && this.hiddenTextarea.focus(); + }, + + /** + * Handles keyup event + * @param {Event} e Event object + */ + onKeyDown: function(e) { + if (!this.isEditing) { + return; + } + if (e.keyCode in this._keysMap) { + this[this._keysMap[e.keyCode]](e); + } + else if ((e.keyCode in this._ctrlKeysMap) && (e.ctrlKey || e.metaKey)) { + this[this._ctrlKeysMap[e.keyCode]](e); + } + else { + return; + } + e.stopImmediatePropagation(); + e.preventDefault(); + this.canvas && this.canvas.renderAll(); + }, + + /** + * Forward delete + */ + forwardDelete: function(e) { + if (this.selectionStart === this.selectionEnd) { + this.moveCursorRight(e); + } + this.removeChars(e); + }, + + /** + * Copies selected text + * @param {Event} e Event object + */ + copy: function(e) { + var selectedText = this.getSelectedText(), + clipboardData = this._getClipboardData(e); + + // Check for backward compatibility with old browsers + if (clipboardData) { + clipboardData.setData('text', selectedText); + } + + this.copiedText = selectedText; + this.copiedStyles = this.getSelectionStyles( + this.selectionStart, + this.selectionEnd); + }, + + /** + * Pastes text + * @param {Event} e Event object + */ + paste: function(e) { + var copiedText = null, + clipboardData = this._getClipboardData(e); + + // Check for backward compatibility with old browsers + if (clipboardData) { + copiedText = clipboardData.getData('text'); + } + else { + copiedText = this.copiedText; + } + + if (copiedText) { + this.insertChars(copiedText, true); + } + }, + + /** + * Cuts text + * @param {Event} e Event object + */ + cut: function(e) { + if (this.selectionStart === this.selectionEnd) { + return; + } + + this.copy(); + this.removeChars(e); + }, + + /** + * @private + * @param {Event} e Event object + * @return {Object} Clipboard data object + */ + _getClipboardData: function(e) { + return e && (e.clipboardData || fabric.window.clipboardData); + }, + + /** + * Handles keypress event + * @param {Event} e Event object + */ + onKeyPress: function(e) { + if (!this.isEditing || e.metaKey || e.ctrlKey) { + return; + } + if (e.which !== 0) { + this.insertChars(String.fromCharCode(e.which)); + } + e.stopPropagation(); + }, + + /** + * Gets start offset of a selection + * @param {Event} e Event object + * @param {Boolean} isRight + * @return {Number} + */ + getDownCursorOffset: function(e, isRight) { + var selectionProp = isRight ? this.selectionEnd : this.selectionStart, + _char, lineLeftOffset, + textBeforeCursor = this.text.slice(0, selectionProp), + textAfterCursor = this.text.slice(selectionProp), + + textOnSameLineBeforeCursor = textBeforeCursor.slice(textBeforeCursor.lastIndexOf('\n') + 1), + textOnSameLineAfterCursor = textAfterCursor.match(/(.*)\n?/)[1], + textOnNextLine = (textAfterCursor.match(/.*\n(.*)\n?/) || { })[1] || '', + + cursorLocation = this.get2DCursorLocation(selectionProp); + + // if on last line, down cursor goes to end of line + if (cursorLocation.lineIndex === this._textLines.length - 1 || e.metaKey || e.keyCode === 34) { + + // move to the end of a text + return this.text.length - selectionProp; + } + + var widthOfSameLineBeforeCursor = this._getLineWidth(this.ctx, cursorLocation.lineIndex); + lineLeftOffset = this._getLineLeftOffset(widthOfSameLineBeforeCursor); + + var widthOfCharsOnSameLineBeforeCursor = lineLeftOffset, + lineIndex = cursorLocation.lineIndex; + + for (var i = 0, len = textOnSameLineBeforeCursor.length; i < len; i++) { + _char = textOnSameLineBeforeCursor[i]; + widthOfCharsOnSameLineBeforeCursor += this._getWidthOfChar(this.ctx, _char, lineIndex, i); + } + + var indexOnNextLine = this._getIndexOnNextLine( + cursorLocation, textOnNextLine, widthOfCharsOnSameLineBeforeCursor); + + return textOnSameLineAfterCursor.length + 1 + indexOnNextLine; + }, + + /** + * @private + */ + _getIndexOnNextLine: function(cursorLocation, textOnNextLine, widthOfCharsOnSameLineBeforeCursor) { + var lineIndex = cursorLocation.lineIndex + 1, + widthOfNextLine = this._getLineWidth(this.ctx, lineIndex), + lineLeftOffset = this._getLineLeftOffset(widthOfNextLine), + widthOfCharsOnNextLine = lineLeftOffset, + indexOnNextLine = 0, + foundMatch; + + for (var j = 0, jlen = textOnNextLine.length; j < jlen; j++) { + + var _char = textOnNextLine[j], + widthOfChar = this._getWidthOfChar(this.ctx, _char, lineIndex, j); + + widthOfCharsOnNextLine += widthOfChar; + + if (widthOfCharsOnNextLine > widthOfCharsOnSameLineBeforeCursor) { + + foundMatch = true; + + var leftEdge = widthOfCharsOnNextLine - widthOfChar, + rightEdge = widthOfCharsOnNextLine, + offsetFromLeftEdge = Math.abs(leftEdge - widthOfCharsOnSameLineBeforeCursor), + offsetFromRightEdge = Math.abs(rightEdge - widthOfCharsOnSameLineBeforeCursor); + + indexOnNextLine = offsetFromRightEdge < offsetFromLeftEdge ? j + 1 : j; + + break; + } + } + + // reached end + if (!foundMatch) { + indexOnNextLine = textOnNextLine.length; + } + + return indexOnNextLine; + }, + + /** + * Moves cursor down + * @param {Event} e Event object + */ + moveCursorDown: function(e) { + this.abortCursorAnimation(); + this._currentCursorOpacity = 1; + + var offset = this.getDownCursorOffset(e, this._selectionDirection === 'right'); + + if (e.shiftKey) { + this.moveCursorDownWithShift(offset); + } + else { + this.moveCursorDownWithoutShift(offset); + } + + this.initDelayedCursor(); + }, + + /** + * Moves cursor down without keeping selection + * @param {Number} offset + */ + moveCursorDownWithoutShift: function(offset) { + this._selectionDirection = 'right'; + this.setSelectionStart(this.selectionStart + offset); + this.setSelectionEnd(this.selectionStart); + }, + + /** + * private + */ + swapSelectionPoints: function() { + var swapSel = this.selectionEnd; + this.setSelectionEnd(this.selectionStart); + this.setSelectionStart(swapSel); + }, + + /** + * Moves cursor down while keeping selection + * @param {Number} offset + */ + moveCursorDownWithShift: function(offset) { + if (this.selectionEnd === this.selectionStart) { + this._selectionDirection = 'right'; + } + if (this._selectionDirection === 'right') { + this.setSelectionEnd(this.selectionEnd + offset); + } + else { + this.setSelectionStart(this.selectionStart + offset); + } + if (this.selectionEnd < this.selectionStart && this._selectionDirection === 'left') { + this.swapSelectionPoints(); + this._selectionDirection = 'right'; + } + if (this.selectionEnd > this.text.length) { + this.setSelectionEnd(this.text.length); + } + }, + + /** + * @param {Event} e Event object + * @param {Boolean} isRight + * @return {Number} + */ + getUpCursorOffset: function(e, isRight) { + var selectionProp = isRight ? this.selectionEnd : this.selectionStart, + cursorLocation = this.get2DCursorLocation(selectionProp); + // if on first line, up cursor goes to start of line + if (cursorLocation.lineIndex === 0 || e.metaKey || e.keyCode === 33) { + return selectionProp; + } + + var textBeforeCursor = this.text.slice(0, selectionProp), + textOnSameLineBeforeCursor = textBeforeCursor.slice(textBeforeCursor.lastIndexOf('\n') + 1), + textOnPreviousLine = (textBeforeCursor.match(/\n?(.*)\n.*$/) || {})[1] || '', + _char, + widthOfSameLineBeforeCursor = this._getLineWidth(this.ctx, cursorLocation.lineIndex), + lineLeftOffset = this._getLineLeftOffset(widthOfSameLineBeforeCursor), + widthOfCharsOnSameLineBeforeCursor = lineLeftOffset, + lineIndex = cursorLocation.lineIndex; + + for (var i = 0, len = textOnSameLineBeforeCursor.length; i < len; i++) { + _char = textOnSameLineBeforeCursor[i]; + widthOfCharsOnSameLineBeforeCursor += this._getWidthOfChar(this.ctx, _char, lineIndex, i); + } + + var indexOnPrevLine = this._getIndexOnPrevLine( + cursorLocation, textOnPreviousLine, widthOfCharsOnSameLineBeforeCursor); + + return textOnPreviousLine.length - indexOnPrevLine + textOnSameLineBeforeCursor.length; + }, + + /** + * @private + */ + _getIndexOnPrevLine: function(cursorLocation, textOnPreviousLine, widthOfCharsOnSameLineBeforeCursor) { + + var lineIndex = cursorLocation.lineIndex - 1, + widthOfPreviousLine = this._getLineWidth(this.ctx, lineIndex), + lineLeftOffset = this._getLineLeftOffset(widthOfPreviousLine), + widthOfCharsOnPreviousLine = lineLeftOffset, + indexOnPrevLine = 0, + foundMatch; + + for (var j = 0, jlen = textOnPreviousLine.length; j < jlen; j++) { + + var _char = textOnPreviousLine[j], + widthOfChar = this._getWidthOfChar(this.ctx, _char, lineIndex, j); + + widthOfCharsOnPreviousLine += widthOfChar; + + if (widthOfCharsOnPreviousLine > widthOfCharsOnSameLineBeforeCursor) { + + foundMatch = true; + + var leftEdge = widthOfCharsOnPreviousLine - widthOfChar, + rightEdge = widthOfCharsOnPreviousLine, + offsetFromLeftEdge = Math.abs(leftEdge - widthOfCharsOnSameLineBeforeCursor), + offsetFromRightEdge = Math.abs(rightEdge - widthOfCharsOnSameLineBeforeCursor); + + indexOnPrevLine = offsetFromRightEdge < offsetFromLeftEdge ? j : (j - 1); + + break; + } + } + + // reached end + if (!foundMatch) { + indexOnPrevLine = textOnPreviousLine.length - 1; + } + + return indexOnPrevLine; + }, + + /** + * Moves cursor up + * @param {Event} e Event object + */ + moveCursorUp: function(e) { + + this.abortCursorAnimation(); + this._currentCursorOpacity = 1; + + var offset = this.getUpCursorOffset(e, this._selectionDirection === 'right'); + if (e.shiftKey) { + this.moveCursorUpWithShift(offset); + } + else { + this.moveCursorUpWithoutShift(offset); + } + + this.initDelayedCursor(); + }, + + /** + * Moves cursor up with shift + * @param {Number} offset + */ + moveCursorUpWithShift: function(offset) { + if (this.selectionEnd === this.selectionStart) { + this._selectionDirection = 'left'; + } + if (this._selectionDirection === 'right') { + this.setSelectionEnd(this.selectionEnd - offset); + } + else { + this.setSelectionStart(this.selectionStart - offset); + } + if (this.selectionEnd < this.selectionStart && this._selectionDirection === 'right') { + this.swapSelectionPoints(); + this._selectionDirection = 'left'; + } + }, + + /** + * Moves cursor up without shift + * @param {Number} offset + */ + moveCursorUpWithoutShift: function(offset) { + if (this.selectionStart === this.selectionEnd) { + this.setSelectionStart(this.selectionStart - offset); + } + this.setSelectionEnd(this.selectionStart); + + this._selectionDirection = 'left'; + }, + + /** + * Moves cursor left + * @param {Event} e Event object + */ + moveCursorLeft: function(e) { + if (this.selectionStart === 0 && this.selectionEnd === 0) { + return; + } + + this.abortCursorAnimation(); + this._currentCursorOpacity = 1; + + if (e.shiftKey) { + this.moveCursorLeftWithShift(e); + } + else { + this.moveCursorLeftWithoutShift(e); + } + + this.initDelayedCursor(); + }, + + /** + * @private + */ + _move: function(e, prop, direction) { + var propMethod = (prop === 'selectionStart' ? 'setSelectionStart' : 'setSelectionEnd'); + if (e.altKey) { + this[propMethod](this['findWordBoundary' + direction](this[prop])); + } + else if (e.metaKey || e.keyCode === 35 || e.keyCode === 36 ) { + this[propMethod](this['findLineBoundary' + direction](this[prop])); + } + else { + this[propMethod](this[prop] + (direction === 'Left' ? -1 : 1)); + } + }, + + /** + * @private + */ + _moveLeft: function(e, prop) { + this._move(e, prop, 'Left'); + }, + + /** + * @private + */ + _moveRight: function(e, prop) { + this._move(e, prop, 'Right'); + }, + + /** + * Moves cursor left without keeping selection + * @param {Event} e + */ + moveCursorLeftWithoutShift: function(e) { + this._selectionDirection = 'left'; + + // only move cursor when there is no selection, + // otherwise we discard it, and leave cursor on same place + if (this.selectionEnd === this.selectionStart) { + this._moveLeft(e, 'selectionStart'); + } + this.setSelectionEnd(this.selectionStart); + }, + + /** + * Moves cursor left while keeping selection + * @param {Event} e + */ + moveCursorLeftWithShift: function(e) { + if (this._selectionDirection === 'right' && this.selectionStart !== this.selectionEnd) { + this._moveLeft(e, 'selectionEnd'); + } + else { + this._selectionDirection = 'left'; + this._moveLeft(e, 'selectionStart'); + + // increase selection by one if it's a newline + if (this.text.charAt(this.selectionStart) === '\n') { + this.setSelectionStart(this.selectionStart - 1); + } + } + }, + + /** + * Moves cursor right + * @param {Event} e Event object + */ + moveCursorRight: function(e) { + if (this.selectionStart >= this.text.length && this.selectionEnd >= this.text.length) { + return; + } + + this.abortCursorAnimation(); + this._currentCursorOpacity = 1; + + if (e.shiftKey) { + this.moveCursorRightWithShift(e); + } + else { + this.moveCursorRightWithoutShift(e); + } + + this.initDelayedCursor(); + }, + + /** + * Moves cursor right while keeping selection + * @param {Event} e + */ + moveCursorRightWithShift: function(e) { + if (this._selectionDirection === 'left' && this.selectionStart !== this.selectionEnd) { + this._moveRight(e, 'selectionStart'); + } + else { + this._selectionDirection = 'right'; + this._moveRight(e, 'selectionEnd'); + + // increase selection by one if it's a newline + if (this.text.charAt(this.selectionEnd - 1) === '\n') { + this.setSelectionEnd(this.selectionEnd + 1); + } + } + }, + + /** + * Moves cursor right without keeping selection + * @param {Event} e Event object + */ + moveCursorRightWithoutShift: function(e) { + this._selectionDirection = 'right'; + + if (this.selectionStart === this.selectionEnd) { + this._moveRight(e, 'selectionStart'); + this.setSelectionEnd(this.selectionStart); + } + else { + this.setSelectionEnd(this.selectionEnd + this.getNumNewLinesInSelectedText()); + this.setSelectionStart(this.selectionEnd); + } + }, + + /** + * Removes characters selected by selection + * @param {Event} e Event object + */ + removeChars: function(e) { + if (this.selectionStart === this.selectionEnd) { + this._removeCharsNearCursor(e); + } + else { + this._removeCharsFromTo(this.selectionStart, this.selectionEnd); + } + + this.setSelectionEnd(this.selectionStart); + + this._removeExtraneousStyles(); + + this._clearCache(); + this.canvas && this.canvas.renderAll(); + + this.setCoords(); + this.fire('changed'); + this.canvas && this.canvas.fire('text:changed', { target: this }); + }, + + /** + * @private + * @param {Event} e Event object + */ + _removeCharsNearCursor: function(e) { + if (this.selectionStart !== 0) { + + if (e.metaKey) { + // remove all till the start of current line + var leftLineBoundary = this.findLineBoundaryLeft(this.selectionStart); + + this._removeCharsFromTo(leftLineBoundary, this.selectionStart); + this.setSelectionStart(leftLineBoundary); + } + else if (e.altKey) { + // remove all till the start of current word + var leftWordBoundary = this.findWordBoundaryLeft(this.selectionStart); + + this._removeCharsFromTo(leftWordBoundary, this.selectionStart); + this.setSelectionStart(leftWordBoundary); + } + else { + var isBeginningOfLine = this.text.slice(this.selectionStart - 1, this.selectionStart) === '\n'; + this.removeStyleObject(isBeginningOfLine); + this.setSelectionStart(this.selectionStart - 1); + this.text = this.text.slice(0, this.selectionStart) + + this.text.slice(this.selectionStart + 1); + } + } + } +}); + + +/* _TO_SVG_START_ */ +fabric.util.object.extend(fabric.IText.prototype, /** @lends fabric.IText.prototype */ { + + /** + * @private + */ + _setSVGTextLineText: function(lineIndex, textSpans, height, textLeftOffset, textTopOffset, textBgRects) { + if (!this.styles[lineIndex]) { + this.callSuper('_setSVGTextLineText', + lineIndex, textSpans, height, textLeftOffset, textTopOffset); + } + else { + this._setSVGTextLineChars( + lineIndex, textSpans, height, textLeftOffset, textBgRects); + } + }, + + /** + * @private + */ + _setSVGTextLineChars: function(lineIndex, textSpans, height, textLeftOffset, textBgRects) { + + var chars = this._textLines[lineIndex].split(''), + charOffset = 0, + lineLeftOffset = this._getSVGLineLeftOffset(lineIndex) - this.width / 2, + lineOffset = this._getSVGLineTopOffset(lineIndex), + heightOfLine = this._getHeightOfLine(this.ctx, lineIndex); + + for (var i = 0, len = chars.length; i < len; i++) { + var styleDecl = this.styles[lineIndex][i] || { }; + + textSpans.push( + this._createTextCharSpan( + chars[i], styleDecl, lineLeftOffset, lineOffset.lineTop + lineOffset.offset, charOffset)); + + var charWidth = this._getWidthOfChar(this.ctx, chars[i], lineIndex, i); + + if (styleDecl.textBackgroundColor) { + textBgRects.push( + this._createTextCharBg( + styleDecl, lineLeftOffset, lineOffset.lineTop, heightOfLine, charWidth, charOffset)); + } + + charOffset += charWidth; + } + }, + + /** + * @private + */ + _getSVGLineLeftOffset: function(lineIndex) { + return fabric.util.toFixed(this._getLineLeftOffset(this.__lineWidths[lineIndex]), 2); + }, + + /** + * @private + */ + _getSVGLineTopOffset: function(lineIndex) { + var lineTopOffset = 0, lastHeight = 0; + for (var j = 0; j < lineIndex; j++) { + lineTopOffset += this._getHeightOfLine(this.ctx, j); + } + lastHeight = this._getHeightOfLine(this.ctx, j); + return { + lineTop: lineTopOffset, + offset: (this._fontSizeMult - this._fontSizeFraction) * lastHeight / (this.lineHeight * this._fontSizeMult) + }; + }, + + /** + * @private + */ + _createTextCharBg: function(styleDecl, lineLeftOffset, lineTopOffset, heightOfLine, charWidth, charOffset) { + return [ + //jscs:disable validateIndentation + '' + //jscs:enable validateIndentation + ].join(''); + }, + + /** + * @private + */ + _createTextCharSpan: function(_char, styleDecl, lineLeftOffset, lineTopOffset, charOffset) { + + var fillStyles = this.getSvgStyles.call(fabric.util.object.extend({ + visible: true, + fill: this.fill, + stroke: this.stroke, + type: 'text' + }, styleDecl)); + + return [ + //jscs:disable validateIndentation + '', + fabric.util.string.escapeXml(_char), + '' + //jscs:enable validateIndentation + ].join(''); + } +}); +/* _TO_SVG_END_ */ + + +(function() { + + if (typeof document !== 'undefined' && typeof window !== 'undefined') { + return; + } + + var DOMParser = require('xmldom').DOMParser, + URL = require('url'), + HTTP = require('http'), + HTTPS = require('https'), + + Canvas = require('canvas'), + Image = require('canvas').Image; + + /** @private */ + function request(url, encoding, callback) { + var oURL = URL.parse(url); + + // detect if http or https is used + if ( !oURL.port ) { + oURL.port = ( oURL.protocol.indexOf('https:') === 0 ) ? 443 : 80; + } + + // assign request handler based on protocol + var reqHandler = (oURL.protocol.indexOf('https:') === 0 ) ? HTTPS : HTTP, + req = reqHandler.request({ + hostname: oURL.hostname, + port: oURL.port, + path: oURL.path, + method: 'GET' + }, function(response) { + var body = ''; + if (encoding) { + response.setEncoding(encoding); + } + response.on('end', function () { + callback(body); + }); + response.on('data', function (chunk) { + if (response.statusCode === 200) { + body += chunk; + } + }); + }); + + req.on('error', function(err) { + if (err.errno === process.ECONNREFUSED) { + fabric.log('ECONNREFUSED: connection refused to ' + oURL.hostname + ':' + oURL.port); + } + else { + fabric.log(err.message); + } + }); + + req.end(); + } + + /** @private */ + function requestFs(path, callback) { + var fs = require('fs'); + fs.readFile(path, function (err, data) { + if (err) { + fabric.log(err); + throw err; + } + else { + callback(data); + } + }); + } + + fabric.util.loadImage = function(url, callback, context) { + function createImageAndCallBack(data) { + img.src = new Buffer(data, 'binary'); + // preserving original url, which seems to be lost in node-canvas + img._src = url; + callback && callback.call(context, img); + } + var img = new Image(); + if (url && (url instanceof Buffer || url.indexOf('data') === 0)) { + img.src = img._src = url; + callback && callback.call(context, img); + } + else if (url && url.indexOf('http') !== 0) { + requestFs(url, createImageAndCallBack); + } + else if (url) { + request(url, 'binary', createImageAndCallBack); + } + else { + callback && callback.call(context, url); + } + }; + + fabric.loadSVGFromURL = function(url, callback, reviver) { + url = url.replace(/^\n\s*/, '').replace(/\?.*$/, '').trim(); + if (url.indexOf('http') !== 0) { + requestFs(url, function(body) { + fabric.loadSVGFromString(body.toString(), callback, reviver); + }); + } + else { + request(url, '', function(body) { + fabric.loadSVGFromString(body, callback, reviver); + }); + } + }; + + fabric.loadSVGFromString = function(string, callback, reviver) { + var doc = new DOMParser().parseFromString(string); + fabric.parseSVGDocument(doc.documentElement, function(results, options) { + callback && callback(results, options); + }, reviver); + }; + + fabric.util.getScript = function(url, callback) { + request(url, '', function(body) { + eval(body); + callback && callback(); + }); + }; + + fabric.Image.fromObject = function(object, callback) { + fabric.util.loadImage(object.src, function(img) { + var oImg = new fabric.Image(img); + + oImg._initConfig(object); + oImg._initFilters(object, function(filters) { + oImg.filters = filters || [ ]; + callback && callback(oImg); + }); + }); + }; + + /** + * Only available when running fabric on node.js + * @param {Number} width Canvas width + * @param {Number} height Canvas height + * @param {Object} [options] Options to pass to FabricCanvas. + * @param {Object} [nodeCanvasOptions] Options to pass to NodeCanvas. + * @return {Object} wrapped canvas instance + */ + fabric.createCanvasForNode = function(width, height, options, nodeCanvasOptions) { + nodeCanvasOptions = nodeCanvasOptions || options; + + var canvasEl = fabric.document.createElement('canvas'), + nodeCanvas = new Canvas(width || 600, height || 600, nodeCanvasOptions); + + // jsdom doesn't create style on canvas element, so here be temp. workaround + canvasEl.style = { }; + + canvasEl.width = nodeCanvas.width; + canvasEl.height = nodeCanvas.height; + + var FabricCanvas = fabric.Canvas || fabric.StaticCanvas, + fabricCanvas = new FabricCanvas(canvasEl, options); + + fabricCanvas.contextContainer = nodeCanvas.getContext('2d'); + fabricCanvas.nodeCanvas = nodeCanvas; + fabricCanvas.Font = Canvas.Font; + + return fabricCanvas; + }; + + /** @ignore */ + fabric.StaticCanvas.prototype.createPNGStream = function() { + return this.nodeCanvas.createPNGStream(); + }; + + fabric.StaticCanvas.prototype.createJPEGStream = function(opts) { + return this.nodeCanvas.createJPEGStream(opts); + }; + + var origSetWidth = fabric.StaticCanvas.prototype.setWidth; + fabric.StaticCanvas.prototype.setWidth = function(width, options) { + origSetWidth.call(this, width, options); + this.nodeCanvas.width = width; + return this; + }; + if (fabric.Canvas) { + fabric.Canvas.prototype.setWidth = fabric.StaticCanvas.prototype.setWidth; + } + + var origSetHeight = fabric.StaticCanvas.prototype.setHeight; + fabric.StaticCanvas.prototype.setHeight = function(height, options) { + origSetHeight.call(this, height, options); + this.nodeCanvas.height = height; + return this; + }; + if (fabric.Canvas) { + fabric.Canvas.prototype.setHeight = fabric.StaticCanvas.prototype.setHeight; + } + +})(); diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/fabric.js/fabric.min.js b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/fabric.js/fabric.min.js new file mode 100644 index 0000000..ddd6a41 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/fabric.js/fabric.min.js @@ -0,0 +1,15 @@ +var fabric=fabric||{version:"1.5.0"};if(typeof exports!=="undefined"){exports.fabric=fabric}if(typeof document!=="undefined"&&typeof window!=="undefined"){fabric.document=document;fabric.window=window;window.fabric=fabric}else{fabric.document=require("jsdom").jsdom("");if(fabric.document.createWindow){fabric.window=fabric.document.createWindow()}else{fabric.window=fabric.document.parentWindow}}fabric.isTouchSupported="ontouchstart"in fabric.document.documentElement;fabric.isLikelyNode=typeof Buffer!=="undefined"&&typeof window==="undefined";fabric.SHARED_ATTRIBUTES=["display","transform","fill","fill-opacity","fill-rule","opacity","stroke","stroke-dasharray","stroke-linecap","stroke-linejoin","stroke-miterlimit","stroke-opacity","stroke-width"];fabric.DPI=96;fabric.reNum="(?:[-+]?(?:\\d+|\\d*\\.\\d+)(?:e[-+]?\\d+)?)";(function(){function _removeEventListener(eventName,handler){if(!this.__eventListeners[eventName]){return}if(handler){fabric.util.removeFromArray(this.__eventListeners[eventName],handler)}else{this.__eventListeners[eventName].length=0}}function observe(eventName,handler){if(!this.__eventListeners){this.__eventListeners={}}if(arguments.length===1){for(var prop in eventName){this.on(prop,eventName[prop])}}else{if(!this.__eventListeners[eventName]){this.__eventListeners[eventName]=[]}this.__eventListeners[eventName].push(handler)}return this}function stopObserving(eventName,handler){if(!this.__eventListeners){return}if(arguments.length===0){this.__eventListeners={}}else if(arguments.length===1&&typeof arguments[0]==="object"){for(var prop in eventName){_removeEventListener.call(this,prop,eventName[prop])}}else{_removeEventListener.call(this,eventName,handler)}return this}function fire(eventName,options){if(!this.__eventListeners){return}var listenersForEvent=this.__eventListeners[eventName];if(!listenersForEvent){return}for(var i=0,len=listenersForEvent.length;i-1},complexity:function(){return this.getObjects().reduce(function(memo,current){memo+=current.complexity?current.complexity():0;return memo},0)}};(function(global){var sqrt=Math.sqrt,atan2=Math.atan2,PiBy180=Math.PI/180;fabric.util={removeFromArray:function(array,value){var idx=array.indexOf(value);if(idx!==-1){array.splice(idx,1)}return array},getRandomInt:function(min,max){return Math.floor(Math.random()*(max-min+1))+min},degreesToRadians:function(degrees){return degrees*PiBy180},radiansToDegrees:function(radians){return radians/PiBy180},rotatePoint:function(point,origin,radians){var sin=Math.sin(radians),cos=Math.cos(radians);point.subtractEquals(origin);var rx=point.x*cos-point.y*sin,ry=point.x*sin+point.y*cos;return new fabric.Point(rx,ry).addEquals(origin)},transformPoint:function(p,t,ignoreOffset){if(ignoreOffset){return new fabric.Point(t[0]*p.x+t[2]*p.y,t[1]*p.x+t[3]*p.y)}return new fabric.Point(t[0]*p.x+t[2]*p.y+t[4],t[1]*p.x+t[3]*p.y+t[5])},invertTransform:function(t){var r=t.slice(),a=1/(t[0]*t[3]-t[1]*t[2]);r=[a*t[3],-a*t[1],-a*t[2],a*t[0],0,0];var o=fabric.util.transformPoint({x:t[4],y:t[5]},r);r[4]=-o.x;r[5]=-o.y;return r},toFixed:function(number,fractionDigits){return parseFloat(Number(number).toFixed(fractionDigits))},parseUnit:function(value,fontSize){var unit=/\D{0,2}$/.exec(value),number=parseFloat(value);if(!fontSize){fontSize=fabric.Text.DEFAULT_SVG_FONT_SIZE}switch(unit[0]){case"mm":return number*fabric.DPI/25.4;case"cm":return number*fabric.DPI/2.54;case"in":return number*fabric.DPI;case"pt":return number*fabric.DPI/72;case"pc":return number*fabric.DPI/72*12;case"em":return number*fontSize;default:return number}},falseFunction:function(){return false},getKlass:function(type,namespace){type=fabric.util.string.camelize(type.charAt(0).toUpperCase()+type.slice(1));return fabric.util.resolveNamespace(namespace)[type]},resolveNamespace:function(namespace){if(!namespace){return fabric}var parts=namespace.split("."),len=parts.length,obj=global||fabric.window;for(var i=0;ix){x+=da[di++%dc];if(x>len){x=len}ctx[draw?"lineTo":"moveTo"](x,0);draw=!draw}ctx.restore()},createCanvasElement:function(canvasEl){canvasEl||(canvasEl=fabric.document.createElement("canvas"));if(!canvasEl.getContext&&typeof G_vmlCanvasManager!=="undefined"){G_vmlCanvasManager.initElement(canvasEl)}return canvasEl},createImage:function(){return fabric.isLikelyNode?new(require("canvas").Image):fabric.document.createElement("img")},createAccessors:function(klass){var proto=klass.prototype;for(var i=proto.stateProperties.length;i--;){var propName=proto.stateProperties[i],capitalizedPropName=propName.charAt(0).toUpperCase()+propName.slice(1),setterName="set"+capitalizedPropName,getterName="get"+capitalizedPropName;if(!proto[getterName]){proto[getterName]=function(property){return new Function('return this.get("'+property+'")')}(propName)}if(!proto[setterName]){proto[setterName]=function(property){return new Function("value",'return this.set("'+property+'", value)')}(propName)}}},clipContext:function(receiver,ctx){ctx.save();ctx.beginPath();receiver.clipTo(ctx);ctx.clip()},multiplyTransformMatrices:function(a,b){return[a[0]*b[0]+a[2]*b[1],a[1]*b[0]+a[3]*b[1],a[0]*b[2]+a[2]*b[3],a[1]*b[2]+a[3]*b[3],a[0]*b[4]+a[2]*b[5]+a[4],a[1]*b[4]+a[3]*b[5]+a[5]]},getFunctionBody:function(fn){return(String(fn).match(/function[^{]*\{([\s\S]*)\}/)||{})[1]},isTransparent:function(ctx,x,y,tolerance){if(tolerance>0){if(x>tolerance){x-=tolerance}else{x=0}if(y>tolerance){y-=tolerance}else{y=0}}var _isTransparent=true,imageData=ctx.getImageData(x,y,tolerance*2||1,tolerance*2||1);for(var i=3,l=imageData.data.length;i0){dtheta-=2*PI}else if(sweep===1&&dtheta<0){dtheta+=2*PI}var segments=Math.ceil(Math.abs(dtheta/PI*2)),result=[],mDelta=dtheta/segments,mT=8/3*Math.sin(mDelta/4)*Math.sin(mDelta/4)/Math.sin(mDelta/2),th3=mTheta+mDelta;for(var i=0;i=ta){return tb-ta}else{return 2*Math.PI-(ta-tb)}}fabric.util.drawArc=function(ctx,fx,fy,coords){var rx=coords[0],ry=coords[1],rot=coords[2],large=coords[3],sweep=coords[4],tx=coords[5],ty=coords[6],segs=[[],[],[],[]],segsNorm=arcToSegments(tx-fx,ty-fy,rx,ry,large,sweep,rot);for(var i=0,len=segsNorm.length;i0){b=6*y0-12*y1+6*y2;a=-3*y0+9*y1-9*y2+3*y3;c=3*y1-3*y0}if(abs(a)<1e-12){if(abs(b)<1e-12){continue}t=-c/b;if(0>>0;if(len===0){return-1}var n=0;if(arguments.length>0){n=Number(arguments[1]);if(n!==n){n=0}else if(n!==0&&n!==Number.POSITIVE_INFINITY&&n!==Number.NEGATIVE_INFINITY){n=(n>0||-1)*Math.floor(Math.abs(n))}}if(n>=len){return-1}var k=n>=0?n:Math.max(len-Math.abs(n),0);for(;k>>0;i>>0;i>>0;i>>0;i>>0;i>>0,i=0,rv;if(arguments.length>1){rv=arguments[1]}else{do{if(i in this){rv=this[i++];break}if(++i>=len){throw new TypeError}}while(true)}for(;i=value2})}function min(array,byProperty){return find(array,byProperty,function(value1,value2){return value1/g,">")}fabric.util.string={camelize:camelize,capitalize:capitalize,escapeXml:escapeXml}})();(function(){var slice=Array.prototype.slice,apply=Function.prototype.apply,Dummy=function(){};if(!Function.prototype.bind){Function.prototype.bind=function(thisArg){var _this=this,args=slice.call(arguments,1),bound;if(args.length){bound=function(){return apply.call(_this,this instanceof Dummy?this:thisArg,args.concat(slice.call(arguments)))}}else{bound=function(){return apply.call(_this,this instanceof Dummy?this:thisArg,arguments)}}Dummy.prototype=this.prototype;bound.prototype=new Dummy;return bound}}})();(function(){var slice=Array.prototype.slice,emptyFunction=function(){},IS_DONTENUM_BUGGY=function(){for(var p in{toString:1}){if(p==="toString"){return false}}return true}(),addMethods=function(klass,source,parent){for(var property in source){if(property in klass.prototype&&typeof klass.prototype[property]==="function"&&(source[property]+"").indexOf("callSuper")>-1){klass.prototype[property]=function(property){return function(){var superclass=this.constructor.superclass;this.constructor.superclass=parent;var returnValue=source[property].apply(this,arguments);this.constructor.superclass=superclass;if(property!=="initialize"){return returnValue}}}(property)}else{klass.prototype[property]=source[property]}if(IS_DONTENUM_BUGGY){if(source.toString!==Object.prototype.toString){klass.prototype.toString=source.toString}if(source.valueOf!==Object.prototype.valueOf){klass.prototype.valueOf=source.valueOf}}}};function Subclass(){}function callSuper(methodName){var fn=this.constructor.superclass.prototype[methodName];return arguments.length>1?fn.apply(this,slice.call(arguments,1)):fn.call(this)}function createClass(){var parent=null,properties=slice.call(arguments,0);if(typeof properties[0]==="function"){parent=properties.shift()}function klass(){this.initialize.apply(this,arguments)}klass.superclass=parent;klass.subclasses=[];if(parent){Subclass.prototype=parent.prototype;klass.prototype=new Subclass;parent.subclasses.push(klass)}for(var i=0,length=properties.length;i-1?setOpacity(element,styles.match(/opacity:\s*(\d?\.?\d*)/)[1]):element}for(var property in styles){if(property==="opacity"){setOpacity(element,styles[property])}else{var normalizedProperty=property==="float"||property==="cssFloat"?typeof elementStyle.styleFloat==="undefined"?"cssFloat":"styleFloat":property;elementStyle[normalizedProperty]=styles[property]}}return element}var parseEl=fabric.document.createElement("div"),supportsOpacity=typeof parseEl.style.opacity==="string",supportsFilters=typeof parseEl.style.filter==="string",reOpacity=/alpha\s*\(\s*opacity\s*=\s*([^\)]+)\)/,setOpacity=function(element){return element};if(supportsOpacity){setOpacity=function(element,value){element.style.opacity=value;return element}}else if(supportsFilters){setOpacity=function(element,value){var es=element.style;if(element.currentStyle&&!element.currentStyle.hasLayout){es.zoom=1}if(reOpacity.test(es.filter)){value=value>=.9999?"":"alpha(opacity="+value*100+")";es.filter=es.filter.replace(reOpacity,value)}else{es.filter+=" alpha(opacity="+value*100+")"}return element}}fabric.util.setStyle=setStyle})();(function(){var _slice=Array.prototype.slice;function getById(id){return typeof id==="string"?fabric.document.getElementById(id):id}var sliceCanConvertNodelists,toArray=function(arrayLike){return _slice.call(arrayLike,0)};try{sliceCanConvertNodelists=toArray(fabric.document.childNodes)instanceof Array}catch(err){}if(!sliceCanConvertNodelists){toArray=function(arrayLike){var arr=new Array(arrayLike.length),i=arrayLike.length;while(i--){arr[i]=arrayLike[i]}return arr}}function makeElement(tagName,attributes){var el=fabric.document.createElement(tagName);for(var prop in attributes){if(prop==="class"){el.className=attributes[prop]}else if(prop==="for"){el.htmlFor=attributes[prop]}else{el.setAttribute(prop,attributes[prop])}}return el}function addClass(element,className){if(element&&(" "+element.className+" ").indexOf(" "+className+" ")===-1){element.className+=(element.className?" ":"")+className}}function wrapElement(element,wrapper,attributes){if(typeof wrapper==="string"){wrapper=makeElement(wrapper,attributes)}if(element.parentNode){element.parentNode.replaceChild(wrapper,element)}wrapper.appendChild(element);return wrapper}function getScrollLeftTop(element,upperCanvasEl){var firstFixedAncestor,origElement,left=0,top=0,docElement=fabric.document.documentElement,body=fabric.document.body||{scrollLeft:0,scrollTop:0};origElement=element;while(element&&element.parentNode&&!firstFixedAncestor){element=element.parentNode;if(element.nodeType===1&&fabric.util.getElementStyle(element,"position")==="fixed"){firstFixedAncestor=element}if(element.nodeType===1&&origElement!==upperCanvasEl&&fabric.util.getElementStyle(element,"position")==="absolute"){left=0;top=0}else if(element===fabric.document){left=body.scrollLeft||docElement.scrollLeft||0;top=body.scrollTop||docElement.scrollTop||0}else{left+=element.scrollLeft||0;top+=element.scrollTop||0}}return{left:left,top:top}}function getElementOffset(element){var docElem,doc=element&&element.ownerDocument,box={left:0,top:0},offset={left:0,top:0},scrollLeftTop,offsetAttributes={borderLeftWidth:"left",borderTopWidth:"top",paddingLeft:"left",paddingTop:"top"};if(!doc){return{left:0,top:0}}for(var attr in offsetAttributes){offset[offsetAttributes[attr]]+=parseInt(getElementStyle(element,attr),10)||0}docElem=doc.documentElement;if(typeof element.getBoundingClientRect!=="undefined"){box=element.getBoundingClientRect()}scrollLeftTop=fabric.util.getScrollLeftTop(element,null);return{left:box.left+scrollLeftTop.left-(docElem.clientLeft||0)+offset.left,top:box.top+scrollLeftTop.top-(docElem.clientTop||0)+offset.top}}var getElementStyle;if(fabric.document.defaultView&&fabric.document.defaultView.getComputedStyle){getElementStyle=function(element,attr){var style=fabric.document.defaultView.getComputedStyle(element,null);return style?style[attr]:undefined}}else{getElementStyle=function(element,attr){var value=element.style[attr];if(!value&&element.currentStyle){value=element.currentStyle[attr]}return value}}(function(){var style=fabric.document.documentElement.style,selectProp="userSelect"in style?"userSelect":"MozUserSelect"in style?"MozUserSelect":"WebkitUserSelect"in style?"WebkitUserSelect":"KhtmlUserSelect"in style?"KhtmlUserSelect":"";function makeElementUnselectable(element){if(typeof element.onselectstart!=="undefined"){element.onselectstart=fabric.util.falseFunction}if(selectProp){element.style[selectProp]="none"}else if(typeof element.unselectable==="string"){element.unselectable="on"}return element}function makeElementSelectable(element){if(typeof element.onselectstart!=="undefined"){element.onselectstart=null}if(selectProp){element.style[selectProp]=""}else if(typeof element.unselectable==="string"){element.unselectable=""}return element}fabric.util.makeElementUnselectable=makeElementUnselectable;fabric.util.makeElementSelectable=makeElementSelectable})();(function(){function getScript(url,callback){var headEl=fabric.document.getElementsByTagName("head")[0],scriptEl=fabric.document.createElement("script"),loading=true;scriptEl.onload=scriptEl.onreadystatechange=function(e){if(loading){if(typeof this.readyState==="string"&&this.readyState!=="loaded"&&this.readyState!=="complete"){return}loading=false;callback(e||fabric.window.event);scriptEl=scriptEl.onload=scriptEl.onreadystatechange=null}};scriptEl.src=url;headEl.appendChild(scriptEl)}fabric.util.getScript=getScript})();fabric.util.getById=getById;fabric.util.toArray=toArray;fabric.util.makeElement=makeElement;fabric.util.addClass=addClass;fabric.util.wrapElement=wrapElement;fabric.util.getScrollLeftTop=getScrollLeftTop;fabric.util.getElementOffset=getElementOffset;fabric.util.getElementStyle=getElementStyle})();(function(){function addParamToUrl(url,param){return url+(/\?/.test(url)?"&":"?")+param}var makeXHR=function(){var factories=[function(){return new ActiveXObject("Microsoft.XMLHTTP")},function(){return new ActiveXObject("Msxml2.XMLHTTP")},function(){return new ActiveXObject("Msxml2.XMLHTTP.3.0")},function(){return new XMLHttpRequest}];for(var i=factories.length;i--;){try{var req=factories[i]();if(req){return factories[i]}}catch(err){}}}();function emptyFn(){}function request(url,options){options||(options={});var method=options.method?options.method.toUpperCase():"GET",onComplete=options.onComplete||function(){},xhr=makeXHR(),body;xhr.onreadystatechange=function(){if(xhr.readyState===4){onComplete(xhr);xhr.onreadystatechange=emptyFn}};if(method==="GET"){body=null;if(typeof options.parameters==="string"){url=addParamToUrl(url,options.parameters)}}xhr.open(method,url,true);if(method==="POST"||method==="PUT"){xhr.setRequestHeader("Content-Type","application/x-www-form-urlencoded")}xhr.send(body);return xhr}fabric.util.request=request})();fabric.log=function(){};fabric.warn=function(){};if(typeof console!=="undefined"){["log","warn"].forEach(function(methodName){if(typeof console[methodName]!=="undefined"&&typeof console[methodName].apply==="function"){fabric[methodName]=function(){return console[methodName].apply(console,arguments)}}})}(function(){function animate(options){requestAnimFrame(function(timestamp){options||(options={});var start=timestamp||+new Date,duration=options.duration||500,finish=start+duration,time,onChange=options.onChange||function(){},abort=options.abort||function(){return false},easing=options.easing||function(t,b,c,d){return-c*Math.cos(t/d*(Math.PI/2))+c+b},startValue="startValue"in options?options.startValue:0,endValue="endValue"in options?options.endValue:100,byValue=options.byValue||endValue-startValue;options.onStart&&options.onStart();(function tick(ticktime){time=ticktime||+new Date;var currentTime=time>finish?duration:time-start;if(abort()){options.onComplete&&options.onComplete();return}onChange(easing(currentTime,startValue,byValue,duration));if(time>finish){options.onComplete&&options.onComplete();return}requestAnimFrame(tick)})(start)})}var _requestAnimFrame=fabric.window.requestAnimationFrame||fabric.window.webkitRequestAnimationFrame||fabric.window.mozRequestAnimationFrame||fabric.window.oRequestAnimationFrame||fabric.window.msRequestAnimationFrame||function(callback){fabric.window.setTimeout(callback,1e3/60)};function requestAnimFrame(){return _requestAnimFrame.apply(fabric.window,arguments)}fabric.util.animate=animate;fabric.util.requestAnimFrame=requestAnimFrame})();(function(){function normalize(a,c,p,s){if(a1){matrices.shift();combinedMatrix=fabric.util.multiplyTransformMatrices(combinedMatrix,matrices[0])}return combinedMatrix}}();function parseStyleString(style,oStyle){var attr,value;style.replace(/;$/,"").split(";").forEach(function(chunk){var pair=chunk.split(":");attr=normalizeAttr(pair[0].trim().toLowerCase());value=normalizeValue(attr,pair[1].trim());oStyle[attr]=value})}function parseStyleObject(style,oStyle){var attr,value;for(var prop in style){if(typeof style[prop]==="undefined"){continue}attr=normalizeAttr(prop.toLowerCase());value=normalizeValue(attr,style[prop]);oStyle[attr]=value}}function getGlobalStylesForElement(element,svgUid){var styles={};for(var rule in fabric.cssRules[svgUid]){if(elementMatchesRule(element,rule.split(" "))){for(var property in fabric.cssRules[svgUid][rule]){styles[property]=fabric.cssRules[svgUid][rule][property]}}}return styles}function elementMatchesRule(element,selectors){var firstMatching,parentMatching=true;firstMatching=selectorMatches(element,selectors.pop());if(firstMatching&&selectors.length){parentMatching=doesSomeParentMatch(element,selectors)}return firstMatching&&parentMatching&&selectors.length===0}function doesSomeParentMatch(element,selectors){var selector,parentMatching=true;while(element.parentNode&&element.parentNode.nodeType===1&&selectors.length){if(parentMatching){selector=selectors.pop()}element=element.parentNode;parentMatching=selectorMatches(element,selector)}return selectors.length===0}function selectorMatches(element,selector){var nodeName=element.nodeName,classNames=element.getAttribute("class"),id=element.getAttribute("id"),matcher;matcher=new RegExp("^"+nodeName,"i");selector=selector.replace(matcher,"");if(id&&selector.length){matcher=new RegExp("#"+id+"(?![a-zA-Z\\-]+)","i");selector=selector.replace(matcher,"")}if(classNames&&selector.length){classNames=classNames.split(" ");for(var i=classNames.length;i--;){matcher=new RegExp("\\."+classNames[i]+"(?![a-zA-Z\\-]+)","i");selector=selector.replace(matcher,"")}}return selector.length===0}function parseUseDirectives(doc){var nodelist=doc.getElementsByTagName("use");while(nodelist.length){var el=nodelist[0],xlink=el.getAttribute("xlink:href").substr(1),x=el.getAttribute("x")||0,y=el.getAttribute("y")||0,el2=doc.getElementById(xlink).cloneNode(true),currentTrans=(el2.getAttribute("transform")||"")+" translate("+x+", "+y+")",parentNode;for(var j=0,attrs=el.attributes,l=attrs.length;jscaleY?scaleY:scaleX;if(!(scaleX!==1||scaleY!==1||minX!==0||minY!==0)){return}matrix=" matrix("+scaleX+" 0"+" 0 "+scaleY+" "+minX*scaleX+" "+minY*scaleY+") ";if(element.tagName==="svg"){el=element.ownerDocument.createElement("g");while(element.firstChild!=null){el.appendChild(element.firstChild)}element.appendChild(el)}else{el=element;matrix=el.getAttribute("transform")+matrix}el.setAttribute("transform",matrix)}fabric.parseSVGDocument=function(){var reAllowedSVGTagNames=/^(path|circle|polygon|polyline|ellipse|rect|line|image|text)$/,reViewBoxTagNames=/^(symbol|image|marker|pattern|view)$/;function hasAncestorWithNodeName(element,nodeName){while(element&&(element=element.parentNode)){if(nodeName.test(element.nodeName)&&!element.getAttribute("instantiated_by_use")){return true}}return false}return function(doc,callback,reviver){if(!doc){return}parseUseDirectives(doc);var startTime=new Date,svgUid=fabric.Object.__uid++,widthAttr,heightAttr,toBeParsed=false;if(doc.getAttribute("width")&&doc.getAttribute("width")!=="100%"){widthAttr=parseUnit(doc.getAttribute("width"))}if(doc.getAttribute("height")&&doc.getAttribute("height")!=="100%"){heightAttr=parseUnit(doc.getAttribute("height"))}if(!widthAttr||!heightAttr){var viewBoxAttr=doc.getAttribute("viewBox");if(viewBoxAttr&&(viewBoxAttr=viewBoxAttr.match(reViewBoxAttrValue))){widthAttr=parseFloat(viewBoxAttr[3]),heightAttr=parseFloat(viewBoxAttr[4])}else{toBeParsed=true}}addVBTransform(doc,widthAttr,heightAttr);var descendants=fabric.util.toArray(doc.getElementsByTagName("*"));if(descendants.length===0&&fabric.isLikelyNode){descendants=doc.selectNodes('//*[name(.)!="svg"]');var arr=[];for(var i=0,len=descendants.length;i','')}}var reFontDeclaration=new RegExp("(normal|italic)?\\s*(normal|small-caps)?\\s*"+"(normal|bold|bolder|lighter|100|200|300|400|500|600|700|800|900)?\\s*("+fabric.reNum+"(?:px|cm|mm|em|pt|pc|in)*)(?:\\/(normal|"+fabric.reNum+"))?\\s+(.*)");extend(fabric,{parseFontDeclaration:function(value,oStyle){var match=value.match(reFontDeclaration);if(!match){return}var fontStyle=match[1],fontWeight=match[3],fontSize=match[4],lineHeight=match[5],fontFamily=match[6];if(fontStyle){oStyle.fontStyle=fontStyle}if(fontWeight){oStyle.fontWeight=isNaN(parseFloat(fontWeight))?fontWeight:parseFloat(fontWeight)}if(fontSize){oStyle.fontSize=parseUnit(fontSize)}if(fontFamily){oStyle.fontFamily=fontFamily}if(lineHeight){oStyle.lineHeight=lineHeight==="normal"?1:lineHeight}},getGradientDefs:function(doc){var linearGradientEls=doc.getElementsByTagName("linearGradient"),radialGradientEls=doc.getElementsByTagName("radialGradient"),el,i,j=0,id,xlink,elList=[],gradientDefs={},idsToXlinkMap={};elList.length=linearGradientEls.length+radialGradientEls.length;i=linearGradientEls.length;while(i--){elList[j++]=linearGradientEls[i]}i=radialGradientEls.length;while(i--){elList[j++]=radialGradientEls[i]}while(j--){el=elList[j];xlink=el.getAttribute("xlink:href");id=el.getAttribute("id");if(xlink){idsToXlinkMap[id]=xlink.substr(1)}gradientDefs[id]=el}for(id in idsToXlinkMap){var el2=gradientDefs[idsToXlinkMap[id]].cloneNode(true);el=gradientDefs[id];while(el2.firstChild){el.appendChild(el2.firstChild)}}return gradientDefs},parseAttributes:function(element,attributes,svgUid){if(!element){return}var value,parentAttributes={},fontSize;if(typeof svgUid==="undefined"){svgUid=element.getAttribute("svgUid")}if(element.parentNode&&/^symbol|[g|a]$/i.test(element.parentNode.nodeName)){parentAttributes=fabric.parseAttributes(element.parentNode,attributes,svgUid)}fontSize=parentAttributes&&parentAttributes.fontSize||element.getAttribute("font-size")||fabric.Text.DEFAULT_SVG_FONT_SIZE;var ownAttributes=attributes.reduce(function(memo,attr){value=element.getAttribute(attr);if(value){attr=normalizeAttr(attr);value=normalizeValue(attr,value,parentAttributes,fontSize);memo[attr]=value}return memo},{});ownAttributes=extend(ownAttributes,extend(getGlobalStylesForElement(element,svgUid),fabric.parseStyleAttribute(element)));if(ownAttributes.font){fabric.parseFontDeclaration(ownAttributes.font,ownAttributes)}return _setStrokeFillOpacity(extend(parentAttributes,ownAttributes))},parseElements:function(elements,callback,options,reviver){new fabric.ElementsParser(elements,callback,options,reviver).parse()},parseStyleAttribute:function(element){var oStyle={},style=element.getAttribute("style");if(!style){return oStyle}if(typeof style==="string"){parseStyleString(style,oStyle)}else{parseStyleObject(style,oStyle)}return oStyle},parsePointsAttribute:function(points){if(!points){return null}points=points.replace(/,/g," ").trim();points=points.split(/\s+/);var parsedPoints=[],i,len;i=0;len=points.length;for(;i/i,""))}if(!xml||!xml.documentElement){return}fabric.parseSVGDocument(xml.documentElement,function(results,options){svgCache.set(url,{objects:fabric.util.array.invoke(results,"toObject"),options:options});callback(results,options)},reviver)}},loadSVGFromString:function(string,callback,reviver){string=string.trim();var doc;if(typeof DOMParser!=="undefined"){var parser=new DOMParser;if(parser&&parser.parseFromString){doc=parser.parseFromString(string,"text/xml")}}else if(fabric.window.ActiveXObject){doc=new ActiveXObject("Microsoft.XMLDOM");doc.async="false";doc.loadXML(string.replace(//i,""))}fabric.parseSVGDocument(doc.documentElement,function(results,options){callback(results,options)},reviver)},createSVGFontFacesMarkup:function(objects){var markup="";for(var i=0,len=objects.length;i',"",""].join("")}return markup},createSVGRefElementsMarkup:function(canvas){var markup=[];_createSVGPattern(markup,canvas,"backgroundColor");_createSVGPattern(markup,canvas,"overlayColor");return markup.join("")}})})(typeof exports!=="undefined"?exports:this);fabric.ElementsParser=function(elements,callback,options,reviver){this.elements=elements;this.callback=callback;this.options=options;this.reviver=reviver;this.svgUid=options&&options.svgUid||0};fabric.ElementsParser.prototype.parse=function(){this.instances=new Array(this.elements.length);this.numElements=this.elements.length;this.createObjects()};fabric.ElementsParser.prototype.createObjects=function(){for(var i=0,len=this.elements.length;ithat.x&&this.y>that.y},gte:function(that){return this.x>=that.x&&this.y>=that.y},lerp:function(that,t){return new Point(this.x+(that.x-this.x)*t,this.y+(that.y-this.y)*t)},distanceFrom:function(that){var dx=this.x-that.x,dy=this.y-that.y;return Math.sqrt(dx*dx+dy*dy)},midPointFrom:function(that){return new Point(this.x+(that.x-this.x)/2,this.y+(that.y-this.y)/2)},min:function(that){return new Point(Math.min(this.x,that.x),Math.min(this.y,that.y))},max:function(that){return new Point(Math.max(this.x,that.x),Math.max(this.y,that.y))},toString:function(){return this.x+","+this.y},setXY:function(x,y){this.x=x;this.y=y},setFromPoint:function(that){this.x=that.x;this.y=that.y},swap:function(that){var x=this.x,y=this.y;this.x=that.x;this.y=that.y;that.x=x;that.y=y}}})(typeof exports!=="undefined"?exports:this);(function(global){"use strict";var fabric=global.fabric||(global.fabric={});if(fabric.Intersection){fabric.warn("fabric.Intersection is already defined");return}function Intersection(status){this.status=status;this.points=[]}fabric.Intersection=Intersection;fabric.Intersection.prototype={appendPoint:function(point){this.points.push(point)},appendPoints:function(points){this.points=this.points.concat(points)}};fabric.Intersection.intersectLineLine=function(a1,a2,b1,b2){var result,uaT=(b2.x-b1.x)*(a1.y-b1.y)-(b2.y-b1.y)*(a1.x-b1.x),ubT=(a2.x-a1.x)*(a1.y-b1.y)-(a2.y-a1.y)*(a1.x-b1.x),uB=(b2.y-b1.y)*(a2.x-a1.x)-(b2.x-b1.x)*(a2.y-a1.y);if(uB!==0){var ua=uaT/uB,ub=ubT/uB;if(0<=ua&&ua<=1&&0<=ub&&ub<=1){result=new Intersection("Intersection");result.points.push(new fabric.Point(a1.x+ua*(a2.x-a1.x),a1.y+ua*(a2.y-a1.y)))}else{result=new Intersection}}else{if(uaT===0||ubT===0){result=new Intersection("Coincident")}else{result=new Intersection("Parallel")}}return result};fabric.Intersection.intersectLinePolygon=function(a1,a2,points){var result=new Intersection,length=points.length;for(var i=0;i0){result.status="Intersection"}return result};fabric.Intersection.intersectPolygonPolygon=function(points1,points2){var result=new Intersection,length=points1.length;for(var i=0;i0){result.status="Intersection"}return result};fabric.Intersection.intersectPolygonRectangle=function(points,r1,r2){var min=r1.min(r2),max=r1.max(r2),topRight=new fabric.Point(max.x,min.y),bottomLeft=new fabric.Point(min.x,max.y),inter1=Intersection.intersectLinePolygon(min,topRight,points),inter2=Intersection.intersectLinePolygon(topRight,max,points),inter3=Intersection.intersectLinePolygon(max,bottomLeft,points),inter4=Intersection.intersectLinePolygon(bottomLeft,min,points),result=new Intersection;result.appendPoints(inter1.points);result.appendPoints(inter2.points);result.appendPoints(inter3.points);result.appendPoints(inter4.points);if(result.points.length>0){result.status="Intersection"}return result}})(typeof exports!=="undefined"?exports:this);(function(global){"use strict";var fabric=global.fabric||(global.fabric={});if(fabric.Color){fabric.warn("fabric.Color is already defined.");return}function Color(color){if(!color){this.setSource([0,0,0,1])}else{this._tryParsingColor(color)}}fabric.Color=Color;fabric.Color.prototype={_tryParsingColor:function(color){var source;if(color in Color.colorNameMap){color=Color.colorNameMap[color]}if(color==="transparent"){this.setSource([255,255,255,0]);return}source=Color.sourceFromHex(color);if(!source){source=Color.sourceFromRgb(color)}if(!source){source=Color.sourceFromHsl(color)}if(source){this.setSource(source)}},_rgbToHsl:function(r,g,b){r/=255,g/=255,b/=255;var h,s,l,max=fabric.util.array.max([r,g,b]),min=fabric.util.array.min([r,g,b]);l=(max+min)/2;if(max===min){h=s=0}else{var d=max-min;s=l>.5?d/(2-max-min):d/(max+min);switch(max){case r:h=(g-b)/d+(g1){t-=1}if(t<1/6){return p+(q-p)*6*t}if(t<1/2){return q}if(t<2/3){return p+(q-p)*(2/3-t)*6}return p}fabric.Color.fromRgb=function(color){return Color.fromSource(Color.sourceFromRgb(color))};fabric.Color.sourceFromRgb=function(color){var match=color.match(Color.reRGBa);if(match){var r=parseInt(match[1],10)/(/%$/.test(match[1])?100:1)*(/%$/.test(match[1])?255:1),g=parseInt(match[2],10)/(/%$/.test(match[2])?100:1)*(/%$/.test(match[2])?255:1),b=parseInt(match[3],10)/(/%$/.test(match[3])?100:1)*(/%$/.test(match[3])?255:1);return[parseInt(r,10),parseInt(g,10),parseInt(b,10),match[4]?parseFloat(match[4]):1]}};fabric.Color.fromRgba=Color.fromRgb; + +fabric.Color.fromHsl=function(color){return Color.fromSource(Color.sourceFromHsl(color))};fabric.Color.sourceFromHsl=function(color){var match=color.match(Color.reHSLa);if(!match){return}var h=(parseFloat(match[1])%360+360)%360/360,s=parseFloat(match[2])/(/%$/.test(match[2])?100:1),l=parseFloat(match[3])/(/%$/.test(match[3])?100:1),r,g,b;if(s===0){r=g=b=l}else{var q=l<=.5?l*(s+1):l+s-l*s,p=l*2-q;r=hue2rgb(p,q,h+1/3);g=hue2rgb(p,q,h);b=hue2rgb(p,q,h-1/3)}return[Math.round(r*255),Math.round(g*255),Math.round(b*255),match[4]?parseFloat(match[4]):1]};fabric.Color.fromHsla=Color.fromHsl;fabric.Color.fromHex=function(color){return Color.fromSource(Color.sourceFromHex(color))};fabric.Color.sourceFromHex=function(color){if(color.match(Color.reHex)){var value=color.slice(color.indexOf("#")+1),isShortNotation=value.length===3,r=isShortNotation?value.charAt(0)+value.charAt(0):value.substring(0,2),g=isShortNotation?value.charAt(1)+value.charAt(1):value.substring(2,4),b=isShortNotation?value.charAt(2)+value.charAt(2):value.substring(4,6);return[parseInt(r,16),parseInt(g,16),parseInt(b,16),1]}};fabric.Color.fromSource=function(source){var oColor=new Color;oColor.setSource(source);return oColor}})(typeof exports!=="undefined"?exports:this);(function(){function getColorStop(el){var style=el.getAttribute("style"),offset=el.getAttribute("offset"),color,colorAlpha,opacity;offset=parseFloat(offset)/(/%$/.test(offset)?100:1);offset=offset<0?0:offset>1?1:offset;if(style){var keyValuePairs=style.split(/\s*;\s*/);if(keyValuePairs[keyValuePairs.length-1]===""){keyValuePairs.pop()}for(var i=keyValuePairs.length;i--;){var split=keyValuePairs[i].split(/\s*:\s*/),key=split[0].trim(),value=split[1].trim();if(key==="stop-color"){color=value}else if(key==="stop-opacity"){opacity=value}}}if(!color){color=el.getAttribute("stop-color")||"rgb(0,0,0)"}if(!opacity){opacity=el.getAttribute("stop-opacity")}color=new fabric.Color(color);colorAlpha=color.getAlpha();opacity=isNaN(parseFloat(opacity))?1:parseFloat(opacity);opacity*=colorAlpha;return{offset:offset,color:color.toRgb(),opacity:opacity}}function getLinearCoords(el){return{x1:el.getAttribute("x1")||0,y1:el.getAttribute("y1")||0,x2:el.getAttribute("x2")||"100%",y2:el.getAttribute("y2")||0}}function getRadialCoords(el){return{x1:el.getAttribute("fx")||el.getAttribute("cx")||"50%",y1:el.getAttribute("fy")||el.getAttribute("cy")||"50%",r1:0,x2:el.getAttribute("cx")||"50%",y2:el.getAttribute("cy")||"50%",r2:el.getAttribute("r")||"50%"}}fabric.Gradient=fabric.util.createClass({offsetX:0,offsetY:0,initialize:function(options){options||(options={});var coords={};this.id=fabric.Object.__uid++;this.type=options.type||"linear";coords={x1:options.coords.x1||0,y1:options.coords.y1||0,x2:options.coords.x2||0,y2:options.coords.y2||0};if(this.type==="radial"){coords.r1=options.coords.r1||0;coords.r2=options.coords.r2||0}this.coords=coords;this.colorStops=options.colorStops.slice();if(options.gradientTransform){this.gradientTransform=options.gradientTransform}this.offsetX=options.offsetX||this.offsetX;this.offsetY=options.offsetY||this.offsetY},addColorStop:function(colorStop){for(var position in colorStop){var color=new fabric.Color(colorStop[position]);this.colorStops.push({offset:position,color:color.toRgb(),opacity:color.getAlpha()})}return this},toObject:function(){return{type:this.type,coords:this.coords,colorStops:this.colorStops,offsetX:this.offsetX,offsetY:this.offsetY}},toSVG:function(object){var coords=fabric.util.object.clone(this.coords),markup,commonAttributes;this.colorStops.sort(function(a,b){return a.offset-b.offset});if(!(object.group&&object.group.type==="path-group")){for(var prop in coords){if(prop==="x1"||prop==="x2"||prop==="r2"){coords[prop]+=this.offsetX-object.width/2}else if(prop==="y1"||prop==="y2"){coords[prop]+=this.offsetY-object.height/2}}}commonAttributes='id="SVGID_'+this.id+'" gradientUnits="userSpaceOnUse"';if(this.gradientTransform){commonAttributes+=' gradientTransform="matrix('+this.gradientTransform.join(" ")+')" '}if(this.type==="linear"){markup=["\n']}else if(this.type==="radial"){markup=["\n']}for(var i=0;i\n')}markup.push(this.type==="linear"?"\n":"\n");return markup.join("")},toLive:function(ctx,object){var gradient,prop,coords=fabric.util.object.clone(this.coords);if(!this.type){return}if(object.group&&object.group.type==="path-group"){for(prop in coords){if(prop==="x1"||prop==="x2"){coords[prop]+=-this.offsetX+object.width/2}else if(prop==="y1"||prop==="y2"){coords[prop]+=-this.offsetY+object.height/2}}}if(object.type==="text"||object.type==="i-text"){for(prop in coords){if(prop==="x1"||prop==="x2"){coords[prop]-=object.width/2}else if(prop==="y1"||prop==="y2"){coords[prop]-=object.height/2}}}if(this.type==="linear"){gradient=ctx.createLinearGradient(coords.x1,coords.y1,coords.x2,coords.y2)}else if(this.type==="radial"){gradient=ctx.createRadialGradient(coords.x1,coords.y1,coords.r1,coords.x2,coords.y2,coords.r2)}for(var i=0,len=this.colorStops.length;i\n'+'\n'+"\n"},toLive:function(ctx){var source=typeof this.source==="function"?this.source():this.source;if(!source){return""}if(typeof source.src!=="undefined"){if(!source.complete){return""}if(source.naturalWidth===0||source.naturalHeight===0){return""}}return ctx.createPattern(source,this.repeat)}});(function(global){"use strict";var fabric=global.fabric||(global.fabric={}),toFixed=fabric.util.toFixed;if(fabric.Shadow){fabric.warn("fabric.Shadow is already defined.");return}fabric.Shadow=fabric.util.createClass({color:"rgb(0,0,0)",blur:0,offsetX:0,offsetY:0,affectStroke:false,includeDefaultValues:true,initialize:function(options){if(typeof options==="string"){options=this._parseShadow(options)}for(var prop in options){this[prop]=options[prop]}this.id=fabric.Object.__uid++},_parseShadow:function(shadow){var shadowStr=shadow.trim(),offsetsAndBlur=fabric.Shadow.reOffsetsAndBlur.exec(shadowStr)||[],color=shadowStr.replace(fabric.Shadow.reOffsetsAndBlur,"")||"rgb(0,0,0)";return{color:color.trim(),offsetX:parseInt(offsetsAndBlur[1],10)||0,offsetY:parseInt(offsetsAndBlur[2],10)||0,blur:parseInt(offsetsAndBlur[3],10)||0}},toString:function(){return[this.offsetX,this.offsetY,this.blur,this.color].join("px ")},toSVG:function(object){var mode="SourceAlpha",fBoxX=40,fBoxY=40;if(object&&(object.fill===this.color||object.stroke===this.color)){mode="SourceGraphic"}if(object.width&&object.height){fBoxX=toFixed(Math.abs(this.offsetX/object.getWidth()),2)*100+20;fBoxY=toFixed(Math.abs(this.offsetY/object.getHeight()),2)*100+20}return'\n"+' \n'+' \n'+' \n'+" \n"+" \n"+' \n'+" \n"+"\n"},toObject:function(){if(this.includeDefaultValues){return{color:this.color,blur:this.blur,offsetX:this.offsetX,offsetY:this.offsetY}}var obj={},proto=fabric.Shadow.prototype;if(this.color!==proto.color){obj.color=this.color}if(this.blur!==proto.blur){obj.blur=this.blur}if(this.offsetX!==proto.offsetX){obj.offsetX=this.offsetX}if(this.offsetY!==proto.offsetY){obj.offsetY=this.offsetY}return obj}});fabric.Shadow.reOffsetsAndBlur=/(?:\s|^)(-?\d+(?:px)?(?:\s?|$))?(-?\d+(?:px)?(?:\s?|$))?(\d+(?:px)?)?(?:\s?|$)(?:$|\s)/})(typeof exports!=="undefined"?exports:this);(function(){"use strict";if(fabric.StaticCanvas){fabric.warn("fabric.StaticCanvas is already defined.");return}var extend=fabric.util.object.extend,getElementOffset=fabric.util.getElementOffset,removeFromArray=fabric.util.removeFromArray,CANVAS_INIT_ERROR=new Error("Could not initialize `canvas` element");fabric.StaticCanvas=fabric.util.createClass({initialize:function(el,options){options||(options={});this._initStatic(el,options);fabric.StaticCanvas.activeInstance=this},backgroundColor:"",backgroundImage:null,overlayColor:"",overlayImage:null,includeDefaultValues:true,stateful:true,renderOnAddRemove:true,clipTo:null,controlsAboveOverlay:false,allowTouchScrolling:false,imageSmoothingEnabled:true,preserveObjectStacking:false,viewportTransform:[1,0,0,1,0,0],onBeforeScaleRotate:function(){},_initStatic:function(el,options){this._objects=[];this._createLowerCanvas(el);this._initOptions(options);this._setImageSmoothing();if(options.overlayImage){this.setOverlayImage(options.overlayImage,this.renderAll.bind(this))}if(options.backgroundImage){this.setBackgroundImage(options.backgroundImage,this.renderAll.bind(this))}if(options.backgroundColor){this.setBackgroundColor(options.backgroundColor,this.renderAll.bind(this))}if(options.overlayColor){this.setOverlayColor(options.overlayColor,this.renderAll.bind(this))}this.calcOffset()},calcOffset:function(){this._offset=getElementOffset(this.lowerCanvasEl);return this},setOverlayImage:function(image,callback,options){return this.__setBgOverlayImage("overlayImage",image,callback,options)},setBackgroundImage:function(image,callback,options){return this.__setBgOverlayImage("backgroundImage",image,callback,options)},setOverlayColor:function(overlayColor,callback){return this.__setBgOverlayColor("overlayColor",overlayColor,callback)},setBackgroundColor:function(backgroundColor,callback){return this.__setBgOverlayColor("backgroundColor",backgroundColor,callback)},_setImageSmoothing:function(){var ctx=this.getContext();ctx.imageSmoothingEnabled=this.imageSmoothingEnabled;ctx.webkitImageSmoothingEnabled=this.imageSmoothingEnabled;ctx.mozImageSmoothingEnabled=this.imageSmoothingEnabled;ctx.msImageSmoothingEnabled=this.imageSmoothingEnabled;ctx.oImageSmoothingEnabled=this.imageSmoothingEnabled},__setBgOverlayImage:function(property,image,callback,options){if(typeof image==="string"){fabric.util.loadImage(image,function(img){this[property]=new fabric.Image(img,options);callback&&callback()},this,options&&options.crossOrigin)}else{options&&image.setOptions(options);this[property]=image;callback&&callback()}return this},__setBgOverlayColor:function(property,color,callback){if(color&&color.source){var _this=this;fabric.util.loadImage(color.source,function(img){_this[property]=new fabric.Pattern({source:img,repeat:color.repeat,offsetX:color.offsetX,offsetY:color.offsetY});callback&&callback()})}else{this[property]=color;callback&&callback()}return this},_createCanvasElement:function(){var element=fabric.document.createElement("canvas");if(!element.style){element.style={}}if(!element){throw CANVAS_INIT_ERROR}this._initCanvasElement(element);return element},_initCanvasElement:function(element){fabric.util.createCanvasElement(element);if(typeof element.getContext==="undefined"){throw CANVAS_INIT_ERROR}},_initOptions:function(options){for(var prop in options){this[prop]=options[prop]}this.width=this.width||parseInt(this.lowerCanvasEl.width,10)||0;this.height=this.height||parseInt(this.lowerCanvasEl.height,10)||0;if(!this.lowerCanvasEl.style){return}this.lowerCanvasEl.width=this.width;this.lowerCanvasEl.height=this.height;this.lowerCanvasEl.style.width=this.width+"px";this.lowerCanvasEl.style.height=this.height+"px";this.viewportTransform=this.viewportTransform.slice()},_createLowerCanvas:function(canvasEl){this.lowerCanvasEl=fabric.util.getById(canvasEl)||this._createCanvasElement();this._initCanvasElement(this.lowerCanvasEl);fabric.util.addClass(this.lowerCanvasEl,"lower-canvas");if(this.interactive){this._applyCanvasStyle(this.lowerCanvasEl)}this.contextContainer=this.lowerCanvasEl.getContext("2d")},getWidth:function(){return this.width},getHeight:function(){return this.height},setWidth:function(value,options){return this.setDimensions({width:value},options)},setHeight:function(value,options){return this.setDimensions({height:value},options)},setDimensions:function(dimensions,options){var cssValue;options=options||{};for(var prop in dimensions){cssValue=dimensions[prop];if(!options.cssOnly){this._setBackstoreDimension(prop,dimensions[prop]);cssValue+="px"}if(!options.backstoreOnly){this._setCssDimension(prop,cssValue)}}if(!options.cssOnly){this.renderAll()}this.calcOffset();return this},_setBackstoreDimension:function(prop,value){this.lowerCanvasEl[prop]=value;if(this.upperCanvasEl){this.upperCanvasEl[prop]=value}if(this.cacheCanvasEl){this.cacheCanvasEl[prop]=value}this[prop]=value;return this},_setCssDimension:function(prop,value){this.lowerCanvasEl.style[prop]=value;if(this.upperCanvasEl){this.upperCanvasEl.style[prop]=value}if(this.wrapperEl){this.wrapperEl.style[prop]=value}return this},getZoom:function(){return Math.sqrt(this.viewportTransform[0]*this.viewportTransform[3])},setViewportTransform:function(vpt){var activeGroup=this.getActiveGroup();this.viewportTransform=vpt;this.renderAll();for(var i=0,len=this._objects.length;i");return markup.join("")},_setSVGPreamble:function(markup,options){if(!options.suppressPreamble){markup.push('','\n')}},_setSVGHeader:function(markup,options){var width,height,vpt;if(options.viewBox){width=options.viewBox.width;height=options.viewBox.height}else{width=this.width;height=this.height;if(!this.svgViewportTransformation){vpt=this.viewportTransform;width/=vpt[0];height/=vpt[3]}}markup.push("',"Created with Fabric.js ",fabric.version,"","",fabric.createSVGFontFacesMarkup(this.getObjects()),fabric.createSVGRefElementsMarkup(this),"")},_setSVGObjects:function(markup,reviver){for(var i=0,objects=this.getObjects(),len=objects.length;i
")}else if(this[property]&&property==="overlayColor"){markup.push('")}},sendToBack:function(object){removeFromArray(this._objects,object);this._objects.unshift(object);return this.renderAll&&this.renderAll()},bringToFront:function(object){removeFromArray(this._objects,object);this._objects.push(object);return this.renderAll&&this.renderAll()},sendBackwards:function(object,intersecting){var idx=this._objects.indexOf(object);if(idx!==0){var newIdx=this._findNewLowerIndex(object,idx,intersecting);removeFromArray(this._objects,object);this._objects.splice(newIdx,0,object);this.renderAll&&this.renderAll()}return this},_findNewLowerIndex:function(object,idx,intersecting){var newIdx;if(intersecting){newIdx=idx;for(var i=idx-1;i>=0;--i){var isIntersecting=object.intersectsWithObject(this._objects[i])||object.isContainedWithinObject(this._objects[i])||this._objects[i].isContainedWithinObject(object);if(isIntersecting){newIdx=i;break}}}else{newIdx=idx-1}return newIdx},bringForward:function(object,intersecting){var idx=this._objects.indexOf(object);if(idx!==this._objects.length-1){var newIdx=this._findNewUpperIndex(object,idx,intersecting);removeFromArray(this._objects,object);this._objects.splice(newIdx,0,object);this.renderAll&&this.renderAll()}return this},_findNewUpperIndex:function(object,idx,intersecting){var newIdx;if(intersecting){newIdx=idx;for(var i=idx+1;i"}});extend(fabric.StaticCanvas.prototype,fabric.Observable);extend(fabric.StaticCanvas.prototype,fabric.Collection);extend(fabric.StaticCanvas.prototype,fabric.DataURLExporter);extend(fabric.StaticCanvas,{EMPTY_JSON:'{"objects": [], "background": "white"}',supports:function(methodName){var el=fabric.util.createCanvasElement();if(!el||!el.getContext){return null}var ctx=el.getContext("2d");if(!ctx){return null}switch(methodName){case"getImageData":return typeof ctx.getImageData!=="undefined";case"setLineDash":return typeof ctx.setLineDash!=="undefined";case"toDataURL":return typeof el.toDataURL!=="undefined";case"toDataURLWithQuality":try{el.toDataURL("image/jpeg",0);return true}catch(e){}return false;default:return null}}});fabric.StaticCanvas.prototype.toJSON=fabric.StaticCanvas.prototype.toObject})();fabric.BaseBrush=fabric.util.createClass({color:"rgb(0, 0, 0)",width:1,shadow:null,strokeLineCap:"round",strokeLineJoin:"round",strokeDashArray:null,setShadow:function(options){this.shadow=new fabric.Shadow(options);return this},_setBrushStyles:function(){var ctx=this.canvas.contextTop;ctx.strokeStyle=this.color;ctx.lineWidth=this.width;ctx.lineCap=this.strokeLineCap;ctx.lineJoin=this.strokeLineJoin;if(this.strokeDashArray&&fabric.StaticCanvas.supports("setLineDash")){ctx.setLineDash(this.strokeDashArray)}},_setShadow:function(){if(!this.shadow){return}var ctx=this.canvas.contextTop;ctx.shadowColor=this.shadow.color;ctx.shadowBlur=this.shadow.blur;ctx.shadowOffsetX=this.shadow.offsetX;ctx.shadowOffsetY=this.shadow.offsetY},_resetShadow:function(){var ctx=this.canvas.contextTop;ctx.shadowColor="";ctx.shadowBlur=ctx.shadowOffsetX=ctx.shadowOffsetY=0}});(function(){fabric.PencilBrush=fabric.util.createClass(fabric.BaseBrush,{initialize:function(canvas){this.canvas=canvas;this._points=[]},onMouseDown:function(pointer){this._prepareForDrawing(pointer);this._captureDrawingPath(pointer);this._render()},onMouseMove:function(pointer){this._captureDrawingPath(pointer);this.canvas.clearContext(this.canvas.contextTop);this._render()},onMouseUp:function(){this._finalizeAndAddPath()},_prepareForDrawing:function(pointer){var p=new fabric.Point(pointer.x,pointer.y);this._reset();this._addPoint(p);this.canvas.contextTop.moveTo(p.x,p.y)},_addPoint:function(point){this._points.push(point)},_reset:function(){this._points.length=0;this._setBrushStyles();this._setShadow()},_captureDrawingPath:function(pointer){var pointerPoint=new fabric.Point(pointer.x,pointer.y);this._addPoint(pointerPoint)},_render:function(){ +var ctx=this.canvas.contextTop,v=this.canvas.viewportTransform,p1=this._points[0],p2=this._points[1];ctx.save();ctx.transform(v[0],v[1],v[2],v[3],v[4],v[5]);ctx.beginPath();if(this._points.length===2&&p1.x===p2.x&&p1.y===p2.y){p1.x-=.5;p2.x+=.5}ctx.moveTo(p1.x,p1.y);for(var i=1,len=this._points.length;itarget.padding){if(localMouse.x<0){localMouse.x+=target.padding}else{localMouse.x-=target.padding}}else{localMouse.x=0}if(abs(localMouse.y)>target.padding){if(localMouse.y<0){localMouse.y+=target.padding}else{localMouse.y-=target.padding}}else{localMouse.y=0}},_rotateObject:function(x,y){var t=this._currentTransform;if(t.target.get("lockRotation")){return}var lastAngle=atan2(t.ey-t.top,t.ex-t.left),curAngle=atan2(y-t.top,x-t.left),angle=radiansToDegrees(curAngle-lastAngle+t.theta);if(angle<0){angle=360+angle}t.target.angle=angle%360},setCursor:function(value){this.upperCanvasEl.style.cursor=value},_resetObjectTransform:function(target){target.scaleX=1;target.scaleY=1;target.setAngle(0)},_drawSelection:function(){var ctx=this.contextTop,groupSelector=this._groupSelector,left=groupSelector.left,top=groupSelector.top,aleft=abs(left),atop=abs(top);ctx.fillStyle=this.selectionColor;ctx.fillRect(groupSelector.ex-(left>0?0:-left),groupSelector.ey-(top>0?0:-top),aleft,atop);ctx.lineWidth=this.selectionLineWidth;ctx.strokeStyle=this.selectionBorderColor;if(this.selectionDashArray.length>1){var px=groupSelector.ex+STROKE_OFFSET-(left>0?0:aleft),py=groupSelector.ey+STROKE_OFFSET-(top>0?0:atop);ctx.beginPath();fabric.util.drawDashedLine(ctx,px,py,px+aleft,py,this.selectionDashArray);fabric.util.drawDashedLine(ctx,px,py+atop-1,px+aleft,py+atop-1,this.selectionDashArray);fabric.util.drawDashedLine(ctx,px,py,px,py+atop,this.selectionDashArray);fabric.util.drawDashedLine(ctx,px+aleft-1,py,px+aleft-1,py+atop,this.selectionDashArray);ctx.closePath();ctx.stroke()}else{ctx.strokeRect(groupSelector.ex+STROKE_OFFSET-(left>0?0:aleft),groupSelector.ey+STROKE_OFFSET-(top>0?0:atop),aleft,atop)}},_isLastRenderedObject:function(e){return this.controlsAboveOverlay&&this.lastRenderedObjectWithControlsAboveOverlay&&this.lastRenderedObjectWithControlsAboveOverlay.visible&&this.containsPoint(e,this.lastRenderedObjectWithControlsAboveOverlay)&&this.lastRenderedObjectWithControlsAboveOverlay._findTargetCorner(this.getPointer(e,true))},findTarget:function(e,skipGroup){if(this.skipTargetFind){return}if(this._isLastRenderedObject(e)){return this.lastRenderedObjectWithControlsAboveOverlay}var activeGroup=this.getActiveGroup();if(activeGroup&&!skipGroup&&this.containsPoint(e,activeGroup)){return activeGroup}var target=this._searchPossibleTargets(e);this._fireOverOutEvents(target);return target},_fireOverOutEvents:function(target){if(target){if(this._hoveredTarget!==target){this.fire("mouse:over",{target:target});target.fire("mouseover");if(this._hoveredTarget){this.fire("mouse:out",{target:this._hoveredTarget});this._hoveredTarget.fire("mouseout")}this._hoveredTarget=target}}else if(this._hoveredTarget){this.fire("mouse:out",{target:this._hoveredTarget});this._hoveredTarget.fire("mouseout");this._hoveredTarget=null}},_checkTarget:function(e,obj,pointer){if(obj&&obj.visible&&obj.evented&&this.containsPoint(e,obj)){if((this.perPixelTargetFind||obj.perPixelTargetFind)&&!obj.isEditing){var isTransparent=this.isTargetTransparent(obj,pointer.x,pointer.y);if(!isTransparent){return true}}else{return true}}},_searchPossibleTargets:function(e){var target,pointer=this.getPointer(e,true),i=this._objects.length;while(i--){if(!this._objects[i].group&&this._checkTarget(e,this._objects[i],pointer)){this.relatedTarget=this._objects[i];target=this._objects[i];break}}return target},getPointer:function(e,ignoreZoom,upperCanvasEl){if(!upperCanvasEl){upperCanvasEl=this.upperCanvasEl}var pointer=getPointer(e,upperCanvasEl),bounds=upperCanvasEl.getBoundingClientRect(),boundsWidth=bounds.width||0,boundsHeight=bounds.height||0,cssScale;if(!boundsWidth||!boundsHeight){if("top"in bounds&&"bottom"in bounds){boundsHeight=Math.abs(bounds.top-bounds.bottom)}if("right"in bounds&&"left"in bounds){boundsWidth=Math.abs(bounds.right-bounds.left)}}this.calcOffset();pointer.x=pointer.x-this._offset.left;pointer.y=pointer.y-this._offset.top;if(!ignoreZoom){pointer=fabric.util.transformPoint(pointer,fabric.util.invertTransform(this.viewportTransform))}if(boundsWidth===0||boundsHeight===0){cssScale={width:1,height:1}}else{cssScale={width:upperCanvasEl.width/boundsWidth,height:upperCanvasEl.height/boundsHeight}}return{x:pointer.x*cssScale.width,y:pointer.y*cssScale.height}},_createUpperCanvas:function(){var lowerCanvasClass=this.lowerCanvasEl.className.replace(/\s*lower-canvas\s*/,"");this.upperCanvasEl=this._createCanvasElement();fabric.util.addClass(this.upperCanvasEl,"upper-canvas "+lowerCanvasClass);this.wrapperEl.appendChild(this.upperCanvasEl);this._copyCanvasStyle(this.lowerCanvasEl,this.upperCanvasEl);this._applyCanvasStyle(this.upperCanvasEl);this.contextTop=this.upperCanvasEl.getContext("2d")},_createCacheCanvas:function(){this.cacheCanvasEl=this._createCanvasElement();this.cacheCanvasEl.setAttribute("width",this.width);this.cacheCanvasEl.setAttribute("height",this.height);this.contextCache=this.cacheCanvasEl.getContext("2d")},_initWrapperElement:function(){this.wrapperEl=fabric.util.wrapElement(this.lowerCanvasEl,"div",{"class":this.containerClass});fabric.util.setStyle(this.wrapperEl,{width:this.getWidth()+"px",height:this.getHeight()+"px",position:"relative"});fabric.util.makeElementUnselectable(this.wrapperEl)},_applyCanvasStyle:function(element){var width=this.getWidth()||element.width,height=this.getHeight()||element.height;fabric.util.setStyle(element,{position:"absolute",width:width+"px",height:height+"px",left:0,top:0});element.width=width;element.height=height;fabric.util.makeElementUnselectable(element)},_copyCanvasStyle:function(fromEl,toEl){toEl.style.cssText=fromEl.style.cssText},getSelectionContext:function(){return this.contextTop},getSelectionElement:function(){return this.upperCanvasEl},_setActiveObject:function(object){if(this._activeObject){this._activeObject.set("active",false)}this._activeObject=object;object.set("active",true)},setActiveObject:function(object,e){this._setActiveObject(object);this.renderAll();this.fire("object:selected",{target:object,e:e});object.fire("selected",{e:e});return this},getActiveObject:function(){return this._activeObject},_discardActiveObject:function(){if(this._activeObject){this._activeObject.set("active",false)}this._activeObject=null},discardActiveObject:function(e){this._discardActiveObject();this.renderAll();this.fire("selection:cleared",{e:e});return this},_setActiveGroup:function(group){this._activeGroup=group;if(group){group.set("active",true)}},setActiveGroup:function(group,e){this._setActiveGroup(group);if(group){this.fire("object:selected",{target:group,e:e});group.fire("selected",{e:e})}return this},getActiveGroup:function(){return this._activeGroup},_discardActiveGroup:function(){var g=this.getActiveGroup();if(g){g.destroy()}this.setActiveGroup(null)},discardActiveGroup:function(e){this._discardActiveGroup();this.fire("selection:cleared",{e:e});return this},deactivateAll:function(){var allObjects=this.getObjects(),i=0,len=allObjects.length;for(;i1){ +return}var groupSelector=this._groupSelector;if(groupSelector){pointer=this.getPointer(e,true);groupSelector.left=pointer.x-groupSelector.ex;groupSelector.top=pointer.y-groupSelector.ey;this.renderTop()}else if(!this._currentTransform){target=this.findTarget(e);if(!target||target&&!target.selectable){this.setCursor(this.defaultCursor)}else{this._setCursorFromEvent(e,target)}}else{this._transformObject(e)}this.fire("mouse:move",{target:target,e:e});target&&target.fire("mousemove",{e:e})},_transformObject:function(e){var pointer=this.getPointer(e),transform=this._currentTransform;transform.reset=false,transform.target.isMoving=true;this._beforeScaleTransform(e,transform);this._performTransformAction(e,transform,pointer);this.renderAll()},_performTransformAction:function(e,transform,pointer){var x=pointer.x,y=pointer.y,target=transform.target,action=transform.action;if(action==="rotate"){this._rotateObject(x,y);this._fire("rotating",target,e)}else if(action==="scale"){this._onScale(e,transform,x,y);this._fire("scaling",target,e)}else if(action==="scaleX"){this._scaleObject(x,y,"x");this._fire("scaling",target,e)}else if(action==="scaleY"){this._scaleObject(x,y,"y");this._fire("scaling",target,e)}else{this._translateObject(x,y);this._fire("moving",target,e);this.setCursor(this.moveCursor)}},_fire:function(eventName,target,e){this.fire("object:"+eventName,{target:target,e:e});target.fire(eventName,{e:e})},_beforeScaleTransform:function(e,transform){if(transform.action==="scale"||transform.action==="scaleX"||transform.action==="scaleY"){var centerTransform=this._shouldCenterTransform(e,transform.target);if(centerTransform&&(transform.originX!=="center"||transform.originY!=="center")||!centerTransform&&transform.originX==="center"&&transform.originY==="center"){this._resetCurrentTransform(e);transform.reset=true}}},_onScale:function(e,transform,x,y){if((e.shiftKey||this.uniScaleTransform)&&!transform.target.get("lockUniScaling")){transform.currentAction="scale";this._scaleObject(x,y)}else{if(!transform.reset&&transform.currentAction==="scale"){this._resetCurrentTransform(e,transform.target)}transform.currentAction="scaleEqually";this._scaleObject(x,y,"equally")}},_setCursorFromEvent:function(e,target){if(!target||!target.selectable){this.setCursor(this.defaultCursor);return false}else{var activeGroup=this.getActiveGroup(),corner=target._findTargetCorner&&(!activeGroup||!activeGroup.contains(target))&&target._findTargetCorner(this.getPointer(e,true));if(!corner){this.setCursor(target.hoverCursor||this.hoverCursor)}else{this._setCornerCursor(corner,target)}}return true},_setCornerCursor:function(corner,target){if(corner in cursorOffset){this.setCursor(this._getRotatedCornerCursor(corner,target))}else if(corner==="mtr"&&target.hasRotatingPoint){this.setCursor(this.rotationCursor)}else{this.setCursor(this.defaultCursor);return false}},_getRotatedCornerCursor:function(corner,target){var n=Math.round(target.getAngle()%360/45);if(n<0){n+=8}n+=cursorOffset[corner];n%=8;return this.cursorMap[n]}})})();(function(){var min=Math.min,max=Math.max;fabric.util.object.extend(fabric.Canvas.prototype,{_shouldGroup:function(e,target){var activeObject=this.getActiveObject();return e.shiftKey&&(this.getActiveGroup()||activeObject&&activeObject!==target)&&this.selection},_handleGrouping:function(e,target){if(target===this.getActiveGroup()){target=this.findTarget(e,true);if(!target||target.isType("group")){return}}if(this.getActiveGroup()){this._updateActiveGroup(target,e)}else{this._createActiveGroup(target,e)}if(this._activeGroup){this._activeGroup.saveCoords()}},_updateActiveGroup:function(target,e){var activeGroup=this.getActiveGroup();if(activeGroup.contains(target)){activeGroup.removeWithUpdate(target);this._resetObjectTransform(activeGroup);target.set("active",false);if(activeGroup.size()===1){this.discardActiveGroup(e);this.setActiveObject(activeGroup.item(0));return}}else{activeGroup.addWithUpdate(target);this._resetObjectTransform(activeGroup)}this.fire("selection:created",{target:activeGroup,e:e});activeGroup.set("active",true)},_createActiveGroup:function(target,e){if(this._activeObject&&target!==this._activeObject){var group=this._createGroup(target);group.addWithUpdate();this.setActiveGroup(group);this._activeObject=null;this.fire("selection:created",{target:group,e:e})}target.set("active",true)},_createGroup:function(target){var objects=this.getObjects(),isActiveLower=objects.indexOf(this._activeObject)1){group=new fabric.Group(group.reverse(),{canvas:this});group.addWithUpdate();this.setActiveGroup(group,e);group.saveCoords();this.fire("selection:created",{target:group});this.renderAll()}},_collectObjects:function(){var group=[],currentObject,x1=this._groupSelector.ex,y1=this._groupSelector.ey,x2=x1+this._groupSelector.left,y2=y1+this._groupSelector.top,selectionX1Y1=new fabric.Point(min(x1,x2),min(y1,y2)),selectionX2Y2=new fabric.Point(max(x1,x2),max(y1,y2)),isClick=x1===x2&&y1===y2;for(var i=this._objects.length;i--;){currentObject=this._objects[i];if(!currentObject||!currentObject.selectable||!currentObject.visible){continue}if(currentObject.intersectsWithRect(selectionX1Y1,selectionX2Y2)||currentObject.isContainedWithinRect(selectionX1Y1,selectionX2Y2)||currentObject.containsPoint(selectionX1Y1)||currentObject.containsPoint(selectionX2Y2)){currentObject.set("active",true);group.push(currentObject);if(isClick){break}}}return group},_maybeGroupObjects:function(e){if(this.selection&&this._groupSelector){this._groupSelectedObjects(e)}var activeGroup=this.getActiveGroup();if(activeGroup){activeGroup.setObjectsCoords().setCoords();activeGroup.isMoving=false;this.setCursor(this.defaultCursor)}this._groupSelector=null;this._currentTransform=null}})})();fabric.util.object.extend(fabric.StaticCanvas.prototype,{toDataURL:function(options){options||(options={});var format=options.format||"png",quality=options.quality||1,multiplier=options.multiplier||1,cropping={left:options.left,top:options.top,width:options.width,height:options.height};if(multiplier!==1){return this.__toDataURLWithMultiplier(format,quality,cropping,multiplier)}else{return this.__toDataURL(format,quality,cropping)}},__toDataURL:function(format,quality,cropping){this.renderAll(true);var canvasEl=this.upperCanvasEl||this.lowerCanvasEl,croppedCanvasEl=this.__getCroppedCanvas(canvasEl,cropping);if(format==="jpg"){format="jpeg"}var data=fabric.StaticCanvas.supports("toDataURLWithQuality")?(croppedCanvasEl||canvasEl).toDataURL("image/"+format,quality):(croppedCanvasEl||canvasEl).toDataURL("image/"+format);this.contextTop&&this.clearContext(this.contextTop);this.renderAll();if(croppedCanvasEl){croppedCanvasEl=null}return data},__getCroppedCanvas:function(canvasEl,cropping){var croppedCanvasEl,croppedCtx,shouldCrop="left"in cropping||"top"in cropping||"width"in cropping||"height"in cropping;if(shouldCrop){croppedCanvasEl=fabric.util.createCanvasElement();croppedCtx=croppedCanvasEl.getContext("2d");croppedCanvasEl.width=cropping.width||this.width;croppedCanvasEl.height=cropping.height||this.height;croppedCtx.drawImage(canvasEl,-cropping.left||0,-cropping.top||0)}return croppedCanvasEl},__toDataURLWithMultiplier:function(format,quality,cropping,multiplier){var origWidth=this.getWidth(),origHeight=this.getHeight(),scaledWidth=origWidth*multiplier,scaledHeight=origHeight*multiplier,activeObject=this.getActiveObject(),activeGroup=this.getActiveGroup(),ctx=this.contextTop||this.contextContainer;if(multiplier>1){this.setWidth(scaledWidth).setHeight(scaledHeight)}ctx.scale(multiplier,multiplier);if(cropping.left){cropping.left*=multiplier}if(cropping.top){cropping.top*=multiplier}if(cropping.width){cropping.width*=multiplier}else if(multiplier<1){cropping.width=scaledWidth}if(cropping.height){cropping.height*=multiplier}else if(multiplier<1){cropping.height=scaledHeight}if(activeGroup){this._tempRemoveBordersControlsFromGroup(activeGroup)}else if(activeObject&&this.deactivateAll){this.deactivateAll()}this.renderAll(true);var data=this.__toDataURL(format,quality,cropping);this.width=origWidth;this.height=origHeight;ctx.scale(1/multiplier,1/multiplier);this.setWidth(origWidth).setHeight(origHeight);if(activeGroup){this._restoreBordersControlsOnGroup(activeGroup)}else if(activeObject&&this.setActiveObject){this.setActiveObject(activeObject)}this.contextTop&&this.clearContext(this.contextTop);this.renderAll();return data},toDataURLWithMultiplier:function(format,multiplier,quality){return this.toDataURL({format:format,multiplier:multiplier,quality:quality})},_tempRemoveBordersControlsFromGroup:function(group){group.origHasControls=group.hasControls;group.origBorderColor=group.borderColor;group.hasControls=true;group.borderColor="rgba(0,0,0,0)";group.forEachObject(function(o){o.origBorderColor=o.borderColor;o.borderColor="rgba(0,0,0,0)"})},_restoreBordersControlsOnGroup:function(group){group.hideControls=group.origHideControls;group.borderColor=group.origBorderColor;group.forEachObject(function(o){o.borderColor=o.origBorderColor;delete o.origBorderColor})}});fabric.util.object.extend(fabric.StaticCanvas.prototype,{loadFromDatalessJSON:function(json,callback,reviver){return this.loadFromJSON(json,callback,reviver)},loadFromJSON:function(json,callback,reviver){if(!json){return}var serialized=typeof json==="string"?JSON.parse(json):json;this.clear();var _this=this;this._enlivenObjects(serialized.objects,function(){_this._setBgOverlay(serialized,callback)},reviver);return this},_setBgOverlay:function(serialized,callback){var _this=this,loaded={backgroundColor:false,overlayColor:false,backgroundImage:false,overlayImage:false};if(!serialized.backgroundImage&&!serialized.overlayImage&&!serialized.background&&!serialized.overlay){callback&&callback();return}var cbIfLoaded=function(){if(loaded.backgroundImage&&loaded.overlayImage&&loaded.backgroundColor&&loaded.overlayColor){_this.renderAll();callback&&callback()}};this.__setBgOverlay("backgroundImage",serialized.backgroundImage,loaded,cbIfLoaded);this.__setBgOverlay("overlayImage",serialized.overlayImage,loaded,cbIfLoaded);this.__setBgOverlay("backgroundColor",serialized.background,loaded,cbIfLoaded);this.__setBgOverlay("overlayColor",serialized.overlay,loaded,cbIfLoaded);cbIfLoaded()},__setBgOverlay:function(property,value,loaded,callback){var _this=this;if(!value){loaded[property]=true;return}if(property==="backgroundImage"||property==="overlayImage"){fabric.Image.fromObject(value,function(img){_this[property]=img;loaded[property]=true;callback&&callback()})}else{this["set"+fabric.util.string.capitalize(property,true)](value,function(){loaded[property]=true;callback&&callback()})}},_enlivenObjects:function(objects,callback,reviver){var _this=this;if(!objects||objects.length===0){callback&&callback();return}var renderOnAddRemove=this.renderOnAddRemove;this.renderOnAddRemove=false;fabric.util.enlivenObjects(objects,function(enlivenedObjects){enlivenedObjects.forEach(function(obj,index){_this.insertAt(obj,index,true)});_this.renderOnAddRemove=renderOnAddRemove;callback&&callback()},null,reviver)},_toDataURL:function(format,callback){this.clone(function(clone){callback(clone.toDataURL(format))})},_toDataURLWithMultiplier:function(format,multiplier,callback){this.clone(function(clone){callback(clone.toDataURLWithMultiplier(format,multiplier))})},clone:function(callback,properties){var data=JSON.stringify(this.toJSON(properties));this.cloneWithoutData(function(clone){clone.loadFromJSON(data,function(){callback&&callback(clone)})})},cloneWithoutData:function(callback){var el=fabric.document.createElement("canvas");el.width=this.getWidth();el.height=this.getHeight();var clone=new fabric.Canvas(el);clone.clipTo=this.clipTo;if(this.backgroundImage){clone.setBackgroundImage(this.backgroundImage.src,function(){clone.renderAll();callback&&callback(clone)});clone.backgroundImageOpacity=this.backgroundImageOpacity;clone.backgroundImageStretch=this.backgroundImageStretch}else{callback&&callback(clone)}}});(function(global){"use strict";var fabric=global.fabric||(global.fabric={}),extend=fabric.util.object.extend,toFixed=fabric.util.toFixed,capitalize=fabric.util.string.capitalize,degreesToRadians=fabric.util.degreesToRadians,supportsLineDash=fabric.StaticCanvas.supports("setLineDash");if(fabric.Object){return}fabric.Object=fabric.util.createClass({type:"object",originX:"left",originY:"top",top:0,left:0,width:0,height:0,scaleX:1,scaleY:1,flipX:false,flipY:false,opacity:1,angle:0,cornerSize:12,transparentCorners:true,hoverCursor:null,padding:0,borderColor:"rgba(102,153,255,0.75)",cornerColor:"rgba(102,153,255,0.5)",centeredScaling:false,centeredRotation:true,fill:"rgb(0,0,0)",fillRule:"nonzero",globalCompositeOperation:"source-over",backgroundColor:"",stroke:null,strokeWidth:1,strokeDashArray:null,strokeLineCap:"butt",strokeLineJoin:"miter",strokeMiterLimit:10,shadow:null,borderOpacityWhenMoving:.4,borderScaleFactor:1,transformMatrix:null,minScaleLimit:.01,selectable:true,evented:true,visible:true,hasControls:true,hasBorders:true,hasRotatingPoint:true,rotatingPointOffset:40,perPixelTargetFind:false,includeDefaultValues:true,clipTo:null,lockMovementX:false,lockMovementY:false,lockRotation:false,lockScalingX:false,lockScalingY:false,lockUniScaling:false,lockScalingFlip:false,stateProperties:("top left width height scaleX scaleY flipX flipY originX originY transformMatrix "+"stroke strokeWidth strokeDashArray strokeLineCap strokeLineJoin strokeMiterLimit "+"angle opacity fill fillRule globalCompositeOperation shadow clipTo visible backgroundColor").split(" "),initialize:function(options){if(options){this.setOptions(options)}},_initGradient:function(options){if(options.fill&&options.fill.colorStops&&!(options.fill instanceof fabric.Gradient)){this.set("fill",new fabric.Gradient(options.fill))}},_initPattern:function(options){if(options.fill&&options.fill.source&&!(options.fill instanceof fabric.Pattern)){this.set("fill",new fabric.Pattern(options.fill))}if(options.stroke&&options.stroke.source&&!(options.stroke instanceof fabric.Pattern)){this.set("stroke",new fabric.Pattern(options.stroke))}},_initClipping:function(options){if(!options.clipTo||typeof options.clipTo!=="string"){return}var functionBody=fabric.util.getFunctionBody(options.clipTo);if(typeof functionBody!=="undefined"){this.clipTo=new Function("ctx",functionBody)}},setOptions:function(options){for(var prop in options){this.set(prop,options[prop])}this._initGradient(options);this._initPattern(options);this._initClipping(options)},transform:function(ctx,fromLeft){var center=fromLeft?this._getLeftTopCoords():this.getCenterPoint();ctx.translate(center.x,center.y);ctx.rotate(degreesToRadians(this.angle));ctx.scale(this.scaleX*(this.flipX?-1:1),this.scaleY*(this.flipY?-1:1))},toObject:function(propertiesToInclude){var NUM_FRACTION_DIGITS=fabric.Object.NUM_FRACTION_DIGITS,object={type:this.type,originX:this.originX,originY:this.originY,left:toFixed(this.left,NUM_FRACTION_DIGITS),top:toFixed(this.top,NUM_FRACTION_DIGITS),width:toFixed(this.width,NUM_FRACTION_DIGITS),height:toFixed(this.height,NUM_FRACTION_DIGITS),fill:this.fill&&this.fill.toObject?this.fill.toObject():this.fill,stroke:this.stroke&&this.stroke.toObject?this.stroke.toObject():this.stroke,strokeWidth:toFixed(this.strokeWidth,NUM_FRACTION_DIGITS),strokeDashArray:this.strokeDashArray,strokeLineCap:this.strokeLineCap,strokeLineJoin:this.strokeLineJoin,strokeMiterLimit:toFixed(this.strokeMiterLimit,NUM_FRACTION_DIGITS),scaleX:toFixed(this.scaleX,NUM_FRACTION_DIGITS),scaleY:toFixed(this.scaleY,NUM_FRACTION_DIGITS),angle:toFixed(this.getAngle(),NUM_FRACTION_DIGITS),flipX:this.flipX,flipY:this.flipY,opacity:toFixed(this.opacity,NUM_FRACTION_DIGITS),shadow:this.shadow&&this.shadow.toObject?this.shadow.toObject():this.shadow,visible:this.visible,clipTo:this.clipTo&&String(this.clipTo),backgroundColor:this.backgroundColor,fillRule:this.fillRule,globalCompositeOperation:this.globalCompositeOperation};if(!this.includeDefaultValues){object=this._removeDefaultValues(object)}fabric.util.populateWithProperties(this,object,propertiesToInclude);return object},toDatalessObject:function(propertiesToInclude){return this.toObject(propertiesToInclude)},_removeDefaultValues:function(object){var prototype=fabric.util.getKlass(object.type).prototype,stateProperties=prototype.stateProperties;stateProperties.forEach(function(prop){if(object[prop]===prototype[prop]){delete object[prop]}});return object},toString:function(){return"#"},get:function(property){return this[property]},_setObject:function(obj){for(var prop in obj){this._set(prop,obj[prop])}},set:function(key,value){if(typeof key==="object"){this._setObject(key)}else{if(typeof value==="function"&&key!=="clipTo"){this._set(key,value(this.get(key)))}else{this._set(key,value)}}return this},_set:function(key,value){var shouldConstrainValue=key==="scaleX"||key==="scaleY";if(shouldConstrainValue){value=this._constrainScale(value)}if(key==="scaleX"&&value<0){this.flipX=!this.flipX;value*=-1}else if(key==="scaleY"&&value<0){this.flipY=!this.flipY;value*=-1}else if(key==="width"||key==="height"){this.minScaleLimit=toFixed(Math.min(.1,1/Math.max(this.width,this.height)),2)}else if(key==="shadow"&&value&&!(value instanceof fabric.Shadow)){value=new fabric.Shadow(value)}this[key]=value;return this},toggle:function(property){var value=this.get(property);if(typeof value==="boolean"){this.set(property,!value)}return this},setSourcePath:function(value){this.sourcePath=value;return this},getViewportTransform:function(){if(this.canvas&&this.canvas.viewportTransform){return this.canvas.viewportTransform}return[1,0,0,1,0,0]},render:function(ctx,noTransform){if(this.width===0&&this.height===0||!this.visible){return}ctx.save();this._setupCompositeOperation(ctx);if(!noTransform){this.transform(ctx)}this._setStrokeStyles(ctx);this._setFillStyles(ctx);if(this.transformMatrix){ctx.transform.apply(ctx,this.transformMatrix)}this._setOpacity(ctx);this._setShadow(ctx);this.clipTo&&fabric.util.clipContext(this,ctx);this._render(ctx,noTransform);this.clipTo&&ctx.restore();this._removeShadow(ctx);this._restoreCompositeOperation(ctx);ctx.restore()},_setOpacity:function(ctx){if(this.group){this.group._setOpacity(ctx)}ctx.globalAlpha*=this.opacity},_setStrokeStyles:function(ctx){if(this.stroke){ctx.lineWidth=this.strokeWidth;ctx.lineCap=this.strokeLineCap;ctx.lineJoin=this.strokeLineJoin;ctx.miterLimit=this.strokeMiterLimit;ctx.strokeStyle=this.stroke.toLive?this.stroke.toLive(ctx,this):this.stroke}},_setFillStyles:function(ctx){if(this.fill){ctx.fillStyle=this.fill.toLive?this.fill.toLive(ctx,this):this.fill}},_renderControls:function(ctx,noTransform){if(!this.active||noTransform){return}var vpt=this.getViewportTransform();ctx.save();var center;if(this.group){center=fabric.util.transformPoint(this.group.getCenterPoint(),vpt);ctx.translate(center.x,center.y);ctx.rotate(degreesToRadians(this.group.angle))}center=fabric.util.transformPoint(this.getCenterPoint(),vpt,null!=this.group);if(this.group){center.x*=this.group.scaleX;center.y*=this.group.scaleY}ctx.translate(center.x,center.y);ctx.rotate(degreesToRadians(this.angle));this.drawBorders(ctx);this.drawControls(ctx);ctx.restore()},_setShadow:function(ctx){if(!this.shadow){return}var multX=this.canvas&&this.canvas.viewportTransform[0]||1,multY=this.canvas&&this.canvas.viewportTransform[3]||1;ctx.shadowColor=this.shadow.color;ctx.shadowBlur=this.shadow.blur*(multX+multY)*(this.scaleX+this.scaleY)/4;ctx.shadowOffsetX=this.shadow.offsetX*multX*this.scaleX;ctx.shadowOffsetY=this.shadow.offsetY*multY*this.scaleY},_removeShadow:function(ctx){if(!this.shadow){return}ctx.shadowColor="";ctx.shadowBlur=ctx.shadowOffsetX=ctx.shadowOffsetY=0},_renderFill:function(ctx){if(!this.fill){return}ctx.save();if(this.fill.gradientTransform){var g=this.fill.gradientTransform;ctx.transform.apply(ctx,g)}if(this.fill.toLive){ctx.translate(-this.width/2+this.fill.offsetX||0,-this.height/2+this.fill.offsetY||0)}if(this.fillRule==="evenodd"){ctx.fill("evenodd")}else{ctx.fill()}ctx.restore();if(this.shadow&&!this.shadow.affectStroke){this._removeShadow(ctx)}},_renderStroke:function(ctx){if(!this.stroke||this.strokeWidth===0){return}ctx.save();if(this.strokeDashArray){if(1&this.strokeDashArray.length){this.strokeDashArray.push.apply(this.strokeDashArray,this.strokeDashArray)}if(supportsLineDash){ctx.setLineDash(this.strokeDashArray);this._stroke&&this._stroke(ctx)}else{this._renderDashedStroke&&this._renderDashedStroke(ctx)}ctx.stroke()}else{if(this.stroke.gradientTransform){var g=this.stroke.gradientTransform;ctx.transform.apply(ctx,g)}this._stroke?this._stroke(ctx):ctx.stroke()}this._removeShadow(ctx);ctx.restore()},clone:function(callback,propertiesToInclude){if(this.constructor.fromObject){return this.constructor.fromObject(this.toObject(propertiesToInclude),callback)}return new fabric.Object(this.toObject(propertiesToInclude))},cloneAsImage:function(callback){var dataUrl=this.toDataURL();fabric.util.loadImage(dataUrl,function(img){if(callback){callback(new fabric.Image(img))}});return this},toDataURL:function(options){options||(options={});var el=fabric.util.createCanvasElement(),boundingRect=this.getBoundingRect();el.width=boundingRect.width;el.height=boundingRect.height;fabric.util.wrapElement(el,"div");var canvas=new fabric.StaticCanvas(el);if(options.format==="jpg"){options.format="jpeg"}if(options.format==="jpeg"){canvas.backgroundColor="#fff"}var origParams={active:this.get("active"),left:this.getLeft(),top:this.getTop()};this.set("active",false);this.setPositionByOrigin(new fabric.Point(el.width/2,el.height/2),"center","center");var originalCanvas=this.canvas;canvas.add(this);var data=canvas.toDataURL(options);this.set(origParams).setCoords();this.canvas=originalCanvas;canvas.dispose();canvas=null;return data},isType:function(type){return this.type===type},complexity:function(){return 0},toJSON:function(propertiesToInclude){return this.toObject(propertiesToInclude)},setGradient:function(property,options){options||(options={});var gradient={colorStops:[]};gradient.type=options.type||(options.r1||options.r2?"radial":"linear");gradient.coords={x1:options.x1,y1:options.y1,x2:options.x2,y2:options.y2};if(options.r1||options.r2){gradient.coords.r1=options.r1;gradient.coords.r2=options.r2}for(var position in options.colorStops){var color=new fabric.Color(options.colorStops[position]);gradient.colorStops.push({offset:position,color:color.toRgb(),opacity:color.getAlpha()})}return this.set(property,fabric.Gradient.forObject(this,gradient))},setPatternFill:function(options){return this.set("fill",new fabric.Pattern(options))},setShadow:function(options){return this.set("shadow",options?new fabric.Shadow(options):null)},setColor:function(color){this.set("fill",color);return this},setAngle:function(angle){var shouldCenterOrigin=(this.originX!=="center"||this.originY!=="center")&&this.centeredRotation;if(shouldCenterOrigin){this._setOriginToCenter()}this.set("angle",angle);if(shouldCenterOrigin){this._resetOrigin()}return this},centerH:function(){this.canvas.centerObjectH(this);return this},centerV:function(){this.canvas.centerObjectV(this);return this},center:function(){this.canvas.centerObject(this);return this},remove:function(){this.canvas.remove(this);return this},getLocalPointer:function(e,pointer){pointer=pointer||this.canvas.getPointer(e);var objectLeftTop=this.translateToOriginPoint(this.getCenterPoint(),"left","top");return{x:pointer.x-objectLeftTop.x,y:pointer.y-objectLeftTop.y}},_setupCompositeOperation:function(ctx){if(this.globalCompositeOperation){this._prevGlobalCompositeOperation=ctx.globalCompositeOperation;ctx.globalCompositeOperation=this.globalCompositeOperation}},_restoreCompositeOperation:function(ctx){if(this.globalCompositeOperation&&this._prevGlobalCompositeOperation){ctx.globalCompositeOperation=this._prevGlobalCompositeOperation}}});fabric.util.createAccessors(fabric.Object);fabric.Object.prototype.rotate=fabric.Object.prototype.setAngle;extend(fabric.Object.prototype,fabric.Observable);fabric.Object.NUM_FRACTION_DIGITS=2;fabric.Object.__uid=0})(typeof exports!=="undefined"?exports:this);(function(){var degreesToRadians=fabric.util.degreesToRadians;fabric.util.object.extend(fabric.Object.prototype,{translateToCenterPoint:function(point,originX,originY){var cx=point.x,cy=point.y,strokeWidth=this.stroke?this.strokeWidth:0;if(originX==="left"){cx=point.x+(this.getWidth()+strokeWidth*this.scaleX)/2}else if(originX==="right"){cx=point.x-(this.getWidth()+strokeWidth*this.scaleX)/2}if(originY==="top"){cy=point.y+(this.getHeight()+strokeWidth*this.scaleY)/2}else if(originY==="bottom"){cy=point.y-(this.getHeight()+strokeWidth*this.scaleY)/2}return fabric.util.rotatePoint(new fabric.Point(cx,cy),point,degreesToRadians(this.angle))},translateToOriginPoint:function(center,originX,originY){var x=center.x,y=center.y,strokeWidth=this.stroke?this.strokeWidth:0;if(originX==="left"){x=center.x-(this.getWidth()+strokeWidth*this.scaleX)/2}else if(originX==="right"){x=center.x+(this.getWidth()+strokeWidth*this.scaleX)/2}if(originY==="top"){y=center.y-(this.getHeight()+strokeWidth*this.scaleY)/2}else if(originY==="bottom"){y=center.y+(this.getHeight()+strokeWidth*this.scaleY)/2}return fabric.util.rotatePoint(new fabric.Point(x,y),center,degreesToRadians(this.angle))},getCenterPoint:function(){var leftTop=new fabric.Point(this.left,this.top);return this.translateToCenterPoint(leftTop,this.originX,this.originY)},getPointByOrigin:function(originX,originY){var center=this.getCenterPoint();return this.translateToOriginPoint(center,originX,originY)},toLocalPoint:function(point,originX,originY){var center=this.getCenterPoint(),strokeWidth=this.stroke?this.strokeWidth:0,x,y;if(originX&&originY){if(originX==="left"){x=center.x-(this.getWidth()+strokeWidth*this.scaleX)/2}else if(originX==="right"){x=center.x+(this.getWidth()+strokeWidth*this.scaleX)/2}else{x=center.x}if(originY==="top"){y=center.y-(this.getHeight()+strokeWidth*this.scaleY)/2}else if(originY==="bottom"){y=center.y+(this.getHeight()+strokeWidth*this.scaleY)/2}else{y=center.y}}else{x=this.left;y=this.top}return fabric.util.rotatePoint(new fabric.Point(point.x,point.y),center,-degreesToRadians(this.angle)).subtractEquals(new fabric.Point(x,y))},setPositionByOrigin:function(pos,originX,originY){var center=this.translateToCenterPoint(pos,originX,originY),position=this.translateToOriginPoint(center,this.originX,this.originY);this.set("left",position.x);this.set("top",position.y)},adjustPosition:function(to){var angle=degreesToRadians(this.angle),hypotHalf=this.getWidth()/2,xHalf=Math.cos(angle)*hypotHalf,yHalf=Math.sin(angle)*hypotHalf,hypotFull=this.getWidth(),xFull=Math.cos(angle)*hypotFull,yFull=Math.sin(angle)*hypotFull;if(this.originX==="center"&&to==="left"||this.originX==="right"&&to==="center"){this.left-=xHalf;this.top-=yHalf}else if(this.originX==="left"&&to==="center"||this.originX==="center"&&to==="right"){this.left+=xHalf;this.top+=yHalf}else if(this.originX==="left"&&to==="right"){this.left+=xFull;this.top+=yFull}else if(this.originX==="right"&&to==="left"){this.left-=xFull;this.top-=yFull}this.setCoords();this.originX=to},_setOriginToCenter:function(){this._originalOriginX=this.originX;this._originalOriginY=this.originY;var center=this.getCenterPoint();this.originX="center";this.originY="center";this.left=center.x;this.top=center.y},_resetOrigin:function(){var originPoint=this.translateToOriginPoint(this.getCenterPoint(),this._originalOriginX,this._originalOriginY);this.originX=this._originalOriginX;this.originY=this._originalOriginY;this.left=originPoint.x;this.top=originPoint.y;this._originalOriginX=null;this._originalOriginY=null},_getLeftTopCoords:function(){return this.translateToOriginPoint(this.getCenterPoint(),"left","center")}})})();(function(){var degreesToRadians=fabric.util.degreesToRadians;fabric.util.object.extend(fabric.Object.prototype,{oCoords:null,intersectsWithRect:function(pointTL,pointBR){var oCoords=this.oCoords,tl=new fabric.Point(oCoords.tl.x,oCoords.tl.y),tr=new fabric.Point(oCoords.tr.x,oCoords.tr.y),bl=new fabric.Point(oCoords.bl.x,oCoords.bl.y),br=new fabric.Point(oCoords.br.x,oCoords.br.y),intersection=fabric.Intersection.intersectPolygonRectangle([tl,tr,br,bl],pointTL,pointBR);return intersection.status==="Intersection"},intersectsWithObject:function(other){function getCoords(oCoords){return{tl:new fabric.Point(oCoords.tl.x,oCoords.tl.y),tr:new fabric.Point(oCoords.tr.x,oCoords.tr.y),bl:new fabric.Point(oCoords.bl.x,oCoords.bl.y),br:new fabric.Point(oCoords.br.x,oCoords.br.y)}}var thisCoords=getCoords(this.oCoords),otherCoords=getCoords(other.oCoords),intersection=fabric.Intersection.intersectPolygonPolygon([thisCoords.tl,thisCoords.tr,thisCoords.br,thisCoords.bl],[otherCoords.tl,otherCoords.tr,otherCoords.br,otherCoords.bl]);return intersection.status==="Intersection"},isContainedWithinObject:function(other){var boundingRect=other.getBoundingRect(),point1=new fabric.Point(boundingRect.left,boundingRect.top),point2=new fabric.Point(boundingRect.left+boundingRect.width,boundingRect.top+boundingRect.height);return this.isContainedWithinRect(point1,point2)},isContainedWithinRect:function(pointTL,pointBR){var boundingRect=this.getBoundingRect();return boundingRect.left>=pointTL.x&&boundingRect.left+boundingRect.width<=pointBR.x&&boundingRect.top>=pointTL.y&&boundingRect.top+boundingRect.height<=pointBR.y},containsPoint:function(point){var lines=this._getImageLines(this.oCoords),xPoints=this._findCrossPoints(point,lines);return xPoints!==0&&xPoints%2===1},_getImageLines:function(oCoords){return{topline:{o:oCoords.tl,d:oCoords.tr},rightline:{o:oCoords.tr,d:oCoords.br},bottomline:{o:oCoords.br,d:oCoords.bl},leftline:{o:oCoords.bl,d:oCoords.tl}}},_findCrossPoints:function(point,oCoords){var b1,b2,a1,a2,xi,yi,xcount=0,iLine;for(var lineKey in oCoords){iLine=oCoords[lineKey];if(iLine.o.y=point.y&&iLine.d.y>=point.y){continue}if(iLine.o.x===iLine.d.x&&iLine.o.x>=point.x){xi=iLine.o.x;yi=point.y}else{b1=0;b2=(iLine.d.y-iLine.o.y)/(iLine.d.x-iLine.o.x);a1=point.y-b1*point.x;a2=iLine.o.y-b2*iLine.o.x;xi=-(a1-a2)/(b1-b2);yi=a1+b1*xi}if(xi>=point.x){xcount+=1}if(xcount===2){break}}return xcount},getBoundingRectWidth:function(){return this.getBoundingRect().width},getBoundingRectHeight:function(){return this.getBoundingRect().height},getBoundingRect:function(){this.oCoords||this.setCoords();var xCoords=[this.oCoords.tl.x,this.oCoords.tr.x,this.oCoords.br.x,this.oCoords.bl.x],minX=fabric.util.array.min(xCoords),maxX=fabric.util.array.max(xCoords),width=Math.abs(minX-maxX),yCoords=[this.oCoords.tl.y,this.oCoords.tr.y,this.oCoords.br.y,this.oCoords.bl.y],minY=fabric.util.array.min(yCoords),maxY=fabric.util.array.max(yCoords),height=Math.abs(minY-maxY);return{left:minX,top:minY,width:width,height:height}},getWidth:function(){return this.width*this.scaleX},getHeight:function(){return this.height*this.scaleY},_constrainScale:function(value){if(Math.abs(value)\n');return reviver?reviver(markup.join("")):markup.join("")},complexity:function(){return 1}});fabric.Line.ATTRIBUTE_NAMES=fabric.SHARED_ATTRIBUTES.concat("x1 y1 x2 y2".split(" "));fabric.Line.fromElement=function(element,options){var parsedAttributes=fabric.parseAttributes(element,fabric.Line.ATTRIBUTE_NAMES),points=[parsedAttributes.x1||0,parsedAttributes.y1||0,parsedAttributes.x2||0,parsedAttributes.y2||0];return new fabric.Line(points,extend(parsedAttributes,options))};fabric.Line.fromObject=function(object){var points=[object.x1,object.y1,object.x2,object.y2];return new fabric.Line(points,object)};function makeEdgeToOriginGetter(propertyNames,originValues){var origin=propertyNames.origin,axis1=propertyNames.axis1,axis2=propertyNames.axis2,dimension=propertyNames.dimension,nearest=originValues.nearest,center=originValues.center,farthest=originValues.farthest;return function(){switch(this.get(origin)){case nearest:return Math.min(this.get(axis1),this.get(axis2));case center:return Math.min(this.get(axis1),this.get(axis2))+.5*this.get(dimension);case farthest:return Math.max(this.get(axis1),this.get(axis2))}}}})(typeof exports!=="undefined"?exports:this);(function(global){"use strict";var fabric=global.fabric||(global.fabric={}),pi=Math.PI,extend=fabric.util.object.extend;if(fabric.Circle){fabric.warn("fabric.Circle is already defined.");return}fabric.Circle=fabric.util.createClass(fabric.Object,{type:"circle",radius:0,startAngle:0,endAngle:pi*2,initialize:function(options){options=options||{};this.callSuper("initialize",options);this.set("radius",options.radius||0);this.startAngle=options.startAngle||this.startAngle;this.endAngle=options.endAngle||this.endAngle},_set:function(key,value){this.callSuper("_set",key,value);if(key==="radius"){this.setRadius(value)}return this},toObject:function(propertiesToInclude){return extend(this.callSuper("toObject",propertiesToInclude),{radius:this.get("radius"),startAngle:this.startAngle,endAngle:this.endAngle})},toSVG:function(reviver){var markup=this._createBaseSVGMarkup(),x=0,y=0,angle=(this.endAngle-this.startAngle)%(2*pi);if(angle===0){if(this.group&&this.group.type==="path-group"){x=this.left+this.radius;y=this.top+this.radius}markup.push("\n')}else{var startX=Math.cos(this.startAngle)*this.radius,startY=Math.sin(this.startAngle)*this.radius,endX=Math.cos(this.endAngle)*this.radius,endY=Math.sin(this.endAngle)*this.radius,largeFlag=angle>pi?"1":"0";markup.push('\n')}return reviver?reviver(markup.join("")):markup.join("")},_render:function(ctx,noTransform){ctx.beginPath();ctx.arc(noTransform?this.left+this.radius:0,noTransform?this.top+this.radius:0,this.radius,this.startAngle,this.endAngle,false);this._renderFill(ctx);this._renderStroke(ctx)},getRadiusX:function(){return this.get("radius")*this.get("scaleX")},getRadiusY:function(){return this.get("radius")*this.get("scaleY")},setRadius:function(value){this.radius=value;this.set("width",value*2).set("height",value*2)},complexity:function(){return 1}});fabric.Circle.ATTRIBUTE_NAMES=fabric.SHARED_ATTRIBUTES.concat("cx cy r".split(" "));fabric.Circle.fromElement=function(element,options){options||(options={});var parsedAttributes=fabric.parseAttributes(element,fabric.Circle.ATTRIBUTE_NAMES);if(!isValidRadius(parsedAttributes)){throw new Error("value of `r` attribute is required and can not be negative")}parsedAttributes.left=parsedAttributes.left||0;parsedAttributes.top=parsedAttributes.top||0;var obj=new fabric.Circle(extend(parsedAttributes,options));obj.left-=obj.radius;obj.top-=obj.radius;return obj};function isValidRadius(attributes){return"radius"in attributes&&attributes.radius>=0}fabric.Circle.fromObject=function(object){return new fabric.Circle(object)}})(typeof exports!=="undefined"?exports:this);(function(global){"use strict";var fabric=global.fabric||(global.fabric={});if(fabric.Triangle){fabric.warn("fabric.Triangle is already defined");return}fabric.Triangle=fabric.util.createClass(fabric.Object,{type:"triangle",initialize:function(options){options=options||{};this.callSuper("initialize",options);this.set("width",options.width||100).set("height",options.height||100)},_render:function(ctx){var widthBy2=this.width/2,heightBy2=this.height/2;ctx.beginPath();ctx.moveTo(-widthBy2,heightBy2);ctx.lineTo(0,-heightBy2);ctx.lineTo(widthBy2,heightBy2);ctx.closePath();this._renderFill(ctx);this._renderStroke(ctx)},_renderDashedStroke:function(ctx){var widthBy2=this.width/2,heightBy2=this.height/2;ctx.beginPath();fabric.util.drawDashedLine(ctx,-widthBy2,heightBy2,0,-heightBy2,this.strokeDashArray);fabric.util.drawDashedLine(ctx,0,-heightBy2,widthBy2,heightBy2,this.strokeDashArray);fabric.util.drawDashedLine(ctx,widthBy2,heightBy2,-widthBy2,heightBy2,this.strokeDashArray);ctx.closePath()},toSVG:function(reviver){var markup=this._createBaseSVGMarkup(),widthBy2=this.width/2,heightBy2=this.height/2,points=[-widthBy2+" "+heightBy2,"0 "+-heightBy2,widthBy2+" "+heightBy2].join(",");markup.push("');return reviver?reviver(markup.join("")):markup.join("")},complexity:function(){return 1}});fabric.Triangle.fromObject=function(object){return new fabric.Triangle(object)}})(typeof exports!=="undefined"?exports:this);(function(global){"use strict";var fabric=global.fabric||(global.fabric={}),piBy2=Math.PI*2,extend=fabric.util.object.extend;if(fabric.Ellipse){fabric.warn("fabric.Ellipse is already defined.");return}fabric.Ellipse=fabric.util.createClass(fabric.Object,{type:"ellipse",rx:0,ry:0,initialize:function(options){options=options||{};this.callSuper("initialize",options);this.set("rx",options.rx||0);this.set("ry",options.ry||0)},_set:function(key,value){this.callSuper("_set",key,value);switch(key){case"rx":this.rx=value;this.set("width",value*2);break;case"ry":this.ry=value;this.set("height",value*2);break}return this},getRx:function(){return this.get("rx")*this.get("scaleX")},getRy:function(){return this.get("ry")*this.get("scaleY")},toObject:function(propertiesToInclude){return extend(this.callSuper("toObject",propertiesToInclude),{rx:this.get("rx"),ry:this.get("ry")})},toSVG:function(reviver){var markup=this._createBaseSVGMarkup(),x=0,y=0;if(this.group&&this.group.type==="path-group"){x=this.left+this.rx;y=this.top+this.ry}markup.push("\n');return reviver?reviver(markup.join("")):markup.join("")},_render:function(ctx,noTransform){ctx.beginPath();ctx.save();ctx.transform(1,0,0,this.ry/this.rx,0,0);ctx.arc(noTransform?this.left+this.rx:0,noTransform?(this.top+this.ry)*this.rx/this.ry:0,this.rx,0,piBy2,false);ctx.restore();this._renderFill(ctx);this._renderStroke(ctx)},complexity:function(){return 1}});fabric.Ellipse.ATTRIBUTE_NAMES=fabric.SHARED_ATTRIBUTES.concat("cx cy rx ry".split(" "));fabric.Ellipse.fromElement=function(element,options){options||(options={});var parsedAttributes=fabric.parseAttributes(element,fabric.Ellipse.ATTRIBUTE_NAMES);parsedAttributes.left=parsedAttributes.left||0;parsedAttributes.top=parsedAttributes.top||0;var ellipse=new fabric.Ellipse(extend(parsedAttributes,options));ellipse.top-=ellipse.ry;ellipse.left-=ellipse.rx;return ellipse};fabric.Ellipse.fromObject=function(object){return new fabric.Ellipse(object)}})(typeof exports!=="undefined"?exports:this);(function(global){"use strict";var fabric=global.fabric||(global.fabric={}),extend=fabric.util.object.extend;if(fabric.Rect){console.warn("fabric.Rect is already defined");return}var stateProperties=fabric.Object.prototype.stateProperties.concat();stateProperties.push("rx","ry","x","y");fabric.Rect=fabric.util.createClass(fabric.Object,{stateProperties:stateProperties,type:"rect",rx:0,ry:0,strokeDashArray:null,initialize:function(options){options=options||{};this.callSuper("initialize",options);this._initRxRy()},_initRxRy:function(){if(this.rx&&!this.ry){this.ry=this.rx}else if(this.ry&&!this.rx){this.rx=this.ry}},_render:function(ctx,noTransform){if(this.width===1&&this.height===1){ctx.fillRect(0,0,1,1);return}var rx=this.rx?Math.min(this.rx,this.width/2):0,ry=this.ry?Math.min(this.ry,this.height/2):0,w=this.width,h=this.height,x=noTransform?this.left:-this.width/2,y=noTransform?this.top:-this.height/2,isRounded=rx!==0||ry!==0,k=1-.5522847498;ctx.beginPath();ctx.moveTo(x+rx,y);ctx.lineTo(x+w-rx,y);isRounded&&ctx.bezierCurveTo(x+w-k*rx,y,x+w,y+k*ry,x+w,y+ry);ctx.lineTo(x+w,y+h-ry);isRounded&&ctx.bezierCurveTo(x+w,y+h-k*ry,x+w-k*rx,y+h,x+w-rx,y+h);ctx.lineTo(x+rx,y+h);isRounded&&ctx.bezierCurveTo(x+k*rx,y+h,x,y+h-k*ry,x,y+h-ry);ctx.lineTo(x,y+ry);isRounded&&ctx.bezierCurveTo(x,y+k*ry,x+k*rx,y,x+rx,y);ctx.closePath();this._renderFill(ctx);this._renderStroke(ctx)},_renderDashedStroke:function(ctx){var x=-this.width/2,y=-this.height/2,w=this.width,h=this.height;ctx.beginPath();fabric.util.drawDashedLine(ctx,x,y,x+w,y,this.strokeDashArray);fabric.util.drawDashedLine(ctx,x+w,y,x+w,y+h,this.strokeDashArray);fabric.util.drawDashedLine(ctx,x+w,y+h,x,y+h,this.strokeDashArray);fabric.util.drawDashedLine(ctx,x,y+h,x,y,this.strokeDashArray);ctx.closePath()},toObject:function(propertiesToInclude){var object=extend(this.callSuper("toObject",propertiesToInclude),{rx:this.get("rx")||0,ry:this.get("ry")||0});if(!this.includeDefaultValues){this._removeDefaultValues(object)}return object},toSVG:function(reviver){var markup=this._createBaseSVGMarkup(),x=this.left,y=this.top;if(!(this.group&&this.group.type==="path-group")){x=-this.width/2;y=-this.height/2}markup.push("\n');return reviver?reviver(markup.join("")):markup.join("")},complexity:function(){return 1}});fabric.Rect.ATTRIBUTE_NAMES=fabric.SHARED_ATTRIBUTES.concat("x y rx ry width height".split(" "));fabric.Rect.fromElement=function(element,options){if(!element){return null}options=options||{};var parsedAttributes=fabric.parseAttributes(element,fabric.Rect.ATTRIBUTE_NAMES);parsedAttributes.left=parsedAttributes.left||0;parsedAttributes.top=parsedAttributes.top||0;var rect=new fabric.Rect(extend(options?fabric.util.object.clone(options):{},parsedAttributes));rect.visible=rect.width>0&&rect.height>0;return rect};fabric.Rect.fromObject=function(object){return new fabric.Rect(object)}})(typeof exports!=="undefined"?exports:this);(function(global){"use strict";var fabric=global.fabric||(global.fabric={});if(fabric.Polyline){fabric.warn("fabric.Polyline is already defined");return}fabric.Polyline=fabric.util.createClass(fabric.Object,{type:"polyline",points:null,minX:0,minY:0,initialize:function(points,options){return fabric.Polygon.prototype.initialize.call(this,points,options)},_calcDimensions:function(){return fabric.Polygon.prototype._calcDimensions.call(this)},_applyPointOffset:function(){return fabric.Polygon.prototype._applyPointOffset.call(this)},toObject:function(propertiesToInclude){return fabric.Polygon.prototype.toObject.call(this,propertiesToInclude)},toSVG:function(reviver){return fabric.Polygon.prototype.toSVG.call(this,reviver)},_render:function(ctx){if(!fabric.Polygon.prototype.commonRender.call(this,ctx)){return}this._renderFill(ctx);this._renderStroke(ctx)},_renderDashedStroke:function(ctx){var p1,p2;ctx.beginPath();for(var i=0,len=this.points.length;i\n');return reviver?reviver(markup.join("")):markup.join("")},_render:function(ctx){if(!this.commonRender(ctx)){return}this._renderFill(ctx);if(this.stroke||this.strokeDashArray){ctx.closePath();this._renderStroke(ctx)}},commonRender:function(ctx){var point,len=this.points.length;if(!len||isNaN(this.points[len-1].y)){return false}ctx.beginPath();if(this._applyPointOffset){if(!(this.group&&this.group.type==="path-group")){this._applyPointOffset()}this._applyPointOffset=null}ctx.moveTo(this.points[0].x,this.points[0].y);for(var i=0;i"},toObject:function(propertiesToInclude){var o=extend(this.callSuper("toObject",propertiesToInclude),{path:this.path.map(function(item){return item.slice()}),pathOffset:this.pathOffset});if(this.sourcePath){o.sourcePath=this.sourcePath}if(this.transformMatrix){o.transformMatrix=this.transformMatrix}return o},toDatalessObject:function(propertiesToInclude){var o=this.toObject(propertiesToInclude);if(this.sourcePath){o.path=this.sourcePath}delete o.sourcePath;return o},toSVG:function(reviver){var chunks=[],markup=this._createBaseSVGMarkup(),addTransform="";for(var i=0,len=this.path.length;i\n");return reviver?reviver(markup.join("")):markup.join("")},complexity:function(){return this.path.length},_parsePath:function(){var result=[],coords=[],currentPath,parsed,re=/([-+]?((\d+\.\d+)|((\d+)|(\.\d+)))(?:e[-+]?\d+)?)/gi,match,coordsStr;for(var i=0,coordsParsed,len=this.path.length;icommandLength){for(var k=1,klen=coordsParsed.length;k\n"];for(var i=0,len=objects.length;i\n");return reviver?reviver(markup.join("")):markup.join("")},toString:function(){return"#"},isSameColor:function(){var firstPathFill=(this.getObjects()[0].get("fill")||"").toLowerCase();return this.getObjects().every(function(path){return(path.get("fill")||"").toLowerCase()===firstPathFill})},complexity:function(){return this.paths.reduce(function(total,path){return total+(path&&path.complexity?path.complexity():0)},0)},getObjects:function(){return this.paths}});fabric.PathGroup.fromObject=function(object,callback){if(typeof object.paths==="string"){fabric.loadSVGFromURL(object.paths,function(elements){var pathUrl=object.paths;delete object.paths;var pathGroup=fabric.util.groupSVGElements(elements,object,pathUrl);callback(pathGroup)})}else{fabric.util.enlivenObjects(object.paths,function(enlivenedObjects){delete object.paths;callback(new fabric.PathGroup(enlivenedObjects,object))})}};fabric.PathGroup.async=true})(typeof exports!=="undefined"?exports:this);(function(global){"use strict";var fabric=global.fabric||(global.fabric={}),extend=fabric.util.object.extend,min=fabric.util.array.min,max=fabric.util.array.max,invoke=fabric.util.array.invoke;if(fabric.Group){return}var _lockProperties={lockMovementX:true,lockMovementY:true,lockRotation:true,lockScalingX:true,lockScalingY:true,lockUniScaling:true};fabric.Group=fabric.util.createClass(fabric.Object,fabric.Collection,{type:"group",initialize:function(objects,options){options=options||{};this._objects=objects||[];for(var i=this._objects.length;i--;){this._objects[i].group=this}this.originalState={};this.callSuper("initialize");if(options.originX){this.originX=options.originX}if(options.originY){this.originY=options.originY}this._calcBounds();this._updateObjectsCoords();this.callSuper("initialize",options);this.setCoords();this.saveCoords()},_updateObjectsCoords:function(){this.forEachObject(this._updateObjectCoords,this)},_updateObjectCoords:function(object){var objectLeft=object.getLeft(),objectTop=object.getTop(),center=this.getCenterPoint();object.set({originalLeft:objectLeft,originalTop:objectTop,left:objectLeft-center.x,top:objectTop-center.y});object.setCoords();object.__origHasControls=object.hasControls;object.hasControls=false},toString:function(){return"#"},addWithUpdate:function(object){this._restoreObjectsState();if(object){this._objects.push(object);object.group=this}this.forEachObject(this._setObjectActive,this);this._calcBounds();this._updateObjectsCoords();return this},_setObjectActive:function(object){object.set("active",true);object.group=this},removeWithUpdate:function(object){this._moveFlippedObject(object);this._restoreObjectsState();this.forEachObject(this._setObjectActive,this);this.remove(object);this._calcBounds();this._updateObjectsCoords();return this},_onObjectAdded:function(object){object.group=this},_onObjectRemoved:function(object){delete object.group;object.set("active",false)},delegatedProperties:{fill:true,opacity:true,fontFamily:true,fontWeight:true,fontSize:true,fontStyle:true,lineHeight:true,textDecoration:true,textAlign:true,backgroundColor:true},_set:function(key,value){if(key in this.delegatedProperties){var i=this._objects.length;while(i--){this._objects[i].set(key,value)}}this.callSuper("_set",key,value)},toObject:function(propertiesToInclude){return extend(this.callSuper("toObject",propertiesToInclude),{objects:invoke(this._objects,"toObject",propertiesToInclude)})},render:function(ctx){if(!this.visible){return}ctx.save();this.clipTo&&fabric.util.clipContext(this,ctx);this.transform(ctx);for(var i=0,len=this._objects.length;i\n'];for(var i=0,len=this._objects.length;i\n");return reviver?reviver(markup.join("")):markup.join("")},get:function(prop){if(prop in _lockProperties){if(this[prop]){return this[prop]}else{for(var i=0,len=this._objects.length;i\n','\n");if(this.stroke||this.strokeDashArray){var origFill=this.fill;this.fill=null;markup.push("\n');this.fill=origFill}markup.push("
\n");return reviver?reviver(markup.join("")):markup.join("")},getSrc:function(){if(this.getElement()){return this.getElement().src||this.getElement()._src}},setSrc:function(src,callback,options){fabric.util.loadImage(src,function(img){return this.setElement(img,callback,options)},this,options&&options.crossOrigin)},toString:function(){return'#'},clone:function(callback,propertiesToInclude){this.constructor.fromObject(this.toObject(propertiesToInclude),callback)},applyFilters:function(callback,filters,imgElement,forResizing){filters=filters||this.filters;imgElement=imgElement||this._originalElement;if(!imgElement){return}var imgEl=imgElement,canvasEl=fabric.util.createCanvasElement(),replacement=fabric.util.createImage(),_this=this;canvasEl.width=imgEl.width;canvasEl.height=imgEl.height;canvasEl.getContext("2d").drawImage(imgEl,0,0,imgEl.width,imgEl.height);if(filters.length===0){this._element=imgElement;callback&&callback();return canvasEl}filters.forEach(function(filter){filter&&filter.applyTo(canvasEl,filter.scaleX||_this.scaleX,filter.scaleY||_this.scaleY);if(!forResizing&&filter&&filter.type==="Resize"){_this.width*=filter.scaleX;_this.height*=filter.scaleY}});replacement.width=canvasEl.width;replacement.height=canvasEl.height;if(fabric.isLikelyNode){replacement.src=canvasEl.toBuffer(undefined,fabric.Image.pngCompression);_this._element=replacement;!forResizing&&(_this._filteredEl=replacement);callback&&callback()}else{replacement.onload=function(){_this._element=replacement;!forResizing&&(_this._filteredEl=replacement);callback&&callback();replacement.onload=canvasEl=imgEl=null};replacement.src=canvasEl.toDataURL("image/png")}return canvasEl},_render:function(ctx,noTransform){var x,y,imageMargins=this._findMargins(),elementToDraw;x=noTransform?this.left:-this.width/2;y=noTransform?this.top:-this.height/2;if(this.meetOrSlice==="slice"){ctx.beginPath();ctx.rect(x,y,this.width,this.height);ctx.clip()}if(this.isMoving===false&&this.resizeFilters.length&&this._needsResize()){this._lastScaleX=this.scaleX;this._lastScaleY=this.scaleY;elementToDraw=this.applyFilters(null,this.resizeFilters,this._filteredEl||this._originalElement,true)}else{elementToDraw=this._element}elementToDraw&&ctx.drawImage(elementToDraw,x+imageMargins.marginX,y+imageMargins.marginY,imageMargins.width,imageMargins.height);this._renderStroke(ctx)},_needsResize:function(){return this.scaleX!==this._lastScaleX||this.scaleY!==this._lastScaleY},_findMargins:function(){var width=this.width,height=this.height,scales,scale,marginX=0,marginY=0;if(this.alignX!=="none"||this.alignY!=="none"){scales=[this.width/this._element.width,this.height/this._element.height];scale=this.meetOrSlice==="meet"?Math.min.apply(null,scales):Math.max.apply(null,scales);width=this._element.width*scale;height=this._element.height*scale;if(this.alignX==="Mid"){marginX=(this.width-width)/2}if(this.alignX==="Max"){marginX=this.width-width}if(this.alignY==="Mid"){marginY=(this.height-height)/2}if(this.alignY==="Max"){marginY=this.height-height}}return{width:width,height:height,marginX:marginX,marginY:marginY}},_resetWidthHeight:function(){var element=this.getElement();this.set("width",element.width);this.set("height",element.height)},_initElement:function(element){this.setElement(fabric.util.getById(element));fabric.util.addClass(this.getElement(),fabric.Image.CSS_CANVAS)},_initConfig:function(options){options||(options={});this.setOptions(options);this._setWidthHeight(options);if(this._element&&this.crossOrigin){this._element.crossOrigin=this.crossOrigin}},_initFilters:function(object,callback){if(object.filters&&object.filters.length){fabric.util.enlivenObjects(object.filters,function(enlivenedObjects){callback&&callback(enlivenedObjects)},"fabric.Image.filters")}else{callback&&callback()}},_setWidthHeight:function(options){this.width="width"in options?options.width:this.getElement()?this.getElement().width||0:0;this.height="height"in options?options.height:this.getElement()?this.getElement().height||0:0},complexity:function(){return 1}});fabric.Image.CSS_CANVAS="canvas-img";fabric.Image.prototype.getSvgSrc=fabric.Image.prototype.getSrc;fabric.Image.fromObject=function(object,callback){fabric.util.loadImage(object.src,function(img){fabric.Image.prototype._initFilters.call(object,object,function(filters){object.filters=filters||[];var instance=new fabric.Image(img,object);callback&&callback(instance)})},null,object.crossOrigin)};fabric.Image.fromURL=function(url,callback,imgOptions){fabric.util.loadImage(url,function(img){callback&&callback(new fabric.Image(img,imgOptions))},null,imgOptions&&imgOptions.crossOrigin)};fabric.Image.ATTRIBUTE_NAMES=fabric.SHARED_ATTRIBUTES.concat("x y width height preserveAspectRatio xlink:href".split(" "));fabric.Image.fromElement=function(element,callback,options){var parsedAttributes=fabric.parseAttributes(element,fabric.Image.ATTRIBUTE_NAMES),align="xMidYMid",meetOrSlice="meet",alignX,alignY,aspectRatioAttrs;if(parsedAttributes.preserveAspectRatio){aspectRatioAttrs=parsedAttributes.preserveAspectRatio.split(" ")}if(aspectRatioAttrs&&aspectRatioAttrs.length){meetOrSlice=aspectRatioAttrs.pop();if(meetOrSlice!=="meet"&&meetOrSlice!=="slice"){align=meetOrSlice;meetOrSlice="meet"}else if(aspectRatioAttrs.length){align=aspectRatioAttrs.pop()}}alignX=align!=="none"?align.slice(1,4):"none";alignY=align!=="none"?align.slice(5,8):"none";parsedAttributes.alignX=alignX;parsedAttributes.alignY=alignY;parsedAttributes.meetOrSlice=meetOrSlice;fabric.Image.fromURL(parsedAttributes["xlink:href"],callback,extend(options?fabric.util.object.clone(options):{},parsedAttributes))};fabric.Image.async=true;fabric.Image.pngCompression=1})(typeof exports!=="undefined"?exports:this);fabric.util.object.extend(fabric.Object.prototype,{_getAngleValueForStraighten:function(){var angle=this.getAngle()%360;if(angle>0){return Math.round((angle-1)/90)*90}return Math.round(angle/90)*90},straighten:function(){this.setAngle(this._getAngleValueForStraighten());return this},fxStraighten:function(callbacks){callbacks=callbacks||{};var empty=function(){},onComplete=callbacks.onComplete||empty,onChange=callbacks.onChange||empty,_this=this;fabric.util.animate({startValue:this.get("angle"),endValue:this._getAngleValueForStraighten(),duration:this.FX_DURATION,onChange:function(value){_this.setAngle(value);onChange()},onComplete:function(){_this.setCoords();onComplete()},onStart:function(){_this.set("active",false)}});return this}});fabric.util.object.extend(fabric.StaticCanvas.prototype,{straightenObject:function(object){object.straighten();this.renderAll();return this},fxStraightenObject:function(object){object.fxStraighten({onChange:this.renderAll.bind(this)});return this}});fabric.Image.filters=fabric.Image.filters||{};fabric.Image.filters.BaseFilter=fabric.util.createClass({type:"BaseFilter",initialize:function(options){if(options){this.setOptions(options)}},setOptions:function(options){for(var prop in options){this[prop]=options[prop]}},toObject:function(){return{type:this.type}},toJSON:function(){return this.toObject()}});(function(global){"use strict";var fabric=global.fabric||(global.fabric={}),extend=fabric.util.object.extend;fabric.Image.filters.Brightness=fabric.util.createClass(fabric.Image.filters.BaseFilter,{type:"Brightness",initialize:function(options){options=options||{};this.brightness=options.brightness||0},applyTo:function(canvasEl){var context=canvasEl.getContext("2d"),imageData=context.getImageData(0,0,canvasEl.width,canvasEl.height),data=imageData.data,brightness=this.brightness;for(var i=0,len=data.length;ish||scx<0||scx>sw){continue}var srcOff=(scy*sw+scx)*4,wt=weights[cy*side+cx];r+=src[srcOff]*wt;g+=src[srcOff+1]*wt;b+=src[srcOff+2]*wt;a+=src[srcOff+3]*wt}}dst[dstOff]=r;dst[dstOff+1]=g;dst[dstOff+2]=b;dst[dstOff+3]=a+alphaFac*(255-a)}}context.putImageData(output,0,0)},toObject:function(){return extend(this.callSuper("toObject"),{opaque:this.opaque,matrix:this.matrix})}});fabric.Image.filters.Convolute.fromObject=function(object){return new fabric.Image.filters.Convolute(object); + +}})(typeof exports!=="undefined"?exports:this);(function(global){"use strict";var fabric=global.fabric||(global.fabric={}),extend=fabric.util.object.extend;fabric.Image.filters.GradientTransparency=fabric.util.createClass(fabric.Image.filters.BaseFilter,{type:"GradientTransparency",initialize:function(options){options=options||{};this.threshold=options.threshold||100},applyTo:function(canvasEl){var context=canvasEl.getContext("2d"),imageData=context.getImageData(0,0,canvasEl.width,canvasEl.height),data=imageData.data,threshold=this.threshold,total=data.length;for(var i=0,len=data.length;i-1?options.channel:0},applyTo:function(canvasEl){if(!this.mask){return}var context=canvasEl.getContext("2d"),imageData=context.getImageData(0,0,canvasEl.width,canvasEl.height),data=imageData.data,maskEl=this.mask.getElement(),maskCanvasEl=fabric.util.createCanvasElement(),channel=this.channel,i,iLen=imageData.width*imageData.height*4;maskCanvasEl.width=maskEl.width;maskCanvasEl.height=maskEl.height;maskCanvasEl.getContext("2d").drawImage(maskEl,0,0,maskEl.width,maskEl.height);var maskImageData=maskCanvasEl.getContext("2d").getImageData(0,0,maskEl.width,maskEl.height),maskData=maskImageData.data;for(i=0;ilimit&&g>limit&&b>limit&&abs(r-g)width){multW=2;signW=-1}if(newHeight>height){multH=2;signH=-1}imageData=context.getImageData(0,0,width,height);canvasEl.width=max(newWidth,width);canvasEl.height=max(newHeight,height);context.putImageData(imageData,0,0);while(!doneW||!doneH){width=stepW;height=stepH;if(newWidth*signWlobes){return 0}x*=Math.PI;if(abs(x)<1e-16){return 1}var xx=x/lobes;return sin(x)*sin(xx)/x/xx}}function process(u){var v,i,weight,idx,a,red,green,blue,alpha,fX,fY;center.x=(u+.5)*ratioX;icenter.x=floor(center.x);for(v=0;v=oW){continue}fX=floor(1e3*abs(i-center.x));if(!cacheLanc[fX]){cacheLanc[fX]={}}for(var j=icenter.y-range2Y;j<=icenter.y+range2Y;j++){if(j<0||j>=oH){continue}fY=floor(1e3*abs(j-center.y));if(!cacheLanc[fX][fY]){cacheLanc[fX][fY]=lanczos(sqrt(pow(fX*rcpRatioX,2)+pow(fY*rcpRatioY,2))/1e3)}weight=cacheLanc[fX][fY];if(weight>0){idx=(j*oW+i)*4;a+=weight;red+=weight*srcData[idx];green+=weight*srcData[idx+1];blue+=weight*srcData[idx+2];alpha+=weight*srcData[idx+3]}}}idx=(v*dW+u)*4;destData[idx]=red/a;destData[idx+1]=green/a;destData[idx+2]=blue/a;destData[idx+3]=alpha/a}if(++u1&&w<-1){continue}weight=2*w*w*w-3*w*w+1;if(weight>0){dx=4*(xx+yy*oW);gxA+=weight*data[dx+3];weightsAlpha+=weight;if(data[dx+3]<255){weight=weight*data[dx+3]/250}gxR+=weight*data[dx];gxG+=weight*data[dx+1];gxB+=weight*data[dx+2];weights+=weight}}}data2[x2]=gxR/weights;data2[x2+1]=gxG/weights;data2[x2+2]=gxB/weights;data2[x2+3]=gxA/weightsAlpha}}return img2},toObject:function(){return{type:this.type,scaleX:this.scaleX,scaley:this.scaleY,resizeType:this.resizeType,lanczosLobes:this.lanczosLobes}}});fabric.Image.filters.Resize.fromObject=function(){return new fabric.Image.filters.Resize}})(typeof exports!=="undefined"?exports:this);(function(global){"use strict";var fabric=global.fabric||(global.fabric={}),extend=fabric.util.object.extend,clone=fabric.util.object.clone,toFixed=fabric.util.toFixed,supportsLineDash=fabric.StaticCanvas.supports("setLineDash");if(fabric.Text){fabric.warn("fabric.Text is already defined");return}var stateProperties=fabric.Object.prototype.stateProperties.concat();stateProperties.push("fontFamily","fontWeight","fontSize","text","textDecoration","textAlign","fontStyle","lineHeight","textBackgroundColor");fabric.Text=fabric.util.createClass(fabric.Object,{_dimensionAffectingProps:{fontSize:true,fontWeight:true,fontFamily:true,fontStyle:true,lineHeight:true,stroke:true,strokeWidth:true,text:true,textAlign:true},_reNewline:/\r?\n/,type:"text",fontSize:40,fontWeight:"normal",fontFamily:"Times New Roman",textDecoration:"",textAlign:"left",fontStyle:"",lineHeight:1.16,textBackgroundColor:"",stateProperties:stateProperties,stroke:null,shadow:null,_fontSizeFraction:.25,_fontSizeMult:1.13,initialize:function(text,options){options=options||{};this.text=text;this.__skipDimension=true;this.setOptions(options);this.__skipDimension=false;this._initDimensions()},_initDimensions:function(ctx){if(this.__skipDimension){return}if(!ctx){ctx=fabric.util.createCanvasElement().getContext("2d");this._setTextStyles(ctx)}this._textLines=this.text.split(this._reNewline);this._clearCache();var currentTextAlign=this.textAlign;this.textAlign="left";this.width=this._getTextWidth(ctx);this.textAlign=currentTextAlign;this.height=this._getTextHeight(ctx)},toString:function(){return"#'},_render:function(ctx){this.clipTo&&fabric.util.clipContext(this,ctx);this._renderTextBackground(ctx);this._renderText(ctx);this._renderTextDecoration(ctx);this.clipTo&&ctx.restore()},_renderText:function(ctx){ctx.save();this._translateForTextAlign(ctx);this._setOpacity(ctx);this._setShadow(ctx);this._setupCompositeOperation(ctx);this._renderTextFill(ctx);this._renderTextStroke(ctx);this._restoreCompositeOperation(ctx);this._removeShadow(ctx);ctx.restore()},_translateForTextAlign:function(ctx){if(this.textAlign!=="left"&&this.textAlign!=="justify"){ctx.translate(this.textAlign==="center"?this.width/2:this.width,0)}},_setTextStyles:function(ctx){ctx.textBaseline="alphabetic";if(!this.skipTextAlign){ctx.textAlign=this.textAlign}ctx.font=this._getFontDeclaration()},_getTextHeight:function(){return this._textLines.length*this._getHeightOfLine()},_getTextWidth:function(ctx){var maxWidth=this._getLineWidth(ctx,0);for(var i=1,len=this._textLines.length;imaxWidth){maxWidth=currentLineWidth}}return maxWidth},_renderChars:function(method,ctx,chars,left,top){ctx[method](chars,left,top)},_renderTextLine:function(method,ctx,line,left,top,lineIndex){top-=this.fontSize*this._fontSizeFraction;if(this.textAlign!=="justify"){this._renderChars(method,ctx,line,left,top,lineIndex);return}var lineWidth=this._getLineWidth(ctx,lineIndex),totalWidth=this.width;if(totalWidth>=lineWidth){var words=line.split(/\s+/),wordsWidth=this._getWidthOfWords(ctx,line,lineIndex),widthDiff=totalWidth-wordsWidth,numSpaces=words.length-1,spaceWidth=widthDiff/numSpaces,leftOffset=0;for(var i=0,len=words.length;i-1){offsets.push(.85)}if(this.textDecoration.indexOf("line-through")>-1){offsets.push(.43)}if(this.textDecoration.indexOf("overline")>-1){offsets.push(-.12)}if(offsets.length>0){renderLinesAtOffset(offsets)}},_getFontDeclaration:function(){return[fabric.isLikelyNode?this.fontWeight:this.fontStyle,fabric.isLikelyNode?this.fontStyle:this.fontWeight,this.fontSize+"px",fabric.isLikelyNode?'"'+this.fontFamily+'"':this.fontFamily].join(" ")},render:function(ctx,noTransform){if(!this.visible){return}ctx.save();this._setTextStyles(ctx);if(this._shouldClearCache()){this._initDimensions(ctx)}if(!noTransform){this.transform(ctx)}this._setStrokeStyles(ctx);this._setFillStyles(ctx);if(this.transformMatrix){ctx.transform.apply(ctx,this.transformMatrix)}if(this.group&&this.group.type==="path-group"){ctx.translate(this.left,this.top)}this._render(ctx);ctx.restore()},toObject:function(propertiesToInclude){var object=extend(this.callSuper("toObject",propertiesToInclude),{text:this.text,fontSize:this.fontSize,fontWeight:this.fontWeight,fontFamily:this.fontFamily,fontStyle:this.fontStyle,lineHeight:this.lineHeight,textDecoration:this.textDecoration,textAlign:this.textAlign,textBackgroundColor:this.textBackgroundColor});if(!this.includeDefaultValues){this._removeDefaultValues(object)}return object},toSVG:function(reviver){var markup=this._createBaseSVGMarkup(),offsets=this._getSVGLeftTopOffsets(this.ctx),textAndBg=this._getSVGTextAndBg(offsets.textTop,offsets.textLeft);this._wrapSVGTextAndBg(markup,textAndBg);return reviver?reviver(markup.join("")):markup.join("")},_getSVGLeftTopOffsets:function(ctx){var lineTop=this._getHeightOfLine(ctx,0),textLeft=-this.width/2,textTop=0;return{textLeft:textLeft+(this.group&&this.group.type==="path-group"?this.left:0),textTop:textTop+(this.group&&this.group.type==="path-group"?-this.top:0),lineTop:lineTop}},_wrapSVGTextAndBg:function(markup,textAndBg){markup.push(' \n',textAndBg.textBgRects.join("")," ',textAndBg.textSpans.join(""),"\n"," \n")},_getSVGTextAndBg:function(textTopOffset,textLeftOffset){var textSpans=[],textBgRects=[],height=0;this._setSVGBg(textBgRects);for(var i=0,len=this._textLines.length;i",fabric.util.string.escapeXml(this._textLines[i]),"")},_setSVGTextLineBg:function(textBgRects,i,textLeftOffset,textTopOffset,height){textBgRects.push(" \n')},_setSVGBg:function(textBgRects){if(this.backgroundColor){textBgRects.push(" \n')}},_getFillAttributes:function(value){var fillColor=value&&typeof value==="string"?new fabric.Color(value):"";if(!fillColor||!fillColor.getSource()||fillColor.getAlpha()===1){return'fill="'+value+'"'}return'opacity="'+fillColor.getAlpha()+'" fill="'+fillColor.setAlpha(1).toRgb()+'"'},_set:function(key,value){this.callSuper("_set",key,value);if(key in this._dimensionAffectingProps){this._initDimensions();this.setCoords()}},complexity:function(){return 1}});fabric.Text.ATTRIBUTE_NAMES=fabric.SHARED_ATTRIBUTES.concat("x y dx dy font-family font-style font-weight font-size text-decoration text-anchor".split(" "));fabric.Text.DEFAULT_SVG_FONT_SIZE=16;fabric.Text.fromElement=function(element,options){if(!element){return null}var parsedAttributes=fabric.parseAttributes(element,fabric.Text.ATTRIBUTE_NAMES);options=fabric.util.object.extend(options?fabric.util.object.clone(options):{},parsedAttributes);options.top=options.top||0;options.left=options.left||0;if("dx"in parsedAttributes){options.left+=parsedAttributes.dx}if("dy"in parsedAttributes){options.top+=parsedAttributes.dy}if(!("fontSize"in options)){options.fontSize=fabric.Text.DEFAULT_SVG_FONT_SIZE}if(!options.originX){options.originX="left"}var textContent=element.textContent.replace(/^\s+|\s+$|\n+/g,"").replace(/\s+/g," "),text=new fabric.Text(textContent,options),offX=0;if(text.originX==="left"){offX=text.getWidth()/2}if(text.originX==="right"){offX=-text.getWidth()/2}text.set({left:text.getLeft()+offX,top:text.getTop()-text.getHeight()/2+text.fontSize*(.18+text._fontSizeFraction)});return text};fabric.Text.fromObject=function(object){return new fabric.Text(object.text,clone(object))};fabric.util.createAccessors(fabric.Text)})(typeof exports!=="undefined"?exports:this);(function(){var clone=fabric.util.object.clone;fabric.IText=fabric.util.createClass(fabric.Text,fabric.Observable,{type:"i-text",selectionStart:0,selectionEnd:0,selectionColor:"rgba(17,119,255,0.3)",isEditing:false,editable:true,editingBorderColor:"rgba(102,153,255,0.25)",cursorWidth:2,cursorColor:"#333",cursorDelay:1e3,cursorDuration:600,styles:null,caching:true,_skipFillStrokeCheck:false,_reSpace:/\s|\n/,_currentCursorOpacity:0,_selectionDirection:null,_abortCursorAnimation:false,_charWidthsCache:{},initialize:function(text,options){this.styles=options?options.styles||{}:{};this.callSuper("initialize",text,options);this.initBehavior()},_clearCache:function(){this.callSuper("_clearCache");this.__maxFontHeights=[];this.__widthOfSpace=[]},isEmptyStyles:function(){if(!this.styles){return true}var obj=this.styles;for(var p1 in obj){for(var p2 in obj[p1]){for(var p3 in obj[p1][p2]){return false}}}return true},setSelectionStart:function(index){index=Math.max(index,0);if(this.selectionStart!==index){this.fire("selection:changed");this.canvas&&this.canvas.fire("text:selection:changed",{target:this});this.selectionStart=index}this._updateTextarea()},setSelectionEnd:function(index){index=Math.min(index,this.text.length);if(this.selectionEnd!==index){this.fire("selection:changed");this.canvas&&this.canvas.fire("text:selection:changed",{target:this});this.selectionEnd=index}this._updateTextarea(); + +},getSelectionStyles:function(startIndex,endIndex){if(arguments.length===2){var styles=[];for(var i=startIndex;i=start.charIndex&&(i!==endLine||jstartLine&&i0||this.skipFillStrokeCheck)){this.callSuper("_renderChars",method,ctx,line,left,top)}},_renderChar:function(method,ctx,lineIndex,i,_char,left,top,lineHeight){var decl,charWidth,charHeight,offset=this._fontSizeFraction*lineHeight/this.lineHeight;if(this.styles&&this.styles[lineIndex]&&(decl=this.styles[lineIndex][i])){var shouldStroke=decl.stroke||this.stroke,shouldFill=decl.fill||this.fill;ctx.save();charWidth=this._applyCharStylesGetWidth(ctx,_char,lineIndex,i,decl);charHeight=this._getHeightOfChar(ctx,_char,lineIndex,i);if(shouldFill){ctx.fillText(_char,left,top)}if(shouldStroke){ctx.strokeText(_char,left,top)}this._renderCharDecoration(ctx,decl,left,top,offset,charWidth,charHeight);ctx.restore();ctx.translate(charWidth,0)}else{if(method==="strokeText"&&this.stroke){ctx[method](_char,left,top)}if(method==="fillText"&&this.fill){ctx[method](_char,left,top)}charWidth=this._applyCharStylesGetWidth(ctx,_char,lineIndex,i);this._renderCharDecoration(ctx,null,left,top,offset,charWidth,this.fontSize);ctx.translate(ctx.measureText(_char).width,0)}},_hasStyleChanged:function(prevStyle,thisStyle){return prevStyle.fill!==thisStyle.fill||prevStyle.fontSize!==thisStyle.fontSize||prevStyle.textBackgroundColor!==thisStyle.textBackgroundColor||prevStyle.textDecoration!==thisStyle.textDecoration||prevStyle.fontFamily!==thisStyle.fontFamily||prevStyle.fontWeight!==thisStyle.fontWeight||prevStyle.fontStyle!==thisStyle.fontStyle||prevStyle.stroke!==thisStyle.stroke||prevStyle.strokeWidth!==thisStyle.strokeWidth},_renderCharDecoration:function(ctx,styleDeclaration,left,top,offset,charWidth,charHeight){var textDecoration=styleDeclaration?styleDeclaration.textDecoration||this.textDecoration:this.textDecoration;if(!textDecoration){return}if(textDecoration.indexOf("underline")>-1){ctx.fillRect(left,top+charHeight/10,charWidth,charHeight/15)}if(textDecoration.indexOf("line-through")>-1){ctx.fillRect(left,top-charHeight*(this._fontSizeFraction+this._fontSizeMult-1)+charHeight/15,charWidth,charHeight/15)}if(textDecoration.indexOf("overline")>-1){ctx.fillRect(left,top-(this._fontSizeMult-this._fontSizeFraction)*charHeight,charWidth,charHeight/15)}},_renderTextLine:function(method,ctx,line,left,top,lineIndex){if(!this.isEmptyStyles()){top+=this.fontSize*(this._fontSizeFraction+.03)}this.callSuper("_renderTextLine",method,ctx,line,left,top,lineIndex)},_renderTextDecoration:function(ctx){if(this.isEmptyStyles()){return this.callSuper("_renderTextDecoration",ctx)}},_renderTextLinesBackground:function(ctx){if(!this.textBackgroundColor&&!this.styles){return}ctx.save();if(this.textBackgroundColor){ctx.fillStyle=this.textBackgroundColor}var lineHeights=0;for(var i=0,len=this._textLines.length;imaxHeight){maxHeight=currentCharHeight}}this.__maxFontHeights[lineIndex]=maxHeight;this.__lineHeights[lineIndex]=maxHeight*this.lineHeight*this._fontSizeMult;return this.__lineHeights[lineIndex]},_getTextHeight:function(ctx){var height=0;for(var i=0,len=this._textLines.length;i-1){offset++;index--}return startFrom-offset},findWordBoundaryRight:function(startFrom){var offset=0,index=startFrom;if(this._reSpace.test(this.text.charAt(index))){while(this._reSpace.test(this.text.charAt(index))){offset++;index++}}while(/\S/.test(this.text.charAt(index))&&index-1){offset++;index--}return startFrom-offset},findLineBoundaryRight:function(startFrom){var offset=0,index=startFrom;while(!/\n/.test(this.text.charAt(index))&&index0&&index=_this.__selectionStartOnMouseDown){_this.setSelectionStart(_this.__selectionStartOnMouseDown);_this.setSelectionEnd(newSelectionStart)}else{_this.setSelectionStart(newSelectionStart);_this.setSelectionEnd(_this.__selectionStartOnMouseDown)}})},_setEditingProps:function(){this.hoverCursor="text";if(this.canvas){this.canvas.defaultCursor=this.canvas.moveCursor="text"}this.borderColor=this.editingBorderColor;this.hasControls=this.selectable=false;this.lockMovementX=this.lockMovementY=true},_updateTextarea:function(){if(!this.hiddenTextarea){return}this.hiddenTextarea.value=this.text;this.hiddenTextarea.selectionStart=this.selectionStart;this.hiddenTextarea.selectionEnd=this.selectionEnd},_saveEditingProps:function(){this._savedProps={hasControls:this.hasControls,borderColor:this.borderColor,lockMovementX:this.lockMovementX,lockMovementY:this.lockMovementY,hoverCursor:this.hoverCursor,defaultCursor:this.canvas&&this.canvas.defaultCursor,moveCursor:this.canvas&&this.canvas.moveCursor}},_restoreEditingProps:function(){if(!this._savedProps){return}this.hoverCursor=this._savedProps.overCursor;this.hasControls=this._savedProps.hasControls;this.borderColor=this._savedProps.borderColor;this.lockMovementX=this._savedProps.lockMovementX;this.lockMovementY=this._savedProps.lockMovementY;if(this.canvas){this.canvas.defaultCursor=this._savedProps.defaultCursor;this.canvas.moveCursor=this._savedProps.moveCursor}},exitEditing:function(){this.selected=false;this.isEditing=false;this.selectable=true;this.selectionEnd=this.selectionStart;this.hiddenTextarea&&this.canvas&&this.hiddenTextarea.parentNode.removeChild(this.hiddenTextarea);this.hiddenTextarea=null;this.abortCursorAnimation();this._restoreEditingProps();this._currentCursorOpacity=0;this.fire("editing:exited");this.canvas&&this.canvas.fire("text:editing:exited",{target:this});return this},_removeExtraneousStyles:function(){for(var prop in this.styles){if(!this._textLines[prop]){delete this.styles[prop]}}},_removeCharsFromTo:function(start,end){var i=end;while(i!==start){var prevIndex=this.get2DCursorLocation(i).charIndex;i--;var index=this.get2DCursorLocation(i).charIndex,isNewline=index>prevIndex;if(isNewline){this.removeStyleObject(isNewline,i+1)}else{this.removeStyleObject(this.get2DCursorLocation(i).charIndex===0,i)}}this.text=this.text.slice(0,start)+this.text.slice(end);this._clearCache()},insertChars:function(_chars,useCopiedStyle){var isEndOfLine=this.text.slice(this.selectionStart,this.selectionStart+1)==="\n";this.text=this.text.slice(0,this.selectionStart)+_chars+this.text.slice(this.selectionEnd);if(this.selectionStart===this.selectionEnd){this.insertStyleObjects(_chars,isEndOfLine,useCopiedStyle)}this.setSelectionStart(this.selectionStart+_chars.length);this.setSelectionEnd(this.selectionStart);this._clearCache();this.canvas&&this.canvas.renderAll();this.setCoords();this.fire("changed");this.canvas&&this.canvas.fire("text:changed",{target:this})},insertNewlineStyleObject:function(lineIndex,charIndex,isEndOfLine){this.shiftLineStyles(lineIndex,+1);if(!this.styles[lineIndex+1]){this.styles[lineIndex+1]={}}var currentCharStyle=this.styles[lineIndex][charIndex-1],newLineStyles={};if(isEndOfLine){newLineStyles[0]=clone(currentCharStyle);this.styles[lineIndex+1]=newLineStyles}else{for(var index in this.styles[lineIndex]){if(parseInt(index,10)>=charIndex){newLineStyles[parseInt(index,10)-charIndex]=this.styles[lineIndex][index];delete this.styles[lineIndex][index]}}this.styles[lineIndex+1]=newLineStyles}this._clearCache()},insertCharStyleObject:function(lineIndex,charIndex,style){var currentLineStyles=this.styles[lineIndex],currentLineStylesCloned=clone(currentLineStyles);if(charIndex===0&&!style){charIndex=1}for(var index in currentLineStylesCloned){var numericIndex=parseInt(index,10);if(numericIndex>=charIndex){currentLineStyles[numericIndex+1]=currentLineStylesCloned[numericIndex]}}this.styles[lineIndex][charIndex]=style||clone(currentLineStyles[charIndex-1]);this._clearCache()},insertStyleObjects:function(_chars,isEndOfLine,useCopiedStyle){var cursorLocation=this.get2DCursorLocation(),lineIndex=cursorLocation.lineIndex,charIndex=cursorLocation.charIndex;if(!this.styles[lineIndex]){this.styles[lineIndex]={}}if(_chars==="\n"){this.insertNewlineStyleObject(lineIndex,charIndex,isEndOfLine)}else{if(useCopiedStyle){this._insertStyles(this.copiedStyles)}else{this.insertCharStyleObject(lineIndex,charIndex)}}},_insertStyles:function(styles){for(var i=0,len=styles.length;ilineIndex){this.styles[numericLine+offset]=clonedStyles[numericLine]}}},removeStyleObject:function(isBeginningOfLine,index){var cursorLocation=this.get2DCursorLocation(index),lineIndex=cursorLocation.lineIndex,charIndex=cursorLocation.charIndex;if(isBeginningOfLine){var textOnPreviousLine=this._textLines[lineIndex-1],newCharIndexOnPrevLine=textOnPreviousLine?textOnPreviousLine.length:0;if(!this.styles[lineIndex-1]){this.styles[lineIndex-1]={}}for(charIndex in this.styles[lineIndex]){this.styles[lineIndex-1][parseInt(charIndex,10)+newCharIndexOnPrevLine]=this.styles[lineIndex][charIndex]}this.shiftLineStyles(lineIndex,-1)}else{var currentLineStyles=this.styles[lineIndex];if(currentLineStyles){var offset=this.selectionStart===this.selectionEnd?-1:0;delete currentLineStyles[charIndex+offset]}var currentLineStylesCloned=clone(currentLineStyles);for(var i in currentLineStylesCloned){var numericIndex=parseInt(i,10);if(numericIndex>=charIndex&&numericIndex!==0){currentLineStyles[numericIndex-1]=currentLineStylesCloned[numericIndex];delete currentLineStyles[numericIndex]}}}},insertNewline:function(){this.insertChars("\n")}})})();fabric.util.object.extend(fabric.IText.prototype,{initDoubleClickSimulation:function(){this.__lastClickTime=+new Date;this.__lastLastClickTime=+new Date;this.__lastPointer={};this.on("mousedown",this.onMouseDown.bind(this))},onMouseDown:function(options){this.__newClickTime=+new Date;var newPointer=this.canvas.getPointer(options.e);if(this.isTripleClick(newPointer)){this.fire("tripleclick",options);this._stopEvent(options.e)}else if(this.isDoubleClick(newPointer)){this.fire("dblclick",options);this._stopEvent(options.e)}this.__lastLastClickTime=this.__lastClickTime;this.__lastClickTime=this.__newClickTime;this.__lastPointer=newPointer;this.__lastIsEditing=this.isEditing;this.__lastSelected=this.selected},isDoubleClick:function(newPointer){return this.__newClickTime-this.__lastClickTime<500&&this.__lastPointer.x===newPointer.x&&this.__lastPointer.y===newPointer.y&&this.__lastIsEditing},isTripleClick:function(newPointer){return this.__newClickTime-this.__lastClickTime<500&&this.__lastClickTime-this.__lastLastClickTime<500&&this.__lastPointer.x===newPointer.x&&this.__lastPointer.y===newPointer.y},_stopEvent:function(e){e.preventDefault&&e.preventDefault();e.stopPropagation&&e.stopPropagation()},initCursorSelectionHandlers:function(){this.initSelectedHandler();this.initMousedownHandler();this.initMouseupHandler();this.initClicks()},initClicks:function(){this.on("dblclick",function(options){this.selectWord(this.getSelectionStartFromPointer(options.e))});this.on("tripleclick",function(options){this.selectLine(this.getSelectionStartFromPointer(options.e))})},initMousedownHandler:function(){this.on("mousedown",function(options){var pointer=this.canvas.getPointer(options.e);this.__mousedownX=pointer.x;this.__mousedownY=pointer.y;this.__isMousedown=true;if(this.hiddenTextarea&&this.canvas){this.canvas.wrapperEl.appendChild(this.hiddenTextarea)}if(this.selected){this.setCursorByClick(options.e)}if(this.isEditing){this.__selectionStartOnMouseDown=this.selectionStart;this.initDelayedCursor(true)}})},_isObjectMoved:function(e){var pointer=this.canvas.getPointer(e);return this.__mousedownX!==pointer.x||this.__mousedownY!==pointer.y},initMouseupHandler:function(){this.on("mouseup",function(options){this.__isMousedown=false;if(this._isObjectMoved(options.e)){return}if(this.__lastSelected){this.enterEditing();this.initDelayedCursor(true)}this.selected=true})},setCursorByClick:function(e){var newSelectionStart=this.getSelectionStartFromPointer(e);if(e.shiftKey){if(newSelectionStartdistanceBtwLastCharAndCursor?0:1,newSelectionStart=index+offset;if(this.flipX){newSelectionStart=jlen-newSelectionStart}if(newSelectionStart>this.text.length){newSelectionStart=this.text.length}return newSelectionStart}});fabric.util.object.extend(fabric.IText.prototype,{initHiddenTextarea:function(){this.hiddenTextarea=fabric.document.createElement("textarea");this.hiddenTextarea.setAttribute("autocapitalize","off");this.hiddenTextarea.style.cssText="position: fixed; bottom: 20px; left: 0px; opacity: 0;"+" width: 0px; height: 0px; z-index: -999;";fabric.document.body.appendChild(this.hiddenTextarea); + +fabric.util.addListener(this.hiddenTextarea,"keydown",this.onKeyDown.bind(this));fabric.util.addListener(this.hiddenTextarea,"keypress",this.onKeyPress.bind(this));fabric.util.addListener(this.hiddenTextarea,"copy",this.copy.bind(this));fabric.util.addListener(this.hiddenTextarea,"paste",this.paste.bind(this));if(!this._clickHandlerInitialized&&this.canvas){fabric.util.addListener(this.canvas.upperCanvasEl,"click",this.onClick.bind(this));this._clickHandlerInitialized=true}},_keysMap:{8:"removeChars",9:"exitEditing",27:"exitEditing",13:"insertNewline",33:"moveCursorUp",34:"moveCursorDown",35:"moveCursorRight",36:"moveCursorLeft",37:"moveCursorLeft",38:"moveCursorUp",39:"moveCursorRight",40:"moveCursorDown",46:"forwardDelete"},_ctrlKeysMap:{65:"selectAll",88:"cut"},onClick:function(){this.hiddenTextarea&&this.hiddenTextarea.focus()},onKeyDown:function(e){if(!this.isEditing){return}if(e.keyCode in this._keysMap){this[this._keysMap[e.keyCode]](e)}else if(e.keyCode in this._ctrlKeysMap&&(e.ctrlKey||e.metaKey)){this[this._ctrlKeysMap[e.keyCode]](e)}else{return}e.stopImmediatePropagation();e.preventDefault();this.canvas&&this.canvas.renderAll()},forwardDelete:function(e){if(this.selectionStart===this.selectionEnd){this.moveCursorRight(e)}this.removeChars(e)},copy:function(e){var selectedText=this.getSelectedText(),clipboardData=this._getClipboardData(e);if(clipboardData){clipboardData.setData("text",selectedText)}this.copiedText=selectedText;this.copiedStyles=this.getSelectionStyles(this.selectionStart,this.selectionEnd)},paste:function(e){var copiedText=null,clipboardData=this._getClipboardData(e);if(clipboardData){copiedText=clipboardData.getData("text")}else{copiedText=this.copiedText}if(copiedText){this.insertChars(copiedText,true)}},cut:function(e){if(this.selectionStart===this.selectionEnd){return}this.copy();this.removeChars(e)},_getClipboardData:function(e){return e&&(e.clipboardData||fabric.window.clipboardData)},onKeyPress:function(e){if(!this.isEditing||e.metaKey||e.ctrlKey){return}if(e.which!==0){this.insertChars(String.fromCharCode(e.which))}e.stopPropagation()},getDownCursorOffset:function(e,isRight){var selectionProp=isRight?this.selectionEnd:this.selectionStart,_char,lineLeftOffset,textBeforeCursor=this.text.slice(0,selectionProp),textAfterCursor=this.text.slice(selectionProp),textOnSameLineBeforeCursor=textBeforeCursor.slice(textBeforeCursor.lastIndexOf("\n")+1),textOnSameLineAfterCursor=textAfterCursor.match(/(.*)\n?/)[1],textOnNextLine=(textAfterCursor.match(/.*\n(.*)\n?/)||{})[1]||"",cursorLocation=this.get2DCursorLocation(selectionProp);if(cursorLocation.lineIndex===this._textLines.length-1||e.metaKey||e.keyCode===34){return this.text.length-selectionProp}var widthOfSameLineBeforeCursor=this._getLineWidth(this.ctx,cursorLocation.lineIndex);lineLeftOffset=this._getLineLeftOffset(widthOfSameLineBeforeCursor);var widthOfCharsOnSameLineBeforeCursor=lineLeftOffset,lineIndex=cursorLocation.lineIndex;for(var i=0,len=textOnSameLineBeforeCursor.length;iwidthOfCharsOnSameLineBeforeCursor){foundMatch=true;var leftEdge=widthOfCharsOnNextLine-widthOfChar,rightEdge=widthOfCharsOnNextLine,offsetFromLeftEdge=Math.abs(leftEdge-widthOfCharsOnSameLineBeforeCursor),offsetFromRightEdge=Math.abs(rightEdge-widthOfCharsOnSameLineBeforeCursor);indexOnNextLine=offsetFromRightEdgethis.text.length){this.setSelectionEnd(this.text.length)}},getUpCursorOffset:function(e,isRight){var selectionProp=isRight?this.selectionEnd:this.selectionStart,cursorLocation=this.get2DCursorLocation(selectionProp);if(cursorLocation.lineIndex===0||e.metaKey||e.keyCode===33){return selectionProp}var textBeforeCursor=this.text.slice(0,selectionProp),textOnSameLineBeforeCursor=textBeforeCursor.slice(textBeforeCursor.lastIndexOf("\n")+1),textOnPreviousLine=(textBeforeCursor.match(/\n?(.*)\n.*$/)||{})[1]||"",_char,widthOfSameLineBeforeCursor=this._getLineWidth(this.ctx,cursorLocation.lineIndex),lineLeftOffset=this._getLineLeftOffset(widthOfSameLineBeforeCursor),widthOfCharsOnSameLineBeforeCursor=lineLeftOffset,lineIndex=cursorLocation.lineIndex;for(var i=0,len=textOnSameLineBeforeCursor.length;iwidthOfCharsOnSameLineBeforeCursor){foundMatch=true;var leftEdge=widthOfCharsOnPreviousLine-widthOfChar,rightEdge=widthOfCharsOnPreviousLine,offsetFromLeftEdge=Math.abs(leftEdge-widthOfCharsOnSameLineBeforeCursor),offsetFromRightEdge=Math.abs(rightEdge-widthOfCharsOnSameLineBeforeCursor);indexOnPrevLine=offsetFromRightEdge=this.text.length&&this.selectionEnd>=this.text.length){return}this.abortCursorAnimation();this._currentCursorOpacity=1;if(e.shiftKey){this.moveCursorRightWithShift(e)}else{this.moveCursorRightWithoutShift(e)}this.initDelayedCursor()},moveCursorRightWithShift:function(e){if(this._selectionDirection==="left"&&this.selectionStart!==this.selectionEnd){this._moveRight(e,"selectionStart")}else{this._selectionDirection="right";this._moveRight(e,"selectionEnd");if(this.text.charAt(this.selectionEnd-1)==="\n"){this.setSelectionEnd(this.selectionEnd+1)}}},moveCursorRightWithoutShift:function(e){this._selectionDirection="right";if(this.selectionStart===this.selectionEnd){this._moveRight(e,"selectionStart");this.setSelectionEnd(this.selectionStart)}else{this.setSelectionEnd(this.selectionEnd+this.getNumNewLinesInSelectedText());this.setSelectionStart(this.selectionEnd)}},removeChars:function(e){if(this.selectionStart===this.selectionEnd){this._removeCharsNearCursor(e)}else{this._removeCharsFromTo(this.selectionStart,this.selectionEnd)}this.setSelectionEnd(this.selectionStart);this._removeExtraneousStyles();this._clearCache();this.canvas&&this.canvas.renderAll();this.setCoords();this.fire("changed");this.canvas&&this.canvas.fire("text:changed",{target:this})},_removeCharsNearCursor:function(e){if(this.selectionStart!==0){if(e.metaKey){var leftLineBoundary=this.findLineBoundaryLeft(this.selectionStart);this._removeCharsFromTo(leftLineBoundary,this.selectionStart);this.setSelectionStart(leftLineBoundary)}else if(e.altKey){var leftWordBoundary=this.findWordBoundaryLeft(this.selectionStart);this._removeCharsFromTo(leftWordBoundary,this.selectionStart);this.setSelectionStart(leftWordBoundary)}else{var isBeginningOfLine=this.text.slice(this.selectionStart-1,this.selectionStart)==="\n";this.removeStyleObject(isBeginningOfLine);this.setSelectionStart(this.selectionStart-1);this.text=this.text.slice(0,this.selectionStart)+this.text.slice(this.selectionStart+1)}}}});fabric.util.object.extend(fabric.IText.prototype,{_setSVGTextLineText:function(lineIndex,textSpans,height,textLeftOffset,textTopOffset,textBgRects){if(!this.styles[lineIndex]){this.callSuper("_setSVGTextLineText",lineIndex,textSpans,height,textLeftOffset,textTopOffset)}else{this._setSVGTextLineChars(lineIndex,textSpans,height,textLeftOffset,textBgRects)}},_setSVGTextLineChars:function(lineIndex,textSpans,height,textLeftOffset,textBgRects){var chars=this._textLines[lineIndex].split(""),charOffset=0,lineLeftOffset=this._getSVGLineLeftOffset(lineIndex)-this.width/2,lineOffset=this._getSVGLineTopOffset(lineIndex),heightOfLine=this._getHeightOfLine(this.ctx,lineIndex);for(var i=0,len=chars.length;i'].join("")},_createTextCharSpan:function(_char,styleDecl,lineLeftOffset,lineTopOffset,charOffset){var fillStyles=this.getSvgStyles.call(fabric.util.object.extend({visible:true,fill:this.fill,stroke:this.stroke,type:"text"},styleDecl));return['',fabric.util.string.escapeXml(_char),""].join("")}});(function(){if(typeof document!=="undefined"&&typeof window!=="undefined"){return}var DOMParser=require("xmldom").DOMParser,URL=require("url"),HTTP=require("http"),HTTPS=require("https"),Canvas=require("canvas"),Image=require("canvas").Image;function request(url,encoding,callback){var oURL=URL.parse(url);if(!oURL.port){oURL.port=oURL.protocol.indexOf("https:")===0?443:80}var reqHandler=oURL.protocol.indexOf("https:")===0?HTTPS:HTTP,req=reqHandler.request({hostname:oURL.hostname,port:oURL.port,path:oURL.path,method:"GET"},function(response){var body="";if(encoding){response.setEncoding(encoding)}response.on("end",function(){callback(body)});response.on("data",function(chunk){if(response.statusCode===200){body+=chunk}})});req.on("error",function(err){if(err.errno===process.ECONNREFUSED){fabric.log("ECONNREFUSED: connection refused to "+oURL.hostname+":"+oURL.port)}else{fabric.log(err.message)}});req.end()}function requestFs(path,callback){var fs=require("fs");fs.readFile(path,function(err,data){if(err){fabric.log(err);throw err}else{callback(data)}})}fabric.util.loadImage=function(url,callback,context){function createImageAndCallBack(data){img.src=new Buffer(data,"binary");img._src=url;callback&&callback.call(context,img)}var img=new Image;if(url&&(url instanceof Buffer||url.indexOf("data")===0)){img.src=img._src=url;callback&&callback.call(context,img)}else if(url&&url.indexOf("http")!==0){requestFs(url,createImageAndCallBack)}else if(url){request(url,"binary",createImageAndCallBack)}else{callback&&callback.call(context,url)}};fabric.loadSVGFromURL=function(url,callback,reviver){url=url.replace(/^\n\s*/,"").replace(/\?.*$/,"").trim();if(url.indexOf("http")!==0){requestFs(url,function(body){fabric.loadSVGFromString(body.toString(),callback,reviver)})}else{request(url,"",function(body){fabric.loadSVGFromString(body,callback,reviver)})}};fabric.loadSVGFromString=function(string,callback,reviver){var doc=(new DOMParser).parseFromString(string);fabric.parseSVGDocument(doc.documentElement,function(results,options){callback&&callback(results,options)},reviver)};fabric.util.getScript=function(url,callback){request(url,"",function(body){eval(body);callback&&callback()})};fabric.Image.fromObject=function(object,callback){fabric.util.loadImage(object.src,function(img){var oImg=new fabric.Image(img);oImg._initConfig(object);oImg._initFilters(object,function(filters){oImg.filters=filters||[];callback&&callback(oImg)})})};fabric.createCanvasForNode=function(width,height,options,nodeCanvasOptions){nodeCanvasOptions=nodeCanvasOptions||options;var canvasEl=fabric.document.createElement("canvas"),nodeCanvas=new Canvas(width||600,height||600,nodeCanvasOptions);canvasEl.style={};canvasEl.width=nodeCanvas.width;canvasEl.height=nodeCanvas.height;var FabricCanvas=fabric.Canvas||fabric.StaticCanvas,fabricCanvas=new FabricCanvas(canvasEl,options);fabricCanvas.contextContainer=nodeCanvas.getContext("2d");fabricCanvas.nodeCanvas=nodeCanvas;fabricCanvas.Font=Canvas.Font;return fabricCanvas};fabric.StaticCanvas.prototype.createPNGStream=function(){return this.nodeCanvas.createPNGStream()};fabric.StaticCanvas.prototype.createJPEGStream=function(opts){return this.nodeCanvas.createJPEGStream(opts)};var origSetWidth=fabric.StaticCanvas.prototype.setWidth;fabric.StaticCanvas.prototype.setWidth=function(width,options){origSetWidth.call(this,width,options);this.nodeCanvas.width=width;return this};if(fabric.Canvas){fabric.Canvas.prototype.setWidth=fabric.StaticCanvas.prototype.setWidth}var origSetHeight=fabric.StaticCanvas.prototype.setHeight;fabric.StaticCanvas.prototype.setHeight=function(height,options){origSetHeight.call(this,height,options);this.nodeCanvas.height=height;return this};if(fabric.Canvas){fabric.Canvas.prototype.setHeight=fabric.StaticCanvas.prototype.setHeight}})(); \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/jszip/jszip.js b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/jszip/jszip.js new file mode 100644 index 0000000..6eb2831 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/jszip/jszip.js @@ -0,0 +1,9155 @@ +/*! + +JSZip - A Javascript class for generating and reading zip files + + +(c) 2009-2014 Stuart Knightley +Dual licenced under the MIT license or GPLv3. See https://raw.github.com/Stuk/jszip/master/LICENSE.markdown. + +JSZip uses the library pako released under the MIT license : +https://github.com/nodeca/pako/blob/master/LICENSE +*/ +!function(e){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=e();else if("function"==typeof define&&define.amd)define([],e);else{var f;"undefined"!=typeof window?f=window:"undefined"!=typeof global?f=global:"undefined"!=typeof self&&(f=self),f.JSZip=e()}}(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);throw new Error("Cannot find module '"+o+"'")}var f=n[o]={exports:{}};t[o][0].call(f.exports,function(e){var n=t[o][1][e];return s(n?n:e)},f,f.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o> 2; + enc2 = ((chr1 & 3) << 4) | (chr2 >> 4); + enc3 = ((chr2 & 15) << 2) | (chr3 >> 6); + enc4 = chr3 & 63; + + if (isNaN(chr2)) { + enc3 = enc4 = 64; + } + else if (isNaN(chr3)) { + enc4 = 64; + } + + output = output + _keyStr.charAt(enc1) + _keyStr.charAt(enc2) + _keyStr.charAt(enc3) + _keyStr.charAt(enc4); + + } + + return output; +}; + +// public method for decoding +exports.decode = function(input, utf8) { + var output = ""; + var chr1, chr2, chr3; + var enc1, enc2, enc3, enc4; + var i = 0; + + input = input.replace(/[^A-Za-z0-9\+\/\=]/g, ""); + + while (i < input.length) { + + enc1 = _keyStr.indexOf(input.charAt(i++)); + enc2 = _keyStr.indexOf(input.charAt(i++)); + enc3 = _keyStr.indexOf(input.charAt(i++)); + enc4 = _keyStr.indexOf(input.charAt(i++)); + + chr1 = (enc1 << 2) | (enc2 >> 4); + chr2 = ((enc2 & 15) << 4) | (enc3 >> 2); + chr3 = ((enc3 & 3) << 6) | enc4; + + output = output + String.fromCharCode(chr1); + + if (enc3 != 64) { + output = output + String.fromCharCode(chr2); + } + if (enc4 != 64) { + output = output + String.fromCharCode(chr3); + } + + } + + return output; + +}; + +},{}],2:[function(_dereq_,module,exports){ +'use strict'; +function CompressedObject() { + this.compressedSize = 0; + this.uncompressedSize = 0; + this.crc32 = 0; + this.compressionMethod = null; + this.compressedContent = null; +} + +CompressedObject.prototype = { + /** + * Return the decompressed content in an unspecified format. + * The format will depend on the decompressor. + * @return {Object} the decompressed content. + */ + getContent: function() { + return null; // see implementation + }, + /** + * Return the compressed content in an unspecified format. + * The format will depend on the compressed conten source. + * @return {Object} the compressed content. + */ + getCompressedContent: function() { + return null; // see implementation + } +}; +module.exports = CompressedObject; + +},{}],3:[function(_dereq_,module,exports){ +'use strict'; +exports.STORE = { + magic: "\x00\x00", + compress: function(content, compressionOptions) { + return content; // no compression + }, + uncompress: function(content) { + return content; // no compression + }, + compressInputType: null, + uncompressInputType: null +}; +exports.DEFLATE = _dereq_('./flate'); + +},{"./flate":8}],4:[function(_dereq_,module,exports){ +'use strict'; + +var utils = _dereq_('./utils'); + +var table = [ + 0x00000000, 0x77073096, 0xEE0E612C, 0x990951BA, + 0x076DC419, 0x706AF48F, 0xE963A535, 0x9E6495A3, + 0x0EDB8832, 0x79DCB8A4, 0xE0D5E91E, 0x97D2D988, + 0x09B64C2B, 0x7EB17CBD, 0xE7B82D07, 0x90BF1D91, + 0x1DB71064, 0x6AB020F2, 0xF3B97148, 0x84BE41DE, + 0x1ADAD47D, 0x6DDDE4EB, 0xF4D4B551, 0x83D385C7, + 0x136C9856, 0x646BA8C0, 0xFD62F97A, 0x8A65C9EC, + 0x14015C4F, 0x63066CD9, 0xFA0F3D63, 0x8D080DF5, + 0x3B6E20C8, 0x4C69105E, 0xD56041E4, 0xA2677172, + 0x3C03E4D1, 0x4B04D447, 0xD20D85FD, 0xA50AB56B, + 0x35B5A8FA, 0x42B2986C, 0xDBBBC9D6, 0xACBCF940, + 0x32D86CE3, 0x45DF5C75, 0xDCD60DCF, 0xABD13D59, + 0x26D930AC, 0x51DE003A, 0xC8D75180, 0xBFD06116, + 0x21B4F4B5, 0x56B3C423, 0xCFBA9599, 0xB8BDA50F, + 0x2802B89E, 0x5F058808, 0xC60CD9B2, 0xB10BE924, + 0x2F6F7C87, 0x58684C11, 0xC1611DAB, 0xB6662D3D, + 0x76DC4190, 0x01DB7106, 0x98D220BC, 0xEFD5102A, + 0x71B18589, 0x06B6B51F, 0x9FBFE4A5, 0xE8B8D433, + 0x7807C9A2, 0x0F00F934, 0x9609A88E, 0xE10E9818, + 0x7F6A0DBB, 0x086D3D2D, 0x91646C97, 0xE6635C01, + 0x6B6B51F4, 0x1C6C6162, 0x856530D8, 0xF262004E, + 0x6C0695ED, 0x1B01A57B, 0x8208F4C1, 0xF50FC457, + 0x65B0D9C6, 0x12B7E950, 0x8BBEB8EA, 0xFCB9887C, + 0x62DD1DDF, 0x15DA2D49, 0x8CD37CF3, 0xFBD44C65, + 0x4DB26158, 0x3AB551CE, 0xA3BC0074, 0xD4BB30E2, + 0x4ADFA541, 0x3DD895D7, 0xA4D1C46D, 0xD3D6F4FB, + 0x4369E96A, 0x346ED9FC, 0xAD678846, 0xDA60B8D0, + 0x44042D73, 0x33031DE5, 0xAA0A4C5F, 0xDD0D7CC9, + 0x5005713C, 0x270241AA, 0xBE0B1010, 0xC90C2086, + 0x5768B525, 0x206F85B3, 0xB966D409, 0xCE61E49F, + 0x5EDEF90E, 0x29D9C998, 0xB0D09822, 0xC7D7A8B4, + 0x59B33D17, 0x2EB40D81, 0xB7BD5C3B, 0xC0BA6CAD, + 0xEDB88320, 0x9ABFB3B6, 0x03B6E20C, 0x74B1D29A, + 0xEAD54739, 0x9DD277AF, 0x04DB2615, 0x73DC1683, + 0xE3630B12, 0x94643B84, 0x0D6D6A3E, 0x7A6A5AA8, + 0xE40ECF0B, 0x9309FF9D, 0x0A00AE27, 0x7D079EB1, + 0xF00F9344, 0x8708A3D2, 0x1E01F268, 0x6906C2FE, + 0xF762575D, 0x806567CB, 0x196C3671, 0x6E6B06E7, + 0xFED41B76, 0x89D32BE0, 0x10DA7A5A, 0x67DD4ACC, + 0xF9B9DF6F, 0x8EBEEFF9, 0x17B7BE43, 0x60B08ED5, + 0xD6D6A3E8, 0xA1D1937E, 0x38D8C2C4, 0x4FDFF252, + 0xD1BB67F1, 0xA6BC5767, 0x3FB506DD, 0x48B2364B, + 0xD80D2BDA, 0xAF0A1B4C, 0x36034AF6, 0x41047A60, + 0xDF60EFC3, 0xA867DF55, 0x316E8EEF, 0x4669BE79, + 0xCB61B38C, 0xBC66831A, 0x256FD2A0, 0x5268E236, + 0xCC0C7795, 0xBB0B4703, 0x220216B9, 0x5505262F, + 0xC5BA3BBE, 0xB2BD0B28, 0x2BB45A92, 0x5CB36A04, + 0xC2D7FFA7, 0xB5D0CF31, 0x2CD99E8B, 0x5BDEAE1D, + 0x9B64C2B0, 0xEC63F226, 0x756AA39C, 0x026D930A, + 0x9C0906A9, 0xEB0E363F, 0x72076785, 0x05005713, + 0x95BF4A82, 0xE2B87A14, 0x7BB12BAE, 0x0CB61B38, + 0x92D28E9B, 0xE5D5BE0D, 0x7CDCEFB7, 0x0BDBDF21, + 0x86D3D2D4, 0xF1D4E242, 0x68DDB3F8, 0x1FDA836E, + 0x81BE16CD, 0xF6B9265B, 0x6FB077E1, 0x18B74777, + 0x88085AE6, 0xFF0F6A70, 0x66063BCA, 0x11010B5C, + 0x8F659EFF, 0xF862AE69, 0x616BFFD3, 0x166CCF45, + 0xA00AE278, 0xD70DD2EE, 0x4E048354, 0x3903B3C2, + 0xA7672661, 0xD06016F7, 0x4969474D, 0x3E6E77DB, + 0xAED16A4A, 0xD9D65ADC, 0x40DF0B66, 0x37D83BF0, + 0xA9BCAE53, 0xDEBB9EC5, 0x47B2CF7F, 0x30B5FFE9, + 0xBDBDF21C, 0xCABAC28A, 0x53B39330, 0x24B4A3A6, + 0xBAD03605, 0xCDD70693, 0x54DE5729, 0x23D967BF, + 0xB3667A2E, 0xC4614AB8, 0x5D681B02, 0x2A6F2B94, + 0xB40BBE37, 0xC30C8EA1, 0x5A05DF1B, 0x2D02EF8D +]; + +/** + * + * Javascript crc32 + * http://www.webtoolkit.info/ + * + */ +module.exports = function crc32(input, crc) { + if (typeof input === "undefined" || !input.length) { + return 0; + } + + var isArray = utils.getTypeOf(input) !== "string"; + + if (typeof(crc) == "undefined") { + crc = 0; + } + var x = 0; + var y = 0; + var b = 0; + + crc = crc ^ (-1); + for (var i = 0, iTop = input.length; i < iTop; i++) { + b = isArray ? input[i] : input.charCodeAt(i); + y = (crc ^ b) & 0xFF; + x = table[y]; + crc = (crc >>> 8) ^ x; + } + + return crc ^ (-1); +}; +// vim: set shiftwidth=4 softtabstop=4: + +},{"./utils":21}],5:[function(_dereq_,module,exports){ +'use strict'; +var utils = _dereq_('./utils'); + +function DataReader(data) { + this.data = null; // type : see implementation + this.length = 0; + this.index = 0; +} +DataReader.prototype = { + /** + * Check that the offset will not go too far. + * @param {string} offset the additional offset to check. + * @throws {Error} an Error if the offset is out of bounds. + */ + checkOffset: function(offset) { + this.checkIndex(this.index + offset); + }, + /** + * Check that the specifed index will not be too far. + * @param {string} newIndex the index to check. + * @throws {Error} an Error if the index is out of bounds. + */ + checkIndex: function(newIndex) { + if (this.length < newIndex || newIndex < 0) { + throw new Error("End of data reached (data length = " + this.length + ", asked index = " + (newIndex) + "). Corrupted zip ?"); + } + }, + /** + * Change the index. + * @param {number} newIndex The new index. + * @throws {Error} if the new index is out of the data. + */ + setIndex: function(newIndex) { + this.checkIndex(newIndex); + this.index = newIndex; + }, + /** + * Skip the next n bytes. + * @param {number} n the number of bytes to skip. + * @throws {Error} if the new index is out of the data. + */ + skip: function(n) { + this.setIndex(this.index + n); + }, + /** + * Get the byte at the specified index. + * @param {number} i the index to use. + * @return {number} a byte. + */ + byteAt: function(i) { + // see implementations + }, + /** + * Get the next number with a given byte size. + * @param {number} size the number of bytes to read. + * @return {number} the corresponding number. + */ + readInt: function(size) { + var result = 0, + i; + this.checkOffset(size); + for (i = this.index + size - 1; i >= this.index; i--) { + result = (result << 8) + this.byteAt(i); + } + this.index += size; + return result; + }, + /** + * Get the next string with a given byte size. + * @param {number} size the number of bytes to read. + * @return {string} the corresponding string. + */ + readString: function(size) { + return utils.transformTo("string", this.readData(size)); + }, + /** + * Get raw data without conversion, bytes. + * @param {number} size the number of bytes to read. + * @return {Object} the raw data, implementation specific. + */ + readData: function(size) { + // see implementations + }, + /** + * Find the last occurence of a zip signature (4 bytes). + * @param {string} sig the signature to find. + * @return {number} the index of the last occurence, -1 if not found. + */ + lastIndexOfSignature: function(sig) { + // see implementations + }, + /** + * Get the next date. + * @return {Date} the date. + */ + readDate: function() { + var dostime = this.readInt(4); + return new Date( + ((dostime >> 25) & 0x7f) + 1980, // year + ((dostime >> 21) & 0x0f) - 1, // month + (dostime >> 16) & 0x1f, // day + (dostime >> 11) & 0x1f, // hour + (dostime >> 5) & 0x3f, // minute + (dostime & 0x1f) << 1); // second + } +}; +module.exports = DataReader; + +},{"./utils":21}],6:[function(_dereq_,module,exports){ +'use strict'; +exports.base64 = false; +exports.binary = false; +exports.dir = false; +exports.createFolders = false; +exports.date = null; +exports.compression = null; +exports.compressionOptions = null; +exports.comment = null; +exports.unixPermissions = null; +exports.dosPermissions = null; + +},{}],7:[function(_dereq_,module,exports){ +'use strict'; +var utils = _dereq_('./utils'); + +/** + * @deprecated + * This function will be removed in a future version without replacement. + */ +exports.string2binary = function(str) { + return utils.string2binary(str); +}; + +/** + * @deprecated + * This function will be removed in a future version without replacement. + */ +exports.string2Uint8Array = function(str) { + return utils.transformTo("uint8array", str); +}; + +/** + * @deprecated + * This function will be removed in a future version without replacement. + */ +exports.uint8Array2String = function(array) { + return utils.transformTo("string", array); +}; + +/** + * @deprecated + * This function will be removed in a future version without replacement. + */ +exports.string2Blob = function(str) { + var buffer = utils.transformTo("arraybuffer", str); + return utils.arrayBuffer2Blob(buffer); +}; + +/** + * @deprecated + * This function will be removed in a future version without replacement. + */ +exports.arrayBuffer2Blob = function(buffer) { + return utils.arrayBuffer2Blob(buffer); +}; + +/** + * @deprecated + * This function will be removed in a future version without replacement. + */ +exports.transformTo = function(outputType, input) { + return utils.transformTo(outputType, input); +}; + +/** + * @deprecated + * This function will be removed in a future version without replacement. + */ +exports.getTypeOf = function(input) { + return utils.getTypeOf(input); +}; + +/** + * @deprecated + * This function will be removed in a future version without replacement. + */ +exports.checkSupport = function(type) { + return utils.checkSupport(type); +}; + +/** + * @deprecated + * This value will be removed in a future version without replacement. + */ +exports.MAX_VALUE_16BITS = utils.MAX_VALUE_16BITS; + +/** + * @deprecated + * This value will be removed in a future version without replacement. + */ +exports.MAX_VALUE_32BITS = utils.MAX_VALUE_32BITS; + + +/** + * @deprecated + * This function will be removed in a future version without replacement. + */ +exports.pretty = function(str) { + return utils.pretty(str); +}; + +/** + * @deprecated + * This function will be removed in a future version without replacement. + */ +exports.findCompression = function(compressionMethod) { + return utils.findCompression(compressionMethod); +}; + +/** + * @deprecated + * This function will be removed in a future version without replacement. + */ +exports.isRegExp = function (object) { + return utils.isRegExp(object); +}; + + +},{"./utils":21}],8:[function(_dereq_,module,exports){ +'use strict'; +var USE_TYPEDARRAY = (typeof Uint8Array !== 'undefined') && (typeof Uint16Array !== 'undefined') && (typeof Uint32Array !== 'undefined'); + +var pako = _dereq_("pako"); +exports.uncompressInputType = USE_TYPEDARRAY ? "uint8array" : "array"; +exports.compressInputType = USE_TYPEDARRAY ? "uint8array" : "array"; + +exports.magic = "\x08\x00"; +exports.compress = function(input, compressionOptions) { + return pako.deflateRaw(input, { + level : compressionOptions.level || -1 // default compression + }); +}; +exports.uncompress = function(input) { + return pako.inflateRaw(input); +}; + +},{"pako":24}],9:[function(_dereq_,module,exports){ +'use strict'; + +var base64 = _dereq_('./base64'); + +/** +Usage: + zip = new JSZip(); + zip.file("hello.txt", "Hello, World!").file("tempfile", "nothing"); + zip.folder("images").file("smile.gif", base64Data, {base64: true}); + zip.file("Xmas.txt", "Ho ho ho !", {date : new Date("December 25, 2007 00:00:01")}); + zip.remove("tempfile"); + + base64zip = zip.generate(); + +**/ + +/** + * Representation a of zip file in js + * @constructor + * @param {String=|ArrayBuffer=|Uint8Array=} data the data to load, if any (optional). + * @param {Object=} options the options for creating this objects (optional). + */ +function JSZip(data, options) { + // if this constructor is used without `new`, it adds `new` before itself: + if(!(this instanceof JSZip)) return new JSZip(data, options); + + // object containing the files : + // { + // "folder/" : {...}, + // "folder/data.txt" : {...} + // } + this.files = {}; + + this.comment = null; + + // Where we are in the hierarchy + this.root = ""; + if (data) { + this.load(data, options); + } + this.clone = function() { + var newObj = new JSZip(); + for (var i in this) { + if (typeof this[i] !== "function") { + newObj[i] = this[i]; + } + } + return newObj; + }; +} +JSZip.prototype = _dereq_('./object'); +JSZip.prototype.load = _dereq_('./load'); +JSZip.support = _dereq_('./support'); +JSZip.defaults = _dereq_('./defaults'); + +/** + * @deprecated + * This namespace will be removed in a future version without replacement. + */ +JSZip.utils = _dereq_('./deprecatedPublicUtils'); + +JSZip.base64 = { + /** + * @deprecated + * This method will be removed in a future version without replacement. + */ + encode : function(input) { + return base64.encode(input); + }, + /** + * @deprecated + * This method will be removed in a future version without replacement. + */ + decode : function(input) { + return base64.decode(input); + } +}; +JSZip.compressions = _dereq_('./compressions'); +module.exports = JSZip; + +},{"./base64":1,"./compressions":3,"./defaults":6,"./deprecatedPublicUtils":7,"./load":10,"./object":13,"./support":17}],10:[function(_dereq_,module,exports){ +'use strict'; +var base64 = _dereq_('./base64'); +var ZipEntries = _dereq_('./zipEntries'); +module.exports = function(data, options) { + var files, zipEntries, i, input; + options = options || {}; + if (options.base64) { + data = base64.decode(data); + } + + zipEntries = new ZipEntries(data, options); + files = zipEntries.files; + for (i = 0; i < files.length; i++) { + input = files[i]; + this.file(input.fileName, input.decompressed, { + binary: true, + optimizedBinaryString: true, + date: input.date, + dir: input.dir, + comment : input.fileComment.length ? input.fileComment : null, + unixPermissions : input.unixPermissions, + dosPermissions : input.dosPermissions, + createFolders: options.createFolders + }); + } + if (zipEntries.zipComment.length) { + this.comment = zipEntries.zipComment; + } + + return this; +}; + +},{"./base64":1,"./zipEntries":22}],11:[function(_dereq_,module,exports){ +(function (Buffer){ +'use strict'; +module.exports = function(data, encoding){ + return new Buffer(data, encoding); +}; +module.exports.test = function(b){ + return Buffer.isBuffer(b); +}; + +}).call(this,(typeof Buffer !== "undefined" ? Buffer : undefined)) +},{}],12:[function(_dereq_,module,exports){ +'use strict'; +var Uint8ArrayReader = _dereq_('./uint8ArrayReader'); + +function NodeBufferReader(data) { + this.data = data; + this.length = this.data.length; + this.index = 0; +} +NodeBufferReader.prototype = new Uint8ArrayReader(); + +/** + * @see DataReader.readData + */ +NodeBufferReader.prototype.readData = function(size) { + this.checkOffset(size); + var result = this.data.slice(this.index, this.index + size); + this.index += size; + return result; +}; +module.exports = NodeBufferReader; + +},{"./uint8ArrayReader":18}],13:[function(_dereq_,module,exports){ +'use strict'; +var support = _dereq_('./support'); +var utils = _dereq_('./utils'); +var crc32 = _dereq_('./crc32'); +var signature = _dereq_('./signature'); +var defaults = _dereq_('./defaults'); +var base64 = _dereq_('./base64'); +var compressions = _dereq_('./compressions'); +var CompressedObject = _dereq_('./compressedObject'); +var nodeBuffer = _dereq_('./nodeBuffer'); +var utf8 = _dereq_('./utf8'); +var StringWriter = _dereq_('./stringWriter'); +var Uint8ArrayWriter = _dereq_('./uint8ArrayWriter'); + +/** + * Returns the raw data of a ZipObject, decompress the content if necessary. + * @param {ZipObject} file the file to use. + * @return {String|ArrayBuffer|Uint8Array|Buffer} the data. + */ +var getRawData = function(file) { + if (file._data instanceof CompressedObject) { + file._data = file._data.getContent(); + file.options.binary = true; + file.options.base64 = false; + + if (utils.getTypeOf(file._data) === "uint8array") { + var copy = file._data; + // when reading an arraybuffer, the CompressedObject mechanism will keep it and subarray() a Uint8Array. + // if we request a file in the same format, we might get the same Uint8Array or its ArrayBuffer (the original zip file). + file._data = new Uint8Array(copy.length); + // with an empty Uint8Array, Opera fails with a "Offset larger than array size" + if (copy.length !== 0) { + file._data.set(copy, 0); + } + } + } + return file._data; +}; + +/** + * Returns the data of a ZipObject in a binary form. If the content is an unicode string, encode it. + * @param {ZipObject} file the file to use. + * @return {String|ArrayBuffer|Uint8Array|Buffer} the data. + */ +var getBinaryData = function(file) { + var result = getRawData(file), + type = utils.getTypeOf(result); + if (type === "string") { + if (!file.options.binary) { + // unicode text ! + // unicode string => binary string is a painful process, check if we can avoid it. + if (support.nodebuffer) { + return nodeBuffer(result, "utf-8"); + } + } + return file.asBinary(); + } + return result; +}; + +/** + * Transform this._data into a string. + * @param {function} filter a function String -> String, applied if not null on the result. + * @return {String} the string representing this._data. + */ +var dataToString = function(asUTF8) { + var result = getRawData(this); + if (result === null || typeof result === "undefined") { + return ""; + } + // if the data is a base64 string, we decode it before checking the encoding ! + if (this.options.base64) { + result = base64.decode(result); + } + if (asUTF8 && this.options.binary) { + // JSZip.prototype.utf8decode supports arrays as input + // skip to array => string step, utf8decode will do it. + result = out.utf8decode(result); + } + else { + // no utf8 transformation, do the array => string step. + result = utils.transformTo("string", result); + } + + if (!asUTF8 && !this.options.binary) { + result = utils.transformTo("string", out.utf8encode(result)); + } + return result; +}; +/** + * A simple object representing a file in the zip file. + * @constructor + * @param {string} name the name of the file + * @param {String|ArrayBuffer|Uint8Array|Buffer} data the data + * @param {Object} options the options of the file + */ +var ZipObject = function(name, data, options) { + this.name = name; + this.dir = options.dir; + this.date = options.date; + this.comment = options.comment; + this.unixPermissions = options.unixPermissions; + this.dosPermissions = options.dosPermissions; + + this._data = data; + this.options = options; + + /* + * This object contains initial values for dir and date. + * With them, we can check if the user changed the deprecated metadata in + * `ZipObject#options` or not. + */ + this._initialMetadata = { + dir : options.dir, + date : options.date + }; +}; + +ZipObject.prototype = { + /** + * Return the content as UTF8 string. + * @return {string} the UTF8 string. + */ + asText: function() { + return dataToString.call(this, true); + }, + /** + * Returns the binary content. + * @return {string} the content as binary. + */ + asBinary: function() { + return dataToString.call(this, false); + }, + /** + * Returns the content as a nodejs Buffer. + * @return {Buffer} the content as a Buffer. + */ + asNodeBuffer: function() { + var result = getBinaryData(this); + return utils.transformTo("nodebuffer", result); + }, + /** + * Returns the content as an Uint8Array. + * @return {Uint8Array} the content as an Uint8Array. + */ + asUint8Array: function() { + var result = getBinaryData(this); + return utils.transformTo("uint8array", result); + }, + /** + * Returns the content as an ArrayBuffer. + * @return {ArrayBuffer} the content as an ArrayBufer. + */ + asArrayBuffer: function() { + return this.asUint8Array().buffer; + } +}; + +/** + * Transform an integer into a string in hexadecimal. + * @private + * @param {number} dec the number to convert. + * @param {number} bytes the number of bytes to generate. + * @returns {string} the result. + */ +var decToHex = function(dec, bytes) { + var hex = "", + i; + for (i = 0; i < bytes; i++) { + hex += String.fromCharCode(dec & 0xff); + dec = dec >>> 8; + } + return hex; +}; + +/** + * Merge the objects passed as parameters into a new one. + * @private + * @param {...Object} var_args All objects to merge. + * @return {Object} a new object with the data of the others. + */ +var extend = function() { + var result = {}, i, attr; + for (i = 0; i < arguments.length; i++) { // arguments is not enumerable in some browsers + for (attr in arguments[i]) { + if (arguments[i].hasOwnProperty(attr) && typeof result[attr] === "undefined") { + result[attr] = arguments[i][attr]; + } + } + } + return result; +}; + +/** + * Transforms the (incomplete) options from the user into the complete + * set of options to create a file. + * @private + * @param {Object} o the options from the user. + * @return {Object} the complete set of options. + */ +var prepareFileAttrs = function(o) { + o = o || {}; + if (o.base64 === true && (o.binary === null || o.binary === undefined)) { + o.binary = true; + } + o = extend(o, defaults); + o.date = o.date || new Date(); + if (o.compression !== null) o.compression = o.compression.toUpperCase(); + + return o; +}; + +/** + * Add a file in the current folder. + * @private + * @param {string} name the name of the file + * @param {String|ArrayBuffer|Uint8Array|Buffer} data the data of the file + * @param {Object} o the options of the file + * @return {Object} the new file. + */ +var fileAdd = function(name, data, o) { + // be sure sub folders exist + var dataType = utils.getTypeOf(data), + parent; + + o = prepareFileAttrs(o); + + if (typeof o.unixPermissions === "string") { + o.unixPermissions = parseInt(o.unixPermissions, 8); + } + + // UNX_IFDIR 0040000 see zipinfo.c + if (o.unixPermissions && (o.unixPermissions & 0x4000)) { + o.dir = true; + } + // Bit 4 Directory + if (o.dosPermissions && (o.dosPermissions & 0x0010)) { + o.dir = true; + } + + if (o.dir) { + name = forceTrailingSlash(name); + } + + if (o.createFolders && (parent = parentFolder(name))) { + folderAdd.call(this, parent, true); + } + + if (o.dir || data === null || typeof data === "undefined") { + o.base64 = false; + o.binary = false; + data = null; + dataType = null; + } + else if (dataType === "string") { + if (o.binary && !o.base64) { + // optimizedBinaryString == true means that the file has already been filtered with a 0xFF mask + if (o.optimizedBinaryString !== true) { + // this is a string, not in a base64 format. + // Be sure that this is a correct "binary string" + data = utils.string2binary(data); + } + } + } + else { // arraybuffer, uint8array, ... + o.base64 = false; + o.binary = true; + + if (!dataType && !(data instanceof CompressedObject)) { + throw new Error("The data of '" + name + "' is in an unsupported format !"); + } + + // special case : it's way easier to work with Uint8Array than with ArrayBuffer + if (dataType === "arraybuffer") { + data = utils.transformTo("uint8array", data); + } + } + + var object = new ZipObject(name, data, o); + this.files[name] = object; + return object; +}; + +/** + * Find the parent folder of the path. + * @private + * @param {string} path the path to use + * @return {string} the parent folder, or "" + */ +var parentFolder = function (path) { + if (path.slice(-1) == '/') { + path = path.substring(0, path.length - 1); + } + var lastSlash = path.lastIndexOf('/'); + return (lastSlash > 0) ? path.substring(0, lastSlash) : ""; +}; + + +/** + * Returns the path with a slash at the end. + * @private + * @param {String} path the path to check. + * @return {String} the path with a trailing slash. + */ +var forceTrailingSlash = function(path) { + // Check the name ends with a / + if (path.slice(-1) != "/") { + path += "/"; // IE doesn't like substr(-1) + } + return path; +}; +/** + * Add a (sub) folder in the current folder. + * @private + * @param {string} name the folder's name + * @param {boolean=} [createFolders] If true, automatically create sub + * folders. Defaults to false. + * @return {Object} the new folder. + */ +var folderAdd = function(name, createFolders) { + createFolders = (typeof createFolders !== 'undefined') ? createFolders : false; + + name = forceTrailingSlash(name); + + // Does this folder already exist? + if (!this.files[name]) { + fileAdd.call(this, name, null, { + dir: true, + createFolders: createFolders + }); + } + return this.files[name]; +}; + +/** + * Generate a JSZip.CompressedObject for a given zipOject. + * @param {ZipObject} file the object to read. + * @param {JSZip.compression} compression the compression to use. + * @param {Object} compressionOptions the options to use when compressing. + * @return {JSZip.CompressedObject} the compressed result. + */ +var generateCompressedObjectFrom = function(file, compression, compressionOptions) { + var result = new CompressedObject(), + content; + + // the data has not been decompressed, we might reuse things ! + if (file._data instanceof CompressedObject) { + result.uncompressedSize = file._data.uncompressedSize; + result.crc32 = file._data.crc32; + + if (result.uncompressedSize === 0 || file.dir) { + compression = compressions['STORE']; + result.compressedContent = ""; + result.crc32 = 0; + } + else if (file._data.compressionMethod === compression.magic) { + result.compressedContent = file._data.getCompressedContent(); + } + else { + content = file._data.getContent(); + // need to decompress / recompress + result.compressedContent = compression.compress(utils.transformTo(compression.compressInputType, content), compressionOptions); + } + } + else { + // have uncompressed data + content = getBinaryData(file); + if (!content || content.length === 0 || file.dir) { + compression = compressions['STORE']; + content = ""; + } + result.uncompressedSize = content.length; + result.crc32 = crc32(content); + result.compressedContent = compression.compress(utils.transformTo(compression.compressInputType, content), compressionOptions); + } + + result.compressedSize = result.compressedContent.length; + result.compressionMethod = compression.magic; + + return result; +}; + + + + +/** + * Generate the UNIX part of the external file attributes. + * @param {Object} unixPermissions the unix permissions or null. + * @param {Boolean} isDir true if the entry is a directory, false otherwise. + * @return {Number} a 32 bit integer. + * + * adapted from http://unix.stackexchange.com/questions/14705/the-zip-formats-external-file-attribute : + * + * TTTTsstrwxrwxrwx0000000000ADVSHR + * ^^^^____________________________ file type, see zipinfo.c (UNX_*) + * ^^^_________________________ setuid, setgid, sticky + * ^^^^^^^^^________________ permissions + * ^^^^^^^^^^______ not used ? + * ^^^^^^ DOS attribute bits : Archive, Directory, Volume label, System file, Hidden, Read only + */ +var generateUnixExternalFileAttr = function (unixPermissions, isDir) { + + var result = unixPermissions; + if (!unixPermissions) { + // I can't use octal values in strict mode, hence the hexa. + // 040775 => 0x41fd + // 0100664 => 0x81b4 + result = isDir ? 0x41fd : 0x81b4; + } + + return (result & 0xFFFF) << 16; +}; + +/** + * Generate the DOS part of the external file attributes. + * @param {Object} dosPermissions the dos permissions or null. + * @param {Boolean} isDir true if the entry is a directory, false otherwise. + * @return {Number} a 32 bit integer. + * + * Bit 0 Read-Only + * Bit 1 Hidden + * Bit 2 System + * Bit 3 Volume Label + * Bit 4 Directory + * Bit 5 Archive + */ +var generateDosExternalFileAttr = function (dosPermissions, isDir) { + + // the dir flag is already set for compatibility + + return (dosPermissions || 0) & 0x3F; +}; + +/** + * Generate the various parts used in the construction of the final zip file. + * @param {string} name the file name. + * @param {ZipObject} file the file content. + * @param {JSZip.CompressedObject} compressedObject the compressed object. + * @param {number} offset the current offset from the start of the zip file. + * @param {String} platform let's pretend we are this platform (change platform dependents fields) + * @return {object} the zip parts. + */ +var generateZipParts = function(name, file, compressedObject, offset, platform) { + var data = compressedObject.compressedContent, + utfEncodedFileName = utils.transformTo("string", utf8.utf8encode(file.name)), + comment = file.comment || "", + utfEncodedComment = utils.transformTo("string", utf8.utf8encode(comment)), + useUTF8ForFileName = utfEncodedFileName.length !== file.name.length, + useUTF8ForComment = utfEncodedComment.length !== comment.length, + o = file.options, + dosTime, + dosDate, + extraFields = "", + unicodePathExtraField = "", + unicodeCommentExtraField = "", + dir, date; + + + // handle the deprecated options.dir + if (file._initialMetadata.dir !== file.dir) { + dir = file.dir; + } else { + dir = o.dir; + } + + // handle the deprecated options.date + if(file._initialMetadata.date !== file.date) { + date = file.date; + } else { + date = o.date; + } + + var extFileAttr = 0; + var versionMadeBy = 0; + if (dir) { + // dos or unix, we set the dos dir flag + extFileAttr |= 0x00010; + } + if(platform === "UNIX") { + versionMadeBy = 0x031E; // UNIX, version 3.0 + extFileAttr |= generateUnixExternalFileAttr(file.unixPermissions, dir); + } else { // DOS or other, fallback to DOS + versionMadeBy = 0x0014; // DOS, version 2.0 + extFileAttr |= generateDosExternalFileAttr(file.dosPermissions, dir); + } + + // date + // @see http://www.delorie.com/djgpp/doc/rbinter/it/52/13.html + // @see http://www.delorie.com/djgpp/doc/rbinter/it/65/16.html + // @see http://www.delorie.com/djgpp/doc/rbinter/it/66/16.html + + dosTime = date.getHours(); + dosTime = dosTime << 6; + dosTime = dosTime | date.getMinutes(); + dosTime = dosTime << 5; + dosTime = dosTime | date.getSeconds() / 2; + + dosDate = date.getFullYear() - 1980; + dosDate = dosDate << 4; + dosDate = dosDate | (date.getMonth() + 1); + dosDate = dosDate << 5; + dosDate = dosDate | date.getDate(); + + if (useUTF8ForFileName) { + // set the unicode path extra field. unzip needs at least one extra + // field to correctly handle unicode path, so using the path is as good + // as any other information. This could improve the situation with + // other archive managers too. + // This field is usually used without the utf8 flag, with a non + // unicode path in the header (winrar, winzip). This helps (a bit) + // with the messy Windows' default compressed folders feature but + // breaks on p7zip which doesn't seek the unicode path extra field. + // So for now, UTF-8 everywhere ! + unicodePathExtraField = + // Version + decToHex(1, 1) + + // NameCRC32 + decToHex(crc32(utfEncodedFileName), 4) + + // UnicodeName + utfEncodedFileName; + + extraFields += + // Info-ZIP Unicode Path Extra Field + "\x75\x70" + + // size + decToHex(unicodePathExtraField.length, 2) + + // content + unicodePathExtraField; + } + + if(useUTF8ForComment) { + + unicodeCommentExtraField = + // Version + decToHex(1, 1) + + // CommentCRC32 + decToHex(this.crc32(utfEncodedComment), 4) + + // UnicodeName + utfEncodedComment; + + extraFields += + // Info-ZIP Unicode Path Extra Field + "\x75\x63" + + // size + decToHex(unicodeCommentExtraField.length, 2) + + // content + unicodeCommentExtraField; + } + + var header = ""; + + // version needed to extract + header += "\x0A\x00"; + // general purpose bit flag + // set bit 11 if utf8 + header += (useUTF8ForFileName || useUTF8ForComment) ? "\x00\x08" : "\x00\x00"; + // compression method + header += compressedObject.compressionMethod; + // last mod file time + header += decToHex(dosTime, 2); + // last mod file date + header += decToHex(dosDate, 2); + // crc-32 + header += decToHex(compressedObject.crc32, 4); + // compressed size + header += decToHex(compressedObject.compressedSize, 4); + // uncompressed size + header += decToHex(compressedObject.uncompressedSize, 4); + // file name length + header += decToHex(utfEncodedFileName.length, 2); + // extra field length + header += decToHex(extraFields.length, 2); + + + var fileRecord = signature.LOCAL_FILE_HEADER + header + utfEncodedFileName + extraFields; + + var dirRecord = signature.CENTRAL_FILE_HEADER + + // version made by (00: DOS) + decToHex(versionMadeBy, 2) + + // file header (common to file and central directory) + header + + // file comment length + decToHex(utfEncodedComment.length, 2) + + // disk number start + "\x00\x00" + + // internal file attributes TODO + "\x00\x00" + + // external file attributes + decToHex(extFileAttr, 4) + + // relative offset of local header + decToHex(offset, 4) + + // file name + utfEncodedFileName + + // extra field + extraFields + + // file comment + utfEncodedComment; + + return { + fileRecord: fileRecord, + dirRecord: dirRecord, + compressedObject: compressedObject + }; +}; + + +// return the actual prototype of JSZip +var out = { + /** + * Read an existing zip and merge the data in the current JSZip object. + * The implementation is in jszip-load.js, don't forget to include it. + * @param {String|ArrayBuffer|Uint8Array|Buffer} stream The stream to load + * @param {Object} options Options for loading the stream. + * options.base64 : is the stream in base64 ? default : false + * @return {JSZip} the current JSZip object + */ + load: function(stream, options) { + throw new Error("Load method is not defined. Is the file jszip-load.js included ?"); + }, + + /** + * Filter nested files/folders with the specified function. + * @param {Function} search the predicate to use : + * function (relativePath, file) {...} + * It takes 2 arguments : the relative path and the file. + * @return {Array} An array of matching elements. + */ + filter: function(search) { + var result = [], + filename, relativePath, file, fileClone; + for (filename in this.files) { + if (!this.files.hasOwnProperty(filename)) { + continue; + } + file = this.files[filename]; + // return a new object, don't let the user mess with our internal objects :) + fileClone = new ZipObject(file.name, file._data, extend(file.options)); + relativePath = filename.slice(this.root.length, filename.length); + if (filename.slice(0, this.root.length) === this.root && // the file is in the current root + search(relativePath, fileClone)) { // and the file matches the function + result.push(fileClone); + } + } + return result; + }, + + /** + * Add a file to the zip file, or search a file. + * @param {string|RegExp} name The name of the file to add (if data is defined), + * the name of the file to find (if no data) or a regex to match files. + * @param {String|ArrayBuffer|Uint8Array|Buffer} data The file data, either raw or base64 encoded + * @param {Object} o File options + * @return {JSZip|Object|Array} this JSZip object (when adding a file), + * a file (when searching by string) or an array of files (when searching by regex). + */ + file: function(name, data, o) { + if (arguments.length === 1) { + if (utils.isRegExp(name)) { + var regexp = name; + return this.filter(function(relativePath, file) { + return !file.dir && regexp.test(relativePath); + }); + } + else { // text + return this.filter(function(relativePath, file) { + return !file.dir && relativePath === name; + })[0] || null; + } + } + else { // more than one argument : we have data ! + name = this.root + name; + fileAdd.call(this, name, data, o); + } + return this; + }, + + /** + * Add a directory to the zip file, or search. + * @param {String|RegExp} arg The name of the directory to add, or a regex to search folders. + * @return {JSZip} an object with the new directory as the root, or an array containing matching folders. + */ + folder: function(arg) { + if (!arg) { + return this; + } + + if (utils.isRegExp(arg)) { + return this.filter(function(relativePath, file) { + return file.dir && arg.test(relativePath); + }); + } + + // else, name is a new folder + var name = this.root + arg; + var newFolder = folderAdd.call(this, name); + + // Allow chaining by returning a new object with this folder as the root + var ret = this.clone(); + ret.root = newFolder.name; + return ret; + }, + + /** + * Delete a file, or a directory and all sub-files, from the zip + * @param {string} name the name of the file to delete + * @return {JSZip} this JSZip object + */ + remove: function(name) { + name = this.root + name; + var file = this.files[name]; + if (!file) { + // Look for any folders + if (name.slice(-1) != "/") { + name += "/"; + } + file = this.files[name]; + } + + if (file && !file.dir) { + // file + delete this.files[name]; + } else { + // maybe a folder, delete recursively + var kids = this.filter(function(relativePath, file) { + return file.name.slice(0, name.length) === name; + }); + for (var i = 0; i < kids.length; i++) { + delete this.files[kids[i].name]; + } + } + + return this; + }, + + /** + * Generate the complete zip file + * @param {Object} options the options to generate the zip file : + * - base64, (deprecated, use type instead) true to generate base64. + * - compression, "STORE" by default. + * - type, "base64" by default. Values are : string, base64, uint8array, arraybuffer, blob. + * @return {String|Uint8Array|ArrayBuffer|Buffer|Blob} the zip file + */ + generate: function(options) { + options = extend(options || {}, { + base64: true, + compression: "STORE", + compressionOptions : null, + type: "base64", + platform: "DOS", + comment: null, + mimeType: 'application/zip' + }); + + utils.checkSupport(options.type); + + // accept nodejs `process.platform` + if( + options.platform === 'darwin' || + options.platform === 'freebsd' || + options.platform === 'linux' || + options.platform === 'sunos' + ) { + options.platform = "UNIX"; + } + if (options.platform === 'win32') { + options.platform = "DOS"; + } + + var zipData = [], + localDirLength = 0, + centralDirLength = 0, + writer, i, + utfEncodedComment = utils.transformTo("string", this.utf8encode(options.comment || this.comment || "")); + + // first, generate all the zip parts. + for (var name in this.files) { + if (!this.files.hasOwnProperty(name)) { + continue; + } + var file = this.files[name]; + + var compressionName = file.options.compression || options.compression.toUpperCase(); + var compression = compressions[compressionName]; + if (!compression) { + throw new Error(compressionName + " is not a valid compression method !"); + } + var compressionOptions = file.options.compressionOptions || options.compressionOptions || {}; + + var compressedObject = generateCompressedObjectFrom.call(this, file, compression, compressionOptions); + + var zipPart = generateZipParts.call(this, name, file, compressedObject, localDirLength, options.platform); + localDirLength += zipPart.fileRecord.length + compressedObject.compressedSize; + centralDirLength += zipPart.dirRecord.length; + zipData.push(zipPart); + } + + var dirEnd = ""; + + // end of central dir signature + dirEnd = signature.CENTRAL_DIRECTORY_END + + // number of this disk + "\x00\x00" + + // number of the disk with the start of the central directory + "\x00\x00" + + // total number of entries in the central directory on this disk + decToHex(zipData.length, 2) + + // total number of entries in the central directory + decToHex(zipData.length, 2) + + // size of the central directory 4 bytes + decToHex(centralDirLength, 4) + + // offset of start of central directory with respect to the starting disk number + decToHex(localDirLength, 4) + + // .ZIP file comment length + decToHex(utfEncodedComment.length, 2) + + // .ZIP file comment + utfEncodedComment; + + + // we have all the parts (and the total length) + // time to create a writer ! + var typeName = options.type.toLowerCase(); + if(typeName==="uint8array"||typeName==="arraybuffer"||typeName==="blob"||typeName==="nodebuffer") { + writer = new Uint8ArrayWriter(localDirLength + centralDirLength + dirEnd.length); + }else{ + writer = new StringWriter(localDirLength + centralDirLength + dirEnd.length); + } + + for (i = 0; i < zipData.length; i++) { + writer.append(zipData[i].fileRecord); + writer.append(zipData[i].compressedObject.compressedContent); + } + for (i = 0; i < zipData.length; i++) { + writer.append(zipData[i].dirRecord); + } + + writer.append(dirEnd); + + var zip = writer.finalize(); + + + + switch(options.type.toLowerCase()) { + // case "zip is an Uint8Array" + case "uint8array" : + case "arraybuffer" : + case "nodebuffer" : + return utils.transformTo(options.type.toLowerCase(), zip); + case "blob" : + return utils.arrayBuffer2Blob(utils.transformTo("arraybuffer", zip), options.mimeType); + // case "zip is a string" + case "base64" : + return (options.base64) ? base64.encode(zip) : zip; + default : // case "string" : + return zip; + } + + }, + + /** + * @deprecated + * This method will be removed in a future version without replacement. + */ + crc32: function (input, crc) { + return crc32(input, crc); + }, + + /** + * @deprecated + * This method will be removed in a future version without replacement. + */ + utf8encode: function (string) { + return utils.transformTo("string", utf8.utf8encode(string)); + }, + + /** + * @deprecated + * This method will be removed in a future version without replacement. + */ + utf8decode: function (input) { + return utf8.utf8decode(input); + } +}; +module.exports = out; + +},{"./base64":1,"./compressedObject":2,"./compressions":3,"./crc32":4,"./defaults":6,"./nodeBuffer":11,"./signature":14,"./stringWriter":16,"./support":17,"./uint8ArrayWriter":19,"./utf8":20,"./utils":21}],14:[function(_dereq_,module,exports){ +'use strict'; +exports.LOCAL_FILE_HEADER = "PK\x03\x04"; +exports.CENTRAL_FILE_HEADER = "PK\x01\x02"; +exports.CENTRAL_DIRECTORY_END = "PK\x05\x06"; +exports.ZIP64_CENTRAL_DIRECTORY_LOCATOR = "PK\x06\x07"; +exports.ZIP64_CENTRAL_DIRECTORY_END = "PK\x06\x06"; +exports.DATA_DESCRIPTOR = "PK\x07\x08"; + +},{}],15:[function(_dereq_,module,exports){ +'use strict'; +var DataReader = _dereq_('./dataReader'); +var utils = _dereq_('./utils'); + +function StringReader(data, optimizedBinaryString) { + this.data = data; + if (!optimizedBinaryString) { + this.data = utils.string2binary(this.data); + } + this.length = this.data.length; + this.index = 0; +} +StringReader.prototype = new DataReader(); +/** + * @see DataReader.byteAt + */ +StringReader.prototype.byteAt = function(i) { + return this.data.charCodeAt(i); +}; +/** + * @see DataReader.lastIndexOfSignature + */ +StringReader.prototype.lastIndexOfSignature = function(sig) { + return this.data.lastIndexOf(sig); +}; +/** + * @see DataReader.readData + */ +StringReader.prototype.readData = function(size) { + this.checkOffset(size); + // this will work because the constructor applied the "& 0xff" mask. + var result = this.data.slice(this.index, this.index + size); + this.index += size; + return result; +}; +module.exports = StringReader; + +},{"./dataReader":5,"./utils":21}],16:[function(_dereq_,module,exports){ +'use strict'; + +var utils = _dereq_('./utils'); + +/** + * An object to write any content to a string. + * @constructor + */ +var StringWriter = function() { + this.data = []; +}; +StringWriter.prototype = { + /** + * Append any content to the current string. + * @param {Object} input the content to add. + */ + append: function(input) { + input = utils.transformTo("string", input); + this.data.push(input); + }, + /** + * Finalize the construction an return the result. + * @return {string} the generated string. + */ + finalize: function() { + return this.data.join(""); + } +}; + +module.exports = StringWriter; + +},{"./utils":21}],17:[function(_dereq_,module,exports){ +(function (Buffer){ +'use strict'; +exports.base64 = true; +exports.array = true; +exports.string = true; +exports.arraybuffer = typeof ArrayBuffer !== "undefined" && typeof Uint8Array !== "undefined"; +// contains true if JSZip can read/generate nodejs Buffer, false otherwise. +// Browserify will provide a Buffer implementation for browsers, which is +// an augmented Uint8Array (i.e., can be used as either Buffer or U8). +exports.nodebuffer = typeof Buffer !== "undefined"; +// contains true if JSZip can read/generate Uint8Array, false otherwise. +exports.uint8array = typeof Uint8Array !== "undefined"; + +if (typeof ArrayBuffer === "undefined") { + exports.blob = false; +} +else { + var buffer = new ArrayBuffer(0); + try { + exports.blob = new Blob([buffer], { + type: "application/zip" + }).size === 0; + } + catch (e) { + try { + var Builder = window.BlobBuilder || window.WebKitBlobBuilder || window.MozBlobBuilder || window.MSBlobBuilder; + var builder = new Builder(); + builder.append(buffer); + exports.blob = builder.getBlob('application/zip').size === 0; + } + catch (e) { + exports.blob = false; + } + } +} + +}).call(this,(typeof Buffer !== "undefined" ? Buffer : undefined)) +},{}],18:[function(_dereq_,module,exports){ +'use strict'; +var DataReader = _dereq_('./dataReader'); + +function Uint8ArrayReader(data) { + if (data) { + this.data = data; + this.length = this.data.length; + this.index = 0; + } +} +Uint8ArrayReader.prototype = new DataReader(); +/** + * @see DataReader.byteAt + */ +Uint8ArrayReader.prototype.byteAt = function(i) { + return this.data[i]; +}; +/** + * @see DataReader.lastIndexOfSignature + */ +Uint8ArrayReader.prototype.lastIndexOfSignature = function(sig) { + var sig0 = sig.charCodeAt(0), + sig1 = sig.charCodeAt(1), + sig2 = sig.charCodeAt(2), + sig3 = sig.charCodeAt(3); + for (var i = this.length - 4; i >= 0; --i) { + if (this.data[i] === sig0 && this.data[i + 1] === sig1 && this.data[i + 2] === sig2 && this.data[i + 3] === sig3) { + return i; + } + } + + return -1; +}; +/** + * @see DataReader.readData + */ +Uint8ArrayReader.prototype.readData = function(size) { + this.checkOffset(size); + if(size === 0) { + // in IE10, when using subarray(idx, idx), we get the array [0x00] instead of []. + return new Uint8Array(0); + } + var result = this.data.subarray(this.index, this.index + size); + this.index += size; + return result; +}; +module.exports = Uint8ArrayReader; + +},{"./dataReader":5}],19:[function(_dereq_,module,exports){ +'use strict'; + +var utils = _dereq_('./utils'); + +/** + * An object to write any content to an Uint8Array. + * @constructor + * @param {number} length The length of the array. + */ +var Uint8ArrayWriter = function(length) { + this.data = new Uint8Array(length); + this.index = 0; +}; +Uint8ArrayWriter.prototype = { + /** + * Append any content to the current array. + * @param {Object} input the content to add. + */ + append: function(input) { + if (input.length !== 0) { + // with an empty Uint8Array, Opera fails with a "Offset larger than array size" + input = utils.transformTo("uint8array", input); + this.data.set(input, this.index); + this.index += input.length; + } + }, + /** + * Finalize the construction an return the result. + * @return {Uint8Array} the generated array. + */ + finalize: function() { + return this.data; + } +}; + +module.exports = Uint8ArrayWriter; + +},{"./utils":21}],20:[function(_dereq_,module,exports){ +'use strict'; + +var utils = _dereq_('./utils'); +var support = _dereq_('./support'); +var nodeBuffer = _dereq_('./nodeBuffer'); + +/** + * The following functions come from pako, from pako/lib/utils/strings + * released under the MIT license, see pako https://github.com/nodeca/pako/ + */ + +// Table with utf8 lengths (calculated by first byte of sequence) +// Note, that 5 & 6-byte values and some 4-byte values can not be represented in JS, +// because max possible codepoint is 0x10ffff +var _utf8len = new Array(256); +for (var i=0; i<256; i++) { + _utf8len[i] = (i >= 252 ? 6 : i >= 248 ? 5 : i >= 240 ? 4 : i >= 224 ? 3 : i >= 192 ? 2 : 1); +} +_utf8len[254]=_utf8len[254]=1; // Invalid sequence start + +// convert string to array (typed, when possible) +var string2buf = function (str) { + var buf, c, c2, m_pos, i, str_len = str.length, buf_len = 0; + + // count binary size + for (m_pos = 0; m_pos < str_len; m_pos++) { + c = str.charCodeAt(m_pos); + if ((c & 0xfc00) === 0xd800 && (m_pos+1 < str_len)) { + c2 = str.charCodeAt(m_pos+1); + if ((c2 & 0xfc00) === 0xdc00) { + c = 0x10000 + ((c - 0xd800) << 10) + (c2 - 0xdc00); + m_pos++; + } + } + buf_len += c < 0x80 ? 1 : c < 0x800 ? 2 : c < 0x10000 ? 3 : 4; + } + + // allocate buffer + if (support.uint8array) { + buf = new Uint8Array(buf_len); + } else { + buf = new Array(buf_len); + } + + // convert + for (i=0, m_pos = 0; i < buf_len; m_pos++) { + c = str.charCodeAt(m_pos); + if ((c & 0xfc00) === 0xd800 && (m_pos+1 < str_len)) { + c2 = str.charCodeAt(m_pos+1); + if ((c2 & 0xfc00) === 0xdc00) { + c = 0x10000 + ((c - 0xd800) << 10) + (c2 - 0xdc00); + m_pos++; + } + } + if (c < 0x80) { + /* one byte */ + buf[i++] = c; + } else if (c < 0x800) { + /* two bytes */ + buf[i++] = 0xC0 | (c >>> 6); + buf[i++] = 0x80 | (c & 0x3f); + } else if (c < 0x10000) { + /* three bytes */ + buf[i++] = 0xE0 | (c >>> 12); + buf[i++] = 0x80 | (c >>> 6 & 0x3f); + buf[i++] = 0x80 | (c & 0x3f); + } else { + /* four bytes */ + buf[i++] = 0xf0 | (c >>> 18); + buf[i++] = 0x80 | (c >>> 12 & 0x3f); + buf[i++] = 0x80 | (c >>> 6 & 0x3f); + buf[i++] = 0x80 | (c & 0x3f); + } + } + + return buf; +}; + +// Calculate max possible position in utf8 buffer, +// that will not break sequence. If that's not possible +// - (very small limits) return max size as is. +// +// buf[] - utf8 bytes array +// max - length limit (mandatory); +var utf8border = function(buf, max) { + var pos; + + max = max || buf.length; + if (max > buf.length) { max = buf.length; } + + // go back from last position, until start of sequence found + pos = max-1; + while (pos >= 0 && (buf[pos] & 0xC0) === 0x80) { pos--; } + + // Fuckup - very small and broken sequence, + // return max, because we should return something anyway. + if (pos < 0) { return max; } + + // If we came to start of buffer - that means vuffer is too small, + // return max too. + if (pos === 0) { return max; } + + return (pos + _utf8len[buf[pos]] > max) ? pos : max; +}; + +// convert array to string +var buf2string = function (buf) { + var str, i, out, c, c_len; + var len = buf.length; + + // Reserve max possible length (2 words per char) + // NB: by unknown reasons, Array is significantly faster for + // String.fromCharCode.apply than Uint16Array. + var utf16buf = new Array(len*2); + + for (out=0, i=0; i 4) { utf16buf[out++] = 0xfffd; i += c_len-1; continue; } + + // apply mask on first byte + c &= c_len === 2 ? 0x1f : c_len === 3 ? 0x0f : 0x07; + // join the rest + while (c_len > 1 && i < len) { + c = (c << 6) | (buf[i++] & 0x3f); + c_len--; + } + + // terminated by end of string? + if (c_len > 1) { utf16buf[out++] = 0xfffd; continue; } + + if (c < 0x10000) { + utf16buf[out++] = c; + } else { + c -= 0x10000; + utf16buf[out++] = 0xd800 | ((c >> 10) & 0x3ff); + utf16buf[out++] = 0xdc00 | (c & 0x3ff); + } + } + + // shrinkBuf(utf16buf, out) + if (utf16buf.length !== out) { + if(utf16buf.subarray) { + utf16buf = utf16buf.subarray(0, out); + } else { + utf16buf.length = out; + } + } + + // return String.fromCharCode.apply(null, utf16buf); + return utils.applyFromCharCode(utf16buf); +}; + + +// That's all for the pako functions. + + +/** + * Transform a javascript string into an array (typed if possible) of bytes, + * UTF-8 encoded. + * @param {String} str the string to encode + * @return {Array|Uint8Array|Buffer} the UTF-8 encoded string. + */ +exports.utf8encode = function utf8encode(str) { + if (support.nodebuffer) { + return nodeBuffer(str, "utf-8"); + } + + return string2buf(str); +}; + + +/** + * Transform a bytes array (or a representation) representing an UTF-8 encoded + * string into a javascript string. + * @param {Array|Uint8Array|Buffer} buf the data de decode + * @return {String} the decoded string. + */ +exports.utf8decode = function utf8decode(buf) { + if (support.nodebuffer) { + return utils.transformTo("nodebuffer", buf).toString("utf-8"); + } + + buf = utils.transformTo(support.uint8array ? "uint8array" : "array", buf); + + // return buf2string(buf); + // Chrome prefers to work with "small" chunks of data + // for the method buf2string. + // Firefox and Chrome has their own shortcut, IE doesn't seem to really care. + var result = [], k = 0, len = buf.length, chunk = 65536; + while (k < len) { + var nextBoundary = utf8border(buf, Math.min(k + chunk, len)); + if (support.uint8array) { + result.push(buf2string(buf.subarray(k, nextBoundary))); + } else { + result.push(buf2string(buf.slice(k, nextBoundary))); + } + k = nextBoundary; + } + return result.join(""); + +}; +// vim: set shiftwidth=4 softtabstop=4: + +},{"./nodeBuffer":11,"./support":17,"./utils":21}],21:[function(_dereq_,module,exports){ +'use strict'; +var support = _dereq_('./support'); +var compressions = _dereq_('./compressions'); +var nodeBuffer = _dereq_('./nodeBuffer'); +/** + * Convert a string to a "binary string" : a string containing only char codes between 0 and 255. + * @param {string} str the string to transform. + * @return {String} the binary string. + */ +exports.string2binary = function(str) { + var result = ""; + for (var i = 0; i < str.length; i++) { + result += String.fromCharCode(str.charCodeAt(i) & 0xff); + } + return result; +}; +exports.arrayBuffer2Blob = function(buffer, mimeType) { + exports.checkSupport("blob"); + mimeType = mimeType || 'application/zip'; + + try { + // Blob constructor + return new Blob([buffer], { + type: mimeType + }); + } + catch (e) { + + try { + // deprecated, browser only, old way + var Builder = window.BlobBuilder || window.WebKitBlobBuilder || window.MozBlobBuilder || window.MSBlobBuilder; + var builder = new Builder(); + builder.append(buffer); + return builder.getBlob(mimeType); + } + catch (e) { + + // well, fuck ?! + throw new Error("Bug : can't construct the Blob."); + } + } + + +}; +/** + * The identity function. + * @param {Object} input the input. + * @return {Object} the same input. + */ +function identity(input) { + return input; +} + +/** + * Fill in an array with a string. + * @param {String} str the string to use. + * @param {Array|ArrayBuffer|Uint8Array|Buffer} array the array to fill in (will be mutated). + * @return {Array|ArrayBuffer|Uint8Array|Buffer} the updated array. + */ +function stringToArrayLike(str, array) { + for (var i = 0; i < str.length; ++i) { + array[i] = str.charCodeAt(i) & 0xFF; + } + return array; +} + +/** + * Transform an array-like object to a string. + * @param {Array|ArrayBuffer|Uint8Array|Buffer} array the array to transform. + * @return {String} the result. + */ +function arrayLikeToString(array) { + // Performances notes : + // -------------------- + // String.fromCharCode.apply(null, array) is the fastest, see + // see http://jsperf.com/converting-a-uint8array-to-a-string/2 + // but the stack is limited (and we can get huge arrays !). + // + // result += String.fromCharCode(array[i]); generate too many strings ! + // + // This code is inspired by http://jsperf.com/arraybuffer-to-string-apply-performance/2 + var chunk = 65536; + var result = [], + len = array.length, + type = exports.getTypeOf(array), + k = 0, + canUseApply = true; + try { + switch(type) { + case "uint8array": + String.fromCharCode.apply(null, new Uint8Array(0)); + break; + case "nodebuffer": + String.fromCharCode.apply(null, nodeBuffer(0)); + break; + } + } catch(e) { + canUseApply = false; + } + + // no apply : slow and painful algorithm + // default browser on android 4.* + if (!canUseApply) { + var resultStr = ""; + for(var i = 0; i < array.length;i++) { + resultStr += String.fromCharCode(array[i]); + } + return resultStr; + } + while (k < len && chunk > 1) { + try { + if (type === "array" || type === "nodebuffer") { + result.push(String.fromCharCode.apply(null, array.slice(k, Math.min(k + chunk, len)))); + } + else { + result.push(String.fromCharCode.apply(null, array.subarray(k, Math.min(k + chunk, len)))); + } + k += chunk; + } + catch (e) { + chunk = Math.floor(chunk / 2); + } + } + return result.join(""); +} + +exports.applyFromCharCode = arrayLikeToString; + + +/** + * Copy the data from an array-like to an other array-like. + * @param {Array|ArrayBuffer|Uint8Array|Buffer} arrayFrom the origin array. + * @param {Array|ArrayBuffer|Uint8Array|Buffer} arrayTo the destination array which will be mutated. + * @return {Array|ArrayBuffer|Uint8Array|Buffer} the updated destination array. + */ +function arrayLikeToArrayLike(arrayFrom, arrayTo) { + for (var i = 0; i < arrayFrom.length; i++) { + arrayTo[i] = arrayFrom[i]; + } + return arrayTo; +} + +// a matrix containing functions to transform everything into everything. +var transform = {}; + +// string to ? +transform["string"] = { + "string": identity, + "array": function(input) { + return stringToArrayLike(input, new Array(input.length)); + }, + "arraybuffer": function(input) { + return transform["string"]["uint8array"](input).buffer; + }, + "uint8array": function(input) { + return stringToArrayLike(input, new Uint8Array(input.length)); + }, + "nodebuffer": function(input) { + return stringToArrayLike(input, nodeBuffer(input.length)); + } +}; + +// array to ? +transform["array"] = { + "string": arrayLikeToString, + "array": identity, + "arraybuffer": function(input) { + return (new Uint8Array(input)).buffer; + }, + "uint8array": function(input) { + return new Uint8Array(input); + }, + "nodebuffer": function(input) { + return nodeBuffer(input); + } +}; + +// arraybuffer to ? +transform["arraybuffer"] = { + "string": function(input) { + return arrayLikeToString(new Uint8Array(input)); + }, + "array": function(input) { + return arrayLikeToArrayLike(new Uint8Array(input), new Array(input.byteLength)); + }, + "arraybuffer": identity, + "uint8array": function(input) { + return new Uint8Array(input); + }, + "nodebuffer": function(input) { + return nodeBuffer(new Uint8Array(input)); + } +}; + +// uint8array to ? +transform["uint8array"] = { + "string": arrayLikeToString, + "array": function(input) { + return arrayLikeToArrayLike(input, new Array(input.length)); + }, + "arraybuffer": function(input) { + return input.buffer; + }, + "uint8array": identity, + "nodebuffer": function(input) { + return nodeBuffer(input); + } +}; + +// nodebuffer to ? +transform["nodebuffer"] = { + "string": arrayLikeToString, + "array": function(input) { + return arrayLikeToArrayLike(input, new Array(input.length)); + }, + "arraybuffer": function(input) { + return transform["nodebuffer"]["uint8array"](input).buffer; + }, + "uint8array": function(input) { + return arrayLikeToArrayLike(input, new Uint8Array(input.length)); + }, + "nodebuffer": identity +}; + +/** + * Transform an input into any type. + * The supported output type are : string, array, uint8array, arraybuffer, nodebuffer. + * If no output type is specified, the unmodified input will be returned. + * @param {String} outputType the output type. + * @param {String|Array|ArrayBuffer|Uint8Array|Buffer} input the input to convert. + * @throws {Error} an Error if the browser doesn't support the requested output type. + */ +exports.transformTo = function(outputType, input) { + if (!input) { + // undefined, null, etc + // an empty string won't harm. + input = ""; + } + if (!outputType) { + return input; + } + exports.checkSupport(outputType); + var inputType = exports.getTypeOf(input); + var result = transform[inputType][outputType](input); + return result; +}; + +/** + * Return the type of the input. + * The type will be in a format valid for JSZip.utils.transformTo : string, array, uint8array, arraybuffer. + * @param {Object} input the input to identify. + * @return {String} the (lowercase) type of the input. + */ +exports.getTypeOf = function(input) { + if (typeof input === "string") { + return "string"; + } + if (Object.prototype.toString.call(input) === "[object Array]") { + return "array"; + } + if (support.nodebuffer && nodeBuffer.test(input)) { + return "nodebuffer"; + } + if (support.uint8array && input instanceof Uint8Array) { + return "uint8array"; + } + if (support.arraybuffer && input instanceof ArrayBuffer) { + return "arraybuffer"; + } +}; + +/** + * Throw an exception if the type is not supported. + * @param {String} type the type to check. + * @throws {Error} an Error if the browser doesn't support the requested type. + */ +exports.checkSupport = function(type) { + var supported = support[type.toLowerCase()]; + if (!supported) { + throw new Error(type + " is not supported by this browser"); + } +}; +exports.MAX_VALUE_16BITS = 65535; +exports.MAX_VALUE_32BITS = -1; // well, "\xFF\xFF\xFF\xFF\xFF\xFF\xFF\xFF" is parsed as -1 + +/** + * Prettify a string read as binary. + * @param {string} str the string to prettify. + * @return {string} a pretty string. + */ +exports.pretty = function(str) { + var res = '', + code, i; + for (i = 0; i < (str || "").length; i++) { + code = str.charCodeAt(i); + res += '\\x' + (code < 16 ? "0" : "") + code.toString(16).toUpperCase(); + } + return res; +}; + +/** + * Find a compression registered in JSZip. + * @param {string} compressionMethod the method magic to find. + * @return {Object|null} the JSZip compression object, null if none found. + */ +exports.findCompression = function(compressionMethod) { + for (var method in compressions) { + if (!compressions.hasOwnProperty(method)) { + continue; + } + if (compressions[method].magic === compressionMethod) { + return compressions[method]; + } + } + return null; +}; +/** +* Cross-window, cross-Node-context regular expression detection +* @param {Object} object Anything +* @return {Boolean} true if the object is a regular expression, +* false otherwise +*/ +exports.isRegExp = function (object) { + return Object.prototype.toString.call(object) === "[object RegExp]"; +}; + + +},{"./compressions":3,"./nodeBuffer":11,"./support":17}],22:[function(_dereq_,module,exports){ +'use strict'; +var StringReader = _dereq_('./stringReader'); +var NodeBufferReader = _dereq_('./nodeBufferReader'); +var Uint8ArrayReader = _dereq_('./uint8ArrayReader'); +var utils = _dereq_('./utils'); +var sig = _dereq_('./signature'); +var ZipEntry = _dereq_('./zipEntry'); +var support = _dereq_('./support'); +var jszipProto = _dereq_('./object'); +// class ZipEntries {{{ +/** + * All the entries in the zip file. + * @constructor + * @param {String|ArrayBuffer|Uint8Array} data the binary stream to load. + * @param {Object} loadOptions Options for loading the stream. + */ +function ZipEntries(data, loadOptions) { + this.files = []; + this.loadOptions = loadOptions; + if (data) { + this.load(data); + } +} +ZipEntries.prototype = { + /** + * Check that the reader is on the speficied signature. + * @param {string} expectedSignature the expected signature. + * @throws {Error} if it is an other signature. + */ + checkSignature: function(expectedSignature) { + var signature = this.reader.readString(4); + if (signature !== expectedSignature) { + throw new Error("Corrupted zip or bug : unexpected signature " + "(" + utils.pretty(signature) + ", expected " + utils.pretty(expectedSignature) + ")"); + } + }, + /** + * Read the end of the central directory. + */ + readBlockEndOfCentral: function() { + this.diskNumber = this.reader.readInt(2); + this.diskWithCentralDirStart = this.reader.readInt(2); + this.centralDirRecordsOnThisDisk = this.reader.readInt(2); + this.centralDirRecords = this.reader.readInt(2); + this.centralDirSize = this.reader.readInt(4); + this.centralDirOffset = this.reader.readInt(4); + + this.zipCommentLength = this.reader.readInt(2); + // warning : the encoding depends of the system locale + // On a linux machine with LANG=en_US.utf8, this field is utf8 encoded. + // On a windows machine, this field is encoded with the localized windows code page. + this.zipComment = this.reader.readString(this.zipCommentLength); + // To get consistent behavior with the generation part, we will assume that + // this is utf8 encoded. + this.zipComment = jszipProto.utf8decode(this.zipComment); + }, + /** + * Read the end of the Zip 64 central directory. + * Not merged with the method readEndOfCentral : + * The end of central can coexist with its Zip64 brother, + * I don't want to read the wrong number of bytes ! + */ + readBlockZip64EndOfCentral: function() { + this.zip64EndOfCentralSize = this.reader.readInt(8); + this.versionMadeBy = this.reader.readString(2); + this.versionNeeded = this.reader.readInt(2); + this.diskNumber = this.reader.readInt(4); + this.diskWithCentralDirStart = this.reader.readInt(4); + this.centralDirRecordsOnThisDisk = this.reader.readInt(8); + this.centralDirRecords = this.reader.readInt(8); + this.centralDirSize = this.reader.readInt(8); + this.centralDirOffset = this.reader.readInt(8); + + this.zip64ExtensibleData = {}; + var extraDataSize = this.zip64EndOfCentralSize - 44, + index = 0, + extraFieldId, + extraFieldLength, + extraFieldValue; + while (index < extraDataSize) { + extraFieldId = this.reader.readInt(2); + extraFieldLength = this.reader.readInt(4); + extraFieldValue = this.reader.readString(extraFieldLength); + this.zip64ExtensibleData[extraFieldId] = { + id: extraFieldId, + length: extraFieldLength, + value: extraFieldValue + }; + } + }, + /** + * Read the end of the Zip 64 central directory locator. + */ + readBlockZip64EndOfCentralLocator: function() { + this.diskWithZip64CentralDirStart = this.reader.readInt(4); + this.relativeOffsetEndOfZip64CentralDir = this.reader.readInt(8); + this.disksCount = this.reader.readInt(4); + if (this.disksCount > 1) { + throw new Error("Multi-volumes zip are not supported"); + } + }, + /** + * Read the local files, based on the offset read in the central part. + */ + readLocalFiles: function() { + var i, file; + for (i = 0; i < this.files.length; i++) { + file = this.files[i]; + this.reader.setIndex(file.localHeaderOffset); + this.checkSignature(sig.LOCAL_FILE_HEADER); + file.readLocalPart(this.reader); + file.handleUTF8(); + file.processAttributes(); + } + }, + /** + * Read the central directory. + */ + readCentralDir: function() { + var file; + + this.reader.setIndex(this.centralDirOffset); + while (this.reader.readString(4) === sig.CENTRAL_FILE_HEADER) { + file = new ZipEntry({ + zip64: this.zip64 + }, this.loadOptions); + file.readCentralPart(this.reader); + this.files.push(file); + } + }, + /** + * Read the end of central directory. + */ + readEndOfCentral: function() { + var offset = this.reader.lastIndexOfSignature(sig.CENTRAL_DIRECTORY_END); + if (offset === -1) { + // Check if the content is a truncated zip or complete garbage. + // A "LOCAL_FILE_HEADER" is not required at the beginning (auto + // extractible zip for example) but it can give a good hint. + // If an ajax request was used without responseType, we will also + // get unreadable data. + var isGarbage = true; + try { + this.reader.setIndex(0); + this.checkSignature(sig.LOCAL_FILE_HEADER); + isGarbage = false; + } catch (e) {} + + if (isGarbage) { + throw new Error("Can't find end of central directory : is this a zip file ? " + + "If it is, see http://stuk.github.io/jszip/documentation/howto/read_zip.html"); + } else { + throw new Error("Corrupted zip : can't find end of central directory"); + } + } + this.reader.setIndex(offset); + this.checkSignature(sig.CENTRAL_DIRECTORY_END); + this.readBlockEndOfCentral(); + + + /* extract from the zip spec : + 4) If one of the fields in the end of central directory + record is too small to hold required data, the field + should be set to -1 (0xFFFF or 0xFFFFFFFF) and the + ZIP64 format record should be created. + 5) The end of central directory record and the + Zip64 end of central directory locator record must + reside on the same disk when splitting or spanning + an archive. + */ + if (this.diskNumber === utils.MAX_VALUE_16BITS || this.diskWithCentralDirStart === utils.MAX_VALUE_16BITS || this.centralDirRecordsOnThisDisk === utils.MAX_VALUE_16BITS || this.centralDirRecords === utils.MAX_VALUE_16BITS || this.centralDirSize === utils.MAX_VALUE_32BITS || this.centralDirOffset === utils.MAX_VALUE_32BITS) { + this.zip64 = true; + + /* + Warning : the zip64 extension is supported, but ONLY if the 64bits integer read from + the zip file can fit into a 32bits integer. This cannot be solved : Javascript represents + all numbers as 64-bit double precision IEEE 754 floating point numbers. + So, we have 53bits for integers and bitwise operations treat everything as 32bits. + see https://developer.mozilla.org/en-US/docs/JavaScript/Reference/Operators/Bitwise_Operators + and http://www.ecma-international.org/publications/files/ECMA-ST/ECMA-262.pdf section 8.5 + */ + + // should look for a zip64 EOCD locator + offset = this.reader.lastIndexOfSignature(sig.ZIP64_CENTRAL_DIRECTORY_LOCATOR); + if (offset === -1) { + throw new Error("Corrupted zip : can't find the ZIP64 end of central directory locator"); + } + this.reader.setIndex(offset); + this.checkSignature(sig.ZIP64_CENTRAL_DIRECTORY_LOCATOR); + this.readBlockZip64EndOfCentralLocator(); + + // now the zip64 EOCD record + this.reader.setIndex(this.relativeOffsetEndOfZip64CentralDir); + this.checkSignature(sig.ZIP64_CENTRAL_DIRECTORY_END); + this.readBlockZip64EndOfCentral(); + } + }, + prepareReader: function(data) { + var type = utils.getTypeOf(data); + if (type === "string" && !support.uint8array) { + this.reader = new StringReader(data, this.loadOptions.optimizedBinaryString); + } + else if (type === "nodebuffer") { + this.reader = new NodeBufferReader(data); + } + else { + this.reader = new Uint8ArrayReader(utils.transformTo("uint8array", data)); + } + }, + /** + * Read a zip file and create ZipEntries. + * @param {String|ArrayBuffer|Uint8Array|Buffer} data the binary string representing a zip file. + */ + load: function(data) { + this.prepareReader(data); + this.readEndOfCentral(); + this.readCentralDir(); + this.readLocalFiles(); + } +}; +// }}} end of ZipEntries +module.exports = ZipEntries; + +},{"./nodeBufferReader":12,"./object":13,"./signature":14,"./stringReader":15,"./support":17,"./uint8ArrayReader":18,"./utils":21,"./zipEntry":23}],23:[function(_dereq_,module,exports){ +'use strict'; +var StringReader = _dereq_('./stringReader'); +var utils = _dereq_('./utils'); +var CompressedObject = _dereq_('./compressedObject'); +var jszipProto = _dereq_('./object'); + +var MADE_BY_DOS = 0x00; +var MADE_BY_UNIX = 0x03; + +// class ZipEntry {{{ +/** + * An entry in the zip file. + * @constructor + * @param {Object} options Options of the current file. + * @param {Object} loadOptions Options for loading the stream. + */ +function ZipEntry(options, loadOptions) { + this.options = options; + this.loadOptions = loadOptions; +} +ZipEntry.prototype = { + /** + * say if the file is encrypted. + * @return {boolean} true if the file is encrypted, false otherwise. + */ + isEncrypted: function() { + // bit 1 is set + return (this.bitFlag & 0x0001) === 0x0001; + }, + /** + * say if the file has utf-8 filename/comment. + * @return {boolean} true if the filename/comment is in utf-8, false otherwise. + */ + useUTF8: function() { + // bit 11 is set + return (this.bitFlag & 0x0800) === 0x0800; + }, + /** + * Prepare the function used to generate the compressed content from this ZipFile. + * @param {DataReader} reader the reader to use. + * @param {number} from the offset from where we should read the data. + * @param {number} length the length of the data to read. + * @return {Function} the callback to get the compressed content (the type depends of the DataReader class). + */ + prepareCompressedContent: function(reader, from, length) { + return function() { + var previousIndex = reader.index; + reader.setIndex(from); + var compressedFileData = reader.readData(length); + reader.setIndex(previousIndex); + + return compressedFileData; + }; + }, + /** + * Prepare the function used to generate the uncompressed content from this ZipFile. + * @param {DataReader} reader the reader to use. + * @param {number} from the offset from where we should read the data. + * @param {number} length the length of the data to read. + * @param {JSZip.compression} compression the compression used on this file. + * @param {number} uncompressedSize the uncompressed size to expect. + * @return {Function} the callback to get the uncompressed content (the type depends of the DataReader class). + */ + prepareContent: function(reader, from, length, compression, uncompressedSize) { + return function() { + + var compressedFileData = utils.transformTo(compression.uncompressInputType, this.getCompressedContent()); + var uncompressedFileData = compression.uncompress(compressedFileData); + + if (uncompressedFileData.length !== uncompressedSize) { + throw new Error("Bug : uncompressed data size mismatch"); + } + + return uncompressedFileData; + }; + }, + /** + * Read the local part of a zip file and add the info in this object. + * @param {DataReader} reader the reader to use. + */ + readLocalPart: function(reader) { + var compression, localExtraFieldsLength; + + // we already know everything from the central dir ! + // If the central dir data are false, we are doomed. + // On the bright side, the local part is scary : zip64, data descriptors, both, etc. + // The less data we get here, the more reliable this should be. + // Let's skip the whole header and dash to the data ! + reader.skip(22); + // in some zip created on windows, the filename stored in the central dir contains \ instead of /. + // Strangely, the filename here is OK. + // I would love to treat these zip files as corrupted (see http://www.info-zip.org/FAQ.html#backslashes + // or APPNOTE#4.4.17.1, "All slashes MUST be forward slashes '/'") but there are a lot of bad zip generators... + // Search "unzip mismatching "local" filename continuing with "central" filename version" on + // the internet. + // + // I think I see the logic here : the central directory is used to display + // content and the local directory is used to extract the files. Mixing / and \ + // may be used to display \ to windows users and use / when extracting the files. + // Unfortunately, this lead also to some issues : http://seclists.org/fulldisclosure/2009/Sep/394 + this.fileNameLength = reader.readInt(2); + localExtraFieldsLength = reader.readInt(2); // can't be sure this will be the same as the central dir + this.fileName = reader.readString(this.fileNameLength); + reader.skip(localExtraFieldsLength); + + if (this.compressedSize == -1 || this.uncompressedSize == -1) { + throw new Error("Bug or corrupted zip : didn't get enough informations from the central directory " + "(compressedSize == -1 || uncompressedSize == -1)"); + } + + compression = utils.findCompression(this.compressionMethod); + if (compression === null) { // no compression found + throw new Error("Corrupted zip : compression " + utils.pretty(this.compressionMethod) + " unknown (inner file : " + this.fileName + ")"); + } + this.decompressed = new CompressedObject(); + this.decompressed.compressedSize = this.compressedSize; + this.decompressed.uncompressedSize = this.uncompressedSize; + this.decompressed.crc32 = this.crc32; + this.decompressed.compressionMethod = this.compressionMethod; + this.decompressed.getCompressedContent = this.prepareCompressedContent(reader, reader.index, this.compressedSize, compression); + this.decompressed.getContent = this.prepareContent(reader, reader.index, this.compressedSize, compression, this.uncompressedSize); + + // we need to compute the crc32... + if (this.loadOptions.checkCRC32) { + this.decompressed = utils.transformTo("string", this.decompressed.getContent()); + if (jszipProto.crc32(this.decompressed) !== this.crc32) { + throw new Error("Corrupted zip : CRC32 mismatch"); + } + } + }, + + /** + * Read the central part of a zip file and add the info in this object. + * @param {DataReader} reader the reader to use. + */ + readCentralPart: function(reader) { + this.versionMadeBy = reader.readInt(2); + this.versionNeeded = reader.readInt(2); + this.bitFlag = reader.readInt(2); + this.compressionMethod = reader.readString(2); + this.date = reader.readDate(); + this.crc32 = reader.readInt(4); + this.compressedSize = reader.readInt(4); + this.uncompressedSize = reader.readInt(4); + this.fileNameLength = reader.readInt(2); + this.extraFieldsLength = reader.readInt(2); + this.fileCommentLength = reader.readInt(2); + this.diskNumberStart = reader.readInt(2); + this.internalFileAttributes = reader.readInt(2); + this.externalFileAttributes = reader.readInt(4); + this.localHeaderOffset = reader.readInt(4); + + if (this.isEncrypted()) { + throw new Error("Encrypted zip are not supported"); + } + + this.fileName = reader.readString(this.fileNameLength); + this.readExtraFields(reader); + this.parseZIP64ExtraField(reader); + this.fileComment = reader.readString(this.fileCommentLength); + }, + + /** + * Parse the external file attributes and get the unix/dos permissions. + */ + processAttributes: function () { + this.unixPermissions = null; + this.dosPermissions = null; + var madeBy = this.versionMadeBy >> 8; + + // Check if we have the DOS directory flag set. + // We look for it in the DOS and UNIX permissions + // but some unknown platform could set it as a compatibility flag. + this.dir = this.externalFileAttributes & 0x0010 ? true : false; + + if(madeBy === MADE_BY_DOS) { + // first 6 bits (0 to 5) + this.dosPermissions = this.externalFileAttributes & 0x3F; + } + + if(madeBy === MADE_BY_UNIX) { + this.unixPermissions = (this.externalFileAttributes >> 16) & 0xFFFF; + // the octal permissions are in (this.unixPermissions & 0x01FF).toString(8); + } + + // fail safe : if the name ends with a / it probably means a folder + if (!this.dir && this.fileName.slice(-1) === '/') { + this.dir = true; + } + }, + + /** + * Parse the ZIP64 extra field and merge the info in the current ZipEntry. + * @param {DataReader} reader the reader to use. + */ + parseZIP64ExtraField: function(reader) { + + if (!this.extraFields[0x0001]) { + return; + } + + // should be something, preparing the extra reader + var extraReader = new StringReader(this.extraFields[0x0001].value); + + // I really hope that these 64bits integer can fit in 32 bits integer, because js + // won't let us have more. + if (this.uncompressedSize === utils.MAX_VALUE_32BITS) { + this.uncompressedSize = extraReader.readInt(8); + } + if (this.compressedSize === utils.MAX_VALUE_32BITS) { + this.compressedSize = extraReader.readInt(8); + } + if (this.localHeaderOffset === utils.MAX_VALUE_32BITS) { + this.localHeaderOffset = extraReader.readInt(8); + } + if (this.diskNumberStart === utils.MAX_VALUE_32BITS) { + this.diskNumberStart = extraReader.readInt(4); + } + }, + /** + * Read the central part of a zip file and add the info in this object. + * @param {DataReader} reader the reader to use. + */ + readExtraFields: function(reader) { + var start = reader.index, + extraFieldId, + extraFieldLength, + extraFieldValue; + + this.extraFields = this.extraFields || {}; + + while (reader.index < start + this.extraFieldsLength) { + extraFieldId = reader.readInt(2); + extraFieldLength = reader.readInt(2); + extraFieldValue = reader.readString(extraFieldLength); + + this.extraFields[extraFieldId] = { + id: extraFieldId, + length: extraFieldLength, + value: extraFieldValue + }; + } + }, + /** + * Apply an UTF8 transformation if needed. + */ + handleUTF8: function() { + if (this.useUTF8()) { + this.fileName = jszipProto.utf8decode(this.fileName); + this.fileComment = jszipProto.utf8decode(this.fileComment); + } else { + var upath = this.findExtraFieldUnicodePath(); + if (upath !== null) { + this.fileName = upath; + } + var ucomment = this.findExtraFieldUnicodeComment(); + if (ucomment !== null) { + this.fileComment = ucomment; + } + } + }, + + /** + * Find the unicode path declared in the extra field, if any. + * @return {String} the unicode path, null otherwise. + */ + findExtraFieldUnicodePath: function() { + var upathField = this.extraFields[0x7075]; + if (upathField) { + var extraReader = new StringReader(upathField.value); + + // wrong version + if (extraReader.readInt(1) !== 1) { + return null; + } + + // the crc of the filename changed, this field is out of date. + if (jszipProto.crc32(this.fileName) !== extraReader.readInt(4)) { + return null; + } + + return jszipProto.utf8decode(extraReader.readString(upathField.length - 5)); + } + return null; + }, + + /** + * Find the unicode comment declared in the extra field, if any. + * @return {String} the unicode comment, null otherwise. + */ + findExtraFieldUnicodeComment: function() { + var ucommentField = this.extraFields[0x6375]; + if (ucommentField) { + var extraReader = new StringReader(ucommentField.value); + + // wrong version + if (extraReader.readInt(1) !== 1) { + return null; + } + + // the crc of the comment changed, this field is out of date. + if (jszipProto.crc32(this.fileComment) !== extraReader.readInt(4)) { + return null; + } + + return jszipProto.utf8decode(extraReader.readString(ucommentField.length - 5)); + } + return null; + } +}; +module.exports = ZipEntry; + +},{"./compressedObject":2,"./object":13,"./stringReader":15,"./utils":21}],24:[function(_dereq_,module,exports){ +// Top level file is just a mixin of submodules & constants +'use strict'; + +var assign = _dereq_('./lib/utils/common').assign; + +var deflate = _dereq_('./lib/deflate'); +var inflate = _dereq_('./lib/inflate'); +var constants = _dereq_('./lib/zlib/constants'); + +var pako = {}; + +assign(pako, deflate, inflate, constants); + +module.exports = pako; +},{"./lib/deflate":25,"./lib/inflate":26,"./lib/utils/common":27,"./lib/zlib/constants":30}],25:[function(_dereq_,module,exports){ +'use strict'; + + +var zlib_deflate = _dereq_('./zlib/deflate.js'); +var utils = _dereq_('./utils/common'); +var strings = _dereq_('./utils/strings'); +var msg = _dereq_('./zlib/messages'); +var zstream = _dereq_('./zlib/zstream'); + + +/* Public constants ==========================================================*/ +/* ===========================================================================*/ + +var Z_NO_FLUSH = 0; +var Z_FINISH = 4; + +var Z_OK = 0; +var Z_STREAM_END = 1; + +var Z_DEFAULT_COMPRESSION = -1; + +var Z_DEFAULT_STRATEGY = 0; + +var Z_DEFLATED = 8; + +/* ===========================================================================*/ + + +/** + * class Deflate + * + * Generic JS-style wrapper for zlib calls. If you don't need + * streaming behaviour - use more simple functions: [[deflate]], + * [[deflateRaw]] and [[gzip]]. + **/ + +/* internal + * Deflate.chunks -> Array + * + * Chunks of output data, if [[Deflate#onData]] not overriden. + **/ + +/** + * Deflate.result -> Uint8Array|Array + * + * Compressed result, generated by default [[Deflate#onData]] + * and [[Deflate#onEnd]] handlers. Filled after you push last chunk + * (call [[Deflate#push]] with `Z_FINISH` / `true` param). + **/ + +/** + * Deflate.err -> Number + * + * Error code after deflate finished. 0 (Z_OK) on success. + * You will not need it in real life, because deflate errors + * are possible only on wrong options or bad `onData` / `onEnd` + * custom handlers. + **/ + +/** + * Deflate.msg -> String + * + * Error message, if [[Deflate.err]] != 0 + **/ + + +/** + * new Deflate(options) + * - options (Object): zlib deflate options. + * + * Creates new deflator instance with specified params. Throws exception + * on bad params. Supported options: + * + * - `level` + * - `windowBits` + * - `memLevel` + * - `strategy` + * + * [http://zlib.net/manual.html#Advanced](http://zlib.net/manual.html#Advanced) + * for more information on these. + * + * Additional options, for internal needs: + * + * - `chunkSize` - size of generated data chunks (16K by default) + * - `raw` (Boolean) - do raw deflate + * - `gzip` (Boolean) - create gzip wrapper + * - `to` (String) - if equal to 'string', then result will be "binary string" + * (each char code [0..255]) + * - `header` (Object) - custom header for gzip + * - `text` (Boolean) - true if compressed data believed to be text + * - `time` (Number) - modification time, unix timestamp + * - `os` (Number) - operation system code + * - `extra` (Array) - array of bytes with extra data (max 65536) + * - `name` (String) - file name (binary string) + * - `comment` (String) - comment (binary string) + * - `hcrc` (Boolean) - true if header crc should be added + * + * ##### Example: + * + * ```javascript + * var pako = require('pako') + * , chunk1 = Uint8Array([1,2,3,4,5,6,7,8,9]) + * , chunk2 = Uint8Array([10,11,12,13,14,15,16,17,18,19]); + * + * var deflate = new pako.Deflate({ level: 3}); + * + * deflate.push(chunk1, false); + * deflate.push(chunk2, true); // true -> last chunk + * + * if (deflate.err) { throw new Error(deflate.err); } + * + * console.log(deflate.result); + * ``` + **/ +var Deflate = function(options) { + + this.options = utils.assign({ + level: Z_DEFAULT_COMPRESSION, + method: Z_DEFLATED, + chunkSize: 16384, + windowBits: 15, + memLevel: 8, + strategy: Z_DEFAULT_STRATEGY, + to: '' + }, options || {}); + + var opt = this.options; + + if (opt.raw && (opt.windowBits > 0)) { + opt.windowBits = -opt.windowBits; + } + + else if (opt.gzip && (opt.windowBits > 0) && (opt.windowBits < 16)) { + opt.windowBits += 16; + } + + this.err = 0; // error code, if happens (0 = Z_OK) + this.msg = ''; // error message + this.ended = false; // used to avoid multiple onEnd() calls + this.chunks = []; // chunks of compressed data + + this.strm = new zstream(); + this.strm.avail_out = 0; + + var status = zlib_deflate.deflateInit2( + this.strm, + opt.level, + opt.method, + opt.windowBits, + opt.memLevel, + opt.strategy + ); + + if (status !== Z_OK) { + throw new Error(msg[status]); + } + + if (opt.header) { + zlib_deflate.deflateSetHeader(this.strm, opt.header); + } +}; + +/** + * Deflate#push(data[, mode]) -> Boolean + * - data (Uint8Array|Array|String): input data. Strings will be converted to + * utf8 byte sequence. + * - mode (Number|Boolean): 0..6 for corresponding Z_NO_FLUSH..Z_TREE modes. + * See constants. Skipped or `false` means Z_NO_FLUSH, `true` meansh Z_FINISH. + * + * Sends input data to deflate pipe, generating [[Deflate#onData]] calls with + * new compressed chunks. Returns `true` on success. The last data block must have + * mode Z_FINISH (or `true`). That flush internal pending buffers and call + * [[Deflate#onEnd]]. + * + * On fail call [[Deflate#onEnd]] with error code and return false. + * + * We strongly recommend to use `Uint8Array` on input for best speed (output + * array format is detected automatically). Also, don't skip last param and always + * use the same type in your code (boolean or number). That will improve JS speed. + * + * For regular `Array`-s make sure all elements are [0..255]. + * + * ##### Example + * + * ```javascript + * push(chunk, false); // push one of data chunks + * ... + * push(chunk, true); // push last chunk + * ``` + **/ +Deflate.prototype.push = function(data, mode) { + var strm = this.strm; + var chunkSize = this.options.chunkSize; + var status, _mode; + + if (this.ended) { return false; } + + _mode = (mode === ~~mode) ? mode : ((mode === true) ? Z_FINISH : Z_NO_FLUSH); + + // Convert data if needed + if (typeof data === 'string') { + // If we need to compress text, change encoding to utf8. + strm.input = strings.string2buf(data); + } else { + strm.input = data; + } + + strm.next_in = 0; + strm.avail_in = strm.input.length; + + do { + if (strm.avail_out === 0) { + strm.output = new utils.Buf8(chunkSize); + strm.next_out = 0; + strm.avail_out = chunkSize; + } + status = zlib_deflate.deflate(strm, _mode); /* no bad return value */ + + if (status !== Z_STREAM_END && status !== Z_OK) { + this.onEnd(status); + this.ended = true; + return false; + } + if (strm.avail_out === 0 || (strm.avail_in === 0 && _mode === Z_FINISH)) { + if (this.options.to === 'string') { + this.onData(strings.buf2binstring(utils.shrinkBuf(strm.output, strm.next_out))); + } else { + this.onData(utils.shrinkBuf(strm.output, strm.next_out)); + } + } + } while ((strm.avail_in > 0 || strm.avail_out === 0) && status !== Z_STREAM_END); + + // Finalize on the last chunk. + if (_mode === Z_FINISH) { + status = zlib_deflate.deflateEnd(this.strm); + this.onEnd(status); + this.ended = true; + return status === Z_OK; + } + + return true; +}; + + +/** + * Deflate#onData(chunk) -> Void + * - chunk (Uint8Array|Array|String): ouput data. Type of array depends + * on js engine support. When string output requested, each chunk + * will be string. + * + * By default, stores data blocks in `chunks[]` property and glue + * those in `onEnd`. Override this handler, if you need another behaviour. + **/ +Deflate.prototype.onData = function(chunk) { + this.chunks.push(chunk); +}; + + +/** + * Deflate#onEnd(status) -> Void + * - status (Number): deflate status. 0 (Z_OK) on success, + * other if not. + * + * Called once after you tell deflate that input stream complete + * or error happenned. By default - join collected chunks, + * free memory and fill `results` / `err` properties. + **/ +Deflate.prototype.onEnd = function(status) { + // On success - join + if (status === Z_OK) { + if (this.options.to === 'string') { + this.result = this.chunks.join(''); + } else { + this.result = utils.flattenChunks(this.chunks); + } + } + this.chunks = []; + this.err = status; + this.msg = this.strm.msg; +}; + + +/** + * deflate(data[, options]) -> Uint8Array|Array|String + * - data (Uint8Array|Array|String): input data to compress. + * - options (Object): zlib deflate options. + * + * Compress `data` with deflate alrorythm and `options`. + * + * Supported options are: + * + * - level + * - windowBits + * - memLevel + * - strategy + * + * [http://zlib.net/manual.html#Advanced](http://zlib.net/manual.html#Advanced) + * for more information on these. + * + * Sugar (options): + * + * - `raw` (Boolean) - say that we work with raw stream, if you don't wish to specify + * negative windowBits implicitly. + * - `to` (String) - if equal to 'string', then result will be "binary string" + * (each char code [0..255]) + * + * ##### Example: + * + * ```javascript + * var pako = require('pako') + * , data = Uint8Array([1,2,3,4,5,6,7,8,9]); + * + * console.log(pako.deflate(data)); + * ``` + **/ +function deflate(input, options) { + var deflator = new Deflate(options); + + deflator.push(input, true); + + // That will never happens, if you don't cheat with options :) + if (deflator.err) { throw deflator.msg; } + + return deflator.result; +} + + +/** + * deflateRaw(data[, options]) -> Uint8Array|Array|String + * - data (Uint8Array|Array|String): input data to compress. + * - options (Object): zlib deflate options. + * + * The same as [[deflate]], but creates raw data, without wrapper + * (header and adler32 crc). + **/ +function deflateRaw(input, options) { + options = options || {}; + options.raw = true; + return deflate(input, options); +} + + +/** + * gzip(data[, options]) -> Uint8Array|Array|String + * - data (Uint8Array|Array|String): input data to compress. + * - options (Object): zlib deflate options. + * + * The same as [[deflate]], but create gzip wrapper instead of + * deflate one. + **/ +function gzip(input, options) { + options = options || {}; + options.gzip = true; + return deflate(input, options); +} + + +exports.Deflate = Deflate; +exports.deflate = deflate; +exports.deflateRaw = deflateRaw; +exports.gzip = gzip; +},{"./utils/common":27,"./utils/strings":28,"./zlib/deflate.js":32,"./zlib/messages":37,"./zlib/zstream":39}],26:[function(_dereq_,module,exports){ +'use strict'; + + +var zlib_inflate = _dereq_('./zlib/inflate.js'); +var utils = _dereq_('./utils/common'); +var strings = _dereq_('./utils/strings'); +var c = _dereq_('./zlib/constants'); +var msg = _dereq_('./zlib/messages'); +var zstream = _dereq_('./zlib/zstream'); +var gzheader = _dereq_('./zlib/gzheader'); + + +/** + * class Inflate + * + * Generic JS-style wrapper for zlib calls. If you don't need + * streaming behaviour - use more simple functions: [[inflate]] + * and [[inflateRaw]]. + **/ + +/* internal + * inflate.chunks -> Array + * + * Chunks of output data, if [[Inflate#onData]] not overriden. + **/ + +/** + * Inflate.result -> Uint8Array|Array|String + * + * Uncompressed result, generated by default [[Inflate#onData]] + * and [[Inflate#onEnd]] handlers. Filled after you push last chunk + * (call [[Inflate#push]] with `Z_FINISH` / `true` param). + **/ + +/** + * Inflate.err -> Number + * + * Error code after inflate finished. 0 (Z_OK) on success. + * Should be checked if broken data possible. + **/ + +/** + * Inflate.msg -> String + * + * Error message, if [[Inflate.err]] != 0 + **/ + + +/** + * new Inflate(options) + * - options (Object): zlib inflate options. + * + * Creates new inflator instance with specified params. Throws exception + * on bad params. Supported options: + * + * - `windowBits` + * + * [http://zlib.net/manual.html#Advanced](http://zlib.net/manual.html#Advanced) + * for more information on these. + * + * Additional options, for internal needs: + * + * - `chunkSize` - size of generated data chunks (16K by default) + * - `raw` (Boolean) - do raw inflate + * - `to` (String) - if equal to 'string', then result will be converted + * from utf8 to utf16 (javascript) string. When string output requested, + * chunk length can differ from `chunkSize`, depending on content. + * + * By default, when no options set, autodetect deflate/gzip data format via + * wrapper header. + * + * ##### Example: + * + * ```javascript + * var pako = require('pako') + * , chunk1 = Uint8Array([1,2,3,4,5,6,7,8,9]) + * , chunk2 = Uint8Array([10,11,12,13,14,15,16,17,18,19]); + * + * var inflate = new pako.Inflate({ level: 3}); + * + * inflate.push(chunk1, false); + * inflate.push(chunk2, true); // true -> last chunk + * + * if (inflate.err) { throw new Error(inflate.err); } + * + * console.log(inflate.result); + * ``` + **/ +var Inflate = function(options) { + + this.options = utils.assign({ + chunkSize: 16384, + windowBits: 0, + to: '' + }, options || {}); + + var opt = this.options; + + // Force window size for `raw` data, if not set directly, + // because we have no header for autodetect. + if (opt.raw && (opt.windowBits >= 0) && (opt.windowBits < 16)) { + opt.windowBits = -opt.windowBits; + if (opt.windowBits === 0) { opt.windowBits = -15; } + } + + // If `windowBits` not defined (and mode not raw) - set autodetect flag for gzip/deflate + if ((opt.windowBits >= 0) && (opt.windowBits < 16) && + !(options && options.windowBits)) { + opt.windowBits += 32; + } + + // Gzip header has no info about windows size, we can do autodetect only + // for deflate. So, if window size not set, force it to max when gzip possible + if ((opt.windowBits > 15) && (opt.windowBits < 48)) { + // bit 3 (16) -> gzipped data + // bit 4 (32) -> autodetect gzip/deflate + if ((opt.windowBits & 15) === 0) { + opt.windowBits |= 15; + } + } + + this.err = 0; // error code, if happens (0 = Z_OK) + this.msg = ''; // error message + this.ended = false; // used to avoid multiple onEnd() calls + this.chunks = []; // chunks of compressed data + + this.strm = new zstream(); + this.strm.avail_out = 0; + + var status = zlib_inflate.inflateInit2( + this.strm, + opt.windowBits + ); + + if (status !== c.Z_OK) { + throw new Error(msg[status]); + } + + this.header = new gzheader(); + + zlib_inflate.inflateGetHeader(this.strm, this.header); +}; + +/** + * Inflate#push(data[, mode]) -> Boolean + * - data (Uint8Array|Array|String): input data + * - mode (Number|Boolean): 0..6 for corresponding Z_NO_FLUSH..Z_TREE modes. + * See constants. Skipped or `false` means Z_NO_FLUSH, `true` meansh Z_FINISH. + * + * Sends input data to inflate pipe, generating [[Inflate#onData]] calls with + * new output chunks. Returns `true` on success. The last data block must have + * mode Z_FINISH (or `true`). That flush internal pending buffers and call + * [[Inflate#onEnd]]. + * + * On fail call [[Inflate#onEnd]] with error code and return false. + * + * We strongly recommend to use `Uint8Array` on input for best speed (output + * format is detected automatically). Also, don't skip last param and always + * use the same type in your code (boolean or number). That will improve JS speed. + * + * For regular `Array`-s make sure all elements are [0..255]. + * + * ##### Example + * + * ```javascript + * push(chunk, false); // push one of data chunks + * ... + * push(chunk, true); // push last chunk + * ``` + **/ +Inflate.prototype.push = function(data, mode) { + var strm = this.strm; + var chunkSize = this.options.chunkSize; + var status, _mode; + var next_out_utf8, tail, utf8str; + + if (this.ended) { return false; } + _mode = (mode === ~~mode) ? mode : ((mode === true) ? c.Z_FINISH : c.Z_NO_FLUSH); + + // Convert data if needed + if (typeof data === 'string') { + // Only binary strings can be decompressed on practice + strm.input = strings.binstring2buf(data); + } else { + strm.input = data; + } + + strm.next_in = 0; + strm.avail_in = strm.input.length; + + do { + if (strm.avail_out === 0) { + strm.output = new utils.Buf8(chunkSize); + strm.next_out = 0; + strm.avail_out = chunkSize; + } + + status = zlib_inflate.inflate(strm, c.Z_NO_FLUSH); /* no bad return value */ + + if (status !== c.Z_STREAM_END && status !== c.Z_OK) { + this.onEnd(status); + this.ended = true; + return false; + } + + if (strm.next_out) { + if (strm.avail_out === 0 || status === c.Z_STREAM_END || (strm.avail_in === 0 && _mode === c.Z_FINISH)) { + + if (this.options.to === 'string') { + + next_out_utf8 = strings.utf8border(strm.output, strm.next_out); + + tail = strm.next_out - next_out_utf8; + utf8str = strings.buf2string(strm.output, next_out_utf8); + + // move tail + strm.next_out = tail; + strm.avail_out = chunkSize - tail; + if (tail) { utils.arraySet(strm.output, strm.output, next_out_utf8, tail, 0); } + + this.onData(utf8str); + + } else { + this.onData(utils.shrinkBuf(strm.output, strm.next_out)); + } + } + } + } while ((strm.avail_in > 0) && status !== c.Z_STREAM_END); + + if (status === c.Z_STREAM_END) { + _mode = c.Z_FINISH; + } + // Finalize on the last chunk. + if (_mode === c.Z_FINISH) { + status = zlib_inflate.inflateEnd(this.strm); + this.onEnd(status); + this.ended = true; + return status === c.Z_OK; + } + + return true; +}; + + +/** + * Inflate#onData(chunk) -> Void + * - chunk (Uint8Array|Array|String): ouput data. Type of array depends + * on js engine support. When string output requested, each chunk + * will be string. + * + * By default, stores data blocks in `chunks[]` property and glue + * those in `onEnd`. Override this handler, if you need another behaviour. + **/ +Inflate.prototype.onData = function(chunk) { + this.chunks.push(chunk); +}; + + +/** + * Inflate#onEnd(status) -> Void + * - status (Number): inflate status. 0 (Z_OK) on success, + * other if not. + * + * Called once after you tell inflate that input stream complete + * or error happenned. By default - join collected chunks, + * free memory and fill `results` / `err` properties. + **/ +Inflate.prototype.onEnd = function(status) { + // On success - join + if (status === c.Z_OK) { + if (this.options.to === 'string') { + // Glue & convert here, until we teach pako to send + // utf8 alligned strings to onData + this.result = this.chunks.join(''); + } else { + this.result = utils.flattenChunks(this.chunks); + } + } + this.chunks = []; + this.err = status; + this.msg = this.strm.msg; +}; + + +/** + * inflate(data[, options]) -> Uint8Array|Array|String + * - data (Uint8Array|Array|String): input data to decompress. + * - options (Object): zlib inflate options. + * + * Decompress `data` with inflate/ungzip and `options`. Autodetect + * format via wrapper header by default. That's why we don't provide + * separate `ungzip` method. + * + * Supported options are: + * + * - windowBits + * + * [http://zlib.net/manual.html#Advanced](http://zlib.net/manual.html#Advanced) + * for more information. + * + * Sugar (options): + * + * - `raw` (Boolean) - say that we work with raw stream, if you don't wish to specify + * negative windowBits implicitly. + * - `to` (String) - if equal to 'string', then result will be converted + * from utf8 to utf16 (javascript) string. When string output requested, + * chunk length can differ from `chunkSize`, depending on content. + * + * + * ##### Example: + * + * ```javascript + * var pako = require('pako') + * , input = pako.deflate([1,2,3,4,5,6,7,8,9]) + * , output; + * + * try { + * output = pako.inflate(input); + * } catch (err) + * console.log(err); + * } + * ``` + **/ +function inflate(input, options) { + var inflator = new Inflate(options); + + inflator.push(input, true); + + // That will never happens, if you don't cheat with options :) + if (inflator.err) { throw inflator.msg; } + + return inflator.result; +} + + +/** + * inflateRaw(data[, options]) -> Uint8Array|Array|String + * - data (Uint8Array|Array|String): input data to decompress. + * - options (Object): zlib inflate options. + * + * The same as [[inflate]], but creates raw data, without wrapper + * (header and adler32 crc). + **/ +function inflateRaw(input, options) { + options = options || {}; + options.raw = true; + return inflate(input, options); +} + + +/** + * ungzip(data[, options]) -> Uint8Array|Array|String + * - data (Uint8Array|Array|String): input data to decompress. + * - options (Object): zlib inflate options. + * + * Just shortcut to [[inflate]], because it autodetects format + * by header.content. Done for convenience. + **/ + + +exports.Inflate = Inflate; +exports.inflate = inflate; +exports.inflateRaw = inflateRaw; +exports.ungzip = inflate; + +},{"./utils/common":27,"./utils/strings":28,"./zlib/constants":30,"./zlib/gzheader":33,"./zlib/inflate.js":35,"./zlib/messages":37,"./zlib/zstream":39}],27:[function(_dereq_,module,exports){ +'use strict'; + + +var TYPED_OK = (typeof Uint8Array !== 'undefined') && + (typeof Uint16Array !== 'undefined') && + (typeof Int32Array !== 'undefined'); + + +exports.assign = function (obj /*from1, from2, from3, ...*/) { + var sources = Array.prototype.slice.call(arguments, 1); + while (sources.length) { + var source = sources.shift(); + if (!source) { continue; } + + if (typeof(source) !== 'object') { + throw new TypeError(source + 'must be non-object'); + } + + for (var p in source) { + if (source.hasOwnProperty(p)) { + obj[p] = source[p]; + } + } + } + + return obj; +}; + + +// reduce buffer size, avoiding mem copy +exports.shrinkBuf = function (buf, size) { + if (buf.length === size) { return buf; } + if (buf.subarray) { return buf.subarray(0, size); } + buf.length = size; + return buf; +}; + + +var fnTyped = { + arraySet: function (dest, src, src_offs, len, dest_offs) { + if (src.subarray && dest.subarray) { + dest.set(src.subarray(src_offs, src_offs+len), dest_offs); + return; + } + // Fallback to ordinary array + for(var i=0; i= 252 ? 6 : i >= 248 ? 5 : i >= 240 ? 4 : i >= 224 ? 3 : i >= 192 ? 2 : 1); +} +_utf8len[254]=_utf8len[254]=1; // Invalid sequence start + + +// convert string to array (typed, when possible) +exports.string2buf = function (str) { + var buf, c, c2, m_pos, i, str_len = str.length, buf_len = 0; + + // count binary size + for (m_pos = 0; m_pos < str_len; m_pos++) { + c = str.charCodeAt(m_pos); + if ((c & 0xfc00) === 0xd800 && (m_pos+1 < str_len)) { + c2 = str.charCodeAt(m_pos+1); + if ((c2 & 0xfc00) === 0xdc00) { + c = 0x10000 + ((c - 0xd800) << 10) + (c2 - 0xdc00); + m_pos++; + } + } + buf_len += c < 0x80 ? 1 : c < 0x800 ? 2 : c < 0x10000 ? 3 : 4; + } + + // allocate buffer + buf = new utils.Buf8(buf_len); + + // convert + for (i=0, m_pos = 0; i < buf_len; m_pos++) { + c = str.charCodeAt(m_pos); + if ((c & 0xfc00) === 0xd800 && (m_pos+1 < str_len)) { + c2 = str.charCodeAt(m_pos+1); + if ((c2 & 0xfc00) === 0xdc00) { + c = 0x10000 + ((c - 0xd800) << 10) + (c2 - 0xdc00); + m_pos++; + } + } + if (c < 0x80) { + /* one byte */ + buf[i++] = c; + } else if (c < 0x800) { + /* two bytes */ + buf[i++] = 0xC0 | (c >>> 6); + buf[i++] = 0x80 | (c & 0x3f); + } else if (c < 0x10000) { + /* three bytes */ + buf[i++] = 0xE0 | (c >>> 12); + buf[i++] = 0x80 | (c >>> 6 & 0x3f); + buf[i++] = 0x80 | (c & 0x3f); + } else { + /* four bytes */ + buf[i++] = 0xf0 | (c >>> 18); + buf[i++] = 0x80 | (c >>> 12 & 0x3f); + buf[i++] = 0x80 | (c >>> 6 & 0x3f); + buf[i++] = 0x80 | (c & 0x3f); + } + } + + return buf; +}; + +// Helper (used in 2 places) +function buf2binstring(buf, len) { + // use fallback for big arrays to avoid stack overflow + if (len < 65537) { + if ((buf.subarray && STR_APPLY_UIA_OK) || (!buf.subarray && STR_APPLY_OK)) { + return String.fromCharCode.apply(null, utils.shrinkBuf(buf, len)); + } + } + + var result = ''; + for(var i=0; i < len; i++) { + result += String.fromCharCode(buf[i]); + } + return result; +} + + +// Convert byte array to binary string +exports.buf2binstring = function(buf) { + return buf2binstring(buf, buf.length); +}; + + +// Convert binary string (typed, when possible) +exports.binstring2buf = function(str) { + var buf = new utils.Buf8(str.length); + for(var i=0, len=buf.length; i < len; i++) { + buf[i] = str.charCodeAt(i); + } + return buf; +}; + + +// convert array to string +exports.buf2string = function (buf, max) { + var i, out, c, c_len; + var len = max || buf.length; + + // Reserve max possible length (2 words per char) + // NB: by unknown reasons, Array is significantly faster for + // String.fromCharCode.apply than Uint16Array. + var utf16buf = new Array(len*2); + + for (out=0, i=0; i 4) { utf16buf[out++] = 0xfffd; i += c_len-1; continue; } + + // apply mask on first byte + c &= c_len === 2 ? 0x1f : c_len === 3 ? 0x0f : 0x07; + // join the rest + while (c_len > 1 && i < len) { + c = (c << 6) | (buf[i++] & 0x3f); + c_len--; + } + + // terminated by end of string? + if (c_len > 1) { utf16buf[out++] = 0xfffd; continue; } + + if (c < 0x10000) { + utf16buf[out++] = c; + } else { + c -= 0x10000; + utf16buf[out++] = 0xd800 | ((c >> 10) & 0x3ff); + utf16buf[out++] = 0xdc00 | (c & 0x3ff); + } + } + + return buf2binstring(utf16buf, out); +}; + + +// Calculate max possible position in utf8 buffer, +// that will not break sequence. If that's not possible +// - (very small limits) return max size as is. +// +// buf[] - utf8 bytes array +// max - length limit (mandatory); +exports.utf8border = function(buf, max) { + var pos; + + max = max || buf.length; + if (max > buf.length) { max = buf.length; } + + // go back from last position, until start of sequence found + pos = max-1; + while (pos >= 0 && (buf[pos] & 0xC0) === 0x80) { pos--; } + + // Fuckup - very small and broken sequence, + // return max, because we should return something anyway. + if (pos < 0) { return max; } + + // If we came to start of buffer - that means vuffer is too small, + // return max too. + if (pos === 0) { return max; } + + return (pos + _utf8len[buf[pos]] > max) ? pos : max; +}; + +},{"./common":27}],29:[function(_dereq_,module,exports){ +'use strict'; + +// Note: adler32 takes 12% for level 0 and 2% for level 6. +// It doesn't worth to make additional optimizationa as in original. +// Small size is preferable. + +function adler32(adler, buf, len, pos) { + var s1 = (adler & 0xffff) |0 + , s2 = ((adler >>> 16) & 0xffff) |0 + , n = 0; + + while (len !== 0) { + // Set limit ~ twice less than 5552, to keep + // s2 in 31-bits, because we force signed ints. + // in other case %= will fail. + n = len > 2000 ? 2000 : len; + len -= n; + + do { + s1 = (s1 + buf[pos++]) |0; + s2 = (s2 + s1) |0; + } while (--n); + + s1 %= 65521; + s2 %= 65521; + } + + return (s1 | (s2 << 16)) |0; +} + + +module.exports = adler32; +},{}],30:[function(_dereq_,module,exports){ +module.exports = { + + /* Allowed flush values; see deflate() and inflate() below for details */ + Z_NO_FLUSH: 0, + Z_PARTIAL_FLUSH: 1, + Z_SYNC_FLUSH: 2, + Z_FULL_FLUSH: 3, + Z_FINISH: 4, + Z_BLOCK: 5, + Z_TREES: 6, + + /* Return codes for the compression/decompression functions. Negative values + * are errors, positive values are used for special but normal events. + */ + Z_OK: 0, + Z_STREAM_END: 1, + Z_NEED_DICT: 2, + Z_ERRNO: -1, + Z_STREAM_ERROR: -2, + Z_DATA_ERROR: -3, + //Z_MEM_ERROR: -4, + Z_BUF_ERROR: -5, + //Z_VERSION_ERROR: -6, + + /* compression levels */ + Z_NO_COMPRESSION: 0, + Z_BEST_SPEED: 1, + Z_BEST_COMPRESSION: 9, + Z_DEFAULT_COMPRESSION: -1, + + + Z_FILTERED: 1, + Z_HUFFMAN_ONLY: 2, + Z_RLE: 3, + Z_FIXED: 4, + Z_DEFAULT_STRATEGY: 0, + + /* Possible values of the data_type field (though see inflate()) */ + Z_BINARY: 0, + Z_TEXT: 1, + //Z_ASCII: 1, // = Z_TEXT (deprecated) + Z_UNKNOWN: 2, + + /* The deflate compression method */ + Z_DEFLATED: 8 + //Z_NULL: null // Use -1 or null inline, depending on var type +}; +},{}],31:[function(_dereq_,module,exports){ +'use strict'; + +// Note: we can't get significant speed boost here. +// So write code to minimize size - no pregenerated tables +// and array tools dependencies. + + +// Use ordinary array, since untyped makes no boost here +function makeTable() { + var c, table = []; + + for(var n =0; n < 256; n++){ + c = n; + for(var k =0; k < 8; k++){ + c = ((c&1) ? (0xEDB88320 ^ (c >>> 1)) : (c >>> 1)); + } + table[n] = c; + } + + return table; +} + +// Create table on load. Just 255 signed longs. Not a problem. +var crcTable = makeTable(); + + +function crc32(crc, buf, len, pos) { + var t = crcTable + , end = pos + len; + + crc = crc ^ (-1); + + for (var i = pos; i < end; i++ ) { + crc = (crc >>> 8) ^ t[(crc ^ buf[i]) & 0xFF]; + } + + return (crc ^ (-1)); // >>> 0; +} + + +module.exports = crc32; +},{}],32:[function(_dereq_,module,exports){ +'use strict'; + +var utils = _dereq_('../utils/common'); +var trees = _dereq_('./trees'); +var adler32 = _dereq_('./adler32'); +var crc32 = _dereq_('./crc32'); +var msg = _dereq_('./messages'); + +/* Public constants ==========================================================*/ +/* ===========================================================================*/ + + +/* Allowed flush values; see deflate() and inflate() below for details */ +var Z_NO_FLUSH = 0; +var Z_PARTIAL_FLUSH = 1; +//var Z_SYNC_FLUSH = 2; +var Z_FULL_FLUSH = 3; +var Z_FINISH = 4; +var Z_BLOCK = 5; +//var Z_TREES = 6; + + +/* Return codes for the compression/decompression functions. Negative values + * are errors, positive values are used for special but normal events. + */ +var Z_OK = 0; +var Z_STREAM_END = 1; +//var Z_NEED_DICT = 2; +//var Z_ERRNO = -1; +var Z_STREAM_ERROR = -2; +var Z_DATA_ERROR = -3; +//var Z_MEM_ERROR = -4; +var Z_BUF_ERROR = -5; +//var Z_VERSION_ERROR = -6; + + +/* compression levels */ +//var Z_NO_COMPRESSION = 0; +//var Z_BEST_SPEED = 1; +//var Z_BEST_COMPRESSION = 9; +var Z_DEFAULT_COMPRESSION = -1; + + +var Z_FILTERED = 1; +var Z_HUFFMAN_ONLY = 2; +var Z_RLE = 3; +var Z_FIXED = 4; +var Z_DEFAULT_STRATEGY = 0; + +/* Possible values of the data_type field (though see inflate()) */ +//var Z_BINARY = 0; +//var Z_TEXT = 1; +//var Z_ASCII = 1; // = Z_TEXT +var Z_UNKNOWN = 2; + + +/* The deflate compression method */ +var Z_DEFLATED = 8; + +/*============================================================================*/ + + +var MAX_MEM_LEVEL = 9; +/* Maximum value for memLevel in deflateInit2 */ +var MAX_WBITS = 15; +/* 32K LZ77 window */ +var DEF_MEM_LEVEL = 8; + + +var LENGTH_CODES = 29; +/* number of length codes, not counting the special END_BLOCK code */ +var LITERALS = 256; +/* number of literal bytes 0..255 */ +var L_CODES = LITERALS + 1 + LENGTH_CODES; +/* number of Literal or Length codes, including the END_BLOCK code */ +var D_CODES = 30; +/* number of distance codes */ +var BL_CODES = 19; +/* number of codes used to transfer the bit lengths */ +var HEAP_SIZE = 2*L_CODES + 1; +/* maximum heap size */ +var MAX_BITS = 15; +/* All codes must not exceed MAX_BITS bits */ + +var MIN_MATCH = 3; +var MAX_MATCH = 258; +var MIN_LOOKAHEAD = (MAX_MATCH + MIN_MATCH + 1); + +var PRESET_DICT = 0x20; + +var INIT_STATE = 42; +var EXTRA_STATE = 69; +var NAME_STATE = 73; +var COMMENT_STATE = 91; +var HCRC_STATE = 103; +var BUSY_STATE = 113; +var FINISH_STATE = 666; + +var BS_NEED_MORE = 1; /* block not completed, need more input or more output */ +var BS_BLOCK_DONE = 2; /* block flush performed */ +var BS_FINISH_STARTED = 3; /* finish started, need only more output at next deflate */ +var BS_FINISH_DONE = 4; /* finish done, accept no more input or output */ + +var OS_CODE = 0x03; // Unix :) . Don't detect, use this default. + +function err(strm, errorCode) { + strm.msg = msg[errorCode]; + return errorCode; +} + +function rank(f) { + return ((f) << 1) - ((f) > 4 ? 9 : 0); +} + +function zero(buf) { var len = buf.length; while (--len >= 0) { buf[len] = 0; } } + + +/* ========================================================================= + * Flush as much pending output as possible. All deflate() output goes + * through this function so some applications may wish to modify it + * to avoid allocating a large strm->output buffer and copying into it. + * (See also read_buf()). + */ +function flush_pending(strm) { + var s = strm.state; + + //_tr_flush_bits(s); + var len = s.pending; + if (len > strm.avail_out) { + len = strm.avail_out; + } + if (len === 0) { return; } + + utils.arraySet(strm.output, s.pending_buf, s.pending_out, len, strm.next_out); + strm.next_out += len; + s.pending_out += len; + strm.total_out += len; + strm.avail_out -= len; + s.pending -= len; + if (s.pending === 0) { + s.pending_out = 0; + } +} + + +function flush_block_only (s, last) { + trees._tr_flush_block(s, (s.block_start >= 0 ? s.block_start : -1), s.strstart - s.block_start, last); + s.block_start = s.strstart; + flush_pending(s.strm); +} + + +function put_byte(s, b) { + s.pending_buf[s.pending++] = b; +} + + +/* ========================================================================= + * Put a short in the pending buffer. The 16-bit value is put in MSB order. + * IN assertion: the stream state is correct and there is enough room in + * pending_buf. + */ +function putShortMSB(s, b) { +// put_byte(s, (Byte)(b >> 8)); +// put_byte(s, (Byte)(b & 0xff)); + s.pending_buf[s.pending++] = (b >>> 8) & 0xff; + s.pending_buf[s.pending++] = b & 0xff; +} + + +/* =========================================================================== + * Read a new buffer from the current input stream, update the adler32 + * and total number of bytes read. All deflate() input goes through + * this function so some applications may wish to modify it to avoid + * allocating a large strm->input buffer and copying from it. + * (See also flush_pending()). + */ +function read_buf(strm, buf, start, size) { + var len = strm.avail_in; + + if (len > size) { len = size; } + if (len === 0) { return 0; } + + strm.avail_in -= len; + + utils.arraySet(buf, strm.input, strm.next_in, len, start); + if (strm.state.wrap === 1) { + strm.adler = adler32(strm.adler, buf, len, start); + } + + else if (strm.state.wrap === 2) { + strm.adler = crc32(strm.adler, buf, len, start); + } + + strm.next_in += len; + strm.total_in += len; + + return len; +} + + +/* =========================================================================== + * Set match_start to the longest match starting at the given string and + * return its length. Matches shorter or equal to prev_length are discarded, + * in which case the result is equal to prev_length and match_start is + * garbage. + * IN assertions: cur_match is the head of the hash chain for the current + * string (strstart) and its distance is <= MAX_DIST, and prev_length >= 1 + * OUT assertion: the match length is not greater than s->lookahead. + */ +function longest_match(s, cur_match) { + var chain_length = s.max_chain_length; /* max hash chain length */ + var scan = s.strstart; /* current string */ + var match; /* matched string */ + var len; /* length of current match */ + var best_len = s.prev_length; /* best match length so far */ + var nice_match = s.nice_match; /* stop if match long enough */ + var limit = (s.strstart > (s.w_size - MIN_LOOKAHEAD)) ? + s.strstart - (s.w_size - MIN_LOOKAHEAD) : 0/*NIL*/; + + var _win = s.window; // shortcut + + var wmask = s.w_mask; + var prev = s.prev; + + /* Stop when cur_match becomes <= limit. To simplify the code, + * we prevent matches with the string of window index 0. + */ + + var strend = s.strstart + MAX_MATCH; + var scan_end1 = _win[scan + best_len - 1]; + var scan_end = _win[scan + best_len]; + + /* The code is optimized for HASH_BITS >= 8 and MAX_MATCH-2 multiple of 16. + * It is easy to get rid of this optimization if necessary. + */ + // Assert(s->hash_bits >= 8 && MAX_MATCH == 258, "Code too clever"); + + /* Do not waste too much time if we already have a good match: */ + if (s.prev_length >= s.good_match) { + chain_length >>= 2; + } + /* Do not look for matches beyond the end of the input. This is necessary + * to make deflate deterministic. + */ + if (nice_match > s.lookahead) { nice_match = s.lookahead; } + + // Assert((ulg)s->strstart <= s->window_size-MIN_LOOKAHEAD, "need lookahead"); + + do { + // Assert(cur_match < s->strstart, "no future"); + match = cur_match; + + /* Skip to next match if the match length cannot increase + * or if the match length is less than 2. Note that the checks below + * for insufficient lookahead only occur occasionally for performance + * reasons. Therefore uninitialized memory will be accessed, and + * conditional jumps will be made that depend on those values. + * However the length of the match is limited to the lookahead, so + * the output of deflate is not affected by the uninitialized values. + */ + + if (_win[match + best_len] !== scan_end || + _win[match + best_len - 1] !== scan_end1 || + _win[match] !== _win[scan] || + _win[++match] !== _win[scan + 1]) { + continue; + } + + /* The check at best_len-1 can be removed because it will be made + * again later. (This heuristic is not always a win.) + * It is not necessary to compare scan[2] and match[2] since they + * are always equal when the other bytes match, given that + * the hash keys are equal and that HASH_BITS >= 8. + */ + scan += 2; + match++; + // Assert(*scan == *match, "match[2]?"); + + /* We check for insufficient lookahead only every 8th comparison; + * the 256th check will be made at strstart+258. + */ + do { + /*jshint noempty:false*/ + } while (_win[++scan] === _win[++match] && _win[++scan] === _win[++match] && + _win[++scan] === _win[++match] && _win[++scan] === _win[++match] && + _win[++scan] === _win[++match] && _win[++scan] === _win[++match] && + _win[++scan] === _win[++match] && _win[++scan] === _win[++match] && + scan < strend); + + // Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan"); + + len = MAX_MATCH - (strend - scan); + scan = strend - MAX_MATCH; + + if (len > best_len) { + s.match_start = cur_match; + best_len = len; + if (len >= nice_match) { + break; + } + scan_end1 = _win[scan + best_len - 1]; + scan_end = _win[scan + best_len]; + } + } while ((cur_match = prev[cur_match & wmask]) > limit && --chain_length !== 0); + + if (best_len <= s.lookahead) { + return best_len; + } + return s.lookahead; +} + + +/* =========================================================================== + * Fill the window when the lookahead becomes insufficient. + * Updates strstart and lookahead. + * + * IN assertion: lookahead < MIN_LOOKAHEAD + * OUT assertions: strstart <= window_size-MIN_LOOKAHEAD + * At least one byte has been read, or avail_in == 0; reads are + * performed for at least two bytes (required for the zip translate_eol + * option -- not supported here). + */ +function fill_window(s) { + var _w_size = s.w_size; + var p, n, m, more, str; + + //Assert(s->lookahead < MIN_LOOKAHEAD, "already enough lookahead"); + + do { + more = s.window_size - s.lookahead - s.strstart; + + // JS ints have 32 bit, block below not needed + /* Deal with !@#$% 64K limit: */ + //if (sizeof(int) <= 2) { + // if (more == 0 && s->strstart == 0 && s->lookahead == 0) { + // more = wsize; + // + // } else if (more == (unsigned)(-1)) { + // /* Very unlikely, but possible on 16 bit machine if + // * strstart == 0 && lookahead == 1 (input done a byte at time) + // */ + // more--; + // } + //} + + + /* If the window is almost full and there is insufficient lookahead, + * move the upper half to the lower one to make room in the upper half. + */ + if (s.strstart >= _w_size + (_w_size - MIN_LOOKAHEAD)) { + + utils.arraySet(s.window, s.window, _w_size, _w_size, 0); + s.match_start -= _w_size; + s.strstart -= _w_size; + /* we now have strstart >= MAX_DIST */ + s.block_start -= _w_size; + + /* Slide the hash table (could be avoided with 32 bit values + at the expense of memory usage). We slide even when level == 0 + to keep the hash table consistent if we switch back to level > 0 + later. (Using level 0 permanently is not an optimal usage of + zlib, so we don't care about this pathological case.) + */ + + n = s.hash_size; + p = n; + do { + m = s.head[--p]; + s.head[p] = (m >= _w_size ? m - _w_size : 0); + } while (--n); + + n = _w_size; + p = n; + do { + m = s.prev[--p]; + s.prev[p] = (m >= _w_size ? m - _w_size : 0); + /* If n is not on any hash chain, prev[n] is garbage but + * its value will never be used. + */ + } while (--n); + + more += _w_size; + } + if (s.strm.avail_in === 0) { + break; + } + + /* If there was no sliding: + * strstart <= WSIZE+MAX_DIST-1 && lookahead <= MIN_LOOKAHEAD - 1 && + * more == window_size - lookahead - strstart + * => more >= window_size - (MIN_LOOKAHEAD-1 + WSIZE + MAX_DIST-1) + * => more >= window_size - 2*WSIZE + 2 + * In the BIG_MEM or MMAP case (not yet supported), + * window_size == input_size + MIN_LOOKAHEAD && + * strstart + s->lookahead <= input_size => more >= MIN_LOOKAHEAD. + * Otherwise, window_size == 2*WSIZE so more >= 2. + * If there was sliding, more >= WSIZE. So in all cases, more >= 2. + */ + //Assert(more >= 2, "more < 2"); + n = read_buf(s.strm, s.window, s.strstart + s.lookahead, more); + s.lookahead += n; + + /* Initialize the hash value now that we have some input: */ + if (s.lookahead + s.insert >= MIN_MATCH) { + str = s.strstart - s.insert; + s.ins_h = s.window[str]; + + /* UPDATE_HASH(s, s->ins_h, s->window[str + 1]); */ + s.ins_h = ((s.ins_h << s.hash_shift) ^ s.window[str + 1]) & s.hash_mask; +//#if MIN_MATCH != 3 +// Call update_hash() MIN_MATCH-3 more times +//#endif + while (s.insert) { + /* UPDATE_HASH(s, s->ins_h, s->window[str + MIN_MATCH-1]); */ + s.ins_h = ((s.ins_h << s.hash_shift) ^ s.window[str + MIN_MATCH-1]) & s.hash_mask; + + s.prev[str & s.w_mask] = s.head[s.ins_h]; + s.head[s.ins_h] = str; + str++; + s.insert--; + if (s.lookahead + s.insert < MIN_MATCH) { + break; + } + } + } + /* If the whole input has less than MIN_MATCH bytes, ins_h is garbage, + * but this is not important since only literal bytes will be emitted. + */ + + } while (s.lookahead < MIN_LOOKAHEAD && s.strm.avail_in !== 0); + + /* If the WIN_INIT bytes after the end of the current data have never been + * written, then zero those bytes in order to avoid memory check reports of + * the use of uninitialized (or uninitialised as Julian writes) bytes by + * the longest match routines. Update the high water mark for the next + * time through here. WIN_INIT is set to MAX_MATCH since the longest match + * routines allow scanning to strstart + MAX_MATCH, ignoring lookahead. + */ +// if (s.high_water < s.window_size) { +// var curr = s.strstart + s.lookahead; +// var init = 0; +// +// if (s.high_water < curr) { +// /* Previous high water mark below current data -- zero WIN_INIT +// * bytes or up to end of window, whichever is less. +// */ +// init = s.window_size - curr; +// if (init > WIN_INIT) +// init = WIN_INIT; +// zmemzero(s->window + curr, (unsigned)init); +// s->high_water = curr + init; +// } +// else if (s->high_water < (ulg)curr + WIN_INIT) { +// /* High water mark at or above current data, but below current data +// * plus WIN_INIT -- zero out to current data plus WIN_INIT, or up +// * to end of window, whichever is less. +// */ +// init = (ulg)curr + WIN_INIT - s->high_water; +// if (init > s->window_size - s->high_water) +// init = s->window_size - s->high_water; +// zmemzero(s->window + s->high_water, (unsigned)init); +// s->high_water += init; +// } +// } +// +// Assert((ulg)s->strstart <= s->window_size - MIN_LOOKAHEAD, +// "not enough room for search"); +} + +/* =========================================================================== + * Copy without compression as much as possible from the input stream, return + * the current block state. + * This function does not insert new strings in the dictionary since + * uncompressible data is probably not useful. This function is used + * only for the level=0 compression option. + * NOTE: this function should be optimized to avoid extra copying from + * window to pending_buf. + */ +function deflate_stored(s, flush) { + /* Stored blocks are limited to 0xffff bytes, pending_buf is limited + * to pending_buf_size, and each stored block has a 5 byte header: + */ + var max_block_size = 0xffff; + + if (max_block_size > s.pending_buf_size - 5) { + max_block_size = s.pending_buf_size - 5; + } + + /* Copy as much as possible from input to output: */ + for (;;) { + /* Fill the window as much as possible: */ + if (s.lookahead <= 1) { + + //Assert(s->strstart < s->w_size+MAX_DIST(s) || + // s->block_start >= (long)s->w_size, "slide too late"); +// if (!(s.strstart < s.w_size + (s.w_size - MIN_LOOKAHEAD) || +// s.block_start >= s.w_size)) { +// throw new Error("slide too late"); +// } + + fill_window(s); + if (s.lookahead === 0 && flush === Z_NO_FLUSH) { + return BS_NEED_MORE; + } + + if (s.lookahead === 0) { + break; + } + /* flush the current block */ + } + //Assert(s->block_start >= 0L, "block gone"); +// if (s.block_start < 0) throw new Error("block gone"); + + s.strstart += s.lookahead; + s.lookahead = 0; + + /* Emit a stored block if pending_buf will be full: */ + var max_start = s.block_start + max_block_size; + + if (s.strstart === 0 || s.strstart >= max_start) { + /* strstart == 0 is possible when wraparound on 16-bit machine */ + s.lookahead = s.strstart - max_start; + s.strstart = max_start; + /*** FLUSH_BLOCK(s, 0); ***/ + flush_block_only(s, false); + if (s.strm.avail_out === 0) { + return BS_NEED_MORE; + } + /***/ + + + } + /* Flush if we may have to slide, otherwise block_start may become + * negative and the data will be gone: + */ + if (s.strstart - s.block_start >= (s.w_size - MIN_LOOKAHEAD)) { + /*** FLUSH_BLOCK(s, 0); ***/ + flush_block_only(s, false); + if (s.strm.avail_out === 0) { + return BS_NEED_MORE; + } + /***/ + } + } + + s.insert = 0; + + if (flush === Z_FINISH) { + /*** FLUSH_BLOCK(s, 1); ***/ + flush_block_only(s, true); + if (s.strm.avail_out === 0) { + return BS_FINISH_STARTED; + } + /***/ + return BS_FINISH_DONE; + } + + if (s.strstart > s.block_start) { + /*** FLUSH_BLOCK(s, 0); ***/ + flush_block_only(s, false); + if (s.strm.avail_out === 0) { + return BS_NEED_MORE; + } + /***/ + } + + return BS_NEED_MORE; +} + +/* =========================================================================== + * Compress as much as possible from the input stream, return the current + * block state. + * This function does not perform lazy evaluation of matches and inserts + * new strings in the dictionary only for unmatched strings or for short + * matches. It is used only for the fast compression options. + */ +function deflate_fast(s, flush) { + var hash_head; /* head of the hash chain */ + var bflush; /* set if current block must be flushed */ + + for (;;) { + /* Make sure that we always have enough lookahead, except + * at the end of the input file. We need MAX_MATCH bytes + * for the next match, plus MIN_MATCH bytes to insert the + * string following the next match. + */ + if (s.lookahead < MIN_LOOKAHEAD) { + fill_window(s); + if (s.lookahead < MIN_LOOKAHEAD && flush === Z_NO_FLUSH) { + return BS_NEED_MORE; + } + if (s.lookahead === 0) { + break; /* flush the current block */ + } + } + + /* Insert the string window[strstart .. strstart+2] in the + * dictionary, and set hash_head to the head of the hash chain: + */ + hash_head = 0/*NIL*/; + if (s.lookahead >= MIN_MATCH) { + /*** INSERT_STRING(s, s.strstart, hash_head); ***/ + s.ins_h = ((s.ins_h << s.hash_shift) ^ s.window[s.strstart + MIN_MATCH - 1]) & s.hash_mask; + hash_head = s.prev[s.strstart & s.w_mask] = s.head[s.ins_h]; + s.head[s.ins_h] = s.strstart; + /***/ + } + + /* Find the longest match, discarding those <= prev_length. + * At this point we have always match_length < MIN_MATCH + */ + if (hash_head !== 0/*NIL*/ && ((s.strstart - hash_head) <= (s.w_size - MIN_LOOKAHEAD))) { + /* To simplify the code, we prevent matches with the string + * of window index 0 (in particular we have to avoid a match + * of the string with itself at the start of the input file). + */ + s.match_length = longest_match(s, hash_head); + /* longest_match() sets match_start */ + } + if (s.match_length >= MIN_MATCH) { + // check_match(s, s.strstart, s.match_start, s.match_length); // for debug only + + /*** _tr_tally_dist(s, s.strstart - s.match_start, + s.match_length - MIN_MATCH, bflush); ***/ + bflush = trees._tr_tally(s, s.strstart - s.match_start, s.match_length - MIN_MATCH); + + s.lookahead -= s.match_length; + + /* Insert new strings in the hash table only if the match length + * is not too large. This saves time but degrades compression. + */ + if (s.match_length <= s.max_lazy_match/*max_insert_length*/ && s.lookahead >= MIN_MATCH) { + s.match_length--; /* string at strstart already in table */ + do { + s.strstart++; + /*** INSERT_STRING(s, s.strstart, hash_head); ***/ + s.ins_h = ((s.ins_h << s.hash_shift) ^ s.window[s.strstart + MIN_MATCH - 1]) & s.hash_mask; + hash_head = s.prev[s.strstart & s.w_mask] = s.head[s.ins_h]; + s.head[s.ins_h] = s.strstart; + /***/ + /* strstart never exceeds WSIZE-MAX_MATCH, so there are + * always MIN_MATCH bytes ahead. + */ + } while (--s.match_length !== 0); + s.strstart++; + } else + { + s.strstart += s.match_length; + s.match_length = 0; + s.ins_h = s.window[s.strstart]; + /* UPDATE_HASH(s, s.ins_h, s.window[s.strstart+1]); */ + s.ins_h = ((s.ins_h << s.hash_shift) ^ s.window[s.strstart + 1]) & s.hash_mask; + +//#if MIN_MATCH != 3 +// Call UPDATE_HASH() MIN_MATCH-3 more times +//#endif + /* If lookahead < MIN_MATCH, ins_h is garbage, but it does not + * matter since it will be recomputed at next deflate call. + */ + } + } else { + /* No match, output a literal byte */ + //Tracevv((stderr,"%c", s.window[s.strstart])); + /*** _tr_tally_lit(s, s.window[s.strstart], bflush); ***/ + bflush = trees._tr_tally(s, 0, s.window[s.strstart]); + + s.lookahead--; + s.strstart++; + } + if (bflush) { + /*** FLUSH_BLOCK(s, 0); ***/ + flush_block_only(s, false); + if (s.strm.avail_out === 0) { + return BS_NEED_MORE; + } + /***/ + } + } + s.insert = ((s.strstart < (MIN_MATCH-1)) ? s.strstart : MIN_MATCH-1); + if (flush === Z_FINISH) { + /*** FLUSH_BLOCK(s, 1); ***/ + flush_block_only(s, true); + if (s.strm.avail_out === 0) { + return BS_FINISH_STARTED; + } + /***/ + return BS_FINISH_DONE; + } + if (s.last_lit) { + /*** FLUSH_BLOCK(s, 0); ***/ + flush_block_only(s, false); + if (s.strm.avail_out === 0) { + return BS_NEED_MORE; + } + /***/ + } + return BS_BLOCK_DONE; +} + +/* =========================================================================== + * Same as above, but achieves better compression. We use a lazy + * evaluation for matches: a match is finally adopted only if there is + * no better match at the next window position. + */ +function deflate_slow(s, flush) { + var hash_head; /* head of hash chain */ + var bflush; /* set if current block must be flushed */ + + var max_insert; + + /* Process the input block. */ + for (;;) { + /* Make sure that we always have enough lookahead, except + * at the end of the input file. We need MAX_MATCH bytes + * for the next match, plus MIN_MATCH bytes to insert the + * string following the next match. + */ + if (s.lookahead < MIN_LOOKAHEAD) { + fill_window(s); + if (s.lookahead < MIN_LOOKAHEAD && flush === Z_NO_FLUSH) { + return BS_NEED_MORE; + } + if (s.lookahead === 0) { break; } /* flush the current block */ + } + + /* Insert the string window[strstart .. strstart+2] in the + * dictionary, and set hash_head to the head of the hash chain: + */ + hash_head = 0/*NIL*/; + if (s.lookahead >= MIN_MATCH) { + /*** INSERT_STRING(s, s.strstart, hash_head); ***/ + s.ins_h = ((s.ins_h << s.hash_shift) ^ s.window[s.strstart + MIN_MATCH - 1]) & s.hash_mask; + hash_head = s.prev[s.strstart & s.w_mask] = s.head[s.ins_h]; + s.head[s.ins_h] = s.strstart; + /***/ + } + + /* Find the longest match, discarding those <= prev_length. + */ + s.prev_length = s.match_length; + s.prev_match = s.match_start; + s.match_length = MIN_MATCH-1; + + if (hash_head !== 0/*NIL*/ && s.prev_length < s.max_lazy_match && + s.strstart - hash_head <= (s.w_size-MIN_LOOKAHEAD)/*MAX_DIST(s)*/) { + /* To simplify the code, we prevent matches with the string + * of window index 0 (in particular we have to avoid a match + * of the string with itself at the start of the input file). + */ + s.match_length = longest_match(s, hash_head); + /* longest_match() sets match_start */ + + if (s.match_length <= 5 && + (s.strategy === Z_FILTERED || (s.match_length === MIN_MATCH && s.strstart - s.match_start > 4096/*TOO_FAR*/))) { + + /* If prev_match is also MIN_MATCH, match_start is garbage + * but we will ignore the current match anyway. + */ + s.match_length = MIN_MATCH-1; + } + } + /* If there was a match at the previous step and the current + * match is not better, output the previous match: + */ + if (s.prev_length >= MIN_MATCH && s.match_length <= s.prev_length) { + max_insert = s.strstart + s.lookahead - MIN_MATCH; + /* Do not insert strings in hash table beyond this. */ + + //check_match(s, s.strstart-1, s.prev_match, s.prev_length); + + /***_tr_tally_dist(s, s.strstart - 1 - s.prev_match, + s.prev_length - MIN_MATCH, bflush);***/ + bflush = trees._tr_tally(s, s.strstart - 1- s.prev_match, s.prev_length - MIN_MATCH); + /* Insert in hash table all strings up to the end of the match. + * strstart-1 and strstart are already inserted. If there is not + * enough lookahead, the last two strings are not inserted in + * the hash table. + */ + s.lookahead -= s.prev_length-1; + s.prev_length -= 2; + do { + if (++s.strstart <= max_insert) { + /*** INSERT_STRING(s, s.strstart, hash_head); ***/ + s.ins_h = ((s.ins_h << s.hash_shift) ^ s.window[s.strstart + MIN_MATCH - 1]) & s.hash_mask; + hash_head = s.prev[s.strstart & s.w_mask] = s.head[s.ins_h]; + s.head[s.ins_h] = s.strstart; + /***/ + } + } while (--s.prev_length !== 0); + s.match_available = 0; + s.match_length = MIN_MATCH-1; + s.strstart++; + + if (bflush) { + /*** FLUSH_BLOCK(s, 0); ***/ + flush_block_only(s, false); + if (s.strm.avail_out === 0) { + return BS_NEED_MORE; + } + /***/ + } + + } else if (s.match_available) { + /* If there was no match at the previous position, output a + * single literal. If there was a match but the current match + * is longer, truncate the previous match to a single literal. + */ + //Tracevv((stderr,"%c", s->window[s->strstart-1])); + /*** _tr_tally_lit(s, s.window[s.strstart-1], bflush); ***/ + bflush = trees._tr_tally(s, 0, s.window[s.strstart-1]); + + if (bflush) { + /*** FLUSH_BLOCK_ONLY(s, 0) ***/ + flush_block_only(s, false); + /***/ + } + s.strstart++; + s.lookahead--; + if (s.strm.avail_out === 0) { + return BS_NEED_MORE; + } + } else { + /* There is no previous match to compare with, wait for + * the next step to decide. + */ + s.match_available = 1; + s.strstart++; + s.lookahead--; + } + } + //Assert (flush != Z_NO_FLUSH, "no flush?"); + if (s.match_available) { + //Tracevv((stderr,"%c", s->window[s->strstart-1])); + /*** _tr_tally_lit(s, s.window[s.strstart-1], bflush); ***/ + bflush = trees._tr_tally(s, 0, s.window[s.strstart-1]); + + s.match_available = 0; + } + s.insert = s.strstart < MIN_MATCH-1 ? s.strstart : MIN_MATCH-1; + if (flush === Z_FINISH) { + /*** FLUSH_BLOCK(s, 1); ***/ + flush_block_only(s, true); + if (s.strm.avail_out === 0) { + return BS_FINISH_STARTED; + } + /***/ + return BS_FINISH_DONE; + } + if (s.last_lit) { + /*** FLUSH_BLOCK(s, 0); ***/ + flush_block_only(s, false); + if (s.strm.avail_out === 0) { + return BS_NEED_MORE; + } + /***/ + } + + return BS_BLOCK_DONE; +} + + +/* =========================================================================== + * For Z_RLE, simply look for runs of bytes, generate matches only of distance + * one. Do not maintain a hash table. (It will be regenerated if this run of + * deflate switches away from Z_RLE.) + */ +function deflate_rle(s, flush) { + var bflush; /* set if current block must be flushed */ + var prev; /* byte at distance one to match */ + var scan, strend; /* scan goes up to strend for length of run */ + + var _win = s.window; + + for (;;) { + /* Make sure that we always have enough lookahead, except + * at the end of the input file. We need MAX_MATCH bytes + * for the longest run, plus one for the unrolled loop. + */ + if (s.lookahead <= MAX_MATCH) { + fill_window(s); + if (s.lookahead <= MAX_MATCH && flush === Z_NO_FLUSH) { + return BS_NEED_MORE; + } + if (s.lookahead === 0) { break; } /* flush the current block */ + } + + /* See how many times the previous byte repeats */ + s.match_length = 0; + if (s.lookahead >= MIN_MATCH && s.strstart > 0) { + scan = s.strstart - 1; + prev = _win[scan]; + if (prev === _win[++scan] && prev === _win[++scan] && prev === _win[++scan]) { + strend = s.strstart + MAX_MATCH; + do { + /*jshint noempty:false*/ + } while (prev === _win[++scan] && prev === _win[++scan] && + prev === _win[++scan] && prev === _win[++scan] && + prev === _win[++scan] && prev === _win[++scan] && + prev === _win[++scan] && prev === _win[++scan] && + scan < strend); + s.match_length = MAX_MATCH - (strend - scan); + if (s.match_length > s.lookahead) { + s.match_length = s.lookahead; + } + } + //Assert(scan <= s->window+(uInt)(s->window_size-1), "wild scan"); + } + + /* Emit match if have run of MIN_MATCH or longer, else emit literal */ + if (s.match_length >= MIN_MATCH) { + //check_match(s, s.strstart, s.strstart - 1, s.match_length); + + /*** _tr_tally_dist(s, 1, s.match_length - MIN_MATCH, bflush); ***/ + bflush = trees._tr_tally(s, 1, s.match_length - MIN_MATCH); + + s.lookahead -= s.match_length; + s.strstart += s.match_length; + s.match_length = 0; + } else { + /* No match, output a literal byte */ + //Tracevv((stderr,"%c", s->window[s->strstart])); + /*** _tr_tally_lit(s, s.window[s.strstart], bflush); ***/ + bflush = trees._tr_tally(s, 0, s.window[s.strstart]); + + s.lookahead--; + s.strstart++; + } + if (bflush) { + /*** FLUSH_BLOCK(s, 0); ***/ + flush_block_only(s, false); + if (s.strm.avail_out === 0) { + return BS_NEED_MORE; + } + /***/ + } + } + s.insert = 0; + if (flush === Z_FINISH) { + /*** FLUSH_BLOCK(s, 1); ***/ + flush_block_only(s, true); + if (s.strm.avail_out === 0) { + return BS_FINISH_STARTED; + } + /***/ + return BS_FINISH_DONE; + } + if (s.last_lit) { + /*** FLUSH_BLOCK(s, 0); ***/ + flush_block_only(s, false); + if (s.strm.avail_out === 0) { + return BS_NEED_MORE; + } + /***/ + } + return BS_BLOCK_DONE; +} + +/* =========================================================================== + * For Z_HUFFMAN_ONLY, do not look for matches. Do not maintain a hash table. + * (It will be regenerated if this run of deflate switches away from Huffman.) + */ +function deflate_huff(s, flush) { + var bflush; /* set if current block must be flushed */ + + for (;;) { + /* Make sure that we have a literal to write. */ + if (s.lookahead === 0) { + fill_window(s); + if (s.lookahead === 0) { + if (flush === Z_NO_FLUSH) { + return BS_NEED_MORE; + } + break; /* flush the current block */ + } + } + + /* Output a literal byte */ + s.match_length = 0; + //Tracevv((stderr,"%c", s->window[s->strstart])); + /*** _tr_tally_lit(s, s.window[s.strstart], bflush); ***/ + bflush = trees._tr_tally(s, 0, s.window[s.strstart]); + s.lookahead--; + s.strstart++; + if (bflush) { + /*** FLUSH_BLOCK(s, 0); ***/ + flush_block_only(s, false); + if (s.strm.avail_out === 0) { + return BS_NEED_MORE; + } + /***/ + } + } + s.insert = 0; + if (flush === Z_FINISH) { + /*** FLUSH_BLOCK(s, 1); ***/ + flush_block_only(s, true); + if (s.strm.avail_out === 0) { + return BS_FINISH_STARTED; + } + /***/ + return BS_FINISH_DONE; + } + if (s.last_lit) { + /*** FLUSH_BLOCK(s, 0); ***/ + flush_block_only(s, false); + if (s.strm.avail_out === 0) { + return BS_NEED_MORE; + } + /***/ + } + return BS_BLOCK_DONE; +} + +/* Values for max_lazy_match, good_match and max_chain_length, depending on + * the desired pack level (0..9). The values given below have been tuned to + * exclude worst case performance for pathological files. Better values may be + * found for specific files. + */ +var Config = function (good_length, max_lazy, nice_length, max_chain, func) { + this.good_length = good_length; + this.max_lazy = max_lazy; + this.nice_length = nice_length; + this.max_chain = max_chain; + this.func = func; +}; + +var configuration_table; + +configuration_table = [ + /* good lazy nice chain */ + new Config(0, 0, 0, 0, deflate_stored), /* 0 store only */ + new Config(4, 4, 8, 4, deflate_fast), /* 1 max speed, no lazy matches */ + new Config(4, 5, 16, 8, deflate_fast), /* 2 */ + new Config(4, 6, 32, 32, deflate_fast), /* 3 */ + + new Config(4, 4, 16, 16, deflate_slow), /* 4 lazy matches */ + new Config(8, 16, 32, 32, deflate_slow), /* 5 */ + new Config(8, 16, 128, 128, deflate_slow), /* 6 */ + new Config(8, 32, 128, 256, deflate_slow), /* 7 */ + new Config(32, 128, 258, 1024, deflate_slow), /* 8 */ + new Config(32, 258, 258, 4096, deflate_slow) /* 9 max compression */ +]; + + +/* =========================================================================== + * Initialize the "longest match" routines for a new zlib stream + */ +function lm_init(s) { + s.window_size = 2 * s.w_size; + + /*** CLEAR_HASH(s); ***/ + zero(s.head); // Fill with NIL (= 0); + + /* Set the default configuration parameters: + */ + s.max_lazy_match = configuration_table[s.level].max_lazy; + s.good_match = configuration_table[s.level].good_length; + s.nice_match = configuration_table[s.level].nice_length; + s.max_chain_length = configuration_table[s.level].max_chain; + + s.strstart = 0; + s.block_start = 0; + s.lookahead = 0; + s.insert = 0; + s.match_length = s.prev_length = MIN_MATCH - 1; + s.match_available = 0; + s.ins_h = 0; +} + + +function DeflateState() { + this.strm = null; /* pointer back to this zlib stream */ + this.status = 0; /* as the name implies */ + this.pending_buf = null; /* output still pending */ + this.pending_buf_size = 0; /* size of pending_buf */ + this.pending_out = 0; /* next pending byte to output to the stream */ + this.pending = 0; /* nb of bytes in the pending buffer */ + this.wrap = 0; /* bit 0 true for zlib, bit 1 true for gzip */ + this.gzhead = null; /* gzip header information to write */ + this.gzindex = 0; /* where in extra, name, or comment */ + this.method = Z_DEFLATED; /* can only be DEFLATED */ + this.last_flush = -1; /* value of flush param for previous deflate call */ + + this.w_size = 0; /* LZ77 window size (32K by default) */ + this.w_bits = 0; /* log2(w_size) (8..16) */ + this.w_mask = 0; /* w_size - 1 */ + + this.window = null; + /* Sliding window. Input bytes are read into the second half of the window, + * and move to the first half later to keep a dictionary of at least wSize + * bytes. With this organization, matches are limited to a distance of + * wSize-MAX_MATCH bytes, but this ensures that IO is always + * performed with a length multiple of the block size. + */ + + this.window_size = 0; + /* Actual size of window: 2*wSize, except when the user input buffer + * is directly used as sliding window. + */ + + this.prev = null; + /* Link to older string with same hash index. To limit the size of this + * array to 64K, this link is maintained only for the last 32K strings. + * An index in this array is thus a window index modulo 32K. + */ + + this.head = null; /* Heads of the hash chains or NIL. */ + + this.ins_h = 0; /* hash index of string to be inserted */ + this.hash_size = 0; /* number of elements in hash table */ + this.hash_bits = 0; /* log2(hash_size) */ + this.hash_mask = 0; /* hash_size-1 */ + + this.hash_shift = 0; + /* Number of bits by which ins_h must be shifted at each input + * step. It must be such that after MIN_MATCH steps, the oldest + * byte no longer takes part in the hash key, that is: + * hash_shift * MIN_MATCH >= hash_bits + */ + + this.block_start = 0; + /* Window position at the beginning of the current output block. Gets + * negative when the window is moved backwards. + */ + + this.match_length = 0; /* length of best match */ + this.prev_match = 0; /* previous match */ + this.match_available = 0; /* set if previous match exists */ + this.strstart = 0; /* start of string to insert */ + this.match_start = 0; /* start of matching string */ + this.lookahead = 0; /* number of valid bytes ahead in window */ + + this.prev_length = 0; + /* Length of the best match at previous step. Matches not greater than this + * are discarded. This is used in the lazy match evaluation. + */ + + this.max_chain_length = 0; + /* To speed up deflation, hash chains are never searched beyond this + * length. A higher limit improves compression ratio but degrades the + * speed. + */ + + this.max_lazy_match = 0; + /* Attempt to find a better match only when the current match is strictly + * smaller than this value. This mechanism is used only for compression + * levels >= 4. + */ + // That's alias to max_lazy_match, don't use directly + //this.max_insert_length = 0; + /* Insert new strings in the hash table only if the match length is not + * greater than this length. This saves time but degrades compression. + * max_insert_length is used only for compression levels <= 3. + */ + + this.level = 0; /* compression level (1..9) */ + this.strategy = 0; /* favor or force Huffman coding*/ + + this.good_match = 0; + /* Use a faster search when the previous match is longer than this */ + + this.nice_match = 0; /* Stop searching when current match exceeds this */ + + /* used by trees.c: */ + + /* Didn't use ct_data typedef below to suppress compiler warning */ + + // struct ct_data_s dyn_ltree[HEAP_SIZE]; /* literal and length tree */ + // struct ct_data_s dyn_dtree[2*D_CODES+1]; /* distance tree */ + // struct ct_data_s bl_tree[2*BL_CODES+1]; /* Huffman tree for bit lengths */ + + // Use flat array of DOUBLE size, with interleaved fata, + // because JS does not support effective + this.dyn_ltree = new utils.Buf16(HEAP_SIZE * 2); + this.dyn_dtree = new utils.Buf16((2*D_CODES+1) * 2); + this.bl_tree = new utils.Buf16((2*BL_CODES+1) * 2); + zero(this.dyn_ltree); + zero(this.dyn_dtree); + zero(this.bl_tree); + + this.l_desc = null; /* desc. for literal tree */ + this.d_desc = null; /* desc. for distance tree */ + this.bl_desc = null; /* desc. for bit length tree */ + + //ush bl_count[MAX_BITS+1]; + this.bl_count = new utils.Buf16(MAX_BITS+1); + /* number of codes at each bit length for an optimal tree */ + + //int heap[2*L_CODES+1]; /* heap used to build the Huffman trees */ + this.heap = new utils.Buf16(2*L_CODES+1); /* heap used to build the Huffman trees */ + zero(this.heap); + + this.heap_len = 0; /* number of elements in the heap */ + this.heap_max = 0; /* element of largest frequency */ + /* The sons of heap[n] are heap[2*n] and heap[2*n+1]. heap[0] is not used. + * The same heap array is used to build all trees. + */ + + this.depth = new utils.Buf16(2*L_CODES+1); //uch depth[2*L_CODES+1]; + zero(this.depth); + /* Depth of each subtree used as tie breaker for trees of equal frequency + */ + + this.l_buf = 0; /* buffer index for literals or lengths */ + + this.lit_bufsize = 0; + /* Size of match buffer for literals/lengths. There are 4 reasons for + * limiting lit_bufsize to 64K: + * - frequencies can be kept in 16 bit counters + * - if compression is not successful for the first block, all input + * data is still in the window so we can still emit a stored block even + * when input comes from standard input. (This can also be done for + * all blocks if lit_bufsize is not greater than 32K.) + * - if compression is not successful for a file smaller than 64K, we can + * even emit a stored file instead of a stored block (saving 5 bytes). + * This is applicable only for zip (not gzip or zlib). + * - creating new Huffman trees less frequently may not provide fast + * adaptation to changes in the input data statistics. (Take for + * example a binary file with poorly compressible code followed by + * a highly compressible string table.) Smaller buffer sizes give + * fast adaptation but have of course the overhead of transmitting + * trees more frequently. + * - I can't count above 4 + */ + + this.last_lit = 0; /* running index in l_buf */ + + this.d_buf = 0; + /* Buffer index for distances. To simplify the code, d_buf and l_buf have + * the same number of elements. To use different lengths, an extra flag + * array would be necessary. + */ + + this.opt_len = 0; /* bit length of current block with optimal trees */ + this.static_len = 0; /* bit length of current block with static trees */ + this.matches = 0; /* number of string matches in current block */ + this.insert = 0; /* bytes at end of window left to insert */ + + + this.bi_buf = 0; + /* Output buffer. bits are inserted starting at the bottom (least + * significant bits). + */ + this.bi_valid = 0; + /* Number of valid bits in bi_buf. All bits above the last valid bit + * are always zero. + */ + + // Used for window memory init. We safely ignore it for JS. That makes + // sense only for pointers and memory check tools. + //this.high_water = 0; + /* High water mark offset in window for initialized bytes -- bytes above + * this are set to zero in order to avoid memory check warnings when + * longest match routines access bytes past the input. This is then + * updated to the new high water mark. + */ +} + + +function deflateResetKeep(strm) { + var s; + + if (!strm || !strm.state) { + return err(strm, Z_STREAM_ERROR); + } + + strm.total_in = strm.total_out = 0; + strm.data_type = Z_UNKNOWN; + + s = strm.state; + s.pending = 0; + s.pending_out = 0; + + if (s.wrap < 0) { + s.wrap = -s.wrap; + /* was made negative by deflate(..., Z_FINISH); */ + } + s.status = (s.wrap ? INIT_STATE : BUSY_STATE); + strm.adler = (s.wrap === 2) ? + 0 // crc32(0, Z_NULL, 0) + : + 1; // adler32(0, Z_NULL, 0) + s.last_flush = Z_NO_FLUSH; + trees._tr_init(s); + return Z_OK; +} + + +function deflateReset(strm) { + var ret = deflateResetKeep(strm); + if (ret === Z_OK) { + lm_init(strm.state); + } + return ret; +} + + +function deflateSetHeader(strm, head) { + if (!strm || !strm.state) { return Z_STREAM_ERROR; } + if (strm.state.wrap !== 2) { return Z_STREAM_ERROR; } + strm.state.gzhead = head; + return Z_OK; +} + + +function deflateInit2(strm, level, method, windowBits, memLevel, strategy) { + if (!strm) { // === Z_NULL + return Z_STREAM_ERROR; + } + var wrap = 1; + + if (level === Z_DEFAULT_COMPRESSION) { + level = 6; + } + + if (windowBits < 0) { /* suppress zlib wrapper */ + wrap = 0; + windowBits = -windowBits; + } + + else if (windowBits > 15) { + wrap = 2; /* write gzip wrapper instead */ + windowBits -= 16; + } + + + if (memLevel < 1 || memLevel > MAX_MEM_LEVEL || method !== Z_DEFLATED || + windowBits < 8 || windowBits > 15 || level < 0 || level > 9 || + strategy < 0 || strategy > Z_FIXED) { + return err(strm, Z_STREAM_ERROR); + } + + + if (windowBits === 8) { + windowBits = 9; + } + /* until 256-byte window bug fixed */ + + var s = new DeflateState(); + + strm.state = s; + s.strm = strm; + + s.wrap = wrap; + s.gzhead = null; + s.w_bits = windowBits; + s.w_size = 1 << s.w_bits; + s.w_mask = s.w_size - 1; + + s.hash_bits = memLevel + 7; + s.hash_size = 1 << s.hash_bits; + s.hash_mask = s.hash_size - 1; + s.hash_shift = ~~((s.hash_bits + MIN_MATCH - 1) / MIN_MATCH); + + s.window = new utils.Buf8(s.w_size * 2); + s.head = new utils.Buf16(s.hash_size); + s.prev = new utils.Buf16(s.w_size); + + // Don't need mem init magic for JS. + //s.high_water = 0; /* nothing written to s->window yet */ + + s.lit_bufsize = 1 << (memLevel + 6); /* 16K elements by default */ + + s.pending_buf_size = s.lit_bufsize * 4; + s.pending_buf = new utils.Buf8(s.pending_buf_size); + + s.d_buf = s.lit_bufsize >> 1; + s.l_buf = (1 + 2) * s.lit_bufsize; + + s.level = level; + s.strategy = strategy; + s.method = method; + + return deflateReset(strm); +} + +function deflateInit(strm, level) { + return deflateInit2(strm, level, Z_DEFLATED, MAX_WBITS, DEF_MEM_LEVEL, Z_DEFAULT_STRATEGY); +} + + +function deflate(strm, flush) { + var old_flush, s; + var beg, val; // for gzip header write only + + if (!strm || !strm.state || + flush > Z_BLOCK || flush < 0) { + return strm ? err(strm, Z_STREAM_ERROR) : Z_STREAM_ERROR; + } + + s = strm.state; + + if (!strm.output || + (!strm.input && strm.avail_in !== 0) || + (s.status === FINISH_STATE && flush !== Z_FINISH)) { + return err(strm, (strm.avail_out === 0) ? Z_BUF_ERROR : Z_STREAM_ERROR); + } + + s.strm = strm; /* just in case */ + old_flush = s.last_flush; + s.last_flush = flush; + + /* Write the header */ + if (s.status === INIT_STATE) { + + if (s.wrap === 2) { // GZIP header + strm.adler = 0; //crc32(0L, Z_NULL, 0); + put_byte(s, 31); + put_byte(s, 139); + put_byte(s, 8); + if (!s.gzhead) { // s->gzhead == Z_NULL + put_byte(s, 0); + put_byte(s, 0); + put_byte(s, 0); + put_byte(s, 0); + put_byte(s, 0); + put_byte(s, s.level === 9 ? 2 : + (s.strategy >= Z_HUFFMAN_ONLY || s.level < 2 ? + 4 : 0)); + put_byte(s, OS_CODE); + s.status = BUSY_STATE; + } + else { + put_byte(s, (s.gzhead.text ? 1 : 0) + + (s.gzhead.hcrc ? 2 : 0) + + (!s.gzhead.extra ? 0 : 4) + + (!s.gzhead.name ? 0 : 8) + + (!s.gzhead.comment ? 0 : 16) + ); + put_byte(s, s.gzhead.time & 0xff); + put_byte(s, (s.gzhead.time >> 8) & 0xff); + put_byte(s, (s.gzhead.time >> 16) & 0xff); + put_byte(s, (s.gzhead.time >> 24) & 0xff); + put_byte(s, s.level === 9 ? 2 : + (s.strategy >= Z_HUFFMAN_ONLY || s.level < 2 ? + 4 : 0)); + put_byte(s, s.gzhead.os & 0xff); + if (s.gzhead.extra && s.gzhead.extra.length) { + put_byte(s, s.gzhead.extra.length & 0xff); + put_byte(s, (s.gzhead.extra.length >> 8) & 0xff); + } + if (s.gzhead.hcrc) { + strm.adler = crc32(strm.adler, s.pending_buf, s.pending, 0); + } + s.gzindex = 0; + s.status = EXTRA_STATE; + } + } + else // DEFLATE header + { + var header = (Z_DEFLATED + ((s.w_bits - 8) << 4)) << 8; + var level_flags = -1; + + if (s.strategy >= Z_HUFFMAN_ONLY || s.level < 2) { + level_flags = 0; + } else if (s.level < 6) { + level_flags = 1; + } else if (s.level === 6) { + level_flags = 2; + } else { + level_flags = 3; + } + header |= (level_flags << 6); + if (s.strstart !== 0) { header |= PRESET_DICT; } + header += 31 - (header % 31); + + s.status = BUSY_STATE; + putShortMSB(s, header); + + /* Save the adler32 of the preset dictionary: */ + if (s.strstart !== 0) { + putShortMSB(s, strm.adler >>> 16); + putShortMSB(s, strm.adler & 0xffff); + } + strm.adler = 1; // adler32(0L, Z_NULL, 0); + } + } + +//#ifdef GZIP + if (s.status === EXTRA_STATE) { + if (s.gzhead.extra/* != Z_NULL*/) { + beg = s.pending; /* start of bytes to update crc */ + + while (s.gzindex < (s.gzhead.extra.length & 0xffff)) { + if (s.pending === s.pending_buf_size) { + if (s.gzhead.hcrc && s.pending > beg) { + strm.adler = crc32(strm.adler, s.pending_buf, s.pending - beg, beg); + } + flush_pending(strm); + beg = s.pending; + if (s.pending === s.pending_buf_size) { + break; + } + } + put_byte(s, s.gzhead.extra[s.gzindex] & 0xff); + s.gzindex++; + } + if (s.gzhead.hcrc && s.pending > beg) { + strm.adler = crc32(strm.adler, s.pending_buf, s.pending - beg, beg); + } + if (s.gzindex === s.gzhead.extra.length) { + s.gzindex = 0; + s.status = NAME_STATE; + } + } + else { + s.status = NAME_STATE; + } + } + if (s.status === NAME_STATE) { + if (s.gzhead.name/* != Z_NULL*/) { + beg = s.pending; /* start of bytes to update crc */ + //int val; + + do { + if (s.pending === s.pending_buf_size) { + if (s.gzhead.hcrc && s.pending > beg) { + strm.adler = crc32(strm.adler, s.pending_buf, s.pending - beg, beg); + } + flush_pending(strm); + beg = s.pending; + if (s.pending === s.pending_buf_size) { + val = 1; + break; + } + } + // JS specific: little magic to add zero terminator to end of string + if (s.gzindex < s.gzhead.name.length) { + val = s.gzhead.name.charCodeAt(s.gzindex++) & 0xff; + } else { + val = 0; + } + put_byte(s, val); + } while (val !== 0); + + if (s.gzhead.hcrc && s.pending > beg){ + strm.adler = crc32(strm.adler, s.pending_buf, s.pending - beg, beg); + } + if (val === 0) { + s.gzindex = 0; + s.status = COMMENT_STATE; + } + } + else { + s.status = COMMENT_STATE; + } + } + if (s.status === COMMENT_STATE) { + if (s.gzhead.comment/* != Z_NULL*/) { + beg = s.pending; /* start of bytes to update crc */ + //int val; + + do { + if (s.pending === s.pending_buf_size) { + if (s.gzhead.hcrc && s.pending > beg) { + strm.adler = crc32(strm.adler, s.pending_buf, s.pending - beg, beg); + } + flush_pending(strm); + beg = s.pending; + if (s.pending === s.pending_buf_size) { + val = 1; + break; + } + } + // JS specific: little magic to add zero terminator to end of string + if (s.gzindex < s.gzhead.comment.length) { + val = s.gzhead.comment.charCodeAt(s.gzindex++) & 0xff; + } else { + val = 0; + } + put_byte(s, val); + } while (val !== 0); + + if (s.gzhead.hcrc && s.pending > beg) { + strm.adler = crc32(strm.adler, s.pending_buf, s.pending - beg, beg); + } + if (val === 0) { + s.status = HCRC_STATE; + } + } + else { + s.status = HCRC_STATE; + } + } + if (s.status === HCRC_STATE) { + if (s.gzhead.hcrc) { + if (s.pending + 2 > s.pending_buf_size) { + flush_pending(strm); + } + if (s.pending + 2 <= s.pending_buf_size) { + put_byte(s, strm.adler & 0xff); + put_byte(s, (strm.adler >> 8) & 0xff); + strm.adler = 0; //crc32(0L, Z_NULL, 0); + s.status = BUSY_STATE; + } + } + else { + s.status = BUSY_STATE; + } + } +//#endif + + /* Flush as much pending output as possible */ + if (s.pending !== 0) { + flush_pending(strm); + if (strm.avail_out === 0) { + /* Since avail_out is 0, deflate will be called again with + * more output space, but possibly with both pending and + * avail_in equal to zero. There won't be anything to do, + * but this is not an error situation so make sure we + * return OK instead of BUF_ERROR at next call of deflate: + */ + s.last_flush = -1; + return Z_OK; + } + + /* Make sure there is something to do and avoid duplicate consecutive + * flushes. For repeated and useless calls with Z_FINISH, we keep + * returning Z_STREAM_END instead of Z_BUF_ERROR. + */ + } else if (strm.avail_in === 0 && rank(flush) <= rank(old_flush) && + flush !== Z_FINISH) { + return err(strm, Z_BUF_ERROR); + } + + /* User must not provide more input after the first FINISH: */ + if (s.status === FINISH_STATE && strm.avail_in !== 0) { + return err(strm, Z_BUF_ERROR); + } + + /* Start a new block or continue the current one. + */ + if (strm.avail_in !== 0 || s.lookahead !== 0 || + (flush !== Z_NO_FLUSH && s.status !== FINISH_STATE)) { + var bstate = (s.strategy === Z_HUFFMAN_ONLY) ? deflate_huff(s, flush) : + (s.strategy === Z_RLE ? deflate_rle(s, flush) : + configuration_table[s.level].func(s, flush)); + + if (bstate === BS_FINISH_STARTED || bstate === BS_FINISH_DONE) { + s.status = FINISH_STATE; + } + if (bstate === BS_NEED_MORE || bstate === BS_FINISH_STARTED) { + if (strm.avail_out === 0) { + s.last_flush = -1; + /* avoid BUF_ERROR next call, see above */ + } + return Z_OK; + /* If flush != Z_NO_FLUSH && avail_out == 0, the next call + * of deflate should use the same flush parameter to make sure + * that the flush is complete. So we don't have to output an + * empty block here, this will be done at next call. This also + * ensures that for a very small output buffer, we emit at most + * one empty block. + */ + } + if (bstate === BS_BLOCK_DONE) { + if (flush === Z_PARTIAL_FLUSH) { + trees._tr_align(s); + } + else if (flush !== Z_BLOCK) { /* FULL_FLUSH or SYNC_FLUSH */ + + trees._tr_stored_block(s, 0, 0, false); + /* For a full flush, this empty block will be recognized + * as a special marker by inflate_sync(). + */ + if (flush === Z_FULL_FLUSH) { + /*** CLEAR_HASH(s); ***/ /* forget history */ + zero(s.head); // Fill with NIL (= 0); + + if (s.lookahead === 0) { + s.strstart = 0; + s.block_start = 0; + s.insert = 0; + } + } + } + flush_pending(strm); + if (strm.avail_out === 0) { + s.last_flush = -1; /* avoid BUF_ERROR at next call, see above */ + return Z_OK; + } + } + } + //Assert(strm->avail_out > 0, "bug2"); + //if (strm.avail_out <= 0) { throw new Error("bug2");} + + if (flush !== Z_FINISH) { return Z_OK; } + if (s.wrap <= 0) { return Z_STREAM_END; } + + /* Write the trailer */ + if (s.wrap === 2) { + put_byte(s, strm.adler & 0xff); + put_byte(s, (strm.adler >> 8) & 0xff); + put_byte(s, (strm.adler >> 16) & 0xff); + put_byte(s, (strm.adler >> 24) & 0xff); + put_byte(s, strm.total_in & 0xff); + put_byte(s, (strm.total_in >> 8) & 0xff); + put_byte(s, (strm.total_in >> 16) & 0xff); + put_byte(s, (strm.total_in >> 24) & 0xff); + } + else + { + putShortMSB(s, strm.adler >>> 16); + putShortMSB(s, strm.adler & 0xffff); + } + + flush_pending(strm); + /* If avail_out is zero, the application will call deflate again + * to flush the rest. + */ + if (s.wrap > 0) { s.wrap = -s.wrap; } + /* write the trailer only once! */ + return s.pending !== 0 ? Z_OK : Z_STREAM_END; +} + +function deflateEnd(strm) { + var status; + + if (!strm/*== Z_NULL*/ || !strm.state/*== Z_NULL*/) { + return Z_STREAM_ERROR; + } + + status = strm.state.status; + if (status !== INIT_STATE && + status !== EXTRA_STATE && + status !== NAME_STATE && + status !== COMMENT_STATE && + status !== HCRC_STATE && + status !== BUSY_STATE && + status !== FINISH_STATE + ) { + return err(strm, Z_STREAM_ERROR); + } + + strm.state = null; + + return status === BUSY_STATE ? err(strm, Z_DATA_ERROR) : Z_OK; +} + +/* ========================================================================= + * Copy the source state to the destination state + */ +//function deflateCopy(dest, source) { +// +//} + +exports.deflateInit = deflateInit; +exports.deflateInit2 = deflateInit2; +exports.deflateReset = deflateReset; +exports.deflateResetKeep = deflateResetKeep; +exports.deflateSetHeader = deflateSetHeader; +exports.deflate = deflate; +exports.deflateEnd = deflateEnd; +exports.deflateInfo = 'pako deflate (from Nodeca project)'; + +/* Not implemented +exports.deflateBound = deflateBound; +exports.deflateCopy = deflateCopy; +exports.deflateSetDictionary = deflateSetDictionary; +exports.deflateParams = deflateParams; +exports.deflatePending = deflatePending; +exports.deflatePrime = deflatePrime; +exports.deflateTune = deflateTune; +*/ +},{"../utils/common":27,"./adler32":29,"./crc32":31,"./messages":37,"./trees":38}],33:[function(_dereq_,module,exports){ +'use strict'; + + +function GZheader() { + /* true if compressed data believed to be text */ + this.text = 0; + /* modification time */ + this.time = 0; + /* extra flags (not used when writing a gzip file) */ + this.xflags = 0; + /* operating system */ + this.os = 0; + /* pointer to extra field or Z_NULL if none */ + this.extra = null; + /* extra field length (valid if extra != Z_NULL) */ + this.extra_len = 0; // Actually, we don't need it in JS, + // but leave for few code modifications + + // + // Setup limits is not necessary because in js we should not preallocate memory + // for inflate use constant limit in 65536 bytes + // + + /* space at extra (only when reading header) */ + // this.extra_max = 0; + /* pointer to zero-terminated file name or Z_NULL */ + this.name = ''; + /* space at name (only when reading header) */ + // this.name_max = 0; + /* pointer to zero-terminated comment or Z_NULL */ + this.comment = ''; + /* space at comment (only when reading header) */ + // this.comm_max = 0; + /* true if there was or will be a header crc */ + this.hcrc = 0; + /* true when done reading gzip header (not used when writing a gzip file) */ + this.done = false; +} + +module.exports = GZheader; +},{}],34:[function(_dereq_,module,exports){ +'use strict'; + +// See state defs from inflate.js +var BAD = 30; /* got a data error -- remain here until reset */ +var TYPE = 12; /* i: waiting for type bits, including last-flag bit */ + +/* + Decode literal, length, and distance codes and write out the resulting + literal and match bytes until either not enough input or output is + available, an end-of-block is encountered, or a data error is encountered. + When large enough input and output buffers are supplied to inflate(), for + example, a 16K input buffer and a 64K output buffer, more than 95% of the + inflate execution time is spent in this routine. + + Entry assumptions: + + state.mode === LEN + strm.avail_in >= 6 + strm.avail_out >= 258 + start >= strm.avail_out + state.bits < 8 + + On return, state.mode is one of: + + LEN -- ran out of enough output space or enough available input + TYPE -- reached end of block code, inflate() to interpret next block + BAD -- error in block data + + Notes: + + - The maximum input bits used by a length/distance pair is 15 bits for the + length code, 5 bits for the length extra, 15 bits for the distance code, + and 13 bits for the distance extra. This totals 48 bits, or six bytes. + Therefore if strm.avail_in >= 6, then there is enough input to avoid + checking for available input while decoding. + + - The maximum bytes that a single length/distance pair can output is 258 + bytes, which is the maximum length that can be coded. inflate_fast() + requires strm.avail_out >= 258 for each loop to avoid checking for + output space. + */ +module.exports = function inflate_fast(strm, start) { + var state; + var _in; /* local strm.input */ + var last; /* have enough input while in < last */ + var _out; /* local strm.output */ + var beg; /* inflate()'s initial strm.output */ + var end; /* while out < end, enough space available */ +//#ifdef INFLATE_STRICT + var dmax; /* maximum distance from zlib header */ +//#endif + var wsize; /* window size or zero if not using window */ + var whave; /* valid bytes in the window */ + var wnext; /* window write index */ + var window; /* allocated sliding window, if wsize != 0 */ + var hold; /* local strm.hold */ + var bits; /* local strm.bits */ + var lcode; /* local strm.lencode */ + var dcode; /* local strm.distcode */ + var lmask; /* mask for first level of length codes */ + var dmask; /* mask for first level of distance codes */ + var here; /* retrieved table entry */ + var op; /* code bits, operation, extra bits, or */ + /* window position, window bytes to copy */ + var len; /* match length, unused bytes */ + var dist; /* match distance */ + var from; /* where to copy match from */ + var from_source; + + + var input, output; // JS specific, because we have no pointers + + /* copy state to local variables */ + state = strm.state; + //here = state.here; + _in = strm.next_in; + input = strm.input; + last = _in + (strm.avail_in - 5); + _out = strm.next_out; + output = strm.output; + beg = _out - (start - strm.avail_out); + end = _out + (strm.avail_out - 257); +//#ifdef INFLATE_STRICT + dmax = state.dmax; +//#endif + wsize = state.wsize; + whave = state.whave; + wnext = state.wnext; + window = state.window; + hold = state.hold; + bits = state.bits; + lcode = state.lencode; + dcode = state.distcode; + lmask = (1 << state.lenbits) - 1; + dmask = (1 << state.distbits) - 1; + + + /* decode literals and length/distances until end-of-block or not enough + input data or output space */ + + top: + do { + if (bits < 15) { + hold += input[_in++] << bits; + bits += 8; + hold += input[_in++] << bits; + bits += 8; + } + + here = lcode[hold & lmask]; + + dolen: + for (;;) { // Goto emulation + op = here >>> 24/*here.bits*/; + hold >>>= op; + bits -= op; + op = (here >>> 16) & 0xff/*here.op*/; + if (op === 0) { /* literal */ + //Tracevv((stderr, here.val >= 0x20 && here.val < 0x7f ? + // "inflate: literal '%c'\n" : + // "inflate: literal 0x%02x\n", here.val)); + output[_out++] = here & 0xffff/*here.val*/; + } + else if (op & 16) { /* length base */ + len = here & 0xffff/*here.val*/; + op &= 15; /* number of extra bits */ + if (op) { + if (bits < op) { + hold += input[_in++] << bits; + bits += 8; + } + len += hold & ((1 << op) - 1); + hold >>>= op; + bits -= op; + } + //Tracevv((stderr, "inflate: length %u\n", len)); + if (bits < 15) { + hold += input[_in++] << bits; + bits += 8; + hold += input[_in++] << bits; + bits += 8; + } + here = dcode[hold & dmask]; + + dodist: + for (;;) { // goto emulation + op = here >>> 24/*here.bits*/; + hold >>>= op; + bits -= op; + op = (here >>> 16) & 0xff/*here.op*/; + + if (op & 16) { /* distance base */ + dist = here & 0xffff/*here.val*/; + op &= 15; /* number of extra bits */ + if (bits < op) { + hold += input[_in++] << bits; + bits += 8; + if (bits < op) { + hold += input[_in++] << bits; + bits += 8; + } + } + dist += hold & ((1 << op) - 1); +//#ifdef INFLATE_STRICT + if (dist > dmax) { + strm.msg = 'invalid distance too far back'; + state.mode = BAD; + break top; + } +//#endif + hold >>>= op; + bits -= op; + //Tracevv((stderr, "inflate: distance %u\n", dist)); + op = _out - beg; /* max distance in output */ + if (dist > op) { /* see if copy from window */ + op = dist - op; /* distance back in window */ + if (op > whave) { + if (state.sane) { + strm.msg = 'invalid distance too far back'; + state.mode = BAD; + break top; + } + +// (!) This block is disabled in zlib defailts, +// don't enable it for binary compatibility +//#ifdef INFLATE_ALLOW_INVALID_DISTANCE_TOOFAR_ARRR +// if (len <= op - whave) { +// do { +// output[_out++] = 0; +// } while (--len); +// continue top; +// } +// len -= op - whave; +// do { +// output[_out++] = 0; +// } while (--op > whave); +// if (op === 0) { +// from = _out - dist; +// do { +// output[_out++] = output[from++]; +// } while (--len); +// continue top; +// } +//#endif + } + from = 0; // window index + from_source = window; + if (wnext === 0) { /* very common case */ + from += wsize - op; + if (op < len) { /* some from window */ + len -= op; + do { + output[_out++] = window[from++]; + } while (--op); + from = _out - dist; /* rest from output */ + from_source = output; + } + } + else if (wnext < op) { /* wrap around window */ + from += wsize + wnext - op; + op -= wnext; + if (op < len) { /* some from end of window */ + len -= op; + do { + output[_out++] = window[from++]; + } while (--op); + from = 0; + if (wnext < len) { /* some from start of window */ + op = wnext; + len -= op; + do { + output[_out++] = window[from++]; + } while (--op); + from = _out - dist; /* rest from output */ + from_source = output; + } + } + } + else { /* contiguous in window */ + from += wnext - op; + if (op < len) { /* some from window */ + len -= op; + do { + output[_out++] = window[from++]; + } while (--op); + from = _out - dist; /* rest from output */ + from_source = output; + } + } + while (len > 2) { + output[_out++] = from_source[from++]; + output[_out++] = from_source[from++]; + output[_out++] = from_source[from++]; + len -= 3; + } + if (len) { + output[_out++] = from_source[from++]; + if (len > 1) { + output[_out++] = from_source[from++]; + } + } + } + else { + from = _out - dist; /* copy direct from output */ + do { /* minimum length is three */ + output[_out++] = output[from++]; + output[_out++] = output[from++]; + output[_out++] = output[from++]; + len -= 3; + } while (len > 2); + if (len) { + output[_out++] = output[from++]; + if (len > 1) { + output[_out++] = output[from++]; + } + } + } + } + else if ((op & 64) === 0) { /* 2nd level distance code */ + here = dcode[(here & 0xffff)/*here.val*/ + (hold & ((1 << op) - 1))]; + continue dodist; + } + else { + strm.msg = 'invalid distance code'; + state.mode = BAD; + break top; + } + + break; // need to emulate goto via "continue" + } + } + else if ((op & 64) === 0) { /* 2nd level length code */ + here = lcode[(here & 0xffff)/*here.val*/ + (hold & ((1 << op) - 1))]; + continue dolen; + } + else if (op & 32) { /* end-of-block */ + //Tracevv((stderr, "inflate: end of block\n")); + state.mode = TYPE; + break top; + } + else { + strm.msg = 'invalid literal/length code'; + state.mode = BAD; + break top; + } + + break; // need to emulate goto via "continue" + } + } while (_in < last && _out < end); + + /* return unused bytes (on entry, bits < 8, so in won't go too far back) */ + len = bits >> 3; + _in -= len; + bits -= len << 3; + hold &= (1 << bits) - 1; + + /* update state and return */ + strm.next_in = _in; + strm.next_out = _out; + strm.avail_in = (_in < last ? 5 + (last - _in) : 5 - (_in - last)); + strm.avail_out = (_out < end ? 257 + (end - _out) : 257 - (_out - end)); + state.hold = hold; + state.bits = bits; + return; +}; + +},{}],35:[function(_dereq_,module,exports){ +'use strict'; + + +var utils = _dereq_('../utils/common'); +var adler32 = _dereq_('./adler32'); +var crc32 = _dereq_('./crc32'); +var inflate_fast = _dereq_('./inffast'); +var inflate_table = _dereq_('./inftrees'); + +var CODES = 0; +var LENS = 1; +var DISTS = 2; + +/* Public constants ==========================================================*/ +/* ===========================================================================*/ + + +/* Allowed flush values; see deflate() and inflate() below for details */ +//var Z_NO_FLUSH = 0; +//var Z_PARTIAL_FLUSH = 1; +//var Z_SYNC_FLUSH = 2; +//var Z_FULL_FLUSH = 3; +var Z_FINISH = 4; +var Z_BLOCK = 5; +var Z_TREES = 6; + + +/* Return codes for the compression/decompression functions. Negative values + * are errors, positive values are used for special but normal events. + */ +var Z_OK = 0; +var Z_STREAM_END = 1; +var Z_NEED_DICT = 2; +//var Z_ERRNO = -1; +var Z_STREAM_ERROR = -2; +var Z_DATA_ERROR = -3; +var Z_MEM_ERROR = -4; +var Z_BUF_ERROR = -5; +//var Z_VERSION_ERROR = -6; + +/* The deflate compression method */ +var Z_DEFLATED = 8; + + +/* STATES ====================================================================*/ +/* ===========================================================================*/ + + +var HEAD = 1; /* i: waiting for magic header */ +var FLAGS = 2; /* i: waiting for method and flags (gzip) */ +var TIME = 3; /* i: waiting for modification time (gzip) */ +var OS = 4; /* i: waiting for extra flags and operating system (gzip) */ +var EXLEN = 5; /* i: waiting for extra length (gzip) */ +var EXTRA = 6; /* i: waiting for extra bytes (gzip) */ +var NAME = 7; /* i: waiting for end of file name (gzip) */ +var COMMENT = 8; /* i: waiting for end of comment (gzip) */ +var HCRC = 9; /* i: waiting for header crc (gzip) */ +var DICTID = 10; /* i: waiting for dictionary check value */ +var DICT = 11; /* waiting for inflateSetDictionary() call */ +var TYPE = 12; /* i: waiting for type bits, including last-flag bit */ +var TYPEDO = 13; /* i: same, but skip check to exit inflate on new block */ +var STORED = 14; /* i: waiting for stored size (length and complement) */ +var COPY_ = 15; /* i/o: same as COPY below, but only first time in */ +var COPY = 16; /* i/o: waiting for input or output to copy stored block */ +var TABLE = 17; /* i: waiting for dynamic block table lengths */ +var LENLENS = 18; /* i: waiting for code length code lengths */ +var CODELENS = 19; /* i: waiting for length/lit and distance code lengths */ +var LEN_ = 20; /* i: same as LEN below, but only first time in */ +var LEN = 21; /* i: waiting for length/lit/eob code */ +var LENEXT = 22; /* i: waiting for length extra bits */ +var DIST = 23; /* i: waiting for distance code */ +var DISTEXT = 24; /* i: waiting for distance extra bits */ +var MATCH = 25; /* o: waiting for output space to copy string */ +var LIT = 26; /* o: waiting for output space to write literal */ +var CHECK = 27; /* i: waiting for 32-bit check value */ +var LENGTH = 28; /* i: waiting for 32-bit length (gzip) */ +var DONE = 29; /* finished check, done -- remain here until reset */ +var BAD = 30; /* got a data error -- remain here until reset */ +var MEM = 31; /* got an inflate() memory error -- remain here until reset */ +var SYNC = 32; /* looking for synchronization bytes to restart inflate() */ + +/* ===========================================================================*/ + + + +var ENOUGH_LENS = 852; +var ENOUGH_DISTS = 592; +//var ENOUGH = (ENOUGH_LENS+ENOUGH_DISTS); + +var MAX_WBITS = 15; +/* 32K LZ77 window */ +var DEF_WBITS = MAX_WBITS; + + +function ZSWAP32(q) { + return (((q >>> 24) & 0xff) + + ((q >>> 8) & 0xff00) + + ((q & 0xff00) << 8) + + ((q & 0xff) << 24)); +} + + +function InflateState() { + this.mode = 0; /* current inflate mode */ + this.last = false; /* true if processing last block */ + this.wrap = 0; /* bit 0 true for zlib, bit 1 true for gzip */ + this.havedict = false; /* true if dictionary provided */ + this.flags = 0; /* gzip header method and flags (0 if zlib) */ + this.dmax = 0; /* zlib header max distance (INFLATE_STRICT) */ + this.check = 0; /* protected copy of check value */ + this.total = 0; /* protected copy of output count */ + // TODO: may be {} + this.head = null; /* where to save gzip header information */ + + /* sliding window */ + this.wbits = 0; /* log base 2 of requested window size */ + this.wsize = 0; /* window size or zero if not using window */ + this.whave = 0; /* valid bytes in the window */ + this.wnext = 0; /* window write index */ + this.window = null; /* allocated sliding window, if needed */ + + /* bit accumulator */ + this.hold = 0; /* input bit accumulator */ + this.bits = 0; /* number of bits in "in" */ + + /* for string and stored block copying */ + this.length = 0; /* literal or length of data to copy */ + this.offset = 0; /* distance back to copy string from */ + + /* for table and code decoding */ + this.extra = 0; /* extra bits needed */ + + /* fixed and dynamic code tables */ + this.lencode = null; /* starting table for length/literal codes */ + this.distcode = null; /* starting table for distance codes */ + this.lenbits = 0; /* index bits for lencode */ + this.distbits = 0; /* index bits for distcode */ + + /* dynamic table building */ + this.ncode = 0; /* number of code length code lengths */ + this.nlen = 0; /* number of length code lengths */ + this.ndist = 0; /* number of distance code lengths */ + this.have = 0; /* number of code lengths in lens[] */ + this.next = null; /* next available space in codes[] */ + + this.lens = new utils.Buf16(320); /* temporary storage for code lengths */ + this.work = new utils.Buf16(288); /* work area for code table building */ + + /* + because we don't have pointers in js, we use lencode and distcode directly + as buffers so we don't need codes + */ + //this.codes = new utils.Buf32(ENOUGH); /* space for code tables */ + this.lendyn = null; /* dynamic table for length/literal codes (JS specific) */ + this.distdyn = null; /* dynamic table for distance codes (JS specific) */ + this.sane = 0; /* if false, allow invalid distance too far */ + this.back = 0; /* bits back of last unprocessed length/lit */ + this.was = 0; /* initial length of match */ +} + +function inflateResetKeep(strm) { + var state; + + if (!strm || !strm.state) { return Z_STREAM_ERROR; } + state = strm.state; + strm.total_in = strm.total_out = state.total = 0; + strm.msg = ''; /*Z_NULL*/ + if (state.wrap) { /* to support ill-conceived Java test suite */ + strm.adler = state.wrap & 1; + } + state.mode = HEAD; + state.last = 0; + state.havedict = 0; + state.dmax = 32768; + state.head = null/*Z_NULL*/; + state.hold = 0; + state.bits = 0; + //state.lencode = state.distcode = state.next = state.codes; + state.lencode = state.lendyn = new utils.Buf32(ENOUGH_LENS); + state.distcode = state.distdyn = new utils.Buf32(ENOUGH_DISTS); + + state.sane = 1; + state.back = -1; + //Tracev((stderr, "inflate: reset\n")); + return Z_OK; +} + +function inflateReset(strm) { + var state; + + if (!strm || !strm.state) { return Z_STREAM_ERROR; } + state = strm.state; + state.wsize = 0; + state.whave = 0; + state.wnext = 0; + return inflateResetKeep(strm); + +} + +function inflateReset2(strm, windowBits) { + var wrap; + var state; + + /* get the state */ + if (!strm || !strm.state) { return Z_STREAM_ERROR; } + state = strm.state; + + /* extract wrap request from windowBits parameter */ + if (windowBits < 0) { + wrap = 0; + windowBits = -windowBits; + } + else { + wrap = (windowBits >> 4) + 1; + if (windowBits < 48) { + windowBits &= 15; + } + } + + /* set number of window bits, free window if different */ + if (windowBits && (windowBits < 8 || windowBits > 15)) { + return Z_STREAM_ERROR; + } + if (state.window !== null && state.wbits !== windowBits) { + state.window = null; + } + + /* update state and reset the rest of it */ + state.wrap = wrap; + state.wbits = windowBits; + return inflateReset(strm); +} + +function inflateInit2(strm, windowBits) { + var ret; + var state; + + if (!strm) { return Z_STREAM_ERROR; } + //strm.msg = Z_NULL; /* in case we return an error */ + + state = new InflateState(); + + //if (state === Z_NULL) return Z_MEM_ERROR; + //Tracev((stderr, "inflate: allocated\n")); + strm.state = state; + state.window = null/*Z_NULL*/; + ret = inflateReset2(strm, windowBits); + if (ret !== Z_OK) { + strm.state = null/*Z_NULL*/; + } + return ret; +} + +function inflateInit(strm) { + return inflateInit2(strm, DEF_WBITS); +} + + +/* + Return state with length and distance decoding tables and index sizes set to + fixed code decoding. Normally this returns fixed tables from inffixed.h. + If BUILDFIXED is defined, then instead this routine builds the tables the + first time it's called, and returns those tables the first time and + thereafter. This reduces the size of the code by about 2K bytes, in + exchange for a little execution time. However, BUILDFIXED should not be + used for threaded applications, since the rewriting of the tables and virgin + may not be thread-safe. + */ +var virgin = true; + +var lenfix, distfix; // We have no pointers in JS, so keep tables separate + +function fixedtables(state) { + /* build fixed huffman tables if first call (may not be thread safe) */ + if (virgin) { + var sym; + + lenfix = new utils.Buf32(512); + distfix = new utils.Buf32(32); + + /* literal/length table */ + sym = 0; + while (sym < 144) { state.lens[sym++] = 8; } + while (sym < 256) { state.lens[sym++] = 9; } + while (sym < 280) { state.lens[sym++] = 7; } + while (sym < 288) { state.lens[sym++] = 8; } + + inflate_table(LENS, state.lens, 0, 288, lenfix, 0, state.work, {bits: 9}); + + /* distance table */ + sym = 0; + while (sym < 32) { state.lens[sym++] = 5; } + + inflate_table(DISTS, state.lens, 0, 32, distfix, 0, state.work, {bits: 5}); + + /* do this just once */ + virgin = false; + } + + state.lencode = lenfix; + state.lenbits = 9; + state.distcode = distfix; + state.distbits = 5; +} + + +/* + Update the window with the last wsize (normally 32K) bytes written before + returning. If window does not exist yet, create it. This is only called + when a window is already in use, or when output has been written during this + inflate call, but the end of the deflate stream has not been reached yet. + It is also called to create a window for dictionary data when a dictionary + is loaded. + + Providing output buffers larger than 32K to inflate() should provide a speed + advantage, since only the last 32K of output is copied to the sliding window + upon return from inflate(), and since all distances after the first 32K of + output will fall in the output data, making match copies simpler and faster. + The advantage may be dependent on the size of the processor's data caches. + */ +function updatewindow(strm, src, end, copy) { + var dist; + var state = strm.state; + + /* if it hasn't been done already, allocate space for the window */ + if (state.window === null) { + state.wsize = 1 << state.wbits; + state.wnext = 0; + state.whave = 0; + + state.window = new utils.Buf8(state.wsize); + } + + /* copy state->wsize or less output bytes into the circular window */ + if (copy >= state.wsize) { + utils.arraySet(state.window,src, end - state.wsize, state.wsize, 0); + state.wnext = 0; + state.whave = state.wsize; + } + else { + dist = state.wsize - state.wnext; + if (dist > copy) { + dist = copy; + } + //zmemcpy(state->window + state->wnext, end - copy, dist); + utils.arraySet(state.window,src, end - copy, dist, state.wnext); + copy -= dist; + if (copy) { + //zmemcpy(state->window, end - copy, copy); + utils.arraySet(state.window,src, end - copy, copy, 0); + state.wnext = copy; + state.whave = state.wsize; + } + else { + state.wnext += dist; + if (state.wnext === state.wsize) { state.wnext = 0; } + if (state.whave < state.wsize) { state.whave += dist; } + } + } + return 0; +} + +function inflate(strm, flush) { + var state; + var input, output; // input/output buffers + var next; /* next input INDEX */ + var put; /* next output INDEX */ + var have, left; /* available input and output */ + var hold; /* bit buffer */ + var bits; /* bits in bit buffer */ + var _in, _out; /* save starting available input and output */ + var copy; /* number of stored or match bytes to copy */ + var from; /* where to copy match bytes from */ + var from_source; + var here = 0; /* current decoding table entry */ + var here_bits, here_op, here_val; // paked "here" denormalized (JS specific) + //var last; /* parent table entry */ + var last_bits, last_op, last_val; // paked "last" denormalized (JS specific) + var len; /* length to copy for repeats, bits to drop */ + var ret; /* return code */ + var hbuf = new utils.Buf8(4); /* buffer for gzip header crc calculation */ + var opts; + + var n; // temporary var for NEED_BITS + + var order = /* permutation of code lengths */ + [16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15]; + + + if (!strm || !strm.state || !strm.output || + (!strm.input && strm.avail_in !== 0)) { + return Z_STREAM_ERROR; + } + + state = strm.state; + if (state.mode === TYPE) { state.mode = TYPEDO; } /* skip check */ + + + //--- LOAD() --- + put = strm.next_out; + output = strm.output; + left = strm.avail_out; + next = strm.next_in; + input = strm.input; + have = strm.avail_in; + hold = state.hold; + bits = state.bits; + //--- + + _in = have; + _out = left; + ret = Z_OK; + + inf_leave: // goto emulation + for (;;) { + switch (state.mode) { + case HEAD: + if (state.wrap === 0) { + state.mode = TYPEDO; + break; + } + //=== NEEDBITS(16); + while (bits < 16) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + if ((state.wrap & 2) && hold === 0x8b1f) { /* gzip header */ + state.check = 0/*crc32(0L, Z_NULL, 0)*/; + //=== CRC2(state.check, hold); + hbuf[0] = hold & 0xff; + hbuf[1] = (hold >>> 8) & 0xff; + state.check = crc32(state.check, hbuf, 2, 0); + //===// + + //=== INITBITS(); + hold = 0; + bits = 0; + //===// + state.mode = FLAGS; + break; + } + state.flags = 0; /* expect zlib header */ + if (state.head) { + state.head.done = false; + } + if (!(state.wrap & 1) || /* check if zlib header allowed */ + (((hold & 0xff)/*BITS(8)*/ << 8) + (hold >> 8)) % 31) { + strm.msg = 'incorrect header check'; + state.mode = BAD; + break; + } + if ((hold & 0x0f)/*BITS(4)*/ !== Z_DEFLATED) { + strm.msg = 'unknown compression method'; + state.mode = BAD; + break; + } + //--- DROPBITS(4) ---// + hold >>>= 4; + bits -= 4; + //---// + len = (hold & 0x0f)/*BITS(4)*/ + 8; + if (state.wbits === 0) { + state.wbits = len; + } + else if (len > state.wbits) { + strm.msg = 'invalid window size'; + state.mode = BAD; + break; + } + state.dmax = 1 << len; + //Tracev((stderr, "inflate: zlib header ok\n")); + strm.adler = state.check = 1/*adler32(0L, Z_NULL, 0)*/; + state.mode = hold & 0x200 ? DICTID : TYPE; + //=== INITBITS(); + hold = 0; + bits = 0; + //===// + break; + case FLAGS: + //=== NEEDBITS(16); */ + while (bits < 16) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + state.flags = hold; + if ((state.flags & 0xff) !== Z_DEFLATED) { + strm.msg = 'unknown compression method'; + state.mode = BAD; + break; + } + if (state.flags & 0xe000) { + strm.msg = 'unknown header flags set'; + state.mode = BAD; + break; + } + if (state.head) { + state.head.text = ((hold >> 8) & 1); + } + if (state.flags & 0x0200) { + //=== CRC2(state.check, hold); + hbuf[0] = hold & 0xff; + hbuf[1] = (hold >>> 8) & 0xff; + state.check = crc32(state.check, hbuf, 2, 0); + //===// + } + //=== INITBITS(); + hold = 0; + bits = 0; + //===// + state.mode = TIME; + /* falls through */ + case TIME: + //=== NEEDBITS(32); */ + while (bits < 32) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + if (state.head) { + state.head.time = hold; + } + if (state.flags & 0x0200) { + //=== CRC4(state.check, hold) + hbuf[0] = hold & 0xff; + hbuf[1] = (hold >>> 8) & 0xff; + hbuf[2] = (hold >>> 16) & 0xff; + hbuf[3] = (hold >>> 24) & 0xff; + state.check = crc32(state.check, hbuf, 4, 0); + //=== + } + //=== INITBITS(); + hold = 0; + bits = 0; + //===// + state.mode = OS; + /* falls through */ + case OS: + //=== NEEDBITS(16); */ + while (bits < 16) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + if (state.head) { + state.head.xflags = (hold & 0xff); + state.head.os = (hold >> 8); + } + if (state.flags & 0x0200) { + //=== CRC2(state.check, hold); + hbuf[0] = hold & 0xff; + hbuf[1] = (hold >>> 8) & 0xff; + state.check = crc32(state.check, hbuf, 2, 0); + //===// + } + //=== INITBITS(); + hold = 0; + bits = 0; + //===// + state.mode = EXLEN; + /* falls through */ + case EXLEN: + if (state.flags & 0x0400) { + //=== NEEDBITS(16); */ + while (bits < 16) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + state.length = hold; + if (state.head) { + state.head.extra_len = hold; + } + if (state.flags & 0x0200) { + //=== CRC2(state.check, hold); + hbuf[0] = hold & 0xff; + hbuf[1] = (hold >>> 8) & 0xff; + state.check = crc32(state.check, hbuf, 2, 0); + //===// + } + //=== INITBITS(); + hold = 0; + bits = 0; + //===// + } + else if (state.head) { + state.head.extra = null/*Z_NULL*/; + } + state.mode = EXTRA; + /* falls through */ + case EXTRA: + if (state.flags & 0x0400) { + copy = state.length; + if (copy > have) { copy = have; } + if (copy) { + if (state.head) { + len = state.head.extra_len - state.length; + if (!state.head.extra) { + // Use untyped array for more conveniend processing later + state.head.extra = new Array(state.head.extra_len); + } + utils.arraySet( + state.head.extra, + input, + next, + // extra field is limited to 65536 bytes + // - no need for additional size check + copy, + /*len + copy > state.head.extra_max - len ? state.head.extra_max : copy,*/ + len + ); + //zmemcpy(state.head.extra + len, next, + // len + copy > state.head.extra_max ? + // state.head.extra_max - len : copy); + } + if (state.flags & 0x0200) { + state.check = crc32(state.check, input, copy, next); + } + have -= copy; + next += copy; + state.length -= copy; + } + if (state.length) { break inf_leave; } + } + state.length = 0; + state.mode = NAME; + /* falls through */ + case NAME: + if (state.flags & 0x0800) { + if (have === 0) { break inf_leave; } + copy = 0; + do { + // TODO: 2 or 1 bytes? + len = input[next + copy++]; + /* use constant limit because in js we should not preallocate memory */ + if (state.head && len && + (state.length < 65536 /*state.head.name_max*/)) { + state.head.name += String.fromCharCode(len); + } + } while (len && copy < have); + + if (state.flags & 0x0200) { + state.check = crc32(state.check, input, copy, next); + } + have -= copy; + next += copy; + if (len) { break inf_leave; } + } + else if (state.head) { + state.head.name = null; + } + state.length = 0; + state.mode = COMMENT; + /* falls through */ + case COMMENT: + if (state.flags & 0x1000) { + if (have === 0) { break inf_leave; } + copy = 0; + do { + len = input[next + copy++]; + /* use constant limit because in js we should not preallocate memory */ + if (state.head && len && + (state.length < 65536 /*state.head.comm_max*/)) { + state.head.comment += String.fromCharCode(len); + } + } while (len && copy < have); + if (state.flags & 0x0200) { + state.check = crc32(state.check, input, copy, next); + } + have -= copy; + next += copy; + if (len) { break inf_leave; } + } + else if (state.head) { + state.head.comment = null; + } + state.mode = HCRC; + /* falls through */ + case HCRC: + if (state.flags & 0x0200) { + //=== NEEDBITS(16); */ + while (bits < 16) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + if (hold !== (state.check & 0xffff)) { + strm.msg = 'header crc mismatch'; + state.mode = BAD; + break; + } + //=== INITBITS(); + hold = 0; + bits = 0; + //===// + } + if (state.head) { + state.head.hcrc = ((state.flags >> 9) & 1); + state.head.done = true; + } + strm.adler = state.check = 0 /*crc32(0L, Z_NULL, 0)*/; + state.mode = TYPE; + break; + case DICTID: + //=== NEEDBITS(32); */ + while (bits < 32) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + strm.adler = state.check = ZSWAP32(hold); + //=== INITBITS(); + hold = 0; + bits = 0; + //===// + state.mode = DICT; + /* falls through */ + case DICT: + if (state.havedict === 0) { + //--- RESTORE() --- + strm.next_out = put; + strm.avail_out = left; + strm.next_in = next; + strm.avail_in = have; + state.hold = hold; + state.bits = bits; + //--- + return Z_NEED_DICT; + } + strm.adler = state.check = 1/*adler32(0L, Z_NULL, 0)*/; + state.mode = TYPE; + /* falls through */ + case TYPE: + if (flush === Z_BLOCK || flush === Z_TREES) { break inf_leave; } + /* falls through */ + case TYPEDO: + if (state.last) { + //--- BYTEBITS() ---// + hold >>>= bits & 7; + bits -= bits & 7; + //---// + state.mode = CHECK; + break; + } + //=== NEEDBITS(3); */ + while (bits < 3) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + state.last = (hold & 0x01)/*BITS(1)*/; + //--- DROPBITS(1) ---// + hold >>>= 1; + bits -= 1; + //---// + + switch ((hold & 0x03)/*BITS(2)*/) { + case 0: /* stored block */ + //Tracev((stderr, "inflate: stored block%s\n", + // state.last ? " (last)" : "")); + state.mode = STORED; + break; + case 1: /* fixed block */ + fixedtables(state); + //Tracev((stderr, "inflate: fixed codes block%s\n", + // state.last ? " (last)" : "")); + state.mode = LEN_; /* decode codes */ + if (flush === Z_TREES) { + //--- DROPBITS(2) ---// + hold >>>= 2; + bits -= 2; + //---// + break inf_leave; + } + break; + case 2: /* dynamic block */ + //Tracev((stderr, "inflate: dynamic codes block%s\n", + // state.last ? " (last)" : "")); + state.mode = TABLE; + break; + case 3: + strm.msg = 'invalid block type'; + state.mode = BAD; + } + //--- DROPBITS(2) ---// + hold >>>= 2; + bits -= 2; + //---// + break; + case STORED: + //--- BYTEBITS() ---// /* go to byte boundary */ + hold >>>= bits & 7; + bits -= bits & 7; + //---// + //=== NEEDBITS(32); */ + while (bits < 32) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + if ((hold & 0xffff) !== ((hold >>> 16) ^ 0xffff)) { + strm.msg = 'invalid stored block lengths'; + state.mode = BAD; + break; + } + state.length = hold & 0xffff; + //Tracev((stderr, "inflate: stored length %u\n", + // state.length)); + //=== INITBITS(); + hold = 0; + bits = 0; + //===// + state.mode = COPY_; + if (flush === Z_TREES) { break inf_leave; } + /* falls through */ + case COPY_: + state.mode = COPY; + /* falls through */ + case COPY: + copy = state.length; + if (copy) { + if (copy > have) { copy = have; } + if (copy > left) { copy = left; } + if (copy === 0) { break inf_leave; } + //--- zmemcpy(put, next, copy); --- + utils.arraySet(output, input, next, copy, put); + //---// + have -= copy; + next += copy; + left -= copy; + put += copy; + state.length -= copy; + break; + } + //Tracev((stderr, "inflate: stored end\n")); + state.mode = TYPE; + break; + case TABLE: + //=== NEEDBITS(14); */ + while (bits < 14) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + state.nlen = (hold & 0x1f)/*BITS(5)*/ + 257; + //--- DROPBITS(5) ---// + hold >>>= 5; + bits -= 5; + //---// + state.ndist = (hold & 0x1f)/*BITS(5)*/ + 1; + //--- DROPBITS(5) ---// + hold >>>= 5; + bits -= 5; + //---// + state.ncode = (hold & 0x0f)/*BITS(4)*/ + 4; + //--- DROPBITS(4) ---// + hold >>>= 4; + bits -= 4; + //---// +//#ifndef PKZIP_BUG_WORKAROUND + if (state.nlen > 286 || state.ndist > 30) { + strm.msg = 'too many length or distance symbols'; + state.mode = BAD; + break; + } +//#endif + //Tracev((stderr, "inflate: table sizes ok\n")); + state.have = 0; + state.mode = LENLENS; + /* falls through */ + case LENLENS: + while (state.have < state.ncode) { + //=== NEEDBITS(3); + while (bits < 3) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + state.lens[order[state.have++]] = (hold & 0x07);//BITS(3); + //--- DROPBITS(3) ---// + hold >>>= 3; + bits -= 3; + //---// + } + while (state.have < 19) { + state.lens[order[state.have++]] = 0; + } + // We have separate tables & no pointers. 2 commented lines below not needed. + //state.next = state.codes; + //state.lencode = state.next; + // Switch to use dynamic table + state.lencode = state.lendyn; + state.lenbits = 7; + + opts = {bits: state.lenbits}; + ret = inflate_table(CODES, state.lens, 0, 19, state.lencode, 0, state.work, opts); + state.lenbits = opts.bits; + + if (ret) { + strm.msg = 'invalid code lengths set'; + state.mode = BAD; + break; + } + //Tracev((stderr, "inflate: code lengths ok\n")); + state.have = 0; + state.mode = CODELENS; + /* falls through */ + case CODELENS: + while (state.have < state.nlen + state.ndist) { + for (;;) { + here = state.lencode[hold & ((1 << state.lenbits) - 1)];/*BITS(state.lenbits)*/ + here_bits = here >>> 24; + here_op = (here >>> 16) & 0xff; + here_val = here & 0xffff; + + if ((here_bits) <= bits) { break; } + //--- PULLBYTE() ---// + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + //---// + } + if (here_val < 16) { + //--- DROPBITS(here.bits) ---// + hold >>>= here_bits; + bits -= here_bits; + //---// + state.lens[state.have++] = here_val; + } + else { + if (here_val === 16) { + //=== NEEDBITS(here.bits + 2); + n = here_bits + 2; + while (bits < n) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + //--- DROPBITS(here.bits) ---// + hold >>>= here_bits; + bits -= here_bits; + //---// + if (state.have === 0) { + strm.msg = 'invalid bit length repeat'; + state.mode = BAD; + break; + } + len = state.lens[state.have - 1]; + copy = 3 + (hold & 0x03);//BITS(2); + //--- DROPBITS(2) ---// + hold >>>= 2; + bits -= 2; + //---// + } + else if (here_val === 17) { + //=== NEEDBITS(here.bits + 3); + n = here_bits + 3; + while (bits < n) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + //--- DROPBITS(here.bits) ---// + hold >>>= here_bits; + bits -= here_bits; + //---// + len = 0; + copy = 3 + (hold & 0x07);//BITS(3); + //--- DROPBITS(3) ---// + hold >>>= 3; + bits -= 3; + //---// + } + else { + //=== NEEDBITS(here.bits + 7); + n = here_bits + 7; + while (bits < n) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + //--- DROPBITS(here.bits) ---// + hold >>>= here_bits; + bits -= here_bits; + //---// + len = 0; + copy = 11 + (hold & 0x7f);//BITS(7); + //--- DROPBITS(7) ---// + hold >>>= 7; + bits -= 7; + //---// + } + if (state.have + copy > state.nlen + state.ndist) { + strm.msg = 'invalid bit length repeat'; + state.mode = BAD; + break; + } + while (copy--) { + state.lens[state.have++] = len; + } + } + } + + /* handle error breaks in while */ + if (state.mode === BAD) { break; } + + /* check for end-of-block code (better have one) */ + if (state.lens[256] === 0) { + strm.msg = 'invalid code -- missing end-of-block'; + state.mode = BAD; + break; + } + + /* build code tables -- note: do not change the lenbits or distbits + values here (9 and 6) without reading the comments in inftrees.h + concerning the ENOUGH constants, which depend on those values */ + state.lenbits = 9; + + opts = {bits: state.lenbits}; + ret = inflate_table(LENS, state.lens, 0, state.nlen, state.lencode, 0, state.work, opts); + // We have separate tables & no pointers. 2 commented lines below not needed. + // state.next_index = opts.table_index; + state.lenbits = opts.bits; + // state.lencode = state.next; + + if (ret) { + strm.msg = 'invalid literal/lengths set'; + state.mode = BAD; + break; + } + + state.distbits = 6; + //state.distcode.copy(state.codes); + // Switch to use dynamic table + state.distcode = state.distdyn; + opts = {bits: state.distbits}; + ret = inflate_table(DISTS, state.lens, state.nlen, state.ndist, state.distcode, 0, state.work, opts); + // We have separate tables & no pointers. 2 commented lines below not needed. + // state.next_index = opts.table_index; + state.distbits = opts.bits; + // state.distcode = state.next; + + if (ret) { + strm.msg = 'invalid distances set'; + state.mode = BAD; + break; + } + //Tracev((stderr, 'inflate: codes ok\n')); + state.mode = LEN_; + if (flush === Z_TREES) { break inf_leave; } + /* falls through */ + case LEN_: + state.mode = LEN; + /* falls through */ + case LEN: + if (have >= 6 && left >= 258) { + //--- RESTORE() --- + strm.next_out = put; + strm.avail_out = left; + strm.next_in = next; + strm.avail_in = have; + state.hold = hold; + state.bits = bits; + //--- + inflate_fast(strm, _out); + //--- LOAD() --- + put = strm.next_out; + output = strm.output; + left = strm.avail_out; + next = strm.next_in; + input = strm.input; + have = strm.avail_in; + hold = state.hold; + bits = state.bits; + //--- + + if (state.mode === TYPE) { + state.back = -1; + } + break; + } + state.back = 0; + for (;;) { + here = state.lencode[hold & ((1 << state.lenbits) -1)]; /*BITS(state.lenbits)*/ + here_bits = here >>> 24; + here_op = (here >>> 16) & 0xff; + here_val = here & 0xffff; + + if (here_bits <= bits) { break; } + //--- PULLBYTE() ---// + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + //---// + } + if (here_op && (here_op & 0xf0) === 0) { + last_bits = here_bits; + last_op = here_op; + last_val = here_val; + for (;;) { + here = state.lencode[last_val + + ((hold & ((1 << (last_bits + last_op)) -1))/*BITS(last.bits + last.op)*/ >> last_bits)]; + here_bits = here >>> 24; + here_op = (here >>> 16) & 0xff; + here_val = here & 0xffff; + + if ((last_bits + here_bits) <= bits) { break; } + //--- PULLBYTE() ---// + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + //---// + } + //--- DROPBITS(last.bits) ---// + hold >>>= last_bits; + bits -= last_bits; + //---// + state.back += last_bits; + } + //--- DROPBITS(here.bits) ---// + hold >>>= here_bits; + bits -= here_bits; + //---// + state.back += here_bits; + state.length = here_val; + if (here_op === 0) { + //Tracevv((stderr, here.val >= 0x20 && here.val < 0x7f ? + // "inflate: literal '%c'\n" : + // "inflate: literal 0x%02x\n", here.val)); + state.mode = LIT; + break; + } + if (here_op & 32) { + //Tracevv((stderr, "inflate: end of block\n")); + state.back = -1; + state.mode = TYPE; + break; + } + if (here_op & 64) { + strm.msg = 'invalid literal/length code'; + state.mode = BAD; + break; + } + state.extra = here_op & 15; + state.mode = LENEXT; + /* falls through */ + case LENEXT: + if (state.extra) { + //=== NEEDBITS(state.extra); + n = state.extra; + while (bits < n) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + state.length += hold & ((1 << state.extra) -1)/*BITS(state.extra)*/; + //--- DROPBITS(state.extra) ---// + hold >>>= state.extra; + bits -= state.extra; + //---// + state.back += state.extra; + } + //Tracevv((stderr, "inflate: length %u\n", state.length)); + state.was = state.length; + state.mode = DIST; + /* falls through */ + case DIST: + for (;;) { + here = state.distcode[hold & ((1 << state.distbits) -1)];/*BITS(state.distbits)*/ + here_bits = here >>> 24; + here_op = (here >>> 16) & 0xff; + here_val = here & 0xffff; + + if ((here_bits) <= bits) { break; } + //--- PULLBYTE() ---// + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + //---// + } + if ((here_op & 0xf0) === 0) { + last_bits = here_bits; + last_op = here_op; + last_val = here_val; + for (;;) { + here = state.distcode[last_val + + ((hold & ((1 << (last_bits + last_op)) -1))/*BITS(last.bits + last.op)*/ >> last_bits)]; + here_bits = here >>> 24; + here_op = (here >>> 16) & 0xff; + here_val = here & 0xffff; + + if ((last_bits + here_bits) <= bits) { break; } + //--- PULLBYTE() ---// + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + //---// + } + //--- DROPBITS(last.bits) ---// + hold >>>= last_bits; + bits -= last_bits; + //---// + state.back += last_bits; + } + //--- DROPBITS(here.bits) ---// + hold >>>= here_bits; + bits -= here_bits; + //---// + state.back += here_bits; + if (here_op & 64) { + strm.msg = 'invalid distance code'; + state.mode = BAD; + break; + } + state.offset = here_val; + state.extra = (here_op) & 15; + state.mode = DISTEXT; + /* falls through */ + case DISTEXT: + if (state.extra) { + //=== NEEDBITS(state.extra); + n = state.extra; + while (bits < n) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + state.offset += hold & ((1 << state.extra) -1)/*BITS(state.extra)*/; + //--- DROPBITS(state.extra) ---// + hold >>>= state.extra; + bits -= state.extra; + //---// + state.back += state.extra; + } +//#ifdef INFLATE_STRICT + if (state.offset > state.dmax) { + strm.msg = 'invalid distance too far back'; + state.mode = BAD; + break; + } +//#endif + //Tracevv((stderr, "inflate: distance %u\n", state.offset)); + state.mode = MATCH; + /* falls through */ + case MATCH: + if (left === 0) { break inf_leave; } + copy = _out - left; + if (state.offset > copy) { /* copy from window */ + copy = state.offset - copy; + if (copy > state.whave) { + if (state.sane) { + strm.msg = 'invalid distance too far back'; + state.mode = BAD; + break; + } +// (!) This block is disabled in zlib defailts, +// don't enable it for binary compatibility +//#ifdef INFLATE_ALLOW_INVALID_DISTANCE_TOOFAR_ARRR +// Trace((stderr, "inflate.c too far\n")); +// copy -= state.whave; +// if (copy > state.length) { copy = state.length; } +// if (copy > left) { copy = left; } +// left -= copy; +// state.length -= copy; +// do { +// output[put++] = 0; +// } while (--copy); +// if (state.length === 0) { state.mode = LEN; } +// break; +//#endif + } + if (copy > state.wnext) { + copy -= state.wnext; + from = state.wsize - copy; + } + else { + from = state.wnext - copy; + } + if (copy > state.length) { copy = state.length; } + from_source = state.window; + } + else { /* copy from output */ + from_source = output; + from = put - state.offset; + copy = state.length; + } + if (copy > left) { copy = left; } + left -= copy; + state.length -= copy; + do { + output[put++] = from_source[from++]; + } while (--copy); + if (state.length === 0) { state.mode = LEN; } + break; + case LIT: + if (left === 0) { break inf_leave; } + output[put++] = state.length; + left--; + state.mode = LEN; + break; + case CHECK: + if (state.wrap) { + //=== NEEDBITS(32); + while (bits < 32) { + if (have === 0) { break inf_leave; } + have--; + // Use '|' insdead of '+' to make sure that result is signed + hold |= input[next++] << bits; + bits += 8; + } + //===// + _out -= left; + strm.total_out += _out; + state.total += _out; + if (_out) { + strm.adler = state.check = + /*UPDATE(state.check, put - _out, _out);*/ + (state.flags ? crc32(state.check, output, _out, put - _out) : adler32(state.check, output, _out, put - _out)); + + } + _out = left; + // NB: crc32 stored as signed 32-bit int, ZSWAP32 returns signed too + if ((state.flags ? hold : ZSWAP32(hold)) !== state.check) { + strm.msg = 'incorrect data check'; + state.mode = BAD; + break; + } + //=== INITBITS(); + hold = 0; + bits = 0; + //===// + //Tracev((stderr, "inflate: check matches trailer\n")); + } + state.mode = LENGTH; + /* falls through */ + case LENGTH: + if (state.wrap && state.flags) { + //=== NEEDBITS(32); + while (bits < 32) { + if (have === 0) { break inf_leave; } + have--; + hold += input[next++] << bits; + bits += 8; + } + //===// + if (hold !== (state.total & 0xffffffff)) { + strm.msg = 'incorrect length check'; + state.mode = BAD; + break; + } + //=== INITBITS(); + hold = 0; + bits = 0; + //===// + //Tracev((stderr, "inflate: length matches trailer\n")); + } + state.mode = DONE; + /* falls through */ + case DONE: + ret = Z_STREAM_END; + break inf_leave; + case BAD: + ret = Z_DATA_ERROR; + break inf_leave; + case MEM: + return Z_MEM_ERROR; + case SYNC: + /* falls through */ + default: + return Z_STREAM_ERROR; + } + } + + // inf_leave <- here is real place for "goto inf_leave", emulated via "break inf_leave" + + /* + Return from inflate(), updating the total counts and the check value. + If there was no progress during the inflate() call, return a buffer + error. Call updatewindow() to create and/or update the window state. + Note: a memory error from inflate() is non-recoverable. + */ + + //--- RESTORE() --- + strm.next_out = put; + strm.avail_out = left; + strm.next_in = next; + strm.avail_in = have; + state.hold = hold; + state.bits = bits; + //--- + + if (state.wsize || (_out !== strm.avail_out && state.mode < BAD && + (state.mode < CHECK || flush !== Z_FINISH))) { + if (updatewindow(strm, strm.output, strm.next_out, _out - strm.avail_out)) { + state.mode = MEM; + return Z_MEM_ERROR; + } + } + _in -= strm.avail_in; + _out -= strm.avail_out; + strm.total_in += _in; + strm.total_out += _out; + state.total += _out; + if (state.wrap && _out) { + strm.adler = state.check = /*UPDATE(state.check, strm.next_out - _out, _out);*/ + (state.flags ? crc32(state.check, output, _out, strm.next_out - _out) : adler32(state.check, output, _out, strm.next_out - _out)); + } + strm.data_type = state.bits + (state.last ? 64 : 0) + + (state.mode === TYPE ? 128 : 0) + + (state.mode === LEN_ || state.mode === COPY_ ? 256 : 0); + if (((_in === 0 && _out === 0) || flush === Z_FINISH) && ret === Z_OK) { + ret = Z_BUF_ERROR; + } + return ret; +} + +function inflateEnd(strm) { + + if (!strm || !strm.state /*|| strm->zfree == (free_func)0*/) { + return Z_STREAM_ERROR; + } + + var state = strm.state; + if (state.window) { + state.window = null; + } + strm.state = null; + return Z_OK; +} + +function inflateGetHeader(strm, head) { + var state; + + /* check state */ + if (!strm || !strm.state) { return Z_STREAM_ERROR; } + state = strm.state; + if ((state.wrap & 2) === 0) { return Z_STREAM_ERROR; } + + /* save header structure */ + state.head = head; + head.done = false; + return Z_OK; +} + + +exports.inflateReset = inflateReset; +exports.inflateReset2 = inflateReset2; +exports.inflateResetKeep = inflateResetKeep; +exports.inflateInit = inflateInit; +exports.inflateInit2 = inflateInit2; +exports.inflate = inflate; +exports.inflateEnd = inflateEnd; +exports.inflateGetHeader = inflateGetHeader; +exports.inflateInfo = 'pako inflate (from Nodeca project)'; + +/* Not implemented +exports.inflateCopy = inflateCopy; +exports.inflateGetDictionary = inflateGetDictionary; +exports.inflateMark = inflateMark; +exports.inflatePrime = inflatePrime; +exports.inflateSetDictionary = inflateSetDictionary; +exports.inflateSync = inflateSync; +exports.inflateSyncPoint = inflateSyncPoint; +exports.inflateUndermine = inflateUndermine; +*/ +},{"../utils/common":27,"./adler32":29,"./crc32":31,"./inffast":34,"./inftrees":36}],36:[function(_dereq_,module,exports){ +'use strict'; + + +var utils = _dereq_('../utils/common'); + +var MAXBITS = 15; +var ENOUGH_LENS = 852; +var ENOUGH_DISTS = 592; +//var ENOUGH = (ENOUGH_LENS+ENOUGH_DISTS); + +var CODES = 0; +var LENS = 1; +var DISTS = 2; + +var lbase = [ /* Length codes 257..285 base */ + 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 15, 17, 19, 23, 27, 31, + 35, 43, 51, 59, 67, 83, 99, 115, 131, 163, 195, 227, 258, 0, 0 +]; + +var lext = [ /* Length codes 257..285 extra */ + 16, 16, 16, 16, 16, 16, 16, 16, 17, 17, 17, 17, 18, 18, 18, 18, + 19, 19, 19, 19, 20, 20, 20, 20, 21, 21, 21, 21, 16, 72, 78 +]; + +var dbase = [ /* Distance codes 0..29 base */ + 1, 2, 3, 4, 5, 7, 9, 13, 17, 25, 33, 49, 65, 97, 129, 193, + 257, 385, 513, 769, 1025, 1537, 2049, 3073, 4097, 6145, + 8193, 12289, 16385, 24577, 0, 0 +]; + +var dext = [ /* Distance codes 0..29 extra */ + 16, 16, 16, 16, 17, 17, 18, 18, 19, 19, 20, 20, 21, 21, 22, 22, + 23, 23, 24, 24, 25, 25, 26, 26, 27, 27, + 28, 28, 29, 29, 64, 64 +]; + +module.exports = function inflate_table(type, lens, lens_index, codes, table, table_index, work, opts) +{ + var bits = opts.bits; + //here = opts.here; /* table entry for duplication */ + + var len = 0; /* a code's length in bits */ + var sym = 0; /* index of code symbols */ + var min = 0, max = 0; /* minimum and maximum code lengths */ + var root = 0; /* number of index bits for root table */ + var curr = 0; /* number of index bits for current table */ + var drop = 0; /* code bits to drop for sub-table */ + var left = 0; /* number of prefix codes available */ + var used = 0; /* code entries in table used */ + var huff = 0; /* Huffman code */ + var incr; /* for incrementing code, index */ + var fill; /* index for replicating entries */ + var low; /* low bits for current root entry */ + var mask; /* mask for low root bits */ + var next; /* next available space in table */ + var base = null; /* base value table to use */ + var base_index = 0; +// var shoextra; /* extra bits table to use */ + var end; /* use base and extra for symbol > end */ + var count = new utils.Buf16(MAXBITS+1); //[MAXBITS+1]; /* number of codes of each length */ + var offs = new utils.Buf16(MAXBITS+1); //[MAXBITS+1]; /* offsets in table for each length */ + var extra = null; + var extra_index = 0; + + var here_bits, here_op, here_val; + + /* + Process a set of code lengths to create a canonical Huffman code. The + code lengths are lens[0..codes-1]. Each length corresponds to the + symbols 0..codes-1. The Huffman code is generated by first sorting the + symbols by length from short to long, and retaining the symbol order + for codes with equal lengths. Then the code starts with all zero bits + for the first code of the shortest length, and the codes are integer + increments for the same length, and zeros are appended as the length + increases. For the deflate format, these bits are stored backwards + from their more natural integer increment ordering, and so when the + decoding tables are built in the large loop below, the integer codes + are incremented backwards. + + This routine assumes, but does not check, that all of the entries in + lens[] are in the range 0..MAXBITS. The caller must assure this. + 1..MAXBITS is interpreted as that code length. zero means that that + symbol does not occur in this code. + + The codes are sorted by computing a count of codes for each length, + creating from that a table of starting indices for each length in the + sorted table, and then entering the symbols in order in the sorted + table. The sorted table is work[], with that space being provided by + the caller. + + The length counts are used for other purposes as well, i.e. finding + the minimum and maximum length codes, determining if there are any + codes at all, checking for a valid set of lengths, and looking ahead + at length counts to determine sub-table sizes when building the + decoding tables. + */ + + /* accumulate lengths for codes (assumes lens[] all in 0..MAXBITS) */ + for (len = 0; len <= MAXBITS; len++) { + count[len] = 0; + } + for (sym = 0; sym < codes; sym++) { + count[lens[lens_index + sym]]++; + } + + /* bound code lengths, force root to be within code lengths */ + root = bits; + for (max = MAXBITS; max >= 1; max--) { + if (count[max] !== 0) { break; } + } + if (root > max) { + root = max; + } + if (max === 0) { /* no symbols to code at all */ + //table.op[opts.table_index] = 64; //here.op = (var char)64; /* invalid code marker */ + //table.bits[opts.table_index] = 1; //here.bits = (var char)1; + //table.val[opts.table_index++] = 0; //here.val = (var short)0; + table[table_index++] = (1 << 24) | (64 << 16) | 0; + + + //table.op[opts.table_index] = 64; + //table.bits[opts.table_index] = 1; + //table.val[opts.table_index++] = 0; + table[table_index++] = (1 << 24) | (64 << 16) | 0; + + opts.bits = 1; + return 0; /* no symbols, but wait for decoding to report error */ + } + for (min = 1; min < max; min++) { + if (count[min] !== 0) { break; } + } + if (root < min) { + root = min; + } + + /* check for an over-subscribed or incomplete set of lengths */ + left = 1; + for (len = 1; len <= MAXBITS; len++) { + left <<= 1; + left -= count[len]; + if (left < 0) { + return -1; + } /* over-subscribed */ + } + if (left > 0 && (type === CODES || max !== 1)) { + return -1; /* incomplete set */ + } + + /* generate offsets into symbol table for each length for sorting */ + offs[1] = 0; + for (len = 1; len < MAXBITS; len++) { + offs[len + 1] = offs[len] + count[len]; + } + + /* sort symbols by length, by symbol order within each length */ + for (sym = 0; sym < codes; sym++) { + if (lens[lens_index + sym] !== 0) { + work[offs[lens[lens_index + sym]]++] = sym; + } + } + + /* + Create and fill in decoding tables. In this loop, the table being + filled is at next and has curr index bits. The code being used is huff + with length len. That code is converted to an index by dropping drop + bits off of the bottom. For codes where len is less than drop + curr, + those top drop + curr - len bits are incremented through all values to + fill the table with replicated entries. + + root is the number of index bits for the root table. When len exceeds + root, sub-tables are created pointed to by the root entry with an index + of the low root bits of huff. This is saved in low to check for when a + new sub-table should be started. drop is zero when the root table is + being filled, and drop is root when sub-tables are being filled. + + When a new sub-table is needed, it is necessary to look ahead in the + code lengths to determine what size sub-table is needed. The length + counts are used for this, and so count[] is decremented as codes are + entered in the tables. + + used keeps track of how many table entries have been allocated from the + provided *table space. It is checked for LENS and DIST tables against + the constants ENOUGH_LENS and ENOUGH_DISTS to guard against changes in + the initial root table size constants. See the comments in inftrees.h + for more information. + + sym increments through all symbols, and the loop terminates when + all codes of length max, i.e. all codes, have been processed. This + routine permits incomplete codes, so another loop after this one fills + in the rest of the decoding tables with invalid code markers. + */ + + /* set up for code type */ + // poor man optimization - use if-else instead of switch, + // to avoid deopts in old v8 + if (type === CODES) { + base = extra = work; /* dummy value--not used */ + end = 19; + } else if (type === LENS) { + base = lbase; + base_index -= 257; + extra = lext; + extra_index -= 257; + end = 256; + } else { /* DISTS */ + base = dbase; + extra = dext; + end = -1; + } + + /* initialize opts for loop */ + huff = 0; /* starting code */ + sym = 0; /* starting code symbol */ + len = min; /* starting code length */ + next = table_index; /* current table to fill in */ + curr = root; /* current table index bits */ + drop = 0; /* current bits to drop from code for index */ + low = -1; /* trigger new sub-table when len > root */ + used = 1 << root; /* use root table entries */ + mask = used - 1; /* mask for comparing low */ + + /* check available table space */ + if ((type === LENS && used > ENOUGH_LENS) || + (type === DISTS && used > ENOUGH_DISTS)) { + return 1; + } + + var i=0; + /* process all codes and make table entries */ + for (;;) { + i++; + /* create table entry */ + here_bits = len - drop; + if (work[sym] < end) { + here_op = 0; + here_val = work[sym]; + } + else if (work[sym] > end) { + here_op = extra[extra_index + work[sym]]; + here_val = base[base_index + work[sym]]; + } + else { + here_op = 32 + 64; /* end of block */ + here_val = 0; + } + + /* replicate for those indices with low len bits equal to huff */ + incr = 1 << (len - drop); + fill = 1 << curr; + min = fill; /* save offset to next table */ + do { + fill -= incr; + table[next + (huff >> drop) + fill] = (here_bits << 24) | (here_op << 16) | here_val |0; + } while (fill !== 0); + + /* backwards increment the len-bit code huff */ + incr = 1 << (len - 1); + while (huff & incr) { + incr >>= 1; + } + if (incr !== 0) { + huff &= incr - 1; + huff += incr; + } else { + huff = 0; + } + + /* go to next symbol, update count, len */ + sym++; + if (--count[len] === 0) { + if (len === max) { break; } + len = lens[lens_index + work[sym]]; + } + + /* create new sub-table if needed */ + if (len > root && (huff & mask) !== low) { + /* if first time, transition to sub-tables */ + if (drop === 0) { + drop = root; + } + + /* increment past last table */ + next += min; /* here min is 1 << curr */ + + /* determine length of next table */ + curr = len - drop; + left = 1 << curr; + while (curr + drop < max) { + left -= count[curr + drop]; + if (left <= 0) { break; } + curr++; + left <<= 1; + } + + /* check for enough space */ + used += 1 << curr; + if ((type === LENS && used > ENOUGH_LENS) || + (type === DISTS && used > ENOUGH_DISTS)) { + return 1; + } + + /* point entry in root table to sub-table */ + low = huff & mask; + /*table.op[low] = curr; + table.bits[low] = root; + table.val[low] = next - opts.table_index;*/ + table[low] = (root << 24) | (curr << 16) | (next - table_index) |0; + } + } + + /* fill in remaining table entry if code is incomplete (guaranteed to have + at most one remaining entry, since if the code is incomplete, the + maximum code length that was allowed to get this far is one bit) */ + if (huff !== 0) { + //table.op[next + huff] = 64; /* invalid code marker */ + //table.bits[next + huff] = len - drop; + //table.val[next + huff] = 0; + table[next + huff] = ((len - drop) << 24) | (64 << 16) |0; + } + + /* set return parameters */ + //opts.table_index += used; + opts.bits = root; + return 0; +}; + +},{"../utils/common":27}],37:[function(_dereq_,module,exports){ +'use strict'; + +module.exports = { + '2': 'need dictionary', /* Z_NEED_DICT 2 */ + '1': 'stream end', /* Z_STREAM_END 1 */ + '0': '', /* Z_OK 0 */ + '-1': 'file error', /* Z_ERRNO (-1) */ + '-2': 'stream error', /* Z_STREAM_ERROR (-2) */ + '-3': 'data error', /* Z_DATA_ERROR (-3) */ + '-4': 'insufficient memory', /* Z_MEM_ERROR (-4) */ + '-5': 'buffer error', /* Z_BUF_ERROR (-5) */ + '-6': 'incompatible version' /* Z_VERSION_ERROR (-6) */ +}; +},{}],38:[function(_dereq_,module,exports){ +'use strict'; + + +var utils = _dereq_('../utils/common'); + +/* Public constants ==========================================================*/ +/* ===========================================================================*/ + + +//var Z_FILTERED = 1; +//var Z_HUFFMAN_ONLY = 2; +//var Z_RLE = 3; +var Z_FIXED = 4; +//var Z_DEFAULT_STRATEGY = 0; + +/* Possible values of the data_type field (though see inflate()) */ +var Z_BINARY = 0; +var Z_TEXT = 1; +//var Z_ASCII = 1; // = Z_TEXT +var Z_UNKNOWN = 2; + +/*============================================================================*/ + + +function zero(buf) { var len = buf.length; while (--len >= 0) { buf[len] = 0; } } + +// From zutil.h + +var STORED_BLOCK = 0; +var STATIC_TREES = 1; +var DYN_TREES = 2; +/* The three kinds of block type */ + +var MIN_MATCH = 3; +var MAX_MATCH = 258; +/* The minimum and maximum match lengths */ + +// From deflate.h +/* =========================================================================== + * Internal compression state. + */ + +var LENGTH_CODES = 29; +/* number of length codes, not counting the special END_BLOCK code */ + +var LITERALS = 256; +/* number of literal bytes 0..255 */ + +var L_CODES = LITERALS + 1 + LENGTH_CODES; +/* number of Literal or Length codes, including the END_BLOCK code */ + +var D_CODES = 30; +/* number of distance codes */ + +var BL_CODES = 19; +/* number of codes used to transfer the bit lengths */ + +var HEAP_SIZE = 2*L_CODES + 1; +/* maximum heap size */ + +var MAX_BITS = 15; +/* All codes must not exceed MAX_BITS bits */ + +var Buf_size = 16; +/* size of bit buffer in bi_buf */ + + +/* =========================================================================== + * Constants + */ + +var MAX_BL_BITS = 7; +/* Bit length codes must not exceed MAX_BL_BITS bits */ + +var END_BLOCK = 256; +/* end of block literal code */ + +var REP_3_6 = 16; +/* repeat previous bit length 3-6 times (2 bits of repeat count) */ + +var REPZ_3_10 = 17; +/* repeat a zero length 3-10 times (3 bits of repeat count) */ + +var REPZ_11_138 = 18; +/* repeat a zero length 11-138 times (7 bits of repeat count) */ + +var extra_lbits = /* extra bits for each length code */ + [0,0,0,0,0,0,0,0,1,1,1,1,2,2,2,2,3,3,3,3,4,4,4,4,5,5,5,5,0]; + +var extra_dbits = /* extra bits for each distance code */ + [0,0,0,0,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13]; + +var extra_blbits = /* extra bits for each bit length code */ + [0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,3,7]; + +var bl_order = + [16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15]; +/* The lengths of the bit length codes are sent in order of decreasing + * probability, to avoid transmitting the lengths for unused bit length codes. + */ + +/* =========================================================================== + * Local data. These are initialized only once. + */ + +// We pre-fill arrays with 0 to avoid uninitialized gaps + +var DIST_CODE_LEN = 512; /* see definition of array dist_code below */ + +// !!!! Use flat array insdead of structure, Freq = i*2, Len = i*2+1 +var static_ltree = new Array((L_CODES+2) * 2); +zero(static_ltree); +/* The static literal tree. Since the bit lengths are imposed, there is no + * need for the L_CODES extra codes used during heap construction. However + * The codes 286 and 287 are needed to build a canonical tree (see _tr_init + * below). + */ + +var static_dtree = new Array(D_CODES * 2); +zero(static_dtree); +/* The static distance tree. (Actually a trivial tree since all codes use + * 5 bits.) + */ + +var _dist_code = new Array(DIST_CODE_LEN); +zero(_dist_code); +/* Distance codes. The first 256 values correspond to the distances + * 3 .. 258, the last 256 values correspond to the top 8 bits of + * the 15 bit distances. + */ + +var _length_code = new Array(MAX_MATCH-MIN_MATCH+1); +zero(_length_code); +/* length code for each normalized match length (0 == MIN_MATCH) */ + +var base_length = new Array(LENGTH_CODES); +zero(base_length); +/* First normalized length for each code (0 = MIN_MATCH) */ + +var base_dist = new Array(D_CODES); +zero(base_dist); +/* First normalized distance for each code (0 = distance of 1) */ + + +var StaticTreeDesc = function (static_tree, extra_bits, extra_base, elems, max_length) { + + this.static_tree = static_tree; /* static tree or NULL */ + this.extra_bits = extra_bits; /* extra bits for each code or NULL */ + this.extra_base = extra_base; /* base index for extra_bits */ + this.elems = elems; /* max number of elements in the tree */ + this.max_length = max_length; /* max bit length for the codes */ + + // show if `static_tree` has data or dummy - needed for monomorphic objects + this.has_stree = static_tree && static_tree.length; +}; + + +var static_l_desc; +var static_d_desc; +var static_bl_desc; + + +var TreeDesc = function(dyn_tree, stat_desc) { + this.dyn_tree = dyn_tree; /* the dynamic tree */ + this.max_code = 0; /* largest code with non zero frequency */ + this.stat_desc = stat_desc; /* the corresponding static tree */ +}; + + + +function d_code(dist) { + return dist < 256 ? _dist_code[dist] : _dist_code[256 + (dist >>> 7)]; +} + + +/* =========================================================================== + * Output a short LSB first on the stream. + * IN assertion: there is enough room in pendingBuf. + */ +function put_short (s, w) { +// put_byte(s, (uch)((w) & 0xff)); +// put_byte(s, (uch)((ush)(w) >> 8)); + s.pending_buf[s.pending++] = (w) & 0xff; + s.pending_buf[s.pending++] = (w >>> 8) & 0xff; +} + + +/* =========================================================================== + * Send a value on a given number of bits. + * IN assertion: length <= 16 and value fits in length bits. + */ +function send_bits(s, value, length) { + if (s.bi_valid > (Buf_size - length)) { + s.bi_buf |= (value << s.bi_valid) & 0xffff; + put_short(s, s.bi_buf); + s.bi_buf = value >> (Buf_size - s.bi_valid); + s.bi_valid += length - Buf_size; + } else { + s.bi_buf |= (value << s.bi_valid) & 0xffff; + s.bi_valid += length; + } +} + + +function send_code(s, c, tree) { + send_bits(s, tree[c*2]/*.Code*/, tree[c*2 + 1]/*.Len*/); +} + + +/* =========================================================================== + * Reverse the first len bits of a code, using straightforward code (a faster + * method would use a table) + * IN assertion: 1 <= len <= 15 + */ +function bi_reverse(code, len) { + var res = 0; + do { + res |= code & 1; + code >>>= 1; + res <<= 1; + } while (--len > 0); + return res >>> 1; +} + + +/* =========================================================================== + * Flush the bit buffer, keeping at most 7 bits in it. + */ +function bi_flush(s) { + if (s.bi_valid === 16) { + put_short(s, s.bi_buf); + s.bi_buf = 0; + s.bi_valid = 0; + + } else if (s.bi_valid >= 8) { + s.pending_buf[s.pending++] = s.bi_buf & 0xff; + s.bi_buf >>= 8; + s.bi_valid -= 8; + } +} + + +/* =========================================================================== + * Compute the optimal bit lengths for a tree and update the total bit length + * for the current block. + * IN assertion: the fields freq and dad are set, heap[heap_max] and + * above are the tree nodes sorted by increasing frequency. + * OUT assertions: the field len is set to the optimal bit length, the + * array bl_count contains the frequencies for each bit length. + * The length opt_len is updated; static_len is also updated if stree is + * not null. + */ +function gen_bitlen(s, desc) +// deflate_state *s; +// tree_desc *desc; /* the tree descriptor */ +{ + var tree = desc.dyn_tree; + var max_code = desc.max_code; + var stree = desc.stat_desc.static_tree; + var has_stree = desc.stat_desc.has_stree; + var extra = desc.stat_desc.extra_bits; + var base = desc.stat_desc.extra_base; + var max_length = desc.stat_desc.max_length; + var h; /* heap index */ + var n, m; /* iterate over the tree elements */ + var bits; /* bit length */ + var xbits; /* extra bits */ + var f; /* frequency */ + var overflow = 0; /* number of elements with bit length too large */ + + for (bits = 0; bits <= MAX_BITS; bits++) { + s.bl_count[bits] = 0; + } + + /* In a first pass, compute the optimal bit lengths (which may + * overflow in the case of the bit length tree). + */ + tree[s.heap[s.heap_max]*2 + 1]/*.Len*/ = 0; /* root of the heap */ + + for (h = s.heap_max+1; h < HEAP_SIZE; h++) { + n = s.heap[h]; + bits = tree[tree[n*2 +1]/*.Dad*/ * 2 + 1]/*.Len*/ + 1; + if (bits > max_length) { + bits = max_length; + overflow++; + } + tree[n*2 + 1]/*.Len*/ = bits; + /* We overwrite tree[n].Dad which is no longer needed */ + + if (n > max_code) { continue; } /* not a leaf node */ + + s.bl_count[bits]++; + xbits = 0; + if (n >= base) { + xbits = extra[n-base]; + } + f = tree[n * 2]/*.Freq*/; + s.opt_len += f * (bits + xbits); + if (has_stree) { + s.static_len += f * (stree[n*2 + 1]/*.Len*/ + xbits); + } + } + if (overflow === 0) { return; } + + // Trace((stderr,"\nbit length overflow\n")); + /* This happens for example on obj2 and pic of the Calgary corpus */ + + /* Find the first bit length which could increase: */ + do { + bits = max_length-1; + while (s.bl_count[bits] === 0) { bits--; } + s.bl_count[bits]--; /* move one leaf down the tree */ + s.bl_count[bits+1] += 2; /* move one overflow item as its brother */ + s.bl_count[max_length]--; + /* The brother of the overflow item also moves one step up, + * but this does not affect bl_count[max_length] + */ + overflow -= 2; + } while (overflow > 0); + + /* Now recompute all bit lengths, scanning in increasing frequency. + * h is still equal to HEAP_SIZE. (It is simpler to reconstruct all + * lengths instead of fixing only the wrong ones. This idea is taken + * from 'ar' written by Haruhiko Okumura.) + */ + for (bits = max_length; bits !== 0; bits--) { + n = s.bl_count[bits]; + while (n !== 0) { + m = s.heap[--h]; + if (m > max_code) { continue; } + if (tree[m*2 + 1]/*.Len*/ !== bits) { + // Trace((stderr,"code %d bits %d->%d\n", m, tree[m].Len, bits)); + s.opt_len += (bits - tree[m*2 + 1]/*.Len*/)*tree[m*2]/*.Freq*/; + tree[m*2 + 1]/*.Len*/ = bits; + } + n--; + } + } +} + + +/* =========================================================================== + * Generate the codes for a given tree and bit counts (which need not be + * optimal). + * IN assertion: the array bl_count contains the bit length statistics for + * the given tree and the field len is set for all tree elements. + * OUT assertion: the field code is set for all tree elements of non + * zero code length. + */ +function gen_codes(tree, max_code, bl_count) +// ct_data *tree; /* the tree to decorate */ +// int max_code; /* largest code with non zero frequency */ +// ushf *bl_count; /* number of codes at each bit length */ +{ + var next_code = new Array(MAX_BITS+1); /* next code value for each bit length */ + var code = 0; /* running code value */ + var bits; /* bit index */ + var n; /* code index */ + + /* The distribution counts are first used to generate the code values + * without bit reversal. + */ + for (bits = 1; bits <= MAX_BITS; bits++) { + next_code[bits] = code = (code + bl_count[bits-1]) << 1; + } + /* Check that the bit counts in bl_count are consistent. The last code + * must be all ones. + */ + //Assert (code + bl_count[MAX_BITS]-1 == (1< length code (0..28) */ + length = 0; + for (code = 0; code < LENGTH_CODES-1; code++) { + base_length[code] = length; + for (n = 0; n < (1< dist code (0..29) */ + dist = 0; + for (code = 0 ; code < 16; code++) { + base_dist[code] = dist; + for (n = 0; n < (1<>= 7; /* from now on, all distances are divided by 128 */ + for ( ; code < D_CODES; code++) { + base_dist[code] = dist << 7; + for (n = 0; n < (1<<(extra_dbits[code]-7)); n++) { + _dist_code[256 + dist++] = code; + } + } + //Assert (dist == 256, "tr_static_init: 256+dist != 512"); + + /* Construct the codes of the static literal tree */ + for (bits = 0; bits <= MAX_BITS; bits++) { + bl_count[bits] = 0; + } + + n = 0; + while (n <= 143) { + static_ltree[n*2 + 1]/*.Len*/ = 8; + n++; + bl_count[8]++; + } + while (n <= 255) { + static_ltree[n*2 + 1]/*.Len*/ = 9; + n++; + bl_count[9]++; + } + while (n <= 279) { + static_ltree[n*2 + 1]/*.Len*/ = 7; + n++; + bl_count[7]++; + } + while (n <= 287) { + static_ltree[n*2 + 1]/*.Len*/ = 8; + n++; + bl_count[8]++; + } + /* Codes 286 and 287 do not exist, but we must include them in the + * tree construction to get a canonical Huffman tree (longest code + * all ones) + */ + gen_codes(static_ltree, L_CODES+1, bl_count); + + /* The static distance tree is trivial: */ + for (n = 0; n < D_CODES; n++) { + static_dtree[n*2 + 1]/*.Len*/ = 5; + static_dtree[n*2]/*.Code*/ = bi_reverse(n, 5); + } + + // Now data ready and we can init static trees + static_l_desc = new StaticTreeDesc(static_ltree, extra_lbits, LITERALS+1, L_CODES, MAX_BITS); + static_d_desc = new StaticTreeDesc(static_dtree, extra_dbits, 0, D_CODES, MAX_BITS); + static_bl_desc =new StaticTreeDesc(new Array(0), extra_blbits, 0, BL_CODES, MAX_BL_BITS); + + //static_init_done = true; +} + + +/* =========================================================================== + * Initialize a new block. + */ +function init_block(s) { + var n; /* iterates over tree elements */ + + /* Initialize the trees. */ + for (n = 0; n < L_CODES; n++) { s.dyn_ltree[n*2]/*.Freq*/ = 0; } + for (n = 0; n < D_CODES; n++) { s.dyn_dtree[n*2]/*.Freq*/ = 0; } + for (n = 0; n < BL_CODES; n++) { s.bl_tree[n*2]/*.Freq*/ = 0; } + + s.dyn_ltree[END_BLOCK*2]/*.Freq*/ = 1; + s.opt_len = s.static_len = 0; + s.last_lit = s.matches = 0; +} + + +/* =========================================================================== + * Flush the bit buffer and align the output on a byte boundary + */ +function bi_windup(s) +{ + if (s.bi_valid > 8) { + put_short(s, s.bi_buf); + } else if (s.bi_valid > 0) { + //put_byte(s, (Byte)s->bi_buf); + s.pending_buf[s.pending++] = s.bi_buf; + } + s.bi_buf = 0; + s.bi_valid = 0; +} + +/* =========================================================================== + * Copy a stored block, storing first the length and its + * one's complement if requested. + */ +function copy_block(s, buf, len, header) +//DeflateState *s; +//charf *buf; /* the input data */ +//unsigned len; /* its length */ +//int header; /* true if block header must be written */ +{ + bi_windup(s); /* align on byte boundary */ + + if (header) { + put_short(s, len); + put_short(s, ~len); + } +// while (len--) { +// put_byte(s, *buf++); +// } + utils.arraySet(s.pending_buf, s.window, buf, len, s.pending); + s.pending += len; +} + +/* =========================================================================== + * Compares to subtrees, using the tree depth as tie breaker when + * the subtrees have equal frequency. This minimizes the worst case length. + */ +function smaller(tree, n, m, depth) { + var _n2 = n*2; + var _m2 = m*2; + return (tree[_n2]/*.Freq*/ < tree[_m2]/*.Freq*/ || + (tree[_n2]/*.Freq*/ === tree[_m2]/*.Freq*/ && depth[n] <= depth[m])); +} + +/* =========================================================================== + * Restore the heap property by moving down the tree starting at node k, + * exchanging a node with the smallest of its two sons if necessary, stopping + * when the heap property is re-established (each father smaller than its + * two sons). + */ +function pqdownheap(s, tree, k) +// deflate_state *s; +// ct_data *tree; /* the tree to restore */ +// int k; /* node to move down */ +{ + var v = s.heap[k]; + var j = k << 1; /* left son of k */ + while (j <= s.heap_len) { + /* Set j to the smallest of the two sons: */ + if (j < s.heap_len && + smaller(tree, s.heap[j+1], s.heap[j], s.depth)) { + j++; + } + /* Exit if v is smaller than both sons */ + if (smaller(tree, v, s.heap[j], s.depth)) { break; } + + /* Exchange v with the smallest son */ + s.heap[k] = s.heap[j]; + k = j; + + /* And continue down the tree, setting j to the left son of k */ + j <<= 1; + } + s.heap[k] = v; +} + + +// inlined manually +// var SMALLEST = 1; + +/* =========================================================================== + * Send the block data compressed using the given Huffman trees + */ +function compress_block(s, ltree, dtree) +// deflate_state *s; +// const ct_data *ltree; /* literal tree */ +// const ct_data *dtree; /* distance tree */ +{ + var dist; /* distance of matched string */ + var lc; /* match length or unmatched char (if dist == 0) */ + var lx = 0; /* running index in l_buf */ + var code; /* the code to send */ + var extra; /* number of extra bits to send */ + + if (s.last_lit !== 0) { + do { + dist = (s.pending_buf[s.d_buf + lx*2] << 8) | (s.pending_buf[s.d_buf + lx*2 + 1]); + lc = s.pending_buf[s.l_buf + lx]; + lx++; + + if (dist === 0) { + send_code(s, lc, ltree); /* send a literal byte */ + //Tracecv(isgraph(lc), (stderr," '%c' ", lc)); + } else { + /* Here, lc is the match length - MIN_MATCH */ + code = _length_code[lc]; + send_code(s, code+LITERALS+1, ltree); /* send the length code */ + extra = extra_lbits[code]; + if (extra !== 0) { + lc -= base_length[code]; + send_bits(s, lc, extra); /* send the extra length bits */ + } + dist--; /* dist is now the match distance - 1 */ + code = d_code(dist); + //Assert (code < D_CODES, "bad d_code"); + + send_code(s, code, dtree); /* send the distance code */ + extra = extra_dbits[code]; + if (extra !== 0) { + dist -= base_dist[code]; + send_bits(s, dist, extra); /* send the extra distance bits */ + } + } /* literal or match pair ? */ + + /* Check that the overlay between pending_buf and d_buf+l_buf is ok: */ + //Assert((uInt)(s->pending) < s->lit_bufsize + 2*lx, + // "pendingBuf overflow"); + + } while (lx < s.last_lit); + } + + send_code(s, END_BLOCK, ltree); +} + + +/* =========================================================================== + * Construct one Huffman tree and assigns the code bit strings and lengths. + * Update the total bit length for the current block. + * IN assertion: the field freq is set for all tree elements. + * OUT assertions: the fields len and code are set to the optimal bit length + * and corresponding code. The length opt_len is updated; static_len is + * also updated if stree is not null. The field max_code is set. + */ +function build_tree(s, desc) +// deflate_state *s; +// tree_desc *desc; /* the tree descriptor */ +{ + var tree = desc.dyn_tree; + var stree = desc.stat_desc.static_tree; + var has_stree = desc.stat_desc.has_stree; + var elems = desc.stat_desc.elems; + var n, m; /* iterate over heap elements */ + var max_code = -1; /* largest code with non zero frequency */ + var node; /* new node being created */ + + /* Construct the initial heap, with least frequent element in + * heap[SMALLEST]. The sons of heap[n] are heap[2*n] and heap[2*n+1]. + * heap[0] is not used. + */ + s.heap_len = 0; + s.heap_max = HEAP_SIZE; + + for (n = 0; n < elems; n++) { + if (tree[n * 2]/*.Freq*/ !== 0) { + s.heap[++s.heap_len] = max_code = n; + s.depth[n] = 0; + + } else { + tree[n*2 + 1]/*.Len*/ = 0; + } + } + + /* The pkzip format requires that at least one distance code exists, + * and that at least one bit should be sent even if there is only one + * possible code. So to avoid special checks later on we force at least + * two codes of non zero frequency. + */ + while (s.heap_len < 2) { + node = s.heap[++s.heap_len] = (max_code < 2 ? ++max_code : 0); + tree[node * 2]/*.Freq*/ = 1; + s.depth[node] = 0; + s.opt_len--; + + if (has_stree) { + s.static_len -= stree[node*2 + 1]/*.Len*/; + } + /* node is 0 or 1 so it does not have extra bits */ + } + desc.max_code = max_code; + + /* The elements heap[heap_len/2+1 .. heap_len] are leaves of the tree, + * establish sub-heaps of increasing lengths: + */ + for (n = (s.heap_len >> 1/*int /2*/); n >= 1; n--) { pqdownheap(s, tree, n); } + + /* Construct the Huffman tree by repeatedly combining the least two + * frequent nodes. + */ + node = elems; /* next internal node of the tree */ + do { + //pqremove(s, tree, n); /* n = node of least frequency */ + /*** pqremove ***/ + n = s.heap[1/*SMALLEST*/]; + s.heap[1/*SMALLEST*/] = s.heap[s.heap_len--]; + pqdownheap(s, tree, 1/*SMALLEST*/); + /***/ + + m = s.heap[1/*SMALLEST*/]; /* m = node of next least frequency */ + + s.heap[--s.heap_max] = n; /* keep the nodes sorted by frequency */ + s.heap[--s.heap_max] = m; + + /* Create a new node father of n and m */ + tree[node * 2]/*.Freq*/ = tree[n * 2]/*.Freq*/ + tree[m * 2]/*.Freq*/; + s.depth[node] = (s.depth[n] >= s.depth[m] ? s.depth[n] : s.depth[m]) + 1; + tree[n*2 + 1]/*.Dad*/ = tree[m*2 + 1]/*.Dad*/ = node; + + /* and insert the new node in the heap */ + s.heap[1/*SMALLEST*/] = node++; + pqdownheap(s, tree, 1/*SMALLEST*/); + + } while (s.heap_len >= 2); + + s.heap[--s.heap_max] = s.heap[1/*SMALLEST*/]; + + /* At this point, the fields freq and dad are set. We can now + * generate the bit lengths. + */ + gen_bitlen(s, desc); + + /* The field len is now set, we can generate the bit codes */ + gen_codes(tree, max_code, s.bl_count); +} + + +/* =========================================================================== + * Scan a literal or distance tree to determine the frequencies of the codes + * in the bit length tree. + */ +function scan_tree(s, tree, max_code) +// deflate_state *s; +// ct_data *tree; /* the tree to be scanned */ +// int max_code; /* and its largest code of non zero frequency */ +{ + var n; /* iterates over all tree elements */ + var prevlen = -1; /* last emitted length */ + var curlen; /* length of current code */ + + var nextlen = tree[0*2 + 1]/*.Len*/; /* length of next code */ + + var count = 0; /* repeat count of the current code */ + var max_count = 7; /* max repeat count */ + var min_count = 4; /* min repeat count */ + + if (nextlen === 0) { + max_count = 138; + min_count = 3; + } + tree[(max_code+1)*2 + 1]/*.Len*/ = 0xffff; /* guard */ + + for (n = 0; n <= max_code; n++) { + curlen = nextlen; + nextlen = tree[(n+1)*2 + 1]/*.Len*/; + + if (++count < max_count && curlen === nextlen) { + continue; + + } else if (count < min_count) { + s.bl_tree[curlen * 2]/*.Freq*/ += count; + + } else if (curlen !== 0) { + + if (curlen !== prevlen) { s.bl_tree[curlen * 2]/*.Freq*/++; } + s.bl_tree[REP_3_6*2]/*.Freq*/++; + + } else if (count <= 10) { + s.bl_tree[REPZ_3_10*2]/*.Freq*/++; + + } else { + s.bl_tree[REPZ_11_138*2]/*.Freq*/++; + } + + count = 0; + prevlen = curlen; + + if (nextlen === 0) { + max_count = 138; + min_count = 3; + + } else if (curlen === nextlen) { + max_count = 6; + min_count = 3; + + } else { + max_count = 7; + min_count = 4; + } + } +} + + +/* =========================================================================== + * Send a literal or distance tree in compressed form, using the codes in + * bl_tree. + */ +function send_tree(s, tree, max_code) +// deflate_state *s; +// ct_data *tree; /* the tree to be scanned */ +// int max_code; /* and its largest code of non zero frequency */ +{ + var n; /* iterates over all tree elements */ + var prevlen = -1; /* last emitted length */ + var curlen; /* length of current code */ + + var nextlen = tree[0*2 + 1]/*.Len*/; /* length of next code */ + + var count = 0; /* repeat count of the current code */ + var max_count = 7; /* max repeat count */ + var min_count = 4; /* min repeat count */ + + /* tree[max_code+1].Len = -1; */ /* guard already set */ + if (nextlen === 0) { + max_count = 138; + min_count = 3; + } + + for (n = 0; n <= max_code; n++) { + curlen = nextlen; + nextlen = tree[(n+1)*2 + 1]/*.Len*/; + + if (++count < max_count && curlen === nextlen) { + continue; + + } else if (count < min_count) { + do { send_code(s, curlen, s.bl_tree); } while (--count !== 0); + + } else if (curlen !== 0) { + if (curlen !== prevlen) { + send_code(s, curlen, s.bl_tree); + count--; + } + //Assert(count >= 3 && count <= 6, " 3_6?"); + send_code(s, REP_3_6, s.bl_tree); + send_bits(s, count-3, 2); + + } else if (count <= 10) { + send_code(s, REPZ_3_10, s.bl_tree); + send_bits(s, count-3, 3); + + } else { + send_code(s, REPZ_11_138, s.bl_tree); + send_bits(s, count-11, 7); + } + + count = 0; + prevlen = curlen; + if (nextlen === 0) { + max_count = 138; + min_count = 3; + + } else if (curlen === nextlen) { + max_count = 6; + min_count = 3; + + } else { + max_count = 7; + min_count = 4; + } + } +} + + +/* =========================================================================== + * Construct the Huffman tree for the bit lengths and return the index in + * bl_order of the last bit length code to send. + */ +function build_bl_tree(s) { + var max_blindex; /* index of last bit length code of non zero freq */ + + /* Determine the bit length frequencies for literal and distance trees */ + scan_tree(s, s.dyn_ltree, s.l_desc.max_code); + scan_tree(s, s.dyn_dtree, s.d_desc.max_code); + + /* Build the bit length tree: */ + build_tree(s, s.bl_desc); + /* opt_len now includes the length of the tree representations, except + * the lengths of the bit lengths codes and the 5+5+4 bits for the counts. + */ + + /* Determine the number of bit length codes to send. The pkzip format + * requires that at least 4 bit length codes be sent. (appnote.txt says + * 3 but the actual value used is 4.) + */ + for (max_blindex = BL_CODES-1; max_blindex >= 3; max_blindex--) { + if (s.bl_tree[bl_order[max_blindex]*2 + 1]/*.Len*/ !== 0) { + break; + } + } + /* Update opt_len to include the bit length tree and counts */ + s.opt_len += 3*(max_blindex+1) + 5+5+4; + //Tracev((stderr, "\ndyn trees: dyn %ld, stat %ld", + // s->opt_len, s->static_len)); + + return max_blindex; +} + + +/* =========================================================================== + * Send the header for a block using dynamic Huffman trees: the counts, the + * lengths of the bit length codes, the literal tree and the distance tree. + * IN assertion: lcodes >= 257, dcodes >= 1, blcodes >= 4. + */ +function send_all_trees(s, lcodes, dcodes, blcodes) +// deflate_state *s; +// int lcodes, dcodes, blcodes; /* number of codes for each tree */ +{ + var rank; /* index in bl_order */ + + //Assert (lcodes >= 257 && dcodes >= 1 && blcodes >= 4, "not enough codes"); + //Assert (lcodes <= L_CODES && dcodes <= D_CODES && blcodes <= BL_CODES, + // "too many codes"); + //Tracev((stderr, "\nbl counts: ")); + send_bits(s, lcodes-257, 5); /* not +255 as stated in appnote.txt */ + send_bits(s, dcodes-1, 5); + send_bits(s, blcodes-4, 4); /* not -3 as stated in appnote.txt */ + for (rank = 0; rank < blcodes; rank++) { + //Tracev((stderr, "\nbl code %2d ", bl_order[rank])); + send_bits(s, s.bl_tree[bl_order[rank]*2 + 1]/*.Len*/, 3); + } + //Tracev((stderr, "\nbl tree: sent %ld", s->bits_sent)); + + send_tree(s, s.dyn_ltree, lcodes-1); /* literal tree */ + //Tracev((stderr, "\nlit tree: sent %ld", s->bits_sent)); + + send_tree(s, s.dyn_dtree, dcodes-1); /* distance tree */ + //Tracev((stderr, "\ndist tree: sent %ld", s->bits_sent)); +} + + +/* =========================================================================== + * Check if the data type is TEXT or BINARY, using the following algorithm: + * - TEXT if the two conditions below are satisfied: + * a) There are no non-portable control characters belonging to the + * "black list" (0..6, 14..25, 28..31). + * b) There is at least one printable character belonging to the + * "white list" (9 {TAB}, 10 {LF}, 13 {CR}, 32..255). + * - BINARY otherwise. + * - The following partially-portable control characters form a + * "gray list" that is ignored in this detection algorithm: + * (7 {BEL}, 8 {BS}, 11 {VT}, 12 {FF}, 26 {SUB}, 27 {ESC}). + * IN assertion: the fields Freq of dyn_ltree are set. + */ +function detect_data_type(s) { + /* black_mask is the bit mask of black-listed bytes + * set bits 0..6, 14..25, and 28..31 + * 0xf3ffc07f = binary 11110011111111111100000001111111 + */ + var black_mask = 0xf3ffc07f; + var n; + + /* Check for non-textual ("black-listed") bytes. */ + for (n = 0; n <= 31; n++, black_mask >>>= 1) { + if ((black_mask & 1) && (s.dyn_ltree[n*2]/*.Freq*/ !== 0)) { + return Z_BINARY; + } + } + + /* Check for textual ("white-listed") bytes. */ + if (s.dyn_ltree[9 * 2]/*.Freq*/ !== 0 || s.dyn_ltree[10 * 2]/*.Freq*/ !== 0 || + s.dyn_ltree[13 * 2]/*.Freq*/ !== 0) { + return Z_TEXT; + } + for (n = 32; n < LITERALS; n++) { + if (s.dyn_ltree[n * 2]/*.Freq*/ !== 0) { + return Z_TEXT; + } + } + + /* There are no "black-listed" or "white-listed" bytes: + * this stream either is empty or has tolerated ("gray-listed") bytes only. + */ + return Z_BINARY; +} + + +var static_init_done = false; + +/* =========================================================================== + * Initialize the tree data structures for a new zlib stream. + */ +function _tr_init(s) +{ + + if (!static_init_done) { + tr_static_init(); + static_init_done = true; + } + + s.l_desc = new TreeDesc(s.dyn_ltree, static_l_desc); + s.d_desc = new TreeDesc(s.dyn_dtree, static_d_desc); + s.bl_desc = new TreeDesc(s.bl_tree, static_bl_desc); + + s.bi_buf = 0; + s.bi_valid = 0; + + /* Initialize the first block of the first file: */ + init_block(s); +} + + +/* =========================================================================== + * Send a stored block + */ +function _tr_stored_block(s, buf, stored_len, last) +//DeflateState *s; +//charf *buf; /* input block */ +//ulg stored_len; /* length of input block */ +//int last; /* one if this is the last block for a file */ +{ + send_bits(s, (STORED_BLOCK<<1)+(last ? 1 : 0), 3); /* send block type */ + copy_block(s, buf, stored_len, true); /* with header */ +} + + +/* =========================================================================== + * Send one empty static block to give enough lookahead for inflate. + * This takes 10 bits, of which 7 may remain in the bit buffer. + */ +function _tr_align(s) { + send_bits(s, STATIC_TREES<<1, 3); + send_code(s, END_BLOCK, static_ltree); + bi_flush(s); +} + + +/* =========================================================================== + * Determine the best encoding for the current block: dynamic trees, static + * trees or store, and output the encoded block to the zip file. + */ +function _tr_flush_block(s, buf, stored_len, last) +//DeflateState *s; +//charf *buf; /* input block, or NULL if too old */ +//ulg stored_len; /* length of input block */ +//int last; /* one if this is the last block for a file */ +{ + var opt_lenb, static_lenb; /* opt_len and static_len in bytes */ + var max_blindex = 0; /* index of last bit length code of non zero freq */ + + /* Build the Huffman trees unless a stored block is forced */ + if (s.level > 0) { + + /* Check if the file is binary or text */ + if (s.strm.data_type === Z_UNKNOWN) { + s.strm.data_type = detect_data_type(s); + } + + /* Construct the literal and distance trees */ + build_tree(s, s.l_desc); + // Tracev((stderr, "\nlit data: dyn %ld, stat %ld", s->opt_len, + // s->static_len)); + + build_tree(s, s.d_desc); + // Tracev((stderr, "\ndist data: dyn %ld, stat %ld", s->opt_len, + // s->static_len)); + /* At this point, opt_len and static_len are the total bit lengths of + * the compressed block data, excluding the tree representations. + */ + + /* Build the bit length tree for the above two trees, and get the index + * in bl_order of the last bit length code to send. + */ + max_blindex = build_bl_tree(s); + + /* Determine the best encoding. Compute the block lengths in bytes. */ + opt_lenb = (s.opt_len+3+7) >>> 3; + static_lenb = (s.static_len+3+7) >>> 3; + + // Tracev((stderr, "\nopt %lu(%lu) stat %lu(%lu) stored %lu lit %u ", + // opt_lenb, s->opt_len, static_lenb, s->static_len, stored_len, + // s->last_lit)); + + if (static_lenb <= opt_lenb) { opt_lenb = static_lenb; } + + } else { + // Assert(buf != (char*)0, "lost buf"); + opt_lenb = static_lenb = stored_len + 5; /* force a stored block */ + } + + if ((stored_len+4 <= opt_lenb) && (buf !== -1)) { + /* 4: two words for the lengths */ + + /* The test buf != NULL is only necessary if LIT_BUFSIZE > WSIZE. + * Otherwise we can't have processed more than WSIZE input bytes since + * the last block flush, because compression would have been + * successful. If LIT_BUFSIZE <= WSIZE, it is never too late to + * transform a block into a stored block. + */ + _tr_stored_block(s, buf, stored_len, last); + + } else if (s.strategy === Z_FIXED || static_lenb === opt_lenb) { + + send_bits(s, (STATIC_TREES<<1) + (last ? 1 : 0), 3); + compress_block(s, static_ltree, static_dtree); + + } else { + send_bits(s, (DYN_TREES<<1) + (last ? 1 : 0), 3); + send_all_trees(s, s.l_desc.max_code+1, s.d_desc.max_code+1, max_blindex+1); + compress_block(s, s.dyn_ltree, s.dyn_dtree); + } + // Assert (s->compressed_len == s->bits_sent, "bad compressed size"); + /* The above check is made mod 2^32, for files larger than 512 MB + * and uLong implemented on 32 bits. + */ + init_block(s); + + if (last) { + bi_windup(s); + } + // Tracev((stderr,"\ncomprlen %lu(%lu) ", s->compressed_len>>3, + // s->compressed_len-7*last)); +} + +/* =========================================================================== + * Save the match info and tally the frequency counts. Return true if + * the current block must be flushed. + */ +function _tr_tally(s, dist, lc) +// deflate_state *s; +// unsigned dist; /* distance of matched string */ +// unsigned lc; /* match length-MIN_MATCH or unmatched char (if dist==0) */ +{ + //var out_length, in_length, dcode; + + s.pending_buf[s.d_buf + s.last_lit * 2] = (dist >>> 8) & 0xff; + s.pending_buf[s.d_buf + s.last_lit * 2 + 1] = dist & 0xff; + + s.pending_buf[s.l_buf + s.last_lit] = lc & 0xff; + s.last_lit++; + + if (dist === 0) { + /* lc is the unmatched char */ + s.dyn_ltree[lc*2]/*.Freq*/++; + } else { + s.matches++; + /* Here, lc is the match length - MIN_MATCH */ + dist--; /* dist = match distance - 1 */ + //Assert((ush)dist < (ush)MAX_DIST(s) && + // (ush)lc <= (ush)(MAX_MATCH-MIN_MATCH) && + // (ush)d_code(dist) < (ush)D_CODES, "_tr_tally: bad match"); + + s.dyn_ltree[(_length_code[lc]+LITERALS+1) * 2]/*.Freq*/++; + s.dyn_dtree[d_code(dist) * 2]/*.Freq*/++; + } + +// (!) This block is disabled in zlib defailts, +// don't enable it for binary compatibility + +//#ifdef TRUNCATE_BLOCK +// /* Try to guess if it is profitable to stop the current block here */ +// if ((s.last_lit & 0x1fff) === 0 && s.level > 2) { +// /* Compute an upper bound for the compressed length */ +// out_length = s.last_lit*8; +// in_length = s.strstart - s.block_start; +// +// for (dcode = 0; dcode < D_CODES; dcode++) { +// out_length += s.dyn_dtree[dcode*2]/*.Freq*/ * (5 + extra_dbits[dcode]); +// } +// out_length >>>= 3; +// //Tracev((stderr,"\nlast_lit %u, in %ld, out ~%ld(%ld%%) ", +// // s->last_lit, in_length, out_length, +// // 100L - out_length*100L/in_length)); +// if (s.matches < (s.last_lit>>1)/*int /2*/ && out_length < (in_length>>1)/*int /2*/) { +// return true; +// } +// } +//#endif + + return (s.last_lit === s.lit_bufsize-1); + /* We avoid equality with lit_bufsize because of wraparound at 64K + * on 16 bit machines and because stored blocks are restricted to + * 64K-1 bytes. + */ +} + +exports._tr_init = _tr_init; +exports._tr_stored_block = _tr_stored_block; +exports._tr_flush_block = _tr_flush_block; +exports._tr_tally = _tr_tally; +exports._tr_align = _tr_align; +},{"../utils/common":27}],39:[function(_dereq_,module,exports){ +'use strict'; + + +function ZStream() { + /* next input byte */ + this.input = null; // JS specific, because we have no pointers + this.next_in = 0; + /* number of bytes available at input */ + this.avail_in = 0; + /* total number of input bytes read so far */ + this.total_in = 0; + /* next output byte should be put there */ + this.output = null; // JS specific, because we have no pointers + this.next_out = 0; + /* remaining free space at output */ + this.avail_out = 0; + /* total number of bytes output so far */ + this.total_out = 0; + /* last error message, NULL if no error */ + this.msg = ''/*Z_NULL*/; + /* not visible by applications */ + this.state = null; + /* best guess about the data type: binary or text */ + this.data_type = 2/*Z_UNKNOWN*/; + /* adler32 value of the uncompressed data */ + this.adler = 0; +} + +module.exports = ZStream; +},{}]},{},[9]) +(9) +}); \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/jszip/jszip.min.js b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/jszip/jszip.min.js new file mode 100644 index 0000000..a09f35b --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/jszip/jszip.min.js @@ -0,0 +1,14 @@ +/*! + +JSZip - A Javascript class for generating and reading zip files + + +(c) 2009-2014 Stuart Knightley +Dual licenced under the MIT license or GPLv3. See https://raw.github.com/Stuk/jszip/master/LICENSE.markdown. + +JSZip uses the library pako released under the MIT license : +https://github.com/nodeca/pako/blob/master/LICENSE +*/ +!function(a){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=a();else if("function"==typeof define&&define.amd)define([],a);else{var b;"undefined"!=typeof window?b=window:"undefined"!=typeof global?b=global:"undefined"!=typeof self&&(b=self),b.JSZip=a()}}(function(){return function a(b,c,d){function e(g,h){if(!c[g]){if(!b[g]){var i="function"==typeof require&&require;if(!h&&i)return i(g,!0);if(f)return f(g,!0);throw new Error("Cannot find module '"+g+"'")}var j=c[g]={exports:{}};b[g][0].call(j.exports,function(a){var c=b[g][1][a];return e(c?c:a)},j,j.exports,a,b,c,d)}return c[g].exports}for(var f="function"==typeof require&&require,g=0;g>2,g=(3&b)<<4|c>>4,h=(15&c)<<2|e>>6,i=63&e,isNaN(c)?h=i=64:isNaN(e)&&(i=64),j=j+d.charAt(f)+d.charAt(g)+d.charAt(h)+d.charAt(i);return j},c.decode=function(a){var b,c,e,f,g,h,i,j="",k=0;for(a=a.replace(/[^A-Za-z0-9\+\/\=]/g,"");k>4,c=(15&g)<<4|h>>2,e=(3&h)<<6|i,j+=String.fromCharCode(b),64!=h&&(j+=String.fromCharCode(c)),64!=i&&(j+=String.fromCharCode(e));return j}},{}],2:[function(a,b){"use strict";function c(){this.compressedSize=0,this.uncompressedSize=0,this.crc32=0,this.compressionMethod=null,this.compressedContent=null}c.prototype={getContent:function(){return null},getCompressedContent:function(){return null}},b.exports=c},{}],3:[function(a,b,c){"use strict";c.STORE={magic:"\x00\x00",compress:function(a){return a},uncompress:function(a){return a},compressInputType:null,uncompressInputType:null},c.DEFLATE=a("./flate")},{"./flate":8}],4:[function(a,b){"use strict";var c=a("./utils"),d=[0,1996959894,3993919788,2567524794,124634137,1886057615,3915621685,2657392035,249268274,2044508324,3772115230,2547177864,162941995,2125561021,3887607047,2428444049,498536548,1789927666,4089016648,2227061214,450548861,1843258603,4107580753,2211677639,325883990,1684777152,4251122042,2321926636,335633487,1661365465,4195302755,2366115317,997073096,1281953886,3579855332,2724688242,1006888145,1258607687,3524101629,2768942443,901097722,1119000684,3686517206,2898065728,853044451,1172266101,3705015759,2882616665,651767980,1373503546,3369554304,3218104598,565507253,1454621731,3485111705,3099436303,671266974,1594198024,3322730930,2970347812,795835527,1483230225,3244367275,3060149565,1994146192,31158534,2563907772,4023717930,1907459465,112637215,2680153253,3904427059,2013776290,251722036,2517215374,3775830040,2137656763,141376813,2439277719,3865271297,1802195444,476864866,2238001368,4066508878,1812370925,453092731,2181625025,4111451223,1706088902,314042704,2344532202,4240017532,1658658271,366619977,2362670323,4224994405,1303535960,984961486,2747007092,3569037538,1256170817,1037604311,2765210733,3554079995,1131014506,879679996,2909243462,3663771856,1141124467,855842277,2852801631,3708648649,1342533948,654459306,3188396048,3373015174,1466479909,544179635,3110523913,3462522015,1591671054,702138776,2966460450,3352799412,1504918807,783551873,3082640443,3233442989,3988292384,2596254646,62317068,1957810842,3939845945,2647816111,81470997,1943803523,3814918930,2489596804,225274430,2053790376,3826175755,2466906013,167816743,2097651377,4027552580,2265490386,503444072,1762050814,4150417245,2154129355,426522225,1852507879,4275313526,2312317920,282753626,1742555852,4189708143,2394877945,397917763,1622183637,3604390888,2714866558,953729732,1340076626,3518719985,2797360999,1068828381,1219638859,3624741850,2936675148,906185462,1090812512,3747672003,2825379669,829329135,1181335161,3412177804,3160834842,628085408,1382605366,3423369109,3138078467,570562233,1426400815,3317316542,2998733608,733239954,1555261956,3268935591,3050360625,752459403,1541320221,2607071920,3965973030,1969922972,40735498,2617837225,3943577151,1913087877,83908371,2512341634,3803740692,2075208622,213261112,2463272603,3855990285,2094854071,198958881,2262029012,4057260610,1759359992,534414190,2176718541,4139329115,1873836001,414664567,2282248934,4279200368,1711684554,285281116,2405801727,4167216745,1634467795,376229701,2685067896,3608007406,1308918612,956543938,2808555105,3495958263,1231636301,1047427035,2932959818,3654703836,1088359270,936918e3,2847714899,3736837829,1202900863,817233897,3183342108,3401237130,1404277552,615818150,3134207493,3453421203,1423857449,601450431,3009837614,3294710456,1567103746,711928724,3020668471,3272380065,1510334235,755167117];b.exports=function(a,b){if("undefined"==typeof a||!a.length)return 0;var e="string"!==c.getTypeOf(a);"undefined"==typeof b&&(b=0);var f=0,g=0,h=0;b=-1^b;for(var i=0,j=a.length;j>i;i++)h=e?a[i]:a.charCodeAt(i),g=255&(b^h),f=d[g],b=b>>>8^f;return-1^b}},{"./utils":21}],5:[function(a,b){"use strict";function c(){this.data=null,this.length=0,this.index=0}var d=a("./utils");c.prototype={checkOffset:function(a){this.checkIndex(this.index+a)},checkIndex:function(a){if(this.lengtha)throw new Error("End of data reached (data length = "+this.length+", asked index = "+a+"). Corrupted zip ?")},setIndex:function(a){this.checkIndex(a),this.index=a},skip:function(a){this.setIndex(this.index+a)},byteAt:function(){},readInt:function(a){var b,c=0;for(this.checkOffset(a),b=this.index+a-1;b>=this.index;b--)c=(c<<8)+this.byteAt(b);return this.index+=a,c},readString:function(a){return d.transformTo("string",this.readData(a))},readData:function(){},lastIndexOfSignature:function(){},readDate:function(){var a=this.readInt(4);return new Date((a>>25&127)+1980,(a>>21&15)-1,a>>16&31,a>>11&31,a>>5&63,(31&a)<<1)}},b.exports=c},{"./utils":21}],6:[function(a,b,c){"use strict";c.base64=!1,c.binary=!1,c.dir=!1,c.createFolders=!1,c.date=null,c.compression=null,c.compressionOptions=null,c.comment=null,c.unixPermissions=null,c.dosPermissions=null},{}],7:[function(a,b,c){"use strict";var d=a("./utils");c.string2binary=function(a){return d.string2binary(a)},c.string2Uint8Array=function(a){return d.transformTo("uint8array",a)},c.uint8Array2String=function(a){return d.transformTo("string",a)},c.string2Blob=function(a){var b=d.transformTo("arraybuffer",a);return d.arrayBuffer2Blob(b)},c.arrayBuffer2Blob=function(a){return d.arrayBuffer2Blob(a)},c.transformTo=function(a,b){return d.transformTo(a,b)},c.getTypeOf=function(a){return d.getTypeOf(a)},c.checkSupport=function(a){return d.checkSupport(a)},c.MAX_VALUE_16BITS=d.MAX_VALUE_16BITS,c.MAX_VALUE_32BITS=d.MAX_VALUE_32BITS,c.pretty=function(a){return d.pretty(a)},c.findCompression=function(a){return d.findCompression(a)},c.isRegExp=function(a){return d.isRegExp(a)}},{"./utils":21}],8:[function(a,b,c){"use strict";var d="undefined"!=typeof Uint8Array&&"undefined"!=typeof Uint16Array&&"undefined"!=typeof Uint32Array,e=a("pako");c.uncompressInputType=d?"uint8array":"array",c.compressInputType=d?"uint8array":"array",c.magic="\b\x00",c.compress=function(a,b){return e.deflateRaw(a,{level:b.level||-1})},c.uncompress=function(a){return e.inflateRaw(a)}},{pako:24}],9:[function(a,b){"use strict";function c(a,b){return this instanceof c?(this.files={},this.comment=null,this.root="",a&&this.load(a,b),void(this.clone=function(){var a=new c;for(var b in this)"function"!=typeof this[b]&&(a[b]=this[b]);return a})):new c(a,b)}var d=a("./base64");c.prototype=a("./object"),c.prototype.load=a("./load"),c.support=a("./support"),c.defaults=a("./defaults"),c.utils=a("./deprecatedPublicUtils"),c.base64={encode:function(a){return d.encode(a)},decode:function(a){return d.decode(a)}},c.compressions=a("./compressions"),b.exports=c},{"./base64":1,"./compressions":3,"./defaults":6,"./deprecatedPublicUtils":7,"./load":10,"./object":13,"./support":17}],10:[function(a,b){"use strict";var c=a("./base64"),d=a("./zipEntries");b.exports=function(a,b){var e,f,g,h;for(b=b||{},b.base64&&(a=c.decode(a)),f=new d(a,b),e=f.files,g=0;gc;c++)d+=String.fromCharCode(255&a),a>>>=8;return d},t=function(){var a,b,c={};for(a=0;a0?a.substring(0,b):""},x=function(a){return"/"!=a.slice(-1)&&(a+="/"),a},y=function(a,b){return b="undefined"!=typeof b?b:!1,a=x(a),this.files[a]||v.call(this,a,null,{dir:!0,createFolders:b}),this.files[a]},z=function(a,b,c){var f,g=new j;return a._data instanceof j?(g.uncompressedSize=a._data.uncompressedSize,g.crc32=a._data.crc32,0===g.uncompressedSize||a.dir?(b=i.STORE,g.compressedContent="",g.crc32=0):a._data.compressionMethod===b.magic?g.compressedContent=a._data.getCompressedContent():(f=a._data.getContent(),g.compressedContent=b.compress(d.transformTo(b.compressInputType,f),c))):(f=p(a),(!f||0===f.length||a.dir)&&(b=i.STORE,f=""),g.uncompressedSize=f.length,g.crc32=e(f),g.compressedContent=b.compress(d.transformTo(b.compressInputType,f),c)),g.compressedSize=g.compressedContent.length,g.compressionMethod=b.magic,g},A=function(a,b){var c=a;return a||(c=b?16893:33204),(65535&c)<<16},B=function(a){return 63&(a||0)},C=function(a,b,c,g,h){var i,j,k,m,n=(c.compressedContent,d.transformTo("string",l.utf8encode(b.name))),o=b.comment||"",p=d.transformTo("string",l.utf8encode(o)),q=n.length!==b.name.length,r=p.length!==o.length,t=b.options,u="",v="",w="";k=b._initialMetadata.dir!==b.dir?b.dir:t.dir,m=b._initialMetadata.date!==b.date?b.date:t.date;var x=0,y=0;k&&(x|=16),"UNIX"===h?(y=798,x|=A(b.unixPermissions,k)):(y=20,x|=B(b.dosPermissions,k)),i=m.getHours(),i<<=6,i|=m.getMinutes(),i<<=5,i|=m.getSeconds()/2,j=m.getFullYear()-1980,j<<=4,j|=m.getMonth()+1,j<<=5,j|=m.getDate(),q&&(v=s(1,1)+s(e(n),4)+n,u+="up"+s(v.length,2)+v),r&&(w=s(1,1)+s(this.crc32(p),4)+p,u+="uc"+s(w.length,2)+w);var z="";z+="\n\x00",z+=q||r?"\x00\b":"\x00\x00",z+=c.compressionMethod,z+=s(i,2),z+=s(j,2),z+=s(c.crc32,4),z+=s(c.compressedSize,4),z+=s(c.uncompressedSize,4),z+=s(n.length,2),z+=s(u.length,2);var C=f.LOCAL_FILE_HEADER+z+n+u,D=f.CENTRAL_FILE_HEADER+s(y,2)+z+s(p.length,2)+"\x00\x00\x00\x00"+s(x,4)+s(g,4)+n+u+p;return{fileRecord:C,dirRecord:D,compressedObject:c}},D={load:function(){throw new Error("Load method is not defined. Is the file jszip-load.js included ?")},filter:function(a){var b,c,d,e,f=[];for(b in this.files)this.files.hasOwnProperty(b)&&(d=this.files[b],e=new r(d.name,d._data,t(d.options)),c=b.slice(this.root.length,b.length),b.slice(0,this.root.length)===this.root&&a(c,e)&&f.push(e));return f},file:function(a,b,c){if(1===arguments.length){if(d.isRegExp(a)){var e=a;return this.filter(function(a,b){return!b.dir&&e.test(a)})}return this.filter(function(b,c){return!c.dir&&b===a})[0]||null}return a=this.root+a,v.call(this,a,b,c),this},folder:function(a){if(!a)return this;if(d.isRegExp(a))return this.filter(function(b,c){return c.dir&&a.test(b)});var b=this.root+a,c=y.call(this,b),e=this.clone();return e.root=c.name,e},remove:function(a){a=this.root+a;var b=this.files[a];if(b||("/"!=a.slice(-1)&&(a+="/"),b=this.files[a]),b&&!b.dir)delete this.files[a];else for(var c=this.filter(function(b,c){return c.name.slice(0,a.length)===a}),d=0;d=0;--f)if(this.data[f]===b&&this.data[f+1]===c&&this.data[f+2]===d&&this.data[f+3]===e)return f;return-1},c.prototype.readData=function(a){if(this.checkOffset(a),0===a)return new Uint8Array(0);var b=this.data.subarray(this.index,this.index+a);return this.index+=a,b},b.exports=c},{"./dataReader":5}],19:[function(a,b){"use strict";var c=a("./utils"),d=function(a){this.data=new Uint8Array(a),this.index=0};d.prototype={append:function(a){0!==a.length&&(a=c.transformTo("uint8array",a),this.data.set(a,this.index),this.index+=a.length)},finalize:function(){return this.data}},b.exports=d},{"./utils":21}],20:[function(a,b,c){"use strict";for(var d=a("./utils"),e=a("./support"),f=a("./nodeBuffer"),g=new Array(256),h=0;256>h;h++)g[h]=h>=252?6:h>=248?5:h>=240?4:h>=224?3:h>=192?2:1;g[254]=g[254]=1;var i=function(a){var b,c,d,f,g,h=a.length,i=0;for(f=0;h>f;f++)c=a.charCodeAt(f),55296===(64512&c)&&h>f+1&&(d=a.charCodeAt(f+1),56320===(64512&d)&&(c=65536+(c-55296<<10)+(d-56320),f++)),i+=128>c?1:2048>c?2:65536>c?3:4;for(b=e.uint8array?new Uint8Array(i):new Array(i),g=0,f=0;i>g;f++)c=a.charCodeAt(f),55296===(64512&c)&&h>f+1&&(d=a.charCodeAt(f+1),56320===(64512&d)&&(c=65536+(c-55296<<10)+(d-56320),f++)),128>c?b[g++]=c:2048>c?(b[g++]=192|c>>>6,b[g++]=128|63&c):65536>c?(b[g++]=224|c>>>12,b[g++]=128|c>>>6&63,b[g++]=128|63&c):(b[g++]=240|c>>>18,b[g++]=128|c>>>12&63,b[g++]=128|c>>>6&63,b[g++]=128|63&c);return b},j=function(a,b){var c;for(b=b||a.length,b>a.length&&(b=a.length),c=b-1;c>=0&&128===(192&a[c]);)c--;return 0>c?b:0===c?b:c+g[a[c]]>b?c:b},k=function(a){var b,c,e,f,h=a.length,i=new Array(2*h);for(c=0,b=0;h>b;)if(e=a[b++],128>e)i[c++]=e;else if(f=g[e],f>4)i[c++]=65533,b+=f-1;else{for(e&=2===f?31:3===f?15:7;f>1&&h>b;)e=e<<6|63&a[b++],f--;f>1?i[c++]=65533:65536>e?i[c++]=e:(e-=65536,i[c++]=55296|e>>10&1023,i[c++]=56320|1023&e)}return i.length!==c&&(i.subarray?i=i.subarray(0,c):i.length=c),d.applyFromCharCode(i)};c.utf8encode=function(a){return e.nodebuffer?f(a,"utf-8"):i(a)},c.utf8decode=function(a){if(e.nodebuffer)return d.transformTo("nodebuffer",a).toString("utf-8");a=d.transformTo(e.uint8array?"uint8array":"array",a);for(var b=[],c=0,f=a.length,g=65536;f>c;){var h=j(a,Math.min(c+g,f));b.push(e.uint8array?k(a.subarray(c,h)):k(a.slice(c,h))),c=h}return b.join("")}},{"./nodeBuffer":11,"./support":17,"./utils":21}],21:[function(a,b,c){"use strict";function d(a){return a}function e(a,b){for(var c=0;cg&&b>1;)try{d.push("array"===f||"nodebuffer"===f?String.fromCharCode.apply(null,a.slice(g,Math.min(g+b,e))):String.fromCharCode.apply(null,a.subarray(g,Math.min(g+b,e)))),g+=b}catch(i){b=Math.floor(b/2)}return d.join("")}function g(a,b){for(var c=0;cb?"0":"")+b.toString(16).toUpperCase();return d},c.findCompression=function(a){for(var b in i)if(i.hasOwnProperty(b)&&i[b].magic===a)return i[b];return null},c.isRegExp=function(a){return"[object RegExp]"===Object.prototype.toString.call(a)}},{"./compressions":3,"./nodeBuffer":11,"./support":17}],22:[function(a,b){"use strict";function c(a,b){this.files=[],this.loadOptions=b,a&&this.load(a)}var d=a("./stringReader"),e=a("./nodeBufferReader"),f=a("./uint8ArrayReader"),g=a("./utils"),h=a("./signature"),i=a("./zipEntry"),j=a("./support"),k=a("./object");c.prototype={checkSignature:function(a){var b=this.reader.readString(4);if(b!==a)throw new Error("Corrupted zip or bug : unexpected signature ("+g.pretty(b)+", expected "+g.pretty(a)+")")},readBlockEndOfCentral:function(){this.diskNumber=this.reader.readInt(2),this.diskWithCentralDirStart=this.reader.readInt(2),this.centralDirRecordsOnThisDisk=this.reader.readInt(2),this.centralDirRecords=this.reader.readInt(2),this.centralDirSize=this.reader.readInt(4),this.centralDirOffset=this.reader.readInt(4),this.zipCommentLength=this.reader.readInt(2),this.zipComment=this.reader.readString(this.zipCommentLength),this.zipComment=k.utf8decode(this.zipComment)},readBlockZip64EndOfCentral:function(){this.zip64EndOfCentralSize=this.reader.readInt(8),this.versionMadeBy=this.reader.readString(2),this.versionNeeded=this.reader.readInt(2),this.diskNumber=this.reader.readInt(4),this.diskWithCentralDirStart=this.reader.readInt(4),this.centralDirRecordsOnThisDisk=this.reader.readInt(8),this.centralDirRecords=this.reader.readInt(8),this.centralDirSize=this.reader.readInt(8),this.centralDirOffset=this.reader.readInt(8),this.zip64ExtensibleData={};for(var a,b,c,d=this.zip64EndOfCentralSize-44,e=0;d>e;)a=this.reader.readInt(2),b=this.reader.readInt(4),c=this.reader.readString(b),this.zip64ExtensibleData[a]={id:a,length:b,value:c}},readBlockZip64EndOfCentralLocator:function(){if(this.diskWithZip64CentralDirStart=this.reader.readInt(4),this.relativeOffsetEndOfZip64CentralDir=this.reader.readInt(8),this.disksCount=this.reader.readInt(4),this.disksCount>1)throw new Error("Multi-volumes zip are not supported")},readLocalFiles:function(){var a,b;for(a=0;a>8;this.dir=16&this.externalFileAttributes?!0:!1,a===h&&(this.dosPermissions=63&this.externalFileAttributes),a===i&&(this.unixPermissions=this.externalFileAttributes>>16&65535),this.dir||"/"!==this.fileName.slice(-1)||(this.dir=!0)},parseZIP64ExtraField:function(){if(this.extraFields[1]){var a=new d(this.extraFields[1].value);this.uncompressedSize===e.MAX_VALUE_32BITS&&(this.uncompressedSize=a.readInt(8)),this.compressedSize===e.MAX_VALUE_32BITS&&(this.compressedSize=a.readInt(8)),this.localHeaderOffset===e.MAX_VALUE_32BITS&&(this.localHeaderOffset=a.readInt(8)),this.diskNumberStart===e.MAX_VALUE_32BITS&&(this.diskNumberStart=a.readInt(4))}},readExtraFields:function(a){var b,c,d,e=a.index;for(this.extraFields=this.extraFields||{};a.index0?b.windowBits=-b.windowBits:b.gzip&&b.windowBits>0&&b.windowBits<16&&(b.windowBits+=16),this.err=0,this.msg="",this.ended=!1,this.chunks=[],this.strm=new k,this.strm.avail_out=0;var c=g.deflateInit2(this.strm,b.level,b.method,b.windowBits,b.memLevel,b.strategy);if(c!==n)throw new Error(j[c]);b.header&&g.deflateSetHeader(this.strm,b.header)};s.prototype.push=function(a,b){var c,d,e=this.strm,f=this.options.chunkSize;if(this.ended)return!1;d=b===~~b?b:b===!0?m:l,e.input="string"==typeof a?i.string2buf(a):a,e.next_in=0,e.avail_in=e.input.length;do{if(0===e.avail_out&&(e.output=new h.Buf8(f),e.next_out=0,e.avail_out=f),c=g.deflate(e,d),c!==o&&c!==n)return this.onEnd(c),this.ended=!0,!1;(0===e.avail_out||0===e.avail_in&&d===m)&&this.onData("string"===this.options.to?i.buf2binstring(h.shrinkBuf(e.output,e.next_out)):h.shrinkBuf(e.output,e.next_out))}while((e.avail_in>0||0===e.avail_out)&&c!==o);return d===m?(c=g.deflateEnd(this.strm),this.onEnd(c),this.ended=!0,c===n):!0},s.prototype.onData=function(a){this.chunks.push(a)},s.prototype.onEnd=function(a){a===n&&(this.result="string"===this.options.to?this.chunks.join(""):h.flattenChunks(this.chunks)),this.chunks=[],this.err=a,this.msg=this.strm.msg},c.Deflate=s,c.deflate=d,c.deflateRaw=e,c.gzip=f},{"./utils/common":27,"./utils/strings":28,"./zlib/deflate.js":32,"./zlib/messages":37,"./zlib/zstream":39}],26:[function(a,b,c){"use strict";function d(a,b){var c=new m(b);if(c.push(a,!0),c.err)throw c.msg;return c.result}function e(a,b){return b=b||{},b.raw=!0,d(a,b)}var f=a("./zlib/inflate.js"),g=a("./utils/common"),h=a("./utils/strings"),i=a("./zlib/constants"),j=a("./zlib/messages"),k=a("./zlib/zstream"),l=a("./zlib/gzheader"),m=function(a){this.options=g.assign({chunkSize:16384,windowBits:0,to:""},a||{});var b=this.options;b.raw&&b.windowBits>=0&&b.windowBits<16&&(b.windowBits=-b.windowBits,0===b.windowBits&&(b.windowBits=-15)),!(b.windowBits>=0&&b.windowBits<16)||a&&a.windowBits||(b.windowBits+=32),b.windowBits>15&&b.windowBits<48&&0===(15&b.windowBits)&&(b.windowBits|=15),this.err=0,this.msg="",this.ended=!1,this.chunks=[],this.strm=new k,this.strm.avail_out=0;var c=f.inflateInit2(this.strm,b.windowBits);if(c!==i.Z_OK)throw new Error(j[c]);this.header=new l,f.inflateGetHeader(this.strm,this.header)};m.prototype.push=function(a,b){var c,d,e,j,k,l=this.strm,m=this.options.chunkSize;if(this.ended)return!1;d=b===~~b?b:b===!0?i.Z_FINISH:i.Z_NO_FLUSH,l.input="string"==typeof a?h.binstring2buf(a):a,l.next_in=0,l.avail_in=l.input.length;do{if(0===l.avail_out&&(l.output=new g.Buf8(m),l.next_out=0,l.avail_out=m),c=f.inflate(l,i.Z_NO_FLUSH),c!==i.Z_STREAM_END&&c!==i.Z_OK)return this.onEnd(c),this.ended=!0,!1;l.next_out&&(0===l.avail_out||c===i.Z_STREAM_END||0===l.avail_in&&d===i.Z_FINISH)&&("string"===this.options.to?(e=h.utf8border(l.output,l.next_out),j=l.next_out-e,k=h.buf2string(l.output,e),l.next_out=j,l.avail_out=m-j,j&&g.arraySet(l.output,l.output,e,j,0),this.onData(k)):this.onData(g.shrinkBuf(l.output,l.next_out)))}while(l.avail_in>0&&c!==i.Z_STREAM_END);return c===i.Z_STREAM_END&&(d=i.Z_FINISH),d===i.Z_FINISH?(c=f.inflateEnd(this.strm),this.onEnd(c),this.ended=!0,c===i.Z_OK):!0},m.prototype.onData=function(a){this.chunks.push(a)},m.prototype.onEnd=function(a){a===i.Z_OK&&(this.result="string"===this.options.to?this.chunks.join(""):g.flattenChunks(this.chunks)),this.chunks=[],this.err=a,this.msg=this.strm.msg},c.Inflate=m,c.inflate=d,c.inflateRaw=e,c.ungzip=d},{"./utils/common":27,"./utils/strings":28,"./zlib/constants":30,"./zlib/gzheader":33,"./zlib/inflate.js":35,"./zlib/messages":37,"./zlib/zstream":39}],27:[function(a,b,c){"use strict";var d="undefined"!=typeof Uint8Array&&"undefined"!=typeof Uint16Array&&"undefined"!=typeof Int32Array;c.assign=function(a){for(var b=Array.prototype.slice.call(arguments,1);b.length;){var c=b.shift();if(c){if("object"!=typeof c)throw new TypeError(c+"must be non-object");for(var d in c)c.hasOwnProperty(d)&&(a[d]=c[d])}}return a},c.shrinkBuf=function(a,b){return a.length===b?a:a.subarray?a.subarray(0,b):(a.length=b,a)};var e={arraySet:function(a,b,c,d,e){if(b.subarray&&a.subarray)return void a.set(b.subarray(c,c+d),e);for(var f=0;d>f;f++)a[e+f]=b[c+f]},flattenChunks:function(a){var b,c,d,e,f,g;for(d=0,b=0,c=a.length;c>b;b++)d+=a[b].length;for(g=new Uint8Array(d),e=0,b=0,c=a.length;c>b;b++)f=a[b],g.set(f,e),e+=f.length;return g}},f={arraySet:function(a,b,c,d,e){for(var f=0;d>f;f++)a[e+f]=b[c+f]},flattenChunks:function(a){return[].concat.apply([],a)}};c.setTyped=function(a){a?(c.Buf8=Uint8Array,c.Buf16=Uint16Array,c.Buf32=Int32Array,c.assign(c,e)):(c.Buf8=Array,c.Buf16=Array,c.Buf32=Array,c.assign(c,f))},c.setTyped(d)},{}],28:[function(a,b,c){"use strict";function d(a,b){if(65537>b&&(a.subarray&&g||!a.subarray&&f))return String.fromCharCode.apply(null,e.shrinkBuf(a,b));for(var c="",d=0;b>d;d++)c+=String.fromCharCode(a[d]);return c}var e=a("./common"),f=!0,g=!0;try{String.fromCharCode.apply(null,[0])}catch(h){f=!1}try{String.fromCharCode.apply(null,new Uint8Array(1))}catch(h){g=!1}for(var i=new e.Buf8(256),j=0;256>j;j++)i[j]=j>=252?6:j>=248?5:j>=240?4:j>=224?3:j>=192?2:1;i[254]=i[254]=1,c.string2buf=function(a){var b,c,d,f,g,h=a.length,i=0;for(f=0;h>f;f++)c=a.charCodeAt(f),55296===(64512&c)&&h>f+1&&(d=a.charCodeAt(f+1),56320===(64512&d)&&(c=65536+(c-55296<<10)+(d-56320),f++)),i+=128>c?1:2048>c?2:65536>c?3:4;for(b=new e.Buf8(i),g=0,f=0;i>g;f++)c=a.charCodeAt(f),55296===(64512&c)&&h>f+1&&(d=a.charCodeAt(f+1),56320===(64512&d)&&(c=65536+(c-55296<<10)+(d-56320),f++)),128>c?b[g++]=c:2048>c?(b[g++]=192|c>>>6,b[g++]=128|63&c):65536>c?(b[g++]=224|c>>>12,b[g++]=128|c>>>6&63,b[g++]=128|63&c):(b[g++]=240|c>>>18,b[g++]=128|c>>>12&63,b[g++]=128|c>>>6&63,b[g++]=128|63&c);return b},c.buf2binstring=function(a){return d(a,a.length)},c.binstring2buf=function(a){for(var b=new e.Buf8(a.length),c=0,d=b.length;d>c;c++)b[c]=a.charCodeAt(c);return b},c.buf2string=function(a,b){var c,e,f,g,h=b||a.length,j=new Array(2*h);for(e=0,c=0;h>c;)if(f=a[c++],128>f)j[e++]=f;else if(g=i[f],g>4)j[e++]=65533,c+=g-1;else{for(f&=2===g?31:3===g?15:7;g>1&&h>c;)f=f<<6|63&a[c++],g--;g>1?j[e++]=65533:65536>f?j[e++]=f:(f-=65536,j[e++]=55296|f>>10&1023,j[e++]=56320|1023&f)}return d(j,e)},c.utf8border=function(a,b){var c;for(b=b||a.length,b>a.length&&(b=a.length),c=b-1;c>=0&&128===(192&a[c]);)c--;return 0>c?b:0===c?b:c+i[a[c]]>b?c:b}},{"./common":27}],29:[function(a,b){"use strict";function c(a,b,c,d){for(var e=65535&a|0,f=a>>>16&65535|0,g=0;0!==c;){g=c>2e3?2e3:c,c-=g;do e=e+b[d++]|0,f=f+e|0;while(--g);e%=65521,f%=65521}return e|f<<16|0}b.exports=c},{}],30:[function(a,b){b.exports={Z_NO_FLUSH:0,Z_PARTIAL_FLUSH:1,Z_SYNC_FLUSH:2,Z_FULL_FLUSH:3,Z_FINISH:4,Z_BLOCK:5,Z_TREES:6,Z_OK:0,Z_STREAM_END:1,Z_NEED_DICT:2,Z_ERRNO:-1,Z_STREAM_ERROR:-2,Z_DATA_ERROR:-3,Z_BUF_ERROR:-5,Z_NO_COMPRESSION:0,Z_BEST_SPEED:1,Z_BEST_COMPRESSION:9,Z_DEFAULT_COMPRESSION:-1,Z_FILTERED:1,Z_HUFFMAN_ONLY:2,Z_RLE:3,Z_FIXED:4,Z_DEFAULT_STRATEGY:0,Z_BINARY:0,Z_TEXT:1,Z_UNKNOWN:2,Z_DEFLATED:8}},{}],31:[function(a,b){"use strict";function c(){for(var a,b=[],c=0;256>c;c++){a=c;for(var d=0;8>d;d++)a=1&a?3988292384^a>>>1:a>>>1;b[c]=a}return b}function d(a,b,c,d){var f=e,g=d+c;a=-1^a;for(var h=d;g>h;h++)a=a>>>8^f[255&(a^b[h])];return-1^a}var e=c();b.exports=d},{}],32:[function(a,b,c){"use strict";function d(a,b){return a.msg=G[b],b}function e(a){return(a<<1)-(a>4?9:0)}function f(a){for(var b=a.length;--b>=0;)a[b]=0}function g(a){var b=a.state,c=b.pending;c>a.avail_out&&(c=a.avail_out),0!==c&&(C.arraySet(a.output,b.pending_buf,b.pending_out,c,a.next_out),a.next_out+=c,b.pending_out+=c,a.total_out+=c,a.avail_out-=c,b.pending-=c,0===b.pending&&(b.pending_out=0))}function h(a,b){D._tr_flush_block(a,a.block_start>=0?a.block_start:-1,a.strstart-a.block_start,b),a.block_start=a.strstart,g(a.strm)}function i(a,b){a.pending_buf[a.pending++]=b}function j(a,b){a.pending_buf[a.pending++]=b>>>8&255,a.pending_buf[a.pending++]=255&b}function k(a,b,c,d){var e=a.avail_in;return e>d&&(e=d),0===e?0:(a.avail_in-=e,C.arraySet(b,a.input,a.next_in,e,c),1===a.state.wrap?a.adler=E(a.adler,b,e,c):2===a.state.wrap&&(a.adler=F(a.adler,b,e,c)),a.next_in+=e,a.total_in+=e,e)}function l(a,b){var c,d,e=a.max_chain_length,f=a.strstart,g=a.prev_length,h=a.nice_match,i=a.strstart>a.w_size-jb?a.strstart-(a.w_size-jb):0,j=a.window,k=a.w_mask,l=a.prev,m=a.strstart+ib,n=j[f+g-1],o=j[f+g];a.prev_length>=a.good_match&&(e>>=2),h>a.lookahead&&(h=a.lookahead);do if(c=b,j[c+g]===o&&j[c+g-1]===n&&j[c]===j[f]&&j[++c]===j[f+1]){f+=2,c++;do;while(j[++f]===j[++c]&&j[++f]===j[++c]&&j[++f]===j[++c]&&j[++f]===j[++c]&&j[++f]===j[++c]&&j[++f]===j[++c]&&j[++f]===j[++c]&&j[++f]===j[++c]&&m>f);if(d=ib-(m-f),f=m-ib,d>g){if(a.match_start=b,g=d,d>=h)break;n=j[f+g-1],o=j[f+g]}}while((b=l[b&k])>i&&0!==--e);return g<=a.lookahead?g:a.lookahead}function m(a){var b,c,d,e,f,g=a.w_size;do{if(e=a.window_size-a.lookahead-a.strstart,a.strstart>=g+(g-jb)){C.arraySet(a.window,a.window,g,g,0),a.match_start-=g,a.strstart-=g,a.block_start-=g,c=a.hash_size,b=c;do d=a.head[--b],a.head[b]=d>=g?d-g:0;while(--c);c=g,b=c;do d=a.prev[--b],a.prev[b]=d>=g?d-g:0;while(--c);e+=g}if(0===a.strm.avail_in)break;if(c=k(a.strm,a.window,a.strstart+a.lookahead,e),a.lookahead+=c,a.lookahead+a.insert>=hb)for(f=a.strstart-a.insert,a.ins_h=a.window[f],a.ins_h=(a.ins_h<a.pending_buf_size-5&&(c=a.pending_buf_size-5);;){if(a.lookahead<=1){if(m(a),0===a.lookahead&&b===H)return sb;if(0===a.lookahead)break}a.strstart+=a.lookahead,a.lookahead=0;var d=a.block_start+c;if((0===a.strstart||a.strstart>=d)&&(a.lookahead=a.strstart-d,a.strstart=d,h(a,!1),0===a.strm.avail_out))return sb;if(a.strstart-a.block_start>=a.w_size-jb&&(h(a,!1),0===a.strm.avail_out))return sb}return a.insert=0,b===K?(h(a,!0),0===a.strm.avail_out?ub:vb):a.strstart>a.block_start&&(h(a,!1),0===a.strm.avail_out)?sb:sb}function o(a,b){for(var c,d;;){if(a.lookahead=hb&&(a.ins_h=(a.ins_h<=hb)if(d=D._tr_tally(a,a.strstart-a.match_start,a.match_length-hb),a.lookahead-=a.match_length,a.match_length<=a.max_lazy_match&&a.lookahead>=hb){a.match_length--;do a.strstart++,a.ins_h=(a.ins_h<=hb&&(a.ins_h=(a.ins_h<4096)&&(a.match_length=hb-1)),a.prev_length>=hb&&a.match_length<=a.prev_length){e=a.strstart+a.lookahead-hb,d=D._tr_tally(a,a.strstart-1-a.prev_match,a.prev_length-hb),a.lookahead-=a.prev_length-1,a.prev_length-=2;do++a.strstart<=e&&(a.ins_h=(a.ins_h<=hb&&a.strstart>0&&(e=a.strstart-1,d=g[e],d===g[++e]&&d===g[++e]&&d===g[++e])){f=a.strstart+ib;do;while(d===g[++e]&&d===g[++e]&&d===g[++e]&&d===g[++e]&&d===g[++e]&&d===g[++e]&&d===g[++e]&&d===g[++e]&&f>e);a.match_length=ib-(f-e),a.match_length>a.lookahead&&(a.match_length=a.lookahead)}if(a.match_length>=hb?(c=D._tr_tally(a,1,a.match_length-hb),a.lookahead-=a.match_length,a.strstart+=a.match_length,a.match_length=0):(c=D._tr_tally(a,0,a.window[a.strstart]),a.lookahead--,a.strstart++),c&&(h(a,!1),0===a.strm.avail_out))return sb}return a.insert=0,b===K?(h(a,!0),0===a.strm.avail_out?ub:vb):a.last_lit&&(h(a,!1),0===a.strm.avail_out)?sb:tb}function r(a,b){for(var c;;){if(0===a.lookahead&&(m(a),0===a.lookahead)){if(b===H)return sb;break}if(a.match_length=0,c=D._tr_tally(a,0,a.window[a.strstart]),a.lookahead--,a.strstart++,c&&(h(a,!1),0===a.strm.avail_out))return sb}return a.insert=0,b===K?(h(a,!0),0===a.strm.avail_out?ub:vb):a.last_lit&&(h(a,!1),0===a.strm.avail_out)?sb:tb}function s(a){a.window_size=2*a.w_size,f(a.head),a.max_lazy_match=B[a.level].max_lazy,a.good_match=B[a.level].good_length,a.nice_match=B[a.level].nice_length,a.max_chain_length=B[a.level].max_chain,a.strstart=0,a.block_start=0,a.lookahead=0,a.insert=0,a.match_length=a.prev_length=hb-1,a.match_available=0,a.ins_h=0}function t(){this.strm=null,this.status=0,this.pending_buf=null,this.pending_buf_size=0,this.pending_out=0,this.pending=0,this.wrap=0,this.gzhead=null,this.gzindex=0,this.method=Y,this.last_flush=-1,this.w_size=0,this.w_bits=0,this.w_mask=0,this.window=null,this.window_size=0,this.prev=null,this.head=null,this.ins_h=0,this.hash_size=0,this.hash_bits=0,this.hash_mask=0,this.hash_shift=0,this.block_start=0,this.match_length=0,this.prev_match=0,this.match_available=0,this.strstart=0,this.match_start=0,this.lookahead=0,this.prev_length=0,this.max_chain_length=0,this.max_lazy_match=0,this.level=0,this.strategy=0,this.good_match=0,this.nice_match=0,this.dyn_ltree=new C.Buf16(2*fb),this.dyn_dtree=new C.Buf16(2*(2*db+1)),this.bl_tree=new C.Buf16(2*(2*eb+1)),f(this.dyn_ltree),f(this.dyn_dtree),f(this.bl_tree),this.l_desc=null,this.d_desc=null,this.bl_desc=null,this.bl_count=new C.Buf16(gb+1),this.heap=new C.Buf16(2*cb+1),f(this.heap),this.heap_len=0,this.heap_max=0,this.depth=new C.Buf16(2*cb+1),f(this.depth),this.l_buf=0,this.lit_bufsize=0,this.last_lit=0,this.d_buf=0,this.opt_len=0,this.static_len=0,this.matches=0,this.insert=0,this.bi_buf=0,this.bi_valid=0}function u(a){var b;return a&&a.state?(a.total_in=a.total_out=0,a.data_type=X,b=a.state,b.pending=0,b.pending_out=0,b.wrap<0&&(b.wrap=-b.wrap),b.status=b.wrap?lb:qb,a.adler=2===b.wrap?0:1,b.last_flush=H,D._tr_init(b),M):d(a,O)}function v(a){var b=u(a);return b===M&&s(a.state),b}function w(a,b){return a&&a.state?2!==a.state.wrap?O:(a.state.gzhead=b,M):O}function x(a,b,c,e,f,g){if(!a)return O;var h=1;if(b===R&&(b=6),0>e?(h=0,e=-e):e>15&&(h=2,e-=16),1>f||f>Z||c!==Y||8>e||e>15||0>b||b>9||0>g||g>V)return d(a,O);8===e&&(e=9);var i=new t;return a.state=i,i.strm=a,i.wrap=h,i.gzhead=null,i.w_bits=e,i.w_size=1<>1,i.l_buf=3*i.lit_bufsize,i.level=b,i.strategy=g,i.method=c,v(a)}function y(a,b){return x(a,b,Y,$,_,W)}function z(a,b){var c,h,k,l;if(!a||!a.state||b>L||0>b)return a?d(a,O):O;if(h=a.state,!a.output||!a.input&&0!==a.avail_in||h.status===rb&&b!==K)return d(a,0===a.avail_out?Q:O);if(h.strm=a,c=h.last_flush,h.last_flush=b,h.status===lb)if(2===h.wrap)a.adler=0,i(h,31),i(h,139),i(h,8),h.gzhead?(i(h,(h.gzhead.text?1:0)+(h.gzhead.hcrc?2:0)+(h.gzhead.extra?4:0)+(h.gzhead.name?8:0)+(h.gzhead.comment?16:0)),i(h,255&h.gzhead.time),i(h,h.gzhead.time>>8&255),i(h,h.gzhead.time>>16&255),i(h,h.gzhead.time>>24&255),i(h,9===h.level?2:h.strategy>=T||h.level<2?4:0),i(h,255&h.gzhead.os),h.gzhead.extra&&h.gzhead.extra.length&&(i(h,255&h.gzhead.extra.length),i(h,h.gzhead.extra.length>>8&255)),h.gzhead.hcrc&&(a.adler=F(a.adler,h.pending_buf,h.pending,0)),h.gzindex=0,h.status=mb):(i(h,0),i(h,0),i(h,0),i(h,0),i(h,0),i(h,9===h.level?2:h.strategy>=T||h.level<2?4:0),i(h,wb),h.status=qb);else{var m=Y+(h.w_bits-8<<4)<<8,n=-1;n=h.strategy>=T||h.level<2?0:h.level<6?1:6===h.level?2:3,m|=n<<6,0!==h.strstart&&(m|=kb),m+=31-m%31,h.status=qb,j(h,m),0!==h.strstart&&(j(h,a.adler>>>16),j(h,65535&a.adler)),a.adler=1}if(h.status===mb)if(h.gzhead.extra){for(k=h.pending;h.gzindex<(65535&h.gzhead.extra.length)&&(h.pending!==h.pending_buf_size||(h.gzhead.hcrc&&h.pending>k&&(a.adler=F(a.adler,h.pending_buf,h.pending-k,k)),g(a),k=h.pending,h.pending!==h.pending_buf_size));)i(h,255&h.gzhead.extra[h.gzindex]),h.gzindex++;h.gzhead.hcrc&&h.pending>k&&(a.adler=F(a.adler,h.pending_buf,h.pending-k,k)),h.gzindex===h.gzhead.extra.length&&(h.gzindex=0,h.status=nb)}else h.status=nb;if(h.status===nb)if(h.gzhead.name){k=h.pending;do{if(h.pending===h.pending_buf_size&&(h.gzhead.hcrc&&h.pending>k&&(a.adler=F(a.adler,h.pending_buf,h.pending-k,k)),g(a),k=h.pending,h.pending===h.pending_buf_size)){l=1;break}l=h.gzindexk&&(a.adler=F(a.adler,h.pending_buf,h.pending-k,k)),0===l&&(h.gzindex=0,h.status=ob)}else h.status=ob;if(h.status===ob)if(h.gzhead.comment){k=h.pending;do{if(h.pending===h.pending_buf_size&&(h.gzhead.hcrc&&h.pending>k&&(a.adler=F(a.adler,h.pending_buf,h.pending-k,k)),g(a),k=h.pending,h.pending===h.pending_buf_size)){l=1;break}l=h.gzindexk&&(a.adler=F(a.adler,h.pending_buf,h.pending-k,k)),0===l&&(h.status=pb)}else h.status=pb;if(h.status===pb&&(h.gzhead.hcrc?(h.pending+2>h.pending_buf_size&&g(a),h.pending+2<=h.pending_buf_size&&(i(h,255&a.adler),i(h,a.adler>>8&255),a.adler=0,h.status=qb)):h.status=qb),0!==h.pending){if(g(a),0===a.avail_out)return h.last_flush=-1,M}else if(0===a.avail_in&&e(b)<=e(c)&&b!==K)return d(a,Q);if(h.status===rb&&0!==a.avail_in)return d(a,Q);if(0!==a.avail_in||0!==h.lookahead||b!==H&&h.status!==rb){var o=h.strategy===T?r(h,b):h.strategy===U?q(h,b):B[h.level].func(h,b);if((o===ub||o===vb)&&(h.status=rb),o===sb||o===ub)return 0===a.avail_out&&(h.last_flush=-1),M;if(o===tb&&(b===I?D._tr_align(h):b!==L&&(D._tr_stored_block(h,0,0,!1),b===J&&(f(h.head),0===h.lookahead&&(h.strstart=0,h.block_start=0,h.insert=0))),g(a),0===a.avail_out))return h.last_flush=-1,M}return b!==K?M:h.wrap<=0?N:(2===h.wrap?(i(h,255&a.adler),i(h,a.adler>>8&255),i(h,a.adler>>16&255),i(h,a.adler>>24&255),i(h,255&a.total_in),i(h,a.total_in>>8&255),i(h,a.total_in>>16&255),i(h,a.total_in>>24&255)):(j(h,a.adler>>>16),j(h,65535&a.adler)),g(a),h.wrap>0&&(h.wrap=-h.wrap),0!==h.pending?M:N)}function A(a){var b;return a&&a.state?(b=a.state.status,b!==lb&&b!==mb&&b!==nb&&b!==ob&&b!==pb&&b!==qb&&b!==rb?d(a,O):(a.state=null,b===qb?d(a,P):M)):O}var B,C=a("../utils/common"),D=a("./trees"),E=a("./adler32"),F=a("./crc32"),G=a("./messages"),H=0,I=1,J=3,K=4,L=5,M=0,N=1,O=-2,P=-3,Q=-5,R=-1,S=1,T=2,U=3,V=4,W=0,X=2,Y=8,Z=9,$=15,_=8,ab=29,bb=256,cb=bb+1+ab,db=30,eb=19,fb=2*cb+1,gb=15,hb=3,ib=258,jb=ib+hb+1,kb=32,lb=42,mb=69,nb=73,ob=91,pb=103,qb=113,rb=666,sb=1,tb=2,ub=3,vb=4,wb=3,xb=function(a,b,c,d,e){this.good_length=a,this.max_lazy=b,this.nice_length=c,this.max_chain=d,this.func=e};B=[new xb(0,0,0,0,n),new xb(4,4,8,4,o),new xb(4,5,16,8,o),new xb(4,6,32,32,o),new xb(4,4,16,16,p),new xb(8,16,32,32,p),new xb(8,16,128,128,p),new xb(8,32,128,256,p),new xb(32,128,258,1024,p),new xb(32,258,258,4096,p)],c.deflateInit=y,c.deflateInit2=x,c.deflateReset=v,c.deflateResetKeep=u,c.deflateSetHeader=w,c.deflate=z,c.deflateEnd=A,c.deflateInfo="pako deflate (from Nodeca project)"},{"../utils/common":27,"./adler32":29,"./crc32":31,"./messages":37,"./trees":38}],33:[function(a,b){"use strict";function c(){this.text=0,this.time=0,this.xflags=0,this.os=0,this.extra=null,this.extra_len=0,this.name="",this.comment="",this.hcrc=0,this.done=!1}b.exports=c},{}],34:[function(a,b){"use strict";var c=30,d=12;b.exports=function(a,b){var e,f,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u,v,w,x,y,z,A,B,C;e=a.state,f=a.next_in,B=a.input,g=f+(a.avail_in-5),h=a.next_out,C=a.output,i=h-(b-a.avail_out),j=h+(a.avail_out-257),k=e.dmax,l=e.wsize,m=e.whave,n=e.wnext,o=e.window,p=e.hold,q=e.bits,r=e.lencode,s=e.distcode,t=(1<q&&(p+=B[f++]<>>24,p>>>=w,q-=w,w=v>>>16&255,0===w)C[h++]=65535&v;else{if(!(16&w)){if(0===(64&w)){v=r[(65535&v)+(p&(1<q&&(p+=B[f++]<>>=w,q-=w),15>q&&(p+=B[f++]<>>24,p>>>=w,q-=w,w=v>>>16&255,!(16&w)){if(0===(64&w)){v=s[(65535&v)+(p&(1<q&&(p+=B[f++]<q&&(p+=B[f++]<k){a.msg="invalid distance too far back",e.mode=c;break a}if(p>>>=w,q-=w,w=h-i,y>w){if(w=y-w,w>m&&e.sane){a.msg="invalid distance too far back",e.mode=c;break a}if(z=0,A=o,0===n){if(z+=l-w,x>w){x-=w;do C[h++]=o[z++];while(--w);z=h-y,A=C}}else if(w>n){if(z+=l+n-w,w-=n,x>w){x-=w;do C[h++]=o[z++];while(--w);if(z=0,x>n){w=n,x-=w;do C[h++]=o[z++];while(--w);z=h-y,A=C}}}else if(z+=n-w,x>w){x-=w;do C[h++]=o[z++];while(--w);z=h-y,A=C}for(;x>2;)C[h++]=A[z++],C[h++]=A[z++],C[h++]=A[z++],x-=3;x&&(C[h++]=A[z++],x>1&&(C[h++]=A[z++]))}else{z=h-y;do C[h++]=C[z++],C[h++]=C[z++],C[h++]=C[z++],x-=3;while(x>2);x&&(C[h++]=C[z++],x>1&&(C[h++]=C[z++]))}break}}break}}while(g>f&&j>h);x=q>>3,f-=x,q-=x<<3,p&=(1<f?5+(g-f):5-(f-g),a.avail_out=j>h?257+(j-h):257-(h-j),e.hold=p,e.bits=q}},{}],35:[function(a,b,c){"use strict";function d(a){return(a>>>24&255)+(a>>>8&65280)+((65280&a)<<8)+((255&a)<<24)}function e(){this.mode=0,this.last=!1,this.wrap=0,this.havedict=!1,this.flags=0,this.dmax=0,this.check=0,this.total=0,this.head=null,this.wbits=0,this.wsize=0,this.whave=0,this.wnext=0,this.window=null,this.hold=0,this.bits=0,this.length=0,this.offset=0,this.extra=0,this.lencode=null,this.distcode=null,this.lenbits=0,this.distbits=0,this.ncode=0,this.nlen=0,this.ndist=0,this.have=0,this.next=null,this.lens=new r.Buf16(320),this.work=new r.Buf16(288),this.lendyn=null,this.distdyn=null,this.sane=0,this.back=0,this.was=0}function f(a){var b;return a&&a.state?(b=a.state,a.total_in=a.total_out=b.total=0,a.msg="",b.wrap&&(a.adler=1&b.wrap),b.mode=K,b.last=0,b.havedict=0,b.dmax=32768,b.head=null,b.hold=0,b.bits=0,b.lencode=b.lendyn=new r.Buf32(ob),b.distcode=b.distdyn=new r.Buf32(pb),b.sane=1,b.back=-1,C):F}function g(a){var b;return a&&a.state?(b=a.state,b.wsize=0,b.whave=0,b.wnext=0,f(a)):F}function h(a,b){var c,d;return a&&a.state?(d=a.state,0>b?(c=0,b=-b):(c=(b>>4)+1,48>b&&(b&=15)),b&&(8>b||b>15)?F:(null!==d.window&&d.wbits!==b&&(d.window=null),d.wrap=c,d.wbits=b,g(a))):F}function i(a,b){var c,d;return a?(d=new e,a.state=d,d.window=null,c=h(a,b),c!==C&&(a.state=null),c):F}function j(a){return i(a,rb)}function k(a){if(sb){var b;for(p=new r.Buf32(512),q=new r.Buf32(32),b=0;144>b;)a.lens[b++]=8;for(;256>b;)a.lens[b++]=9;for(;280>b;)a.lens[b++]=7;for(;288>b;)a.lens[b++]=8;for(v(x,a.lens,0,288,p,0,a.work,{bits:9}),b=0;32>b;)a.lens[b++]=5;v(y,a.lens,0,32,q,0,a.work,{bits:5}),sb=!1}a.lencode=p,a.lenbits=9,a.distcode=q,a.distbits=5}function l(a,b,c,d){var e,f=a.state;return null===f.window&&(f.wsize=1<=f.wsize?(r.arraySet(f.window,b,c-f.wsize,f.wsize,0),f.wnext=0,f.whave=f.wsize):(e=f.wsize-f.wnext,e>d&&(e=d),r.arraySet(f.window,b,c-d,e,f.wnext),d-=e,d?(r.arraySet(f.window,b,c-d,d,0),f.wnext=d,f.whave=f.wsize):(f.wnext+=e,f.wnext===f.wsize&&(f.wnext=0),f.whaven;){if(0===i)break a;i--,m+=e[g++]<>>8&255,c.check=t(c.check,Bb,2,0),m=0,n=0,c.mode=L;break}if(c.flags=0,c.head&&(c.head.done=!1),!(1&c.wrap)||(((255&m)<<8)+(m>>8))%31){a.msg="incorrect header check",c.mode=lb;break}if((15&m)!==J){a.msg="unknown compression method",c.mode=lb;break}if(m>>>=4,n-=4,wb=(15&m)+8,0===c.wbits)c.wbits=wb;else if(wb>c.wbits){a.msg="invalid window size",c.mode=lb;break}c.dmax=1<n;){if(0===i)break a;i--,m+=e[g++]<>8&1),512&c.flags&&(Bb[0]=255&m,Bb[1]=m>>>8&255,c.check=t(c.check,Bb,2,0)),m=0,n=0,c.mode=M;case M:for(;32>n;){if(0===i)break a;i--,m+=e[g++]<>>8&255,Bb[2]=m>>>16&255,Bb[3]=m>>>24&255,c.check=t(c.check,Bb,4,0)),m=0,n=0,c.mode=N;case N:for(;16>n;){if(0===i)break a;i--,m+=e[g++]<>8),512&c.flags&&(Bb[0]=255&m,Bb[1]=m>>>8&255,c.check=t(c.check,Bb,2,0)),m=0,n=0,c.mode=O;case O:if(1024&c.flags){for(;16>n;){if(0===i)break a;i--,m+=e[g++]<>>8&255,c.check=t(c.check,Bb,2,0)),m=0,n=0}else c.head&&(c.head.extra=null);c.mode=P;case P:if(1024&c.flags&&(q=c.length,q>i&&(q=i),q&&(c.head&&(wb=c.head.extra_len-c.length,c.head.extra||(c.head.extra=new Array(c.head.extra_len)),r.arraySet(c.head.extra,e,g,q,wb)),512&c.flags&&(c.check=t(c.check,e,q,g)),i-=q,g+=q,c.length-=q),c.length))break a;c.length=0,c.mode=Q;case Q:if(2048&c.flags){if(0===i)break a;q=0;do wb=e[g+q++],c.head&&wb&&c.length<65536&&(c.head.name+=String.fromCharCode(wb));while(wb&&i>q);if(512&c.flags&&(c.check=t(c.check,e,q,g)),i-=q,g+=q,wb)break a}else c.head&&(c.head.name=null);c.length=0,c.mode=R;case R:if(4096&c.flags){if(0===i)break a;q=0;do wb=e[g+q++],c.head&&wb&&c.length<65536&&(c.head.comment+=String.fromCharCode(wb));while(wb&&i>q);if(512&c.flags&&(c.check=t(c.check,e,q,g)),i-=q,g+=q,wb)break a}else c.head&&(c.head.comment=null);c.mode=S;case S:if(512&c.flags){for(;16>n;){if(0===i)break a;i--,m+=e[g++]<>9&1,c.head.done=!0),a.adler=c.check=0,c.mode=V;break;case T:for(;32>n;){if(0===i)break a;i--,m+=e[g++]<>>=7&n,n-=7&n,c.mode=ib;break}for(;3>n;){if(0===i)break a;i--,m+=e[g++]<>>=1,n-=1,3&m){case 0:c.mode=X;break;case 1:if(k(c),c.mode=bb,b===B){m>>>=2,n-=2;break a}break;case 2:c.mode=$;break;case 3:a.msg="invalid block type",c.mode=lb}m>>>=2,n-=2;break;case X:for(m>>>=7&n,n-=7&n;32>n;){if(0===i)break a;i--,m+=e[g++]<>>16^65535)){a.msg="invalid stored block lengths",c.mode=lb;break}if(c.length=65535&m,m=0,n=0,c.mode=Y,b===B)break a;case Y:c.mode=Z;case Z:if(q=c.length){if(q>i&&(q=i),q>j&&(q=j),0===q)break a;r.arraySet(f,e,g,q,h),i-=q,g+=q,j-=q,h+=q,c.length-=q;break}c.mode=V;break;case $:for(;14>n;){if(0===i)break a;i--,m+=e[g++]<>>=5,n-=5,c.ndist=(31&m)+1,m>>>=5,n-=5,c.ncode=(15&m)+4,m>>>=4,n-=4,c.nlen>286||c.ndist>30){a.msg="too many length or distance symbols",c.mode=lb;break}c.have=0,c.mode=_;case _:for(;c.haven;){if(0===i)break a;i--,m+=e[g++]<>>=3,n-=3}for(;c.have<19;)c.lens[Cb[c.have++]]=0;if(c.lencode=c.lendyn,c.lenbits=7,yb={bits:c.lenbits},xb=v(w,c.lens,0,19,c.lencode,0,c.work,yb),c.lenbits=yb.bits,xb){a.msg="invalid code lengths set",c.mode=lb;break}c.have=0,c.mode=ab;case ab:for(;c.have>>24,rb=Ab>>>16&255,sb=65535&Ab,!(n>=qb);){if(0===i)break a;i--,m+=e[g++]<sb)m>>>=qb,n-=qb,c.lens[c.have++]=sb;else{if(16===sb){for(zb=qb+2;zb>n;){if(0===i)break a;i--,m+=e[g++]<>>=qb,n-=qb,0===c.have){a.msg="invalid bit length repeat",c.mode=lb;break}wb=c.lens[c.have-1],q=3+(3&m),m>>>=2,n-=2}else if(17===sb){for(zb=qb+3;zb>n;){if(0===i)break a;i--,m+=e[g++]<>>=qb,n-=qb,wb=0,q=3+(7&m),m>>>=3,n-=3}else{for(zb=qb+7;zb>n;){if(0===i)break a;i--,m+=e[g++]<>>=qb,n-=qb,wb=0,q=11+(127&m),m>>>=7,n-=7}if(c.have+q>c.nlen+c.ndist){a.msg="invalid bit length repeat",c.mode=lb;break}for(;q--;)c.lens[c.have++]=wb}}if(c.mode===lb)break;if(0===c.lens[256]){a.msg="invalid code -- missing end-of-block",c.mode=lb;break}if(c.lenbits=9,yb={bits:c.lenbits},xb=v(x,c.lens,0,c.nlen,c.lencode,0,c.work,yb),c.lenbits=yb.bits,xb){a.msg="invalid literal/lengths set",c.mode=lb;break}if(c.distbits=6,c.distcode=c.distdyn,yb={bits:c.distbits},xb=v(y,c.lens,c.nlen,c.ndist,c.distcode,0,c.work,yb),c.distbits=yb.bits,xb){a.msg="invalid distances set",c.mode=lb;break}if(c.mode=bb,b===B)break a;case bb:c.mode=cb;case cb:if(i>=6&&j>=258){a.next_out=h,a.avail_out=j,a.next_in=g,a.avail_in=i,c.hold=m,c.bits=n,u(a,p),h=a.next_out,f=a.output,j=a.avail_out,g=a.next_in,e=a.input,i=a.avail_in,m=c.hold,n=c.bits,c.mode===V&&(c.back=-1); +break}for(c.back=0;Ab=c.lencode[m&(1<>>24,rb=Ab>>>16&255,sb=65535&Ab,!(n>=qb);){if(0===i)break a;i--,m+=e[g++]<>tb)],qb=Ab>>>24,rb=Ab>>>16&255,sb=65535&Ab,!(n>=tb+qb);){if(0===i)break a;i--,m+=e[g++]<>>=tb,n-=tb,c.back+=tb}if(m>>>=qb,n-=qb,c.back+=qb,c.length=sb,0===rb){c.mode=hb;break}if(32&rb){c.back=-1,c.mode=V;break}if(64&rb){a.msg="invalid literal/length code",c.mode=lb;break}c.extra=15&rb,c.mode=db;case db:if(c.extra){for(zb=c.extra;zb>n;){if(0===i)break a;i--,m+=e[g++]<>>=c.extra,n-=c.extra,c.back+=c.extra}c.was=c.length,c.mode=eb;case eb:for(;Ab=c.distcode[m&(1<>>24,rb=Ab>>>16&255,sb=65535&Ab,!(n>=qb);){if(0===i)break a;i--,m+=e[g++]<>tb)],qb=Ab>>>24,rb=Ab>>>16&255,sb=65535&Ab,!(n>=tb+qb);){if(0===i)break a;i--,m+=e[g++]<>>=tb,n-=tb,c.back+=tb}if(m>>>=qb,n-=qb,c.back+=qb,64&rb){a.msg="invalid distance code",c.mode=lb;break}c.offset=sb,c.extra=15&rb,c.mode=fb;case fb:if(c.extra){for(zb=c.extra;zb>n;){if(0===i)break a;i--,m+=e[g++]<>>=c.extra,n-=c.extra,c.back+=c.extra}if(c.offset>c.dmax){a.msg="invalid distance too far back",c.mode=lb;break}c.mode=gb;case gb:if(0===j)break a;if(q=p-j,c.offset>q){if(q=c.offset-q,q>c.whave&&c.sane){a.msg="invalid distance too far back",c.mode=lb;break}q>c.wnext?(q-=c.wnext,ob=c.wsize-q):ob=c.wnext-q,q>c.length&&(q=c.length),pb=c.window}else pb=f,ob=h-c.offset,q=c.length;q>j&&(q=j),j-=q,c.length-=q;do f[h++]=pb[ob++];while(--q);0===c.length&&(c.mode=cb);break;case hb:if(0===j)break a;f[h++]=c.length,j--,c.mode=cb;break;case ib:if(c.wrap){for(;32>n;){if(0===i)break a;i--,m|=e[g++]<n;){if(0===i)break a;i--,m+=e[g++]<=D;D++)P[D]=0;for(E=0;o>E;E++)P[b[n+E]]++;for(H=C,G=d;G>=1&&0===P[G];G--);if(H>G&&(H=G),0===G)return p[q++]=20971520,p[q++]=20971520,s.bits=1,0;for(F=1;G>F&&0===P[F];F++);for(F>H&&(H=F),K=1,D=1;d>=D;D++)if(K<<=1,K-=P[D],0>K)return-1;if(K>0&&(a===g||1!==G))return-1;for(Q[1]=0,D=1;d>D;D++)Q[D+1]=Q[D]+P[D];for(E=0;o>E;E++)0!==b[n+E]&&(r[Q[b[n+E]]++]=E);if(a===g?(N=R=r,y=19):a===h?(N=j,O-=257,R=k,S-=257,y=256):(N=l,R=m,y=-1),M=0,E=0,D=F,x=q,I=H,J=0,v=-1,L=1<e||a===i&&L>f)return 1;for(var T=0;;){T++,z=D-J,r[E]y?(A=R[S+r[E]],B=N[O+r[E]]):(A=96,B=0),t=1<>J)+u]=z<<24|A<<16|B|0;while(0!==u);for(t=1<>=1;if(0!==t?(M&=t-1,M+=t):M=0,E++,0===--P[D]){if(D===G)break;D=b[n+r[E]]}if(D>H&&(M&w)!==v){for(0===J&&(J=H),x+=F,I=D-J,K=1<I+J&&(K-=P[I+J],!(0>=K));)I++,K<<=1;if(L+=1<e||a===i&&L>f)return 1;v=M&w,p[v]=H<<24|I<<16|x-q|0}}return 0!==M&&(p[x+M]=D-J<<24|64<<16|0),s.bits=H,0}},{"../utils/common":27}],37:[function(a,b){"use strict";b.exports={2:"need dictionary",1:"stream end",0:"","-1":"file error","-2":"stream error","-3":"data error","-4":"insufficient memory","-5":"buffer error","-6":"incompatible version"}},{}],38:[function(a,b,c){"use strict";function d(a){for(var b=a.length;--b>=0;)a[b]=0}function e(a){return 256>a?gb[a]:gb[256+(a>>>7)]}function f(a,b){a.pending_buf[a.pending++]=255&b,a.pending_buf[a.pending++]=b>>>8&255}function g(a,b,c){a.bi_valid>V-c?(a.bi_buf|=b<>V-a.bi_valid,a.bi_valid+=c-V):(a.bi_buf|=b<>>=1,c<<=1;while(--b>0);return c>>>1}function j(a){16===a.bi_valid?(f(a,a.bi_buf),a.bi_buf=0,a.bi_valid=0):a.bi_valid>=8&&(a.pending_buf[a.pending++]=255&a.bi_buf,a.bi_buf>>=8,a.bi_valid-=8)}function k(a,b){var c,d,e,f,g,h,i=b.dyn_tree,j=b.max_code,k=b.stat_desc.static_tree,l=b.stat_desc.has_stree,m=b.stat_desc.extra_bits,n=b.stat_desc.extra_base,o=b.stat_desc.max_length,p=0;for(f=0;U>=f;f++)a.bl_count[f]=0;for(i[2*a.heap[a.heap_max]+1]=0,c=a.heap_max+1;T>c;c++)d=a.heap[c],f=i[2*i[2*d+1]+1]+1,f>o&&(f=o,p++),i[2*d+1]=f,d>j||(a.bl_count[f]++,g=0,d>=n&&(g=m[d-n]),h=i[2*d],a.opt_len+=h*(f+g),l&&(a.static_len+=h*(k[2*d+1]+g)));if(0!==p){do{for(f=o-1;0===a.bl_count[f];)f--;a.bl_count[f]--,a.bl_count[f+1]+=2,a.bl_count[o]--,p-=2}while(p>0);for(f=o;0!==f;f--)for(d=a.bl_count[f];0!==d;)e=a.heap[--c],e>j||(i[2*e+1]!==f&&(a.opt_len+=(f-i[2*e+1])*i[2*e],i[2*e+1]=f),d--)}}function l(a,b,c){var d,e,f=new Array(U+1),g=0;for(d=1;U>=d;d++)f[d]=g=g+c[d-1]<<1;for(e=0;b>=e;e++){var h=a[2*e+1];0!==h&&(a[2*e]=i(f[h]++,h))}}function m(){var a,b,c,d,e,f=new Array(U+1);for(c=0,d=0;O-1>d;d++)for(ib[d]=c,a=0;a<1<<_[d];a++)hb[c++]=d;for(hb[c-1]=d,e=0,d=0;16>d;d++)for(jb[d]=e,a=0;a<1<>=7;R>d;d++)for(jb[d]=e<<7,a=0;a<1<=b;b++)f[b]=0;for(a=0;143>=a;)eb[2*a+1]=8,a++,f[8]++;for(;255>=a;)eb[2*a+1]=9,a++,f[9]++;for(;279>=a;)eb[2*a+1]=7,a++,f[7]++;for(;287>=a;)eb[2*a+1]=8,a++,f[8]++;for(l(eb,Q+1,f),a=0;R>a;a++)fb[2*a+1]=5,fb[2*a]=i(a,5);kb=new nb(eb,_,P+1,Q,U),lb=new nb(fb,ab,0,R,U),mb=new nb(new Array(0),bb,0,S,W)}function n(a){var b;for(b=0;Q>b;b++)a.dyn_ltree[2*b]=0;for(b=0;R>b;b++)a.dyn_dtree[2*b]=0;for(b=0;S>b;b++)a.bl_tree[2*b]=0;a.dyn_ltree[2*X]=1,a.opt_len=a.static_len=0,a.last_lit=a.matches=0}function o(a){a.bi_valid>8?f(a,a.bi_buf):a.bi_valid>0&&(a.pending_buf[a.pending++]=a.bi_buf),a.bi_buf=0,a.bi_valid=0}function p(a,b,c,d){o(a),d&&(f(a,c),f(a,~c)),E.arraySet(a.pending_buf,a.window,b,c,a.pending),a.pending+=c}function q(a,b,c,d){var e=2*b,f=2*c;return a[e]c;c++)0!==f[2*c]?(a.heap[++a.heap_len]=j=c,a.depth[c]=0):f[2*c+1]=0;for(;a.heap_len<2;)e=a.heap[++a.heap_len]=2>j?++j:0,f[2*e]=1,a.depth[e]=0,a.opt_len--,h&&(a.static_len-=g[2*e+1]);for(b.max_code=j,c=a.heap_len>>1;c>=1;c--)r(a,f,c);e=i;do c=a.heap[1],a.heap[1]=a.heap[a.heap_len--],r(a,f,1),d=a.heap[1],a.heap[--a.heap_max]=c,a.heap[--a.heap_max]=d,f[2*e]=f[2*c]+f[2*d],a.depth[e]=(a.depth[c]>=a.depth[d]?a.depth[c]:a.depth[d])+1,f[2*c+1]=f[2*d+1]=e,a.heap[1]=e++,r(a,f,1);while(a.heap_len>=2);a.heap[--a.heap_max]=a.heap[1],k(a,b),l(f,j,a.bl_count)}function u(a,b,c){var d,e,f=-1,g=b[1],h=0,i=7,j=4;for(0===g&&(i=138,j=3),b[2*(c+1)+1]=65535,d=0;c>=d;d++)e=g,g=b[2*(d+1)+1],++hh?a.bl_tree[2*e]+=h:0!==e?(e!==f&&a.bl_tree[2*e]++,a.bl_tree[2*Y]++):10>=h?a.bl_tree[2*Z]++:a.bl_tree[2*$]++,h=0,f=e,0===g?(i=138,j=3):e===g?(i=6,j=3):(i=7,j=4))}function v(a,b,c){var d,e,f=-1,i=b[1],j=0,k=7,l=4;for(0===i&&(k=138,l=3),d=0;c>=d;d++)if(e=i,i=b[2*(d+1)+1],!(++jj){do h(a,e,a.bl_tree);while(0!==--j)}else 0!==e?(e!==f&&(h(a,e,a.bl_tree),j--),h(a,Y,a.bl_tree),g(a,j-3,2)):10>=j?(h(a,Z,a.bl_tree),g(a,j-3,3)):(h(a,$,a.bl_tree),g(a,j-11,7));j=0,f=e,0===i?(k=138,l=3):e===i?(k=6,l=3):(k=7,l=4)}}function w(a){var b;for(u(a,a.dyn_ltree,a.l_desc.max_code),u(a,a.dyn_dtree,a.d_desc.max_code),t(a,a.bl_desc),b=S-1;b>=3&&0===a.bl_tree[2*cb[b]+1];b--);return a.opt_len+=3*(b+1)+5+5+4,b}function x(a,b,c,d){var e;for(g(a,b-257,5),g(a,c-1,5),g(a,d-4,4),e=0;d>e;e++)g(a,a.bl_tree[2*cb[e]+1],3);v(a,a.dyn_ltree,b-1),v(a,a.dyn_dtree,c-1)}function y(a){var b,c=4093624447;for(b=0;31>=b;b++,c>>>=1)if(1&c&&0!==a.dyn_ltree[2*b])return G;if(0!==a.dyn_ltree[18]||0!==a.dyn_ltree[20]||0!==a.dyn_ltree[26])return H;for(b=32;P>b;b++)if(0!==a.dyn_ltree[2*b])return H;return G}function z(a){pb||(m(),pb=!0),a.l_desc=new ob(a.dyn_ltree,kb),a.d_desc=new ob(a.dyn_dtree,lb),a.bl_desc=new ob(a.bl_tree,mb),a.bi_buf=0,a.bi_valid=0,n(a)}function A(a,b,c,d){g(a,(J<<1)+(d?1:0),3),p(a,b,c,!0)}function B(a){g(a,K<<1,3),h(a,X,eb),j(a)}function C(a,b,c,d){var e,f,h=0;a.level>0?(a.strm.data_type===I&&(a.strm.data_type=y(a)),t(a,a.l_desc),t(a,a.d_desc),h=w(a),e=a.opt_len+3+7>>>3,f=a.static_len+3+7>>>3,e>=f&&(e=f)):e=f=c+5,e>=c+4&&-1!==b?A(a,b,c,d):a.strategy===F||f===e?(g(a,(K<<1)+(d?1:0),3),s(a,eb,fb)):(g(a,(L<<1)+(d?1:0),3),x(a,a.l_desc.max_code+1,a.d_desc.max_code+1,h+1),s(a,a.dyn_ltree,a.dyn_dtree)),n(a),d&&o(a)}function D(a,b,c){return a.pending_buf[a.d_buf+2*a.last_lit]=b>>>8&255,a.pending_buf[a.d_buf+2*a.last_lit+1]=255&b,a.pending_buf[a.l_buf+a.last_lit]=255&c,a.last_lit++,0===b?a.dyn_ltree[2*c]++:(a.matches++,b--,a.dyn_ltree[2*(hb[c]+P+1)]++,a.dyn_dtree[2*e(b)]++),a.last_lit===a.lit_bufsize-1}var E=a("../utils/common"),F=4,G=0,H=1,I=2,J=0,K=1,L=2,M=3,N=258,O=29,P=256,Q=P+1+O,R=30,S=19,T=2*Q+1,U=15,V=16,W=7,X=256,Y=16,Z=17,$=18,_=[0,0,0,0,0,0,0,0,1,1,1,1,2,2,2,2,3,3,3,3,4,4,4,4,5,5,5,5,0],ab=[0,0,0,0,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13],bb=[0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,3,7],cb=[16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15],db=512,eb=new Array(2*(Q+2));d(eb);var fb=new Array(2*R);d(fb);var gb=new Array(db);d(gb);var hb=new Array(N-M+1);d(hb);var ib=new Array(O);d(ib);var jb=new Array(R);d(jb);var kb,lb,mb,nb=function(a,b,c,d,e){this.static_tree=a,this.extra_bits=b,this.extra_base=c,this.elems=d,this.max_length=e,this.has_stree=a&&a.length},ob=function(a,b){this.dyn_tree=a,this.max_code=0,this.stat_desc=b},pb=!1;c._tr_init=z,c._tr_stored_block=A,c._tr_flush_block=C,c._tr_tally=D,c._tr_align=B},{"../utils/common":27}],39:[function(a,b){"use strict";function c(){this.input=null,this.next_in=0,this.avail_in=0,this.total_in=0,this.output=null,this.next_out=0,this.avail_out=0,this.total_out=0,this.msg="",this.state=null,this.data_type=2,this.adler=0}b.exports=c},{}]},{},[9])(9)}); \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/pdfmake/pdfmake.js b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/pdfmake/pdfmake.js new file mode 100644 index 0000000..59ac401 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/export/libs/pdfmake/pdfmake.js @@ -0,0 +1,66368 @@ +/******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; + +/******/ // The require function +/******/ function __webpack_require__(moduleId) { + +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) +/******/ return installedModules[moduleId].exports; + +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ exports: {}, +/******/ id: moduleId, +/******/ loaded: false +/******/ }; + +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); + +/******/ // Flag the module as loaded +/******/ module.loaded = true; + +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } + + +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; + +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; + +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; + +/******/ // Load entry module and return exports +/******/ return __webpack_require__(0); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(global) {module.exports = global["pdfMake"] = __webpack_require__(1); + /* WEBPACK VAR INJECTION */}.call(exports, (function() { return this; }()))) + +/***/ }, +/* 1 */ +/***/ function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(Buffer) {/* jslint node: true */ + /* jslint browser: true */ + /* global BlobBuilder */ + 'use strict'; + + var PdfPrinter = __webpack_require__(2); + var saveAs = __webpack_require__(3); + + var defaultClientFonts = { + Roboto: { + normal: 'Roboto-Regular.ttf', + bold: 'Roboto-Medium.ttf', + italics: 'Roboto-Italic.ttf', + bolditalics: 'Roboto-Italic.ttf' + } + }; + + function Document(docDefinition, fonts, vfs) { + this.docDefinition = docDefinition; + this.fonts = fonts || defaultClientFonts; + this.vfs = vfs; + } + + Document.prototype._createDoc = function(options, callback) { + var printer = new PdfPrinter(this.fonts); + printer.fs.bindFS(this.vfs); + + var doc = printer.createPdfKitDocument(this.docDefinition, options); + var chunks = []; + var result; + + doc.on('data', function(chunk) { + chunks.push(chunk); + }); + doc.on('end', function() { + result = Buffer.concat(chunks); + callback(result, doc._pdfMakePages); + }); + doc.end(); + }; + + Document.prototype._getPages = function(options, cb){ + if (!cb) throw 'getBuffer is an async method and needs a callback argument'; + this._createDoc(options, function(ignoreBuffer, pages){ + cb(pages); + }); + }; + + Document.prototype.open = function(message) { + // we have to open the window immediately and store the reference + // otherwise popup blockers will stop us + var win = window.open('', '_blank'); + + try { + this.getDataUrl(function(result) { + win.location.href = result; + }); + } catch(e) { + win.close(); + throw e; + } + }; + + + Document.prototype.print = function() { + this.getDataUrl(function(dataUrl) { + var iFrame = document.createElement('iframe'); + iFrame.style.position = 'absolute'; + iFrame.style.left = '-99999px'; + iFrame.src = dataUrl; + iFrame.onload = function() { + function removeIFrame(){ + document.body.removeChild(iFrame); + document.removeEventListener('click', removeIFrame); + } + document.addEventListener('click', removeIFrame, false); + }; + + document.body.appendChild(iFrame); + }, { autoPrint: true }); + }; + + Document.prototype.download = function(defaultFileName, cb) { + if(typeof defaultFileName === "function") { + cb = defaultFileName; + defaultFileName = null; + } + + defaultFileName = defaultFileName || 'file.pdf'; + this.getBuffer(function(result) { + saveAs(new Blob([result], {type: 'application/pdf'}), defaultFileName); + if (typeof cb === "function") { + cb(); + } + }); + }; + + Document.prototype.getBase64 = function(cb, options) { + if (!cb) throw 'getBase64 is an async method and needs a callback argument'; + this._createDoc(options, function(buffer) { + cb(buffer.toString('base64')); + }); + }; + + Document.prototype.getDataUrl = function(cb, options) { + if (!cb) throw 'getDataUrl is an async method and needs a callback argument'; + this._createDoc(options, function(buffer) { + cb('data:application/pdf;base64,' + buffer.toString('base64')); + }); + }; + + Document.prototype.getBuffer = function(cb, options) { + if (!cb) throw 'getBuffer is an async method and needs a callback argument'; + this._createDoc(options, function(buffer){ + cb(buffer); + }); + }; + + module.exports = { + createPdf: function(docDefinition) { + return new Document(docDefinition, window.pdfMake.fonts, window.pdfMake.vfs); + } + }; + + /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(4).Buffer)) + +/***/ }, +/* 2 */ +/***/ function(module, exports, __webpack_require__) { + + /* jslint node: true */ + /* global window */ + 'use strict'; + + var _ = __webpack_require__(11); + var FontProvider = __webpack_require__(5); + var LayoutBuilder = __webpack_require__(6); + var PdfKit = __webpack_require__(28); + var PDFReference = __webpack_require__(12); + var sizes = __webpack_require__(7); + var ImageMeasure = __webpack_require__(8); + var textDecorator = __webpack_require__(9); + var FontProvider = __webpack_require__(5); + + //////////////////////////////////////// + // PdfPrinter + + /** + * @class Creates an instance of a PdfPrinter which turns document definition into a pdf + * + * @param {Object} fontDescriptors font definition dictionary + * + * @example + * var fontDescriptors = { + * Roboto: { + * normal: 'fonts/Roboto-Regular.ttf', + * bold: 'fonts/Roboto-Medium.ttf', + * italics: 'fonts/Roboto-Italic.ttf', + * bolditalics: 'fonts/Roboto-Italic.ttf' + * } + * }; + * + * var printer = new PdfPrinter(fontDescriptors); + */ + function PdfPrinter(fontDescriptors) { + this.fontDescriptors = fontDescriptors; + } + + /** + * Executes layout engine for the specified document and renders it into a pdfkit document + * ready to be saved. + * + * @param {Object} docDefinition document definition + * @param {Object} docDefinition.content an array describing the pdf structure (for more information take a look at the examples in the /examples folder) + * @param {Object} [docDefinition.defaultStyle] default (implicit) style definition + * @param {Object} [docDefinition.styles] dictionary defining all styles which can be used in the document + * @param {Object} [docDefinition.pageSize] page size (pdfkit units, A4 dimensions by default) + * @param {Number} docDefinition.pageSize.width width + * @param {Number} docDefinition.pageSize.height height + * @param {Object} [docDefinition.pageMargins] page margins (pdfkit units) + * + * @example + * + * var docDefinition = { + * content: [ + * 'First paragraph', + * 'Second paragraph, this time a little bit longer', + * { text: 'Third paragraph, slightly bigger font size', fontSize: 20 }, + * { text: 'Another paragraph using a named style', style: 'header' }, + * { text: ['playing with ', 'inlines' ] }, + * { text: ['and ', { text: 'restyling ', bold: true }, 'them'] }, + * ], + * styles: { + * header: { fontSize: 30, bold: true } + * } + * } + * + * var pdfDoc = printer.createPdfKitDocument(docDefinition); + * + * pdfDoc.pipe(fs.createWriteStream('sample.pdf')); + * pdfDoc.end(); + * + * @return {Object} a pdfKit document object which can be saved or encode to data-url + */ + PdfPrinter.prototype.createPdfKitDocument = function(docDefinition, options) { + options = options || {}; + + var pageSize = pageSize2widthAndHeight(docDefinition.pageSize || 'a4'); + + if(docDefinition.pageOrientation === 'landscape') { + pageSize = { width: pageSize.height, height: pageSize.width}; + } + pageSize.orientation = docDefinition.pageOrientation === 'landscape' ? docDefinition.pageOrientation : 'portrait'; + + this.pdfKitDoc = new PdfKit({ size: [ pageSize.width, pageSize.height ], compress: false}); + this.pdfKitDoc.info.Producer = 'pdfmake'; + this.pdfKitDoc.info.Creator = 'pdfmake'; + this.fontProvider = new FontProvider(this.fontDescriptors, this.pdfKitDoc); + + docDefinition.images = docDefinition.images || {}; + + var builder = new LayoutBuilder( + pageSize, + fixPageMargins(docDefinition.pageMargins || 40), + new ImageMeasure(this.pdfKitDoc, docDefinition.images)); + + registerDefaultTableLayouts(builder); + if (options.tableLayouts) { + builder.registerTableLayouts(options.tableLayouts); + } + + var pages = builder.layoutDocument(docDefinition.content, this.fontProvider, docDefinition.styles || {}, docDefinition.defaultStyle || { fontSize: 12, font: 'Roboto' }, docDefinition.background, docDefinition.header, docDefinition.footer, docDefinition.images, docDefinition.watermark, docDefinition.pageBreakBefore); + + renderPages(pages, this.fontProvider, this.pdfKitDoc); + + if(options.autoPrint){ + var jsRef = this.pdfKitDoc.ref({ + S: 'JavaScript', + JS: new StringObject('this.print\\(true\\);') + }); + var namesRef = this.pdfKitDoc.ref({ + Names: [new StringObject('EmbeddedJS'), new PDFReference(this.pdfKitDoc, jsRef.id)], + }); + + jsRef.end(); + namesRef.end(); + + this.pdfKitDoc._root.data.Names = { + JavaScript: new PDFReference(this.pdfKitDoc, namesRef.id) + }; + } + return this.pdfKitDoc; + }; + + function fixPageMargins(margin) { + if (!margin) return null; + + if (typeof margin === 'number' || margin instanceof Number) { + margin = { left: margin, right: margin, top: margin, bottom: margin }; + } else if (margin instanceof Array) { + if (margin.length === 2) { + margin = { left: margin[0], top: margin[1], right: margin[0], bottom: margin[1] }; + } else if (margin.length === 4) { + margin = { left: margin[0], top: margin[1], right: margin[2], bottom: margin[3] }; + } else throw 'Invalid pageMargins definition'; + } + + return margin; + } + + function registerDefaultTableLayouts(layoutBuilder) { + layoutBuilder.registerTableLayouts({ + noBorders: { + hLineWidth: function(i) { return 0; }, + vLineWidth: function(i) { return 0; }, + paddingLeft: function(i) { return i && 4 || 0; }, + paddingRight: function(i, node) { return (i < node.table.widths.length - 1) ? 4 : 0; }, + }, + headerLineOnly: { + hLineWidth: function(i, node) { + if (i === 0 || i === node.table.body.length) return 0; + return (i === node.table.headerRows) ? 2 : 0; + }, + vLineWidth: function(i) { return 0; }, + paddingLeft: function(i) { + return i === 0 ? 0 : 8; + }, + paddingRight: function(i, node) { + return (i === node.table.widths.length - 1) ? 0 : 8; + } + }, + lightHorizontalLines: { + hLineWidth: function(i, node) { + if (i === 0 || i === node.table.body.length) return 0; + return (i === node.table.headerRows) ? 2 : 1; + }, + vLineWidth: function(i) { return 0; }, + hLineColor: function(i) { return i === 1 ? 'black' : '#aaa'; }, + paddingLeft: function(i) { + return i === 0 ? 0 : 8; + }, + paddingRight: function(i, node) { + return (i === node.table.widths.length - 1) ? 0 : 8; + } + } + }); + } + + var defaultLayout = { + hLineWidth: function(i, node) { return 1; }, //return node.table.headerRows && i === node.table.headerRows && 3 || 0; }, + vLineWidth: function(i, node) { return 1; }, + hLineColor: function(i, node) { return 'black'; }, + vLineColor: function(i, node) { return 'black'; }, + paddingLeft: function(i, node) { return 4; }, //i && 4 || 0; }, + paddingRight: function(i, node) { return 4; }, //(i < node.table.widths.length - 1) ? 4 : 0; }, + paddingTop: function(i, node) { return 2; }, + paddingBottom: function(i, node) { return 2; } + }; + + function pageSize2widthAndHeight(pageSize) { + if (typeof pageSize == 'string' || pageSize instanceof String) { + var size = sizes[pageSize.toUpperCase()]; + if (!size) throw ('Page size ' + pageSize + ' not recognized'); + return { width: size[0], height: size[1] }; + } + + return pageSize; + } + + function StringObject(str){ + this.isString = true; + this.toString = function(){ + return str; + }; + } + + function updatePageOrientationInOptions(currentPage, pdfKitDoc) { + var previousPageOrientation = pdfKitDoc.options.size[0] > pdfKitDoc.options.size[1] ? 'landscape' : 'portrait'; + + if(currentPage.pageSize.orientation !== previousPageOrientation) { + var width = pdfKitDoc.options.size[0]; + var height = pdfKitDoc.options.size[1]; + pdfKitDoc.options.size = [height, width]; + } + } + + function renderPages(pages, fontProvider, pdfKitDoc) { + pdfKitDoc._pdfMakePages = pages; + for (var i = 0; i < pages.length; i++) { + if (i > 0) { + updatePageOrientationInOptions(pages[i], pdfKitDoc); + pdfKitDoc.addPage(pdfKitDoc.options); + } + + var page = pages[i]; + for(var ii = 0, il = page.items.length; ii < il; ii++) { + var item = page.items[ii]; + switch(item.type) { + case 'vector': + renderVector(item.item, pdfKitDoc); + break; + case 'line': + renderLine(item.item, item.item.x, item.item.y, pdfKitDoc); + break; + case 'image': + renderImage(item.item, item.item.x, item.item.y, pdfKitDoc); + break; + } + } + if(page.watermark){ + renderWatermark(page, pdfKitDoc); + } + + fontProvider.setFontRefsToPdfDoc(); + } + } + + function renderLine(line, x, y, pdfKitDoc) { + x = x || 0; + y = y || 0; + + var ascenderHeight = line.getAscenderHeight(); + + textDecorator.drawBackground(line, x, y, pdfKitDoc); + + //TODO: line.optimizeInlines(); + for(var i = 0, l = line.inlines.length; i < l; i++) { + var inline = line.inlines[i]; + + pdfKitDoc.fill(inline.color || 'black'); + + pdfKitDoc.save(); + pdfKitDoc.transform(1, 0, 0, -1, 0, pdfKitDoc.page.height); + + + var encoded = inline.font.encode(inline.text); + pdfKitDoc.addContent('BT'); + + pdfKitDoc.addContent('' + (x + inline.x) + ' ' + (pdfKitDoc.page.height - y - ascenderHeight) + ' Td'); + pdfKitDoc.addContent('/' + encoded.fontId + ' ' + inline.fontSize + ' Tf'); + + pdfKitDoc.addContent('<' + encoded.encodedText + '> Tj'); + + pdfKitDoc.addContent('ET'); + pdfKitDoc.restore(); + } + + textDecorator.drawDecorations(line, x, y, pdfKitDoc); + + } + + function renderWatermark(page, pdfKitDoc){ + var watermark = page.watermark; + + pdfKitDoc.fill('black'); + pdfKitDoc.opacity(0.6); + + pdfKitDoc.save(); + pdfKitDoc.transform(1, 0, 0, -1, 0, pdfKitDoc.page.height); + + var angle = Math.atan2(pdfKitDoc.page.height, pdfKitDoc.page.width) * 180/Math.PI; + pdfKitDoc.rotate(angle, {origin: [pdfKitDoc.page.width/2, pdfKitDoc.page.height/2]}); + + var encoded = watermark.font.encode(watermark.text); + pdfKitDoc.addContent('BT'); + pdfKitDoc.addContent('' + (pdfKitDoc.page.width/2 - watermark.size.size.width/2) + ' ' + (pdfKitDoc.page.height/2 - watermark.size.size.height/4) + ' Td'); + pdfKitDoc.addContent('/' + encoded.fontId + ' ' + watermark.size.fontSize + ' Tf'); + pdfKitDoc.addContent('<' + encoded.encodedText + '> Tj'); + pdfKitDoc.addContent('ET'); + pdfKitDoc.restore(); + } + + function renderVector(vector, pdfDoc) { + //TODO: pdf optimization (there's no need to write all properties everytime) + pdfDoc.lineWidth(vector.lineWidth || 1); + if (vector.dash) { + pdfDoc.dash(vector.dash.length, { space: vector.dash.space || vector.dash.length }); + } else { + pdfDoc.undash(); + } + pdfDoc.fillOpacity(vector.fillOpacity || 1); + pdfDoc.strokeOpacity(vector.strokeOpacity || 1); + pdfDoc.lineJoin(vector.lineJoin || 'miter'); + + //TODO: clipping + + switch(vector.type) { + case 'ellipse': + pdfDoc.ellipse(vector.x, vector.y, vector.r1, vector.r2); + break; + case 'rect': + if (vector.r) { + pdfDoc.roundedRect(vector.x, vector.y, vector.w, vector.h, vector.r); + } else { + pdfDoc.rect(vector.x, vector.y, vector.w, vector.h); + } + break; + case 'line': + pdfDoc.moveTo(vector.x1, vector.y1); + pdfDoc.lineTo(vector.x2, vector.y2); + break; + case 'polyline': + if (vector.points.length === 0) break; + + pdfDoc.moveTo(vector.points[0].x, vector.points[0].y); + for(var i = 1, l = vector.points.length; i < l; i++) { + pdfDoc.lineTo(vector.points[i].x, vector.points[i].y); + } + + if (vector.points.length > 1) { + var p1 = vector.points[0]; + var pn = vector.points[vector.points.length - 1]; + + if (vector.closePath || p1.x === pn.x && p1.y === pn.y) { + pdfDoc.closePath(); + } + } + break; + } + + if (vector.color && vector.lineColor) { + pdfDoc.fillAndStroke(vector.color, vector.lineColor); + } else if (vector.color) { + pdfDoc.fill(vector.color); + } else { + pdfDoc.stroke(vector.lineColor || 'black'); + } + } + + function renderImage(image, x, y, pdfKitDoc) { + pdfKitDoc.image(image.image, image.x, image.y, { width: image._width, height: image._height }); + } + + module.exports = PdfPrinter; + + + /* temporary browser extension */ + PdfPrinter.prototype.fs = __webpack_require__(10); + + +/***/ }, +/* 3 */ +/***/ function(module, exports, __webpack_require__) { + + var __WEBPACK_AMD_DEFINE_ARRAY__, __WEBPACK_AMD_DEFINE_RESULT__;/* WEBPACK VAR INJECTION */(function(module) {/* FileSaver.js + * A saveAs() FileSaver implementation. + * 2014-08-29 + * + * By Eli Grey, http://eligrey.com + * License: X11/MIT + * See https://github.com/eligrey/FileSaver.js/blob/master/LICENSE.md + */ + + /*global self */ + /*jslint bitwise: true, indent: 4, laxbreak: true, laxcomma: true, smarttabs: true, plusplus: true */ + + /*! @source http://purl.eligrey.com/github/FileSaver.js/blob/master/FileSaver.js */ + + var saveAs = saveAs + // IE 10+ (native saveAs) + || (typeof navigator !== "undefined" && + navigator.msSaveOrOpenBlob && navigator.msSaveOrOpenBlob.bind(navigator)) + // Everyone else + || (function(view) { + "use strict"; + // IE <10 is explicitly unsupported + if (typeof navigator !== "undefined" && + /MSIE [1-9]\./.test(navigator.userAgent)) { + return; + } + var + doc = view.document + // only get URL when necessary in case Blob.js hasn't overridden it yet + , get_URL = function() { + return view.URL || view.webkitURL || view; + } + , save_link = doc.createElementNS("http://www.w3.org/1999/xhtml", "a") + , can_use_save_link = "download" in save_link + , click = function(node) { + var event = doc.createEvent("MouseEvents"); + event.initMouseEvent( + "click", true, false, view, 0, 0, 0, 0, 0 + , false, false, false, false, 0, null + ); + node.dispatchEvent(event); + } + , webkit_req_fs = view.webkitRequestFileSystem + , req_fs = view.requestFileSystem || webkit_req_fs || view.mozRequestFileSystem + , throw_outside = function(ex) { + (view.setImmediate || view.setTimeout)(function() { + throw ex; + }, 0); + } + , force_saveable_type = "application/octet-stream" + , fs_min_size = 0 + // See https://code.google.com/p/chromium/issues/detail?id=375297#c7 for + // the reasoning behind the timeout and revocation flow + , arbitrary_revoke_timeout = 10 + , revoke = function(file) { + var revoker = function() { + if (typeof file === "string") { // file is an object URL + get_URL().revokeObjectURL(file); + } else { // file is a File + file.remove(); + } + }; + if (view.chrome) { + revoker(); + } else { + setTimeout(revoker, arbitrary_revoke_timeout); + } + } + , dispatch = function(filesaver, event_types, event) { + event_types = [].concat(event_types); + var i = event_types.length; + while (i--) { + var listener = filesaver["on" + event_types[i]]; + if (typeof listener === "function") { + try { + listener.call(filesaver, event || filesaver); + } catch (ex) { + throw_outside(ex); + } + } + } + } + , FileSaver = function(blob, name) { + // First try a.download, then web filesystem, then object URLs + var + filesaver = this + , type = blob.type + , blob_changed = false + , object_url + , target_view + , dispatch_all = function() { + dispatch(filesaver, "writestart progress write writeend".split(" ")); + } + // on any filesys errors revert to saving with object URLs + , fs_error = function() { + // don't create more object URLs than needed + if (blob_changed || !object_url) { + object_url = get_URL().createObjectURL(blob); + } + if (target_view) { + target_view.location.href = object_url; + } else { + var new_tab = view.open(object_url, "_blank"); + if (new_tab == undefined && typeof safari !== "undefined") { + //Apple do not allow window.open, see http://bit.ly/1kZffRI + view.location.href = object_url + } + } + filesaver.readyState = filesaver.DONE; + dispatch_all(); + revoke(object_url); + } + , abortable = function(func) { + return function() { + if (filesaver.readyState !== filesaver.DONE) { + return func.apply(this, arguments); + } + }; + } + , create_if_not_found = {create: true, exclusive: false} + , slice + ; + filesaver.readyState = filesaver.INIT; + if (!name) { + name = "download"; + } + if (can_use_save_link) { + object_url = get_URL().createObjectURL(blob); + save_link.href = object_url; + save_link.download = name; + click(save_link); + filesaver.readyState = filesaver.DONE; + dispatch_all(); + revoke(object_url); + return; + } + // Object and web filesystem URLs have a problem saving in Google Chrome when + // viewed in a tab, so I force save with application/octet-stream + // http://code.google.com/p/chromium/issues/detail?id=91158 + // Update: Google errantly closed 91158, I submitted it again: + // https://code.google.com/p/chromium/issues/detail?id=389642 + if (view.chrome && type && type !== force_saveable_type) { + slice = blob.slice || blob.webkitSlice; + blob = slice.call(blob, 0, blob.size, force_saveable_type); + blob_changed = true; + } + // Since I can't be sure that the guessed media type will trigger a download + // in WebKit, I append .download to the filename. + // https://bugs.webkit.org/show_bug.cgi?id=65440 + if (webkit_req_fs && name !== "download") { + name += ".download"; + } + if (type === force_saveable_type || webkit_req_fs) { + target_view = view; + } + if (!req_fs) { + fs_error(); + return; + } + fs_min_size += blob.size; + req_fs(view.TEMPORARY, fs_min_size, abortable(function(fs) { + fs.root.getDirectory("saved", create_if_not_found, abortable(function(dir) { + var save = function() { + dir.getFile(name, create_if_not_found, abortable(function(file) { + file.createWriter(abortable(function(writer) { + writer.onwriteend = function(event) { + target_view.location.href = file.toURL(); + filesaver.readyState = filesaver.DONE; + dispatch(filesaver, "writeend", event); + revoke(file); + }; + writer.onerror = function() { + var error = writer.error; + if (error.code !== error.ABORT_ERR) { + fs_error(); + } + }; + "writestart progress write abort".split(" ").forEach(function(event) { + writer["on" + event] = filesaver["on" + event]; + }); + writer.write(blob); + filesaver.abort = function() { + writer.abort(); + filesaver.readyState = filesaver.DONE; + }; + filesaver.readyState = filesaver.WRITING; + }), fs_error); + }), fs_error); + }; + dir.getFile(name, {create: false}, abortable(function(file) { + // delete file if it already exists + file.remove(); + save(); + }), abortable(function(ex) { + if (ex.code === ex.NOT_FOUND_ERR) { + save(); + } else { + fs_error(); + } + })); + }), fs_error); + }), fs_error); + } + , FS_proto = FileSaver.prototype + , saveAs = function(blob, name) { + return new FileSaver(blob, name); + } + ; + FS_proto.abort = function() { + var filesaver = this; + filesaver.readyState = filesaver.DONE; + dispatch(filesaver, "abort"); + }; + FS_proto.readyState = FS_proto.INIT = 0; + FS_proto.WRITING = 1; + FS_proto.DONE = 2; + + FS_proto.error = + FS_proto.onwritestart = + FS_proto.onprogress = + FS_proto.onwrite = + FS_proto.onabort = + FS_proto.onerror = + FS_proto.onwriteend = + null; + + return saveAs; + }( + typeof self !== "undefined" && self + || typeof window !== "undefined" && window + || this.content + )); + // `self` is undefined in Firefox for Android content script context + // while `this` is nsIContentFrameMessageManager + // with an attribute `content` that corresponds to the window + + if (typeof module !== "undefined" && module !== null) { + module.exports = saveAs; + } else if (("function" !== "undefined" && __webpack_require__(13) !== null) && (__webpack_require__(14) != null)) { + !(__WEBPACK_AMD_DEFINE_ARRAY__ = [], __WEBPACK_AMD_DEFINE_RESULT__ = function() { + return saveAs; + }.apply(exports, __WEBPACK_AMD_DEFINE_ARRAY__), __WEBPACK_AMD_DEFINE_RESULT__ !== undefined && (module.exports = __WEBPACK_AMD_DEFINE_RESULT__)); + } + + /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(15)(module))) + +/***/ }, +/* 4 */ +/***/ function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(Buffer) {/*! + * The buffer module from node.js, for the browser. + * + * @author Feross Aboukhadijeh + * @license MIT + */ + + var base64 = __webpack_require__(31) + var ieee754 = __webpack_require__(29) + var isArray = __webpack_require__(30) + + exports.Buffer = Buffer + exports.SlowBuffer = SlowBuffer + exports.INSPECT_MAX_BYTES = 50 + Buffer.poolSize = 8192 // not used by this implementation + + var kMaxLength = 0x3fffffff + var rootParent = {} + + /** + * If `Buffer.TYPED_ARRAY_SUPPORT`: + * === true Use Uint8Array implementation (fastest) + * === false Use Object implementation (most compatible, even IE6) + * + * Browsers that support typed arrays are IE 10+, Firefox 4+, Chrome 7+, Safari 5.1+, + * Opera 11.6+, iOS 4.2+. + * + * Note: + * + * - Implementation must support adding new properties to `Uint8Array` instances. + * Firefox 4-29 lacked support, fixed in Firefox 30+. + * See: https://bugzilla.mozilla.org/show_bug.cgi?id=695438. + * + * - Chrome 9-10 is missing the `TypedArray.prototype.subarray` function. + * + * - IE10 has a broken `TypedArray.prototype.subarray` function which returns arrays of + * incorrect length in some situations. + * + * We detect these buggy browsers and set `Buffer.TYPED_ARRAY_SUPPORT` to `false` so they will + * get the Object implementation, which is slower but will work correctly. + */ + Buffer.TYPED_ARRAY_SUPPORT = (function () { + try { + var buf = new ArrayBuffer(0) + var arr = new Uint8Array(buf) + arr.foo = function () { return 42 } + return arr.foo() === 42 && // typed array instances can be augmented + typeof arr.subarray === 'function' && // chrome 9-10 lack `subarray` + new Uint8Array(1).subarray(1, 1).byteLength === 0 // ie10 has broken `subarray` + } catch (e) { + return false + } + })() + + /** + * Class: Buffer + * ============= + * + * The Buffer constructor returns instances of `Uint8Array` that are augmented + * with function properties for all the node `Buffer` API functions. We use + * `Uint8Array` so that square bracket notation works as expected -- it returns + * a single octet. + * + * By augmenting the instances, we can avoid modifying the `Uint8Array` + * prototype. + */ + function Buffer (arg) { + if (!(this instanceof Buffer)) { + // Avoid going through an ArgumentsAdaptorTrampoline in the common case. + if (arguments.length > 1) return new Buffer(arg, arguments[1]) + return new Buffer(arg) + } + + this.length = 0 + this.parent = undefined + + // Common case. + if (typeof arg === 'number') { + return fromNumber(this, arg) + } + + // Slightly less common case. + if (typeof arg === 'string') { + return fromString(this, arg, arguments.length > 1 ? arguments[1] : 'utf8') + } + + // Unusual. + return fromObject(this, arg) + } + + function fromNumber (that, length) { + that = allocate(that, length < 0 ? 0 : checked(length) | 0) + if (!Buffer.TYPED_ARRAY_SUPPORT) { + for (var i = 0; i < length; i++) { + that[i] = 0 + } + } + return that + } + + function fromString (that, string, encoding) { + if (typeof encoding !== 'string' || encoding === '') encoding = 'utf8' + + // Assumption: byteLength() return value is always < kMaxLength. + var length = byteLength(string, encoding) | 0 + that = allocate(that, length) + + that.write(string, encoding) + return that + } + + function fromObject (that, object) { + if (Buffer.isBuffer(object)) return fromBuffer(that, object) + + if (isArray(object)) return fromArray(that, object) + + if (object == null) { + throw new TypeError('must start with number, buffer, array or string') + } + + if (typeof ArrayBuffer !== 'undefined' && object.buffer instanceof ArrayBuffer) { + return fromTypedArray(that, object) + } + + if (object.length) return fromArrayLike(that, object) + + return fromJsonObject(that, object) + } + + function fromBuffer (that, buffer) { + var length = checked(buffer.length) | 0 + that = allocate(that, length) + buffer.copy(that, 0, 0, length) + return that + } + + function fromArray (that, array) { + var length = checked(array.length) | 0 + that = allocate(that, length) + for (var i = 0; i < length; i += 1) { + that[i] = array[i] & 255 + } + return that + } + + // Duplicate of fromArray() to keep fromArray() monomorphic. + function fromTypedArray (that, array) { + var length = checked(array.length) | 0 + that = allocate(that, length) + // Truncating the elements is probably not what people expect from typed + // arrays with BYTES_PER_ELEMENT > 1 but it's compatible with the behavior + // of the old Buffer constructor. + for (var i = 0; i < length; i += 1) { + that[i] = array[i] & 255 + } + return that + } + + function fromArrayLike (that, array) { + var length = checked(array.length) | 0 + that = allocate(that, length) + for (var i = 0; i < length; i += 1) { + that[i] = array[i] & 255 + } + return that + } + + // Deserialize { type: 'Buffer', data: [1,2,3,...] } into a Buffer object. + // Returns a zero-length buffer for inputs that don't conform to the spec. + function fromJsonObject (that, object) { + var array + var length = 0 + + if (object.type === 'Buffer' && isArray(object.data)) { + array = object.data + length = checked(array.length) | 0 + } + that = allocate(that, length) + + for (var i = 0; i < length; i += 1) { + that[i] = array[i] & 255 + } + return that + } + + function allocate (that, length) { + if (Buffer.TYPED_ARRAY_SUPPORT) { + // Return an augmented `Uint8Array` instance, for best performance + that = Buffer._augment(new Uint8Array(length)) + } else { + // Fallback: Return an object instance of the Buffer class + that.length = length + that._isBuffer = true + } + + var fromPool = length !== 0 && length <= Buffer.poolSize >>> 1 + if (fromPool) that.parent = rootParent + + return that + } + + function checked (length) { + // Note: cannot use `length < kMaxLength` here because that fails when + // length is NaN (which is otherwise coerced to zero.) + if (length >= kMaxLength) { + throw new RangeError('Attempt to allocate Buffer larger than maximum ' + + 'size: 0x' + kMaxLength.toString(16) + ' bytes') + } + return length | 0 + } + + function SlowBuffer (subject, encoding) { + if (!(this instanceof SlowBuffer)) return new SlowBuffer(subject, encoding) + + var buf = new Buffer(subject, encoding) + delete buf.parent + return buf + } + + Buffer.isBuffer = function isBuffer (b) { + return !!(b != null && b._isBuffer) + } + + Buffer.compare = function compare (a, b) { + if (!Buffer.isBuffer(a) || !Buffer.isBuffer(b)) { + throw new TypeError('Arguments must be Buffers') + } + + if (a === b) return 0 + + var x = a.length + var y = b.length + + var i = 0 + var len = Math.min(x, y) + while (i < len) { + if (a[i] !== b[i]) break + + ++i + } + + if (i !== len) { + x = a[i] + y = b[i] + } + + if (x < y) return -1 + if (y < x) return 1 + return 0 + } + + Buffer.isEncoding = function isEncoding (encoding) { + switch (String(encoding).toLowerCase()) { + case 'hex': + case 'utf8': + case 'utf-8': + case 'ascii': + case 'binary': + case 'base64': + case 'raw': + case 'ucs2': + case 'ucs-2': + case 'utf16le': + case 'utf-16le': + return true + default: + return false + } + } + + Buffer.concat = function concat (list, length) { + if (!isArray(list)) throw new TypeError('list argument must be an Array of Buffers.') + + if (list.length === 0) { + return new Buffer(0) + } else if (list.length === 1) { + return list[0] + } + + var i + if (length === undefined) { + length = 0 + for (i = 0; i < list.length; i++) { + length += list[i].length + } + } + + var buf = new Buffer(length) + var pos = 0 + for (i = 0; i < list.length; i++) { + var item = list[i] + item.copy(buf, pos) + pos += item.length + } + return buf + } + + function byteLength (string, encoding) { + if (typeof string !== 'string') string = String(string) + + if (string.length === 0) return 0 + + switch (encoding || 'utf8') { + case 'ascii': + case 'binary': + case 'raw': + return string.length + case 'ucs2': + case 'ucs-2': + case 'utf16le': + case 'utf-16le': + return string.length * 2 + case 'hex': + return string.length >>> 1 + case 'utf8': + case 'utf-8': + return utf8ToBytes(string).length + case 'base64': + return base64ToBytes(string).length + default: + return string.length + } + } + Buffer.byteLength = byteLength + + // pre-set for values that may exist in the future + Buffer.prototype.length = undefined + Buffer.prototype.parent = undefined + + // toString(encoding, start=0, end=buffer.length) + Buffer.prototype.toString = function toString (encoding, start, end) { + var loweredCase = false + + start = start | 0 + end = end === undefined || end === Infinity ? this.length : end | 0 + + if (!encoding) encoding = 'utf8' + if (start < 0) start = 0 + if (end > this.length) end = this.length + if (end <= start) return '' + + while (true) { + switch (encoding) { + case 'hex': + return hexSlice(this, start, end) + + case 'utf8': + case 'utf-8': + return utf8Slice(this, start, end) + + case 'ascii': + return asciiSlice(this, start, end) + + case 'binary': + return binarySlice(this, start, end) + + case 'base64': + return base64Slice(this, start, end) + + case 'ucs2': + case 'ucs-2': + case 'utf16le': + case 'utf-16le': + return utf16leSlice(this, start, end) + + default: + if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding) + encoding = (encoding + '').toLowerCase() + loweredCase = true + } + } + } + + Buffer.prototype.equals = function equals (b) { + if (!Buffer.isBuffer(b)) throw new TypeError('Argument must be a Buffer') + if (this === b) return true + return Buffer.compare(this, b) === 0 + } + + Buffer.prototype.inspect = function inspect () { + var str = '' + var max = exports.INSPECT_MAX_BYTES + if (this.length > 0) { + str = this.toString('hex', 0, max).match(/.{2}/g).join(' ') + if (this.length > max) str += ' ... ' + } + return '' + } + + Buffer.prototype.compare = function compare (b) { + if (!Buffer.isBuffer(b)) throw new TypeError('Argument must be a Buffer') + if (this === b) return 0 + return Buffer.compare(this, b) + } + + Buffer.prototype.indexOf = function indexOf (val, byteOffset) { + if (byteOffset > 0x7fffffff) byteOffset = 0x7fffffff + else if (byteOffset < -0x80000000) byteOffset = -0x80000000 + byteOffset >>= 0 + + if (this.length === 0) return -1 + if (byteOffset >= this.length) return -1 + + // Negative offsets start from the end of the buffer + if (byteOffset < 0) byteOffset = Math.max(this.length + byteOffset, 0) + + if (typeof val === 'string') { + if (val.length === 0) return -1 // special case: looking for empty string always fails + return String.prototype.indexOf.call(this, val, byteOffset) + } + if (Buffer.isBuffer(val)) { + return arrayIndexOf(this, val, byteOffset) + } + if (typeof val === 'number') { + if (Buffer.TYPED_ARRAY_SUPPORT && Uint8Array.prototype.indexOf === 'function') { + return Uint8Array.prototype.indexOf.call(this, val, byteOffset) + } + return arrayIndexOf(this, [ val ], byteOffset) + } + + function arrayIndexOf (arr, val, byteOffset) { + var foundIndex = -1 + for (var i = 0; byteOffset + i < arr.length; i++) { + if (arr[byteOffset + i] === val[foundIndex === -1 ? 0 : i - foundIndex]) { + if (foundIndex === -1) foundIndex = i + if (i - foundIndex + 1 === val.length) return byteOffset + foundIndex + } else { + foundIndex = -1 + } + } + return -1 + } + + throw new TypeError('val must be string, number or Buffer') + } + + // `get` will be removed in Node 0.13+ + Buffer.prototype.get = function get (offset) { + console.log('.get() is deprecated. Access using array indexes instead.') + return this.readUInt8(offset) + } + + // `set` will be removed in Node 0.13+ + Buffer.prototype.set = function set (v, offset) { + console.log('.set() is deprecated. Access using array indexes instead.') + return this.writeUInt8(v, offset) + } + + function hexWrite (buf, string, offset, length) { + offset = Number(offset) || 0 + var remaining = buf.length - offset + if (!length) { + length = remaining + } else { + length = Number(length) + if (length > remaining) { + length = remaining + } + } + + // must be an even number of digits + var strLen = string.length + if (strLen % 2 !== 0) throw new Error('Invalid hex string') + + if (length > strLen / 2) { + length = strLen / 2 + } + for (var i = 0; i < length; i++) { + var parsed = parseInt(string.substr(i * 2, 2), 16) + if (isNaN(parsed)) throw new Error('Invalid hex string') + buf[offset + i] = parsed + } + return i + } + + function utf8Write (buf, string, offset, length) { + return blitBuffer(utf8ToBytes(string, buf.length - offset), buf, offset, length) + } + + function asciiWrite (buf, string, offset, length) { + return blitBuffer(asciiToBytes(string), buf, offset, length) + } + + function binaryWrite (buf, string, offset, length) { + return asciiWrite(buf, string, offset, length) + } + + function base64Write (buf, string, offset, length) { + return blitBuffer(base64ToBytes(string), buf, offset, length) + } + + function ucs2Write (buf, string, offset, length) { + return blitBuffer(utf16leToBytes(string, buf.length - offset), buf, offset, length) + } + + Buffer.prototype.write = function write (string, offset, length, encoding) { + // Buffer#write(string) + if (offset === undefined) { + encoding = 'utf8' + length = this.length + offset = 0 + // Buffer#write(string, encoding) + } else if (length === undefined && typeof offset === 'string') { + encoding = offset + length = this.length + offset = 0 + // Buffer#write(string, offset[, length][, encoding]) + } else if (isFinite(offset)) { + offset = offset | 0 + if (isFinite(length)) { + length = length | 0 + if (encoding === undefined) encoding = 'utf8' + } else { + encoding = length + length = undefined + } + // legacy write(string, encoding, offset, length) - remove in v0.13 + } else { + var swap = encoding + encoding = offset + offset = length | 0 + length = swap + } + + var remaining = this.length - offset + if (length === undefined || length > remaining) length = remaining + + if ((string.length > 0 && (length < 0 || offset < 0)) || offset > this.length) { + throw new RangeError('attempt to write outside buffer bounds') + } + + if (!encoding) encoding = 'utf8' + + var loweredCase = false + for (;;) { + switch (encoding) { + case 'hex': + return hexWrite(this, string, offset, length) + + case 'utf8': + case 'utf-8': + return utf8Write(this, string, offset, length) + + case 'ascii': + return asciiWrite(this, string, offset, length) + + case 'binary': + return binaryWrite(this, string, offset, length) + + case 'base64': + // Warning: maxLength not taken into account in base64Write + return base64Write(this, string, offset, length) + + case 'ucs2': + case 'ucs-2': + case 'utf16le': + case 'utf-16le': + return ucs2Write(this, string, offset, length) + + default: + if (loweredCase) throw new TypeError('Unknown encoding: ' + encoding) + encoding = ('' + encoding).toLowerCase() + loweredCase = true + } + } + } + + Buffer.prototype.toJSON = function toJSON () { + return { + type: 'Buffer', + data: Array.prototype.slice.call(this._arr || this, 0) + } + } + + function base64Slice (buf, start, end) { + if (start === 0 && end === buf.length) { + return base64.fromByteArray(buf) + } else { + return base64.fromByteArray(buf.slice(start, end)) + } + } + + function utf8Slice (buf, start, end) { + var res = '' + var tmp = '' + end = Math.min(buf.length, end) + + for (var i = start; i < end; i++) { + if (buf[i] <= 0x7F) { + res += decodeUtf8Char(tmp) + String.fromCharCode(buf[i]) + tmp = '' + } else { + tmp += '%' + buf[i].toString(16) + } + } + + return res + decodeUtf8Char(tmp) + } + + function asciiSlice (buf, start, end) { + var ret = '' + end = Math.min(buf.length, end) + + for (var i = start; i < end; i++) { + ret += String.fromCharCode(buf[i] & 0x7F) + } + return ret + } + + function binarySlice (buf, start, end) { + var ret = '' + end = Math.min(buf.length, end) + + for (var i = start; i < end; i++) { + ret += String.fromCharCode(buf[i]) + } + return ret + } + + function hexSlice (buf, start, end) { + var len = buf.length + + if (!start || start < 0) start = 0 + if (!end || end < 0 || end > len) end = len + + var out = '' + for (var i = start; i < end; i++) { + out += toHex(buf[i]) + } + return out + } + + function utf16leSlice (buf, start, end) { + var bytes = buf.slice(start, end) + var res = '' + for (var i = 0; i < bytes.length; i += 2) { + res += String.fromCharCode(bytes[i] + bytes[i + 1] * 256) + } + return res + } + + Buffer.prototype.slice = function slice (start, end) { + var len = this.length + start = ~~start + end = end === undefined ? len : ~~end + + if (start < 0) { + start += len + if (start < 0) start = 0 + } else if (start > len) { + start = len + } + + if (end < 0) { + end += len + if (end < 0) end = 0 + } else if (end > len) { + end = len + } + + if (end < start) end = start + + var newBuf + if (Buffer.TYPED_ARRAY_SUPPORT) { + newBuf = Buffer._augment(this.subarray(start, end)) + } else { + var sliceLen = end - start + newBuf = new Buffer(sliceLen, undefined) + for (var i = 0; i < sliceLen; i++) { + newBuf[i] = this[i + start] + } + } + + if (newBuf.length) newBuf.parent = this.parent || this + + return newBuf + } + + /* + * Need to make sure that buffer isn't trying to write out of bounds. + */ + function checkOffset (offset, ext, length) { + if ((offset % 1) !== 0 || offset < 0) throw new RangeError('offset is not uint') + if (offset + ext > length) throw new RangeError('Trying to access beyond buffer length') + } + + Buffer.prototype.readUIntLE = function readUIntLE (offset, byteLength, noAssert) { + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) checkOffset(offset, byteLength, this.length) + + var val = this[offset] + var mul = 1 + var i = 0 + while (++i < byteLength && (mul *= 0x100)) { + val += this[offset + i] * mul + } + + return val + } + + Buffer.prototype.readUIntBE = function readUIntBE (offset, byteLength, noAssert) { + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) { + checkOffset(offset, byteLength, this.length) + } + + var val = this[offset + --byteLength] + var mul = 1 + while (byteLength > 0 && (mul *= 0x100)) { + val += this[offset + --byteLength] * mul + } + + return val + } + + Buffer.prototype.readUInt8 = function readUInt8 (offset, noAssert) { + if (!noAssert) checkOffset(offset, 1, this.length) + return this[offset] + } + + Buffer.prototype.readUInt16LE = function readUInt16LE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 2, this.length) + return this[offset] | (this[offset + 1] << 8) + } + + Buffer.prototype.readUInt16BE = function readUInt16BE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 2, this.length) + return (this[offset] << 8) | this[offset + 1] + } + + Buffer.prototype.readUInt32LE = function readUInt32LE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + + return ((this[offset]) | + (this[offset + 1] << 8) | + (this[offset + 2] << 16)) + + (this[offset + 3] * 0x1000000) + } + + Buffer.prototype.readUInt32BE = function readUInt32BE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + + return (this[offset] * 0x1000000) + + ((this[offset + 1] << 16) | + (this[offset + 2] << 8) | + this[offset + 3]) + } + + Buffer.prototype.readIntLE = function readIntLE (offset, byteLength, noAssert) { + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) checkOffset(offset, byteLength, this.length) + + var val = this[offset] + var mul = 1 + var i = 0 + while (++i < byteLength && (mul *= 0x100)) { + val += this[offset + i] * mul + } + mul *= 0x80 + + if (val >= mul) val -= Math.pow(2, 8 * byteLength) + + return val + } + + Buffer.prototype.readIntBE = function readIntBE (offset, byteLength, noAssert) { + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) checkOffset(offset, byteLength, this.length) + + var i = byteLength + var mul = 1 + var val = this[offset + --i] + while (i > 0 && (mul *= 0x100)) { + val += this[offset + --i] * mul + } + mul *= 0x80 + + if (val >= mul) val -= Math.pow(2, 8 * byteLength) + + return val + } + + Buffer.prototype.readInt8 = function readInt8 (offset, noAssert) { + if (!noAssert) checkOffset(offset, 1, this.length) + if (!(this[offset] & 0x80)) return (this[offset]) + return ((0xff - this[offset] + 1) * -1) + } + + Buffer.prototype.readInt16LE = function readInt16LE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 2, this.length) + var val = this[offset] | (this[offset + 1] << 8) + return (val & 0x8000) ? val | 0xFFFF0000 : val + } + + Buffer.prototype.readInt16BE = function readInt16BE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 2, this.length) + var val = this[offset + 1] | (this[offset] << 8) + return (val & 0x8000) ? val | 0xFFFF0000 : val + } + + Buffer.prototype.readInt32LE = function readInt32LE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + + return (this[offset]) | + (this[offset + 1] << 8) | + (this[offset + 2] << 16) | + (this[offset + 3] << 24) + } + + Buffer.prototype.readInt32BE = function readInt32BE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + + return (this[offset] << 24) | + (this[offset + 1] << 16) | + (this[offset + 2] << 8) | + (this[offset + 3]) + } + + Buffer.prototype.readFloatLE = function readFloatLE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + return ieee754.read(this, offset, true, 23, 4) + } + + Buffer.prototype.readFloatBE = function readFloatBE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 4, this.length) + return ieee754.read(this, offset, false, 23, 4) + } + + Buffer.prototype.readDoubleLE = function readDoubleLE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 8, this.length) + return ieee754.read(this, offset, true, 52, 8) + } + + Buffer.prototype.readDoubleBE = function readDoubleBE (offset, noAssert) { + if (!noAssert) checkOffset(offset, 8, this.length) + return ieee754.read(this, offset, false, 52, 8) + } + + function checkInt (buf, value, offset, ext, max, min) { + if (!Buffer.isBuffer(buf)) throw new TypeError('buffer must be a Buffer instance') + if (value > max || value < min) throw new RangeError('value is out of bounds') + if (offset + ext > buf.length) throw new RangeError('index out of range') + } + + Buffer.prototype.writeUIntLE = function writeUIntLE (value, offset, byteLength, noAssert) { + value = +value + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) checkInt(this, value, offset, byteLength, Math.pow(2, 8 * byteLength), 0) + + var mul = 1 + var i = 0 + this[offset] = value & 0xFF + while (++i < byteLength && (mul *= 0x100)) { + this[offset + i] = (value / mul) & 0xFF + } + + return offset + byteLength + } + + Buffer.prototype.writeUIntBE = function writeUIntBE (value, offset, byteLength, noAssert) { + value = +value + offset = offset | 0 + byteLength = byteLength | 0 + if (!noAssert) checkInt(this, value, offset, byteLength, Math.pow(2, 8 * byteLength), 0) + + var i = byteLength - 1 + var mul = 1 + this[offset + i] = value & 0xFF + while (--i >= 0 && (mul *= 0x100)) { + this[offset + i] = (value / mul) & 0xFF + } + + return offset + byteLength + } + + Buffer.prototype.writeUInt8 = function writeUInt8 (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 1, 0xff, 0) + if (!Buffer.TYPED_ARRAY_SUPPORT) value = Math.floor(value) + this[offset] = value + return offset + 1 + } + + function objectWriteUInt16 (buf, value, offset, littleEndian) { + if (value < 0) value = 0xffff + value + 1 + for (var i = 0, j = Math.min(buf.length - offset, 2); i < j; i++) { + buf[offset + i] = (value & (0xff << (8 * (littleEndian ? i : 1 - i)))) >>> + (littleEndian ? i : 1 - i) * 8 + } + } + + Buffer.prototype.writeUInt16LE = function writeUInt16LE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = value + this[offset + 1] = (value >>> 8) + } else { + objectWriteUInt16(this, value, offset, true) + } + return offset + 2 + } + + Buffer.prototype.writeUInt16BE = function writeUInt16BE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 2, 0xffff, 0) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value >>> 8) + this[offset + 1] = value + } else { + objectWriteUInt16(this, value, offset, false) + } + return offset + 2 + } + + function objectWriteUInt32 (buf, value, offset, littleEndian) { + if (value < 0) value = 0xffffffff + value + 1 + for (var i = 0, j = Math.min(buf.length - offset, 4); i < j; i++) { + buf[offset + i] = (value >>> (littleEndian ? i : 3 - i) * 8) & 0xff + } + } + + Buffer.prototype.writeUInt32LE = function writeUInt32LE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset + 3] = (value >>> 24) + this[offset + 2] = (value >>> 16) + this[offset + 1] = (value >>> 8) + this[offset] = value + } else { + objectWriteUInt32(this, value, offset, true) + } + return offset + 4 + } + + Buffer.prototype.writeUInt32BE = function writeUInt32BE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 4, 0xffffffff, 0) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value >>> 24) + this[offset + 1] = (value >>> 16) + this[offset + 2] = (value >>> 8) + this[offset + 3] = value + } else { + objectWriteUInt32(this, value, offset, false) + } + return offset + 4 + } + + Buffer.prototype.writeIntLE = function writeIntLE (value, offset, byteLength, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) { + var limit = Math.pow(2, 8 * byteLength - 1) + + checkInt(this, value, offset, byteLength, limit - 1, -limit) + } + + var i = 0 + var mul = 1 + var sub = value < 0 ? 1 : 0 + this[offset] = value & 0xFF + while (++i < byteLength && (mul *= 0x100)) { + this[offset + i] = ((value / mul) >> 0) - sub & 0xFF + } + + return offset + byteLength + } + + Buffer.prototype.writeIntBE = function writeIntBE (value, offset, byteLength, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) { + var limit = Math.pow(2, 8 * byteLength - 1) + + checkInt(this, value, offset, byteLength, limit - 1, -limit) + } + + var i = byteLength - 1 + var mul = 1 + var sub = value < 0 ? 1 : 0 + this[offset + i] = value & 0xFF + while (--i >= 0 && (mul *= 0x100)) { + this[offset + i] = ((value / mul) >> 0) - sub & 0xFF + } + + return offset + byteLength + } + + Buffer.prototype.writeInt8 = function writeInt8 (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 1, 0x7f, -0x80) + if (!Buffer.TYPED_ARRAY_SUPPORT) value = Math.floor(value) + if (value < 0) value = 0xff + value + 1 + this[offset] = value + return offset + 1 + } + + Buffer.prototype.writeInt16LE = function writeInt16LE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = value + this[offset + 1] = (value >>> 8) + } else { + objectWriteUInt16(this, value, offset, true) + } + return offset + 2 + } + + Buffer.prototype.writeInt16BE = function writeInt16BE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 2, 0x7fff, -0x8000) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value >>> 8) + this[offset + 1] = value + } else { + objectWriteUInt16(this, value, offset, false) + } + return offset + 2 + } + + Buffer.prototype.writeInt32LE = function writeInt32LE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000) + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = value + this[offset + 1] = (value >>> 8) + this[offset + 2] = (value >>> 16) + this[offset + 3] = (value >>> 24) + } else { + objectWriteUInt32(this, value, offset, true) + } + return offset + 4 + } + + Buffer.prototype.writeInt32BE = function writeInt32BE (value, offset, noAssert) { + value = +value + offset = offset | 0 + if (!noAssert) checkInt(this, value, offset, 4, 0x7fffffff, -0x80000000) + if (value < 0) value = 0xffffffff + value + 1 + if (Buffer.TYPED_ARRAY_SUPPORT) { + this[offset] = (value >>> 24) + this[offset + 1] = (value >>> 16) + this[offset + 2] = (value >>> 8) + this[offset + 3] = value + } else { + objectWriteUInt32(this, value, offset, false) + } + return offset + 4 + } + + function checkIEEE754 (buf, value, offset, ext, max, min) { + if (value > max || value < min) throw new RangeError('value is out of bounds') + if (offset + ext > buf.length) throw new RangeError('index out of range') + if (offset < 0) throw new RangeError('index out of range') + } + + function writeFloat (buf, value, offset, littleEndian, noAssert) { + if (!noAssert) { + checkIEEE754(buf, value, offset, 4, 3.4028234663852886e+38, -3.4028234663852886e+38) + } + ieee754.write(buf, value, offset, littleEndian, 23, 4) + return offset + 4 + } + + Buffer.prototype.writeFloatLE = function writeFloatLE (value, offset, noAssert) { + return writeFloat(this, value, offset, true, noAssert) + } + + Buffer.prototype.writeFloatBE = function writeFloatBE (value, offset, noAssert) { + return writeFloat(this, value, offset, false, noAssert) + } + + function writeDouble (buf, value, offset, littleEndian, noAssert) { + if (!noAssert) { + checkIEEE754(buf, value, offset, 8, 1.7976931348623157E+308, -1.7976931348623157E+308) + } + ieee754.write(buf, value, offset, littleEndian, 52, 8) + return offset + 8 + } + + Buffer.prototype.writeDoubleLE = function writeDoubleLE (value, offset, noAssert) { + return writeDouble(this, value, offset, true, noAssert) + } + + Buffer.prototype.writeDoubleBE = function writeDoubleBE (value, offset, noAssert) { + return writeDouble(this, value, offset, false, noAssert) + } + + // copy(targetBuffer, targetStart=0, sourceStart=0, sourceEnd=buffer.length) + Buffer.prototype.copy = function copy (target, targetStart, start, end) { + if (!start) start = 0 + if (!end && end !== 0) end = this.length + if (targetStart >= target.length) targetStart = target.length + if (!targetStart) targetStart = 0 + if (end > 0 && end < start) end = start + + // Copy 0 bytes; we're done + if (end === start) return 0 + if (target.length === 0 || this.length === 0) return 0 + + // Fatal error conditions + if (targetStart < 0) { + throw new RangeError('targetStart out of bounds') + } + if (start < 0 || start >= this.length) throw new RangeError('sourceStart out of bounds') + if (end < 0) throw new RangeError('sourceEnd out of bounds') + + // Are we oob? + if (end > this.length) end = this.length + if (target.length - targetStart < end - start) { + end = target.length - targetStart + start + } + + var len = end - start + + if (len < 1000 || !Buffer.TYPED_ARRAY_SUPPORT) { + for (var i = 0; i < len; i++) { + target[i + targetStart] = this[i + start] + } + } else { + target._set(this.subarray(start, start + len), targetStart) + } + + return len + } + + // fill(value, start=0, end=buffer.length) + Buffer.prototype.fill = function fill (value, start, end) { + if (!value) value = 0 + if (!start) start = 0 + if (!end) end = this.length + + if (end < start) throw new RangeError('end < start') + + // Fill 0 bytes; we're done + if (end === start) return + if (this.length === 0) return + + if (start < 0 || start >= this.length) throw new RangeError('start out of bounds') + if (end < 0 || end > this.length) throw new RangeError('end out of bounds') + + var i + if (typeof value === 'number') { + for (i = start; i < end; i++) { + this[i] = value + } + } else { + var bytes = utf8ToBytes(value.toString()) + var len = bytes.length + for (i = start; i < end; i++) { + this[i] = bytes[i % len] + } + } + + return this + } + + /** + * Creates a new `ArrayBuffer` with the *copied* memory of the buffer instance. + * Added in Node 0.12. Only available in browsers that support ArrayBuffer. + */ + Buffer.prototype.toArrayBuffer = function toArrayBuffer () { + if (typeof Uint8Array !== 'undefined') { + if (Buffer.TYPED_ARRAY_SUPPORT) { + return (new Buffer(this)).buffer + } else { + var buf = new Uint8Array(this.length) + for (var i = 0, len = buf.length; i < len; i += 1) { + buf[i] = this[i] + } + return buf.buffer + } + } else { + throw new TypeError('Buffer.toArrayBuffer not supported in this browser') + } + } + + // HELPER FUNCTIONS + // ================ + + var BP = Buffer.prototype + + /** + * Augment a Uint8Array *instance* (not the Uint8Array class!) with Buffer methods + */ + Buffer._augment = function _augment (arr) { + arr.constructor = Buffer + arr._isBuffer = true + + // save reference to original Uint8Array set method before overwriting + arr._set = arr.set + + // deprecated, will be removed in node 0.13+ + arr.get = BP.get + arr.set = BP.set + + arr.write = BP.write + arr.toString = BP.toString + arr.toLocaleString = BP.toString + arr.toJSON = BP.toJSON + arr.equals = BP.equals + arr.compare = BP.compare + arr.indexOf = BP.indexOf + arr.copy = BP.copy + arr.slice = BP.slice + arr.readUIntLE = BP.readUIntLE + arr.readUIntBE = BP.readUIntBE + arr.readUInt8 = BP.readUInt8 + arr.readUInt16LE = BP.readUInt16LE + arr.readUInt16BE = BP.readUInt16BE + arr.readUInt32LE = BP.readUInt32LE + arr.readUInt32BE = BP.readUInt32BE + arr.readIntLE = BP.readIntLE + arr.readIntBE = BP.readIntBE + arr.readInt8 = BP.readInt8 + arr.readInt16LE = BP.readInt16LE + arr.readInt16BE = BP.readInt16BE + arr.readInt32LE = BP.readInt32LE + arr.readInt32BE = BP.readInt32BE + arr.readFloatLE = BP.readFloatLE + arr.readFloatBE = BP.readFloatBE + arr.readDoubleLE = BP.readDoubleLE + arr.readDoubleBE = BP.readDoubleBE + arr.writeUInt8 = BP.writeUInt8 + arr.writeUIntLE = BP.writeUIntLE + arr.writeUIntBE = BP.writeUIntBE + arr.writeUInt16LE = BP.writeUInt16LE + arr.writeUInt16BE = BP.writeUInt16BE + arr.writeUInt32LE = BP.writeUInt32LE + arr.writeUInt32BE = BP.writeUInt32BE + arr.writeIntLE = BP.writeIntLE + arr.writeIntBE = BP.writeIntBE + arr.writeInt8 = BP.writeInt8 + arr.writeInt16LE = BP.writeInt16LE + arr.writeInt16BE = BP.writeInt16BE + arr.writeInt32LE = BP.writeInt32LE + arr.writeInt32BE = BP.writeInt32BE + arr.writeFloatLE = BP.writeFloatLE + arr.writeFloatBE = BP.writeFloatBE + arr.writeDoubleLE = BP.writeDoubleLE + arr.writeDoubleBE = BP.writeDoubleBE + arr.fill = BP.fill + arr.inspect = BP.inspect + arr.toArrayBuffer = BP.toArrayBuffer + + return arr + } + + var INVALID_BASE64_RE = /[^+\/0-9A-z\-]/g + + function base64clean (str) { + // Node strips out invalid characters like \n and \t from the string, base64-js does not + str = stringtrim(str).replace(INVALID_BASE64_RE, '') + // Node converts strings with length < 2 to '' + if (str.length < 2) return '' + // Node allows for non-padded base64 strings (missing trailing ===), base64-js does not + while (str.length % 4 !== 0) { + str = str + '=' + } + return str + } + + function stringtrim (str) { + if (str.trim) return str.trim() + return str.replace(/^\s+|\s+$/g, '') + } + + function toHex (n) { + if (n < 16) return '0' + n.toString(16) + return n.toString(16) + } + + function utf8ToBytes (string, units) { + units = units || Infinity + var codePoint + var length = string.length + var leadSurrogate = null + var bytes = [] + var i = 0 + + for (; i < length; i++) { + codePoint = string.charCodeAt(i) + + // is surrogate component + if (codePoint > 0xD7FF && codePoint < 0xE000) { + // last char was a lead + if (leadSurrogate) { + // 2 leads in a row + if (codePoint < 0xDC00) { + if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD) + leadSurrogate = codePoint + continue + } else { + // valid surrogate pair + codePoint = leadSurrogate - 0xD800 << 10 | codePoint - 0xDC00 | 0x10000 + leadSurrogate = null + } + } else { + // no lead yet + + if (codePoint > 0xDBFF) { + // unexpected trail + if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD) + continue + } else if (i + 1 === length) { + // unpaired lead + if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD) + continue + } else { + // valid lead + leadSurrogate = codePoint + continue + } + } + } else if (leadSurrogate) { + // valid bmp char, but last char was a lead + if ((units -= 3) > -1) bytes.push(0xEF, 0xBF, 0xBD) + leadSurrogate = null + } + + // encode utf8 + if (codePoint < 0x80) { + if ((units -= 1) < 0) break + bytes.push(codePoint) + } else if (codePoint < 0x800) { + if ((units -= 2) < 0) break + bytes.push( + codePoint >> 0x6 | 0xC0, + codePoint & 0x3F | 0x80 + ) + } else if (codePoint < 0x10000) { + if ((units -= 3) < 0) break + bytes.push( + codePoint >> 0xC | 0xE0, + codePoint >> 0x6 & 0x3F | 0x80, + codePoint & 0x3F | 0x80 + ) + } else if (codePoint < 0x200000) { + if ((units -= 4) < 0) break + bytes.push( + codePoint >> 0x12 | 0xF0, + codePoint >> 0xC & 0x3F | 0x80, + codePoint >> 0x6 & 0x3F | 0x80, + codePoint & 0x3F | 0x80 + ) + } else { + throw new Error('Invalid code point') + } + } + + return bytes + } + + function asciiToBytes (str) { + var byteArray = [] + for (var i = 0; i < str.length; i++) { + // Node's code seems to be doing this and not & 0x7F.. + byteArray.push(str.charCodeAt(i) & 0xFF) + } + return byteArray + } + + function utf16leToBytes (str, units) { + var c, hi, lo + var byteArray = [] + for (var i = 0; i < str.length; i++) { + if ((units -= 2) < 0) break + + c = str.charCodeAt(i) + hi = c >> 8 + lo = c % 256 + byteArray.push(lo) + byteArray.push(hi) + } + + return byteArray + } + + function base64ToBytes (str) { + return base64.toByteArray(base64clean(str)) + } + + function blitBuffer (src, dst, offset, length) { + for (var i = 0; i < length; i++) { + if ((i + offset >= dst.length) || (i >= src.length)) break + dst[i + offset] = src[i] + } + return i + } + + function decodeUtf8Char (str) { + try { + return decodeURIComponent(str) + } catch (err) { + return String.fromCharCode(0xFFFD) // UTF 8 invalid char + } + } + + /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(4).Buffer)) + +/***/ }, +/* 5 */ +/***/ function(module, exports, __webpack_require__) { + + /* jslint node: true */ + 'use strict'; + + var _ = __webpack_require__(11); + var FontWrapper = __webpack_require__(16); + + function typeName(bold, italics){ + var type = 'normal'; + if (bold && italics) type = 'bolditalics'; + else if (bold) type = 'bold'; + else if (italics) type = 'italics'; + return type; + } + + function FontProvider(fontDescriptors, pdfDoc) { + this.fonts = {}; + this.pdfDoc = pdfDoc; + this.fontWrappers = {}; + + for(var font in fontDescriptors) { + if (fontDescriptors.hasOwnProperty(font)) { + var fontDef = fontDescriptors[font]; + + this.fonts[font] = { + normal: fontDef.normal, + bold: fontDef.bold, + italics: fontDef.italics, + bolditalics: fontDef.bolditalics + }; + } + } + } + + FontProvider.prototype.provideFont = function(familyName, bold, italics) { + if (!this.fonts[familyName]) return this.pdfDoc._font; + var type = typeName(bold, italics); + + this.fontWrappers[familyName] = this.fontWrappers[familyName] || {}; + + if (!this.fontWrappers[familyName][type]) { + this.fontWrappers[familyName][type] = new FontWrapper(this.pdfDoc, this.fonts[familyName][type], familyName + '(' + type + ')'); + } + + return this.fontWrappers[familyName][type]; + }; + + FontProvider.prototype.setFontRefsToPdfDoc = function(){ + var self = this; + + _.each(self.fontWrappers, function(fontFamily) { + _.each(fontFamily, function(fontWrapper){ + _.each(fontWrapper.pdfFonts, function(font){ + if (!self.pdfDoc.page.fonts[font.id]) { + self.pdfDoc.page.fonts[font.id] = font.ref(); + } + }); + }); + }); + }; + + module.exports = FontProvider; + + +/***/ }, +/* 6 */ +/***/ function(module, exports, __webpack_require__) { + + /* jslint node: true */ + 'use strict'; + + var _ = __webpack_require__(11); + var TraversalTracker = __webpack_require__(18); + var DocMeasure = __webpack_require__(19); + var DocumentContext = __webpack_require__(20); + var PageElementWriter = __webpack_require__(21); + var ColumnCalculator = __webpack_require__(22); + var TableProcessor = __webpack_require__(23); + var Line = __webpack_require__(24); + var pack = __webpack_require__(25).pack; + var offsetVector = __webpack_require__(25).offsetVector; + var fontStringify = __webpack_require__(25).fontStringify; + var isFunction = __webpack_require__(25).isFunction; + var TextTools = __webpack_require__(26); + var StyleContextStack = __webpack_require__(27); + + function addAll(target, otherArray){ + _.each(otherArray, function(item){ + target.push(item); + }); + } + + /** + * Creates an instance of LayoutBuilder - layout engine which turns document-definition-object + * into a set of pages, lines, inlines and vectors ready to be rendered into a PDF + * + * @param {Object} pageSize - an object defining page width and height + * @param {Object} pageMargins - an object defining top, left, right and bottom margins + */ + function LayoutBuilder(pageSize, pageMargins, imageMeasure) { + this.pageSize = pageSize; + this.pageMargins = pageMargins; + this.tracker = new TraversalTracker(); + this.imageMeasure = imageMeasure; + this.tableLayouts = {}; + } + + LayoutBuilder.prototype.registerTableLayouts = function (tableLayouts) { + this.tableLayouts = pack(this.tableLayouts, tableLayouts); + }; + + /** + * Executes layout engine on document-definition-object and creates an array of pages + * containing positioned Blocks, Lines and inlines + * + * @param {Object} docStructure document-definition-object + * @param {Object} fontProvider font provider + * @param {Object} styleDictionary dictionary with style definitions + * @param {Object} defaultStyle default style definition + * @return {Array} an array of pages + */ + LayoutBuilder.prototype.layoutDocument = function (docStructure, fontProvider, styleDictionary, defaultStyle, background, header, footer, images, watermark, pageBreakBeforeFct) { + + function addPageBreaksIfNecessary(linearNodeList, pages) { + linearNodeList = _.reject(linearNodeList, function(node){ + return _.isEmpty(node.positions); + }); + + _.each(linearNodeList, function(node) { + var nodeInfo = _.pick(node, [ + 'id', 'text', 'ul', 'ol', 'table', 'image', 'qr', 'canvas', 'columns', + 'headlineLevel', 'style', 'pageBreak', 'pageOrientation', + 'width', 'height' + ]); + nodeInfo.startPosition = _.first(node.positions); + nodeInfo.pageNumbers = _.chain(node.positions).map('pageNumber').uniq().value(); + nodeInfo.pages = pages.length; + nodeInfo.stack = _.isArray(node.stack); + + node.nodeInfo = nodeInfo; + }); + + return _.any(linearNodeList, function (node, index, followingNodeList) { + if (node.pageBreak !== 'before' && !node.pageBreakCalculated) { + node.pageBreakCalculated = true; + var pageNumber = _.first(node.nodeInfo.pageNumbers); + + var followingNodesOnPage = _.chain(followingNodeList).drop(index + 1).filter(function (node0) { + return _.contains(node0.nodeInfo.pageNumbers, pageNumber); + }).value(); + + var nodesOnNextPage = _.chain(followingNodeList).drop(index + 1).filter(function (node0) { + return _.contains(node0.nodeInfo.pageNumbers, pageNumber + 1); + }).value(); + + var previousNodesOnPage = _.chain(followingNodeList).take(index).filter(function (node0) { + return _.contains(node0.nodeInfo.pageNumbers, pageNumber); + }).value(); + + if (pageBreakBeforeFct(node.nodeInfo, + _.map(followingNodesOnPage, 'nodeInfo'), + _.map(nodesOnNextPage, 'nodeInfo'), + _.map(previousNodesOnPage, 'nodeInfo'))) { + node.pageBreak = 'before'; + return true; + } + } + }); + } + + if(!isFunction(pageBreakBeforeFct)){ + pageBreakBeforeFct = function(){ + return false; + }; + } + + this.docMeasure = new DocMeasure(fontProvider, styleDictionary, defaultStyle, this.imageMeasure, this.tableLayouts, images); + + + function resetXYs(result) { + _.each(result.linearNodeList, function (node) { + node.resetXY(); + }); + } + + var result = this.tryLayoutDocument(docStructure, fontProvider, styleDictionary, defaultStyle, background, header, footer, images, watermark); + while(addPageBreaksIfNecessary(result.linearNodeList, result.pages)){ + resetXYs(result); + result = this.tryLayoutDocument(docStructure, fontProvider, styleDictionary, defaultStyle, background, header, footer, images, watermark); + } + + return result.pages; + }; + + LayoutBuilder.prototype.tryLayoutDocument = function (docStructure, fontProvider, styleDictionary, defaultStyle, background, header, footer, images, watermark, pageBreakBeforeFct) { + + this.linearNodeList = []; + docStructure = this.docMeasure.measureDocument(docStructure); + + this.writer = new PageElementWriter( + new DocumentContext(this.pageSize, this.pageMargins), this.tracker); + + var _this = this; + this.writer.context().tracker.startTracking('pageAdded', function() { + _this.addBackground(background); + }); + + this.addBackground(background); + this.processNode(docStructure); + this.addHeadersAndFooters(header, footer); + /* jshint eqnull:true */ + if(watermark != null) + this.addWatermark(watermark, fontProvider); + + return {pages: this.writer.context().pages, linearNodeList: this.linearNodeList}; + }; + + + LayoutBuilder.prototype.addBackground = function(background) { + var backgroundGetter = isFunction(background) ? background : function() { return background; }; + + var pageBackground = backgroundGetter(this.writer.context().page + 1); + + if (pageBackground) { + var pageSize = this.writer.context().getCurrentPage().pageSize; + this.writer.beginUnbreakableBlock(pageSize.width, pageSize.height); + this.processNode(this.docMeasure.measureDocument(pageBackground)); + this.writer.commitUnbreakableBlock(0, 0); + } + }; + + LayoutBuilder.prototype.addStaticRepeatable = function(headerOrFooter, sizeFunction) { + this.addDynamicRepeatable(function() { return headerOrFooter; }, sizeFunction); + }; + + LayoutBuilder.prototype.addDynamicRepeatable = function(nodeGetter, sizeFunction) { + var pages = this.writer.context().pages; + + for(var pageIndex = 0, l = pages.length; pageIndex < l; pageIndex++) { + this.writer.context().page = pageIndex; + + var node = nodeGetter(pageIndex + 1, l); + + if (node) { + var sizes = sizeFunction(this.writer.context().getCurrentPage().pageSize, this.pageMargins); + this.writer.beginUnbreakableBlock(sizes.width, sizes.height); + this.processNode(this.docMeasure.measureDocument(node)); + this.writer.commitUnbreakableBlock(sizes.x, sizes.y); + } + } + }; + + LayoutBuilder.prototype.addHeadersAndFooters = function(header, footer) { + var headerSizeFct = function(pageSize, pageMargins){ + return { + x: 0, + y: 0, + width: pageSize.width, + height: pageMargins.top + }; + }; + + var footerSizeFct = function (pageSize, pageMargins) { + return { + x: 0, + y: pageSize.height - pageMargins.bottom, + width: pageSize.width, + height: pageMargins.bottom + }; + }; + + if(isFunction(header)) { + this.addDynamicRepeatable(header, headerSizeFct); + } else if(header) { + this.addStaticRepeatable(header, headerSizeFct); + } + + if(isFunction(footer)) { + this.addDynamicRepeatable(footer, footerSizeFct); + } else if(footer) { + this.addStaticRepeatable(footer, footerSizeFct); + } + }; + + LayoutBuilder.prototype.addWatermark = function(watermark, fontProvider){ + var defaultFont = Object.getOwnPropertyNames(fontProvider.fonts)[0]; // TODO allow selection of other font + var watermarkObject = { + text: watermark, + font: fontProvider.provideFont(fontProvider[defaultFont], false, false), + size: getSize(this.pageSize, watermark, fontProvider) + }; + + var pages = this.writer.context().pages; + for(var i = 0, l = pages.length; i < l; i++) { + pages[i].watermark = watermarkObject; + } + + function getSize(pageSize, watermark, fontProvider){ + var width = pageSize.width; + var height = pageSize.height; + var targetWidth = Math.sqrt(width*width + height*height)*0.8; /* page diagnoal * sample factor */ + var textTools = new TextTools(fontProvider); + var styleContextStack = new StyleContextStack(); + var size; + + /** + * Binary search the best font size. + * Initial bounds [0, 1000] + * Break when range < 1 + */ + var a = 0; + var b = 1000; + var c = (a+b)/2; + while(Math.abs(a - b) > 1){ + styleContextStack.push({ + fontSize: c + }); + size = textTools.sizeOfString(watermark, styleContextStack); + if(size.width > targetWidth){ + b = c; + c = (a+b)/2; + } + else if(size.width < targetWidth){ + a = c; + c = (a+b)/2; + } + styleContextStack.pop(); + } + /* + End binary search + */ + return {size: size, fontSize: c}; + } + }; + + function decorateNode(node){ + var x = node.x, y = node.y; + node.positions = []; + + _.each(node.canvas, function(vector){ + var x = vector.x, y = vector.y; + vector.resetXY = function(){ + vector.x = x; + vector.y = y; + }; + }); + + node.resetXY = function(){ + node.x = x; + node.y = y; + _.each(node.canvas, function(vector){ + vector.resetXY(); + }); + }; + } + + LayoutBuilder.prototype.processNode = function(node) { + var self = this; + + this.linearNodeList.push(node); + decorateNode(node); + + applyMargins(function() { + var absPosition = node.absolutePosition; + if(absPosition){ + self.writer.context().beginDetachedBlock(); + self.writer.context().moveTo(absPosition.x || 0, absPosition.y || 0); + } + + if (node.stack) { + self.processVerticalContainer(node); + } else if (node.columns) { + self.processColumns(node); + } else if (node.ul) { + self.processList(false, node); + } else if (node.ol) { + self.processList(true, node); + } else if (node.table) { + self.processTable(node); + } else if (node.text !== undefined) { + self.processLeaf(node); + } else if (node.image) { + self.processImage(node); + } else if (node.canvas) { + self.processCanvas(node); + } else if (node.qr) { + self.processQr(node); + }else if (!node._span) { + throw 'Unrecognized document structure: ' + JSON.stringify(node, fontStringify); + } + + if(absPosition){ + self.writer.context().endDetachedBlock(); + } + }); + + function applyMargins(callback) { + var margin = node._margin; + + if (node.pageBreak === 'before') { + self.writer.moveToNextPage(node.pageOrientation); + } + + if (margin) { + self.writer.context().moveDown(margin[1]); + self.writer.context().addMargin(margin[0], margin[2]); + } + + callback(); + + if(margin) { + self.writer.context().addMargin(-margin[0], -margin[2]); + self.writer.context().moveDown(margin[3]); + } + + if (node.pageBreak === 'after') { + self.writer.moveToNextPage(node.pageOrientation); + } + } + }; + + // vertical container + LayoutBuilder.prototype.processVerticalContainer = function(node) { + var self = this; + node.stack.forEach(function(item) { + self.processNode(item); + addAll(node.positions, item.positions); + + //TODO: paragraph gap + }); + }; + + // columns + LayoutBuilder.prototype.processColumns = function(columnNode) { + var columns = columnNode.columns; + var availableWidth = this.writer.context().availableWidth; + var gaps = gapArray(columnNode._gap); + + if (gaps) availableWidth -= (gaps.length - 1) * columnNode._gap; + + ColumnCalculator.buildColumnWidths(columns, availableWidth); + var result = this.processRow(columns, columns, gaps); + addAll(columnNode.positions, result.positions); + + + function gapArray(gap) { + if (!gap) return null; + + var gaps = []; + gaps.push(0); + + for(var i = columns.length - 1; i > 0; i--) { + gaps.push(gap); + } + + return gaps; + } + }; + + LayoutBuilder.prototype.processRow = function(columns, widths, gaps, tableBody, tableRow) { + var self = this; + var pageBreaks = [], positions = []; + + this.tracker.auto('pageChanged', storePageBreakData, function() { + widths = widths || columns; + + self.writer.context().beginColumnGroup(); + + for(var i = 0, l = columns.length; i < l; i++) { + var column = columns[i]; + var width = widths[i]._calcWidth; + var leftOffset = colLeftOffset(i); + + if (column.colSpan && column.colSpan > 1) { + for(var j = 1; j < column.colSpan; j++) { + width += widths[++i]._calcWidth + gaps[i]; + } + } + + self.writer.context().beginColumn(width, leftOffset, getEndingCell(column, i)); + if (!column._span) { + self.processNode(column); + addAll(positions, column.positions); + } else if (column._columnEndingContext) { + // row-span ending + self.writer.context().markEnding(column); + } + } + + self.writer.context().completeColumnGroup(); + }); + + return {pageBreaks: pageBreaks, positions: positions}; + + function storePageBreakData(data) { + var pageDesc; + + for(var i = 0, l = pageBreaks.length; i < l; i++) { + var desc = pageBreaks[i]; + if (desc.prevPage === data.prevPage) { + pageDesc = desc; + break; + } + } + + if (!pageDesc) { + pageDesc = data; + pageBreaks.push(pageDesc); + } + pageDesc.prevY = Math.max(pageDesc.prevY, data.prevY); + pageDesc.y = Math.min(pageDesc.y, data.y); + } + + function colLeftOffset(i) { + if (gaps && gaps.length > i) return gaps[i]; + return 0; + } + + function getEndingCell(column, columnIndex) { + if (column.rowSpan && column.rowSpan > 1) { + var endingRow = tableRow + column.rowSpan - 1; + if (endingRow >= tableBody.length) throw 'Row span for column ' + columnIndex + ' (with indexes starting from 0) exceeded row count'; + return tableBody[endingRow][columnIndex]; + } + + return null; + } + }; + + // lists + LayoutBuilder.prototype.processList = function(orderedList, node) { + var self = this, + items = orderedList ? node.ol : node.ul, + gapSize = node._gapSize; + + this.writer.context().addMargin(gapSize.width); + + var nextMarker; + this.tracker.auto('lineAdded', addMarkerToFirstLeaf, function() { + items.forEach(function(item) { + nextMarker = item.listMarker; + self.processNode(item); + addAll(node.positions, item.positions); + }); + }); + + this.writer.context().addMargin(-gapSize.width); + + function addMarkerToFirstLeaf(line) { + // I'm not very happy with the way list processing is implemented + // (both code and algorithm should be rethinked) + if (nextMarker) { + var marker = nextMarker; + nextMarker = null; + + if (marker.canvas) { + var vector = marker.canvas[0]; + + offsetVector(vector, -marker._minWidth, 0); + self.writer.addVector(vector); + } else { + var markerLine = new Line(self.pageSize.width); + markerLine.addInline(marker._inlines[0]); + markerLine.x = -marker._minWidth; + markerLine.y = line.getAscenderHeight() - markerLine.getAscenderHeight(); + self.writer.addLine(markerLine, true); + } + } + } + }; + + // tables + LayoutBuilder.prototype.processTable = function(tableNode) { + var processor = new TableProcessor(tableNode); + + processor.beginTable(this.writer); + + for(var i = 0, l = tableNode.table.body.length; i < l; i++) { + processor.beginRow(i, this.writer); + + var result = this.processRow(tableNode.table.body[i], tableNode.table.widths, tableNode._offsets.offsets, tableNode.table.body, i); + addAll(tableNode.positions, result.positions); + + processor.endRow(i, this.writer, result.pageBreaks); + } + + processor.endTable(this.writer); + }; + + // leafs (texts) + LayoutBuilder.prototype.processLeaf = function(node) { + var line = this.buildNextLine(node); + + while (line) { + var positions = this.writer.addLine(line); + node.positions.push(positions); + line = this.buildNextLine(node); + } + }; + + LayoutBuilder.prototype.buildNextLine = function(textNode) { + if (!textNode._inlines || textNode._inlines.length === 0) return null; + + var line = new Line(this.writer.context().availableWidth); + + while(textNode._inlines && textNode._inlines.length > 0 && line.hasEnoughSpaceForInline(textNode._inlines[0])) { + line.addInline(textNode._inlines.shift()); + } + + line.lastLineInParagraph = textNode._inlines.length === 0; + return line; + }; + + // images + LayoutBuilder.prototype.processImage = function(node) { + var position = this.writer.addImage(node); + node.positions.push(position); + }; + + LayoutBuilder.prototype.processCanvas = function(node) { + var height = node._minHeight; + + if (this.writer.context().availableHeight < height) { + // TODO: support for canvas larger than a page + // TODO: support for other overflow methods + + this.writer.moveToNextPage(); + } + + node.canvas.forEach(function(vector) { + var position = this.writer.addVector(vector); + node.positions.push(position); + }, this); + + this.writer.context().moveDown(height); + }; + + LayoutBuilder.prototype.processQr = function(node) { + var position = this.writer.addQr(node); + node.positions.push(position); + }; + + module.exports = LayoutBuilder; + + +/***/ }, +/* 7 */ +/***/ function(module, exports, __webpack_require__) { + + module.exports = { + '4A0': [4767.87, 6740.79], + '2A0': [3370.39, 4767.87], + A0: [2383.94, 3370.39], + A1: [1683.78, 2383.94], + A2: [1190.55, 1683.78], + A3: [841.89, 1190.55], + A4: [595.28, 841.89], + A5: [419.53, 595.28], + A6: [297.64, 419.53], + A7: [209.76, 297.64], + A8: [147.40, 209.76], + A9: [104.88, 147.40], + A10: [73.70, 104.88], + B0: [2834.65, 4008.19], + B1: [2004.09, 2834.65], + B2: [1417.32, 2004.09], + B3: [1000.63, 1417.32], + B4: [708.66, 1000.63], + B5: [498.90, 708.66], + B6: [354.33, 498.90], + B7: [249.45, 354.33], + B8: [175.75, 249.45], + B9: [124.72, 175.75], + B10: [87.87, 124.72], + C0: [2599.37, 3676.54], + C1: [1836.85, 2599.37], + C2: [1298.27, 1836.85], + C3: [918.43, 1298.27], + C4: [649.13, 918.43], + C5: [459.21, 649.13], + C6: [323.15, 459.21], + C7: [229.61, 323.15], + C8: [161.57, 229.61], + C9: [113.39, 161.57], + C10: [79.37, 113.39], + RA0: [2437.80, 3458.27], + RA1: [1729.13, 2437.80], + RA2: [1218.90, 1729.13], + RA3: [864.57, 1218.90], + RA4: [609.45, 864.57], + SRA0: [2551.18, 3628.35], + SRA1: [1814.17, 2551.18], + SRA2: [1275.59, 1814.17], + SRA3: [907.09, 1275.59], + SRA4: [637.80, 907.09], + EXECUTIVE: [521.86, 756.00], + FOLIO: [612.00, 936.00], + LEGAL: [612.00, 1008.00], + LETTER: [612.00, 792.00], + TABLOID: [792.00, 1224.00] + }; + + +/***/ }, +/* 8 */ +/***/ function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(Buffer) {/* jslint node: true */ + 'use strict'; + + var pdfKit = __webpack_require__(28); + var PDFImage = __webpack_require__(17); + + function ImageMeasure(pdfDoc, imageDictionary) { + this.pdfDoc = pdfDoc; + this.imageDictionary = imageDictionary || {}; + } + + ImageMeasure.prototype.measureImage = function(src) { + var image, label; + var that = this; + + if (!this.pdfDoc._imageRegistry[src]) { + label = 'I' + (++this.pdfDoc._imageCount); + image = PDFImage.open(realImageSrc(src), label); + image.embed(this.pdfDoc); + this.pdfDoc._imageRegistry[src] = image; + } else { + image = this.pdfDoc._imageRegistry[src]; + } + + return { width: image.width, height: image.height }; + + function realImageSrc(src) { + var img = that.imageDictionary[src]; + + if (!img) return src; + + var index = img.indexOf('base64,'); + if (index < 0) { + throw 'invalid image format, images dictionary should contain dataURL entries'; + } + + return new Buffer(img.substring(index + 7), 'base64'); + } + }; + + module.exports = ImageMeasure; + + /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(4).Buffer)) + +/***/ }, +/* 9 */ +/***/ function(module, exports, __webpack_require__) { + + /* jslint node: true */ + 'use strict'; + + + function groupDecorations(line) { + var groups = [], curGroup = null; + for(var i = 0, l = line.inlines.length; i < l; i++) { + var inline = line.inlines[i]; + var decoration = inline.decoration; + if(!decoration) { + curGroup = null; + continue; + } + var color = inline.decorationColor || inline.color || 'black'; + var style = inline.decorationStyle || 'solid'; + decoration = Array.isArray(decoration) ? decoration : [ decoration ]; + for(var ii = 0, ll = decoration.length; ii < ll; ii++) { + var deco = decoration[ii]; + if(!curGroup || deco !== curGroup.decoration || + style !== curGroup.decorationStyle || color !== curGroup.decorationColor || + deco === 'lineThrough') { + + curGroup = { + line: line, + decoration: deco, + decorationColor: color, + decorationStyle: style, + inlines: [ inline ] + }; + groups.push(curGroup); + } else { + curGroup.inlines.push(inline); + } + } + } + + return groups; + } + + function drawDecoration(group, x, y, pdfKitDoc) { + function maxInline() { + var max = 0; + for (var i = 0, l = group.inlines.length; i < l; i++) { + var inl = group.inlines[i]; + max = inl.fontSize > max ? i : max; + } + return group.inlines[max]; + } + function width() { + var sum = 0; + for (var i = 0, l = group.inlines.length; i < l; i++) { + sum += group.inlines[i].width; + } + return sum; + } + var firstInline = group.inlines[0], + biggerInline = maxInline(), + totalWidth = width(), + lineAscent = group.line.getAscenderHeight(), + ascent = biggerInline.font.ascender / 1000 * biggerInline.fontSize, + height = biggerInline.height, + descent = height - ascent; + + var lw = 0.5 + Math.floor(Math.max(biggerInline.fontSize - 8, 0) / 2) * 0.12; + + switch (group.decoration) { + case 'underline': + y += lineAscent + descent * 0.45; + break; + case 'overline': + y += lineAscent - (ascent * 0.85); + break; + case 'lineThrough': + y += lineAscent - (ascent * 0.25); + break; + default: + throw 'Unkown decoration : ' + group.decoration; + } + pdfKitDoc.save(); + + if(group.decorationStyle === 'double') { + var gap = Math.max(0.5, lw*2); + pdfKitDoc .fillColor(group.decorationColor) + .rect(x + firstInline.x, y-lw/2, totalWidth, lw/2).fill() + .rect(x + firstInline.x, y+gap-lw/2, totalWidth, lw/2).fill(); + } else if(group.decorationStyle === 'dashed') { + var nbDashes = Math.ceil(totalWidth / (3.96+2.84)); + var rdx = x + firstInline.x; + pdfKitDoc.rect(rdx, y, totalWidth, lw).clip(); + pdfKitDoc.fillColor(group.decorationColor); + for (var i = 0; i < nbDashes; i++) { + pdfKitDoc.rect(rdx, y-lw/2, 3.96, lw).fill(); + rdx += 3.96 + 2.84; + } + } else if(group.decorationStyle === 'dotted') { + var nbDots = Math.ceil(totalWidth / (lw*3)); + var rx = x + firstInline.x; + pdfKitDoc.rect(rx, y, totalWidth, lw).clip(); + pdfKitDoc.fillColor(group.decorationColor); + for (var ii = 0; ii < nbDots; ii++) { + pdfKitDoc.rect(rx, y-lw/2, lw, lw).fill(); + rx += (lw*3); + } + } else if(group.decorationStyle === 'wavy') { + var sh = 0.7, sv = 1; + var nbWaves = Math.ceil(totalWidth / (sh*2))+1; + var rwx = x + firstInline.x - 1; + pdfKitDoc.rect(x + firstInline.x, y-sv, totalWidth, y+sv).clip(); + pdfKitDoc.lineWidth(0.24); + pdfKitDoc.moveTo(rwx, y); + for(var iii = 0; iii < nbWaves; iii++) { + pdfKitDoc .bezierCurveTo(rwx+sh, y-sv, rwx+sh*2, y-sv, rwx+sh*3, y) + .bezierCurveTo(rwx+sh*4, y+sv, rwx+sh*5, y+sv, rwx+sh*6, y); + rwx += sh*6; + } + pdfKitDoc.stroke(group.decorationColor); + + } else { + pdfKitDoc .fillColor(group.decorationColor) + .rect(x + firstInline.x, y-lw/2, totalWidth, lw) + .fill(); + } + pdfKitDoc.restore(); + } + + function drawDecorations(line, x, y, pdfKitDoc) { + var groups = groupDecorations(line); + for (var i = 0, l = groups.length; i < l; i++) { + drawDecoration(groups[i], x, y, pdfKitDoc); + } + } + + function drawBackground(line, x, y, pdfKitDoc) { + var height = line.getHeight(); + for(var i = 0, l = line.inlines.length; i < l; i++) { + var inline = line.inlines[i]; + if(inline.background) { + pdfKitDoc .fillColor(inline.background) + .rect(x + inline.x, y, inline.width, height) + .fill(); + } + } + } + + module.exports = { + drawBackground: drawBackground, + drawDecorations: drawDecorations + }; + +/***/ }, +/* 10 */ +/***/ function(module, exports, __webpack_require__) { + + /* WEBPACK VAR INJECTION */(function(Buffer, __dirname) {/* jslint node: true */ + 'use strict'; + + // var b64 = require('./base64.js').base64DecToArr; + function VirtualFileSystem() { + this.fileSystem = {}; + this.baseSystem = {}; + } + + VirtualFileSystem.prototype.readFileSync = function(filename) { + filename = fixFilename(filename); + + var base64content = this.baseSystem[filename]; + if (base64content) { + return new Buffer(base64content, 'base64'); + } + + return this.fileSystem[filename]; + }; + + VirtualFileSystem.prototype.writeFileSync = function(filename, content) { + this.fileSystem[fixFilename(filename)] = content; + }; + + VirtualFileSystem.prototype.bindFS = function(data) { + this.baseSystem = data; + }; + + + function fixFilename(filename) { + if (filename.indexOf(__dirname) === 0) { + filename = filename.substring(__dirname.length); + } + + if (filename.indexOf('/') === 0) { + filename = filename.substring(1); + } + + return filename; + } + + module.exports = new VirtualFileSystem(); + + /* WEBPACK VAR INJECTION */}.call(exports, __webpack_require__(4).Buffer, "/")) + +/***/ }, +/* 11 */ +/***/ function(module, exports, __webpack_require__) { + + var __WEBPACK_AMD_DEFINE_RESULT__;/* WEBPACK VAR INJECTION */(function(module, global) {/** + * @license + * lodash 3.1.0 (Custom Build) + * Build: `lodash modern -d -o ./index.js` + * Copyright 2012-2015 The Dojo Foundation + * Based on Underscore.js 1.7.0 + * Copyright 2009-2015 Jeremy Ashkenas, DocumentCloud and Investigative Reporters & Editors + * Available under MIT license + */ + ;(function() { + + /** Used as a safe reference for `undefined` in pre-ES5 environments. */ + var undefined; + + /** Used as the semantic version number. */ + var VERSION = '3.1.0'; + + /** Used to compose bitmasks for wrapper metadata. */ + var BIND_FLAG = 1, + BIND_KEY_FLAG = 2, + CURRY_BOUND_FLAG = 4, + CURRY_FLAG = 8, + CURRY_RIGHT_FLAG = 16, + PARTIAL_FLAG = 32, + PARTIAL_RIGHT_FLAG = 64, + REARG_FLAG = 128, + ARY_FLAG = 256; + + /** Used as default options for `_.trunc`. */ + var DEFAULT_TRUNC_LENGTH = 30, + DEFAULT_TRUNC_OMISSION = '...'; + + /** Used to detect when a function becomes hot. */ + var HOT_COUNT = 150, + HOT_SPAN = 16; + + /** Used to indicate the type of lazy iteratees. */ + var LAZY_FILTER_FLAG = 0, + LAZY_MAP_FLAG = 1, + LAZY_WHILE_FLAG = 2; + + /** Used as the `TypeError` message for "Functions" methods. */ + var FUNC_ERROR_TEXT = 'Expected a function'; + + /** Used as the internal argument placeholder. */ + var PLACEHOLDER = '__lodash_placeholder__'; + + /** `Object#toString` result references. */ + var argsTag = '[object Arguments]', + arrayTag = '[object Array]', + boolTag = '[object Boolean]', + dateTag = '[object Date]', + errorTag = '[object Error]', + funcTag = '[object Function]', + mapTag = '[object Map]', + numberTag = '[object Number]', + objectTag = '[object Object]', + regexpTag = '[object RegExp]', + setTag = '[object Set]', + stringTag = '[object String]', + weakMapTag = '[object WeakMap]'; + + var arrayBufferTag = '[object ArrayBuffer]', + float32Tag = '[object Float32Array]', + float64Tag = '[object Float64Array]', + int8Tag = '[object Int8Array]', + int16Tag = '[object Int16Array]', + int32Tag = '[object Int32Array]', + uint8Tag = '[object Uint8Array]', + uint8ClampedTag = '[object Uint8ClampedArray]', + uint16Tag = '[object Uint16Array]', + uint32Tag = '[object Uint32Array]'; + + /** Used to match empty string literals in compiled template source. */ + var reEmptyStringLeading = /\b__p \+= '';/g, + reEmptyStringMiddle = /\b(__p \+=) '' \+/g, + reEmptyStringTrailing = /(__e\(.*?\)|\b__t\)) \+\n'';/g; + + /** Used to match HTML entities and HTML characters. */ + var reEscapedHtml = /&(?:amp|lt|gt|quot|#39|#96);/g, + reUnescapedHtml = /[&<>"'`]/g, + reHasEscapedHtml = RegExp(reEscapedHtml.source), + reHasUnescapedHtml = RegExp(reUnescapedHtml.source); + + /** Used to match template delimiters. */ + var reEscape = /<%-([\s\S]+?)%>/g, + reEvaluate = /<%([\s\S]+?)%>/g, + reInterpolate = /<%=([\s\S]+?)%>/g; + + /** + * Used to match ES template delimiters. + * See the [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-template-literal-lexical-components) + * for more details. + */ + var reEsTemplate = /\$\{([^\\}]*(?:\\.[^\\}]*)*)\}/g; + + /** Used to match `RegExp` flags from their coerced string values. */ + var reFlags = /\w*$/; + + /** Used to detect named functions. */ + var reFuncName = /^\s*function[ \n\r\t]+\w/; + + /** Used to detect hexadecimal string values. */ + var reHexPrefix = /^0[xX]/; + + /** Used to detect host constructors (Safari > 5). */ + var reHostCtor = /^\[object .+?Constructor\]$/; + + /** Used to match latin-1 supplementary letters (excluding mathematical operators). */ + var reLatin1 = /[\xc0-\xd6\xd8-\xde\xdf-\xf6\xf8-\xff]/g; + + /** Used to ensure capturing order of template delimiters. */ + var reNoMatch = /($^)/; + + /** + * Used to match `RegExp` special characters. + * See this [article on `RegExp` characters](http://www.regular-expressions.info/characters.html#special) + * for more details. + */ + var reRegExpChars = /[.*+?^${}()|[\]\/\\]/g, + reHasRegExpChars = RegExp(reRegExpChars.source); + + /** Used to detect functions containing a `this` reference. */ + var reThis = /\bthis\b/; + + /** Used to match unescaped characters in compiled string literals. */ + var reUnescapedString = /['\n\r\u2028\u2029\\]/g; + + /** Used to match words to create compound words. */ + var reWords = (function() { + var upper = '[A-Z\\xc0-\\xd6\\xd8-\\xde]', + lower = '[a-z\\xdf-\\xf6\\xf8-\\xff]+'; + + return RegExp(upper + '{2,}(?=' + upper + lower + ')|' + upper + '?' + lower + '|' + upper + '+|[0-9]+', 'g'); + }()); + + /** Used to detect and test for whitespace. */ + var whitespace = ( + // Basic whitespace characters. + ' \t\x0b\f\xa0\ufeff' + + + // Line terminators. + '\n\r\u2028\u2029' + + + // Unicode category "Zs" space separators. + '\u1680\u180e\u2000\u2001\u2002\u2003\u2004\u2005\u2006\u2007\u2008\u2009\u200a\u202f\u205f\u3000' + ); + + /** Used to assign default `context` object properties. */ + var contextProps = [ + 'Array', 'ArrayBuffer', 'Date', 'Error', 'Float32Array', 'Float64Array', + 'Function', 'Int8Array', 'Int16Array', 'Int32Array', 'Math', 'Number', + 'Object', 'RegExp', 'Set', 'String', '_', 'clearTimeout', 'document', + 'isFinite', 'parseInt', 'setTimeout', 'TypeError', 'Uint8Array', + 'Uint8ClampedArray', 'Uint16Array', 'Uint32Array', 'WeakMap', + 'window', 'WinRTError' + ]; + + /** Used to make template sourceURLs easier to identify. */ + var templateCounter = -1; + + /** Used to identify `toStringTag` values of typed arrays. */ + var typedArrayTags = {}; + typedArrayTags[float32Tag] = typedArrayTags[float64Tag] = + typedArrayTags[int8Tag] = typedArrayTags[int16Tag] = + typedArrayTags[int32Tag] = typedArrayTags[uint8Tag] = + typedArrayTags[uint8ClampedTag] = typedArrayTags[uint16Tag] = + typedArrayTags[uint32Tag] = true; + typedArrayTags[argsTag] = typedArrayTags[arrayTag] = + typedArrayTags[arrayBufferTag] = typedArrayTags[boolTag] = + typedArrayTags[dateTag] = typedArrayTags[errorTag] = + typedArrayTags[funcTag] = typedArrayTags[mapTag] = + typedArrayTags[numberTag] = typedArrayTags[objectTag] = + typedArrayTags[regexpTag] = typedArrayTags[setTag] = + typedArrayTags[stringTag] = typedArrayTags[weakMapTag] = false; + + /** Used to identify `toStringTag` values supported by `_.clone`. */ + var cloneableTags = {}; + cloneableTags[argsTag] = cloneableTags[arrayTag] = + cloneableTags[arrayBufferTag] = cloneableTags[boolTag] = + cloneableTags[dateTag] = cloneableTags[float32Tag] = + cloneableTags[float64Tag] = cloneableTags[int8Tag] = + cloneableTags[int16Tag] = cloneableTags[int32Tag] = + cloneableTags[numberTag] = cloneableTags[objectTag] = + cloneableTags[regexpTag] = cloneableTags[stringTag] = + cloneableTags[uint8Tag] = cloneableTags[uint8ClampedTag] = + cloneableTags[uint16Tag] = cloneableTags[uint32Tag] = true; + cloneableTags[errorTag] = cloneableTags[funcTag] = + cloneableTags[mapTag] = cloneableTags[setTag] = + cloneableTags[weakMapTag] = false; + + /** Used as an internal `_.debounce` options object by `_.throttle`. */ + var debounceOptions = { + 'leading': false, + 'maxWait': 0, + 'trailing': false + }; + + /** Used to map latin-1 supplementary letters to basic latin letters. */ + var deburredLetters = { + '\xc0': 'A', '\xc1': 'A', '\xc2': 'A', '\xc3': 'A', '\xc4': 'A', '\xc5': 'A', + '\xe0': 'a', '\xe1': 'a', '\xe2': 'a', '\xe3': 'a', '\xe4': 'a', '\xe5': 'a', + '\xc7': 'C', '\xe7': 'c', + '\xd0': 'D', '\xf0': 'd', + '\xc8': 'E', '\xc9': 'E', '\xca': 'E', '\xcb': 'E', + '\xe8': 'e', '\xe9': 'e', '\xea': 'e', '\xeb': 'e', + '\xcC': 'I', '\xcd': 'I', '\xce': 'I', '\xcf': 'I', + '\xeC': 'i', '\xed': 'i', '\xee': 'i', '\xef': 'i', + '\xd1': 'N', '\xf1': 'n', + '\xd2': 'O', '\xd3': 'O', '\xd4': 'O', '\xd5': 'O', '\xd6': 'O', '\xd8': 'O', + '\xf2': 'o', '\xf3': 'o', '\xf4': 'o', '\xf5': 'o', '\xf6': 'o', '\xf8': 'o', + '\xd9': 'U', '\xda': 'U', '\xdb': 'U', '\xdc': 'U', + '\xf9': 'u', '\xfa': 'u', '\xfb': 'u', '\xfc': 'u', + '\xdd': 'Y', '\xfd': 'y', '\xff': 'y', + '\xc6': 'Ae', '\xe6': 'ae', + '\xde': 'Th', '\xfe': 'th', + '\xdf': 'ss' + }; + + /** Used to map characters to HTML entities. */ + var htmlEscapes = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + "'": ''', + '`': '`' + }; + + /** Used to map HTML entities to characters. */ + var htmlUnescapes = { + '&': '&', + '<': '<', + '>': '>', + '"': '"', + ''': "'", + '`': '`' + }; + + /** Used to determine if values are of the language type `Object`. */ + var objectTypes = { + 'function': true, + 'object': true + }; + + /** Used to escape characters for inclusion in compiled string literals. */ + var stringEscapes = { + '\\': '\\', + "'": "'", + '\n': 'n', + '\r': 'r', + '\u2028': 'u2028', + '\u2029': 'u2029' + }; + + /** + * Used as a reference to the global object. + * + * The `this` value is used if it is the global object to avoid Greasemonkey's + * restricted `window` object, otherwise the `window` object is used. + */ + var root = (objectTypes[typeof window] && window !== (this && this.window)) ? window : this; + + /** Detect free variable `exports`. */ + var freeExports = objectTypes[typeof exports] && exports && !exports.nodeType && exports; + + /** Detect free variable `module`. */ + var freeModule = objectTypes[typeof module] && module && !module.nodeType && module; + + /** Detect free variable `global` from Node.js or Browserified code and use it as `root`. */ + var freeGlobal = freeExports && freeModule && typeof global == 'object' && global; + if (freeGlobal && (freeGlobal.global === freeGlobal || freeGlobal.window === freeGlobal || freeGlobal.self === freeGlobal)) { + root = freeGlobal; + } + + /** Detect the popular CommonJS extension `module.exports`. */ + var moduleExports = freeModule && freeModule.exports === freeExports && freeExports; + + /*--------------------------------------------------------------------------*/ + + /** + * The base implementation of `compareAscending` which compares values and + * sorts them in ascending order without guaranteeing a stable sort. + * + * @private + * @param {*} value The value to compare to `other`. + * @param {*} other The value to compare to `value`. + * @returns {number} Returns the sort order indicator for `value`. + */ + function baseCompareAscending(value, other) { + if (value !== other) { + var valIsReflexive = value === value, + othIsReflexive = other === other; + + if (value > other || !valIsReflexive || (typeof value == 'undefined' && othIsReflexive)) { + return 1; + } + if (value < other || !othIsReflexive || (typeof other == 'undefined' && valIsReflexive)) { + return -1; + } + } + return 0; + } + + /** + * The base implementation of `_.indexOf` without support for binary searches. + * + * @private + * @param {Array} array The array to search. + * @param {*} value The value to search for. + * @param {number} [fromIndex=0] The index to search from. + * @returns {number} Returns the index of the matched value, else `-1`. + */ + function baseIndexOf(array, value, fromIndex) { + if (value !== value) { + return indexOfNaN(array, fromIndex); + } + var index = (fromIndex || 0) - 1, + length = array.length; + + while (++index < length) { + if (array[index] === value) { + return index; + } + } + return -1; + } + + /** + * The base implementation of `_.sortBy` and `_.sortByAll` which uses `comparer` + * to define the sort order of `array` and replaces criteria objects with their + * corresponding values. + * + * @private + * @param {Array} array The array to sort. + * @param {Function} comparer The function to define sort order. + * @returns {Array} Returns `array`. + */ + function baseSortBy(array, comparer) { + var length = array.length; + + array.sort(comparer); + while (length--) { + array[length] = array[length].value; + } + return array; + } + + /** + * Converts `value` to a string if it is not one. An empty string is returned + * for `null` or `undefined` values. + * + * @private + * @param {*} value The value to process. + * @returns {string} Returns the string. + */ + function baseToString(value) { + if (typeof value == 'string') { + return value; + } + return value == null ? '' : (value + ''); + } + + /** + * Used by `_.max` and `_.min` as the default callback for string values. + * + * @private + * @param {string} string The string to inspect. + * @returns {number} Returns the code unit of the first character of the string. + */ + function charAtCallback(string) { + return string.charCodeAt(0); + } + + /** + * Used by `_.trim` and `_.trimLeft` to get the index of the first character + * of `string` that is not found in `chars`. + * + * @private + * @param {string} string The string to inspect. + * @param {string} chars The characters to find. + * @returns {number} Returns the index of the first character not found in `chars`. + */ + function charsLeftIndex(string, chars) { + var index = -1, + length = string.length; + + while (++index < length && chars.indexOf(string.charAt(index)) > -1) {} + return index; + } + + /** + * Used by `_.trim` and `_.trimRight` to get the index of the last character + * of `string` that is not found in `chars`. + * + * @private + * @param {string} string The string to inspect. + * @param {string} chars The characters to find. + * @returns {number} Returns the index of the last character not found in `chars`. + */ + function charsRightIndex(string, chars) { + var index = string.length; + + while (index-- && chars.indexOf(string.charAt(index)) > -1) {} + return index; + } + + /** + * Used by `_.sortBy` to compare transformed elements of a collection and stable + * sort them in ascending order. + * + * @private + * @param {Object} object The object to compare to `other`. + * @param {Object} other The object to compare to `object`. + * @returns {number} Returns the sort order indicator for `object`. + */ + function compareAscending(object, other) { + return baseCompareAscending(object.criteria, other.criteria) || (object.index - other.index); + } + + /** + * Used by `_.sortByAll` to compare multiple properties of each element + * in a collection and stable sort them in ascending order. + * + * @private + * @param {Object} object The object to compare to `other`. + * @param {Object} other The object to compare to `object`. + * @returns {number} Returns the sort order indicator for `object`. + */ + function compareMultipleAscending(object, other) { + var index = -1, + objCriteria = object.criteria, + othCriteria = other.criteria, + length = objCriteria.length; + + while (++index < length) { + var result = baseCompareAscending(objCriteria[index], othCriteria[index]); + if (result) { + return result; + } + } + // Fixes an `Array#sort` bug in the JS engine embedded in Adobe applications + // that causes it, under certain circumstances, to provide the same value for + // `object` and `other`. See https://github.com/jashkenas/underscore/pull/1247 + // for more details. + // + // This also ensures a stable sort in V8 and other engines. + // See https://code.google.com/p/v8/issues/detail?id=90 for more details. + return object.index - other.index; + } + + /** + * Used by `_.deburr` to convert latin-1 supplementary letters to basic latin letters. + * + * @private + * @param {string} letter The matched letter to deburr. + * @returns {string} Returns the deburred letter. + */ + function deburrLetter(letter) { + return deburredLetters[letter]; + } + + /** + * Used by `_.escape` to convert characters to HTML entities. + * + * @private + * @param {string} chr The matched character to escape. + * @returns {string} Returns the escaped character. + */ + function escapeHtmlChar(chr) { + return htmlEscapes[chr]; + } + + /** + * Used by `_.template` to escape characters for inclusion in compiled + * string literals. + * + * @private + * @param {string} chr The matched character to escape. + * @returns {string} Returns the escaped character. + */ + function escapeStringChar(chr) { + return '\\' + stringEscapes[chr]; + } + + /** + * Gets the index at which the first occurrence of `NaN` is found in `array`. + * If `fromRight` is provided elements of `array` are iterated from right to left. + * + * @private + * @param {Array} array The array to search. + * @param {number} [fromIndex] The index to search from. + * @param {boolean} [fromRight] Specify iterating from right to left. + * @returns {number} Returns the index of the matched `NaN`, else `-1`. + */ + function indexOfNaN(array, fromIndex, fromRight) { + var length = array.length, + index = fromRight ? (fromIndex || length) : ((fromIndex || 0) - 1); + + while ((fromRight ? index-- : ++index < length)) { + var other = array[index]; + if (other !== other) { + return index; + } + } + return -1; + } + + /** + * Checks if `value` is object-like. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is object-like, else `false`. + */ + function isObjectLike(value) { + return (value && typeof value == 'object') || false; + } + + /** + * Used by `trimmedLeftIndex` and `trimmedRightIndex` to determine if a + * character code is whitespace. + * + * @private + * @param {number} charCode The character code to inspect. + * @returns {boolean} Returns `true` if `charCode` is whitespace, else `false`. + */ + function isSpace(charCode) { + return ((charCode <= 160 && (charCode >= 9 && charCode <= 13) || charCode == 32 || charCode == 160) || charCode == 5760 || charCode == 6158 || + (charCode >= 8192 && (charCode <= 8202 || charCode == 8232 || charCode == 8233 || charCode == 8239 || charCode == 8287 || charCode == 12288 || charCode == 65279))); + } + + /** + * Replaces all `placeholder` elements in `array` with an internal placeholder + * and returns an array of their indexes. + * + * @private + * @param {Array} array The array to modify. + * @param {*} placeholder The placeholder to replace. + * @returns {Array} Returns the new array of placeholder indexes. + */ + function replaceHolders(array, placeholder) { + var index = -1, + length = array.length, + resIndex = -1, + result = []; + + while (++index < length) { + if (array[index] === placeholder) { + array[index] = PLACEHOLDER; + result[++resIndex] = index; + } + } + return result; + } + + /** + * An implementation of `_.uniq` optimized for sorted arrays without support + * for callback shorthands and `this` binding. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The function invoked per iteration. + * @returns {Array} Returns the new duplicate-value-free array. + */ + function sortedUniq(array, iteratee) { + var seen, + index = -1, + length = array.length, + resIndex = -1, + result = []; + + while (++index < length) { + var value = array[index], + computed = iteratee ? iteratee(value, index, array) : value; + + if (!index || seen !== computed) { + seen = computed; + result[++resIndex] = value; + } + } + return result; + } + + /** + * Used by `_.trim` and `_.trimLeft` to get the index of the first non-whitespace + * character of `string`. + * + * @private + * @param {string} string The string to inspect. + * @returns {number} Returns the index of the first non-whitespace character. + */ + function trimmedLeftIndex(string) { + var index = -1, + length = string.length; + + while (++index < length && isSpace(string.charCodeAt(index))) {} + return index; + } + + /** + * Used by `_.trim` and `_.trimRight` to get the index of the last non-whitespace + * character of `string`. + * + * @private + * @param {string} string The string to inspect. + * @returns {number} Returns the index of the last non-whitespace character. + */ + function trimmedRightIndex(string) { + var index = string.length; + + while (index-- && isSpace(string.charCodeAt(index))) {} + return index; + } + + /** + * Used by `_.unescape` to convert HTML entities to characters. + * + * @private + * @param {string} chr The matched character to unescape. + * @returns {string} Returns the unescaped character. + */ + function unescapeHtmlChar(chr) { + return htmlUnescapes[chr]; + } + + /*--------------------------------------------------------------------------*/ + + /** + * Create a new pristine `lodash` function using the given `context` object. + * + * @static + * @memberOf _ + * @category Utility + * @param {Object} [context=root] The context object. + * @returns {Function} Returns a new `lodash` function. + * @example + * + * _.mixin({ 'add': function(a, b) { return a + b; } }); + * + * var lodash = _.runInContext(); + * lodash.mixin({ 'sub': function(a, b) { return a - b; } }); + * + * _.isFunction(_.add); + * // => true + * _.isFunction(_.sub); + * // => false + * + * lodash.isFunction(lodash.add); + * // => false + * lodash.isFunction(lodash.sub); + * // => true + * + * // using `context` to mock `Date#getTime` use in `_.now` + * var mock = _.runInContext({ + * 'Date': function() { + * return { 'getTime': getTimeMock }; + * } + * }); + * + * // or creating a suped-up `defer` in Node.js + * var defer = _.runInContext({ 'setTimeout': setImmediate }).defer; + */ + function runInContext(context) { + // Avoid issues with some ES3 environments that attempt to use values, named + // after built-in constructors like `Object`, for the creation of literals. + // ES5 clears this up by stating that literals must use built-in constructors. + // See https://es5.github.io/#x11.1.5 for more details. + context = context ? _.defaults(root.Object(), context, _.pick(root, contextProps)) : root; + + /** Native constructor references. */ + var Array = context.Array, + Date = context.Date, + Error = context.Error, + Function = context.Function, + Math = context.Math, + Number = context.Number, + Object = context.Object, + RegExp = context.RegExp, + String = context.String, + TypeError = context.TypeError; + + /** Used for native method references. */ + var arrayProto = Array.prototype, + objectProto = Object.prototype; + + /** Used to detect DOM support. */ + var document = (document = context.window) && document.document; + + /** Used to resolve the decompiled source of functions. */ + var fnToString = Function.prototype.toString; + + /** Used to the length of n-tuples for `_.unzip`. */ + var getLength = baseProperty('length'); + + /** Used to check objects for own properties. */ + var hasOwnProperty = objectProto.hasOwnProperty; + + /** Used to generate unique IDs. */ + var idCounter = 0; + + /** + * Used to resolve the `toStringTag` of values. + * See the [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-object.prototype.tostring) + * for more details. + */ + var objToString = objectProto.toString; + + /** Used to restore the original `_` reference in `_.noConflict`. */ + var oldDash = context._; + + /** Used to detect if a method is native. */ + var reNative = RegExp('^' + + escapeRegExp(objToString) + .replace(/toString|(function).*?(?=\\\()| for .+?(?=\\\])/g, '$1.*?') + '$' + ); + + /** Native method references. */ + var ArrayBuffer = isNative(ArrayBuffer = context.ArrayBuffer) && ArrayBuffer, + bufferSlice = isNative(bufferSlice = ArrayBuffer && new ArrayBuffer(0).slice) && bufferSlice, + ceil = Math.ceil, + clearTimeout = context.clearTimeout, + floor = Math.floor, + getPrototypeOf = isNative(getPrototypeOf = Object.getPrototypeOf) && getPrototypeOf, + push = arrayProto.push, + propertyIsEnumerable = objectProto.propertyIsEnumerable, + Set = isNative(Set = context.Set) && Set, + setTimeout = context.setTimeout, + splice = arrayProto.splice, + Uint8Array = isNative(Uint8Array = context.Uint8Array) && Uint8Array, + unshift = arrayProto.unshift, + WeakMap = isNative(WeakMap = context.WeakMap) && WeakMap; + + /** Used to clone array buffers. */ + var Float64Array = (function() { + // Safari 5 errors when using an array buffer to initialize a typed array + // where the array buffer's `byteLength` is not a multiple of the typed + // array's `BYTES_PER_ELEMENT`. + try { + var func = isNative(func = context.Float64Array) && func, + result = new func(new ArrayBuffer(10), 0, 1) && func; + } catch(e) {} + return result; + }()); + + /* Native method references for those with the same name as other `lodash` methods. */ + var nativeIsArray = isNative(nativeIsArray = Array.isArray) && nativeIsArray, + nativeCreate = isNative(nativeCreate = Object.create) && nativeCreate, + nativeIsFinite = context.isFinite, + nativeKeys = isNative(nativeKeys = Object.keys) && nativeKeys, + nativeMax = Math.max, + nativeMin = Math.min, + nativeNow = isNative(nativeNow = Date.now) && nativeNow, + nativeNumIsFinite = isNative(nativeNumIsFinite = Number.isFinite) && nativeNumIsFinite, + nativeParseInt = context.parseInt, + nativeRandom = Math.random; + + /** Used as references for `-Infinity` and `Infinity`. */ + var NEGATIVE_INFINITY = Number.NEGATIVE_INFINITY, + POSITIVE_INFINITY = Number.POSITIVE_INFINITY; + + /** Used as references for the maximum length and index of an array. */ + var MAX_ARRAY_LENGTH = Math.pow(2, 32) - 1, + MAX_ARRAY_INDEX = MAX_ARRAY_LENGTH - 1, + HALF_MAX_ARRAY_LENGTH = MAX_ARRAY_LENGTH >>> 1; + + /** Used as the size, in bytes, of each `Float64Array` element. */ + var FLOAT64_BYTES_PER_ELEMENT = Float64Array ? Float64Array.BYTES_PER_ELEMENT : 0; + + /** + * Used as the maximum length of an array-like value. + * See the [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-number.max_safe_integer) + * for more details. + */ + var MAX_SAFE_INTEGER = Math.pow(2, 53) - 1; + + /** Used to store function metadata. */ + var metaMap = WeakMap && new WeakMap; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a `lodash` object which wraps `value` to enable intuitive chaining. + * Methods that operate on and return arrays, collections, and functions can + * be chained together. Methods that return a boolean or single value will + * automatically end the chain returning the unwrapped value. Explicit chaining + * may be enabled using `_.chain`. The execution of chained methods is lazy, + * that is, execution is deferred until `_#value` is implicitly or explicitly + * called. + * + * Lazy evaluation allows several methods to support shortcut fusion. Shortcut + * fusion is an optimization that merges iteratees to avoid creating intermediate + * arrays and reduce the number of iteratee executions. + * + * Chaining is supported in custom builds as long as the `_#value` method is + * directly or indirectly included in the build. + * + * In addition to lodash methods, wrappers also have the following `Array` methods: + * `concat`, `join`, `pop`, `push`, `reverse`, `shift`, `slice`, `sort`, `splice`, + * and `unshift` + * + * The wrapper functions that support shortcut fusion are: + * `drop`, `dropRight`, `dropRightWhile`, `dropWhile`, `filter`, `first`, + * `initial`, `last`, `map`, `pluck`, `reject`, `rest`, `reverse`, `slice`, + * `take`, `takeRight`, `takeRightWhile`, `takeWhile`, and `where` + * + * The chainable wrapper functions are: + * `after`, `ary`, `assign`, `at`, `before`, `bind`, `bindAll`, `bindKey`, + * `callback`, `chain`, `chunk`, `compact`, `concat`, `constant`, `countBy`, + * `create`, `curry`, `debounce`, `defaults`, `defer`, `delay`, `difference`, + * `drop`, `dropRight`, `dropRightWhile`, `dropWhile`, `filter`, `flatten`, + * `flattenDeep`, `flow`, `flowRight`, `forEach`, `forEachRight`, `forIn`, + * `forInRight`, `forOwn`, `forOwnRight`, `functions`, `groupBy`, `indexBy`, + * `initial`, `intersection`, `invert`, `invoke`, `keys`, `keysIn`, `map`, + * `mapValues`, `matches`, `memoize`, `merge`, `mixin`, `negate`, `noop`, + * `omit`, `once`, `pairs`, `partial`, `partialRight`, `partition`, `pick`, + * `pluck`, `property`, `propertyOf`, `pull`, `pullAt`, `push`, `range`, + * `rearg`, `reject`, `remove`, `rest`, `reverse`, `shuffle`, `slice`, `sort`, + * `sortBy`, `sortByAll`, `splice`, `take`, `takeRight`, `takeRightWhile`, + * `takeWhile`, `tap`, `throttle`, `thru`, `times`, `toArray`, `toPlainObject`, + * `transform`, `union`, `uniq`, `unshift`, `unzip`, `values`, `valuesIn`, + * `where`, `without`, `wrap`, `xor`, `zip`, and `zipObject` + * + * The wrapper functions that are **not** chainable by default are: + * `attempt`, `camelCase`, `capitalize`, `clone`, `cloneDeep`, `deburr`, + * `endsWith`, `escape`, `escapeRegExp`, `every`, `find`, `findIndex`, `findKey`, + * `findLast`, `findLastIndex`, `findLastKey`, `findWhere`, `first`, `has`, + * `identity`, `includes`, `indexOf`, `isArguments`, `isArray`, `isBoolean`, + * `isDate`, `isElement`, `isEmpty`, `isEqual`, `isError`, `isFinite`, + * `isFunction`, `isMatch`, `isNative`, `isNaN`, `isNull`, `isNumber`, + * `isObject`, `isPlainObject`, `isRegExp`, `isString`, `isUndefined`, + * `isTypedArray`, `join`, `kebabCase`, `last`, `lastIndexOf`, `max`, `min`, + * `noConflict`, `now`, `pad`, `padLeft`, `padRight`, `parseInt`, `pop`, + * `random`, `reduce`, `reduceRight`, `repeat`, `result`, `runInContext`, + * `shift`, `size`, `snakeCase`, `some`, `sortedIndex`, `sortedLastIndex`, + * `startCase`, `startsWith`, `template`, `trim`, `trimLeft`, `trimRight`, + * `trunc`, `unescape`, `uniqueId`, `value`, and `words` + * + * The wrapper function `sample` will return a wrapped value when `n` is provided, + * otherwise an unwrapped value is returned. + * + * @name _ + * @constructor + * @category Chain + * @param {*} value The value to wrap in a `lodash` instance. + * @returns {Object} Returns a `lodash` instance. + * @example + * + * var wrapped = _([1, 2, 3]); + * + * // returns an unwrapped value + * wrapped.reduce(function(sum, n) { return sum + n; }); + * // => 6 + * + * // returns a wrapped value + * var squares = wrapped.map(function(n) { return n * n; }); + * + * _.isArray(squares); + * // => false + * + * _.isArray(squares.value()); + * // => true + */ + function lodash(value) { + if (isObjectLike(value) && !isArray(value)) { + if (value instanceof LodashWrapper) { + return value; + } + if (hasOwnProperty.call(value, '__wrapped__')) { + return new LodashWrapper(value.__wrapped__, value.__chain__, arrayCopy(value.__actions__)); + } + } + return new LodashWrapper(value); + } + + /** + * The base constructor for creating `lodash` wrapper objects. + * + * @private + * @param {*} value The value to wrap. + * @param {boolean} [chainAll] Enable chaining for all wrapper methods. + * @param {Array} [actions=[]] Actions to peform to resolve the unwrapped value. + */ + function LodashWrapper(value, chainAll, actions) { + this.__actions__ = actions || []; + this.__chain__ = !!chainAll; + this.__wrapped__ = value; + } + + /** + * An object environment feature flags. + * + * @static + * @memberOf _ + * @type Object + */ + var support = lodash.support = {}; + + (function(x) { + + /** + * Detect if functions can be decompiled by `Function#toString` + * (all but Firefox OS certified apps, older Opera mobile browsers, and + * the PlayStation 3; forced `false` for Windows 8 apps). + * + * @memberOf _.support + * @type boolean + */ + support.funcDecomp = !isNative(context.WinRTError) && reThis.test(runInContext); + + /** + * Detect if `Function#name` is supported (all but IE). + * + * @memberOf _.support + * @type boolean + */ + support.funcNames = typeof Function.name == 'string'; + + /** + * Detect if the DOM is supported. + * + * @memberOf _.support + * @type boolean + */ + try { + support.dom = document.createDocumentFragment().nodeType === 11; + } catch(e) { + support.dom = false; + } + + /** + * Detect if `arguments` object indexes are non-enumerable. + * + * In Firefox < 4, IE < 9, PhantomJS, and Safari < 5.1 `arguments` object + * indexes are non-enumerable. Chrome < 25 and Node.js < 0.11.0 treat + * `arguments` object indexes as non-enumerable and fail `hasOwnProperty` + * checks for indexes that exceed their function's formal parameters with + * associated values of `0`. + * + * @memberOf _.support + * @type boolean + */ + try { + support.nonEnumArgs = !propertyIsEnumerable.call(arguments, 1); + } catch(e) { + support.nonEnumArgs = true; + } + }(0, 0)); + + /** + * By default, the template delimiters used by lodash are like those in + * embedded Ruby (ERB). Change the following template settings to use + * alternative delimiters. + * + * @static + * @memberOf _ + * @type Object + */ + lodash.templateSettings = { + + /** + * Used to detect `data` property values to be HTML-escaped. + * + * @memberOf _.templateSettings + * @type RegExp + */ + 'escape': reEscape, + + /** + * Used to detect code to be evaluated. + * + * @memberOf _.templateSettings + * @type RegExp + */ + 'evaluate': reEvaluate, + + /** + * Used to detect `data` property values to inject. + * + * @memberOf _.templateSettings + * @type RegExp + */ + 'interpolate': reInterpolate, + + /** + * Used to reference the data object in the template text. + * + * @memberOf _.templateSettings + * @type string + */ + 'variable': '', + + /** + * Used to import variables into the compiled template. + * + * @memberOf _.templateSettings + * @type Object + */ + 'imports': { + + /** + * A reference to the `lodash` function. + * + * @memberOf _.templateSettings.imports + * @type Function + */ + '_': lodash + } + }; + + /*------------------------------------------------------------------------*/ + + /** + * Creates a lazy wrapper object which wraps `value` to enable lazy evaluation. + * + * @private + * @param {*} value The value to wrap. + */ + function LazyWrapper(value) { + this.actions = null; + this.dir = 1; + this.dropCount = 0; + this.filtered = false; + this.iteratees = null; + this.takeCount = POSITIVE_INFINITY; + this.views = null; + this.wrapped = value; + } + + /** + * Creates a clone of the lazy wrapper object. + * + * @private + * @name clone + * @memberOf LazyWrapper + * @returns {Object} Returns the cloned `LazyWrapper` object. + */ + function lazyClone() { + var actions = this.actions, + iteratees = this.iteratees, + views = this.views, + result = new LazyWrapper(this.wrapped); + + result.actions = actions ? arrayCopy(actions) : null; + result.dir = this.dir; + result.dropCount = this.dropCount; + result.filtered = this.filtered; + result.iteratees = iteratees ? arrayCopy(iteratees) : null; + result.takeCount = this.takeCount; + result.views = views ? arrayCopy(views) : null; + return result; + } + + /** + * Reverses the direction of lazy iteration. + * + * @private + * @name reverse + * @memberOf LazyWrapper + * @returns {Object} Returns the new reversed `LazyWrapper` object. + */ + function lazyReverse() { + if (this.filtered) { + var result = new LazyWrapper(this); + result.dir = -1; + result.filtered = true; + } else { + result = this.clone(); + result.dir *= -1; + } + return result; + } + + /** + * Extracts the unwrapped value from its lazy wrapper. + * + * @private + * @name value + * @memberOf LazyWrapper + * @returns {*} Returns the unwrapped value. + */ + function lazyValue() { + var array = this.wrapped.value(); + if (!isArray(array)) { + return baseWrapperValue(array, this.actions); + } + var dir = this.dir, + isRight = dir < 0, + view = getView(0, array.length, this.views), + start = view.start, + end = view.end, + length = end - start, + dropCount = this.dropCount, + takeCount = nativeMin(length, this.takeCount - dropCount), + index = isRight ? end : start - 1, + iteratees = this.iteratees, + iterLength = iteratees ? iteratees.length : 0, + resIndex = 0, + result = []; + + outer: + while (length-- && resIndex < takeCount) { + index += dir; + + var iterIndex = -1, + value = array[index]; + + while (++iterIndex < iterLength) { + var data = iteratees[iterIndex], + iteratee = data.iteratee, + computed = iteratee(value, index, array), + type = data.type; + + if (type == LAZY_MAP_FLAG) { + value = computed; + } else if (!computed) { + if (type == LAZY_FILTER_FLAG) { + continue outer; + } else { + break outer; + } + } + } + if (dropCount) { + dropCount--; + } else { + result[resIndex++] = value; + } + } + return result; + } + + /*------------------------------------------------------------------------*/ + + /** + * Creates a cache object to store key/value pairs. + * + * @private + * @static + * @name Cache + * @memberOf _.memoize + */ + function MapCache() { + this.__data__ = {}; + } + + /** + * Removes `key` and its value from the cache. + * + * @private + * @name delete + * @memberOf _.memoize.Cache + * @param {string} key The key of the value to remove. + * @returns {boolean} Returns `true` if the entry was removed successfully, else `false`. + */ + function mapDelete(key) { + return this.has(key) && delete this.__data__[key]; + } + + /** + * Gets the cached value for `key`. + * + * @private + * @name get + * @memberOf _.memoize.Cache + * @param {string} key The key of the value to get. + * @returns {*} Returns the cached value. + */ + function mapGet(key) { + return key == '__proto__' ? undefined : this.__data__[key]; + } + + /** + * Checks if a cached value for `key` exists. + * + * @private + * @name has + * @memberOf _.memoize.Cache + * @param {string} key The key of the entry to check. + * @returns {boolean} Returns `true` if an entry for `key` exists, else `false`. + */ + function mapHas(key) { + return key != '__proto__' && hasOwnProperty.call(this.__data__, key); + } + + /** + * Adds `value` to `key` of the cache. + * + * @private + * @name set + * @memberOf _.memoize.Cache + * @param {string} key The key of the value to cache. + * @param {*} value The value to cache. + * @returns {Object} Returns the cache object. + */ + function mapSet(key, value) { + if (key != '__proto__') { + this.__data__[key] = value; + } + return this; + } + + /*------------------------------------------------------------------------*/ + + /** + * + * Creates a cache object to store unique values. + * + * @private + * @param {Array} [values] The values to cache. + */ + function SetCache(values) { + var length = values ? values.length : 0; + + this.data = { 'hash': nativeCreate(null), 'set': new Set }; + while (length--) { + this.push(values[length]); + } + } + + /** + * Checks if `value` is in `cache` mimicking the return signature of + * `_.indexOf` by returning `0` if the value is found, else `-1`. + * + * @private + * @param {Object} cache The cache to search. + * @param {*} value The value to search for. + * @returns {number} Returns `0` if `value` is found, else `-1`. + */ + function cacheIndexOf(cache, value) { + var data = cache.data, + result = (typeof value == 'string' || isObject(value)) ? data.set.has(value) : data.hash[value]; + + return result ? 0 : -1; + } + + /** + * Adds `value` to the cache. + * + * @private + * @name push + * @memberOf SetCache + * @param {*} value The value to cache. + */ + function cachePush(value) { + var data = this.data; + if (typeof value == 'string' || isObject(value)) { + data.set.add(value); + } else { + data.hash[value] = true; + } + } + + /*------------------------------------------------------------------------*/ + + /** + * Copies the values of `source` to `array`. + * + * @private + * @param {Array} source The array to copy values from. + * @param {Array} [array=[]] The array to copy values to. + * @returns {Array} Returns `array`. + */ + function arrayCopy(source, array) { + var index = -1, + length = source.length; + + array || (array = Array(length)); + while (++index < length) { + array[index] = source[index]; + } + return array; + } + + /** + * A specialized version of `_.forEach` for arrays without support for callback + * shorthands or `this` binding. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ + function arrayEach(array, iteratee) { + var index = -1, + length = array.length; + + while (++index < length) { + if (iteratee(array[index], index, array) === false) { + break; + } + } + return array; + } + + /** + * A specialized version of `_.forEachRight` for arrays without support for + * callback shorthands or `this` binding. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns `array`. + */ + function arrayEachRight(array, iteratee) { + var length = array.length; + + while (length--) { + if (iteratee(array[length], length, array) === false) { + break; + } + } + return array; + } + + /** + * A specialized version of `_.every` for arrays without support for callback + * shorthands or `this` binding. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false`. + */ + function arrayEvery(array, predicate) { + var index = -1, + length = array.length; + + while (++index < length) { + if (!predicate(array[index], index, array)) { + return false; + } + } + return true; + } + + /** + * A specialized version of `_.filter` for arrays without support for callback + * shorthands or `this` binding. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + */ + function arrayFilter(array, predicate) { + var index = -1, + length = array.length, + resIndex = -1, + result = []; + + while (++index < length) { + var value = array[index]; + if (predicate(value, index, array)) { + result[++resIndex] = value; + } + } + return result; + } + + /** + * A specialized version of `_.map` for arrays without support for callback + * shorthands or `this` binding. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + */ + function arrayMap(array, iteratee) { + var index = -1, + length = array.length, + result = Array(length); + + while (++index < length) { + result[index] = iteratee(array[index], index, array); + } + return result; + } + + /** + * A specialized version of `_.max` for arrays without support for iteratees. + * + * @private + * @param {Array} array The array to iterate over. + * @returns {*} Returns the maximum value. + */ + function arrayMax(array) { + var index = -1, + length = array.length, + result = NEGATIVE_INFINITY; + + while (++index < length) { + var value = array[index]; + if (value > result) { + result = value; + } + } + return result; + } + + /** + * A specialized version of `_.min` for arrays without support for iteratees. + * + * @private + * @param {Array} array The array to iterate over. + * @returns {*} Returns the minimum value. + */ + function arrayMin(array) { + var index = -1, + length = array.length, + result = POSITIVE_INFINITY; + + while (++index < length) { + var value = array[index]; + if (value < result) { + result = value; + } + } + return result; + } + + /** + * A specialized version of `_.reduce` for arrays without support for callback + * shorthands or `this` binding. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initFromArray] Specify using the first element of `array` + * as the initial value. + * @returns {*} Returns the accumulated value. + */ + function arrayReduce(array, iteratee, accumulator, initFromArray) { + var index = -1, + length = array.length; + + if (initFromArray && length) { + accumulator = array[++index]; + } + while (++index < length) { + accumulator = iteratee(accumulator, array[index], index, array); + } + return accumulator; + } + + /** + * A specialized version of `_.reduceRight` for arrays without support for + * callback shorthands or `this` binding. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {boolean} [initFromArray] Specify using the last element of `array` + * as the initial value. + * @returns {*} Returns the accumulated value. + */ + function arrayReduceRight(array, iteratee, accumulator, initFromArray) { + var length = array.length; + if (initFromArray && length) { + accumulator = array[--length]; + } + while (length--) { + accumulator = iteratee(accumulator, array[length], length, array); + } + return accumulator; + } + + /** + * A specialized version of `_.some` for arrays without support for callback + * shorthands or `this` binding. + * + * @private + * @param {Array} array The array to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + */ + function arraySome(array, predicate) { + var index = -1, + length = array.length; + + while (++index < length) { + if (predicate(array[index], index, array)) { + return true; + } + } + return false; + } + + /** + * Used by `_.defaults` to customize its `_.assign` use. + * + * @private + * @param {*} objectValue The destination object property value. + * @param {*} sourceValue The source object property value. + * @returns {*} Returns the value to assign to the destination object. + */ + function assignDefaults(objectValue, sourceValue) { + return typeof objectValue == 'undefined' ? sourceValue : objectValue; + } + + /** + * Used by `_.template` to customize its `_.assign` use. + * + * **Note:** This method is like `assignDefaults` except that it ignores + * inherited property values when checking if a property is `undefined`. + * + * @private + * @param {*} objectValue The destination object property value. + * @param {*} sourceValue The source object property value. + * @param {string} key The key associated with the object and source values. + * @param {Object} object The destination object. + * @returns {*} Returns the value to assign to the destination object. + */ + function assignOwnDefaults(objectValue, sourceValue, key, object) { + return (typeof objectValue == 'undefined' || !hasOwnProperty.call(object, key)) + ? sourceValue + : objectValue; + } + + /** + * The base implementation of `_.assign` without support for argument juggling, + * multiple sources, and `this` binding `customizer` functions. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {Function} [customizer] The function to customize assigning values. + * @returns {Object} Returns the destination object. + */ + function baseAssign(object, source, customizer) { + var props = keys(source); + if (!customizer) { + return baseCopy(source, object, props); + } + var index = -1, + length = props.length + + while (++index < length) { + var key = props[index], + value = object[key], + result = customizer(value, source[key], key, object, source); + + if ((result === result ? result !== value : value === value) || + (typeof value == 'undefined' && !(key in object))) { + object[key] = result; + } + } + return object; + } + + /** + * The base implementation of `_.at` without support for strings and individual + * key arguments. + * + * @private + * @param {Array|Object} collection The collection to iterate over. + * @param {number[]|string[]} [props] The property names or indexes of elements to pick. + * @returns {Array} Returns the new array of picked elements. + */ + function baseAt(collection, props) { + var index = -1, + length = collection.length, + isArr = isLength(length), + propsLength = props.length, + result = Array(propsLength); + + while(++index < propsLength) { + var key = props[index]; + if (isArr) { + key = parseFloat(key); + result[index] = isIndex(key, length) ? collection[key] : undefined; + } else { + result[index] = collection[key]; + } + } + return result; + } + + /** + * Copies the properties of `source` to `object`. + * + * @private + * @param {Object} source The object to copy properties from. + * @param {Object} [object={}] The object to copy properties to. + * @param {Array} props The property names to copy. + * @returns {Object} Returns `object`. + */ + function baseCopy(source, object, props) { + if (!props) { + props = object; + object = {}; + } + var index = -1, + length = props.length; + + while (++index < length) { + var key = props[index]; + object[key] = source[key]; + } + return object; + } + + /** + * The base implementation of `_.bindAll` without support for individual + * method name arguments. + * + * @private + * @param {Object} object The object to bind and assign the bound methods to. + * @param {string[]} methodNames The object method names to bind. + * @returns {Object} Returns `object`. + */ + function baseBindAll(object, methodNames) { + var index = -1, + length = methodNames.length; + + while (++index < length) { + var key = methodNames[index]; + object[key] = createWrapper(object[key], BIND_FLAG, object); + } + return object; + } + + /** + * The base implementation of `_.callback` which supports specifying the + * number of arguments to provide to `func`. + * + * @private + * @param {*} [func=_.identity] The value to convert to a callback. + * @param {*} [thisArg] The `this` binding of `func`. + * @param {number} [argCount] The number of arguments to provide to `func`. + * @returns {Function} Returns the callback. + */ + function baseCallback(func, thisArg, argCount) { + var type = typeof func; + if (type == 'function') { + return (typeof thisArg != 'undefined' && isBindable(func)) + ? bindCallback(func, thisArg, argCount) + : func; + } + if (func == null) { + return identity; + } + // Handle "_.property" and "_.matches" style callback shorthands. + return type == 'object' + ? baseMatches(func) + : baseProperty(func + ''); + } + + /** + * The base implementation of `_.clone` without support for argument juggling + * and `this` binding `customizer` functions. + * + * @private + * @param {*} value The value to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @param {Function} [customizer] The function to customize cloning values. + * @param {string} [key] The key of `value`. + * @param {Object} [object] The object `value` belongs to. + * @param {Array} [stackA=[]] Tracks traversed source objects. + * @param {Array} [stackB=[]] Associates clones with source counterparts. + * @returns {*} Returns the cloned value. + */ + function baseClone(value, isDeep, customizer, key, object, stackA, stackB) { + var result; + if (customizer) { + result = object ? customizer(value, key, object) : customizer(value); + } + if (typeof result != 'undefined') { + return result; + } + if (!isObject(value)) { + return value; + } + var isArr = isArray(value); + if (isArr) { + result = initCloneArray(value); + if (!isDeep) { + return arrayCopy(value, result); + } + } else { + var tag = objToString.call(value), + isFunc = tag == funcTag; + + if (tag == objectTag || tag == argsTag || (isFunc && !object)) { + result = initCloneObject(isFunc ? {} : value); + if (!isDeep) { + return baseCopy(value, result, keys(value)); + } + } else { + return cloneableTags[tag] + ? initCloneByTag(value, tag, isDeep) + : (object ? value : {}); + } + } + // Check for circular references and return corresponding clone. + stackA || (stackA = []); + stackB || (stackB = []); + + var length = stackA.length; + while (length--) { + if (stackA[length] == value) { + return stackB[length]; + } + } + // Add the source value to the stack of traversed objects and associate it with its clone. + stackA.push(value); + stackB.push(result); + + // Recursively populate clone (susceptible to call stack limits). + (isArr ? arrayEach : baseForOwn)(value, function(subValue, key) { + result[key] = baseClone(subValue, isDeep, customizer, key, value, stackA, stackB); + }); + return result; + } + + /** + * The base implementation of `_.create` without support for assigning + * properties to the created object. + * + * @private + * @param {Object} prototype The object to inherit from. + * @returns {Object} Returns the new object. + */ + var baseCreate = (function() { + function Object() {} + return function(prototype) { + if (isObject(prototype)) { + Object.prototype = prototype; + var result = new Object; + Object.prototype = null; + } + return result || context.Object(); + }; + }()); + + /** + * The base implementation of `_.delay` and `_.defer` which accepts an index + * of where to slice the arguments to provide to `func`. + * + * @private + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @param {Object} args The `arguments` object to slice and provide to `func`. + * @returns {number} Returns the timer id. + */ + function baseDelay(func, wait, args, fromIndex) { + if (!isFunction(func)) { + throw new TypeError(FUNC_ERROR_TEXT); + } + return setTimeout(function() { func.apply(undefined, baseSlice(args, fromIndex)); }, wait); + } + + /** + * The base implementation of `_.difference` which accepts a single array + * of values to exclude. + * + * @private + * @param {Array} array The array to inspect. + * @param {Array} values The values to exclude. + * @returns {Array} Returns the new array of filtered values. + */ + function baseDifference(array, values) { + var length = array ? array.length : 0, + result = []; + + if (!length) { + return result; + } + var index = -1, + indexOf = getIndexOf(), + isCommon = indexOf == baseIndexOf, + cache = isCommon && values.length >= 200 && createCache(values), + valuesLength = values.length; + + if (cache) { + indexOf = cacheIndexOf; + isCommon = false; + values = cache; + } + outer: + while (++index < length) { + var value = array[index]; + + if (isCommon && value === value) { + var valuesIndex = valuesLength; + while (valuesIndex--) { + if (values[valuesIndex] === value) { + continue outer; + } + } + result.push(value); + } + else if (indexOf(values, value) < 0) { + result.push(value); + } + } + return result; + } + + /** + * The base implementation of `_.forEach` without support for callback + * shorthands and `this` binding. + * + * @private + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array|Object|string} Returns `collection`. + */ + function baseEach(collection, iteratee) { + var length = collection ? collection.length : 0; + if (!isLength(length)) { + return baseForOwn(collection, iteratee); + } + var index = -1, + iterable = toObject(collection); + + while (++index < length) { + if (iteratee(iterable[index], index, iterable) === false) { + break; + } + } + return collection; + } + + /** + * The base implementation of `_.forEachRight` without support for callback + * shorthands and `this` binding. + * + * @private + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array|Object|string} Returns `collection`. + */ + function baseEachRight(collection, iteratee) { + var length = collection ? collection.length : 0; + if (!isLength(length)) { + return baseForOwnRight(collection, iteratee); + } + var iterable = toObject(collection); + while (length--) { + if (iteratee(iterable[length], length, iterable) === false) { + break; + } + } + return collection; + } + + /** + * The base implementation of `_.every` without support for callback + * shorthands or `this` binding. + * + * @private + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false` + */ + function baseEvery(collection, predicate) { + var result = true; + baseEach(collection, function(value, index, collection) { + result = !!predicate(value, index, collection); + return result; + }); + return result; + } + + /** + * The base implementation of `_.filter` without support for callback + * shorthands or `this` binding. + * + * @private + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {Array} Returns the new filtered array. + */ + function baseFilter(collection, predicate) { + var result = []; + baseEach(collection, function(value, index, collection) { + if (predicate(value, index, collection)) { + result.push(value); + } + }); + return result; + } + + /** + * The base implementation of `_.find`, `_.findLast`, `_.findKey`, and `_.findLastKey`, + * without support for callback shorthands and `this` binding, which iterates + * over `collection` using the provided `eachFunc`. + * + * @private + * @param {Array|Object|string} collection The collection to search. + * @param {Function} predicate The function invoked per iteration. + * @param {Function} eachFunc The function to iterate over `collection`. + * @param {boolean} [retKey] Specify returning the key of the found element + * instead of the element itself. + * @returns {*} Returns the found element or its key, else `undefined`. + */ + function baseFind(collection, predicate, eachFunc, retKey) { + var result; + eachFunc(collection, function(value, key, collection) { + if (predicate(value, key, collection)) { + result = retKey ? key : value; + return false; + } + }); + return result; + } + + /** + * The base implementation of `_.flatten` with added support for restricting + * flattening and specifying the start index. + * + * @private + * @param {Array} array The array to flatten. + * @param {boolean} [isDeep] Specify a deep flatten. + * @param {boolean} [isStrict] Restrict flattening to arrays and `arguments` objects. + * @param {number} [fromIndex=0] The index to start from. + * @returns {Array} Returns the new flattened array. + */ + function baseFlatten(array, isDeep, isStrict, fromIndex) { + var index = (fromIndex || 0) - 1, + length = array.length, + resIndex = -1, + result = []; + + while (++index < length) { + var value = array[index]; + + if (isObjectLike(value) && isLength(value.length) && (isArray(value) || isArguments(value))) { + if (isDeep) { + // Recursively flatten arrays (susceptible to call stack limits). + value = baseFlatten(value, isDeep, isStrict); + } + var valIndex = -1, + valLength = value.length; + + result.length += valLength; + while (++valIndex < valLength) { + result[++resIndex] = value[valIndex]; + } + } else if (!isStrict) { + result[++resIndex] = value; + } + } + return result; + } + + /** + * The base implementation of `baseForIn` and `baseForOwn` which iterates + * over `object` properties returned by `keysFunc` invoking `iteratee` for + * each property. Iterator functions may exit iteration early by explicitly + * returning `false`. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {Function} keysFunc The function to get the keys of `object`. + * @returns {Object} Returns `object`. + */ + function baseFor(object, iteratee, keysFunc) { + var index = -1, + iterable = toObject(object), + props = keysFunc(object), + length = props.length; + + while (++index < length) { + var key = props[index]; + if (iteratee(iterable[key], key, iterable) === false) { + break; + } + } + return object; + } + + /** + * This function is like `baseFor` except that it iterates over properties + * in the opposite order. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {Function} keysFunc The function to get the keys of `object`. + * @returns {Object} Returns `object`. + */ + function baseForRight(object, iteratee, keysFunc) { + var iterable = toObject(object), + props = keysFunc(object), + length = props.length; + + while (length--) { + var key = props[length]; + if (iteratee(iterable[key], key, iterable) === false) { + break; + } + } + return object; + } + + /** + * The base implementation of `_.forIn` without support for callback + * shorthands and `this` binding. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. + */ + function baseForIn(object, iteratee) { + return baseFor(object, iteratee, keysIn); + } + + /** + * The base implementation of `_.forOwn` without support for callback + * shorthands and `this` binding. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. + */ + function baseForOwn(object, iteratee) { + return baseFor(object, iteratee, keys); + } + + /** + * The base implementation of `_.forOwnRight` without support for callback + * shorthands and `this` binding. + * + * @private + * @param {Object} object The object to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Object} Returns `object`. + */ + function baseForOwnRight(object, iteratee) { + return baseForRight(object, iteratee, keys); + } + + /** + * The base implementation of `_.functions` which creates an array of + * `object` function property names filtered from those provided. + * + * @private + * @param {Object} object The object to inspect. + * @param {Array} props The property names to filter. + * @returns {Array} Returns the new array of filtered property names. + */ + function baseFunctions(object, props) { + var index = -1, + length = props.length, + resIndex = -1, + result = []; + + while (++index < length) { + var key = props[index]; + if (isFunction(object[key])) { + result[++resIndex] = key; + } + } + return result; + } + + /** + * The base implementation of `_.invoke` which requires additional arguments + * to be provided as an array of arguments rather than individually. + * + * @private + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function|string} methodName The name of the method to invoke or + * the function invoked per iteration. + * @param {Array} [args] The arguments to invoke the method with. + * @returns {Array} Returns the array of results. + */ + function baseInvoke(collection, methodName, args) { + var index = -1, + isFunc = typeof methodName == 'function', + length = collection ? collection.length : 0, + result = isLength(length) ? Array(length) : []; + + baseEach(collection, function(value) { + var func = isFunc ? methodName : (value != null && value[methodName]); + result[++index] = func ? func.apply(value, args) : undefined; + }); + return result; + } + + /** + * The base implementation of `_.isEqual` without support for `this` binding + * `customizer` functions. + * + * @private + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @param {Function} [customizer] The function to customize comparing values. + * @param {boolean} [isWhere] Specify performing partial comparisons. + * @param {Array} [stackA] Tracks traversed `value` objects. + * @param {Array} [stackB] Tracks traversed `other` objects. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + */ + function baseIsEqual(value, other, customizer, isWhere, stackA, stackB) { + // Exit early for identical values. + if (value === other) { + // Treat `+0` vs. `-0` as not equal. + return value !== 0 || (1 / value == 1 / other); + } + var valType = typeof value, + othType = typeof other; + + // Exit early for unlike primitive values. + if ((valType != 'function' && valType != 'object' && othType != 'function' && othType != 'object') || + value == null || other == null) { + // Return `false` unless both values are `NaN`. + return value !== value && other !== other; + } + return baseIsEqualDeep(value, other, baseIsEqual, customizer, isWhere, stackA, stackB); + } + + /** + * A specialized version of `baseIsEqual` for arrays and objects which performs + * deep comparisons and tracks traversed objects enabling objects with circular + * references to be compared. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Function} [customizer] The function to customize comparing objects. + * @param {boolean} [isWhere] Specify performing partial comparisons. + * @param {Array} [stackA=[]] Tracks traversed `value` objects. + * @param {Array} [stackB=[]] Tracks traversed `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function baseIsEqualDeep(object, other, equalFunc, customizer, isWhere, stackA, stackB) { + var objIsArr = isArray(object), + othIsArr = isArray(other), + objTag = arrayTag, + othTag = arrayTag; + + if (!objIsArr) { + objTag = objToString.call(object); + if (objTag == argsTag) { + objTag = objectTag; + } else if (objTag != objectTag) { + objIsArr = isTypedArray(object); + } + } + if (!othIsArr) { + othTag = objToString.call(other); + if (othTag == argsTag) { + othTag = objectTag; + } else if (othTag != objectTag) { + othIsArr = isTypedArray(other); + } + } + var objIsObj = objTag == objectTag, + othIsObj = othTag == objectTag, + isSameTag = objTag == othTag; + + if (isSameTag && !(objIsArr || objIsObj)) { + return equalByTag(object, other, objTag); + } + var valWrapped = objIsObj && hasOwnProperty.call(object, '__wrapped__'), + othWrapped = othIsObj && hasOwnProperty.call(other, '__wrapped__'); + + if (valWrapped || othWrapped) { + return equalFunc(valWrapped ? object.value() : object, othWrapped ? other.value() : other, customizer, isWhere, stackA, stackB); + } + if (!isSameTag) { + return false; + } + // Assume cyclic values are equal. + // For more information on detecting circular references see https://es5.github.io/#JO. + stackA || (stackA = []); + stackB || (stackB = []); + + var length = stackA.length; + while (length--) { + if (stackA[length] == object) { + return stackB[length] == other; + } + } + // Add `object` and `other` to the stack of traversed objects. + stackA.push(object); + stackB.push(other); + + var result = (objIsArr ? equalArrays : equalObjects)(object, other, equalFunc, customizer, isWhere, stackA, stackB); + + stackA.pop(); + stackB.pop(); + + return result; + } + + /** + * The base implementation of `_.isMatch` without support for callback + * shorthands or `this` binding. + * + * @private + * @param {Object} source The object to inspect. + * @param {Array} props The source property names to match. + * @param {Array} values The source values to match. + * @param {Array} strictCompareFlags Strict comparison flags for source values. + * @param {Function} [customizer] The function to customize comparing objects. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. + */ + function baseIsMatch(object, props, values, strictCompareFlags, customizer) { + var length = props.length; + if (object == null) { + return !length; + } + var index = -1, + noCustomizer = !customizer; + + while (++index < length) { + if ((noCustomizer && strictCompareFlags[index]) + ? values[index] !== object[props[index]] + : !hasOwnProperty.call(object, props[index]) + ) { + return false; + } + } + index = -1; + while (++index < length) { + var key = props[index]; + if (noCustomizer && strictCompareFlags[index]) { + var result = hasOwnProperty.call(object, key); + } else { + var objValue = object[key], + srcValue = values[index]; + + result = customizer ? customizer(objValue, srcValue, key) : undefined; + if (typeof result == 'undefined') { + result = baseIsEqual(srcValue, objValue, customizer, true); + } + } + if (!result) { + return false; + } + } + return true; + } + + /** + * The base implementation of `_.map` without support for callback shorthands + * or `this` binding. + * + * @private + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @returns {Array} Returns the new mapped array. + */ + function baseMap(collection, iteratee) { + var result = []; + baseEach(collection, function(value, key, collection) { + result.push(iteratee(value, key, collection)); + }); + return result; + } + + /** + * The base implementation of `_.matches` which supports specifying whether + * `source` should be cloned. + * + * @private + * @param {Object} source The object of property values to match. + * @returns {Function} Returns the new function. + */ + function baseMatches(source) { + var props = keys(source), + length = props.length; + + if (length == 1) { + var key = props[0], + value = source[key]; + + if (isStrictComparable(value)) { + return function(object) { + return object != null && value === object[key] && hasOwnProperty.call(object, key); + }; + } + } + var values = Array(length), + strictCompareFlags = Array(length); + + while (length--) { + value = source[props[length]]; + values[length] = value; + strictCompareFlags[length] = isStrictComparable(value); + } + return function(object) { + return baseIsMatch(object, props, values, strictCompareFlags); + }; + } + + /** + * The base implementation of `_.merge` without support for argument juggling, + * multiple sources, and `this` binding `customizer` functions. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {Function} [customizer] The function to customize merging properties. + * @param {Array} [stackA=[]] Tracks traversed source objects. + * @param {Array} [stackB=[]] Associates values with source counterparts. + * @returns {Object} Returns the destination object. + */ + function baseMerge(object, source, customizer, stackA, stackB) { + var isSrcArr = isLength(source.length) && (isArray(source) || isTypedArray(source)); + + (isSrcArr ? arrayEach : baseForOwn)(source, function(srcValue, key, source) { + if (isObjectLike(srcValue)) { + stackA || (stackA = []); + stackB || (stackB = []); + return baseMergeDeep(object, source, key, baseMerge, customizer, stackA, stackB); + } + var value = object[key], + result = customizer ? customizer(value, srcValue, key, object, source) : undefined, + isCommon = typeof result == 'undefined'; + + if (isCommon) { + result = srcValue; + } + if ((isSrcArr || typeof result != 'undefined') && + (isCommon || (result === result ? result !== value : value === value))) { + object[key] = result; + } + }); + return object; + } + + /** + * A specialized version of `baseMerge` for arrays and objects which performs + * deep merges and tracks traversed objects enabling objects with circular + * references to be merged. + * + * @private + * @param {Object} object The destination object. + * @param {Object} source The source object. + * @param {string} key The key of the value to merge. + * @param {Function} mergeFunc The function to merge values. + * @param {Function} [customizer] The function to customize merging properties. + * @param {Array} [stackA=[]] Tracks traversed source objects. + * @param {Array} [stackB=[]] Associates values with source counterparts. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function baseMergeDeep(object, source, key, mergeFunc, customizer, stackA, stackB) { + var length = stackA.length, + srcValue = source[key]; + + while (length--) { + if (stackA[length] == srcValue) { + object[key] = stackB[length]; + return; + } + } + var value = object[key], + result = customizer ? customizer(value, srcValue, key, object, source) : undefined, + isCommon = typeof result == 'undefined'; + + if (isCommon) { + result = srcValue; + if (isLength(srcValue.length) && (isArray(srcValue) || isTypedArray(srcValue))) { + result = isArray(value) + ? value + : (value ? arrayCopy(value) : []); + } + else if (isPlainObject(srcValue) || isArguments(srcValue)) { + result = isArguments(value) + ? toPlainObject(value) + : (isPlainObject(value) ? value : {}); + } + else { + isCommon = false; + } + } + // Add the source value to the stack of traversed objects and associate + // it with its merged value. + stackA.push(srcValue); + stackB.push(result); + + if (isCommon) { + // Recursively merge objects and arrays (susceptible to call stack limits). + object[key] = mergeFunc(result, srcValue, customizer, stackA, stackB); + } else if (result === result ? result !== value : value === value) { + object[key] = result; + } + } + + /** + * The base implementation of `_.property` which does not coerce `key` to a string. + * + * @private + * @param {string} key The key of the property to get. + * @returns {Function} Returns the new function. + */ + function baseProperty(key) { + return function(object) { + return object == null ? undefined : object[key]; + }; + } + + /** + * The base implementation of `_.pullAt` without support for individual + * index arguments. + * + * @private + * @param {Array} array The array to modify. + * @param {number[]} indexes The indexes of elements to remove. + * @returns {Array} Returns the new array of removed elements. + */ + function basePullAt(array, indexes) { + var length = indexes.length, + result = baseAt(array, indexes); + + indexes.sort(baseCompareAscending); + while (length--) { + var index = parseFloat(indexes[length]); + if (index != previous && isIndex(index)) { + var previous = index; + splice.call(array, index, 1); + } + } + return result; + } + + /** + * The base implementation of `_.random` without support for argument juggling + * and returning floating-point numbers. + * + * @private + * @param {number} min The minimum possible value. + * @param {number} max The maximum possible value. + * @returns {number} Returns the random number. + */ + function baseRandom(min, max) { + return min + floor(nativeRandom() * (max - min + 1)); + } + + /** + * The base implementation of `_.reduce` and `_.reduceRight` without support + * for callback shorthands or `this` binding, which iterates over `collection` + * using the provided `eachFunc`. + * + * @private + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {*} accumulator The initial value. + * @param {boolean} initFromCollection Specify using the first or last element + * of `collection` as the initial value. + * @param {Function} eachFunc The function to iterate over `collection`. + * @returns {*} Returns the accumulated value. + */ + function baseReduce(collection, iteratee, accumulator, initFromCollection, eachFunc) { + eachFunc(collection, function(value, index, collection) { + accumulator = initFromCollection + ? (initFromCollection = false, value) + : iteratee(accumulator, value, index, collection) + }); + return accumulator; + } + + /** + * The base implementation of `setData` without support for hot loop detection. + * + * @private + * @param {Function} func The function to associate metadata with. + * @param {*} data The metadata. + * @returns {Function} Returns `func`. + */ + var baseSetData = !metaMap ? identity : function(func, data) { + metaMap.set(func, data); + return func; + }; + + /** + * The base implementation of `_.slice` without an iteratee call guard. + * + * @private + * @param {Array} array The array to slice. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the slice of `array`. + */ + function baseSlice(array, start, end) { + var index = -1, + length = array.length; + + start = start == null ? 0 : (+start || 0); + if (start < 0) { + start = -start > length ? 0 : (length + start); + } + end = (typeof end == 'undefined' || end > length) ? length : (+end || 0); + if (end < 0) { + end += length; + } + length = start > end ? 0 : (end - start) >>> 0; + start >>>= 0; + + var result = Array(length); + while (++index < length) { + result[index] = array[index + start]; + } + return result; + } + + /** + * The base implementation of `_.some` without support for callback shorthands + * or `this` binding. + * + * @private + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function} predicate The function invoked per iteration. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + */ + function baseSome(collection, predicate) { + var result; + + baseEach(collection, function(value, index, collection) { + result = predicate(value, index, collection); + return !result; + }); + return !!result; + } + + /** + * The base implementation of `_.uniq` without support for callback shorthands + * and `this` binding. + * + * @private + * @param {Array} array The array to inspect. + * @param {Function} [iteratee] The function invoked per iteration. + * @returns {Array} Returns the new duplicate-value-free array. + */ + function baseUniq(array, iteratee) { + var index = -1, + indexOf = getIndexOf(), + length = array.length, + isCommon = indexOf == baseIndexOf, + isLarge = isCommon && length >= 200, + seen = isLarge && createCache(), + result = []; + + if (seen) { + indexOf = cacheIndexOf; + isCommon = false; + } else { + isLarge = false; + seen = iteratee ? [] : result; + } + outer: + while (++index < length) { + var value = array[index], + computed = iteratee ? iteratee(value, index, array) : value; + + if (isCommon && value === value) { + var seenIndex = seen.length; + while (seenIndex--) { + if (seen[seenIndex] === computed) { + continue outer; + } + } + if (iteratee) { + seen.push(computed); + } + result.push(value); + } + else if (indexOf(seen, computed) < 0) { + if (iteratee || isLarge) { + seen.push(computed); + } + result.push(value); + } + } + return result; + } + + /** + * The base implementation of `_.values` and `_.valuesIn` which creates an + * array of `object` property values corresponding to the property names + * returned by `keysFunc`. + * + * @private + * @param {Object} object The object to query. + * @param {Array} props The property names to get values for. + * @returns {Object} Returns the array of property values. + */ + function baseValues(object, props) { + var index = -1, + length = props.length, + result = Array(length); + + while (++index < length) { + result[index] = object[props[index]]; + } + return result; + } + + /** + * The base implementation of `wrapperValue` which returns the result of + * performing a sequence of actions on the unwrapped `value`, where each + * successive action is supplied the return value of the previous. + * + * @private + * @param {*} value The unwrapped value. + * @param {Array} actions Actions to peform to resolve the unwrapped value. + * @returns {*} Returns the resolved unwrapped value. + */ + function baseWrapperValue(value, actions) { + var result = value; + if (result instanceof LazyWrapper) { + result = result.value(); + } + var index = -1, + length = actions.length; + + while (++index < length) { + var args = [result], + action = actions[index]; + + push.apply(args, action.args); + result = action.func.apply(action.thisArg, args); + } + return result; + } + + /** + * Performs a binary search of `array` to determine the index at which `value` + * should be inserted into `array` in order to maintain its sort order. + * + * @private + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {boolean} [retHighest] Specify returning the highest, instead + * of the lowest, index at which a value should be inserted into `array`. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + */ + function binaryIndex(array, value, retHighest) { + var low = 0, + high = array ? array.length : low; + + if (typeof value == 'number' && value === value && high <= HALF_MAX_ARRAY_LENGTH) { + while (low < high) { + var mid = (low + high) >>> 1, + computed = array[mid]; + + if (retHighest ? (computed <= value) : (computed < value)) { + low = mid + 1; + } else { + high = mid; + } + } + return high; + } + return binaryIndexBy(array, value, identity, retHighest); + } + + /** + * This function is like `binaryIndex` except that it invokes `iteratee` for + * `value` and each element of `array` to compute their sort ranking. The + * iteratee is invoked with one argument; (value). + * + * @private + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function} iteratee The function invoked per iteration. + * @param {boolean} [retHighest] Specify returning the highest, instead + * of the lowest, index at which a value should be inserted into `array`. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + */ + function binaryIndexBy(array, value, iteratee, retHighest) { + value = iteratee(value); + + var low = 0, + high = array ? array.length : 0, + valIsNaN = value !== value, + valIsUndef = typeof value == 'undefined'; + + while (low < high) { + var mid = floor((low + high) / 2), + computed = iteratee(array[mid]), + isReflexive = computed === computed; + + if (valIsNaN) { + var setLow = isReflexive || retHighest; + } else if (valIsUndef) { + setLow = isReflexive && (retHighest || typeof computed != 'undefined'); + } else { + setLow = retHighest ? (computed <= value) : (computed < value); + } + if (setLow) { + low = mid + 1; + } else { + high = mid; + } + } + return nativeMin(high, MAX_ARRAY_INDEX); + } + + /** + * A specialized version of `baseCallback` which only supports `this` binding + * and specifying the number of arguments to provide to `func`. + * + * @private + * @param {Function} func The function to bind. + * @param {*} thisArg The `this` binding of `func`. + * @param {number} [argCount] The number of arguments to provide to `func`. + * @returns {Function} Returns the callback. + */ + function bindCallback(func, thisArg, argCount) { + if (typeof func != 'function') { + return identity; + } + if (typeof thisArg == 'undefined') { + return func; + } + switch (argCount) { + case 1: return function(value) { + return func.call(thisArg, value); + }; + case 3: return function(value, index, collection) { + return func.call(thisArg, value, index, collection); + }; + case 4: return function(accumulator, value, index, collection) { + return func.call(thisArg, accumulator, value, index, collection); + }; + case 5: return function(value, other, key, object, source) { + return func.call(thisArg, value, other, key, object, source); + }; + } + return function() { + return func.apply(thisArg, arguments); + }; + } + + /** + * Creates a clone of the given array buffer. + * + * @private + * @param {ArrayBuffer} buffer The array buffer to clone. + * @returns {ArrayBuffer} Returns the cloned array buffer. + */ + function bufferClone(buffer) { + return bufferSlice.call(buffer, 0); + } + if (!bufferSlice) { + // PhantomJS has `ArrayBuffer` and `Uint8Array` but not `Float64Array`. + bufferClone = !(ArrayBuffer && Uint8Array) ? constant(null) : function(buffer) { + var byteLength = buffer.byteLength, + floatLength = Float64Array ? floor(byteLength / FLOAT64_BYTES_PER_ELEMENT) : 0, + offset = floatLength * FLOAT64_BYTES_PER_ELEMENT, + result = new ArrayBuffer(byteLength); + + if (floatLength) { + var view = new Float64Array(result, 0, floatLength); + view.set(new Float64Array(buffer, 0, floatLength)); + } + if (byteLength != offset) { + view = new Uint8Array(result, offset); + view.set(new Uint8Array(buffer, offset)); + } + return result; + }; + } + + /** + * Creates an array that is the composition of partially applied arguments, + * placeholders, and provided arguments into a single array of arguments. + * + * @private + * @param {Array|Object} args The provided arguments. + * @param {Array} partials The arguments to prepend to those provided. + * @param {Array} holders The `partials` placeholder indexes. + * @returns {Array} Returns the new array of composed arguments. + */ + function composeArgs(args, partials, holders) { + var holdersLength = holders.length, + argsIndex = -1, + argsLength = nativeMax(args.length - holdersLength, 0), + leftIndex = -1, + leftLength = partials.length, + result = Array(argsLength + leftLength); + + while (++leftIndex < leftLength) { + result[leftIndex] = partials[leftIndex]; + } + while (++argsIndex < holdersLength) { + result[holders[argsIndex]] = args[argsIndex]; + } + while (argsLength--) { + result[leftIndex++] = args[argsIndex++]; + } + return result; + } + + /** + * This function is like `composeArgs` except that the arguments composition + * is tailored for `_.partialRight`. + * + * @private + * @param {Array|Object} args The provided arguments. + * @param {Array} partials The arguments to append to those provided. + * @param {Array} holders The `partials` placeholder indexes. + * @returns {Array} Returns the new array of composed arguments. + */ + function composeArgsRight(args, partials, holders) { + var holdersIndex = -1, + holdersLength = holders.length, + argsIndex = -1, + argsLength = nativeMax(args.length - holdersLength, 0), + rightIndex = -1, + rightLength = partials.length, + result = Array(argsLength + rightLength); + + while (++argsIndex < argsLength) { + result[argsIndex] = args[argsIndex]; + } + var pad = argsIndex; + while (++rightIndex < rightLength) { + result[pad + rightIndex] = partials[rightIndex]; + } + while (++holdersIndex < holdersLength) { + result[pad + holders[holdersIndex]] = args[argsIndex++]; + } + return result; + } + + /** + * Creates a function that aggregates a collection, creating an accumulator + * object composed from the results of running each element in the collection + * through an iteratee. The `setter` sets the keys and values of the accumulator + * object. If `initializer` is provided initializes the accumulator object. + * + * @private + * @param {Function} setter The function to set keys and values of the accumulator object. + * @param {Function} [initializer] The function to initialize the accumulator object. + * @returns {Function} Returns the new aggregator function. + */ + function createAggregator(setter, initializer) { + return function(collection, iteratee, thisArg) { + var result = initializer ? initializer() : {}; + iteratee = getCallback(iteratee, thisArg, 3); + + if (isArray(collection)) { + var index = -1, + length = collection.length; + + while (++index < length) { + var value = collection[index]; + setter(result, value, iteratee(value, index, collection), collection); + } + } else { + baseEach(collection, function(value, key, collection) { + setter(result, value, iteratee(value, key, collection), collection); + }); + } + return result; + }; + } + + /** + * Creates a function that assigns properties of source object(s) to a given + * destination object. + * + * @private + * @param {Function} assigner The function to assign values. + * @returns {Function} Returns the new assigner function. + */ + function createAssigner(assigner) { + return function() { + var length = arguments.length, + object = arguments[0]; + + if (length < 2 || object == null) { + return object; + } + if (length > 3 && isIterateeCall(arguments[1], arguments[2], arguments[3])) { + length = 2; + } + // Juggle arguments. + if (length > 3 && typeof arguments[length - 2] == 'function') { + var customizer = bindCallback(arguments[--length - 1], arguments[length--], 5); + } else if (length > 2 && typeof arguments[length - 1] == 'function') { + customizer = arguments[--length]; + } + var index = 0; + while (++index < length) { + var source = arguments[index]; + if (source) { + assigner(object, source, customizer); + } + } + return object; + }; + } + + /** + * Creates a function that wraps `func` and invokes it with the `this` + * binding of `thisArg`. + * + * @private + * @param {Function} func The function to bind. + * @param {*} [thisArg] The `this` binding of `func`. + * @returns {Function} Returns the new bound function. + */ + function createBindWrapper(func, thisArg) { + var Ctor = createCtorWrapper(func); + + function wrapper() { + return (this instanceof wrapper ? Ctor : func).apply(thisArg, arguments); + } + return wrapper; + } + + /** + * Creates a `Set` cache object to optimize linear searches of large arrays. + * + * @private + * @param {Array} [values] The values to cache. + * @returns {null|Object} Returns the new cache object if `Set` is supported, else `null`. + */ + var createCache = !(nativeCreate && Set) ? constant(null) : function(values) { + return new SetCache(values); + }; + + /** + * Creates a function that produces compound words out of the words in a + * given string. + * + * @private + * @param {Function} callback The function to combine each word. + * @returns {Function} Returns the new compounder function. + */ + function createCompounder(callback) { + return function(string) { + var index = -1, + array = words(deburr(string)), + length = array.length, + result = ''; + + while (++index < length) { + result = callback(result, array[index], index); + } + return result; + }; + } + + /** + * Creates a function that produces an instance of `Ctor` regardless of + * whether it was invoked as part of a `new` expression or by `call` or `apply`. + * + * @private + * @param {Function} Ctor The constructor to wrap. + * @returns {Function} Returns the new wrapped function. + */ + function createCtorWrapper(Ctor) { + return function() { + var thisBinding = baseCreate(Ctor.prototype), + result = Ctor.apply(thisBinding, arguments); + + // Mimic the constructor's `return` behavior. + // See https://es5.github.io/#x13.2.2 for more details. + return isObject(result) ? result : thisBinding; + }; + } + + /** + * Creates a function that gets the extremum value of a collection. + * + * @private + * @param {Function} arrayFunc The function to get the extremum value from an array. + * @param {boolean} [isMin] Specify returning the minimum, instead of the maximum, + * extremum value. + * @returns {Function} Returns the new extremum function. + */ + function createExtremum(arrayFunc, isMin) { + return function(collection, iteratee, thisArg) { + if (thisArg && isIterateeCall(collection, iteratee, thisArg)) { + iteratee = null; + } + var func = getCallback(), + noIteratee = iteratee == null; + + if (!(func === baseCallback && noIteratee)) { + noIteratee = false; + iteratee = func(iteratee, thisArg, 3); + } + if (noIteratee) { + var isArr = isArray(collection); + if (!isArr && isString(collection)) { + iteratee = charAtCallback; + } else { + return arrayFunc(isArr ? collection : toIterable(collection)); + } + } + return extremumBy(collection, iteratee, isMin); + }; + } + + /** + * Creates a function that wraps `func` and invokes it with optional `this` + * binding of, partial application, and currying. + * + * @private + * @param {Function|string} func The function or method name to reference. + * @param {number} bitmask The bitmask of flags. See `createWrapper` for more details. + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to prepend to those provided to the new function. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [partialsRight] The arguments to append to those provided to the new function. + * @param {Array} [holdersRight] The `partialsRight` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createHybridWrapper(func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity) { + var isAry = bitmask & ARY_FLAG, + isBind = bitmask & BIND_FLAG, + isBindKey = bitmask & BIND_KEY_FLAG, + isCurry = bitmask & CURRY_FLAG, + isCurryBound = bitmask & CURRY_BOUND_FLAG, + isCurryRight = bitmask & CURRY_RIGHT_FLAG; + + var Ctor = !isBindKey && createCtorWrapper(func), + key = func; + + function wrapper() { + // Avoid `arguments` object use disqualifying optimizations by + // converting it to an array before providing it to other functions. + var length = arguments.length, + index = length, + args = Array(length); + + while (index--) { + args[index] = arguments[index]; + } + if (partials) { + args = composeArgs(args, partials, holders); + } + if (partialsRight) { + args = composeArgsRight(args, partialsRight, holdersRight); + } + if (isCurry || isCurryRight) { + var placeholder = wrapper.placeholder, + argsHolders = replaceHolders(args, placeholder); + + length -= argsHolders.length; + if (length < arity) { + var newArgPos = argPos ? arrayCopy(argPos) : null, + newArity = nativeMax(arity - length, 0), + newsHolders = isCurry ? argsHolders : null, + newHoldersRight = isCurry ? null : argsHolders, + newPartials = isCurry ? args : null, + newPartialsRight = isCurry ? null : args; + + bitmask |= (isCurry ? PARTIAL_FLAG : PARTIAL_RIGHT_FLAG); + bitmask &= ~(isCurry ? PARTIAL_RIGHT_FLAG : PARTIAL_FLAG); + + if (!isCurryBound) { + bitmask &= ~(BIND_FLAG | BIND_KEY_FLAG); + } + var result = createHybridWrapper(func, bitmask, thisArg, newPartials, newsHolders, newPartialsRight, newHoldersRight, newArgPos, ary, newArity); + result.placeholder = placeholder; + return result; + } + } + var thisBinding = isBind ? thisArg : this; + if (isBindKey) { + func = thisBinding[key]; + } + if (argPos) { + args = reorder(args, argPos); + } + if (isAry && ary < args.length) { + args.length = ary; + } + return (this instanceof wrapper ? (Ctor || createCtorWrapper(func)) : func).apply(thisBinding, args); + } + return wrapper; + } + + /** + * Creates the pad required for `string` based on the given padding length. + * The `chars` string may be truncated if the number of padding characters + * exceeds the padding length. + * + * @private + * @param {string} string The string to create padding for. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the pad for `string`. + */ + function createPad(string, length, chars) { + var strLength = string.length; + length = +length; + + if (strLength >= length || !nativeIsFinite(length)) { + return ''; + } + var padLength = length - strLength; + chars = chars == null ? ' ' : (chars + ''); + return repeat(chars, ceil(padLength / chars.length)).slice(0, padLength); + } + + /** + * Creates a function that wraps `func` and invokes it with the optional `this` + * binding of `thisArg` and the `partials` prepended to those provided to + * the wrapper. + * + * @private + * @param {Function} func The function to partially apply arguments to. + * @param {number} bitmask The bitmask of flags. See `createWrapper` for more details. + * @param {*} thisArg The `this` binding of `func`. + * @param {Array} partials The arguments to prepend to those provided to the new function. + * @returns {Function} Returns the new bound function. + */ + function createPartialWrapper(func, bitmask, thisArg, partials) { + var isBind = bitmask & BIND_FLAG, + Ctor = createCtorWrapper(func); + + function wrapper() { + // Avoid `arguments` object use disqualifying optimizations by + // converting it to an array before providing it `func`. + var argsIndex = -1, + argsLength = arguments.length, + leftIndex = -1, + leftLength = partials.length, + args = Array(argsLength + leftLength); + + while (++leftIndex < leftLength) { + args[leftIndex] = partials[leftIndex]; + } + while (argsLength--) { + args[leftIndex++] = arguments[++argsIndex]; + } + return (this instanceof wrapper ? Ctor : func).apply(isBind ? thisArg : this, args); + } + return wrapper; + } + + /** + * Creates a function that either curries or invokes `func` with optional + * `this` binding and partially applied arguments. + * + * @private + * @param {Function|string} func The function or method name to reference. + * @param {number} bitmask The bitmask of flags. + * The bitmask may be composed of the following flags: + * 1 - `_.bind` + * 2 - `_.bindKey` + * 4 - `_.curry` or `_.curryRight` of a bound function + * 8 - `_.curry` + * 16 - `_.curryRight` + * 32 - `_.partial` + * 64 - `_.partialRight` + * 128 - `_.rearg` + * 256 - `_.ary` + * @param {*} [thisArg] The `this` binding of `func`. + * @param {Array} [partials] The arguments to be partially applied. + * @param {Array} [holders] The `partials` placeholder indexes. + * @param {Array} [argPos] The argument positions of the new function. + * @param {number} [ary] The arity cap of `func`. + * @param {number} [arity] The arity of `func`. + * @returns {Function} Returns the new wrapped function. + */ + function createWrapper(func, bitmask, thisArg, partials, holders, argPos, ary, arity) { + var isBindKey = bitmask & BIND_KEY_FLAG; + if (!isBindKey && !isFunction(func)) { + throw new TypeError(FUNC_ERROR_TEXT); + } + var length = partials ? partials.length : 0; + if (!length) { + bitmask &= ~(PARTIAL_FLAG | PARTIAL_RIGHT_FLAG); + partials = holders = null; + } + length -= (holders ? holders.length : 0); + if (bitmask & PARTIAL_RIGHT_FLAG) { + var partialsRight = partials, + holdersRight = holders; + + partials = holders = null; + } + var data = !isBindKey && getData(func), + newData = [func, bitmask, thisArg, partials, holders, partialsRight, holdersRight, argPos, ary, arity]; + + if (data && data !== true) { + mergeData(newData, data); + bitmask = newData[1]; + arity = newData[9]; + } + newData[9] = arity == null + ? (isBindKey ? 0 : func.length) + : (nativeMax(arity - length, 0) || 0); + + if (bitmask == BIND_FLAG) { + var result = createBindWrapper(newData[0], newData[2]); + } else if ((bitmask == PARTIAL_FLAG || bitmask == (BIND_FLAG | PARTIAL_FLAG)) && !newData[4].length) { + result = createPartialWrapper.apply(null, newData); + } else { + result = createHybridWrapper.apply(null, newData); + } + var setter = data ? baseSetData : setData; + return setter(result, newData); + } + + /** + * A specialized version of `baseIsEqualDeep` for arrays with support for + * partial deep comparisons. + * + * @private + * @param {Array} array The array to compare. + * @param {Array} other The other array to compare. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Function} [customizer] The function to customize comparing arrays. + * @param {boolean} [isWhere] Specify performing partial comparisons. + * @param {Array} [stackA] Tracks traversed `value` objects. + * @param {Array} [stackB] Tracks traversed `other` objects. + * @returns {boolean} Returns `true` if the arrays are equivalent, else `false`. + */ + function equalArrays(array, other, equalFunc, customizer, isWhere, stackA, stackB) { + var index = -1, + arrLength = array.length, + othLength = other.length, + result = true; + + if (arrLength != othLength && !(isWhere && othLength > arrLength)) { + return false; + } + // Deep compare the contents, ignoring non-numeric properties. + while (result && ++index < arrLength) { + var arrValue = array[index], + othValue = other[index]; + + result = undefined; + if (customizer) { + result = isWhere + ? customizer(othValue, arrValue, index) + : customizer(arrValue, othValue, index); + } + if (typeof result == 'undefined') { + // Recursively compare arrays (susceptible to call stack limits). + if (isWhere) { + var othIndex = othLength; + while (othIndex--) { + othValue = other[othIndex]; + result = (arrValue && arrValue === othValue) || equalFunc(arrValue, othValue, customizer, isWhere, stackA, stackB); + if (result) { + break; + } + } + } else { + result = (arrValue && arrValue === othValue) || equalFunc(arrValue, othValue, customizer, isWhere, stackA, stackB); + } + } + } + return !!result; + } + + /** + * A specialized version of `baseIsEqualDeep` for comparing objects of + * the same `toStringTag`. + * + * **Note:** This function only supports comparing values with tags of + * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. + * + * @private + * @param {Object} value The object to compare. + * @param {Object} other The other object to compare. + * @param {string} tag The `toStringTag` of the objects to compare. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function equalByTag(object, other, tag) { + switch (tag) { + case boolTag: + case dateTag: + // Coerce dates and booleans to numbers, dates to milliseconds and booleans + // to `1` or `0` treating invalid dates coerced to `NaN` as not equal. + return +object == +other; + + case errorTag: + return object.name == other.name && object.message == other.message; + + case numberTag: + // Treat `NaN` vs. `NaN` as equal. + return (object != +object) + ? other != +other + // But, treat `-0` vs. `+0` as not equal. + : (object == 0 ? ((1 / object) == (1 / other)) : object == +other); + + case regexpTag: + case stringTag: + // Coerce regexes to strings and treat strings primitives and string + // objects as equal. See https://es5.github.io/#x15.10.6.4 for more details. + return object == (other + ''); + } + return false; + } + + /** + * A specialized version of `baseIsEqualDeep` for objects with support for + * partial deep comparisons. + * + * @private + * @param {Object} object The object to compare. + * @param {Object} other The other object to compare. + * @param {Function} equalFunc The function to determine equivalents of values. + * @param {Function} [customizer] The function to customize comparing values. + * @param {boolean} [isWhere] Specify performing partial comparisons. + * @param {Array} [stackA] Tracks traversed `value` objects. + * @param {Array} [stackB] Tracks traversed `other` objects. + * @returns {boolean} Returns `true` if the objects are equivalent, else `false`. + */ + function equalObjects(object, other, equalFunc, customizer, isWhere, stackA, stackB) { + var objProps = keys(object), + objLength = objProps.length, + othProps = keys(other), + othLength = othProps.length; + + if (objLength != othLength && !isWhere) { + return false; + } + var hasCtor, + index = -1; + + while (++index < objLength) { + var key = objProps[index], + result = hasOwnProperty.call(other, key); + + if (result) { + var objValue = object[key], + othValue = other[key]; + + result = undefined; + if (customizer) { + result = isWhere + ? customizer(othValue, objValue, key) + : customizer(objValue, othValue, key); + } + if (typeof result == 'undefined') { + // Recursively compare objects (susceptible to call stack limits). + result = (objValue && objValue === othValue) || equalFunc(objValue, othValue, customizer, isWhere, stackA, stackB); + } + } + if (!result) { + return false; + } + hasCtor || (hasCtor = key == 'constructor'); + } + if (!hasCtor) { + var objCtor = object.constructor, + othCtor = other.constructor; + + // Non `Object` object instances with different constructors are not equal. + if (objCtor != othCtor && ('constructor' in object && 'constructor' in other) && + !(typeof objCtor == 'function' && objCtor instanceof objCtor && typeof othCtor == 'function' && othCtor instanceof othCtor)) { + return false; + } + } + return true; + } + + /** + * Gets the extremum value of `collection` invoking `iteratee` for each value + * in `collection` to generate the criterion by which the value is ranked. + * The `iteratee` is invoked with three arguments; (value, index, collection). + * + * @private + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function} iteratee The function invoked per iteration. + * @param {boolean} [isMin] Specify returning the minimum, instead of the + * maximum, extremum value. + * @returns {*} Returns the extremum value. + */ + function extremumBy(collection, iteratee, isMin) { + var exValue = isMin ? POSITIVE_INFINITY : NEGATIVE_INFINITY, + computed = exValue, + result = computed; + + baseEach(collection, function(value, index, collection) { + var current = iteratee(value, index, collection); + if ((isMin ? current < computed : current > computed) || (current === exValue && current === result)) { + computed = current; + result = value; + } + }); + return result; + } + + /** + * Gets the appropriate "callback" function. If the `_.callback` method is + * customized this function returns the custom method, otherwise it returns + * the `baseCallback` function. If arguments are provided the chosen function + * is invoked with them and its result is returned. + * + * @private + * @returns {Function} Returns the chosen function or its result. + */ + function getCallback(func, thisArg, argCount) { + var result = lodash.callback || callback; + result = result === callback ? baseCallback : result; + return argCount ? result(func, thisArg, argCount) : result; + } + + /** + * Gets metadata for `func`. + * + * @private + * @param {Function} func The function to query. + * @returns {*} Returns the metadata for `func`. + */ + var getData = !metaMap ? noop : function(func) { + return metaMap.get(func); + }; + + /** + * Gets the appropriate "indexOf" function. If the `_.indexOf` method is + * customized this function returns the custom method, otherwise it returns + * the `baseIndexOf` function. If arguments are provided the chosen function + * is invoked with them and its result is returned. + * + * @private + * @returns {Function|number} Returns the chosen function or its result. + */ + function getIndexOf(collection, target, fromIndex) { + var result = lodash.indexOf || indexOf; + result = result === indexOf ? baseIndexOf : result; + return collection ? result(collection, target, fromIndex) : result; + } + + /** + * Gets the view, applying any `transforms` to the `start` and `end` positions. + * + * @private + * @param {number} start The start of the view. + * @param {number} end The end of the view. + * @param {Array} [transforms] The transformations to apply to the view. + * @returns {Object} Returns an object containing the `start` and `end` + * positions of the view. + */ + function getView(start, end, transforms) { + var index = -1, + length = transforms ? transforms.length : 0; + + while (++index < length) { + var data = transforms[index], + size = data.size; + + switch (data.type) { + case 'drop': start += size; break; + case 'dropRight': end -= size; break; + case 'take': end = nativeMin(end, start + size); break; + case 'takeRight': start = nativeMax(start, end - size); break; + } + } + return { 'start': start, 'end': end }; + } + + /** + * Initializes an array clone. + * + * @private + * @param {Array} array The array to clone. + * @returns {Array} Returns the initialized clone. + */ + function initCloneArray(array) { + var length = array.length, + result = new array.constructor(length); + + // Add array properties assigned by `RegExp#exec`. + if (length && typeof array[0] == 'string' && hasOwnProperty.call(array, 'index')) { + result.index = array.index; + result.input = array.input; + } + return result; + } + + /** + * Initializes an object clone. + * + * @private + * @param {Object} object The object to clone. + * @returns {Object} Returns the initialized clone. + */ + function initCloneObject(object) { + var Ctor = object.constructor; + if (!(typeof Ctor == 'function' && Ctor instanceof Ctor)) { + Ctor = Object; + } + return new Ctor; + } + + /** + * Initializes an object clone based on its `toStringTag`. + * + * **Note:** This function only supports cloning values with tags of + * `Boolean`, `Date`, `Error`, `Number`, `RegExp`, or `String`. + * + * + * @private + * @param {Object} object The object to clone. + * @param {string} tag The `toStringTag` of the object to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @returns {Object} Returns the initialized clone. + */ + function initCloneByTag(object, tag, isDeep) { + var Ctor = object.constructor; + switch (tag) { + case arrayBufferTag: + return bufferClone(object); + + case boolTag: + case dateTag: + return new Ctor(+object); + + case float32Tag: case float64Tag: + case int8Tag: case int16Tag: case int32Tag: + case uint8Tag: case uint8ClampedTag: case uint16Tag: case uint32Tag: + var buffer = object.buffer; + return new Ctor(isDeep ? bufferClone(buffer) : buffer, object.byteOffset, object.length); + + case numberTag: + case stringTag: + return new Ctor(object); + + case regexpTag: + var result = new Ctor(object.source, reFlags.exec(object)); + result.lastIndex = object.lastIndex; + } + return result; + } + + /** + * Checks if `func` is eligible for `this` binding. + * + * @private + * @param {Function} func The function to check. + * @returns {boolean} Returns `true` if `func` is eligible, else `false`. + */ + function isBindable(func) { + var support = lodash.support, + result = !(support.funcNames ? func.name : support.funcDecomp); + + if (!result) { + var source = fnToString.call(func); + if (!support.funcNames) { + result = !reFuncName.test(source); + } + if (!result) { + // Check if `func` references the `this` keyword and store the result. + result = reThis.test(source) || isNative(func); + baseSetData(func, result); + } + } + return result; + } + + /** + * Checks if `value` is a valid array-like index. + * + * @private + * @param {*} value The value to check. + * @param {number} [length=MAX_SAFE_INTEGER] The upper bounds of a valid index. + * @returns {boolean} Returns `true` if `value` is a valid index, else `false`. + */ + function isIndex(value, length) { + value = +value; + length = length == null ? MAX_SAFE_INTEGER : length; + return value > -1 && value % 1 == 0 && value < length; + } + + /** + * Checks if the provided arguments are from an iteratee call. + * + * @private + * @param {*} value The potential iteratee value argument. + * @param {*} index The potential iteratee index or key argument. + * @param {*} object The potential iteratee object argument. + * @returns {boolean} Returns `true` if the arguments are from an iteratee call, else `false`. + */ + function isIterateeCall(value, index, object) { + if (!isObject(object)) { + return false; + } + var type = typeof index; + if (type == 'number') { + var length = object.length, + prereq = isLength(length) && isIndex(index, length); + } else { + prereq = type == 'string' && index in object; + } + return prereq && object[index] === value; + } + + /** + * Checks if `value` is a valid array-like length. + * + * **Note:** This function is based on ES `ToLength`. See the + * [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-tolength) + * for more details. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a valid length, else `false`. + */ + function isLength(value) { + return typeof value == 'number' && value > -1 && value % 1 == 0 && value <= MAX_SAFE_INTEGER; + } + + /** + * Checks if `value` is suitable for strict equality comparisons, i.e. `===`. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` if suitable for strict + * equality comparisons, else `false`. + */ + function isStrictComparable(value) { + return value === value && (value === 0 ? ((1 / value) > 0) : !isObject(value)); + } + + /** + * Merges the function metadata of `source` into `data`. + * + * Merging metadata reduces the number of wrappers required to invoke a function. + * This is possible because methods like `_.bind`, `_.curry`, and `_.partial` + * may be applied regardless of execution order. Methods like `_.ary` and `_.rearg` + * augment function arguments, making the order in which they are executed important, + * preventing the merging of metadata. However, we make an exception for a safe + * common case where curried functions have `_.ary` and or `_.rearg` applied. + * + * @private + * @param {Array} data The destination metadata. + * @param {Array} source The source metadata. + * @returns {Array} Returns `data`. + */ + function mergeData(data, source) { + var bitmask = data[1], + srcBitmask = source[1], + newBitmask = bitmask | srcBitmask; + + var arityFlags = ARY_FLAG | REARG_FLAG, + bindFlags = BIND_FLAG | BIND_KEY_FLAG, + comboFlags = arityFlags | bindFlags | CURRY_BOUND_FLAG | CURRY_RIGHT_FLAG; + + var isAry = bitmask & ARY_FLAG && !(srcBitmask & ARY_FLAG), + isRearg = bitmask & REARG_FLAG && !(srcBitmask & REARG_FLAG), + argPos = (isRearg ? data : source)[7], + ary = (isAry ? data : source)[8]; + + var isCommon = !(bitmask >= REARG_FLAG && srcBitmask > bindFlags) && + !(bitmask > bindFlags && srcBitmask >= REARG_FLAG); + + var isCombo = (newBitmask >= arityFlags && newBitmask <= comboFlags) && + (bitmask < REARG_FLAG || ((isRearg || isAry) && argPos.length <= ary)); + + // Exit early if metadata can't be merged. + if (!(isCommon || isCombo)) { + return data; + } + // Use source `thisArg` if available. + if (srcBitmask & BIND_FLAG) { + data[2] = source[2]; + // Set when currying a bound function. + newBitmask |= (bitmask & BIND_FLAG) ? 0 : CURRY_BOUND_FLAG; + } + // Compose partial arguments. + var value = source[3]; + if (value) { + var partials = data[3]; + data[3] = partials ? composeArgs(partials, value, source[4]) : arrayCopy(value); + data[4] = partials ? replaceHolders(data[3], PLACEHOLDER) : arrayCopy(source[4]); + } + // Compose partial right arguments. + value = source[5]; + if (value) { + partials = data[5]; + data[5] = partials ? composeArgsRight(partials, value, source[6]) : arrayCopy(value); + data[6] = partials ? replaceHolders(data[5], PLACEHOLDER) : arrayCopy(source[6]); + } + // Use source `argPos` if available. + value = source[7]; + if (value) { + data[7] = arrayCopy(value); + } + // Use source `ary` if it's smaller. + if (srcBitmask & ARY_FLAG) { + data[8] = data[8] == null ? source[8] : nativeMin(data[8], source[8]); + } + // Use source `arity` if one is not provided. + if (data[9] == null) { + data[9] = source[9]; + } + // Use source `func` and merge bitmasks. + data[0] = source[0]; + data[1] = newBitmask; + + return data; + } + + /** + * A specialized version of `_.pick` that picks `object` properties specified + * by the `props` array. + * + * @private + * @param {Object} object The source object. + * @param {string[]} props The property names to pick. + * @returns {Object} Returns the new object. + */ + function pickByArray(object, props) { + object = toObject(object); + + var index = -1, + length = props.length, + result = {}; + + while (++index < length) { + var key = props[index]; + if (key in object) { + result[key] = object[key]; + } + } + return result; + } + + /** + * A specialized version of `_.pick` that picks `object` properties `predicate` + * returns truthy for. + * + * @private + * @param {Object} object The source object. + * @param {Function} predicate The function invoked per iteration. + * @returns {Object} Returns the new object. + */ + function pickByCallback(object, predicate) { + var result = {}; + baseForIn(object, function(value, key, object) { + if (predicate(value, key, object)) { + result[key] = value; + } + }); + return result; + } + + /** + * Reorder `array` according to the specified indexes where the element at + * the first index is assigned as the first element, the element at + * the second index is assigned as the second element, and so on. + * + * @private + * @param {Array} array The array to reorder. + * @param {Array} indexes The arranged array indexes. + * @returns {Array} Returns `array`. + */ + function reorder(array, indexes) { + var arrLength = array.length, + length = nativeMin(indexes.length, arrLength), + oldArray = arrayCopy(array); + + while (length--) { + var index = indexes[length]; + array[length] = isIndex(index, arrLength) ? oldArray[index] : undefined; + } + return array; + } + + /** + * Sets metadata for `func`. + * + * **Note:** If this function becomes hot, i.e. is invoked a lot in a short + * period of time, it will trip its breaker and transition to an identity function + * to avoid garbage collection pauses in V8. See [V8 issue 2070](https://code.google.com/p/v8/issues/detail?id=2070) + * for more details. + * + * @private + * @param {Function} func The function to associate metadata with. + * @param {*} data The metadata. + * @returns {Function} Returns `func`. + */ + var setData = (function() { + var count = 0, + lastCalled = 0; + + return function(key, value) { + var stamp = now(), + remaining = HOT_SPAN - (stamp - lastCalled); + + lastCalled = stamp; + if (remaining > 0) { + if (++count >= HOT_COUNT) { + return key; + } + } else { + count = 0; + } + return baseSetData(key, value); + }; + }()); + + /** + * A fallback implementation of `_.isPlainObject` which checks if `value` + * is an object created by the `Object` constructor or has a `[[Prototype]]` + * of `null`. + * + * @private + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a plain object, else `false`. + */ + function shimIsPlainObject(value) { + var Ctor, + support = lodash.support; + + // Exit early for non `Object` objects. + if (!(isObjectLike(value) && objToString.call(value) == objectTag) || + (!hasOwnProperty.call(value, 'constructor') && + (Ctor = value.constructor, typeof Ctor == 'function' && !(Ctor instanceof Ctor)))) { + return false; + } + // IE < 9 iterates inherited properties before own properties. If the first + // iterated property is an object's own property then there are no inherited + // enumerable properties. + var result; + // In most environments an object's own properties are iterated before + // its inherited properties. If the last iterated property is an object's + // own property then there are no inherited enumerable properties. + baseForIn(value, function(subValue, key) { + result = key; + }); + return typeof result == 'undefined' || hasOwnProperty.call(value, result); + } + + /** + * A fallback implementation of `Object.keys` which creates an array of the + * own enumerable property names of `object`. + * + * @private + * @param {Object} object The object to inspect. + * @returns {Array} Returns the array of property names. + */ + function shimKeys(object) { + var props = keysIn(object), + propsLength = props.length, + length = propsLength && object.length, + support = lodash.support; + + var allowIndexes = length && isLength(length) && + (isArray(object) || (support.nonEnumArgs && isArguments(object))); + + var index = -1, + result = []; + + while (++index < propsLength) { + var key = props[index]; + if ((allowIndexes && isIndex(key, length)) || hasOwnProperty.call(object, key)) { + result.push(key); + } + } + return result; + } + + /** + * Converts `value` to an array-like object if it is not one. + * + * @private + * @param {*} value The value to process. + * @returns {Array|Object} Returns the array-like object. + */ + function toIterable(value) { + if (value == null) { + return []; + } + if (!isLength(value.length)) { + return values(value); + } + return isObject(value) ? value : Object(value); + } + + /** + * Converts `value` to an object if it is not one. + * + * @private + * @param {*} value The value to process. + * @returns {Object} Returns the object. + */ + function toObject(value) { + return isObject(value) ? value : Object(value); + } + + /*------------------------------------------------------------------------*/ + + /** + * Creates an array of elements split into groups the length of `size`. + * If `collection` can't be split evenly, the final chunk will be the remaining + * elements. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to process. + * @param {numer} [size=1] The length of each chunk. + * @param- {Object} [guard] Enables use as a callback for functions like `_.map`. + * @returns {Array} Returns the new array containing chunks. + * @example + * + * _.chunk(['a', 'b', 'c', 'd'], 2); + * // => [['a', 'b'], ['c', 'd']] + * + * _.chunk(['a', 'b', 'c', 'd'], 3); + * // => [['a', 'b', 'c'], ['d']] + */ + function chunk(array, size, guard) { + if (guard ? isIterateeCall(array, size, guard) : size == null) { + size = 1; + } else { + size = nativeMax(+size || 1, 1); + } + var index = 0, + length = array ? array.length : 0, + resIndex = -1, + result = Array(ceil(length / size)); + + while (index < length) { + result[++resIndex] = baseSlice(array, index, (index += size)); + } + return result; + } + + /** + * Creates an array with all falsey values removed. The values `false`, `null`, + * `0`, `""`, `undefined`, and `NaN` are falsey. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to compact. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.compact([0, 1, false, 2, '', 3]); + * // => [1, 2, 3] + */ + function compact(array) { + var index = -1, + length = array ? array.length : 0, + resIndex = -1, + result = []; + + while (++index < length) { + var value = array[index]; + if (value) { + result[++resIndex] = value; + } + } + return result; + } + + /** + * Creates an array excluding all values of the provided arrays using + * `SameValueZero` for equality comparisons. + * + * **Note:** `SameValueZero` comparisons are like strict equality comparisons, + * e.g. `===`, except that `NaN` matches `NaN`. See the + * [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-samevaluezero) + * for more details. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to inspect. + * @param {...Array} [values] The arrays of values to exclude. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.difference([1, 2, 3], [5, 2, 10]); + * // => [1, 3] + */ + function difference() { + var index = -1, + length = arguments.length; + + while (++index < length) { + var value = arguments[index]; + if (isArray(value) || isArguments(value)) { + break; + } + } + return baseDifference(value, baseFlatten(arguments, false, true, ++index)); + } + + /** + * Creates a slice of `array` with `n` elements dropped from the beginning. + * + * @static + * @memberOf _ + * @type Function + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to drop. + * @param- {Object} [guard] Enables use as a callback for functions like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.drop([1, 2, 3]); + * // => [2, 3] + * + * _.drop([1, 2, 3], 2); + * // => [3] + * + * _.drop([1, 2, 3], 5); + * // => [] + * + * _.drop([1, 2, 3], 0); + * // => [1, 2, 3] + */ + function drop(array, n, guard) { + var length = array ? array.length : 0; + if (!length) { + return []; + } + if (guard ? isIterateeCall(array, n, guard) : n == null) { + n = 1; + } + return baseSlice(array, n < 0 ? 0 : n); + } + + /** + * Creates a slice of `array` with `n` elements dropped from the end. + * + * @static + * @memberOf _ + * @type Function + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to drop. + * @param- {Object} [guard] Enables use as a callback for functions like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.dropRight([1, 2, 3]); + * // => [1, 2] + * + * _.dropRight([1, 2, 3], 2); + * // => [1] + * + * _.dropRight([1, 2, 3], 5); + * // => [] + * + * _.dropRight([1, 2, 3], 0); + * // => [1, 2, 3] + */ + function dropRight(array, n, guard) { + var length = array ? array.length : 0; + if (!length) { + return []; + } + if (guard ? isIterateeCall(array, n, guard) : n == null) { + n = 1; + } + n = length - (+n || 0); + return baseSlice(array, 0, n < 0 ? 0 : n); + } + + /** + * Creates a slice of `array` excluding elements dropped from the end. + * Elements are dropped until `predicate` returns falsey. The predicate is + * bound to `thisArg` and invoked with three arguments; (value, index, array). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @type Function + * @category Array + * @param {Array} array The array to query. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per element. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.dropRightWhile([1, 2, 3], function(n) { return n > 1; }); + * // => [1] + * + * var users = [ + * { 'user': 'barney', 'status': 'busy', 'active': false }, + * { 'user': 'fred', 'status': 'busy', 'active': true }, + * { 'user': 'pebbles', 'status': 'away', 'active': true } + * ]; + * + * // using the "_.property" callback shorthand + * _.pluck(_.dropRightWhile(users, 'active'), 'user'); + * // => ['barney'] + * + * // using the "_.matches" callback shorthand + * _.pluck(_.dropRightWhile(users, { 'status': 'away' }), 'user'); + * // => ['barney', 'fred'] + */ + function dropRightWhile(array, predicate, thisArg) { + var length = array ? array.length : 0; + if (!length) { + return []; + } + predicate = getCallback(predicate, thisArg, 3); + while (length-- && predicate(array[length], length, array)) {} + return baseSlice(array, 0, length + 1); + } + + /** + * Creates a slice of `array` excluding elements dropped from the beginning. + * Elements are dropped until `predicate` returns falsey. The predicate is + * bound to `thisArg` and invoked with three arguments; (value, index, array). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @type Function + * @category Array + * @param {Array} array The array to query. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per element. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.dropWhile([1, 2, 3], function(n) { return n < 3; }); + * // => [3] + * + * var users = [ + * { 'user': 'barney', 'status': 'busy', 'active': true }, + * { 'user': 'fred', 'status': 'busy', 'active': false }, + * { 'user': 'pebbles', 'status': 'away', 'active': true } + * ]; + * + * // using the "_.property" callback shorthand + * _.pluck(_.dropWhile(users, 'active'), 'user'); + * // => ['fred', 'pebbles'] + * + * // using the "_.matches" callback shorthand + * _.pluck(_.dropWhile(users, { 'status': 'busy' }), 'user'); + * // => ['pebbles'] + */ + function dropWhile(array, predicate, thisArg) { + var length = array ? array.length : 0; + if (!length) { + return []; + } + var index = -1; + predicate = getCallback(predicate, thisArg, 3); + while (++index < length && predicate(array[index], index, array)) {} + return baseSlice(array, index); + } + + /** + * This method is like `_.find` except that it returns the index of the first + * element `predicate` returns truthy for, instead of the element itself. + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to search. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {number} Returns the index of the found element, else `-1`. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true }, + * { 'user': 'pebbles', 'age': 1, 'active': false } + * ]; + * + * _.findIndex(users, function(chr) { return chr.age < 40; }); + * // => 0 + * + * // using the "_.matches" callback shorthand + * _.findIndex(users, { 'age': 1 }); + * // => 2 + * + * // using the "_.property" callback shorthand + * _.findIndex(users, 'active'); + * // => 1 + */ + function findIndex(array, predicate, thisArg) { + var index = -1, + length = array ? array.length : 0; + + predicate = getCallback(predicate, thisArg, 3); + while (++index < length) { + if (predicate(array[index], index, array)) { + return index; + } + } + return -1; + } + + /** + * This method is like `_.findIndex` except that it iterates over elements + * of `collection` from right to left. + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to search. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {number} Returns the index of the found element, else `-1`. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': true }, + * { 'user': 'fred', 'age': 40, 'active': false }, + * { 'user': 'pebbles', 'age': 1, 'active': false } + * ]; + * + * _.findLastIndex(users, function(chr) { return chr.age < 40; }); + * // => 2 + * + * // using the "_.matches" callback shorthand + * _.findLastIndex(users, { 'age': 40 }); + * // => 1 + * + * // using the "_.property" callback shorthand + * _.findLastIndex(users, 'active'); + * // => 0 + */ + function findLastIndex(array, predicate, thisArg) { + var length = array ? array.length : 0; + predicate = getCallback(predicate, thisArg, 3); + while (length--) { + if (predicate(array[length], length, array)) { + return length; + } + } + return -1; + } + + /** + * Gets the first element of `array`. + * + * @static + * @memberOf _ + * @alias head + * @category Array + * @param {Array} array The array to query. + * @returns {*} Returns the first element of `array`. + * @example + * + * _.first([1, 2, 3]); + * // => 1 + * + * _.first([]); + * // => undefined + */ + function first(array) { + return array ? array[0] : undefined; + } + + /** + * Flattens a nested array. If `isDeep` is `true` the array is recursively + * flattened, otherwise it is only flattened a single level. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to flatten. + * @param {boolean} [isDeep] Specify a deep flatten. + * @param- {Object} [guard] Enables use as a callback for functions like `_.map`. + * @returns {Array} Returns the new flattened array. + * @example + * + * _.flatten([1, [2], [3, [[4]]]]); + * // => [1, 2, 3, [[4]]]; + * + * // using `isDeep` + * _.flatten([1, [2], [3, [[4]]]], true); + * // => [1, 2, 3, 4]; + */ + function flatten(array, isDeep, guard) { + var length = array ? array.length : 0; + if (guard && isIterateeCall(array, isDeep, guard)) { + isDeep = false; + } + return length ? baseFlatten(array, isDeep) : []; + } + + /** + * Recursively flattens a nested array. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to recursively flatten. + * @returns {Array} Returns the new flattened array. + * @example + * + * _.flattenDeep([1, [2], [3, [[4]]]]); + * // => [1, 2, 3, 4]; + */ + function flattenDeep(array) { + var length = array ? array.length : 0; + return length ? baseFlatten(array, true) : []; + } + + /** + * Gets the index at which the first occurrence of `value` is found in `array` + * using `SameValueZero` for equality comparisons. If `fromIndex` is negative, + * it is used as the offset from the end of `array`. If `array` is sorted + * providing `true` for `fromIndex` performs a faster binary search. + * + * **Note:** `SameValueZero` comparisons are like strict equality comparisons, + * e.g. `===`, except that `NaN` matches `NaN`. See the + * [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-samevaluezero) + * for more details. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to search. + * @param {*} value The value to search for. + * @param {boolean|number} [fromIndex=0] The index to search from or `true` + * to perform a binary search on a sorted array. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.indexOf([1, 2, 3, 1, 2, 3], 2); + * // => 1 + * + * // using `fromIndex` + * _.indexOf([1, 2, 3, 1, 2, 3], 2, 3); + * // => 4 + * + * // performing a binary search + * _.indexOf([4, 4, 5, 5, 6, 6], 5, true); + * // => 2 + */ + function indexOf(array, value, fromIndex) { + var length = array ? array.length : 0; + if (!length) { + return -1; + } + if (typeof fromIndex == 'number') { + fromIndex = fromIndex < 0 ? nativeMax(length + fromIndex, 0) : (fromIndex || 0); + } else if (fromIndex) { + var index = binaryIndex(array, value), + other = array[index]; + + return (value === value ? value === other : other !== other) ? index : -1; + } + return baseIndexOf(array, value, fromIndex); + } + + /** + * Gets all but the last element of `array`. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to query. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.initial([1, 2, 3]); + * // => [1, 2] + */ + function initial(array) { + return dropRight(array, 1); + } + + /** + * Creates an array of unique values in all provided arrays using `SameValueZero` + * for equality comparisons. + * + * **Note:** `SameValueZero` comparisons are like strict equality comparisons, + * e.g. `===`, except that `NaN` matches `NaN`. See the + * [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-samevaluezero) + * for more details. + * + * @static + * @memberOf _ + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of shared values. + * @example + * + * _.intersection([1, 2, 3], [5, 2, 1, 4], [2, 1]); + * // => [1, 2] + */ + function intersection() { + var args = [], + argsIndex = -1, + argsLength = arguments.length, + caches = [], + indexOf = getIndexOf(), + isCommon = indexOf == baseIndexOf; + + while (++argsIndex < argsLength) { + var value = arguments[argsIndex]; + if (isArray(value) || isArguments(value)) { + args.push(value); + caches.push(isCommon && value.length >= 120 && createCache(argsIndex && value)); + } + } + argsLength = args.length; + var array = args[0], + index = -1, + length = array ? array.length : 0, + result = [], + seen = caches[0]; + + outer: + while (++index < length) { + value = array[index]; + if ((seen ? cacheIndexOf(seen, value) : indexOf(result, value)) < 0) { + argsIndex = argsLength; + while (--argsIndex) { + var cache = caches[argsIndex]; + if ((cache ? cacheIndexOf(cache, value) : indexOf(args[argsIndex], value)) < 0) { + continue outer; + } + } + if (seen) { + seen.push(value); + } + result.push(value); + } + } + return result; + } + + /** + * Gets the last element of `array`. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to query. + * @returns {*} Returns the last element of `array`. + * @example + * + * _.last([1, 2, 3]); + * // => 3 + */ + function last(array) { + var length = array ? array.length : 0; + return length ? array[length - 1] : undefined; + } + + /** + * This method is like `_.indexOf` except that it iterates over elements of + * `array` from right to left. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to search. + * @param {*} value The value to search for. + * @param {boolean|number} [fromIndex=array.length-1] The index to search from + * or `true` to perform a binary search on a sorted array. + * @returns {number} Returns the index of the matched value, else `-1`. + * @example + * + * _.lastIndexOf([1, 2, 3, 1, 2, 3], 2); + * // => 4 + * + * // using `fromIndex` + * _.lastIndexOf([1, 2, 3, 1, 2, 3], 2, 3); + * // => 1 + * + * // performing a binary search + * _.lastIndexOf([4, 4, 5, 5, 6, 6], 5, true); + * // => 3 + */ + function lastIndexOf(array, value, fromIndex) { + var length = array ? array.length : 0; + if (!length) { + return -1; + } + var index = length; + if (typeof fromIndex == 'number') { + index = (fromIndex < 0 ? nativeMax(length + fromIndex, 0) : nativeMin(fromIndex || 0, length - 1)) + 1; + } else if (fromIndex) { + index = binaryIndex(array, value, true) - 1; + var other = array[index]; + return (value === value ? value === other : other !== other) ? index : -1; + } + if (value !== value) { + return indexOfNaN(array, index, true); + } + while (index--) { + if (array[index] === value) { + return index; + } + } + return -1; + } + + /** + * Removes all provided values from `array` using `SameValueZero` for equality + * comparisons. + * + * **Notes:** + * - Unlike `_.without`, this method mutates `array`. + * - `SameValueZero` comparisons are like strict equality comparisons, e.g. `===`, + * except that `NaN` matches `NaN`. See the [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-samevaluezero) + * for more details. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to modify. + * @param {...*} [values] The values to remove. + * @returns {Array} Returns `array`. + * @example + * + * var array = [1, 2, 3, 1, 2, 3]; + * _.pull(array, 2, 3); + * console.log(array); + * // => [1, 1] + */ + function pull() { + var array = arguments[0]; + if (!(array && array.length)) { + return array; + } + var index = 0, + indexOf = getIndexOf(), + length = arguments.length; + + while (++index < length) { + var fromIndex = 0, + value = arguments[index]; + + while ((fromIndex = indexOf(array, value, fromIndex)) > -1) { + splice.call(array, fromIndex, 1); + } + } + return array; + } + + /** + * Removes elements from `array` corresponding to the given indexes and returns + * an array of the removed elements. Indexes may be specified as an array of + * indexes or as individual arguments. + * + * **Note:** Unlike `_.at`, this method mutates `array`. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to modify. + * @param {...(number|number[])} [indexes] The indexes of elements to remove, + * specified as individual indexes or arrays of indexes. + * @returns {Array} Returns the new array of removed elements. + * @example + * + * var array = [5, 10, 15, 20]; + * var evens = _.pullAt(array, [1, 3]); + * + * console.log(array); + * // => [5, 15] + * + * console.log(evens); + * // => [10, 20] + */ + function pullAt(array) { + return basePullAt(array || [], baseFlatten(arguments, false, false, 1)); + } + + /** + * Removes all elements from `array` that `predicate` returns truthy for + * and returns an array of the removed elements. The predicate is bound to + * `thisArg` and invoked with three arguments; (value, index, array). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * **Note:** Unlike `_.filter`, this method mutates `array`. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to modify. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {Array} Returns the new array of removed elements. + * @example + * + * var array = [1, 2, 3, 4]; + * var evens = _.remove(array, function(n) { return n % 2 == 0; }); + * + * console.log(array); + * // => [1, 3] + * + * console.log(evens); + * // => [2, 4] + */ + function remove(array, predicate, thisArg) { + var index = -1, + length = array ? array.length : 0, + result = []; + + predicate = getCallback(predicate, thisArg, 3); + while (++index < length) { + var value = array[index]; + if (predicate(value, index, array)) { + result.push(value); + splice.call(array, index--, 1); + length--; + } + } + return result; + } + + /** + * Gets all but the first element of `array`. + * + * @static + * @memberOf _ + * @alias tail + * @category Array + * @param {Array} array The array to query. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.rest([1, 2, 3]); + * // => [2, 3] + */ + function rest(array) { + return drop(array, 1); + } + + /** + * Creates a slice of `array` from `start` up to, but not including, `end`. + * + * **Note:** This function is used instead of `Array#slice` to support node + * lists in IE < 9 and to ensure dense arrays are returned. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to slice. + * @param {number} [start=0] The start position. + * @param {number} [end=array.length] The end position. + * @returns {Array} Returns the slice of `array`. + */ + function slice(array, start, end) { + var length = array ? array.length : 0; + if (!length) { + return []; + } + if (end && typeof end != 'number' && isIterateeCall(array, start, end)) { + start = 0; + end = length; + } + return baseSlice(array, start, end); + } + + /** + * Uses a binary search to determine the lowest index at which `value` should + * be inserted into `array` in order to maintain its sort order. If an iteratee + * function is provided it is invoked for `value` and each element of `array` + * to compute their sort ranking. The iteratee is bound to `thisArg` and + * invoked with one argument; (value). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function|Object|string} [iteratee=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * _.sortedIndex([30, 50], 40); + * // => 1 + * + * _.sortedIndex([4, 4, 5, 5, 6, 6], 5); + * // => 2 + * + * var dict = { 'data': { 'thirty': 30, 'forty': 40, 'fifty': 50 } }; + * + * // using an iteratee function + * _.sortedIndex(['thirty', 'fifty'], 'forty', function(word) { + * return this.data[word]; + * }, dict); + * // => 1 + * + * // using the "_.property" callback shorthand + * _.sortedIndex([{ 'x': 30 }, { 'x': 50 }], { 'x': 40 }, 'x'); + * // => 1 + */ + function sortedIndex(array, value, iteratee, thisArg) { + var func = getCallback(iteratee); + return (func === baseCallback && iteratee == null) + ? binaryIndex(array, value) + : binaryIndexBy(array, value, func(iteratee, thisArg, 1)); + } + + /** + * This method is like `_.sortedIndex` except that it returns the highest + * index at which `value` should be inserted into `array` in order to + * maintain its sort order. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The sorted array to inspect. + * @param {*} value The value to evaluate. + * @param {Function|Object|string} [iteratee=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {number} Returns the index at which `value` should be inserted + * into `array`. + * @example + * + * _.sortedLastIndex([4, 4, 5, 5, 6, 6], 5); + * // => 4 + */ + function sortedLastIndex(array, value, iteratee, thisArg) { + var func = getCallback(iteratee); + return (func === baseCallback && iteratee == null) + ? binaryIndex(array, value, true) + : binaryIndexBy(array, value, func(iteratee, thisArg, 1), true); + } + + /** + * Creates a slice of `array` with `n` elements taken from the beginning. + * + * @static + * @memberOf _ + * @type Function + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to take. + * @param- {Object} [guard] Enables use as a callback for functions like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.take([1, 2, 3]); + * // => [1] + * + * _.take([1, 2, 3], 2); + * // => [1, 2] + * + * _.take([1, 2, 3], 5); + * // => [1, 2, 3] + * + * _.take([1, 2, 3], 0); + * // => [] + */ + function take(array, n, guard) { + var length = array ? array.length : 0; + if (!length) { + return []; + } + if (guard ? isIterateeCall(array, n, guard) : n == null) { + n = 1; + } + return baseSlice(array, 0, n < 0 ? 0 : n); + } + + /** + * Creates a slice of `array` with `n` elements taken from the end. + * + * @static + * @memberOf _ + * @type Function + * @category Array + * @param {Array} array The array to query. + * @param {number} [n=1] The number of elements to take. + * @param- {Object} [guard] Enables use as a callback for functions like `_.map`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.takeRight([1, 2, 3]); + * // => [3] + * + * _.takeRight([1, 2, 3], 2); + * // => [2, 3] + * + * _.takeRight([1, 2, 3], 5); + * // => [1, 2, 3] + * + * _.takeRight([1, 2, 3], 0); + * // => [] + */ + function takeRight(array, n, guard) { + var length = array ? array.length : 0; + if (!length) { + return []; + } + if (guard ? isIterateeCall(array, n, guard) : n == null) { + n = 1; + } + n = length - (+n || 0); + return baseSlice(array, n < 0 ? 0 : n); + } + + /** + * Creates a slice of `array` with elements taken from the end. Elements are + * taken until `predicate` returns falsey. The predicate is bound to `thisArg` + * and invoked with three arguments; (value, index, array). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @type Function + * @category Array + * @param {Array} array The array to query. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per element. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.takeRightWhile([1, 2, 3], function(n) { return n > 1; }); + * // => [2, 3] + * + * var users = [ + * { 'user': 'barney', 'status': 'busy', 'active': false }, + * { 'user': 'fred', 'status': 'busy', 'active': true }, + * { 'user': 'pebbles', 'status': 'away', 'active': true } + * ]; + * + * // using the "_.property" callback shorthand + * _.pluck(_.takeRightWhile(users, 'active'), 'user'); + * // => ['fred', 'pebbles'] + * + * // using the "_.matches" callback shorthand + * _.pluck(_.takeRightWhile(users, { 'status': 'away' }), 'user'); + * // => ['pebbles'] + */ + function takeRightWhile(array, predicate, thisArg) { + var length = array ? array.length : 0; + if (!length) { + return []; + } + predicate = getCallback(predicate, thisArg, 3); + while (length-- && predicate(array[length], length, array)) {} + return baseSlice(array, length + 1); + } + + /** + * Creates a slice of `array` with elements taken from the beginning. Elements + * are taken until `predicate` returns falsey. The predicate is bound to + * `thisArg` and invoked with three arguments; (value, index, array). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @type Function + * @category Array + * @param {Array} array The array to query. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per element. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {Array} Returns the slice of `array`. + * @example + * + * _.takeWhile([1, 2, 3], function(n) { return n < 3; }); + * // => [1, 2] + * + * var users = [ + * { 'user': 'barney', 'status': 'busy', 'active': true }, + * { 'user': 'fred', 'status': 'busy', 'active': false }, + * { 'user': 'pebbles', 'status': 'away', 'active': true } + * ]; + * + * // using the "_.property" callback shorthand + * _.pluck(_.takeWhile(users, 'active'), 'user'); + * // => ['barney'] + * + * // using the "_.matches" callback shorthand + * _.pluck(_.takeWhile(users, { 'status': 'busy' }), 'user'); + * // => ['barney', 'fred'] + */ + function takeWhile(array, predicate, thisArg) { + var length = array ? array.length : 0; + if (!length) { + return []; + } + var index = -1; + predicate = getCallback(predicate, thisArg, 3); + while (++index < length && predicate(array[index], index, array)) {} + return baseSlice(array, 0, index); + } + + /** + * Creates an array of unique values, in order, of the provided arrays using + * `SameValueZero` for equality comparisons. + * + * **Note:** `SameValueZero` comparisons are like strict equality comparisons, + * e.g. `===`, except that `NaN` matches `NaN`. See the + * [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-samevaluezero) + * for more details. + * + * @static + * @memberOf _ + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of combined values. + * @example + * + * _.union([1, 2, 3], [5, 2, 1, 4], [2, 1]); + * // => [1, 2, 3, 5, 4] + */ + function union() { + return baseUniq(baseFlatten(arguments, false, true)); + } + + /** + * Creates a duplicate-value-free version of an array using `SameValueZero` + * for equality comparisons. Providing `true` for `isSorted` performs a faster + * search algorithm for sorted arrays. If an iteratee function is provided it + * is invoked for each value in the array to generate the criterion by which + * uniqueness is computed. The `iteratee` is bound to `thisArg` and invoked + * with three arguments; (value, index, array). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * **Note:** `SameValueZero` comparisons are like strict equality comparisons, + * e.g. `===`, except that `NaN` matches `NaN`. See the + * [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-samevaluezero) + * for more details. + * + * @static + * @memberOf _ + * @alias unique + * @category Array + * @param {Array} array The array to inspect. + * @param {boolean} [isSorted] Specify the array is sorted. + * @param {Function|Object|string} [iteratee] The function invoked per iteration. + * If a property name or object is provided it is used to create a "_.property" + * or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {Array} Returns the new duplicate-value-free array. + * @example + * + * _.uniq([1, 2, 1]); + * // => [1, 2] + * + * // using `isSorted` + * _.uniq([1, 1, 2], true); + * // => [1, 2] + * + * // using an iteratee function + * _.uniq([1, 2.5, 1.5, 2], function(n) { return this.floor(n); }, Math); + * // => [1, 2.5] + * + * // using the "_.property" callback shorthand + * _.uniq([{ 'x': 1 }, { 'x': 2 }, { 'x': 1 }], 'x'); + * // => [{ 'x': 1 }, { 'x': 2 }] + */ + function uniq(array, isSorted, iteratee, thisArg) { + var length = array ? array.length : 0; + if (!length) { + return []; + } + // Juggle arguments. + if (typeof isSorted != 'boolean' && isSorted != null) { + thisArg = iteratee; + iteratee = isIterateeCall(array, isSorted, thisArg) ? null : isSorted; + isSorted = false; + } + var func = getCallback(); + if (!(func === baseCallback && iteratee == null)) { + iteratee = func(iteratee, thisArg, 3); + } + return (isSorted && getIndexOf() == baseIndexOf) + ? sortedUniq(array, iteratee) + : baseUniq(array, iteratee); + } + + /** + * This method is like `_.zip` except that it accepts an array of grouped + * elements and creates an array regrouping the elements to their pre-`_.zip` + * configuration. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array of grouped elements to process. + * @returns {Array} Returns the new array of regrouped elements. + * @example + * + * var zipped = _.zip(['fred', 'barney'], [30, 40], [true, false]); + * // => [['fred', 30, true], ['barney', 40, false]] + * + * _.unzip(zipped); + * // => [['fred', 'barney'], [30, 40], [true, false]] + */ + function unzip(array) { + var index = -1, + length = (array && array.length && arrayMax(arrayMap(array, getLength))) >>> 0, + result = Array(length); + + while (++index < length) { + result[index] = arrayMap(array, baseProperty(index)); + } + return result; + } + + /** + * Creates an array excluding all provided values using `SameValueZero` for + * equality comparisons. + * + * **Note:** `SameValueZero` comparisons are like strict equality comparisons, + * e.g. `===`, except that `NaN` matches `NaN`. See the + * [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-samevaluezero) + * for more details. + * + * @static + * @memberOf _ + * @category Array + * @param {Array} array The array to filter. + * @param {...*} [values] The values to exclude. + * @returns {Array} Returns the new array of filtered values. + * @example + * + * _.without([1, 2, 1, 0, 3, 1, 4], 0, 1); + * // => [2, 3, 4] + */ + function without(array) { + return baseDifference(array, baseSlice(arguments, 1)); + } + + /** + * Creates an array that is the symmetric difference of the provided arrays. + * See [Wikipedia](https://en.wikipedia.org/wiki/Symmetric_difference) for + * more details. + * + * @static + * @memberOf _ + * @category Array + * @param {...Array} [arrays] The arrays to inspect. + * @returns {Array} Returns the new array of values. + * @example + * + * _.xor([1, 2, 3], [5, 2, 1, 4]); + * // => [3, 5, 4] + * + * _.xor([1, 2, 5], [2, 3, 5], [3, 4, 5]); + * // => [1, 4, 5] + */ + function xor() { + var index = -1, + length = arguments.length; + + while (++index < length) { + var array = arguments[index]; + if (isArray(array) || isArguments(array)) { + var result = result + ? baseDifference(result, array).concat(baseDifference(array, result)) + : array; + } + } + return result ? baseUniq(result) : []; + } + + /** + * Creates an array of grouped elements, the first of which contains the first + * elements of the given arrays, the second of which contains the second elements + * of the given arrays, and so on. + * + * @static + * @memberOf _ + * @category Array + * @param {...Array} [arrays] The arrays to process. + * @returns {Array} Returns the new array of grouped elements. + * @example + * + * _.zip(['fred', 'barney'], [30, 40], [true, false]); + * // => [['fred', 30, true], ['barney', 40, false]] + */ + function zip() { + var length = arguments.length, + array = Array(length); + + while (length--) { + array[length] = arguments[length]; + } + return unzip(array); + } + + /** + * Creates an object composed from arrays of property names and values. Provide + * either a single two dimensional array, e.g. `[[key1, value1], [key2, value2]]` + * or two arrays, one of property names and one of corresponding values. + * + * @static + * @memberOf _ + * @alias object + * @category Array + * @param {Array} props The property names. + * @param {Array} [values=[]] The property values. + * @returns {Object} Returns the new object. + * @example + * + * _.zipObject(['fred', 'barney'], [30, 40]); + * // => { 'fred': 30, 'barney': 40 } + */ + function zipObject(props, values) { + var index = -1, + length = props ? props.length : 0, + result = {}; + + if (length && !values && !isArray(props[0])) { + values = []; + } + while (++index < length) { + var key = props[index]; + if (values) { + result[key] = values[index]; + } else if (key) { + result[key[0]] = key[1]; + } + } + return result; + } + + /*------------------------------------------------------------------------*/ + + /** + * Creates a `lodash` object that wraps `value` with explicit method + * chaining enabled. + * + * @static + * @memberOf _ + * @category Chain + * @param {*} value The value to wrap. + * @returns {Object} Returns the new `lodash` object. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'pebbles', 'age': 1 } + * ]; + * + * var youngest = _.chain(users) + * .sortBy('age') + * .map(function(chr) { return chr.user + ' is ' + chr.age; }) + * .first() + * .value(); + * // => 'pebbles is 1' + */ + function chain(value) { + var result = lodash(value); + result.__chain__ = true; + return result; + } + + /** + * This method invokes `interceptor` and returns `value`. The interceptor is + * bound to `thisArg` and invoked with one argument; (value). The purpose of + * this method is to "tap into" a method chain in order to perform operations + * on intermediate results within the chain. + * + * @static + * @memberOf _ + * @category Chain + * @param {*} value The value to provide to `interceptor`. + * @param {Function} interceptor The function to invoke. + * @param {*} [thisArg] The `this` binding of `interceptor`. + * @returns {*} Returns `value`. + * @example + * + * _([1, 2, 3]) + * .tap(function(array) { array.pop(); }) + * .reverse() + * .value(); + * // => [2, 1] + */ + function tap(value, interceptor, thisArg) { + interceptor.call(thisArg, value); + return value; + } + + /** + * This method is like `_.tap` except that it returns the result of `interceptor`. + * + * @static + * @memberOf _ + * @category Chain + * @param {*} value The value to provide to `interceptor`. + * @param {Function} interceptor The function to invoke. + * @param {*} [thisArg] The `this` binding of `interceptor`. + * @returns {*} Returns the result of `interceptor`. + * @example + * + * _([1, 2, 3]) + * .last() + * .thru(function(value) { return [value]; }) + * .value(); + * // => [3] + */ + function thru(value, interceptor, thisArg) { + return interceptor.call(thisArg, value); + } + + /** + * Enables explicit method chaining on the wrapper object. + * + * @name chain + * @memberOf _ + * @category Chain + * @returns {*} Returns the `lodash` object. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 } + * ]; + * + * // without explicit chaining + * _(users).first(); + * // => { 'user': 'barney', 'age': 36 } + * + * // with explicit chaining + * _(users).chain() + * .first() + * .pick('user') + * .value(); + * // => { 'user': 'barney' } + */ + function wrapperChain() { + return chain(this); + } + + /** + * Reverses the wrapped array so the first element becomes the last, the + * second element becomes the second to last, and so on. + * + * **Note:** This method mutates the wrapped array. + * + * @name reverse + * @memberOf _ + * @category Chain + * @returns {Object} Returns the new reversed `lodash` object. + * @example + * + * var array = [1, 2, 3]; + * + * _(array).reverse().value() + * // => [3, 2, 1] + * + * console.log(array); + * // => [3, 2, 1] + */ + function wrapperReverse() { + var value = this.__wrapped__; + if (value instanceof LazyWrapper) { + if (this.__actions__.length) { + value = new LazyWrapper(this); + } + return new LodashWrapper(value.reverse()); + } + return this.thru(function(value) { + return value.reverse(); + }); + } + + /** + * Produces the result of coercing the unwrapped value to a string. + * + * @name toString + * @memberOf _ + * @category Chain + * @returns {string} Returns the coerced string value. + * @example + * + * _([1, 2, 3]).toString(); + * // => '1,2,3' + */ + function wrapperToString() { + return (this.value() + ''); + } + + /** + * Executes the chained sequence to extract the unwrapped value. + * + * @name value + * @memberOf _ + * @alias toJSON, valueOf + * @category Chain + * @returns {*} Returns the resolved unwrapped value. + * @example + * + * _([1, 2, 3]).value(); + * // => [1, 2, 3] + */ + function wrapperValue() { + return baseWrapperValue(this.__wrapped__, this.__actions__); + } + + /*------------------------------------------------------------------------*/ + + /** + * Creates an array of elements corresponding to the given keys, or indexes, + * of `collection`. Keys may be specified as individual arguments or as arrays + * of keys. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {...(number|number[]|string|string[])} [props] The property names + * or indexes of elements to pick, specified individually or in arrays. + * @returns {Array} Returns the new array of picked elements. + * @example + * + * _.at(['a', 'b', 'c', 'd', 'e'], [0, 2, 4]); + * // => ['a', 'c', 'e'] + * + * _.at(['fred', 'barney', 'pebbles'], 0, 2); + * // => ['fred', 'pebbles'] + */ + function at(collection) { + var length = collection ? collection.length : 0; + if (isLength(length)) { + collection = toIterable(collection); + } + return baseAt(collection, baseFlatten(arguments, false, false, 1)); + } + + /** + * Checks if `value` is in `collection` using `SameValueZero` for equality + * comparisons. If `fromIndex` is negative, it is used as the offset from + * the end of `collection`. + * + * **Note:** `SameValueZero` comparisons are like strict equality comparisons, + * e.g. `===`, except that `NaN` matches `NaN`. See the + * [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-samevaluezero) + * for more details. + * + * @static + * @memberOf _ + * @alias contains, include + * @category Collection + * @param {Array|Object|string} collection The collection to search. + * @param {*} target The value to search for. + * @param {number} [fromIndex=0] The index to search from. + * @returns {boolean} Returns `true` if a matching element is found, else `false`. + * @example + * + * _.includes([1, 2, 3], 1); + * // => true + * + * _.includes([1, 2, 3], 1, 2); + * // => false + * + * _.includes({ 'user': 'fred', 'age': 40 }, 'fred'); + * // => true + * + * _.includes('pebbles', 'eb'); + * // => true + */ + function includes(collection, target, fromIndex) { + var length = collection ? collection.length : 0; + if (!isLength(length)) { + collection = values(collection); + length = collection.length; + } + if (!length) { + return false; + } + if (typeof fromIndex == 'number') { + fromIndex = fromIndex < 0 ? nativeMax(length + fromIndex, 0) : (fromIndex || 0); + } else { + fromIndex = 0; + } + return (typeof collection == 'string' || !isArray(collection) && isString(collection)) + ? (fromIndex < length && collection.indexOf(target, fromIndex) > -1) + : (getIndexOf(collection, target, fromIndex) > -1); + } + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` through `iteratee`. The corresponding value + * of each key is the number of times the key was returned by `iteratee`. + * The `iteratee` is bound to `thisArg` and invoked with three arguments; + * (value, index|key, collection). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function|Object|string} [iteratee=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * _.countBy([4.3, 6.1, 6.4], function(n) { return Math.floor(n); }); + * // => { '4': 1, '6': 2 } + * + * _.countBy([4.3, 6.1, 6.4], function(n) { return this.floor(n); }, Math); + * // => { '4': 1, '6': 2 } + * + * _.countBy(['one', 'two', 'three'], 'length'); + * // => { '3': 2, '5': 1 } + */ + var countBy = createAggregator(function(result, value, key) { + hasOwnProperty.call(result, key) ? ++result[key] : (result[key] = 1); + }); + + /** + * Checks if `predicate` returns truthy for **all** elements of `collection`. + * The predicate is bound to `thisArg` and invoked with three arguments; + * (value, index|key, collection). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @alias all + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {boolean} Returns `true` if all elements pass the predicate check, + * else `false`. + * @example + * + * _.every([true, 1, null, 'yes']); + * // => false + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 } + * ]; + * + * // using the "_.property" callback shorthand + * _.every(users, 'age'); + * // => true + * + * // using the "_.matches" callback shorthand + * _.every(users, { 'age': 36 }); + * // => false + */ + function every(collection, predicate, thisArg) { + var func = isArray(collection) ? arrayEvery : baseEvery; + if (typeof predicate != 'function' || typeof thisArg != 'undefined') { + predicate = getCallback(predicate, thisArg, 3); + } + return func(collection, predicate); + } + + /** + * Iterates over elements of `collection`, returning an array of all elements + * `predicate` returns truthy for. The predicate is bound to `thisArg` and + * invoked with three arguments; (value, index|key, collection). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @alias select + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {Array} Returns the new filtered array. + * @example + * + * var evens = _.filter([1, 2, 3, 4], function(n) { return n % 2 == 0; }); + * // => [2, 4] + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true } + * ]; + * + * // using the "_.property" callback shorthand + * _.pluck(_.filter(users, 'active'), 'user'); + * // => ['fred'] + * + * // using the "_.matches" callback shorthand + * _.pluck(_.filter(users, { 'age': 36 }), 'user'); + * // => ['barney'] + */ + function filter(collection, predicate, thisArg) { + var func = isArray(collection) ? arrayFilter : baseFilter; + predicate = getCallback(predicate, thisArg, 3); + return func(collection, predicate); + } + + /** + * Iterates over elements of `collection`, returning the first element + * `predicate` returns truthy for. The predicate is bound to `thisArg` and + * invoked with three arguments; (value, index|key, collection). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @alias detect + * @category Collection + * @param {Array|Object|string} collection The collection to search. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {*} Returns the matched element, else `undefined`. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true }, + * { 'user': 'pebbles', 'age': 1, 'active': false } + * ]; + * + * _.result(_.find(users, function(chr) { return chr.age < 40; }), 'user'); + * // => 'barney' + * + * // using the "_.matches" callback shorthand + * _.result(_.find(users, { 'age': 1 }), 'user'); + * // => 'pebbles' + * + * // using the "_.property" callback shorthand + * _.result(_.find(users, 'active'), 'user'); + * // => 'fred' + */ + function find(collection, predicate, thisArg) { + if (isArray(collection)) { + var index = findIndex(collection, predicate, thisArg); + return index > -1 ? collection[index] : undefined; + } + predicate = getCallback(predicate, thisArg, 3); + return baseFind(collection, predicate, baseEach); + } + + /** + * This method is like `_.find` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to search. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {*} Returns the matched element, else `undefined`. + * @example + * + * _.findLast([1, 2, 3, 4], function(n) { return n % 2 == 1; }); + * // => 3 + */ + function findLast(collection, predicate, thisArg) { + predicate = getCallback(predicate, thisArg, 3); + return baseFind(collection, predicate, baseEachRight); + } + + /** + * Performs a deep comparison between each element in `collection` and the + * source object, returning the first element that has equivalent property + * values. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to search. + * @param {Object} source The object of property values to match. + * @returns {*} Returns the matched element, else `undefined`. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'status': 'busy' }, + * { 'user': 'fred', 'age': 40, 'status': 'busy' } + * ]; + * + * _.result(_.findWhere(users, { 'status': 'busy' }), 'user'); + * // => 'barney' + * + * _.result(_.findWhere(users, { 'age': 40 }), 'user'); + * // => 'fred' + */ + function findWhere(collection, source) { + return find(collection, baseMatches(source)); + } + + /** + * Iterates over elements of `collection` invoking `iteratee` for each element. + * The `iteratee` is bound to `thisArg` and invoked with three arguments; + * (value, index|key, collection). Iterator functions may exit iteration early + * by explicitly returning `false`. + * + * **Note:** As with other "Collections" methods, objects with a `length` property + * are iterated like arrays. To avoid this behavior `_.forIn` or `_.forOwn` + * may be used for object iteration. + * + * @static + * @memberOf _ + * @alias each + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {Array|Object|string} Returns `collection`. + * @example + * + * _([1, 2, 3]).forEach(function(n) { console.log(n); }).value(); + * // => logs each value from left to right and returns the array + * + * _.forEach({ 'one': 1, 'two': 2, 'three': 3 }, function(n, key) { console.log(n, key); }); + * // => logs each value-key pair and returns the object (iteration order is not guaranteed) + */ + function forEach(collection, iteratee, thisArg) { + return (typeof iteratee == 'function' && typeof thisArg == 'undefined' && isArray(collection)) + ? arrayEach(collection, iteratee) + : baseEach(collection, bindCallback(iteratee, thisArg, 3)); + } + + /** + * This method is like `_.forEach` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @alias eachRight + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {Array|Object|string} Returns `collection`. + * @example + * + * _([1, 2, 3]).forEachRight(function(n) { console.log(n); }).join(','); + * // => logs each value from right to left and returns the array + */ + function forEachRight(collection, iteratee, thisArg) { + return (typeof iteratee == 'function' && typeof thisArg == 'undefined' && isArray(collection)) + ? arrayEachRight(collection, iteratee) + : baseEachRight(collection, bindCallback(iteratee, thisArg, 3)); + } + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` through `iteratee`. The corresponding value + * of each key is an array of the elements responsible for generating the key. + * The `iteratee` is bound to `thisArg` and invoked with three arguments; + * (value, index|key, collection). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function|Object|string} [iteratee=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * _.groupBy([4.2, 6.1, 6.4], function(n) { return Math.floor(n); }); + * // => { '4': [4.2], '6': [6.1, 6.4] } + * + * _.groupBy([4.2, 6.1, 6.4], function(n) { return this.floor(n); }, Math); + * // => { '4': [4.2], '6': [6.1, 6.4] } + * + * // using the "_.property" callback shorthand + * _.groupBy(['one', 'two', 'three'], 'length'); + * // => { '3': ['one', 'two'], '5': ['three'] } + */ + var groupBy = createAggregator(function(result, value, key) { + if (hasOwnProperty.call(result, key)) { + result[key].push(value); + } else { + result[key] = [value]; + } + }); + + /** + * Creates an object composed of keys generated from the results of running + * each element of `collection` through `iteratee`. The corresponding value + * of each key is the last element responsible for generating the key. The + * iteratee function is bound to `thisArg` and invoked with three arguments; + * (value, index|key, collection). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function|Object|string} [iteratee=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {Object} Returns the composed aggregate object. + * @example + * + * var keyData = [ + * { 'dir': 'left', 'code': 97 }, + * { 'dir': 'right', 'code': 100 } + * ]; + * + * _.indexBy(keyData, 'dir'); + * // => { 'left': { 'dir': 'left', 'code': 97 }, 'right': { 'dir': 'right', 'code': 100 } } + * + * _.indexBy(keyData, function(object) { return String.fromCharCode(object.code); }); + * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } + * + * _.indexBy(keyData, function(object) { return this.fromCharCode(object.code); }, String); + * // => { 'a': { 'dir': 'left', 'code': 97 }, 'd': { 'dir': 'right', 'code': 100 } } + */ + var indexBy = createAggregator(function(result, value, key) { + result[key] = value; + }); + + /** + * Invokes the method named by `methodName` on each element in `collection`, + * returning an array of the results of each invoked method. Any additional + * arguments are provided to each invoked method. If `methodName` is a function + * it is invoked for, and `this` bound to, each element in `collection`. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function|string} methodName The name of the method to invoke or + * the function invoked per iteration. + * @param {...*} [args] The arguments to invoke the method with. + * @returns {Array} Returns the array of results. + * @example + * + * _.invoke([[5, 1, 7], [3, 2, 1]], 'sort'); + * // => [[1, 5, 7], [1, 2, 3]] + * + * _.invoke([123, 456], String.prototype.split, ''); + * // => [['1', '2', '3'], ['4', '5', '6']] + */ + function invoke(collection, methodName) { + return baseInvoke(collection, methodName, baseSlice(arguments, 2)); + } + + /** + * Creates an array of values by running each element in `collection` through + * `iteratee`. The `iteratee` is bound to `thisArg` and invoked with three + * arguments; (value, index|key, collection). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @alias collect + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function|Object|string} [iteratee=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {Array} Returns the new mapped array. + * @example + * + * _.map([1, 2, 3], function(n) { return n * 3; }); + * // => [3, 6, 9] + * + * _.map({ 'one': 1, 'two': 2, 'three': 3 }, function(n) { return n * 3; }); + * // => [3, 6, 9] (iteration order is not guaranteed) + * + * var users = [ + * { 'user': 'barney' }, + * { 'user': 'fred' } + * ]; + * + * // using the "_.property" callback shorthand + * _.map(users, 'user'); + * // => ['barney', 'fred'] + */ + function map(collection, iteratee, thisArg) { + var func = isArray(collection) ? arrayMap : baseMap; + iteratee = getCallback(iteratee, thisArg, 3); + return func(collection, iteratee); + } + + /** + * Gets the maximum value of `collection`. If `collection` is empty or falsey + * `-Infinity` is returned. If an iteratee function is provided it is invoked + * for each value in `collection` to generate the criterion by which the value + * is ranked. The `iteratee` is bound to `thisArg` and invoked with three + * arguments; (value, index, collection). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function|Object|string} [iteratee] The function invoked per iteration. + * If a property name or object is provided it is used to create a "_.property" + * or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {*} Returns the maximum value. + * @example + * + * _.max([4, 2, 8, 6]); + * // => 8 + * + * _.max([]); + * // => -Infinity + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 } + * ]; + * + * _.max(users, function(chr) { return chr.age; }); + * // => { 'user': 'fred', 'age': 40 }; + * + * // using the "_.property" callback shorthand + * _.max(users, 'age'); + * // => { 'user': 'fred', 'age': 40 }; + */ + var max = createExtremum(arrayMax); + + /** + * Gets the minimum value of `collection`. If `collection` is empty or falsey + * `Infinity` is returned. If an iteratee function is provided it is invoked + * for each value in `collection` to generate the criterion by which the value + * is ranked. The `iteratee` is bound to `thisArg` and invoked with three + * arguments; (value, index, collection). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function|Object|string} [iteratee] The function invoked per iteration. + * If a property name or object is provided it is used to create a "_.property" + * or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {*} Returns the minimum value. + * @example + * + * _.min([4, 2, 8, 6]); + * // => 2 + * + * _.min([]); + * // => Infinity + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 } + * ]; + * + * _.min(users, function(chr) { return chr.age; }); + * // => { 'user': 'barney', 'age': 36 }; + * + * // using the "_.property" callback shorthand + * _.min(users, 'age'); + * // => { 'user': 'barney', 'age': 36 }; + */ + var min = createExtremum(arrayMin, true); + + /** + * Creates an array of elements split into two groups, the first of which + * contains elements `predicate` returns truthy for, while the second of which + * contains elements `predicate` returns falsey for. The predicate is bound + * to `thisArg` and invoked with three arguments; (value, index|key, collection). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {Array} Returns the array of grouped elements. + * @example + * + * _.partition([1, 2, 3], function(n) { return n % 2; }); + * // => [[1, 3], [2]] + * + * _.partition([1.2, 2.3, 3.4], function(n) { return this.floor(n) % 2; }, Math); + * // => [[1, 3], [2]] + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true }, + * { 'user': 'pebbles', 'age': 1, 'active': false } + * ]; + * + * // using the "_.matches" callback shorthand + * _.map(_.partition(users, { 'age': 1 }), function(array) { return _.pluck(array, 'user'); }); + * // => [['pebbles'], ['barney', 'fred']] + * + * // using the "_.property" callback shorthand + * _.map(_.partition(users, 'active'), function(array) { return _.pluck(array, 'user'); }); + * // => [['fred'], ['barney', 'pebbles']] + */ + var partition = createAggregator(function(result, value, key) { + result[key ? 0 : 1].push(value); + }, function() { return [[], []]; }); + + /** + * Gets the value of `key` from all elements in `collection`. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {string} key The key of the property to pluck. + * @returns {Array} Returns the property values. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 } + * ]; + * + * _.pluck(users, 'user'); + * // => ['barney', 'fred'] + * + * var userIndex = _.indexBy(users, 'user'); + * _.pluck(userIndex, 'age'); + * // => [36, 40] (iteration order is not guaranteed) + */ + function pluck(collection, key) { + return map(collection, baseProperty(key + '')); + } + + /** + * Reduces `collection` to a value which is the accumulated result of running + * each element in `collection` through `iteratee`, where each successive + * invocation is supplied the return value of the previous. If `accumulator` + * is not provided the first element of `collection` is used as the initial + * value. The `iteratee` is bound to `thisArg`and invoked with four arguments; + * (accumulator, value, index|key, collection). + * + * @static + * @memberOf _ + * @alias foldl, inject + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {*} Returns the accumulated value. + * @example + * + * var sum = _.reduce([1, 2, 3], function(sum, n) { return sum + n; }); + * // => 6 + * + * var mapped = _.reduce({ 'a': 1, 'b': 2, 'c': 3 }, function(result, n, key) { + * result[key] = n * 3; + * return result; + * }, {}); + * // => { 'a': 3, 'b': 6, 'c': 9 } (iteration order is not guaranteed) + */ + function reduce(collection, iteratee, accumulator, thisArg) { + var func = isArray(collection) ? arrayReduce : baseReduce; + return func(collection, getCallback(iteratee, thisArg, 4), accumulator, arguments.length < 3, baseEach); + } + + /** + * This method is like `_.reduce` except that it iterates over elements of + * `collection` from right to left. + * + * @static + * @memberOf _ + * @alias foldr + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The initial value. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {*} Returns the accumulated value. + * @example + * + * var array = [[0, 1], [2, 3], [4, 5]]; + * _.reduceRight(array, function(flattened, other) { return flattened.concat(other); }, []); + * // => [4, 5, 2, 3, 0, 1] + */ + function reduceRight(collection, iteratee, accumulator, thisArg) { + var func = isArray(collection) ? arrayReduceRight : baseReduce; + return func(collection, getCallback(iteratee, thisArg, 4), accumulator, arguments.length < 3, baseEachRight); + } + + /** + * The opposite of `_.filter`; this method returns the elements of `collection` + * that `predicate` does **not** return truthy for. + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {Array} Returns the new filtered array. + * @example + * + * var odds = _.reject([1, 2, 3, 4], function(n) { return n % 2 == 0; }); + * // => [1, 3] + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true } + * ]; + * + * // using the "_.property" callback shorthand + * _.pluck(_.reject(users, 'active'), 'user'); + * // => ['barney'] + * + * // using the "_.matches" callback shorthand + * _.pluck(_.reject(users, { 'age': 36 }), 'user'); + * // => ['fred'] + */ + function reject(collection, predicate, thisArg) { + var func = isArray(collection) ? arrayFilter : baseFilter; + predicate = getCallback(predicate, thisArg, 3); + return func(collection, function(value, index, collection) { + return !predicate(value, index, collection); + }); + } + + /** + * Gets a random element or `n` random elements from a collection. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to sample. + * @param {number} [n] The number of elements to sample. + * @param- {Object} [guard] Enables use as a callback for functions like `_.map`. + * @returns {*} Returns the random sample(s). + * @example + * + * _.sample([1, 2, 3, 4]); + * // => 2 + * + * _.sample([1, 2, 3, 4], 2); + * // => [3, 1] + */ + function sample(collection, n, guard) { + if (guard ? isIterateeCall(collection, n, guard) : n == null) { + collection = toIterable(collection); + var length = collection.length; + return length > 0 ? collection[baseRandom(0, length - 1)] : undefined; + } + var result = shuffle(collection); + result.length = nativeMin(n < 0 ? 0 : (+n || 0), result.length); + return result; + } + + /** + * Creates an array of shuffled values, using a version of the Fisher-Yates + * shuffle. See [Wikipedia](https://en.wikipedia.org/wiki/Fisher-Yates_shuffle) + * for more details. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to shuffle. + * @returns {Array} Returns the new shuffled array. + * @example + * + * _.shuffle([1, 2, 3, 4]); + * // => [4, 1, 3, 2] + */ + function shuffle(collection) { + collection = toIterable(collection); + + var index = -1, + length = collection.length, + result = Array(length); + + while (++index < length) { + var rand = baseRandom(0, index); + if (index != rand) { + result[index] = result[rand]; + } + result[rand] = collection[index]; + } + return result; + } + + /** + * Gets the size of `collection` by returning `collection.length` for + * array-like values or the number of own enumerable properties for objects. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to inspect. + * @returns {number} Returns the size of `collection`. + * @example + * + * _.size([1, 2]); + * // => 2 + * + * _.size({ 'one': 1, 'two': 2, 'three': 3 }); + * // => 3 + * + * _.size('pebbles'); + * // => 7 + */ + function size(collection) { + var length = collection ? collection.length : 0; + return isLength(length) ? length : keys(collection).length; + } + + /** + * Checks if `predicate` returns truthy for **any** element of `collection`. + * The function returns as soon as it finds a passing value and does not iterate + * over the entire collection. The predicate is bound to `thisArg` and invoked + * with three arguments; (value, index|key, collection). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @alias any + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {boolean} Returns `true` if any element passes the predicate check, + * else `false`. + * @example + * + * _.some([null, 0, 'yes', false], Boolean); + * // => true + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'active': false }, + * { 'user': 'fred', 'age': 40, 'active': true } + * ]; + * + * // using the "_.property" callback shorthand + * _.some(users, 'active'); + * // => true + * + * // using the "_.matches" callback shorthand + * _.some(users, { 'age': 1 }); + * // => false + */ + function some(collection, predicate, thisArg) { + var func = isArray(collection) ? arraySome : baseSome; + if (typeof predicate != 'function' || typeof thisArg != 'undefined') { + predicate = getCallback(predicate, thisArg, 3); + } + return func(collection, predicate); + } + + /** + * Creates an array of elements, sorted in ascending order by the results of + * running each element in a collection through `iteratee`. This method performs + * a stable sort, that is, it preserves the original sort order of equal elements. + * The `iteratee` is bound to `thisArg` and invoked with three arguments; + * (value, index|key, collection). + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {Array|Function|Object|string} [iteratee=_.identity] The function + * invoked per iteration. If a property name or an object is provided it is + * used to create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {Array} Returns the new sorted array. + * @example + * + * _.sortBy([1, 2, 3], function(n) { return Math.sin(n); }); + * // => [3, 1, 2] + * + * _.sortBy([1, 2, 3], function(n) { return this.sin(n); }, Math); + * // => [3, 1, 2] + * + * var users = [ + * { 'user': 'fred' }, + * { 'user': 'pebbles' }, + * { 'user': 'barney' } + * ]; + * + * // using the "_.property" callback shorthand + * _.pluck(_.sortBy(users, 'user'), 'user'); + * // => ['barney', 'fred', 'pebbles'] + */ + function sortBy(collection, iteratee, thisArg) { + var index = -1, + length = collection ? collection.length : 0, + result = isLength(length) ? Array(length) : []; + + if (thisArg && isIterateeCall(collection, iteratee, thisArg)) { + iteratee = null; + } + iteratee = getCallback(iteratee, thisArg, 3); + baseEach(collection, function(value, key, collection) { + result[++index] = { 'criteria': iteratee(value, key, collection), 'index': index, 'value': value }; + }); + return baseSortBy(result, compareAscending); + } + + /** + * This method is like `_.sortBy` except that it sorts by property names + * instead of an iteratee function. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to iterate over. + * @param {...(string|string[])} props The property names to sort by, + * specified as individual property names or arrays of property names. + * @returns {Array} Returns the new sorted array. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36 }, + * { 'user': 'fred', 'age': 40 }, + * { 'user': 'barney', 'age': 26 }, + * { 'user': 'fred', 'age': 30 } + * ]; + * + * _.map(_.sortByAll(users, ['user', 'age']), _.values); + * // => [['barney', 26], ['barney', 36], ['fred', 30], ['fred', 40]] + */ + function sortByAll(collection) { + var args = arguments; + if (args.length > 3 && isIterateeCall(args[1], args[2], args[3])) { + args = [collection, args[1]]; + } + var index = -1, + length = collection ? collection.length : 0, + props = baseFlatten(args, false, false, 1), + result = isLength(length) ? Array(length) : []; + + baseEach(collection, function(value, key, collection) { + var length = props.length, + criteria = Array(length); + + while (length--) { + criteria[length] = value == null ? undefined : value[props[length]]; + } + result[++index] = { 'criteria': criteria, 'index': index, 'value': value }; + }); + return baseSortBy(result, compareMultipleAscending); + } + + /** + * Performs a deep comparison between each element in `collection` and the + * source object, returning an array of all elements that have equivalent + * property values. + * + * @static + * @memberOf _ + * @category Collection + * @param {Array|Object|string} collection The collection to search. + * @param {Object} source The object of property values to match. + * @returns {Array} Returns the new filtered array. + * @example + * + * var users = [ + * { 'user': 'barney', 'age': 36, 'status': 'busy', 'pets': ['hoppy'] }, + * { 'user': 'fred', 'age': 40, 'status': 'busy', 'pets': ['baby puss', 'dino'] } + * ]; + * + * _.pluck(_.where(users, { 'age': 36 }), 'user'); + * // => ['barney'] + * + * _.pluck(_.where(users, { 'pets': ['dino'] }), 'user'); + * // => ['fred'] + * + * _.pluck(_.where(users, { 'status': 'busy' }), 'user'); + * // => ['barney', 'fred'] + */ + function where(collection, source) { + return filter(collection, baseMatches(source)); + } + + /*------------------------------------------------------------------------*/ + + /** + * Gets the number of milliseconds that have elapsed since the Unix epoch + * (1 January 1970 00:00:00 UTC). + * + * @static + * @memberOf _ + * @category Date + * @example + * + * _.defer(function(stamp) { console.log(_.now() - stamp); }, _.now()); + * // => logs the number of milliseconds it took for the deferred function to be invoked + */ + var now = nativeNow || function() { + return new Date().getTime(); + }; + + /*------------------------------------------------------------------------*/ + + /** + * The opposite of `_.before`; this method creates a function that invokes + * `func` once it is called `n` or more times. + * + * @static + * @memberOf _ + * @category Function + * @param {number} n The number of calls before `func` is invoked. + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * var saves = ['profile', 'settings']; + * + * var done = _.after(saves.length, function() { + * console.log('done saving!'); + * }); + * + * _.forEach(saves, function(type) { + * asyncSave({ 'type': type, 'complete': done }); + * }); + * // => logs 'done saving!' after the two async saves have completed + */ + function after(n, func) { + if (!isFunction(func)) { + if (isFunction(n)) { + var temp = n; + n = func; + func = temp; + } else { + throw new TypeError(FUNC_ERROR_TEXT); + } + } + n = nativeIsFinite(n = +n) ? n : 0; + return function() { + if (--n < 1) { + return func.apply(this, arguments); + } + }; + } + + /** + * Creates a function that accepts up to `n` arguments ignoring any + * additional arguments. + * + * @static + * @memberOf _ + * @category Function + * @param {Function} func The function to cap arguments for. + * @param {number} [n=func.length] The arity cap. + * @param- {Object} [guard] Enables use as a callback for functions like `_.map`. + * @returns {Function} Returns the new function. + * @example + * + * _.map(['6', '8', '10'], _.ary(parseInt, 1)); + * // => [6, 8, 10] + */ + function ary(func, n, guard) { + if (guard && isIterateeCall(func, n, guard)) { + n = null; + } + n = (func && n == null) ? func.length : nativeMax(+n || 0, 0); + return createWrapper(func, ARY_FLAG, null, null, null, null, n); + } + + /** + * Creates a function that invokes `func`, with the `this` binding and arguments + * of the created function, while it is called less than `n` times. Subsequent + * calls to the created function return the result of the last `func` invocation. + * + * @static + * @memberOf _ + * @category Function + * @param {number} n The number of calls at which `func` is no longer invoked. + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * jQuery('#add').on('click', _.before(5, addContactToList)); + * // => allows adding up to 4 contacts to the list + */ + function before(n, func) { + var result; + if (!isFunction(func)) { + if (isFunction(n)) { + var temp = n; + n = func; + func = temp; + } else { + throw new TypeError(FUNC_ERROR_TEXT); + } + } + return function() { + if (--n > 0) { + result = func.apply(this, arguments); + } else { + func = null; + } + return result; + }; + } + + /** + * Creates a function that invokes `func` with the `this` binding of `thisArg` + * and prepends any additional `_.bind` arguments to those provided to the + * bound function. + * + * The `_.bind.placeholder` value, which defaults to `_` in monolithic builds, + * may be used as a placeholder for partially applied arguments. + * + * **Note:** Unlike native `Function#bind` this method does not set the `length` + * property of bound functions. + * + * @static + * @memberOf _ + * @category Function + * @param {Function} func The function to bind. + * @param {*} thisArg The `this` binding of `func`. + * @param {...*} [args] The arguments to be partially applied. + * @returns {Function} Returns the new bound function. + * @example + * + * var greet = function(greeting, punctuation) { + * return greeting + ' ' + this.user + punctuation; + * }; + * + * var object = { 'user': 'fred' }; + * + * var bound = _.bind(greet, object, 'hi'); + * bound('!'); + * // => 'hi fred!' + * + * // using placeholders + * var bound = _.bind(greet, object, _, '!'); + * bound('hi'); + * // => 'hi fred!' + */ + function bind(func, thisArg) { + var bitmask = BIND_FLAG; + if (arguments.length > 2) { + var partials = baseSlice(arguments, 2), + holders = replaceHolders(partials, bind.placeholder); + + bitmask |= PARTIAL_FLAG; + } + return createWrapper(func, bitmask, thisArg, partials, holders); + } + + /** + * Binds methods of an object to the object itself, overwriting the existing + * method. Method names may be specified as individual arguments or as arrays + * of method names. If no method names are provided all enumerable function + * properties, own and inherited, of `object` are bound. + * + * **Note:** This method does not set the `length` property of bound functions. + * + * @static + * @memberOf _ + * @category Function + * @param {Object} object The object to bind and assign the bound methods to. + * @param {...(string|string[])} [methodNames] The object method names to bind, + * specified as individual method names or arrays of method names. + * @returns {Object} Returns `object`. + * @example + * + * var view = { + * 'label': 'docs', + * 'onClick': function() { console.log('clicked ' + this.label); } + * }; + * + * _.bindAll(view); + * jQuery('#docs').on('click', view.onClick); + * // => logs 'clicked docs' when the element is clicked + */ + function bindAll(object) { + return baseBindAll(object, + arguments.length > 1 + ? baseFlatten(arguments, false, false, 1) + : functions(object) + ); + } + + /** + * Creates a function that invokes the method at `object[key]` and prepends + * any additional `_.bindKey` arguments to those provided to the bound function. + * + * This method differs from `_.bind` by allowing bound functions to reference + * methods that may be redefined or don't yet exist. + * See [Peter Michaux's article](http://michaux.ca/articles/lazy-function-definition-pattern) + * for more details. + * + * The `_.bindKey.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * @static + * @memberOf _ + * @category Function + * @param {Object} object The object the method belongs to. + * @param {string} key The key of the method. + * @param {...*} [args] The arguments to be partially applied. + * @returns {Function} Returns the new bound function. + * @example + * + * var object = { + * 'user': 'fred', + * 'greet': function(greeting, punctuation) { + * return greeting + ' ' + this.user + punctuation; + * } + * }; + * + * var bound = _.bindKey(object, 'greet', 'hi'); + * bound('!'); + * // => 'hi fred!' + * + * object.greet = function(greeting, punctuation) { + * return greeting + 'ya ' + this.user + punctuation; + * }; + * + * bound('!'); + * // => 'hiya fred!' + * + * // using placeholders + * var bound = _.bindKey(object, 'greet', _, '!'); + * bound('hi'); + * // => 'hiya fred!' + */ + function bindKey(object, key) { + var bitmask = BIND_FLAG | BIND_KEY_FLAG; + if (arguments.length > 2) { + var partials = baseSlice(arguments, 2), + holders = replaceHolders(partials, bindKey.placeholder); + + bitmask |= PARTIAL_FLAG; + } + return createWrapper(key, bitmask, object, partials, holders); + } + + /** + * Creates a function that accepts one or more arguments of `func` that when + * called either invokes `func` returning its result, if all `func` arguments + * have been provided, or returns a function that accepts one or more of the + * remaining `func` arguments, and so on. The arity of `func` may be specified + * if `func.length` is not sufficient. + * + * The `_.curry.placeholder` value, which defaults to `_` in monolithic builds, + * may be used as a placeholder for provided arguments. + * + * **Note:** This method does not set the `length` property of curried functions. + * + * @static + * @memberOf _ + * @category Function + * @param {Function} func The function to curry. + * @param {number} [arity=func.length] The arity of `func`. + * @param- {Object} [guard] Enables use as a callback for functions like `_.map`. + * @returns {Function} Returns the new curried function. + * @example + * + * var abc = function(a, b, c) { + * return [a, b, c]; + * }; + * + * var curried = _.curry(abc); + * + * curried(1)(2)(3); + * // => [1, 2, 3] + * + * curried(1, 2)(3); + * // => [1, 2, 3] + * + * curried(1, 2, 3); + * // => [1, 2, 3] + * + * // using placeholders + * curried(1)(_, 3)(2); + * // => [1, 2, 3] + */ + function curry(func, arity, guard) { + if (guard && isIterateeCall(func, arity, guard)) { + arity = null; + } + var result = createWrapper(func, CURRY_FLAG, null, null, null, null, null, arity); + result.placeholder = curry.placeholder; + return result; + } + + /** + * This method is like `_.curry` except that arguments are applied to `func` + * in the manner of `_.partialRight` instead of `_.partial`. + * + * The `_.curryRight.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for provided arguments. + * + * **Note:** This method does not set the `length` property of curried functions. + * + * @static + * @memberOf _ + * @category Function + * @param {Function} func The function to curry. + * @param {number} [arity=func.length] The arity of `func`. + * @param- {Object} [guard] Enables use as a callback for functions like `_.map`. + * @returns {Function} Returns the new curried function. + * @example + * + * var abc = function(a, b, c) { + * return [a, b, c]; + * }; + * + * var curried = _.curryRight(abc); + * + * curried(3)(2)(1); + * // => [1, 2, 3] + * + * curried(2, 3)(1); + * // => [1, 2, 3] + * + * curried(1, 2, 3); + * // => [1, 2, 3] + * + * // using placeholders + * curried(3)(1, _)(2); + * // => [1, 2, 3] + */ + function curryRight(func, arity, guard) { + if (guard && isIterateeCall(func, arity, guard)) { + arity = null; + } + var result = createWrapper(func, CURRY_RIGHT_FLAG, null, null, null, null, null, arity); + result.placeholder = curryRight.placeholder; + return result; + } + + /** + * Creates a function that delays invoking `func` until after `wait` milliseconds + * have elapsed since the last time it was invoked. The created function comes + * with a `cancel` method to cancel delayed invocations. Provide an options + * object to indicate that `func` should be invoked on the leading and/or + * trailing edge of the `wait` timeout. Subsequent calls to the debounced + * function return the result of the last `func` invocation. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is invoked + * on the trailing edge of the timeout only if the the debounced function is + * invoked more than once during the `wait` timeout. + * + * See [David Corbacho's article](http://drupalmotion.com/article/debounce-and-throttle-visual-explanation) + * for details over the differences between `_.debounce` and `_.throttle`. + * + * @static + * @memberOf _ + * @category Function + * @param {Function} func The function to debounce. + * @param {number} wait The number of milliseconds to delay. + * @param {Object} [options] The options object. + * @param {boolean} [options.leading=false] Specify invoking on the leading + * edge of the timeout. + * @param {number} [options.maxWait] The maximum time `func` is allowed to be + * delayed before it is invoked. + * @param {boolean} [options.trailing=true] Specify invoking on the trailing + * edge of the timeout. + * @returns {Function} Returns the new debounced function. + * @example + * + * // avoid costly calculations while the window size is in flux + * jQuery(window).on('resize', _.debounce(calculateLayout, 150)); + * + * // invoke `sendMail` when the click event is fired, debouncing subsequent calls + * jQuery('#postbox').on('click', _.debounce(sendMail, 300, { + * 'leading': true, + * 'trailing': false + * })); + * + * // ensure `batchLog` is invoked once after 1 second of debounced calls + * var source = new EventSource('/stream'); + * jQuery(source).on('message', _.debounce(batchLog, 250, { + * 'maxWait': 1000 + * })); + * + * // cancel a debounced call + * var todoChanges = _.debounce(batchLog, 1000); + * Object.observe(models.todo, todoChanges); + * + * Object.observe(models, function(changes) { + * if (_.find(changes, { 'user': 'todo', 'type': 'delete'})) { + * todoChanges.cancel(); + * } + * }, ['delete']); + * + * // ...at some point `models.todo` is changed + * models.todo.completed = true; + * + * // ...before 1 second has passed `models.todo` is deleted + * // which cancels the debounced `todoChanges` call + * delete models.todo; + */ + function debounce(func, wait, options) { + var args, + maxTimeoutId, + result, + stamp, + thisArg, + timeoutId, + trailingCall, + lastCalled = 0, + maxWait = false, + trailing = true; + + if (!isFunction(func)) { + throw new TypeError(FUNC_ERROR_TEXT); + } + wait = wait < 0 ? 0 : wait; + if (options === true) { + var leading = true; + trailing = false; + } else if (isObject(options)) { + leading = options.leading; + maxWait = 'maxWait' in options && nativeMax(+options.maxWait || 0, wait); + trailing = 'trailing' in options ? options.trailing : trailing; + } + + function cancel() { + if (timeoutId) { + clearTimeout(timeoutId); + } + if (maxTimeoutId) { + clearTimeout(maxTimeoutId); + } + maxTimeoutId = timeoutId = trailingCall = undefined; + } + + function delayed() { + var remaining = wait - (now() - stamp); + if (remaining <= 0 || remaining > wait) { + if (maxTimeoutId) { + clearTimeout(maxTimeoutId); + } + var isCalled = trailingCall; + maxTimeoutId = timeoutId = trailingCall = undefined; + if (isCalled) { + lastCalled = now(); + result = func.apply(thisArg, args); + if (!timeoutId && !maxTimeoutId) { + args = thisArg = null; + } + } + } else { + timeoutId = setTimeout(delayed, remaining); + } + } + + function maxDelayed() { + if (timeoutId) { + clearTimeout(timeoutId); + } + maxTimeoutId = timeoutId = trailingCall = undefined; + if (trailing || (maxWait !== wait)) { + lastCalled = now(); + result = func.apply(thisArg, args); + if (!timeoutId && !maxTimeoutId) { + args = thisArg = null; + } + } + } + + function debounced() { + args = arguments; + stamp = now(); + thisArg = this; + trailingCall = trailing && (timeoutId || !leading); + + if (maxWait === false) { + var leadingCall = leading && !timeoutId; + } else { + if (!maxTimeoutId && !leading) { + lastCalled = stamp; + } + var remaining = maxWait - (stamp - lastCalled), + isCalled = remaining <= 0 || remaining > maxWait; + + if (isCalled) { + if (maxTimeoutId) { + maxTimeoutId = clearTimeout(maxTimeoutId); + } + lastCalled = stamp; + result = func.apply(thisArg, args); + } + else if (!maxTimeoutId) { + maxTimeoutId = setTimeout(maxDelayed, remaining); + } + } + if (isCalled && timeoutId) { + timeoutId = clearTimeout(timeoutId); + } + else if (!timeoutId && wait !== maxWait) { + timeoutId = setTimeout(delayed, wait); + } + if (leadingCall) { + isCalled = true; + result = func.apply(thisArg, args); + } + if (isCalled && !timeoutId && !maxTimeoutId) { + args = thisArg = null; + } + return result; + } + debounced.cancel = cancel; + return debounced; + } + + /** + * Defers invoking the `func` until the current call stack has cleared. Any + * additional arguments are provided to `func` when it is invoked. + * + * @static + * @memberOf _ + * @category Function + * @param {Function} func The function to defer. + * @param {...*} [args] The arguments to invoke the function with. + * @returns {number} Returns the timer id. + * @example + * + * _.defer(function(text) { console.log(text); }, 'deferred'); + * // logs 'deferred' after one or more milliseconds + */ + function defer(func) { + return baseDelay(func, 1, arguments, 1); + } + + /** + * Invokes `func` after `wait` milliseconds. Any additional arguments are + * provided to `func` when it is invoked. + * + * @static + * @memberOf _ + * @category Function + * @param {Function} func The function to delay. + * @param {number} wait The number of milliseconds to delay invocation. + * @param {...*} [args] The arguments to invoke the function with. + * @returns {number} Returns the timer id. + * @example + * + * _.delay(function(text) { console.log(text); }, 1000, 'later'); + * // => logs 'later' after one second + */ + function delay(func, wait) { + return baseDelay(func, wait, arguments, 2); + } + + /** + * Creates a function that returns the result of invoking the provided + * functions with the `this` binding of the created function, where each + * successive invocation is supplied the return value of the previous. + * + * @static + * @memberOf _ + * @category Function + * @param {...Function} [funcs] Functions to invoke. + * @returns {Function} Returns the new function. + * @example + * + * function add(x, y) { + * return x + y; + * } + * + * function square(n) { + * return n * n; + * } + * + * var addSquare = _.flow(add, square); + * addSquare(1, 2); + * // => 9 + */ + function flow() { + var funcs = arguments, + length = funcs.length; + + if (!length) { + return function() {}; + } + if (!arrayEvery(funcs, isFunction)) { + throw new TypeError(FUNC_ERROR_TEXT); + } + return function() { + var index = 0, + result = funcs[index].apply(this, arguments); + + while (++index < length) { + result = funcs[index].call(this, result); + } + return result; + }; + } + + /** + * This method is like `_.flow` except that it creates a function that + * invokes the provided functions from right to left. + * + * @static + * @memberOf _ + * @alias backflow, compose + * @category Function + * @param {...Function} [funcs] Functions to invoke. + * @returns {Function} Returns the new function. + * @example + * + * function add(x, y) { + * return x + y; + * } + * + * function square(n) { + * return n * n; + * } + * + * var addSquare = _.flowRight(square, add); + * addSquare(1, 2); + * // => 9 + */ + function flowRight() { + var funcs = arguments, + fromIndex = funcs.length - 1; + + if (fromIndex < 0) { + return function() {}; + } + if (!arrayEvery(funcs, isFunction)) { + throw new TypeError(FUNC_ERROR_TEXT); + } + return function() { + var index = fromIndex, + result = funcs[index].apply(this, arguments); + + while (index--) { + result = funcs[index].call(this, result); + } + return result; + }; + } + + /** + * Creates a function that memoizes the result of `func`. If `resolver` is + * provided it determines the cache key for storing the result based on the + * arguments provided to the memoized function. By default, the first argument + * provided to the memoized function is coerced to a string and used as the + * cache key. The `func` is invoked with the `this` binding of the memoized + * function. + * + * **Note:** The cache is exposed as the `cache` property on the memoized + * function. Its creation may be customized by replacing the `_.memoize.Cache` + * constructor with one whose instances implement the ES `Map` method interface + * of `get`, `has`, and `set`. See the + * [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-properties-of-the-map-prototype-object) + * for more details. + * + * @static + * @memberOf _ + * @category Function + * @param {Function} func The function to have its output memoized. + * @param {Function} [resolver] The function to resolve the cache key. + * @returns {Function} Returns the new memoizing function. + * @example + * + * var upperCase = _.memoize(function(string) { + * return string.toUpperCase(); + * }); + * + * upperCase('fred'); + * // => 'FRED' + * + * // modifying the result cache + * upperCase.cache.set('fred', 'BARNEY'); + * upperCase('fred'); + * // => 'BARNEY' + * + * // replacing `_.memoize.Cache` + * var object = { 'user': 'fred' }; + * var other = { 'user': 'barney' }; + * var identity = _.memoize(_.identity); + * + * identity(object); + * // => { 'user': 'fred' } + * identity(other); + * // => { 'user': 'fred' } + * + * _.memoize.Cache = WeakMap; + * var identity = _.memoize(_.identity); + * + * identity(object); + * // => { 'user': 'fred' } + * identity(other); + * // => { 'user': 'barney' } + */ + function memoize(func, resolver) { + if (!isFunction(func) || (resolver && !isFunction(resolver))) { + throw new TypeError(FUNC_ERROR_TEXT); + } + var memoized = function() { + var cache = memoized.cache, + key = resolver ? resolver.apply(this, arguments) : arguments[0]; + + if (cache.has(key)) { + return cache.get(key); + } + var result = func.apply(this, arguments); + cache.set(key, result); + return result; + }; + memoized.cache = new memoize.Cache; + return memoized; + } + + /** + * Creates a function that negates the result of the predicate `func`. The + * `func` predicate is invoked with the `this` binding and arguments of the + * created function. + * + * @static + * @memberOf _ + * @category Function + * @param {Function} predicate The predicate to negate. + * @returns {Function} Returns the new function. + * @example + * + * function isEven(n) { + * return n % 2 == 0; + * } + * + * _.filter([1, 2, 3, 4, 5, 6], _.negate(isEven)); + * // => [1, 3, 5] + */ + function negate(predicate) { + if (!isFunction(predicate)) { + throw new TypeError(FUNC_ERROR_TEXT); + } + return function() { + return !predicate.apply(this, arguments); + }; + } + + /** + * Creates a function that is restricted to invoking `func` once. Repeat calls + * to the function return the value of the first call. The `func` is invoked + * with the `this` binding of the created function. + * + * @static + * @memberOf _ + * @type Function + * @category Function + * @param {Function} func The function to restrict. + * @returns {Function} Returns the new restricted function. + * @example + * + * var initialize = _.once(createApplication); + * initialize(); + * initialize(); + * // `initialize` invokes `createApplication` once + */ + function once(func) { + return before(func, 2); + } + + /** + * Creates a function that invokes `func` with `partial` arguments prepended + * to those provided to the new function. This method is like `_.bind` except + * it does **not** alter the `this` binding. + * + * The `_.partial.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * **Note:** This method does not set the `length` property of partially + * applied functions. + * + * @static + * @memberOf _ + * @category Function + * @param {Function} func The function to partially apply arguments to. + * @param {...*} [args] The arguments to be partially applied. + * @returns {Function} Returns the new partially applied function. + * @example + * + * var greet = function(greeting, name) { + * return greeting + ' ' + name; + * }; + * + * var sayHelloTo = _.partial(greet, 'hello'); + * sayHelloTo('fred'); + * // => 'hello fred' + * + * // using placeholders + * var greetFred = _.partial(greet, _, 'fred'); + * greetFred('hi'); + * // => 'hi fred' + */ + function partial(func) { + var partials = baseSlice(arguments, 1), + holders = replaceHolders(partials, partial.placeholder); + + return createWrapper(func, PARTIAL_FLAG, null, partials, holders); + } + + /** + * This method is like `_.partial` except that partially applied arguments + * are appended to those provided to the new function. + * + * The `_.partialRight.placeholder` value, which defaults to `_` in monolithic + * builds, may be used as a placeholder for partially applied arguments. + * + * **Note:** This method does not set the `length` property of partially + * applied functions. + * + * @static + * @memberOf _ + * @category Function + * @param {Function} func The function to partially apply arguments to. + * @param {...*} [args] The arguments to be partially applied. + * @returns {Function} Returns the new partially applied function. + * @example + * + * var greet = function(greeting, name) { + * return greeting + ' ' + name; + * }; + * + * var greetFred = _.partialRight(greet, 'fred'); + * greetFred('hi'); + * // => 'hi fred' + * + * // using placeholders + * var sayHelloTo = _.partialRight(greet, 'hello', _); + * sayHelloTo('fred'); + * // => 'hello fred' + */ + function partialRight(func) { + var partials = baseSlice(arguments, 1), + holders = replaceHolders(partials, partialRight.placeholder); + + return createWrapper(func, PARTIAL_RIGHT_FLAG, null, partials, holders); + } + + /** + * Creates a function that invokes `func` with arguments arranged according + * to the specified indexes where the argument value at the first index is + * provided as the first argument, the argument value at the second index is + * provided as the second argument, and so on. + * + * @static + * @memberOf _ + * @category Function + * @param {Function} func The function to rearrange arguments for. + * @param {...(number|number[])} indexes The arranged argument indexes, + * specified as individual indexes or arrays of indexes. + * @returns {Function} Returns the new function. + * @example + * + * var rearged = _.rearg(function(a, b, c) { + * return [a, b, c]; + * }, 2, 0, 1); + * + * rearged('b', 'c', 'a') + * // => ['a', 'b', 'c'] + * + * var map = _.rearg(_.map, [1, 0]); + * map(function(n) { return n * 3; }, [1, 2, 3]); + * // => [3, 6, 9] + */ + function rearg(func) { + var indexes = baseFlatten(arguments, false, false, 1); + return createWrapper(func, REARG_FLAG, null, null, null, indexes); + } + + /** + * Creates a function that only invokes `func` at most once per every `wait` + * milliseconds. The created function comes with a `cancel` method to cancel + * delayed invocations. Provide an options object to indicate that `func` + * should be invoked on the leading and/or trailing edge of the `wait` timeout. + * Subsequent calls to the throttled function return the result of the last + * `func` call. + * + * **Note:** If `leading` and `trailing` options are `true`, `func` is invoked + * on the trailing edge of the timeout only if the the throttled function is + * invoked more than once during the `wait` timeout. + * + * See [David Corbacho's article](http://drupalmotion.com/article/debounce-and-throttle-visual-explanation) + * for details over the differences between `_.throttle` and `_.debounce`. + * + * @static + * @memberOf _ + * @category Function + * @param {Function} func The function to throttle. + * @param {number} wait The number of milliseconds to throttle invocations to. + * @param {Object} [options] The options object. + * @param {boolean} [options.leading=true] Specify invoking on the leading + * edge of the timeout. + * @param {boolean} [options.trailing=true] Specify invoking on the trailing + * edge of the timeout. + * @returns {Function} Returns the new throttled function. + * @example + * + * // avoid excessively updating the position while scrolling + * jQuery(window).on('scroll', _.throttle(updatePosition, 100)); + * + * // invoke `renewToken` when the click event is fired, but not more than once every 5 minutes + * var throttled = _.throttle(renewToken, 300000, { 'trailing': false }) + * jQuery('.interactive').on('click', throttled); + * + * // cancel a trailing throttled call + * jQuery(window).on('popstate', throttled.cancel); + */ + function throttle(func, wait, options) { + var leading = true, + trailing = true; + + if (!isFunction(func)) { + throw new TypeError(FUNC_ERROR_TEXT); + } + if (options === false) { + leading = false; + } else if (isObject(options)) { + leading = 'leading' in options ? !!options.leading : leading; + trailing = 'trailing' in options ? !!options.trailing : trailing; + } + debounceOptions.leading = leading; + debounceOptions.maxWait = +wait; + debounceOptions.trailing = trailing; + return debounce(func, wait, debounceOptions); + } + + /** + * Creates a function that provides `value` to the wrapper function as its + * first argument. Any additional arguments provided to the function are + * appended to those provided to the wrapper function. The wrapper is invoked + * with the `this` binding of the created function. + * + * @static + * @memberOf _ + * @category Function + * @param {*} value The value to wrap. + * @param {Function} wrapper The wrapper function. + * @returns {Function} Returns the new function. + * @example + * + * var p = _.wrap(_.escape, function(func, text) { + * return '

' + func(text) + '

'; + * }); + * + * p('fred, barney, & pebbles'); + * // => '

fred, barney, & pebbles

' + */ + function wrap(value, wrapper) { + wrapper = wrapper == null ? identity : wrapper; + return createWrapper(wrapper, PARTIAL_FLAG, null, [value], []); + } + + /*------------------------------------------------------------------------*/ + + /** + * Creates a clone of `value`. If `isDeep` is `true` nested objects are cloned, + * otherwise they are assigned by reference. If `customizer` is provided it is + * invoked to produce the cloned values. If `customizer` returns `undefined` + * cloning is handled by the method instead. The `customizer` is bound to + * `thisArg` and invoked with two argument; (value [, index|key, object]). + * + * **Note:** This method is loosely based on the structured clone algorithm. + * The enumerable properties of `arguments` objects and objects created by + * constructors other than `Object` are cloned to plain `Object` objects. An + * empty object is returned for uncloneable values such as functions, DOM nodes, + * Maps, Sets, and WeakMaps. See the [HTML5 specification](http://www.w3.org/TR/html5/infrastructure.html#internal-structured-cloning-algorithm) + * for more details. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to clone. + * @param {boolean} [isDeep] Specify a deep clone. + * @param {Function} [customizer] The function to customize cloning values. + * @param {*} [thisArg] The `this` binding of `customizer`. + * @returns {*} Returns the cloned value. + * @example + * + * var users = [ + * { 'user': 'barney' }, + * { 'user': 'fred' } + * ]; + * + * var shallow = _.clone(users); + * shallow[0] === users[0]; + * // => true + * + * var deep = _.clone(users, true); + * deep[0] === users[0]; + * // => false + * + * // using a customizer callback + * var body = _.clone(document.body, function(value) { + * return _.isElement(value) ? value.cloneNode(false) : undefined; + * }); + * + * body === document.body + * // => false + * body.nodeName + * // => BODY + * body.childNodes.length; + * // => 0 + */ + function clone(value, isDeep, customizer, thisArg) { + // Juggle arguments. + if (typeof isDeep != 'boolean' && isDeep != null) { + thisArg = customizer; + customizer = isIterateeCall(value, isDeep, thisArg) ? null : isDeep; + isDeep = false; + } + customizer = typeof customizer == 'function' && bindCallback(customizer, thisArg, 1); + return baseClone(value, isDeep, customizer); + } + + /** + * Creates a deep clone of `value`. If `customizer` is provided it is invoked + * to produce the cloned values. If `customizer` returns `undefined` cloning + * is handled by the method instead. The `customizer` is bound to `thisArg` + * and invoked with two argument; (value [, index|key, object]). + * + * **Note:** This method is loosely based on the structured clone algorithm. + * The enumerable properties of `arguments` objects and objects created by + * constructors other than `Object` are cloned to plain `Object` objects. An + * empty object is returned for uncloneable values such as functions, DOM nodes, + * Maps, Sets, and WeakMaps. See the [HTML5 specification](http://www.w3.org/TR/html5/infrastructure.html#internal-structured-cloning-algorithm) + * for more details. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to deep clone. + * @param {Function} [customizer] The function to customize cloning values. + * @param {*} [thisArg] The `this` binding of `customizer`. + * @returns {*} Returns the deep cloned value. + * @example + * + * var users = [ + * { 'user': 'barney' }, + * { 'user': 'fred' } + * ]; + * + * var deep = _.cloneDeep(users); + * deep[0] === users[0]; + * // => false + * + * // using a customizer callback + * var el = _.cloneDeep(document.body, function(value) { + * return _.isElement(value) ? value.cloneNode(true) : undefined; + * }); + * + * body === document.body + * // => false + * body.nodeName + * // => BODY + * body.childNodes.length; + * // => 20 + */ + function cloneDeep(value, customizer, thisArg) { + customizer = typeof customizer == 'function' && bindCallback(customizer, thisArg, 1); + return baseClone(value, true, customizer); + } + + /** + * Checks if `value` is classified as an `arguments` object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * (function() { return _.isArguments(arguments); })(); + * // => true + * + * _.isArguments([1, 2, 3]); + * // => false + */ + function isArguments(value) { + var length = isObjectLike(value) ? value.length : undefined; + return (isLength(length) && objToString.call(value) == argsTag) || false; + } + + /** + * Checks if `value` is classified as an `Array` object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isArray([1, 2, 3]); + * // => true + * + * (function() { return _.isArray(arguments); })(); + * // => false + */ + var isArray = nativeIsArray || function(value) { + return (isObjectLike(value) && isLength(value.length) && objToString.call(value) == arrayTag) || false; + }; + + /** + * Checks if `value` is classified as a boolean primitive or object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isBoolean(false); + * // => true + * + * _.isBoolean(null); + * // => false + */ + function isBoolean(value) { + return (value === true || value === false || isObjectLike(value) && objToString.call(value) == boolTag) || false; + } + + /** + * Checks if `value` is classified as a `Date` object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isDate(new Date); + * // => true + * + * _.isDate('Mon April 23 2012'); + * // => false + */ + function isDate(value) { + return (isObjectLike(value) && objToString.call(value) == dateTag) || false; + } + + /** + * Checks if `value` is a DOM element. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a DOM element, else `false`. + * @example + * + * _.isElement(document.body); + * // => true + * + * _.isElement(''); + * // => false + */ + function isElement(value) { + return (value && value.nodeType === 1 && isObjectLike(value) && + objToString.call(value).indexOf('Element') > -1) || false; + } + // Fallback for environments without DOM support. + if (!support.dom) { + isElement = function(value) { + return (value && value.nodeType === 1 && isObjectLike(value) && !isPlainObject(value)) || false; + }; + } + + /** + * Checks if a value is empty. A value is considered empty unless it is an + * `arguments` object, array, string, or jQuery-like collection with a length + * greater than `0` or an object with own enumerable properties. + * + * @static + * @memberOf _ + * @category Lang + * @param {Array|Object|string} value The value to inspect. + * @returns {boolean} Returns `true` if `value` is empty, else `false`. + * @example + * + * _.isEmpty(null); + * // => true + * + * _.isEmpty(true); + * // => true + * + * _.isEmpty(1); + * // => true + * + * _.isEmpty([1, 2, 3]); + * // => false + * + * _.isEmpty({ 'a': 1 }); + * // => false + */ + function isEmpty(value) { + if (value == null) { + return true; + } + var length = value.length; + if (isLength(length) && (isArray(value) || isString(value) || isArguments(value) || + (isObjectLike(value) && isFunction(value.splice)))) { + return !length; + } + return !keys(value).length; + } + + /** + * Performs a deep comparison between two values to determine if they are + * equivalent. If `customizer` is provided it is invoked to compare values. + * If `customizer` returns `undefined` comparisons are handled by the method + * instead. The `customizer` is bound to `thisArg` and invoked with three + * arguments; (value, other [, index|key]). + * + * **Note:** This method supports comparing arrays, booleans, `Date` objects, + * numbers, `Object` objects, regexes, and strings. Functions and DOM nodes + * are **not** supported. Provide a customizer function to extend support + * for comparing other values. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to compare. + * @param {*} other The other value to compare. + * @param {Function} [customizer] The function to customize comparing values. + * @param {*} [thisArg] The `this` binding of `customizer`. + * @returns {boolean} Returns `true` if the values are equivalent, else `false`. + * @example + * + * var object = { 'user': 'fred' }; + * var other = { 'user': 'fred' }; + * + * object == other; + * // => false + * + * _.isEqual(object, other); + * // => true + * + * // using a customizer callback + * var array = ['hello', 'goodbye']; + * var other = ['hi', 'goodbye']; + * + * _.isEqual(array, other, function(value, other) { + * return _.every([value, other], RegExp.prototype.test, /^h(?:i|ello)$/) || undefined; + * }); + * // => true + */ + function isEqual(value, other, customizer, thisArg) { + customizer = typeof customizer == 'function' && bindCallback(customizer, thisArg, 3); + if (!customizer && isStrictComparable(value) && isStrictComparable(other)) { + return value === other; + } + var result = customizer ? customizer(value, other) : undefined; + return typeof result == 'undefined' ? baseIsEqual(value, other, customizer) : !!result; + } + + /** + * Checks if `value` is an `Error`, `EvalError`, `RangeError`, `ReferenceError`, + * `SyntaxError`, `TypeError`, or `URIError` object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an error object, else `false`. + * @example + * + * _.isError(new Error); + * // => true + * + * _.isError(Error); + * // => false + */ + function isError(value) { + return (isObjectLike(value) && typeof value.message == 'string' && objToString.call(value) == errorTag) || false; + } + + /** + * Checks if `value` is a finite primitive number. + * + * **Note:** This method is based on ES `Number.isFinite`. See the + * [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-number.isfinite) + * for more details. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a finite number, else `false`. + * @example + * + * _.isFinite(10); + * // => true + * + * _.isFinite('10'); + * // => false + * + * _.isFinite(true); + * // => false + * + * _.isFinite(Object(10)); + * // => false + * + * _.isFinite(Infinity); + * // => false + */ + var isFinite = nativeNumIsFinite || function(value) { + return typeof value == 'number' && nativeIsFinite(value); + }; + + /** + * Checks if `value` is classified as a `Function` object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isFunction(_); + * // => true + * + * _.isFunction(/abc/); + * // => false + */ + function isFunction(value) { + // Avoid a Chakra JIT bug in compatibility modes of IE 11. + // See https://github.com/jashkenas/underscore/issues/1621 for more details. + return typeof value == 'function' || false; + } + // Fallback for environments that return incorrect `typeof` operator results. + if (isFunction(/x/) || (Uint8Array && !isFunction(Uint8Array))) { + isFunction = function(value) { + // The use of `Object#toString` avoids issues with the `typeof` operator + // in older versions of Chrome and Safari which return 'function' for regexes + // and Safari 8 equivalents which return 'object' for typed array constructors. + return objToString.call(value) == funcTag; + }; + } + + /** + * Checks if `value` is the language type of `Object`. + * (e.g. arrays, functions, objects, regexes, `new Number(0)`, and `new String('')`) + * + * **Note:** See the [ES5 spec](https://es5.github.io/#x8) for more details. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is an object, else `false`. + * @example + * + * _.isObject({}); + * // => true + * + * _.isObject([1, 2, 3]); + * // => true + * + * _.isObject(1); + * // => false + */ + function isObject(value) { + // Avoid a V8 JIT bug in Chrome 19-20. + // See https://code.google.com/p/v8/issues/detail?id=2291 for more details. + var type = typeof value; + return type == 'function' || (value && type == 'object') || false; + } + + /** + * Performs a deep comparison between `object` and `source` to determine if + * `object` contains equivalent property values. If `customizer` is provided + * it is invoked to compare values. If `customizer` returns `undefined` + * comparisons are handled by the method instead. The `customizer` is bound + * to `thisArg` and invoked with three arguments; (value, other, index|key). + * + * **Note:** This method supports comparing properties of arrays, booleans, + * `Date` objects, numbers, `Object` objects, regexes, and strings. Functions + * and DOM nodes are **not** supported. Provide a customizer function to extend + * support for comparing other values. + * + * @static + * @memberOf _ + * @category Lang + * @param {Object} source The object to inspect. + * @param {Object} source The object of property values to match. + * @param {Function} [customizer] The function to customize comparing values. + * @param {*} [thisArg] The `this` binding of `customizer`. + * @returns {boolean} Returns `true` if `object` is a match, else `false`. + * @example + * + * var object = { 'user': 'fred', 'age': 40 }; + * + * _.isMatch(object, { 'age': 40 }); + * // => true + * + * _.isMatch(object, { 'age': 36 }); + * // => false + * + * // using a customizer callback + * var object = { 'greeting': 'hello' }; + * var source = { 'greeting': 'hi' }; + * + * _.isMatch(object, source, function(value, other) { + * return _.every([value, other], RegExp.prototype.test, /^h(?:i|ello)$/) || undefined; + * }); + * // => true + */ + function isMatch(object, source, customizer, thisArg) { + var props = keys(source), + length = props.length; + + customizer = typeof customizer == 'function' && bindCallback(customizer, thisArg, 3); + if (!customizer && length == 1) { + var key = props[0], + value = source[key]; + + if (isStrictComparable(value)) { + return object != null && value === object[key] && hasOwnProperty.call(object, key); + } + } + var values = Array(length), + strictCompareFlags = Array(length); + + while (length--) { + value = values[length] = source[props[length]]; + strictCompareFlags[length] = isStrictComparable(value); + } + return baseIsMatch(object, props, values, strictCompareFlags, customizer); + } + + /** + * Checks if `value` is `NaN`. + * + * **Note:** This method is not the same as native `isNaN` which returns `true` + * for `undefined` and other non-numeric values. See the [ES5 spec](https://es5.github.io/#x15.1.2.4) + * for more details. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `NaN`, else `false`. + * @example + * + * _.isNaN(NaN); + * // => true + * + * _.isNaN(new Number(NaN)); + * // => true + * + * isNaN(undefined); + * // => true + * + * _.isNaN(undefined); + * // => false + */ + function isNaN(value) { + // An `NaN` primitive is the only value that is not equal to itself. + // Perform the `toStringTag` check first to avoid errors with some host objects in IE. + return isNumber(value) && value != +value; + } + + /** + * Checks if `value` is a native function. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a native function, else `false`. + * @example + * + * _.isNative(Array.prototype.push); + * // => true + * + * _.isNative(_); + * // => false + */ + function isNative(value) { + if (value == null) { + return false; + } + if (objToString.call(value) == funcTag) { + return reNative.test(fnToString.call(value)); + } + return (isObjectLike(value) && reHostCtor.test(value)) || false; + } + + /** + * Checks if `value` is `null`. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `null`, else `false`. + * @example + * + * _.isNull(null); + * // => true + * + * _.isNull(void 0); + * // => false + */ + function isNull(value) { + return value === null; + } + + /** + * Checks if `value` is classified as a `Number` primitive or object. + * + * **Note:** To exclude `Infinity`, `-Infinity`, and `NaN`, which are classified + * as numbers, use the `_.isFinite` method. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isNumber(8.4); + * // => true + * + * _.isNumber(NaN); + * // => true + * + * _.isNumber('8.4'); + * // => false + */ + function isNumber(value) { + return typeof value == 'number' || (isObjectLike(value) && objToString.call(value) == numberTag) || false; + } + + /** + * Checks if `value` is a plain object, that is, an object created by the + * `Object` constructor or one with a `[[Prototype]]` of `null`. + * + * **Note:** This method assumes objects created by the `Object` constructor + * have no inherited enumerable properties. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is a plain object, else `false`. + * @example + * + * function Foo() { + * this.a = 1; + * } + * + * _.isPlainObject(new Foo); + * // => false + * + * _.isPlainObject([1, 2, 3]); + * // => false + * + * _.isPlainObject({ 'x': 0, 'y': 0 }); + * // => true + * + * _.isPlainObject(Object.create(null)); + * // => true + */ + var isPlainObject = !getPrototypeOf ? shimIsPlainObject : function(value) { + if (!(value && objToString.call(value) == objectTag)) { + return false; + } + var valueOf = value.valueOf, + objProto = isNative(valueOf) && (objProto = getPrototypeOf(valueOf)) && getPrototypeOf(objProto); + + return objProto + ? (value == objProto || getPrototypeOf(value) == objProto) + : shimIsPlainObject(value); + }; + + /** + * Checks if `value` is classified as a `RegExp` object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isRegExp(/abc/); + * // => true + * + * _.isRegExp('/abc/'); + * // => false + */ + function isRegExp(value) { + return (isObjectLike(value) && objToString.call(value) == regexpTag) || false; + } + + /** + * Checks if `value` is classified as a `String` primitive or object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isString('abc'); + * // => true + * + * _.isString(1); + * // => false + */ + function isString(value) { + return typeof value == 'string' || (isObjectLike(value) && objToString.call(value) == stringTag) || false; + } + + /** + * Checks if `value` is classified as a typed array. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is correctly classified, else `false`. + * @example + * + * _.isTypedArray(new Uint8Array); + * // => true + * + * _.isTypedArray([]); + * // => false + */ + function isTypedArray(value) { + return (isObjectLike(value) && isLength(value.length) && typedArrayTags[objToString.call(value)]) || false; + } + + /** + * Checks if `value` is `undefined`. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to check. + * @returns {boolean} Returns `true` if `value` is `undefined`, else `false`. + * @example + * + * _.isUndefined(void 0); + * // => true + * + * _.isUndefined(null); + * // => false + */ + function isUndefined(value) { + return typeof value == 'undefined'; + } + + /** + * Converts `value` to an array. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to convert. + * @returns {Array} Returns the converted array. + * @example + * + * (function() { return _.toArray(arguments).slice(1); })(1, 2, 3); + * // => [2, 3] + */ + function toArray(value) { + var length = value ? value.length : 0; + if (!isLength(length)) { + return values(value); + } + if (!length) { + return []; + } + return arrayCopy(value); + } + + /** + * Converts `value` to a plain object flattening inherited enumerable + * properties of `value` to own properties of the plain object. + * + * @static + * @memberOf _ + * @category Lang + * @param {*} value The value to convert. + * @returns {Object} Returns the converted plain object. + * @example + * + * function Foo() { + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.assign({ 'a': 1 }, new Foo); + * // => { 'a': 1, 'b': 2 } + * + * _.assign({ 'a': 1 }, _.toPlainObject(new Foo)); + * // => { 'a': 1, 'b': 2, 'c': 3 } + */ + function toPlainObject(value) { + return baseCopy(value, keysIn(value)); + } + + /*------------------------------------------------------------------------*/ + + /** + * Assigns own enumerable properties of source object(s) to the destination + * object. Subsequent sources overwrite property assignments of previous sources. + * If `customizer` is provided it is invoked to produce the assigned values. + * The `customizer` is bound to `thisArg` and invoked with five arguments; + * (objectValue, sourceValue, key, object, source). + * + * @static + * @memberOf _ + * @alias extend + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @param {Function} [customizer] The function to customize assigning values. + * @param {*} [thisArg] The `this` binding of `customizer`. + * @returns {Object} Returns `object`. + * @example + * + * _.assign({ 'user': 'barney' }, { 'age': 40 }, { 'user': 'fred' }); + * // => { 'user': 'fred', 'age': 40 } + * + * // using a customizer callback + * var defaults = _.partialRight(_.assign, function(value, other) { + * return typeof value == 'undefined' ? other : value; + * }); + * + * defaults({ 'user': 'barney' }, { 'age': 36 }, { 'user': 'fred' }); + * // => { 'user': 'barney', 'age': 36 } + */ + var assign = createAssigner(baseAssign); + + /** + * Creates an object that inherits from the given `prototype` object. If a + * `properties` object is provided its own enumerable properties are assigned + * to the created object. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} prototype The object to inherit from. + * @param {Object} [properties] The properties to assign to the object. + * @param- {Object} [guard] Enables use as a callback for functions like `_.map`. + * @returns {Object} Returns the new object. + * @example + * + * function Shape() { + * this.x = 0; + * this.y = 0; + * } + * + * function Circle() { + * Shape.call(this); + * } + * + * Circle.prototype = _.create(Shape.prototype, { 'constructor': Circle }); + * + * var circle = new Circle; + * circle instanceof Circle; + * // => true + * + * circle instanceof Shape; + * // => true + */ + function create(prototype, properties, guard) { + var result = baseCreate(prototype); + if (guard && isIterateeCall(prototype, properties, guard)) { + properties = null; + } + return properties ? baseCopy(properties, result, keys(properties)) : result; + } + + /** + * Assigns own enumerable properties of source object(s) to the destination + * object for all destination properties that resolve to `undefined`. Once a + * property is set, additional defaults of the same property are ignored. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @returns {Object} Returns `object`. + * @example + * + * _.defaults({ 'user': 'barney' }, { 'age': 36 }, { 'user': 'fred' }); + * // => { 'user': 'barney', 'age': 36 } + */ + function defaults(object) { + if (object == null) { + return object; + } + var args = arrayCopy(arguments); + args.push(assignDefaults); + return assign.apply(undefined, args); + } + + /** + * This method is like `_.findIndex` except that it returns the key of the + * first element `predicate` returns truthy for, instead of the element itself. + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to search. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {string|undefined} Returns the key of the matched element, else `undefined`. + * @example + * + * var users = { + * 'barney': { 'age': 36, 'active': true }, + * 'fred': { 'age': 40, 'active': false }, + * 'pebbles': { 'age': 1, 'active': true } + * }; + * + * _.findKey(users, function(chr) { return chr.age < 40; }); + * // => 'barney' (iteration order is not guaranteed) + * + * // using the "_.matches" callback shorthand + * _.findKey(users, { 'age': 1 }); + * // => 'pebbles' + * + * // using the "_.property" callback shorthand + * _.findKey(users, 'active'); + * // => 'barney' + */ + function findKey(object, predicate, thisArg) { + predicate = getCallback(predicate, thisArg, 3); + return baseFind(object, predicate, baseForOwn, true); + } + + /** + * This method is like `_.findKey` except that it iterates over elements of + * a collection in the opposite order. + * + * If a property name is provided for `predicate` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `predicate` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to search. + * @param {Function|Object|string} [predicate=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {string|undefined} Returns the key of the matched element, else `undefined`. + * @example + * + * var users = { + * 'barney': { 'age': 36, 'active': true }, + * 'fred': { 'age': 40, 'active': false }, + * 'pebbles': { 'age': 1, 'active': true } + * }; + * + * _.findLastKey(users, function(chr) { return chr.age < 40; }); + * // => returns `pebbles` assuming `_.findKey` returns `barney` + * + * // using the "_.matches" callback shorthand + * _.findLastKey(users, { 'age': 36 }); + * // => 'barney' + * + * // using the "_.property" callback shorthand + * _.findLastKey(users, 'active'); + * // => 'pebbles' + */ + function findLastKey(object, predicate, thisArg) { + predicate = getCallback(predicate, thisArg, 3); + return baseFind(object, predicate, baseForOwnRight, true); + } + + /** + * Iterates over own and inherited enumerable properties of an object invoking + * `iteratee` for each property. The `iteratee` is bound to `thisArg` and invoked + * with three arguments; (value, key, object). Iterator functions may exit + * iteration early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {Object} Returns `object`. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forIn(new Foo, function(value, key) { + * console.log(key); + * }); + * // => logs 'a', 'b', and 'c' (iteration order is not guaranteed) + */ + function forIn(object, iteratee, thisArg) { + if (typeof iteratee != 'function' || typeof thisArg != 'undefined') { + iteratee = bindCallback(iteratee, thisArg, 3); + } + return baseFor(object, iteratee, keysIn); + } + + /** + * This method is like `_.forIn` except that it iterates over properties of + * `object` in the opposite order. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {Object} Returns `object`. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.forInRight(new Foo, function(value, key) { + * console.log(key); + * }); + * // => logs 'c', 'b', and 'a' assuming `_.forIn ` logs 'a', 'b', and 'c' + */ + function forInRight(object, iteratee, thisArg) { + iteratee = bindCallback(iteratee, thisArg, 3); + return baseForRight(object, iteratee, keysIn); + } + + /** + * Iterates over own enumerable properties of an object invoking `iteratee` + * for each property. The `iteratee` is bound to `thisArg` and invoked with + * three arguments; (value, key, object). Iterator functions may exit iteration + * early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {Object} Returns `object`. + * @example + * + * _.forOwn({ '0': 'zero', '1': 'one', 'length': 2 }, function(n, key) { + * console.log(key); + * }); + * // => logs '0', '1', and 'length' (iteration order is not guaranteed) + */ + function forOwn(object, iteratee, thisArg) { + if (typeof iteratee != 'function' || typeof thisArg != 'undefined') { + iteratee = bindCallback(iteratee, thisArg, 3); + } + return baseForOwn(object, iteratee); + } + + /** + * This method is like `_.forOwn` except that it iterates over properties of + * `object` in the opposite order. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {Object} Returns `object`. + * @example + * + * _.forOwnRight({ '0': 'zero', '1': 'one', 'length': 2 }, function(n, key) { + * console.log(key); + * }); + * // => logs 'length', '1', and '0' assuming `_.forOwn` logs '0', '1', and 'length' + */ + function forOwnRight(object, iteratee, thisArg) { + iteratee = bindCallback(iteratee, thisArg, 3); + return baseForRight(object, iteratee, keys); + } + + /** + * Creates an array of function property names from all enumerable properties, + * own and inherited, of `object`. + * + * @static + * @memberOf _ + * @alias methods + * @category Object + * @param {Object} object The object to inspect. + * @returns {Array} Returns the new array of property names. + * @example + * + * _.functions(_); + * // => ['all', 'any', 'bind', ...] + */ + function functions(object) { + return baseFunctions(object, keysIn(object)); + } + + /** + * Checks if `key` exists as a direct property of `object` instead of an + * inherited property. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to inspect. + * @param {string} key The key to check. + * @returns {boolean} Returns `true` if `key` is a direct property, else `false`. + * @example + * + * _.has({ 'a': 1, 'b': 2, 'c': 3 }, 'b'); + * // => true + */ + function has(object, key) { + return object ? hasOwnProperty.call(object, key) : false; + } + + /** + * Creates an object composed of the inverted keys and values of `object`. + * If `object` contains duplicate values, subsequent values overwrite property + * assignments of previous values unless `multiValue` is `true`. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to invert. + * @param {boolean} [multiValue] Allow multiple values per key. + * @param- {Object} [guard] Enables use as a callback for functions like `_.map`. + * @returns {Object} Returns the new inverted object. + * @example + * + * _.invert({ 'first': 'fred', 'second': 'barney' }); + * // => { 'fred': 'first', 'barney': 'second' } + * + * // without `multiValue` + * _.invert({ 'first': 'fred', 'second': 'barney', 'third': 'fred' }); + * // => { 'fred': 'third', 'barney': 'second' } + * + * // with `multiValue` + * _.invert({ 'first': 'fred', 'second': 'barney', 'third': 'fred' }, true); + * // => { 'fred': ['first', 'third'], 'barney': ['second'] } + */ + function invert(object, multiValue, guard) { + if (guard && isIterateeCall(object, multiValue, guard)) { + multiValue = null; + } + var index = -1, + props = keys(object), + length = props.length, + result = {}; + + while (++index < length) { + var key = props[index], + value = object[key]; + + if (multiValue) { + if (hasOwnProperty.call(result, value)) { + result[value].push(key); + } else { + result[value] = [key]; + } + } + else { + result[value] = key; + } + } + return result; + } + + /** + * Creates an array of the own enumerable property names of `object`. + * + * **Note:** Non-object values are coerced to objects. See the + * [ES spec](https://people.mozilla.org/~jorendorff/es6-draft.html#sec-object.keys) + * for more details. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to inspect. + * @returns {Array} Returns the array of property names. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.keys(new Foo); + * // => ['a', 'b'] (iteration order is not guaranteed) + * + * _.keys('hi'); + * // => ['0', '1'] + */ + var keys = !nativeKeys ? shimKeys : function(object) { + if (object) { + var Ctor = object.constructor, + length = object.length; + } + if ((typeof Ctor == 'function' && Ctor.prototype === object) || + (typeof object != 'function' && (length && isLength(length)))) { + return shimKeys(object); + } + return isObject(object) ? nativeKeys(object) : []; + }; + + /** + * Creates an array of the own and inherited enumerable property names of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to inspect. + * @returns {Array} Returns the array of property names. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.keysIn(new Foo); + * // => ['a', 'b', 'c'] (iteration order is not guaranteed) + */ + function keysIn(object) { + if (object == null) { + return []; + } + if (!isObject(object)) { + object = Object(object); + } + var length = object.length; + length = (length && isLength(length) && + (isArray(object) || (support.nonEnumArgs && isArguments(object))) && length) || 0; + + var Ctor = object.constructor, + index = -1, + isProto = typeof Ctor == 'function' && Ctor.prototype == object, + result = Array(length), + skipIndexes = length > 0; + + while (++index < length) { + result[index] = (index + ''); + } + for (var key in object) { + if (!(skipIndexes && isIndex(key, length)) && + !(key == 'constructor' && (isProto || !hasOwnProperty.call(object, key)))) { + result.push(key); + } + } + return result; + } + + /** + * Creates an object with the same keys as `object` and values generated by + * running each own enumerable property of `object` through `iteratee`. The + * iteratee function is bound to `thisArg` and invoked with three arguments; + * (value, key, object). + * + * If a property name is provided for `iteratee` the created "_.property" + * style callback returns the property value of the given element. + * + * If an object is provided for `iteratee` the created "_.matches" style + * callback returns `true` for elements that have the properties of the given + * object, else `false`. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to iterate over. + * @param {Function|Object|string} [iteratee=_.identity] The function invoked + * per iteration. If a property name or object is provided it is used to + * create a "_.property" or "_.matches" style callback respectively. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {Object} Returns the new mapped object. + * @example + * + * _.mapValues({ 'a': 1, 'b': 2, 'c': 3} , function(n) { return n * 3; }); + * // => { 'a': 3, 'b': 6, 'c': 9 } + * + * var users = { + * 'fred': { 'user': 'fred', 'age': 40 }, + * 'pebbles': { 'user': 'pebbles', 'age': 1 } + * }; + * + * // using the "_.property" callback shorthand + * _.mapValues(users, 'age'); + * // => { 'fred': 40, 'pebbles': 1 } (iteration order is not guaranteed) + */ + function mapValues(object, iteratee, thisArg) { + var result = {}; + iteratee = getCallback(iteratee, thisArg, 3); + + baseForOwn(object, function(value, key, object) { + result[key] = iteratee(value, key, object); + }); + return result; + } + + /** + * Recursively merges own enumerable properties of the source object(s), that + * don't resolve to `undefined` into the destination object. Subsequent sources + * overwrite property assignments of previous sources. If `customizer` is + * provided it is invoked to produce the merged values of the destination and + * source properties. If `customizer` returns `undefined` merging is handled + * by the method instead. The `customizer` is bound to `thisArg` and invoked + * with five arguments; (objectValue, sourceValue, key, object, source). + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The destination object. + * @param {...Object} [sources] The source objects. + * @param {Function} [customizer] The function to customize merging properties. + * @param {*} [thisArg] The `this` binding of `customizer`. + * @returns {Object} Returns `object`. + * @example + * + * var users = { + * 'data': [{ 'user': 'barney' }, { 'user': 'fred' }] + * }; + * + * var ages = { + * 'data': [{ 'age': 36 }, { 'age': 40 }] + * }; + * + * _.merge(users, ages); + * // => { 'data': [{ 'user': 'barney', 'age': 36 }, { 'user': 'fred', 'age': 40 }] } + * + * // using a customizer callback + * var object = { + * 'fruits': ['apple'], + * 'vegetables': ['beet'] + * }; + * + * var other = { + * 'fruits': ['banana'], + * 'vegetables': ['carrot'] + * }; + * + * _.merge(object, other, function(a, b) { + * return _.isArray(a) ? a.concat(b) : undefined; + * }); + * // => { 'fruits': ['apple', 'banana'], 'vegetables': ['beet', 'carrot'] } + */ + var merge = createAssigner(baseMerge); + + /** + * The opposite of `_.pick`; this method creates an object composed of the + * own and inherited enumerable properties of `object` that are not omitted. + * Property names may be specified as individual arguments or as arrays of + * property names. If `predicate` is provided it is invoked for each property + * of `object` omitting the properties `predicate` returns truthy for. The + * predicate is bound to `thisArg` and invoked with three arguments; + * (value, key, object). + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The source object. + * @param {Function|...(string|string[])} [predicate] The function invoked per + * iteration or property names to omit, specified as individual property + * names or arrays of property names. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'user': 'fred', 'age': 40 }; + * + * _.omit(object, 'age'); + * // => { 'user': 'fred' } + * + * _.omit(object, _.isNumber); + * // => { 'user': 'fred' } + */ + function omit(object, predicate, thisArg) { + if (object == null) { + return {}; + } + if (typeof predicate != 'function') { + var props = arrayMap(baseFlatten(arguments, false, false, 1), String); + return pickByArray(object, baseDifference(keysIn(object), props)); + } + predicate = bindCallback(predicate, thisArg, 3); + return pickByCallback(object, function(value, key, object) { + return !predicate(value, key, object); + }); + } + + /** + * Creates a two dimensional array of the key-value pairs for `object`, + * e.g. `[[key1, value1], [key2, value2]]`. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to inspect. + * @returns {Array} Returns the new array of key-value pairs. + * @example + * + * _.pairs({ 'barney': 36, 'fred': 40 }); + * // => [['barney', 36], ['fred', 40]] (iteration order is not guaranteed) + */ + function pairs(object) { + var index = -1, + props = keys(object), + length = props.length, + result = Array(length); + + while (++index < length) { + var key = props[index]; + result[index] = [key, object[key]]; + } + return result; + } + + /** + * Creates an object composed of the picked `object` properties. Property + * names may be specified as individual arguments or as arrays of property + * names. If `predicate` is provided it is invoked for each property of `object` + * picking the properties `predicate` returns truthy for. The predicate is + * bound to `thisArg` and invoked with three arguments; (value, key, object). + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The source object. + * @param {Function|...(string|string[])} [predicate] The function invoked per + * iteration or property names to pick, specified as individual property + * names or arrays of property names. + * @param {*} [thisArg] The `this` binding of `predicate`. + * @returns {Object} Returns the new object. + * @example + * + * var object = { 'user': 'fred', 'age': 40 }; + * + * _.pick(object, 'user'); + * // => { 'user': 'fred' } + * + * _.pick(object, _.isString); + * // => { 'user': 'fred' } + */ + function pick(object, predicate, thisArg) { + if (object == null) { + return {}; + } + return typeof predicate == 'function' + ? pickByCallback(object, bindCallback(predicate, thisArg, 3)) + : pickByArray(object, baseFlatten(arguments, false, false, 1)); + } + + /** + * Resolves the value of property `key` on `object`. If the value of `key` is + * a function it is invoked with the `this` binding of `object` and its result + * is returned, else the property value is returned. If the property value is + * `undefined` the `defaultValue` is used in its place. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @param {string} key The key of the property to resolve. + * @param {*} [defaultValue] The value returned if the property value + * resolves to `undefined`. + * @returns {*} Returns the resolved value. + * @example + * + * var object = { 'user': 'fred', 'age': _.constant(40) }; + * + * _.result(object, 'user'); + * // => 'fred' + * + * _.result(object, 'age'); + * // => 40 + * + * _.result(object, 'status', 'busy'); + * // => 'busy' + * + * _.result(object, 'status', _.constant('busy')); + * // => 'busy' + */ + function result(object, key, defaultValue) { + var value = object == null ? undefined : object[key]; + if (typeof value == 'undefined') { + value = defaultValue; + } + return isFunction(value) ? value.call(object) : value; + } + + /** + * An alternative to `_.reduce`; this method transforms `object` to a new + * `accumulator` object which is the result of running each of its own enumerable + * properties through `iteratee`, with each invocation potentially mutating + * the `accumulator` object. The `iteratee` is bound to `thisArg` and invoked + * with four arguments; (accumulator, value, key, object). Iterator functions + * may exit iteration early by explicitly returning `false`. + * + * @static + * @memberOf _ + * @category Object + * @param {Array|Object} object The object to iterate over. + * @param {Function} [iteratee=_.identity] The function invoked per iteration. + * @param {*} [accumulator] The custom accumulator value. + * @param {*} [thisArg] The `this` binding of `iteratee`. + * @returns {*} Returns the accumulated value. + * @example + * + * var squares = _.transform([1, 2, 3, 4, 5, 6], function(result, n) { + * n *= n; + * if (n % 2) { + * return result.push(n) < 3; + * } + * }); + * // => [1, 9, 25] + * + * var mapped = _.transform({ 'a': 1, 'b': 2, 'c': 3 }, function(result, n, key) { + * result[key] = n * 3; + * }); + * // => { 'a': 3, 'b': 6, 'c': 9 } + */ + function transform(object, iteratee, accumulator, thisArg) { + var isArr = isArray(object) || isTypedArray(object); + iteratee = getCallback(iteratee, thisArg, 4); + + if (accumulator == null) { + if (isArr || isObject(object)) { + var Ctor = object.constructor; + if (isArr) { + accumulator = isArray(object) ? new Ctor : []; + } else { + accumulator = baseCreate(typeof Ctor == 'function' && Ctor.prototype); + } + } else { + accumulator = {}; + } + } + (isArr ? arrayEach : baseForOwn)(object, function(value, index, object) { + return iteratee(accumulator, value, index, object); + }); + return accumulator; + } + + /** + * Creates an array of the own enumerable property values of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property values. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.values(new Foo); + * // => [1, 2] (iteration order is not guaranteed) + * + * _.values('hi'); + * // => ['h', 'i'] + */ + function values(object) { + return baseValues(object, keys(object)); + } + + /** + * Creates an array of the own and inherited enumerable property values + * of `object`. + * + * **Note:** Non-object values are coerced to objects. + * + * @static + * @memberOf _ + * @category Object + * @param {Object} object The object to query. + * @returns {Array} Returns the array of property values. + * @example + * + * function Foo() { + * this.a = 1; + * this.b = 2; + * } + * + * Foo.prototype.c = 3; + * + * _.valuesIn(new Foo); + * // => [1, 2, 3] (iteration order is not guaranteed) + */ + function valuesIn(object) { + return baseValues(object, keysIn(object)); + } + + /*------------------------------------------------------------------------*/ + + /** + * Produces a random number between `min` and `max` (inclusive). If only one + * argument is provided a number between `0` and the given number is returned. + * If `floating` is `true`, or either `min` or `max` are floats, a floating-point + * number is returned instead of an integer. + * + * @static + * @memberOf _ + * @category Number + * @param {number} [min=0] The minimum possible value. + * @param {number} [max=1] The maximum possible value. + * @param {boolean} [floating] Specify returning a floating-point number. + * @returns {number} Returns the random number. + * @example + * + * _.random(0, 5); + * // => an integer between 0 and 5 + * + * _.random(5); + * // => also an integer between 0 and 5 + * + * _.random(5, true); + * // => a floating-point number between 0 and 5 + * + * _.random(1.2, 5.2); + * // => a floating-point number between 1.2 and 5.2 + */ + function random(min, max, floating) { + if (floating && isIterateeCall(min, max, floating)) { + max = floating = null; + } + var noMin = min == null, + noMax = max == null; + + if (floating == null) { + if (noMax && typeof min == 'boolean') { + floating = min; + min = 1; + } + else if (typeof max == 'boolean') { + floating = max; + noMax = true; + } + } + if (noMin && noMax) { + max = 1; + noMax = false; + } + min = +min || 0; + if (noMax) { + max = min; + min = 0; + } else { + max = +max || 0; + } + if (floating || min % 1 || max % 1) { + var rand = nativeRandom(); + return nativeMin(min + (rand * (max - min + parseFloat('1e-' + ((rand + '').length - 1)))), max); + } + return baseRandom(min, max); + } + + /*------------------------------------------------------------------------*/ + + /** + * Converts `string` to camel case. + * See [Wikipedia](https://en.wikipedia.org/wiki/CamelCase) for more details. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the camel cased string. + * @example + * + * _.camelCase('Foo Bar'); + * // => 'fooBar' + * + * _.camelCase('--foo-bar'); + * // => 'fooBar' + * + * _.camelCase('__foo_bar__'); + * // => 'fooBar' + */ + var camelCase = createCompounder(function(result, word, index) { + word = word.toLowerCase(); + return result + (index ? (word.charAt(0).toUpperCase() + word.slice(1)) : word); + }); + + /** + * Capitalizes the first character of `string`. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to capitalize. + * @returns {string} Returns the capitalized string. + * @example + * + * _.capitalize('fred'); + * // => 'Fred' + */ + function capitalize(string) { + string = baseToString(string); + return string && (string.charAt(0).toUpperCase() + string.slice(1)); + } + + /** + * Deburrs `string` by converting latin-1 supplementary letters to basic latin letters. + * See [Wikipedia](https://en.wikipedia.org/wiki/Latin-1_Supplement_(Unicode_block)#Character_table) + * for more details. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to deburr. + * @returns {string} Returns the deburred string. + * @example + * + * _.deburr('déjà vu'); + * // => 'deja vu' + */ + function deburr(string) { + string = baseToString(string); + return string && string.replace(reLatin1, deburrLetter); + } + + /** + * Checks if `string` ends with the given target string. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to search. + * @param {string} [target] The string to search for. + * @param {number} [position=string.length] The position to search from. + * @returns {boolean} Returns `true` if `string` ends with `target`, else `false`. + * @example + * + * _.endsWith('abc', 'c'); + * // => true + * + * _.endsWith('abc', 'b'); + * // => false + * + * _.endsWith('abc', 'b', 2); + * // => true + */ + function endsWith(string, target, position) { + string = baseToString(string); + target = (target + ''); + + var length = string.length; + position = (typeof position == 'undefined' ? length : nativeMin(position < 0 ? 0 : (+position || 0), length)) - target.length; + return position >= 0 && string.indexOf(target, position) == position; + } + + /** + * Converts the characters "&", "<", ">", '"', "'", and '`', in `string` to + * their corresponding HTML entities. + * + * **Note:** No other characters are escaped. To escape additional characters + * use a third-party library like [_he_](https://mths.be/he). + * + * Though the ">" character is escaped for symmetry, characters like + * ">" and "/" don't require escaping in HTML and have no special meaning + * unless they're part of a tag or unquoted attribute value. + * See [Mathias Bynens's article](https://mathiasbynens.be/notes/ambiguous-ampersands) + * (under "semi-related fun fact") for more details. + * + * Backticks are escaped because in Internet Explorer < 9, they can break out + * of attribute values or HTML comments. See [#102](https://html5sec.org/#102), + * [#108](https://html5sec.org/#108), and [#133](https://html5sec.org/#133) of + * the [HTML5 Security Cheatsheet](https://html5sec.org/) for more details. + * + * When working with HTML you should always quote attribute values to reduce + * XSS vectors. See [Ryan Grove's article](http://wonko.com/post/html-escaping) + * for more details. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to escape. + * @returns {string} Returns the escaped string. + * @example + * + * _.escape('fred, barney, & pebbles'); + * // => 'fred, barney, & pebbles' + */ + function escape(string) { + // Reset `lastIndex` because in IE < 9 `String#replace` does not. + string = baseToString(string); + return (string && reHasUnescapedHtml.test(string)) + ? string.replace(reUnescapedHtml, escapeHtmlChar) + : string; + } + + /** + * Escapes the `RegExp` special characters "\", "^", "$", ".", "|", "?", "*", + * "+", "(", ")", "[", "]", "{" and "}" in `string`. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to escape. + * @returns {string} Returns the escaped string. + * @example + * + * _.escapeRegExp('[lodash](https://lodash.com/)'); + * // => '\[lodash\]\(https://lodash\.com/\)' + */ + function escapeRegExp(string) { + string = baseToString(string); + return (string && reHasRegExpChars.test(string)) + ? string.replace(reRegExpChars, '\\$&') + : string; + } + + /** + * Converts `string` to kebab case (a.k.a. spinal case). + * See [Wikipedia](https://en.wikipedia.org/wiki/Letter_case#Special_case_styles) for + * more details. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the kebab cased string. + * @example + * + * _.kebabCase('Foo Bar'); + * // => 'foo-bar' + * + * _.kebabCase('fooBar'); + * // => 'foo-bar' + * + * _.kebabCase('__foo_bar__'); + * // => 'foo-bar' + */ + var kebabCase = createCompounder(function(result, word, index) { + return result + (index ? '-' : '') + word.toLowerCase(); + }); + + /** + * Pads `string` on the left and right sides if it is shorter then the given + * padding length. The `chars` string may be truncated if the number of padding + * characters can't be evenly divided by the padding length. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.pad('abc', 8); + * // => ' abc ' + * + * _.pad('abc', 8, '_-'); + * // => '_-abc_-_' + * + * _.pad('abc', 3); + * // => 'abc' + */ + function pad(string, length, chars) { + string = baseToString(string); + length = +length; + + var strLength = string.length; + if (strLength >= length || !nativeIsFinite(length)) { + return string; + } + var mid = (length - strLength) / 2, + leftLength = floor(mid), + rightLength = ceil(mid); + + chars = createPad('', rightLength, chars); + return chars.slice(0, leftLength) + string + chars; + } + + /** + * Pads `string` on the left side if it is shorter then the given padding + * length. The `chars` string may be truncated if the number of padding + * characters exceeds the padding length. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.padLeft('abc', 6); + * // => ' abc' + * + * _.padLeft('abc', 6, '_-'); + * // => '_-_abc' + * + * _.padLeft('abc', 3); + * // => 'abc' + */ + function padLeft(string, length, chars) { + string = baseToString(string); + return string && (createPad(string, length, chars) + string); + } + + /** + * Pads `string` on the right side if it is shorter then the given padding + * length. The `chars` string may be truncated if the number of padding + * characters exceeds the padding length. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to pad. + * @param {number} [length=0] The padding length. + * @param {string} [chars=' '] The string used as padding. + * @returns {string} Returns the padded string. + * @example + * + * _.padRight('abc', 6); + * // => 'abc ' + * + * _.padRight('abc', 6, '_-'); + * // => 'abc_-_' + * + * _.padRight('abc', 3); + * // => 'abc' + */ + function padRight(string, length, chars) { + string = baseToString(string); + return string && (string + createPad(string, length, chars)); + } + + /** + * Converts `string` to an integer of the specified radix. If `radix` is + * `undefined` or `0`, a `radix` of `10` is used unless `value` is a hexadecimal, + * in which case a `radix` of `16` is used. + * + * **Note:** This method aligns with the ES5 implementation of `parseInt`. + * See the [ES5 spec](https://es5.github.io/#E) for more details. + * + * @static + * @memberOf _ + * @category String + * @param {string} string The string to convert. + * @param {number} [radix] The radix to interpret `value` by. + * @param- {Object} [guard] Enables use as a callback for functions like `_.map`. + * @returns {number} Returns the converted integer. + * @example + * + * _.parseInt('08'); + * // => 8 + * + * _.map(['6', '08', '10'], _.parseInt); + * // => [6, 8, 10] + */ + function parseInt(string, radix, guard) { + if (guard && isIterateeCall(string, radix, guard)) { + radix = 0; + } + return nativeParseInt(string, radix); + } + // Fallback for environments with pre-ES5 implementations. + if (nativeParseInt(whitespace + '08') != 8) { + parseInt = function(string, radix, guard) { + // Firefox < 21 and Opera < 15 follow ES3 for `parseInt`. + // Chrome fails to trim leading whitespace characters. + // See https://code.google.com/p/v8/issues/detail?id=3109 for more details. + if (guard ? isIterateeCall(string, radix, guard) : radix == null) { + radix = 0; + } else if (radix) { + radix = +radix; + } + string = trim(string); + return nativeParseInt(string, radix || (reHexPrefix.test(string) ? 16 : 10)); + }; + } + + /** + * Repeats the given string `n` times. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to repeat. + * @param {number} [n=0] The number of times to repeat the string. + * @returns {string} Returns the repeated string. + * @example + * + * _.repeat('*', 3); + * // => '***' + * + * _.repeat('abc', 2); + * // => 'abcabc' + * + * _.repeat('abc', 0); + * // => '' + */ + function repeat(string, n) { + var result = ''; + string = baseToString(string); + n = +n; + if (n < 1 || !string || !nativeIsFinite(n)) { + return result; + } + // Leverage the exponentiation by squaring algorithm for a faster repeat. + // See https://en.wikipedia.org/wiki/Exponentiation_by_squaring for more details. + do { + if (n % 2) { + result += string; + } + n = floor(n / 2); + string += string; + } while (n); + + return result; + } + + /** + * Converts `string` to snake case. + * See [Wikipedia](https://en.wikipedia.org/wiki/Snake_case) for more details. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the snake cased string. + * @example + * + * _.snakeCase('Foo Bar'); + * // => 'foo_bar' + * + * _.snakeCase('fooBar'); + * // => 'foo_bar' + * + * _.snakeCase('--foo-bar'); + * // => 'foo_bar' + */ + var snakeCase = createCompounder(function(result, word, index) { + return result + (index ? '_' : '') + word.toLowerCase(); + }); + + /** + * Converts `string` to start case. + * See [Wikipedia](https://en.wikipedia.org/wiki/Letter_case#Stylistic_or_specialised_usage) + * for more details. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to convert. + * @returns {string} Returns the start cased string. + * @example + * + * _.startCase('--foo-bar'); + * // => 'Foo Bar' + * + * _.startCase('fooBar'); + * // => 'Foo Bar' + * + * _.startCase('__foo_bar__'); + * // => 'Foo Bar' + */ + var startCase = createCompounder(function(result, word, index) { + return result + (index ? ' ' : '') + (word.charAt(0).toUpperCase() + word.slice(1)); + }); + + /** + * Checks if `string` starts with the given target string. + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The string to search. + * @param {string} [target] The string to search for. + * @param {number} [position=0] The position to search from. + * @returns {boolean} Returns `true` if `string` starts with `target`, else `false`. + * @example + * + * _.startsWith('abc', 'a'); + * // => true + * + * _.startsWith('abc', 'b'); + * // => false + * + * _.startsWith('abc', 'b', 1); + * // => true + */ + function startsWith(string, target, position) { + string = baseToString(string); + position = position == null ? 0 : nativeMin(position < 0 ? 0 : (+position || 0), string.length); + return string.lastIndexOf(target, position) == position; + } + + /** + * Creates a compiled template function that can interpolate data properties + * in "interpolate" delimiters, HTML-escape interpolated data properties in + * "escape" delimiters, and execute JavaScript in "evaluate" delimiters. Data + * properties may be accessed as free variables in the template. If a setting + * object is provided it takes precedence over `_.templateSettings` values. + * + * **Note:** In the development build `_.template` utilizes sourceURLs for easier debugging. + * See the [HTML5 Rocks article on sourcemaps](http://www.html5rocks.com/en/tutorials/developertools/sourcemaps/#toc-sourceurl) + * for more details. + * + * For more information on precompiling templates see + * [lodash's custom builds documentation](https://lodash.com/custom-builds). + * + * For more information on Chrome extension sandboxes see + * [Chrome's extensions documentation](https://developer.chrome.com/extensions/sandboxingEval). + * + * @static + * @memberOf _ + * @category String + * @param {string} [string=''] The template string. + * @param {Object} [options] The options object. + * @param {RegExp} [options.escape] The HTML "escape" delimiter. + * @param {RegExp} [options.evaluate] The "evaluate" delimiter. + * @param {Object} [options.imports] An object to import into the template as free variables. + * @param {RegExp} [options.interpolate] The "interpolate" delimiter. + * @param {string} [options.sourceURL] The sourceURL of the template's compiled source. + * @param {string} [options.variable] The data object variable name. + * @param- {Object} [otherOptions] Enables the legacy `options` param signature. + * @returns {Function} Returns the compiled template function. + * @example + * + * // using the "interpolate" delimiter to create a compiled template + * var compiled = _.template('hello <%= user %>!'); + * compiled({ 'user': 'fred' }); + * // => 'hello fred!' + * + * // using the HTML "escape" delimiter to escape data property values + * var compiled = _.template('<%- value %>'); + * compiled({ 'value': ' + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/gantt.html b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/gantt.html new file mode 100644 index 0000000..145f977 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/gantt.html @@ -0,0 +1,304 @@ + + + + + + + + + + + + + + + + +
+ + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/gauge.html b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/gauge.html new file mode 100644 index 0000000..6f9c1d4 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/gauge.html @@ -0,0 +1,71 @@ + + + + + + + amCharts Responsive Example + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/images/bicycle.png b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/images/bicycle.png new file mode 100644 index 0000000..0873bf9 Binary files /dev/null and b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/images/bicycle.png differ diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/images/car.png b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/images/car.png new file mode 100644 index 0000000..4214fb7 Binary files /dev/null and b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/images/car.png differ diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/images/motorcycle.png b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/images/motorcycle.png new file mode 100644 index 0000000..47c6ce8 Binary files /dev/null and b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/images/motorcycle.png differ diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/index.html b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/index.html new file mode 100644 index 0000000..07e6d69 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/index.html @@ -0,0 +1,112 @@ + + + + + + amCharts Responsive Example + + + + + + + + + + +
+ + + + + + +
+ +
800x500px
+
+ +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/map.html b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/map.html new file mode 100644 index 0000000..fba6ae7 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/map.html @@ -0,0 +1,198 @@ + + + + + + + amCharts Responsive Example + + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/pie1.html b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/pie1.html new file mode 100644 index 0000000..5b69183 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/pie1.html @@ -0,0 +1,71 @@ + + + + + + + amCharts Responsive Example + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/pie2.html b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/pie2.html new file mode 100644 index 0000000..4b41a3b --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/pie2.html @@ -0,0 +1,73 @@ + + + + + + + amCharts Responsive Example + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/pie3.html b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/pie3.html new file mode 100644 index 0000000..e0f2d7d --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/pie3.html @@ -0,0 +1,106 @@ + + + + + + + amCharts Responsive Example + + + + + + + + +
+
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/radar.html b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/radar.html new file mode 100644 index 0000000..dbfb314 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/radar.html @@ -0,0 +1,67 @@ + + + + + + + amCharts Responsive Example + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/serial1.html b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/serial1.html new file mode 100644 index 0000000..fcdce99 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/serial1.html @@ -0,0 +1,203 @@ + + + + + + + amCharts Responsive Example + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/serial2.html b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/serial2.html new file mode 100644 index 0000000..6610515 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/serial2.html @@ -0,0 +1,84 @@ + + + + + + + amCharts Responsive Example + + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/serial3.html b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/serial3.html new file mode 100644 index 0000000..351d1eb --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/serial3.html @@ -0,0 +1,103 @@ + + + + + + + amCharts Responsive Example + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/stock.html b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/stock.html new file mode 100644 index 0000000..71b50dc --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/stock.html @@ -0,0 +1,210 @@ + + + + + + + amCharts Responsive Example + + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/xy.html b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/xy.html new file mode 100644 index 0000000..8d61d70 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/examples/xy.html @@ -0,0 +1,145 @@ + + + + + + + amCharts Responsive Example + + + + + + + + +
+ + + \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/license.txt b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/license.txt new file mode 100644 index 0000000..9c8f3ea --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/license.txt @@ -0,0 +1,201 @@ + Apache License + Version 2.0, January 2004 + http://www.apache.org/licenses/ + + TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION + + 1. Definitions. + + "License" shall mean the terms and conditions for use, reproduction, + and distribution as defined by Sections 1 through 9 of this document. + + "Licensor" shall mean the copyright owner or entity authorized by + the copyright owner that is granting the License. + + "Legal Entity" shall mean the union of the acting entity and all + other entities that control, are controlled by, or are under common + control with that entity. For the purposes of this definition, + "control" means (i) the power, direct or indirect, to cause the + direction or management of such entity, whether by contract or + otherwise, or (ii) ownership of fifty percent (50%) or more of the + outstanding shares, or (iii) beneficial ownership of such entity. + + "You" (or "Your") shall mean an individual or Legal Entity + exercising permissions granted by this License. + + "Source" form shall mean the preferred form for making modifications, + including but not limited to software source code, documentation + source, and configuration files. + + "Object" form shall mean any form resulting from mechanical + transformation or translation of a Source form, including but + not limited to compiled object code, generated documentation, + and conversions to other media types. + + "Work" shall mean the work of authorship, whether in Source or + Object form, made available under the License, as indicated by a + copyright notice that is included in or attached to the work + (an example is provided in the Appendix below). + + "Derivative Works" shall mean any work, whether in Source or Object + form, that is based on (or derived from) the Work and for which the + editorial revisions, annotations, elaborations, or other modifications + represent, as a whole, an original work of authorship. For the purposes + of this License, Derivative Works shall not include works that remain + separable from, or merely link (or bind by name) to the interfaces of, + the Work and Derivative Works thereof. + + "Contribution" shall mean any work of authorship, including + the original version of the Work and any modifications or additions + to that Work or Derivative Works thereof, that is intentionally + submitted to Licensor for inclusion in the Work by the copyright owner + or by an individual or Legal Entity authorized to submit on behalf of + the copyright owner. For the purposes of this definition, "submitted" + means any form of electronic, verbal, or written communication sent + to the Licensor or its representatives, including but not limited to + communication on electronic mailing lists, source code control systems, + and issue tracking systems that are managed by, or on behalf of, the + Licensor for the purpose of discussing and improving the Work, but + excluding communication that is conspicuously marked or otherwise + designated in writing by the copyright owner as "Not a Contribution." + + "Contributor" shall mean Licensor and any individual or Legal Entity + on behalf of whom a Contribution has been received by Licensor and + subsequently incorporated within the Work. + + 2. Grant of Copyright License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + copyright license to reproduce, prepare Derivative Works of, + publicly display, publicly perform, sublicense, and distribute the + Work and such Derivative Works in Source or Object form. + + 3. Grant of Patent License. Subject to the terms and conditions of + this License, each Contributor hereby grants to You a perpetual, + worldwide, non-exclusive, no-charge, royalty-free, irrevocable + (except as stated in this section) patent license to make, have made, + use, offer to sell, sell, import, and otherwise transfer the Work, + where such license applies only to those patent claims licensable + by such Contributor that are necessarily infringed by their + Contribution(s) alone or by combination of their Contribution(s) + with the Work to which such Contribution(s) was submitted. If You + institute patent litigation against any entity (including a + cross-claim or counterclaim in a lawsuit) alleging that the Work + or a Contribution incorporated within the Work constitutes direct + or contributory patent infringement, then any patent licenses + granted to You under this License for that Work shall terminate + as of the date such litigation is filed. + + 4. Redistribution. You may reproduce and distribute copies of the + Work or Derivative Works thereof in any medium, with or without + modifications, and in Source or Object form, provided that You + meet the following conditions: + + (a) You must give any other recipients of the Work or + Derivative Works a copy of this License; and + + (b) You must cause any modified files to carry prominent notices + stating that You changed the files; and + + (c) You must retain, in the Source form of any Derivative Works + that You distribute, all copyright, patent, trademark, and + attribution notices from the Source form of the Work, + excluding those notices that do not pertain to any part of + the Derivative Works; and + + (d) If the Work includes a "NOTICE" text file as part of its + distribution, then any Derivative Works that You distribute must + include a readable copy of the attribution notices contained + within such NOTICE file, excluding those notices that do not + pertain to any part of the Derivative Works, in at least one + of the following places: within a NOTICE text file distributed + as part of the Derivative Works; within the Source form or + documentation, if provided along with the Derivative Works; or, + within a display generated by the Derivative Works, if and + wherever such third-party notices normally appear. The contents + of the NOTICE file are for informational purposes only and + do not modify the License. You may add Your own attribution + notices within Derivative Works that You distribute, alongside + or as an addendum to the NOTICE text from the Work, provided + that such additional attribution notices cannot be construed + as modifying the License. + + You may add Your own copyright statement to Your modifications and + may provide additional or different license terms and conditions + for use, reproduction, or distribution of Your modifications, or + for any such Derivative Works as a whole, provided Your use, + reproduction, and distribution of the Work otherwise complies with + the conditions stated in this License. + + 5. Submission of Contributions. Unless You explicitly state otherwise, + any Contribution intentionally submitted for inclusion in the Work + by You to the Licensor shall be under the terms and conditions of + this License, without any additional terms or conditions. + Notwithstanding the above, nothing herein shall supersede or modify + the terms of any separate license agreement you may have executed + with Licensor regarding such Contributions. + + 6. Trademarks. This License does not grant permission to use the trade + names, trademarks, service marks, or product names of the Licensor, + except as required for reasonable and customary use in describing the + origin of the Work and reproducing the content of the NOTICE file. + + 7. Disclaimer of Warranty. Unless required by applicable law or + agreed to in writing, Licensor provides the Work (and each + Contributor provides its Contributions) on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or + implied, including, without limitation, any warranties or conditions + of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A + PARTICULAR PURPOSE. You are solely responsible for determining the + appropriateness of using or redistributing the Work and assume any + risks associated with Your exercise of permissions under this License. + + 8. Limitation of Liability. In no event and under no legal theory, + whether in tort (including negligence), contract, or otherwise, + unless required by applicable law (such as deliberate and grossly + negligent acts) or agreed to in writing, shall any Contributor be + liable to You for damages, including any direct, indirect, special, + incidental, or consequential damages of any character arising as a + result of this License or out of the use or inability to use the + Work (including but not limited to damages for loss of goodwill, + work stoppage, computer failure or malfunction, or any and all + other commercial damages or losses), even if such Contributor + has been advised of the possibility of such damages. + + 9. Accepting Warranty or Additional Liability. While redistributing + the Work or Derivative Works thereof, You may choose to offer, + and charge a fee for, acceptance of support, warranty, indemnity, + or other liability obligations and/or rights consistent with this + License. However, in accepting such obligations, You may act only + on Your own behalf and on Your sole responsibility, not on behalf + of any other Contributor, and only if You agree to indemnify, + defend, and hold each Contributor harmless for any liability + incurred by, or claims asserted against, such Contributor by reason + of your accepting any such warranty or additional liability. + + END OF TERMS AND CONDITIONS + + APPENDIX: How to apply the Apache License to your work. + + To apply the Apache License to your work, attach the following + boilerplate notice, with the fields enclosed by brackets "{}" + replaced with your own identifying information. (Don't include + the brackets!) The text should be enclosed in the appropriate + comment syntax for the file format. We also recommend that a + file or class name and description of purpose be included on the + same "printed page" as the copyright notice for easier + identification within third-party archives. + + Copyright {yyyy} {name of copyright owner} + + Licensed under the Apache License, Version 2.0 (the "License"); + you may not use this file except in compliance with the License. + You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + + Unless required by applicable law or agreed to in writing, software + distributed under the License is distributed on an "AS IS" BASIS, + WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + See the License for the specific language governing permissions and + limitations under the License. \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/readme.md b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/readme.md new file mode 100644 index 0000000..f93f883 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/readme.md @@ -0,0 +1,360 @@ +# amCharts Responsive + +Version: 1.0.1 + + +## Description + +Use this plugin to enable "responsive" features for amCharts' JavaScript Charts, +JavaScript Stock Chart, or JavaScript Maps. + +"Responsive" chart or map will modify it's features dynamically (even as you +resize the container) based on the available area. For example: a full fledged +line chart with legend guides, labels, titles and other elements will be +displayed in all its glory if container is big enough. + +If the container shrinks (i.e. you resize a browser window or view it on an +iPad), it starts "compacting" the chart. First the legend is removed. Shrink it +even further, axis titles are removed and its value labels are moved inside the +plot area. Going even smaller, bullets, labels gone. All the way to the +sparkline representation of the chart. + +Plugin brings a universal set of pre-defined rules that you can use to instantly +enable responsiveness. Those are custom-tailored for each chart/map type and +will probably fit your requirements out-of the-box. All you need to do is to +enable "responsive" plugin for your chart instance. + +You can modify those defaults rules, or make your own list. The plugin allows +that. (see further down this file for instructions) + + +## Usage + +1. Include the minified version of file of this plugin. I.e.: + +``` + +``` + +(this needs to go after all the other amCharts includes) + +2. Add the following setting to your chart configuration: + +``` +AmCharts.makeChart( "chartdiv", { + ..., + "responsive": { + "enabled": true + } +} ); +``` + +Or if you are using non-JSON setup: + +``` +chart.responsive = { + "enabled": true +}; +``` + +That's it. + + +## Advanced use + +### Rules + +You can modify (or completely overwrite) the default responsive rules used by +the plugin. + +A plugin works by checking chart area dimensions after each resize. (or after +initial build / mobile device orientation change) It then overrides particular +settings suitable for these particular dimensions. + +Override rules are implemented by defining chart rules, or just "rules" moving +forward. Each rule has two things: + +1. Dimension conditions; +2. Overrides. (a set of properties to override for this particular rule) + +A rule is an object, for example: + +``` +{ + "minWidth": 200, + "maxWidth": 400, + "maxHeight": 400, + "minHeight": 200, + "overrides": { + "precision": 2, + "legend": { + "enabled": false + }, + "valueAxes": { + "inside": true + } + } +} +``` + +The above rule will be applicable to a chart that is between 200px and 400px in +width and height. + +It is not necessary to add all of the dimensional properties. You just neat at +least one. + +So for example to make the rule apply to all charts with width 400px or lower, +you would do something like this: + +``` +{ + "maxWidth": 400, + "overrides": { + "precision": 2, + "legend": { + "enabled": false + }, + "valueAxes": { + "inside": true + } + } +} +``` + +Please note that there are several other conditional properties besides the ones +that deal with chart's dimensions: + +* "rotate" (true|false) - set this property if you want to make this rule + applicable to rotated serial chart only (i.e. bar chart) + +* "legendPosition" ("top|bottom|left|right") - set this property if you want the + rule applied only when the chart legend is set to particular position. + Please note that this does not check whether the legend is enabled at all. + +Now, on to explaining "overrides". It's an object, that contains properties that +you want to override the chart's initial ones with. + +It can be either simple properties, like "fontSize" or "precision", or complext +types like object, or array. + +To override a property of a child object, such as "legend", you would simply go +with JSON representation of the properties you need to override. I.e.: + +``` +"legend": { + "enabled": false +} +``` + +This will look for a "legend" property in chart object, then change it's +"enabled" property to false. + +### Overriding arrays of objects + +Some objects in charts are collected in arrays, i.e. "graphs", "valueAxes", etc. + +There are some ways to override their properties as well. + +To override properties for ALL objects in the array, you would provide an +override instruction as an object. I.e.: + +``` +"graphs": { + "bullet": "round", + "lineThickness": 5 +} +``` + +The above will add a round bullet and set line thickness to all of the graphs on +the chart. + +You can also target individual items in the array. There are two ways to do +that: + +a) Use "id" property; +b) Apply using the same index. + +To individually apply property overrides, you will need to supply override +instructions as an array: + +``` +"graphs": [ + { + "id": "g1", + "bullet": "round", + "lineThickness": 5 + } +] +``` + +The above will apply the same properties for the graph with an id of "g1" only. +It will not touch the rest of the graphs. + +Please note that original graph definition in your chart settings needs to have +the "id" property set so this plugin can target it. + +Or you can omit the "id" and just apply overrides in the same order as you have +them defined. I.e.: + +``` +"graphs": [ + { + "bullet": "round" + }, + { + "bullet": "square" + } +] +``` + +The above will apply round bullets to the first defined graph, and square +bullets to the second graph. + +### Chaining multiple rules + +The cool pat is that you can daisy-chain the override rules, much like in CSS. + +The plugin will examine all of the rules if their dimensional conditions match +current chart condition and will apply their overrides in the same order they +are defined. + +Consider this rule set: + +``` +"responsive": { + "enabled": true, + "rules": [ + // at 400px wide, we hide legend + { + "maxWidth": 400, + "overrides": { + "legend": { + "enabled" + } + } + }, + + // at 300px or less, we move value axis labels inside plot area + // the legend is still hidden because the above rule is still applicable + { + "maxWidth": 300, + "overrides": { + "valueAxes": { + "inside": true + } + } + }, + + // at 200 px we hide value axis labels altogether + { + "maxWidth": 200, + "overrides": { + "valueAxes": { + "labelsEnabled": false + } + } + } + + ] +} +``` + +In case several rules modify the same property, the last one will always "win". + +### Combining custom rules with pre-defined ones + +The plugin will combine your custom rules with pre-defined ones automatically. + +In case you want to go pure and set only your own responsive rules, you can set +property "addDefaultRules" to false. I.e.: + +``` +"responsive": { + "enabled": true, + "addDefaultRules": false, + "rules": [ + { + "maxWidth": 400, + "overrides": { + "legend": { + "enabled" + } + } + } + ] +} +``` + +When your custom rules are combined with pre-defined ones, yours are appended at +the end of the list. This means that your rules will always have the "last +word". + + +## Requirements + +This plugin requires at least 3.13 version of JavaScript Charts, JavaScript +Stock Chart or JavaScript Maps. + +Any older versions will be ignored by this plugin. The charts will function but +no responsive rules will be applied to them. + + +## Demos + +Run the index.html in the subdirectory /examples. It will allow viewing misc +chart types at various resolutions. + + +## Extending this plugin + +You're encouraged to modify, extend and make derivative plugins out of this +plugin. + +You can modify files, included in this archive or, better yet, fork this project +on GitHub: + +https://github.com/amcharts/responsive + +We're curious types. Please let us know (contact@amcharts.com) if you do create +something new out of this plugin. + + +## License + +This plugin is licensed under Apache License 2.0. + +This basically means you're free to use or modify this plugin, even make your +own versions or completely different products out of it. + +Please see attached file "license.txt" for the complete license or online here: + +http://www.apache.org/licenses/LICENSE-2.0 + + +## Contact us + +* Email:contact@amcharts.com +* Web: http://www.amcharts.com/ +* Facebook: https://www.facebook.com/amcharts +* Twitter: https://twitter.com/amcharts + + +## Changelog + +### 1.0.1 +* Fixed bug with overrides being overwritten with chart object in some cases +* V3.14 compatibility + +### 1.0 +* Added support for GANTT chart type (available sin JavaScript Charts V3.14) + +### 0.9.2 +* Fixed a custom rules being applied in the wrong order + +### 0.9.1 +* Made all examples use minified version of the plugin +* Introduced removal of grid lines on micro charts +* Tweaked legend hiding dimensions for pie chart + +### 0.9 +* Initial release \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/responsive.js b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/responsive.js new file mode 100644 index 0000000..3d7bcb7 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/responsive.js @@ -0,0 +1,1241 @@ +/* +Plugin Name: amCharts Responsive +Description: This plugin add responsive functionality to JavaScript Charts and Maps. +Author: Martynas Majeris, amCharts +Contributors: Ohad Schneider +Version: 1.0.1 +Author URI: http://www.amcharts.com/ + +Copyright 2015 amCharts + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. + +Please note that the above license covers only this plugin. It by all means does +not apply to any other amCharts products that are covered by different licenses. +*/ + +/*global AmCharts*/ + +AmCharts.addInitHandler( function( chart ) { + "use strict"; + + if ( chart.responsive === undefined || chart.responsive.ready === true || chart.responsive.enabled !== true ) + return; + + var version = chart.version.split( '.' ); + if ( ( version.length < 2 ) || Number( version[ 0 ] ) < 3 || ( Number( version[ 0 ] ) === 3 && Number( version[ 1 ] ) < 13 ) ) + return; + + // a short variable for easy reference + var r = chart.responsive; + + r.ready = true; + r.currentRules = {}; + r.overridden = []; + + // defaults per chart type + var defaults = { + + /** + * AmPie + */ + 'pie': [ + + /** + * Disable legend in certain cases + */ + { + "maxWidth": 550, + "legendPosition": "left", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 550, + "legendPosition": "right", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 150, + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 350, + "legendPosition": "top", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 350, + "legendPosition": "bottom", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 150, + "overrides": { + "legend": { + "enabled": false + } + } + }, + + /** + * Narrow chart + */ + { + "maxWidth": 400, + "overrides": { + "labelsEnabled": false + } + }, { + "maxWidth": 100, + "overrides": { + "legend": { + "enabled": false + } + } + }, + + /** + * Short chart + */ + { + "maxHeight": 350, + "overrides": { + "pullOutRadius": 0 + } + }, { + "maxHeight": 200, + "overrides": { + "titles": { + "enabled": false + }, + "labelsEnabled": false + } + }, + + /** + * Supersmall + */ + { + "maxWidth": 60, + "overrides": { + "autoMargins": false, + "marginTop": 0, + "marginBottom": 0, + "marginLeft": 0, + "marginRight": 0, + "radius": "50%", + "innerRadius": 0, + "balloon": { + "enabled": false + }, + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 60, + "overrides": { + "marginTop": 0, + "marginBottom": 0, + "marginLeft": 0, + "marginRight": 0, + "radius": "50%", + "innerRadius": 0, + "balloon": { + "enabled": false + }, + "legend": { + "enabled": false + } + } + } + ], + + /** + * AmFunnel + */ + + 'funnel': [ { + "maxWidth": 550, + "legendPosition": "left", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 550, + "legendPosition": "right", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 150, + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 500, + "legendPosition": "top", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 500, + "legendPosition": "bottom", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 150, + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 400, + "overrides": { + "labelsEnabled": false, + "marginLeft": 10, + "marginRight": 10, + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 350, + "overrides": { + "pullOutRadius": 0, + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 300, + "overrides": { + "titles": { + "enabled": false + } + } + } ], + + /** + * AmRadar + */ + + "radar": [ { + "maxWidth": 550, + "legendPosition": "left", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 550, + "legendPosition": "right", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 150, + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 350, + "legendPosition": "top", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 350, + "legendPosition": "bottom", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 150, + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 300, + "overrides": { + "labelsEnabled": false + } + }, { + "maxWidth": 200, + "overrides": { + "autoMargins": false, + "marginTop": 0, + "marginBottom": 0, + "marginLeft": 0, + "marginRight": 0, + "radius": "50%", + "titles": { + "enabled": false + }, + "valueAxes": { + "labelsEnabled": false, + "radarCategoriesEnabled": false + } + } + }, { + "maxHeight": 300, + "overrides": { + "labelsEnabled": false + } + }, { + "maxHeight": 200, + "overrides": { + "autoMargins": false, + "marginTop": 0, + "marginBottom": 0, + "marginLeft": 0, + "marginRight": 0, + "radius": "50%", + "titles": { + "enabled": false + }, + "valueAxes": { + "radarCategoriesEnabled": false + } + } + }, { + "maxHeight": 100, + "overrides": { + "valueAxes": { + "labelsEnabled": false + } + } + } ], + + /** + * AmGauge + */ + + 'gauge': [ { + "maxWidth": 550, + "legendPosition": "left", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 550, + "legendPosition": "right", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 150, + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 500, + "legendPosition": "top", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 500, + "legendPosition": "bottom", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 150, + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 200, + "overrides": { + "titles": { + "enabled": false + }, + "allLabels": { + "enabled": false + }, + "axes": { + "labelsEnabled": false + } + } + }, { + "maxHeight": 200, + "overrides": { + "titles": { + "enabled": false + }, + "allLabels": { + "enabled": false + }, + "axes": { + "labelsEnabled": false + } + } + } ], + + /** + * AmSerial + */ + "serial": [ + + /** + * Disable legend in certain cases + */ + { + "maxWidth": 550, + "legendPosition": "left", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 550, + "legendPosition": "right", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 100, + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 350, + "legendPosition": "top", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 350, + "legendPosition": "bottom", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 100, + "overrides": { + "legend": { + "enabled": false + } + } + }, + + + /** + * Narrow chart + */ + { + "maxWidth": 350, + "overrides": { + "autoMarginOffset": 0, + "graphs": { + "hideBulletsCount": 10 + } + } + }, { + "maxWidth": 350, + "rotate": false, + "overrides": { + "marginLeft": 10, + "marginRight": 10, + "valueAxes": { + "ignoreAxisWidth": true, + "inside": true, + "title": "", + "showFirstLabel": false, + "showLastLabel": false + }, + "graphs": { + "bullet": "none" + } + } + }, { + "maxWidth": 350, + "rotate": true, + "overrides": { + "marginLeft": 10, + "marginRight": 10, + "categoryAxis": { + "ignoreAxisWidth": true, + "inside": true, + "title": "" + } + } + }, { + "maxWidth": 200, + "rotate": false, + "overrides": { + "marginLeft": 10, + "marginRight": 10, + "marginTop": 10, + "marginBottom": 10, + "categoryAxis": { + "ignoreAxisWidth": true, + "labelsEnabled": false, + "inside": true, + "title": "", + "guides": { + "inside": true + } + }, + "valueAxes": { + "ignoreAxisWidth": true, + "labelsEnabled": false, + "axisAlpha": 0, + "guides": { + "label": "" + } + }, + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 200, + "rotate": true, + "overrides": { + "chartScrollbar": { + "scrollbarHeight": 4, + "graph": "", + "resizeEnabled": false + }, + "categoryAxis": { + "labelsEnabled": false, + "axisAlpha": 0, + "guides": { + "label": "" + } + }, + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 100, + "rotate": false, + "overrides": { + "valueAxes": { + "gridAlpha": 0 + } + } + }, { + "maxWidth": 100, + "rotate": true, + "overrides": { + "categoryAxis": { + "gridAlpha": 0 + } + } + }, + + /** + * Short chart + */ + { + "maxHeight": 300, + "overrides": { + "autoMarginOffset": 0, + "graphs": { + "hideBulletsCount": 10 + } + } + }, { + "maxHeight": 200, + "rotate": false, + "overrides": { + "marginTop": 10, + "marginBottom": 10, + "categoryAxis": { + "ignoreAxisWidth": true, + "inside": true, + "title": "", + "showFirstLabel": false, + "showLastLabel": false + } + } + }, { + "maxHeight": 200, + "rotate": true, + "overrides": { + "marginTop": 10, + "marginBottom": 10, + "valueAxes": { + "ignoreAxisWidth": true, + "inside": true, + "title": "", + "showFirstLabel": false, + "showLastLabel": false + }, + "graphs": { + "bullet": "none" + } + } + }, { + "maxHeight": 150, + "rotate": false, + "overrides": { + "titles": { + "enabled": false + }, + "chartScrollbar": { + "scrollbarHeight": 4, + "graph": "", + "resizeEnabled": false + }, + "categoryAxis": { + "labelsEnabled": false, + "ignoreAxisWidth": true, + "axisAlpha": 0, + "guides": { + "label": "" + } + } + } + }, { + "maxHeight": 150, + "rotate": true, + "overrides": { + "titles": { + "enabled": false + }, + "valueAxes": { + "labelsEnabled": false, + "ignoreAxisWidth": true, + "axisAlpha": 0, + "guides": { + "label": "" + } + } + } + }, { + "maxHeight": 100, + "rotate": false, + "overrides": { + "valueAxes": { + "labelsEnabled": false, + "ignoreAxisWidth": true, + "axisAlpha": 0, + "gridAlpha": 0, + "guides": { + "label": "" + } + } + } + }, { + "maxHeight": 100, + "rotate": true, + "overrides": { + "categoryAxis": { + "labelsEnabled": false, + "ignoreAxisWidth": true, + "axisAlpha": 0, + "gridAlpha": 0, + "guides": { + "label": "" + } + } + } + }, + + /** + * Really small charts: microcharts and sparklines + */ + { + "maxWidth": 100, + "overrides": { + "autoMargins": false, + "marginTop": 0, + "marginBottom": 0, + "marginLeft": 0, + "marginRight": 0, + "categoryAxis": { + "labelsEnabled": false + }, + "valueAxes": { + "labelsEnabled": false + } + } + }, { + "maxHeight": 100, + "overrides": { + "autoMargins": false, + "marginTop": 0, + "marginBottom": 0, + "marginLeft": 0, + "marginRight": 0, + "categoryAxis": { + "labelsEnabled": false + }, + "valueAxes": { + "labelsEnabled": false + } + } + } + ], + + /** + * AmXY + */ + "xy": [ + + /** + * Disable legend in certain cases + */ + { + "maxWidth": 550, + "legendPosition": "left", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 550, + "legendPosition": "right", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 100, + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 350, + "legendPosition": "top", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 350, + "legendPosition": "bottom", + "overrides": { + "legend": { + "enabled": false + } + } + }, { + "maxHeight": 100, + "overrides": { + "legend": { + "enabled": false + } + } + }, + + /** + * Narrow chart + */ + { + "maxWidth": 250, + "overrides": { + "autoMarginOffset": 0, + "autoMargins": false, + "marginTop": 0, + "marginBottom": 0, + "marginLeft": 0, + "marginRight": 0, + "valueAxes": { + "inside": true, + "title": "", + "showFirstLabel": false, + "showLastLabel": false + }, + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 150, + "overrides": { + "valueyAxes": { + "labelsEnabled": false, + "axisAlpha": 0, + "gridAlpha": 0, + "guides": { + "label": "" + } + } + } + }, + + /** + * Short chart + */ + { + "maxHeight": 250, + "overrides": { + "autoMarginOffset": 0, + "autoMargins": false, + "marginTop": 0, + "marginBottom": 0, + "marginLeft": 0, + "marginRight": 0, + "valueAxes": { + "inside": true, + "title": "", + "showFirstLabel": false, + "showLastLabel": false + }, + "legend": { + "enabled": false + } + } + }, { + "maxWidth": 150, + "overrides": { + "valueyAxes": { + "labelsEnabled": false, + "axisAlpha": 0, + "gridAlpha": 0, + "guides": { + "label": "" + } + } + } + } + ], + + /** + * AmStock + */ + + 'stock': [ { + "maxWidth": 500, + "overrides": { + "dataSetSelector": { + "position": "top" + }, + "periodSelector": { + "position": "bottom" + } + } + }, { + "maxWidth": 400, + "overrides": { + "dataSetSelector": { + "selectText": "", + "compareText": "" + }, + "periodSelector": { + "periodsText": "", + "inputFieldsEnabled": false + } + } + } ], + + /** + * AmMap + */ + + 'map': [ { + "maxWidth": 200, + "overrides": { + "zoomControl": { + "zoomControlEnabled": false + }, + "smallMap": { + "enabled": false + }, + "valueLegend": { + "enabled": false + }, + "dataProvider": { + "areas": { + "descriptionWindowWidth": 160, + "descriptionWindowRight": 10, + "descriptionWindowTop": 10 + }, + "images": { + "descriptionWindowWidth": 160, + "descriptionWindowRight": 10, + "descriptionWindowTop": 10 + }, + "lines": { + "descriptionWindowWidth": 160, + "descriptionWindowRight": 10, + "descriptionWindowTop": 10 + } + } + } + }, { + "maxWidth": 150, + "overrides": { + "dataProvider": { + "areas": { + "descriptionWindowWidth": 110, + "descriptionWindowRight": 10, + "descriptionWindowTop": 10 + }, + "images": { + "descriptionWindowWidth": 110, + "descriptionWindowRight": 10, + "descriptionWindowTop": 10 + }, + "lines": { + "descriptionWindowWidth": 110, + "descriptionWindowLeft": 10, + "descriptionWindowRight": 10 + } + } + } + }, { + "maxHeight": 200, + "overrides": { + "zoomControl": { + "zoomControlEnabled": false + }, + "smallMap": { + "enabled": false + }, + "valueLegend": { + "enabled": false + }, + "dataProvider": { + "areas": { + "descriptionWindowHeight": 160, + "descriptionWindowRight": 10, + "descriptionWindowTop": 10 + }, + "images": { + "descriptionWindowHeight": 160, + "descriptionWindowRight": 10, + "descriptionWindowTop": 10 + }, + "lines": { + "descriptionWindowHeight": 160, + "descriptionWindowRight": 10, + "descriptionWindowTop": 10 + } + } + } + }, { + "maxHeight": 150, + "overrides": { + "dataProvider": { + "areas": { + "descriptionWindowHeight": 110, + "descriptionWindowRight": 10, + "descriptionWindowTop": 10 + }, + "images": { + "descriptionWindowHeight": 110, + "descriptionWindowRight": 10, + "descriptionWindowTop": 10 + }, + "lines": { + "descriptionWindowHeight": 110, + "descriptionWindowLeft": 10, + "descriptionWindowRight": 10 + } + } + } + } ] + }; + + var isNullOrUndefined = function( obj ) { + return ( obj === null ) || ( obj === undefined ); + }; + + var isArray = function( obj ) { + return ( !isNullOrUndefined( obj ) && Object.prototype.toString.call( obj ) === '[object Array]' ); + }; + + var isObject = function( obj ) { + return ( obj !== null && typeof obj === 'object' ); //the null check is necessary - recall that typeof null === 'object' ! + }; + + var findArrayObjectById = function( arr, id ) { + for ( var i = 0; i < arr.length; i++ ) { + if ( isObject( arr[ i ] ) && arr[ i ].id === id ) + return arr[ i ]; + } + return undefined; //we can use undefined as it doesn't have an Id property and so will never be the desired object from the array + }; + + var cloneWithoutPrototypes = function( obj ) { + if ( !isObject( obj ) ) { + return obj; + } + + if ( isArray( obj ) ) { + return obj.slice(); //effectively clones the array + } + + var clone = {}; //here is where we lose the prototype + for ( var property in obj ) { + if ( Object.prototype.hasOwnProperty.call( obj, property ) ) { + clone[ property ] = cloneWithoutPrototypes( obj[ property ] ); + } + } + return clone; + }; + + var originalValueRetainerPrefix = '{F0578839-A214-4E2D-8D1B-44941ECE8332}_'; + var noOriginalPropertyStub = {}; + + var overrideProperty = function( object, property, overrideValue ) { + + var originalValueRetainerProperty = originalValueRetainerPrefix + property; + if ( !( originalValueRetainerProperty in object ) ) { + object[ originalValueRetainerProperty ] = ( property in object ) ? object[ property ] : noOriginalPropertyStub; + } + + object[ property ] = cloneWithoutPrototypes( overrideValue ); + + r.overridden.push( { + object: object, + property: property + } ); + }; + + var restoreOriginalProperty = function( object, property ) { + var originalValue = object[ originalValueRetainerPrefix + property ]; + if ( originalValue === noOriginalPropertyStub ) { + delete object[ property ]; + } else { + object[ property ] = originalValue; + } + }; + + var restoreOriginals = function() { + while ( r.overridden.length > 0 ) { + var override = r.overridden.pop(); + restoreOriginalProperty( override.object, override.property ); + } + }; + + var redrawChart = function() { + chart.dataChanged = true; + if ( chart.type !== 'xy' ) { + chart.marginsUpdated = false; + } + chart.zoomOutOnDataUpdate = false; + chart.validateNow( true ); + restoreOriginalProperty( chart, 'zoomOutOnDataUpdate' ); + }; + + var applyConfig = function( current, override ) { + if ( isNullOrUndefined( override ) ) { + return; + } + + for ( var property in override ) { + if ( !Object.prototype.hasOwnProperty.call( override, property ) ) { + continue; + } + + var currentValue = current[ property ]; + var overrideValue = override[ property ]; + + //property doesn't exist on current object or it exists as null/undefined => completely override it + if ( isNullOrUndefined( currentValue ) ) { + overrideProperty( current, property, overrideValue ); + continue; + } + + //current value is an array => override method depends on override form + if ( isArray( currentValue ) ) { + + //override value is an array => override method depends on array elements + if ( isArray( overrideValue ) ) { + + //current value is an array of non-objects => override the entire array + //we assume a uniformly-typed array, so checking the first value should suffice + if ( ( currentValue.length > 0 && !isObject( currentValue[ 0 ] ) ) || ( overrideValue.length > 0 && !isObject( overrideValue[ 0 ] ) ) ) { + overrideProperty( current, property, overrideValue ); + continue; + } + + var idPresentOnAllOverrideElements = true; + for ( var k = 0; k < overrideValue.length; k++ ) { + if ( isNullOrUndefined( overrideValue[ k ] ) || isNullOrUndefined( overrideValue[ k ].id ) ) { + idPresentOnAllOverrideElements = false; + break; + } + } + + //Id property is present on all override elements => override elements by ID + if ( idPresentOnAllOverrideElements ) { + for ( var i = 0; i < overrideValue.length; i++ ) { + var correspondingCurrentElement = findArrayObjectById( currentValue, overrideValue[ i ].id ); + if ( correspondingCurrentElement === undefined ) { + throw ( 'could not find element to override in "' + property + '" with ID: ' + overrideValue[ i ].id ); + } + applyConfig( correspondingCurrentElement, overrideValue[ i ] ); + } + continue; + } + + //Id property is not set on all override elements and there aren't too many overrides => override objects by their index + if ( overrideValue.length <= currentValue.length ) { + for ( var l = 0; l < overrideValue.length; l++ ) { + applyConfig( currentValue[ l ], overrideValue[ l ] ); + } + continue; + } + + throw 'too many index-based overrides specified for object array property: ' + property; + } + + // override value is a single object => override all current array objects with that object + if ( isObject( overrideValue ) ) { + for ( var j = 0; j < currentValue.length; j++ ) { + applyConfig( currentValue[ j ], overrideValue ); + } + continue; + } + + throw ( 'non-object override detected for array property: ' + property ); + } + + if ( isObject( currentValue ) ) { + applyConfig( currentValue, overrideValue ); + continue; + } + + //if we reached this point, the property is defined on the current object but is not an object => override it + overrideProperty( current, property, overrideValue ); + } + }; + + var checkRules = function() { + + var width = chart.divRealWidth; + var height = chart.divRealHeight; + + // update current rules + var rulesChanged = false; + for ( var i = 0; i < r.rules.length; i++ ) { + var rule = r.rules[ i ]; + + var ruleMatches = + ( rule.minWidth === undefined || ( rule.minWidth <= width ) ) && ( rule.maxWidth === undefined || ( rule.maxWidth >= width ) ) && + ( rule.minHeight === undefined || ( rule.minHeight <= height ) ) && ( rule.maxHeight === undefined || ( rule.maxHeight >= height ) ) && + ( rule.rotate === undefined || ( rule.rotate === true && chart.rotate === true ) || ( rule.rotate === false && ( chart.rotate === undefined || chart.rotate === false ) ) ) && + ( rule.legendPosition === undefined || ( chart.legend !== undefined && chart.legend.position !== undefined && chart.legend.position === rule.legendPosition ) ); + + if ( ruleMatches ) { + if ( r.currentRules[ i ] === undefined ) { + r.currentRules[ i ] = true; + rulesChanged = true; + } + } else if ( r.currentRules[ i ] !== undefined ) { + r.currentRules[ i ] = undefined; + rulesChanged = true; + } + } + + if ( !rulesChanged ) + return; + + restoreOriginals(); + + for ( var key in r.currentRules ) { + if ( !Object.prototype.hasOwnProperty.call( r.currentRules, key ) ) { + continue; + } + + if ( r.currentRules[ key ] !== undefined ) { + if ( isNullOrUndefined( r.rules[ key ] ) ) { + throw 'null or undefined rule in index: ' + key; + } + applyConfig( chart, r.rules[ key ].overrides ); + } + } + + // TODO - re-apply zooms/slices as necessary + + redrawChart(); + }; + + defaults.gantt = defaults.serial; + + if ( !isArray( r.rules ) ) { + r.rules = defaults[ chart.type ]; + } else if ( r.addDefaultRules !== false ) { + r.rules = defaults[ chart.type ].concat( r.rules ); + } + + //retain original zoomOutOnDataUpdate value + overrideProperty( chart, 'zoomOutOnDataUpdate', chart.zoomOutOnDataUpdate ); + + chart.addListener( 'resized', checkRules ); + chart.addListener( 'init', checkRules ); + +}, [ 'pie', 'serial', 'xy', 'funnel', 'radar', 'gauge', 'gantt', 'stock', 'map' ] ); \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/responsive.min.js b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/responsive.min.js new file mode 100644 index 0000000..bf77798 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/responsive.min.js @@ -0,0 +1,2 @@ +AmCharts.addInitHandler(function(n){"use strict";var u,t;if(n.responsive!==undefined&&n.responsive.ready!==!0&&n.responsive.enabled===!0&&(u=n.version.split("."),!(u.length<2)&&!(Number(u[0])<3)&&(Number(u[0])!==3||!(Number(u[1])<13)))){t=n.responsive;t.ready=!0;t.currentRules={};t.overridden=[];var e={pie:[{maxWidth:550,legendPosition:"left",overrides:{legend:{enabled:!1}}},{maxWidth:550,legendPosition:"right",overrides:{legend:{enabled:!1}}},{maxWidth:150,overrides:{legend:{enabled:!1}}},{maxHeight:350,legendPosition:"top",overrides:{legend:{enabled:!1}}},{maxHeight:350,legendPosition:"bottom",overrides:{legend:{enabled:!1}}},{maxHeight:150,overrides:{legend:{enabled:!1}}},{maxWidth:400,overrides:{labelsEnabled:!1}},{maxWidth:100,overrides:{legend:{enabled:!1}}},{maxHeight:350,overrides:{pullOutRadius:0}},{maxHeight:200,overrides:{titles:{enabled:!1},labelsEnabled:!1}},{maxWidth:60,overrides:{autoMargins:!1,marginTop:0,marginBottom:0,marginLeft:0,marginRight:0,radius:"50%",innerRadius:0,balloon:{enabled:!1},legend:{enabled:!1}}},{maxHeight:60,overrides:{marginTop:0,marginBottom:0,marginLeft:0,marginRight:0,radius:"50%",innerRadius:0,balloon:{enabled:!1},legend:{enabled:!1}}}],funnel:[{maxWidth:550,legendPosition:"left",overrides:{legend:{enabled:!1}}},{maxWidth:550,legendPosition:"right",overrides:{legend:{enabled:!1}}},{maxWidth:150,overrides:{legend:{enabled:!1}}},{maxHeight:500,legendPosition:"top",overrides:{legend:{enabled:!1}}},{maxHeight:500,legendPosition:"bottom",overrides:{legend:{enabled:!1}}},{maxHeight:150,overrides:{legend:{enabled:!1}}},{maxWidth:400,overrides:{labelsEnabled:!1,marginLeft:10,marginRight:10,legend:{enabled:!1}}},{maxHeight:350,overrides:{pullOutRadius:0,legend:{enabled:!1}}},{maxHeight:300,overrides:{titles:{enabled:!1}}}],radar:[{maxWidth:550,legendPosition:"left",overrides:{legend:{enabled:!1}}},{maxWidth:550,legendPosition:"right",overrides:{legend:{enabled:!1}}},{maxWidth:150,overrides:{legend:{enabled:!1}}},{maxHeight:350,legendPosition:"top",overrides:{legend:{enabled:!1}}},{maxHeight:350,legendPosition:"bottom",overrides:{legend:{enabled:!1}}},{maxHeight:150,overrides:{legend:{enabled:!1}}},{maxWidth:300,overrides:{labelsEnabled:!1}},{maxWidth:200,overrides:{autoMargins:!1,marginTop:0,marginBottom:0,marginLeft:0,marginRight:0,radius:"50%",titles:{enabled:!1},valueAxes:{labelsEnabled:!1,radarCategoriesEnabled:!1}}},{maxHeight:300,overrides:{labelsEnabled:!1}},{maxHeight:200,overrides:{autoMargins:!1,marginTop:0,marginBottom:0,marginLeft:0,marginRight:0,radius:"50%",titles:{enabled:!1},valueAxes:{radarCategoriesEnabled:!1}}},{maxHeight:100,overrides:{valueAxes:{labelsEnabled:!1}}}],gauge:[{maxWidth:550,legendPosition:"left",overrides:{legend:{enabled:!1}}},{maxWidth:550,legendPosition:"right",overrides:{legend:{enabled:!1}}},{maxWidth:150,overrides:{legend:{enabled:!1}}},{maxHeight:500,legendPosition:"top",overrides:{legend:{enabled:!1}}},{maxHeight:500,legendPosition:"bottom",overrides:{legend:{enabled:!1}}},{maxHeight:150,overrides:{legend:{enabled:!1}}},{maxWidth:200,overrides:{titles:{enabled:!1},allLabels:{enabled:!1},axes:{labelsEnabled:!1}}},{maxHeight:200,overrides:{titles:{enabled:!1},allLabels:{enabled:!1},axes:{labelsEnabled:!1}}}],serial:[{maxWidth:550,legendPosition:"left",overrides:{legend:{enabled:!1}}},{maxWidth:550,legendPosition:"right",overrides:{legend:{enabled:!1}}},{maxWidth:100,overrides:{legend:{enabled:!1}}},{maxHeight:350,legendPosition:"top",overrides:{legend:{enabled:!1}}},{maxHeight:350,legendPosition:"bottom",overrides:{legend:{enabled:!1}}},{maxHeight:100,overrides:{legend:{enabled:!1}}},{maxWidth:350,overrides:{autoMarginOffset:0,graphs:{hideBulletsCount:10}}},{maxWidth:350,rotate:!1,overrides:{marginLeft:10,marginRight:10,valueAxes:{ignoreAxisWidth:!0,inside:!0,title:"",showFirstLabel:!1,showLastLabel:!1},graphs:{bullet:"none"}}},{maxWidth:350,rotate:!0,overrides:{marginLeft:10,marginRight:10,categoryAxis:{ignoreAxisWidth:!0,inside:!0,title:""}}},{maxWidth:200,rotate:!1,overrides:{marginLeft:10,marginRight:10,marginTop:10,marginBottom:10,categoryAxis:{ignoreAxisWidth:!0,labelsEnabled:!1,inside:!0,title:"",guides:{inside:!0}},valueAxes:{ignoreAxisWidth:!0,labelsEnabled:!1,axisAlpha:0,guides:{label:""}},legend:{enabled:!1}}},{maxWidth:200,rotate:!0,overrides:{chartScrollbar:{scrollbarHeight:4,graph:"",resizeEnabled:!1},categoryAxis:{labelsEnabled:!1,axisAlpha:0,guides:{label:""}},legend:{enabled:!1}}},{maxWidth:100,rotate:!1,overrides:{valueAxes:{gridAlpha:0}}},{maxWidth:100,rotate:!0,overrides:{categoryAxis:{gridAlpha:0}}},{maxHeight:300,overrides:{autoMarginOffset:0,graphs:{hideBulletsCount:10}}},{maxHeight:200,rotate:!1,overrides:{marginTop:10,marginBottom:10,categoryAxis:{ignoreAxisWidth:!0,inside:!0,title:"",showFirstLabel:!1,showLastLabel:!1}}},{maxHeight:200,rotate:!0,overrides:{marginTop:10,marginBottom:10,valueAxes:{ignoreAxisWidth:!0,inside:!0,title:"",showFirstLabel:!1,showLastLabel:!1},graphs:{bullet:"none"}}},{maxHeight:150,rotate:!1,overrides:{titles:{enabled:!1},chartScrollbar:{scrollbarHeight:4,graph:"",resizeEnabled:!1},categoryAxis:{labelsEnabled:!1,ignoreAxisWidth:!0,axisAlpha:0,guides:{label:""}}}},{maxHeight:150,rotate:!0,overrides:{titles:{enabled:!1},valueAxes:{labelsEnabled:!1,ignoreAxisWidth:!0,axisAlpha:0,guides:{label:""}}}},{maxHeight:100,rotate:!1,overrides:{valueAxes:{labelsEnabled:!1,ignoreAxisWidth:!0,axisAlpha:0,gridAlpha:0,guides:{label:""}}}},{maxHeight:100,rotate:!0,overrides:{categoryAxis:{labelsEnabled:!1,ignoreAxisWidth:!0,axisAlpha:0,gridAlpha:0,guides:{label:""}}}},{maxWidth:100,overrides:{autoMargins:!1,marginTop:0,marginBottom:0,marginLeft:0,marginRight:0,categoryAxis:{labelsEnabled:!1},valueAxes:{labelsEnabled:!1}}},{maxHeight:100,overrides:{autoMargins:!1,marginTop:0,marginBottom:0,marginLeft:0,marginRight:0,categoryAxis:{labelsEnabled:!1},valueAxes:{labelsEnabled:!1}}}],xy:[{maxWidth:550,legendPosition:"left",overrides:{legend:{enabled:!1}}},{maxWidth:550,legendPosition:"right",overrides:{legend:{enabled:!1}}},{maxWidth:100,overrides:{legend:{enabled:!1}}},{maxHeight:350,legendPosition:"top",overrides:{legend:{enabled:!1}}},{maxHeight:350,legendPosition:"bottom",overrides:{legend:{enabled:!1}}},{maxHeight:100,overrides:{legend:{enabled:!1}}},{maxWidth:250,overrides:{autoMarginOffset:0,autoMargins:!1,marginTop:0,marginBottom:0,marginLeft:0,marginRight:0,valueAxes:{inside:!0,title:"",showFirstLabel:!1,showLastLabel:!1},legend:{enabled:!1}}},{maxWidth:150,overrides:{valueyAxes:{labelsEnabled:!1,axisAlpha:0,gridAlpha:0,guides:{label:""}}}},{maxHeight:250,overrides:{autoMarginOffset:0,autoMargins:!1,marginTop:0,marginBottom:0,marginLeft:0,marginRight:0,valueAxes:{inside:!0,title:"",showFirstLabel:!1,showLastLabel:!1},legend:{enabled:!1}}},{maxWidth:150,overrides:{valueyAxes:{labelsEnabled:!1,axisAlpha:0,gridAlpha:0,guides:{label:""}}}}],stock:[{maxWidth:500,overrides:{dataSetSelector:{position:"top"},periodSelector:{position:"bottom"}}},{maxWidth:400,overrides:{dataSetSelector:{selectText:"",compareText:""},periodSelector:{periodsText:"",inputFieldsEnabled:!1}}}],map:[{maxWidth:200,overrides:{zoomControl:{zoomControlEnabled:!1},smallMap:{enabled:!1},valueLegend:{enabled:!1},dataProvider:{areas:{descriptionWindowWidth:160,descriptionWindowRight:10,descriptionWindowTop:10},images:{descriptionWindowWidth:160,descriptionWindowRight:10,descriptionWindowTop:10},lines:{descriptionWindowWidth:160,descriptionWindowRight:10,descriptionWindowTop:10}}}},{maxWidth:150,overrides:{dataProvider:{areas:{descriptionWindowWidth:110,descriptionWindowRight:10,descriptionWindowTop:10},images:{descriptionWindowWidth:110,descriptionWindowRight:10,descriptionWindowTop:10},lines:{descriptionWindowWidth:110,descriptionWindowLeft:10,descriptionWindowRight:10}}}},{maxHeight:200,overrides:{zoomControl:{zoomControlEnabled:!1},smallMap:{enabled:!1},valueLegend:{enabled:!1},dataProvider:{areas:{descriptionWindowHeight:160,descriptionWindowRight:10,descriptionWindowTop:10},images:{descriptionWindowHeight:160,descriptionWindowRight:10,descriptionWindowTop:10},lines:{descriptionWindowHeight:160,descriptionWindowRight:10,descriptionWindowTop:10}}}},{maxHeight:150,overrides:{dataProvider:{areas:{descriptionWindowHeight:110,descriptionWindowRight:10,descriptionWindowTop:10},images:{descriptionWindowHeight:110,descriptionWindowRight:10,descriptionWindowTop:10},lines:{descriptionWindowHeight:110,descriptionWindowLeft:10,descriptionWindowRight:10}}}}]},i=function(n){return n===null||n===undefined},o=function(n){return!i(n)&&Object.prototype.toString.call(n)==="[object Array]"},r=function(n){return n!==null&&typeof n=="object"},y=function(n,t){for(var i=0;i0){var n=t.overridden.pop();a(n.object,n.property)}},w=function(){n.dataChanged=!0;n.type!=="xy"&&(n.marginsUpdated=!1);n.zoomOutOnDataUpdate=!1;n.validateNow(!0);a(n,"zoomOutOnDataUpdate")},f=function(n,t){var h,e,u,p,l,c,w,a,v;if(!i(t))for(h in t)if(Object.prototype.hasOwnProperty.call(t,h)){if(e=n[h],u=t[h],i(e)){s(n,h,u);continue}if(o(e)){if(o(u)){if(e.length>0&&!r(e[0])||u.length>0&&!r(u[0])){s(n,h,u);continue}for(p=!0,l=0;l=s)&&(r.minHeight===undefined||r.minHeight<=h)&&(r.maxHeight===undefined||r.maxHeight>=h)&&(r.rotate===undefined||r.rotate===!0&&n.rotate===!0||r.rotate===!1&&(n.rotate===undefined||n.rotate===!1))&&(r.legendPosition===undefined||n.legend!==undefined&&n.legend.position!==undefined&&n.legend.position===r.legendPosition),c?t.currentRules[u]===undefined&&(t.currentRules[u]=!0,o=!0):t.currentRules[u]!==undefined&&(t.currentRules[u]=undefined,o=!0);if(o){p();for(e in t.currentRules)if(Object.prototype.hasOwnProperty.call(t.currentRules,e)&&t.currentRules[e]!==undefined){if(i(t.rules[e]))throw"null or undefined rule in index: "+e;f(n,t.rules[e].overrides)}w()}};e.gantt=e.serial;o(t.rules)?t.addDefaultRules!==!1&&(t.rules=e[n.type].concat(t.rules)):t.rules=e[n.type];s(n,"zoomOutOnDataUpdate",n.zoomOutOnDataUpdate);n.addListener("resized",v);n.addListener("init",v)}},["pie","serial","xy","funnel","radar","gauge","gantt","stock","map"]); +//# sourceMappingURL=responsive.min.js.map diff --git a/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/responsive.min.js.map b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/responsive.min.js.map new file mode 100644 index 0000000..f975308 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/plugins/responsive/responsive.min.js.map @@ -0,0 +1,8 @@ +{ +"version":3, +"file":"responsive.min.js", +"lineCount":1, +"mappings":"AA4BAA,QAAQC,eAAe,CAAE,QAAQ,CAAEC,CAAF,CAAU,CACzC,Y,CAKA,IAAIC,EAKAC,CALoC,CAHxC,GAAKF,CAAKG,WAAY,GAAIC,SAAU,EAAGJ,CAAKG,WAAWE,MAAO,GAAI,CAAA,CAAK,EAAGL,CAAKG,WAAWG,QAAS,GAAI,CAAA,C,GAGnGL,CAAQ,CAAED,CAAKC,QAAQM,MAAM,CAAE,GAAF,C,CAC1B,EAAAN,CAAOO,OAAQ,CAAE,EAAI,EAAG,EAAAC,MAAM,CAAER,CAAS,CAAA,CAAA,CAAX,CAAiB,CAAE,EAAE,GAAKQ,MAAM,CAAER,CAAS,CAAA,CAAA,CAAX,CAAiB,GAAI,CAAE,EAAG,EAAAQ,MAAM,CAAER,CAAS,CAAA,CAAA,CAAX,CAAiB,CAAE,MACtH,CAGEC,CAAE,CAAEF,CAAKG,W,CAEbD,CAACG,MAAO,CAAE,CAAA,CAAI,CACdH,CAACQ,aAAc,CAAE,CAAA,CAAE,CACnBR,CAACS,WAAY,CAAE,CAAA,CAAE,CAGjB,IAAIC,EAAW,CAKb,GAAK,CAAE,CAKL,CACE,QAAU,CAAE,GAAG,CACf,cAAgB,CAAE,MAAM,CACxB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHf,CAQC,CAAE,CACD,QAAU,CAAE,GAAG,CACf,cAAgB,CAAE,OAAO,CACzB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAFZ,CAOF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,cAAgB,CAAE,KAAK,CACvB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,cAAgB,CAAE,QAAQ,CAC1B,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAFZ,CAOF,CAKD,CACE,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,aAAe,CAAE,CAAA,CADN,CAFf,CAKC,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAFZ,CAOF,CAKD,CACE,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,aAAe,CAAE,CADN,CAFf,CAKC,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAET,CACD,aAAe,CAAE,CAAA,CAJN,CAFZ,CAQF,CAKD,CACE,QAAU,CAAE,EAAE,CACd,SAAW,CAAE,CACX,WAAa,CAAE,CAAA,CAAK,CACpB,SAAW,CAAE,CAAC,CACd,YAAc,CAAE,CAAC,CACjB,UAAY,CAAE,CAAC,CACf,WAAa,CAAE,CAAC,CAChB,MAAQ,CAAE,KAAK,CACf,WAAa,CAAE,CAAC,CAChB,OAAS,CAAE,CACT,OAAS,CAAE,CAAA,CADF,CAEV,CACD,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAXC,CAFf,CAiBC,CAAE,CACD,SAAW,CAAE,EAAE,CACf,SAAW,CAAE,CACX,SAAW,CAAE,CAAC,CACd,YAAc,CAAE,CAAC,CACjB,UAAY,CAAE,CAAC,CACf,WAAa,CAAE,CAAC,CAChB,MAAQ,CAAE,KAAK,CACf,WAAa,CAAE,CAAC,CAChB,OAAS,CAAE,CACT,OAAS,CAAE,CAAA,CADF,CAEV,CACD,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAVC,CAFZ,CA5GE,CA6HN,CAMD,MAAQ,CAAE,CAAE,CACV,QAAU,CAAE,GAAG,CACf,cAAgB,CAAE,MAAM,CACxB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHH,CAQX,CAAE,CACD,QAAU,CAAE,GAAG,CACf,cAAgB,CAAE,OAAO,CACzB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAFZ,CAOF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,cAAgB,CAAE,KAAK,CACvB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,cAAgB,CAAE,QAAQ,CAC1B,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAFZ,CAOF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,aAAe,CAAE,CAAA,CAAK,CACtB,UAAY,CAAE,EAAE,CAChB,WAAa,CAAE,EAAE,CACjB,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAJC,CAFZ,CAUF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,aAAe,CAAE,CAAC,CAClB,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAFC,CAFZ,CAQF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAFZ,CAhEO,CAuEP,CAMH,KAAO,CAAE,CAAE,CACT,QAAU,CAAE,GAAG,CACf,cAAgB,CAAE,MAAM,CACxB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHJ,CAQV,CAAE,CACD,QAAU,CAAE,GAAG,CACf,cAAgB,CAAE,OAAO,CACzB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAFZ,CAOF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,cAAgB,CAAE,KAAK,CACvB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,cAAgB,CAAE,QAAQ,CAC1B,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAFZ,CAOF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,aAAe,CAAE,CAAA,CADN,CAFZ,CAKF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,WAAa,CAAE,CAAA,CAAK,CACpB,SAAW,CAAE,CAAC,CACd,YAAc,CAAE,CAAC,CACjB,UAAY,CAAE,CAAC,CACf,WAAa,CAAE,CAAC,CAChB,MAAQ,CAAE,KAAK,CACf,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAET,CACD,SAAW,CAAE,CACX,aAAe,CAAE,CAAA,CAAK,CACtB,sBAAwB,CAAE,CAAA,CAFf,CAVF,CAFZ,CAiBF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,aAAe,CAAE,CAAA,CADN,CAFZ,CAKF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,WAAa,CAAE,CAAA,CAAK,CACpB,SAAW,CAAE,CAAC,CACd,YAAc,CAAE,CAAC,CACjB,UAAY,CAAE,CAAC,CACf,WAAa,CAAE,CAAC,CAChB,MAAQ,CAAE,KAAK,CACf,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAET,CACD,SAAW,CAAE,CACX,sBAAwB,CAAE,CAAA,CADf,CAVF,CAFZ,CAgBF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,SAAW,CAAE,CACX,aAAe,CAAE,CAAA,CADN,CADF,CAFZ,CAzFM,CAgGN,CAMH,KAAO,CAAE,CAAE,CACT,QAAU,CAAE,GAAG,CACf,cAAgB,CAAE,MAAM,CACxB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHJ,CAQV,CAAE,CACD,QAAU,CAAE,GAAG,CACf,cAAgB,CAAE,OAAO,CACzB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAFZ,CAOF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,cAAgB,CAAE,KAAK,CACvB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,cAAgB,CAAE,QAAQ,CAC1B,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAFZ,CAOF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAET,CACD,SAAW,CAAE,CACX,OAAS,CAAE,CAAA,CADA,CAEZ,CACD,IAAM,CAAE,CACN,aAAe,CAAE,CAAA,CADX,CAPG,CAFZ,CAaF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAET,CACD,SAAW,CAAE,CACX,OAAS,CAAE,CAAA,CADA,CAEZ,CACD,IAAM,CAAE,CACN,aAAe,CAAE,CAAA,CADX,CAPG,CAFZ,CA3DM,CAwEN,CAKH,MAAQ,CAAE,CAKR,CACE,QAAU,CAAE,GAAG,CACf,cAAgB,CAAE,MAAM,CACxB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHf,CAQC,CAAE,CACD,QAAU,CAAE,GAAG,CACf,cAAgB,CAAE,OAAO,CACzB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAFZ,CAOF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,cAAgB,CAAE,KAAK,CACvB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,cAAgB,CAAE,QAAQ,CAC1B,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAFZ,CAOF,CAMD,CACE,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,gBAAkB,CAAE,CAAC,CACrB,MAAQ,CAAE,CACR,gBAAkB,CAAE,EADZ,CAFC,CAFf,CAQC,CAAE,CACD,QAAU,CAAE,GAAG,CACf,MAAQ,CAAE,CAAA,CAAK,CACf,SAAW,CAAE,CACX,UAAY,CAAE,EAAE,CAChB,WAAa,CAAE,EAAE,CACjB,SAAW,CAAE,CACX,eAAiB,CAAE,CAAA,CAAI,CACvB,MAAQ,CAAE,CAAA,CAAI,CACd,KAAO,CAAE,EAAE,CACX,cAAgB,CAAE,CAAA,CAAK,CACvB,aAAe,CAAE,CAAA,CALN,CAMZ,CACD,MAAQ,CAAE,CACR,MAAQ,CAAE,MADF,CAVC,CAHZ,CAiBF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,MAAQ,CAAE,CAAA,CAAI,CACd,SAAW,CAAE,CACX,UAAY,CAAE,EAAE,CAChB,WAAa,CAAE,EAAE,CACjB,YAAc,CAAE,CACd,eAAiB,CAAE,CAAA,CAAI,CACvB,MAAQ,CAAE,CAAA,CAAI,CACd,KAAO,CAAE,EAHK,CAHL,CAHZ,CAYF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,MAAQ,CAAE,CAAA,CAAK,CACf,SAAW,CAAE,CACX,UAAY,CAAE,EAAE,CAChB,WAAa,CAAE,EAAE,CACjB,SAAW,CAAE,EAAE,CACf,YAAc,CAAE,EAAE,CAClB,YAAc,CAAE,CACd,eAAiB,CAAE,CAAA,CAAI,CACvB,aAAe,CAAE,CAAA,CAAK,CACtB,MAAQ,CAAE,CAAA,CAAI,CACd,KAAO,CAAE,EAAE,CACX,MAAQ,CAAE,CACR,MAAQ,CAAE,CAAA,CADF,CALI,CAQf,CACD,SAAW,CAAE,CACX,eAAiB,CAAE,CAAA,CAAI,CACvB,aAAe,CAAE,CAAA,CAAK,CACtB,SAAW,CAAE,CAAC,CACd,MAAQ,CAAE,CACR,KAAO,CAAE,EADD,CAJC,CAOZ,CACD,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAtBC,CAHZ,CA6BF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,MAAQ,CAAE,CAAA,CAAI,CACd,SAAW,CAAE,CACX,cAAgB,CAAE,CAChB,eAAiB,CAAE,CAAC,CACpB,KAAO,CAAE,EAAE,CACX,aAAe,CAAE,CAAA,CAHD,CAIjB,CACD,YAAc,CAAE,CACd,aAAe,CAAE,CAAA,CAAK,CACtB,SAAW,CAAE,CAAC,CACd,MAAQ,CAAE,CACR,KAAO,CAAE,EADD,CAHI,CAMf,CACD,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAbC,CAHZ,CAoBF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,MAAQ,CAAE,CAAA,CAAK,CACf,SAAW,CAAE,CACX,SAAW,CAAE,CACX,SAAW,CAAE,CADF,CADF,CAHZ,CAQF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,MAAQ,CAAE,CAAA,CAAI,CACd,SAAW,CAAE,CACX,YAAc,CAAE,CACd,SAAW,CAAE,CADC,CADL,CAHZ,CAQF,CAKD,CACE,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,gBAAkB,CAAE,CAAC,CACrB,MAAQ,CAAE,CACR,gBAAkB,CAAE,EADZ,CAFC,CAFf,CAQC,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,MAAQ,CAAE,CAAA,CAAK,CACf,SAAW,CAAE,CACX,SAAW,CAAE,EAAE,CACf,YAAc,CAAE,EAAE,CAClB,YAAc,CAAE,CACd,eAAiB,CAAE,CAAA,CAAI,CACvB,MAAQ,CAAE,CAAA,CAAI,CACd,KAAO,CAAE,EAAE,CACX,cAAgB,CAAE,CAAA,CAAK,CACvB,aAAe,CAAE,CAAA,CALH,CAHL,CAHZ,CAcF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,MAAQ,CAAE,CAAA,CAAI,CACd,SAAW,CAAE,CACX,SAAW,CAAE,EAAE,CACf,YAAc,CAAE,EAAE,CAClB,SAAW,CAAE,CACX,eAAiB,CAAE,CAAA,CAAI,CACvB,MAAQ,CAAE,CAAA,CAAI,CACd,KAAO,CAAE,EAAE,CACX,cAAgB,CAAE,CAAA,CAAK,CACvB,aAAe,CAAE,CAAA,CALN,CAMZ,CACD,MAAQ,CAAE,CACR,MAAQ,CAAE,MADF,CAVC,CAHZ,CAiBF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,MAAQ,CAAE,CAAA,CAAK,CACf,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAET,CACD,cAAgB,CAAE,CAChB,eAAiB,CAAE,CAAC,CACpB,KAAO,CAAE,EAAE,CACX,aAAe,CAAE,CAAA,CAHD,CAIjB,CACD,YAAc,CAAE,CACd,aAAe,CAAE,CAAA,CAAK,CACtB,eAAiB,CAAE,CAAA,CAAI,CACvB,SAAW,CAAE,CAAC,CACd,MAAQ,CAAE,CACR,KAAO,CAAE,EADD,CAJI,CATL,CAHZ,CAqBF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,MAAQ,CAAE,CAAA,CAAI,CACd,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAET,CACD,SAAW,CAAE,CACX,aAAe,CAAE,CAAA,CAAK,CACtB,eAAiB,CAAE,CAAA,CAAI,CACvB,SAAW,CAAE,CAAC,CACd,MAAQ,CAAE,CACR,KAAO,CAAE,EADD,CAJC,CAJF,CAHZ,CAgBF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,MAAQ,CAAE,CAAA,CAAK,CACf,SAAW,CAAE,CACX,SAAW,CAAE,CACX,aAAe,CAAE,CAAA,CAAK,CACtB,eAAiB,CAAE,CAAA,CAAI,CACvB,SAAW,CAAE,CAAC,CACd,SAAW,CAAE,CAAC,CACd,MAAQ,CAAE,CACR,KAAO,CAAE,EADD,CALC,CADF,CAHZ,CAcF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,MAAQ,CAAE,CAAA,CAAI,CACd,SAAW,CAAE,CACX,YAAc,CAAE,CACd,aAAe,CAAE,CAAA,CAAK,CACtB,eAAiB,CAAE,CAAA,CAAI,CACvB,SAAW,CAAE,CAAC,CACd,SAAW,CAAE,CAAC,CACd,MAAQ,CAAE,CACR,KAAO,CAAE,EADD,CALI,CADL,CAHZ,CAcF,CAKD,CACE,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,WAAa,CAAE,CAAA,CAAK,CACpB,SAAW,CAAE,CAAC,CACd,YAAc,CAAE,CAAC,CACjB,UAAY,CAAE,CAAC,CACf,WAAa,CAAE,CAAC,CAChB,YAAc,CAAE,CACd,aAAe,CAAE,CAAA,CADH,CAEf,CACD,SAAW,CAAE,CACX,aAAe,CAAE,CAAA,CADN,CATF,CAFf,CAeC,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,WAAa,CAAE,CAAA,CAAK,CACpB,SAAW,CAAE,CAAC,CACd,YAAc,CAAE,CAAC,CACjB,UAAY,CAAE,CAAC,CACf,WAAa,CAAE,CAAC,CAChB,YAAc,CAAE,CACd,aAAe,CAAE,CAAA,CADH,CAEf,CACD,SAAW,CAAE,CACX,aAAe,CAAE,CAAA,CADN,CATF,CAFZ,CAhSK,CAgTT,CAKD,EAAI,CAAE,CAKJ,CACE,QAAU,CAAE,GAAG,CACf,cAAgB,CAAE,MAAM,CACxB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHf,CAQC,CAAE,CACD,QAAU,CAAE,GAAG,CACf,cAAgB,CAAE,OAAO,CACzB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAFZ,CAOF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,cAAgB,CAAE,KAAK,CACvB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,cAAgB,CAAE,QAAQ,CAC1B,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAHZ,CAQF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CADC,CAFZ,CAOF,CAKD,CACE,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,gBAAkB,CAAE,CAAC,CACrB,WAAa,CAAE,CAAA,CAAK,CACpB,SAAW,CAAE,CAAC,CACd,YAAc,CAAE,CAAC,CACjB,UAAY,CAAE,CAAC,CACf,WAAa,CAAE,CAAC,CAChB,SAAW,CAAE,CACX,MAAQ,CAAE,CAAA,CAAI,CACd,KAAO,CAAE,EAAE,CACX,cAAgB,CAAE,CAAA,CAAK,CACvB,aAAe,CAAE,CAAA,CAJN,CAKZ,CACD,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAbC,CAFf,CAmBC,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,UAAY,CAAE,CACZ,aAAe,CAAE,CAAA,CAAK,CACtB,SAAW,CAAE,CAAC,CACd,SAAW,CAAE,CAAC,CACd,MAAQ,CAAE,CACR,KAAO,CAAE,EADD,CAJE,CADH,CAFZ,CAYF,CAKD,CACE,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,gBAAkB,CAAE,CAAC,CACrB,WAAa,CAAE,CAAA,CAAK,CACpB,SAAW,CAAE,CAAC,CACd,YAAc,CAAE,CAAC,CACjB,UAAY,CAAE,CAAC,CACf,WAAa,CAAE,CAAC,CAChB,SAAW,CAAE,CACX,MAAQ,CAAE,CAAA,CAAI,CACd,KAAO,CAAE,EAAE,CACX,cAAgB,CAAE,CAAA,CAAK,CACvB,aAAe,CAAE,CAAA,CAJN,CAKZ,CACD,MAAQ,CAAE,CACR,OAAS,CAAE,CAAA,CADH,CAbC,CAFf,CAmBC,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,UAAY,CAAE,CACZ,aAAe,CAAE,CAAA,CAAK,CACtB,SAAW,CAAE,CAAC,CACd,SAAW,CAAE,CAAC,CACd,MAAQ,CAAE,CACR,KAAO,CAAE,EADD,CAJE,CADH,CAFZ,CA/GC,CA4HL,CAMD,KAAO,CAAE,CAAE,CACT,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,eAAiB,CAAE,CACjB,QAAU,CAAE,KADK,CAElB,CACD,cAAgB,CAAE,CAChB,QAAU,CAAE,QADI,CAJP,CAFJ,CAUV,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,eAAiB,CAAE,CACjB,UAAY,CAAE,EAAE,CAChB,WAAa,CAAE,EAFE,CAGlB,CACD,cAAgB,CAAE,CAChB,WAAa,CAAE,EAAE,CACjB,kBAAoB,CAAE,CAAA,CAFN,CALP,CAFZ,CAVM,CAsBN,CAMH,GAAK,CAAE,CAAE,CACP,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,WAAa,CAAE,CACb,kBAAoB,CAAE,CAAA,CADT,CAEd,CACD,QAAU,CAAE,CACV,OAAS,CAAE,CAAA,CADD,CAEX,CACD,WAAa,CAAE,CACb,OAAS,CAAE,CAAA,CADE,CAEd,CACD,YAAc,CAAE,CACd,KAAO,CAAE,CACP,sBAAwB,CAAE,GAAG,CAC7B,sBAAwB,CAAE,EAAE,CAC5B,oBAAsB,CAAE,EAHjB,CAIR,CACD,MAAQ,CAAE,CACR,sBAAwB,CAAE,GAAG,CAC7B,sBAAwB,CAAE,EAAE,CAC5B,oBAAsB,CAAE,EAHhB,CAIT,CACD,KAAO,CAAE,CACP,sBAAwB,CAAE,GAAG,CAC7B,sBAAwB,CAAE,EAAE,CAC5B,oBAAsB,CAAE,EAHjB,CAXK,CAVL,CAFN,CA8BR,CAAE,CACD,QAAU,CAAE,GAAG,CACf,SAAW,CAAE,CACX,YAAc,CAAE,CACd,KAAO,CAAE,CACP,sBAAwB,CAAE,GAAG,CAC7B,sBAAwB,CAAE,EAAE,CAC5B,oBAAsB,CAAE,EAHjB,CAIR,CACD,MAAQ,CAAE,CACR,sBAAwB,CAAE,GAAG,CAC7B,sBAAwB,CAAE,EAAE,CAC5B,oBAAsB,CAAE,EAHhB,CAIT,CACD,KAAO,CAAE,CACP,sBAAwB,CAAE,GAAG,CAC7B,qBAAuB,CAAE,EAAE,CAC3B,sBAAwB,CAAE,EAHnB,CAXK,CADL,CAFZ,CAqBF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,WAAa,CAAE,CACb,kBAAoB,CAAE,CAAA,CADT,CAEd,CACD,QAAU,CAAE,CACV,OAAS,CAAE,CAAA,CADD,CAEX,CACD,WAAa,CAAE,CACb,OAAS,CAAE,CAAA,CADE,CAEd,CACD,YAAc,CAAE,CACd,KAAO,CAAE,CACP,uBAAyB,CAAE,GAAG,CAC9B,sBAAwB,CAAE,EAAE,CAC5B,oBAAsB,CAAE,EAHjB,CAIR,CACD,MAAQ,CAAE,CACR,uBAAyB,CAAE,GAAG,CAC9B,sBAAwB,CAAE,EAAE,CAC5B,oBAAsB,CAAE,EAHhB,CAIT,CACD,KAAO,CAAE,CACP,uBAAyB,CAAE,GAAG,CAC9B,sBAAwB,CAAE,EAAE,CAC5B,oBAAsB,CAAE,EAHjB,CAXK,CAVL,CAFZ,CA8BF,CAAE,CACD,SAAW,CAAE,GAAG,CAChB,SAAW,CAAE,CACX,YAAc,CAAE,CACd,KAAO,CAAE,CACP,uBAAyB,CAAE,GAAG,CAC9B,sBAAwB,CAAE,EAAE,CAC5B,oBAAsB,CAAE,EAHjB,CAIR,CACD,MAAQ,CAAE,CACR,uBAAyB,CAAE,GAAG,CAC9B,sBAAwB,CAAE,EAAE,CAC5B,oBAAsB,CAAE,EAHhB,CAIT,CACD,KAAO,CAAE,CACP,uBAAyB,CAAE,GAAG,CAC9B,qBAAuB,CAAE,EAAE,CAC3B,sBAAwB,CAAE,EAHnB,CAXK,CADL,CAFZ,CAjFI,CA31BM,EAo8BXC,EAAoB,QAAQ,CAAEC,CAAF,CAAQ,CACtC,OAASA,CAAI,GAAI,IAAO,EAAKA,CAAI,GAAIV,SADC,EAIpCW,EAAU,QAAQ,CAAED,CAAF,CAAQ,CAC5B,MAAS,CAACD,CAAiB,CAAEC,CAAF,CAAQ,EAAGE,MAAMC,UAAUC,SAASC,KAAK,CAAEL,CAAF,CAAQ,GAAI,gBADpD,EAI1BM,EAAW,QAAQ,CAAEN,CAAF,CAAQ,CAC7B,OAASA,CAAI,GAAI,IAAK,EAAG,OAAOA,CAAI,EAAI,QADX,EAI3BO,EAAsB,QAAQ,CAAEC,CAAG,CAAEC,CAAP,CAAY,CAC5C,IAAM,IAAIC,EAAI,CAAC,CAAEA,CAAE,CAAEF,CAAGd,OAAO,CAAEgB,CAAC,EAAlC,CACE,GAAKJ,CAAQ,CAAEE,CAAK,CAAAE,CAAA,CAAP,CAAa,EAAGF,CAAK,CAAAE,CAAA,CAAGD,GAAI,GAAIA,EAC3C,OAAOD,CAAK,CAAAE,CAAA,CAChB,CACA,OAAOpB,SALqC,EAQ1CqB,EAAyB,QAAQ,CAAEX,CAAF,CAAQ,CAS3C,IAAIY,EACMC,CADI,CARd,GAAK,CAACP,CAAQ,CAAEN,CAAF,EACZ,OAAOA,CACT,CAEA,GAAKC,CAAO,CAAED,CAAF,EACV,OAAOA,CAAGc,MAAM,CAAA,CAClB,CAEIF,CAAM,CAAE,CAAA,C,CACZ,IAAUC,EAAS,GAAGb,CAAtB,CACOE,MAAMC,UAAUY,eAAeV,KAAK,CAAEL,CAAG,CAAEa,CAAP,C,GACvCD,CAAO,CAAAC,CAAA,CAAW,CAAEF,CAAsB,CAAEX,CAAK,CAAAa,CAAA,CAAP,EAE9C,CACA,OAAOD,CAfoC,EAkBzCI,EAA8B,0CAC9BC,EAAyB,CAAA,EAEzBC,EAAmB,QAAQ,CAAEC,CAAM,CAAEN,CAAQ,CAAEO,CAApB,CAAoC,CAEjE,IAAIC,EAAgCL,CAA4B,CAAEH,CAAQ,CAClEQ,EAA8B,GAAGF,C,GACvCA,CAAQ,CAAAE,CAAA,CAAgC,CAAIR,EAAS,GAAGM,CAAS,CAAEA,CAAQ,CAAAN,CAAA,CAAW,CAAEI,EAAsB,CAGhHE,CAAQ,CAAAN,CAAA,CAAW,CAAEF,CAAsB,CAAES,CAAF,CAAiB,CAE5DhC,CAACS,WAAWyB,KAAK,CAAE,CACjB,MAAM,CAAEH,CAAM,CACd,QAAQ,CAAEN,CAFO,CAAF,CATgD,EAe/DU,EAA0B,QAAQ,CAAEJ,CAAM,CAAEN,CAAV,CAAqB,CACzD,IAAIW,EAAgBL,CAAQ,CAAAH,CAA4B,CAAEH,CAA9B,CAAwC,CAC/DW,CAAc,GAAIP,CAAvB,CACE,OAAOE,CAAQ,CAAAN,CAAA,CADjB,CAGEM,CAAQ,CAAAN,CAAA,CAAW,CAAEW,CALkC,EASvDC,EAAmB,QAAQ,CAAA,CAAG,OACxBrC,CAACS,WAAWH,OAAQ,CAAE,EAAI,CAChC,IAAIgC,EAAWtC,CAACS,WAAW8B,IAAI,CAAA,CAAE,CACjCJ,CAAuB,CAAEG,CAAQP,OAAO,CAAEO,CAAQb,SAA3B,CAFS,CADF,EAO9Be,EAAc,QAAQ,CAAA,CAAG,CAC3B1C,CAAK2C,YAAa,CAAE,CAAA,CAAI,CACnB3C,CAAK4C,KAAM,GAAI,I,GAClB5C,CAAK6C,eAAgB,CAAE,CAAA,EAAK,CAE9B7C,CAAK8C,oBAAqB,CAAE,CAAA,CAAK,CACjC9C,CAAK+C,YAAY,CAAE,CAAA,CAAF,CAAQ,CACzBV,CAAuB,CAAErC,CAAK,CAAE,qBAAT,CAPI,EAUzBgD,EAAc,QAAQ,CAAEC,CAAO,CAAET,CAAX,CAAsB,CAKxC,IAAIb,EAKJuB,EACAhB,EAqBIiB,EACMC,EASE5B,EACJ6B,EAWIC,EAWFC,C,CAhEhB,GAAK,CAAA1C,CAAiB,CAAE2B,CAAF,EAItB,IAAUb,EAAS,GAAGa,CAAtB,CACE,GAAMxB,MAAMC,UAAUY,eAAeV,KAAK,CAAEqB,CAAQ,CAAEb,CAAZ,EAAyB,CAQnE,GAJIuB,CAAa,CAAED,CAAS,CAAAtB,CAAA,C,CACxBO,CAAc,CAAEM,CAAU,CAAAb,CAAA,C,CAGzBd,CAAiB,CAAEqC,CAAF,EAAmB,CACvClB,CAAgB,CAAEiB,CAAO,CAAEtB,CAAQ,CAAEO,CAArB,CAAoC,CACpD,QAFuC,CAMzC,GAAKnB,CAAO,CAAEmC,CAAF,EAAmB,CAG7B,GAAKnC,CAAO,CAAEmB,CAAF,EAAoB,CAI9B,GAAOgB,CAAY1C,OAAQ,CAAE,CAAE,EAAG,CAACY,CAAQ,CAAE8B,CAAc,CAAA,CAAA,CAAhB,CAAwB,EAAKhB,CAAa1B,OAAQ,CAAE,CAAE,EAAG,CAACY,CAAQ,CAAEc,CAAe,CAAA,CAAA,CAAjB,EAA2B,CACtIF,CAAgB,CAAEiB,CAAO,CAAEtB,CAAQ,CAAEO,CAArB,CAAoC,CACpD,QAFsI,CAMxI,IADIiB,CAA+B,CAAE,CAAA,C,CAC3BC,CAAE,CAAE,CAAC,CAAEA,CAAE,CAAElB,CAAa1B,OAAO,CAAE4C,CAAC,EAA5C,CACE,GAAKvC,CAAiB,CAAEqB,CAAe,CAAAkB,CAAA,CAAjB,CAAuB,EAAGvC,CAAiB,CAAEqB,CAAe,CAAAkB,CAAA,CAAG7B,GAApB,EAA4B,CAC3F4B,CAA+B,CAAE,CAAA,CAAK,CACtC,KAF2F,CAO/F,GAAKA,EAAiC,CACpC,IAAU3B,CAAE,CAAE,CAAC,CAAEA,CAAE,CAAEU,CAAa1B,OAAO,CAAEgB,CAAC,EAA5C,CAAiD,CAE/C,GADI6B,CAA4B,CAAEhC,CAAmB,CAAE6B,CAAY,CAAEhB,CAAe,CAAAV,CAAA,CAAGD,GAAlC,C,CAChD8B,CAA4B,GAAIjD,UACnC,KAAQ,yCAA0C,CAAEuB,CAAS,CAAE,aAAc,CAAEO,CAAe,CAAAV,CAAA,CAAGD,GAAK,CAExGyB,CAAW,CAAEK,CAA2B,CAAEnB,CAAe,CAAAV,CAAA,CAA9C,CALoC,CAOjD,QARoC,CAYtC,GAAKU,CAAa1B,OAAQ,EAAG0C,CAAY1C,QAAU,CACjD,IAAU8C,CAAE,CAAE,CAAC,CAAEA,CAAE,CAAEpB,CAAa1B,OAAO,CAAE8C,CAAC,EAA5C,CACEN,CAAW,CAAEE,CAAc,CAAAI,CAAA,CAAG,CAAEpB,CAAe,CAAAoB,CAAA,CAApC,CACb,CACA,QAJiD,CAOnD,KAAM,sEAAuE,CAAE3B,CAAQ,CArCzD,CAyChC,GAAKP,CAAQ,CAAEc,CAAF,EAAoB,CAC/B,IAAUqB,CAAE,CAAE,CAAC,CAAEA,CAAE,CAAEL,CAAY1C,OAAO,CAAE+C,CAAC,EAA3C,CACEP,CAAW,CAAEE,CAAc,CAAAK,CAAA,CAAG,CAAErB,CAArB,CACb,CACA,QAJ+B,CAOjC,KAAQ,mDAAoD,CAAEP,CAAU,CAnD3C,CAsD/B,GAAKP,CAAQ,CAAE8B,CAAF,EAAmB,CAC9BF,CAAW,CAAEE,CAAY,CAAEhB,CAAhB,CAA+B,CAC1C,QAF8B,CAMhCF,CAAgB,CAAEiB,CAAO,CAAEtB,CAAQ,CAAEO,CAArB,CA1EmD,CANvB,EAoF5CsB,EAAa,QAAQ,CAAA,CAAG,CAO1B,IAAM,IACAC,EAEAC,EAsBIC,EA9BNC,EAAQ5D,CAAK6D,cACbC,EAAS9D,CAAK+D,eAGdC,EAAe,CAAA,EACTxC,EAAI,CAAC,CAAEA,CAAE,CAAEtB,CAAC+D,MAAMzD,OAAO,CAAEgB,CAAC,EAAtC,CACMiC,CAAK,CAAEvD,CAAC+D,MAAQ,CAAAzC,CAAA,C,CAEhBkC,CAAY,CACd,CAAED,CAAIS,SAAU,GAAI9D,SAAU,EAAKqD,CAAIS,SAAU,EAAGN,CAApD,CAA8D,EAAG,CAAEH,CAAIU,SAAU,GAAI/D,SAAU,EAAKqD,CAAIU,SAAU,EAAGP,CAApD,CAA8D,EAC/H,CAAEH,CAAIW,UAAW,GAAIhE,SAAU,EAAKqD,CAAIW,UAAW,EAAGN,CAAtD,CAAiE,EAAG,CAAEL,CAAIY,UAAW,GAAIjE,SAAU,EAAKqD,CAAIY,UAAW,EAAGP,CAAtD,CAAiE,EACrI,CAAEL,CAAIa,OAAQ,GAAIlE,SAAU,EAAKqD,CAAIa,OAAQ,GAAI,CAAA,CAAK,EAAGtE,CAAKsE,OAAQ,GAAI,CAAA,CAAO,EAAKb,CAAIa,OAAQ,GAAI,CAAA,CAAM,EAAG,CAAEtE,CAAKsE,OAAQ,GAAIlE,SAAU,EAAGJ,CAAKsE,OAAQ,GAAI,CAAA,CAAjD,CAA/G,CAA4K,EAC5K,CAAEb,CAAIc,eAAgB,GAAInE,SAAU,EAAKJ,CAAKwE,OAAQ,GAAIpE,SAAU,EAAGJ,CAAKwE,OAAOC,SAAU,GAAIrE,SAAU,EAAGJ,CAAKwE,OAAOC,SAAU,GAAIhB,CAAIc,eAA5I,C,CAEGb,CAAL,CACOxD,CAACQ,aAAe,CAAAc,CAAA,CAAI,GAAIpB,S,GAC3BF,CAACQ,aAAe,CAAAc,CAAA,CAAI,CAAE,CAAA,CAAI,CAC1BwC,CAAa,CAAE,CAAA,EAHnB,CAKY9D,CAACQ,aAAe,CAAAc,CAAA,CAAI,GAAIpB,S,GAClCF,CAACQ,aAAe,CAAAc,CAAA,CAAI,CAAEpB,SAAS,CAC/B4D,CAAa,CAAE,CAAA,EAEnB,CAEA,GAAMA,EACJ,CAEFzB,CAAgB,CAAA,CAAE,CAElB,IAAUoB,EAAI,GAAGzD,CAACQ,aAAlB,CACE,GAAMM,MAAMC,UAAUY,eAAeV,KAAK,CAAEjB,CAACQ,aAAa,CAAEiD,CAAlB,C,EAIrCzD,CAACQ,aAAe,CAAAiD,CAAA,CAAM,GAAIvD,UAAY,CACzC,GAAKS,CAAiB,CAAEX,CAAC+D,MAAQ,CAAAN,CAAA,CAAX,EACpB,KAAM,mCAAoC,CAAEA,CAAG,CAEjDX,CAAW,CAAEhD,CAAK,CAAEE,CAAC+D,MAAQ,CAAAN,CAAA,CAAKe,UAAvB,CAJ8B,CAU7ChC,CAAW,CAAA,CAnBT,CA5BwB,CAxK3B,CA0ND9B,CAAQ+D,MAAO,CAAE/D,CAAQgE,OAAO,CAE1B7D,CAAO,CAAEb,CAAC+D,MAAH,CAAb,CAEY/D,CAAC2E,gBAAiB,GAAI,CAAA,C,GAChC3E,CAAC+D,MAAO,CAAErD,CAAU,CAAAZ,CAAK4C,KAAL,CAAYkC,OAAO,CAAE5E,CAAC+D,MAAH,EAHzC,CACE/D,CAAC+D,MAAO,CAAErD,CAAU,CAAAZ,CAAK4C,KAAL,C,CAMtBZ,CAAgB,CAAEhC,CAAK,CAAE,qBAAqB,CAAEA,CAAK8C,oBAArC,CAA2D,CAE3E9C,CAAK+E,YAAY,CAAE,SAAS,CAAEvB,CAAb,CAAyB,CAC1CxD,CAAK+E,YAAY,CAAE,MAAM,CAAEvB,CAAV,CAlrCf,CARuC,CA4rC1C,CAAE,CAAE,KAAK,CAAE,QAAQ,CAAE,IAAI,CAAE,QAAQ,CAAE,OAAO,CAAE,OAAO,CAAE,OAAO,CAAE,OAAO,CAAE,KAAvE,CA5rCoB,CA4rC4D", +"sources":["responsive.js"], +"names":["AmCharts","addInitHandler","chart","version","r","responsive","undefined","ready","enabled","split","length","Number","currentRules","overridden","defaults","isNullOrUndefined","obj","isArray","Object","prototype","toString","call","isObject","findArrayObjectById","arr","id","i","cloneWithoutPrototypes","clone","property","slice","hasOwnProperty","originalValueRetainerPrefix","noOriginalPropertyStub","overrideProperty","object","overrideValue","originalValueRetainerProperty","push","restoreOriginalProperty","originalValue","restoreOriginals","override","pop","redrawChart","dataChanged","type","marginsUpdated","zoomOutOnDataUpdate","validateNow","applyConfig","current","currentValue","idPresentOnAllOverrideElements","k","correspondingCurrentElement","l","j","checkRules","rule","ruleMatches","key","width","divRealWidth","height","divRealHeight","rulesChanged","rules","minWidth","maxWidth","minHeight","maxHeight","rotate","legendPosition","legend","position","overrides","gantt","serial","addDefaultRules","concat","addListener"] +} diff --git a/ResoursesManager/ResoursesManager/amcharts/radar.js b/ResoursesManager/ResoursesManager/amcharts/radar.js new file mode 100644 index 0000000..357dc1d --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/radar.js @@ -0,0 +1,10 @@ +(function(){var c=window.AmCharts;c.AmRadarChart=c.Class({inherits:c.AmCoordinateChart,construct:function(a){this.type="radar";c.AmRadarChart.base.construct.call(this,a);this.cname="AmRadarChart";this.marginRight=this.marginBottom=this.marginTop=this.marginLeft=0;this.radius="35%";c.applyTheme(this,a,this.cname)},initChart:function(){c.AmRadarChart.base.initChart.call(this);this.dataChanged&&(this.updateData(),this.dataChanged=!1,this.dispatchDataUpdated=!0);this.drawChart()},updateData:function(){this.parseData(); +var a=this.graphs,b;for(b=0;bg&&(z="end",r-=10);180==g&&(v-=5);0===g&&(v+=5);g=c.text(b.container,t[u].category,q,k,n,z);g.translate(r+5,v);this.set.push(g);c.setCN(b,g,a.bcn+"title")}}}}})})();(function(){var c=window.AmCharts;c.RadItem=c.Class({construct:function(a,b,d,f,l,m,e,p){f=a.chart;void 0===d&&(d="");var h=a.chart.fontFamily,k=a.fontSize;void 0===k&&(k=a.chart.fontSize);var n=a.color;void 0===n&&(n=a.chart.color);var q=a.chart.container;this.set=l=q.set();var t=a.axisColor,C=a.axisAlpha,u=a.tickLength,g=a.gridAlpha,r=a.gridThickness,v=a.gridColor,z=a.dashLength,F=a.fillColor,D=a.fillAlpha,G=a.labelsEnabled;m=a.counter;var H=a.inside,I=a.gridType,w,L=a.labelOffset,A;b-=a.height; +var y,B=a.x,J=a.y;e?(G=!0,void 0!==e.id&&(A=f.classNamePrefix+"-guide-"+e.id),isNaN(e.tickLength)||(u=e.tickLength),void 0!=e.lineColor&&(v=e.lineColor),isNaN(e.lineAlpha)||(g=e.lineAlpha),isNaN(e.dashLength)||(z=e.dashLength),isNaN(e.lineThickness)||(r=e.lineThickness),!0===e.inside&&(H=!0),void 0!==e.boldLabel&&(p=e.boldLabel)):d||(g/=3,u/=2);var K="end",E=-1;H&&(K="start",E=1);var x;G&&(x=c.text(q,d,n,h,k,K,p),x.translate(B+(u+3+L)*E,b),l.push(x),c.setCN(f,x,a.bcn+"label"),e&&c.setCN(f,x,"guide"), +c.setCN(f,x,A,!0),this.label=x,y=c.line(q,[B,B+u*E],[b,b],t,C,r),l.push(y),c.setCN(f,y,a.bcn+"tick"),e&&c.setCN(f,y,"guide"),c.setCN(f,y,A,!0));b=Math.round(a.y-b);p=[];h=[];if(0a?d?(f=this.endTime-this.startTime,d=this.startTime+c*g,g=this.endTime+e*g,0=m&&(g=m,d=m-f),this.zoomToDates(new Date(d),new Date(g))):(0=f-1&&(c=e=0),d=this.start+c,g=this.end+e, +this.zoomToIndexes(d,g)):d?(f=this.endTime-this.startTime,d=this.startTime-c*g,g=this.endTime-e*g,0this.start&&(c=e=0),d=this.start-c,g=this.end-e,this.zoomToIndexes(d,g))}},validateData:function(a){this.marginsUpdated=!1;this.zoomOutOnDataUpdate&&!a&&(this.endTime=this.end=this.startTime=this.start=NaN);e.AmSerialChart.base.validateData.call(this)},drawChart:function(){e.AmSerialChart.base.drawChart.call(this);var a= +this.chartData;if(e.ifArray(a)){var b=this.chartScrollbar;b&&b.draw();if(0c&&(a=b-c,this.updateScrollbar=!0),a!=this.startTime&&b-a>c&&(b=a+c,this.updateScrollbar=!0));var d=this.minSelectedTime;if(0m&&(a=m);bm&&(b=m);bc&&(a=b-c,this.updateScrollbar=!0),a!=this.start&&b-a>c&&(b=a+c,this.updateScrollbar=!0));if(a!=this.start||b!=this.end){var d=this.chartData.length-1;isNaN(a)&&(a=0,isNaN(c)||(a=d-c));isNaN(b)&&(b=d);bd&&(b= +d);a>d&&(a=d-1);0>a&&(a=0);this.start=a;this.end=b;this.categoryAxis.zoom(a,b);this.zoomAxesAndGraphs();this.zoomScrollbar();0!==a||b!=this.chartData.length-1?this.showZB(!0):this.showZB(!1);this.updateColumnsDepth();this.dispatchIndexZoomEvent()}},updateGraphs:function(){e.AmSerialChart.base.updateGraphs.call(this);var a=this.graphs,b;for(b=0;bb.depth? +1:-1},zoomScrollbar:function(){var a=this.chartScrollbar,b=this.categoryAxis;a&&this.updateScrollbar&&a.enabled&&(a.dragger.stop(),b.parseDates&&!b.equalSpacing?a.timeZoom(this.startTime,this.endTime):a.zoom(this.start,this.end),this.updateScrollbar=!0)},updateTrendLines:function(){var a=this.trendLines,b;for(b=0;be&&(e=0);h>a.length-1&&(h=a.length-1);var f=e+Math.round((h-e)/2),m=a[f][b];if(c==m)return f;if(1>=h-e){if(d)return e;d=a[h][b];return Math.abs(a[e][b]-c)a&&(a=0),b>d-1&&(b=d-1),d=this.categoryAxis,d.parseDates&&!d.equalSpacing?this.zoom(c[a].time,this.getEndTime(c[b].time)):this.zoom(a, +b))}},zoomToDates:function(a,b){this.updateScrollbar=!0;var c=this.chartData;if(this.categoryAxis.equalSpacing){var d=this.getClosestIndex(c,"time",a.getTime(),!0,0,c.length);b=e.resetDateToMin(b,this.categoryAxis.minPeriod,1);c=this.getClosestIndex(c,"time",b.getTime(),!1,0,c.length);this.zoom(d,c)}else this.zoom(a.getTime(),b.getTime())},zoomToCategoryValues:function(a,b){this.updateScrollbar=!0;this.zoom(this.getCategoryIndexByValue(a),this.getCategoryIndexByValue(b))},formatPeriodString:function(a, +b){if(b){var c=["value","open","low","high","close"],d="value open low high close average sum count".split(" "),g=b.valueAxis,h=this.chartData,f=b.numberFormatter;f||(f=this.nf);for(var m=0;my.x||y.x>y.graph.height)C=NaN}else if(0>y.x||y.x>y.graph.width)C=NaN;if(!isNaN(C)){isNaN(n)&&(n=C);x=C;if(isNaN(A)|| +A>C)A=C;if(isNaN(v)||vy)z=y;if(isNaN(B)||Bb&&0===p&&(p=180):0>c&&270==p&&(p=90);this.gradientRotation=p;0===d&&0===e&&(this.cornerRadius=n);this.draw()},draw:function(){var a=this.set;a.clear(); +var b=this.container,c=b.chart,d=this.w,g=this.h,h=this.dx,f=this.dy,m=this.colors,l=this.alpha,k=this.bwidth,p=this.bcolor,n=this.balpha,x=this.gradientRotation,A=this.cornerRadius,v=this.dashLength,t=this.pattern,u=this.topRadius,q=this.bcn,r=m,w=m;"object"==typeof m&&(r=m[0],w=m[m.length-1]);var z,B,F,G,y,C,E,L,M,Q=l;t&&(l=0);var D,H,I,J,K=this.rotate;if(0Math.abs(g)&&(g=0);1>Math.abs(d)&&(d=0);!isNaN(u)&&(0g&&(k=" A"),l+=k+Math.round(d/2-I)+","+Math.round(g-J)+","+Math.round(d/2+I)+","+Math.round(g+J)+",0,"+g+","+d+","+g,l+=" L"+d+",0",l+=k+Math.round(d/ +2+D)+","+Math.round(H)+","+Math.round(d/2-D)+","+Math.round(-H)+","+d+",0,0,0"):(l+="A"+I+","+J+",0,0,0,"+(d-d/2*(1-u))+","+g+"L"+d+",0",l+="A"+D+","+H+",0,0,1,0,0"),D=180),b=b.path(l).attr(m),b.gradient("linearGradient",[r,e.adjustLuminosity(r,-.3),e.adjustLuminosity(r,-.3),r],D),K?b.translate(h/2,0):b.translate(0,f/2)):b=0===g?e.line(b,[0,d],[0,0],p,n,k,v):0===d?e.line(b,[0,0],[0,g],p,n,k,v):0g?[z, +M,B,F,G,y,C,E,L,b]:[E,L,B,F,G,y,z,M,C,b]:K?0g?[z,b,E]:[E,b,z];e.setCN(c,b,q+"front");e.setCN(c,B,q+"back");e.setCN(c,E,q+"top");e.setCN(c,z,q+"bottom");e.setCN(c,G,q+"left");e.setCN(c,y,q+"right");for(z=0;zr&&(this.endTime=r);q=this.minorGridEnabled;var w,r=this.gridAlpha;if(this.parseDates&&!this.equalSpacing)this.lastTime=a[a.length-1].time,this.maxTime=e.resetDateToMin(new Date(this.lastTime+1.05*x),this.minPeriod,1,b).getTime(),this.timeDifference=this.endTime-this.startTime,this.parseDatesDraw();else if(!this.parseDates){if(this.cellWidth=this.getStepWidth(f), +ff&&(f=0);var z=0;this.end-f+1>=this.autoRotateCount&&(this.labelRotation=this.autoRotateAngle);for(b=f;b<=this.end+2;b++){p=!1;0<=b&&bthis.end&&"start"==this.tickPosition&&(n=" ");this.rotate&&this.inside&&(t=-2);t=new this.axisItemRenderer(this,f,n,p,B,t,void 0, +x,a,!1,v.labelColor,v.className);t.serialDataItem=v;this.pushAxisItem(t);this.gridAlpha=r}}}else if(this.parseDates&&this.equalSpacing){h=this.start;this.startTime=this.data[this.start].time;this.endTime=this.data[this.end].time;this.timeDifference=this.endTime-this.startTime;d=this.choosePeriod(0);g=d.period;A=d.count;a=e.getPeriodDuration(g,A);af&&(f=0);a=this.end+2;a>=this.data.length&&(a=this.data.length);B=!1;B=!l;this.previousPos=-1E3;20=F){f=this.getCoordinate(b-this.start);q=!1;this.nextPeriod[v]&&(q=this.checkPeriodChange(this.nextPeriod[v],1,u,n,v));x=!1;q&&this.markPeriodChange?(q=this.dateFormatsObject[this.nextPeriod[v]],x=!0):q=this.dateFormatsObject[v];n=e.formatDate(new Date(u),q,c);if(b==d&&!l||b==m&&!k)n=" ";B?B=!1:(p||(x=!1),f-this.previousPos>this.safeDistance*Math.cos(this.labelRotation* +Math.PI/180)&&(this.labelFunction&&(n=this.labelFunction(n,new Date(u),this,g,A,t)),this.boldLabels&&(x=!0),t=new this.axisItemRenderer(this,f,n,void 0,void 0,void 0,void 0,x),q=t.graphics(),this.pushAxisItem(t),q=q.getBBox().width,e.isModern||(q-=f),this.previousPos=f+q));t=n=u}else isNaN(w)||(this.checkPeriodChange(g,w,u,z)&&(this.gridAlpha=this.minorGridAlpha,f=this.getCoordinate(b-this.start),q=new this.axisItemRenderer(this,f,void 0,void 0,void 0,void 0,void 0,void 0,void 0,!0),this.pushAxisItem(q), +z=u),this.gridAlpha=r)}for(b=0;bthis.height+1&&c--:h>this.width+1&&c--;0>h&&c++;return c=e.fitToBounds(c,0,b.length-1)},dateToCoordinate:function(a){return this.parseDates&&!this.equalSpacing?(a.getTime()-this.startTime)*this.stepWidth:this.parseDates&& +this.equalSpacing?(a=this.chart.getClosestIndex(this.data,"time",a.getTime(),!1,0,this.data.length-1),this.getCoordinate(a-this.start)):NaN},categoryToCoordinate:function(a){return this.chart?(a=this.chart.getCategoryIndexByValue(a),this.getCoordinate(a-this.start)):NaN},coordinateToDate:function(a){return this.equalSpacing?(a=this.xToIndex(a),new Date(this.data[a].time)):new Date(this.startTime+a/this.stepWidth)},getCoordinate:function(a){a*=this.stepWidth;this.startOnAxis||(a+=this.stepWidth/2); +return Math.round(a)}})})(); \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/themes/black.js b/ResoursesManager/ResoursesManager/amcharts/themes/black.js new file mode 100644 index 0000000..b604c34 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/themes/black.js @@ -0,0 +1,206 @@ +AmCharts.themes.black = { + + themeName: "black", + + AmChart: { + color: "#e7e7e7", backgroundColor: "#222222" + }, + + AmCoordinateChart: { + colors: ["#de4c4f", "#d8854f", "#eea638", "#a7a737", "#86a965", "#8aabb0", "#69c8ff", "#cfd27e", "#9d9888", "#916b8a", "#724887", "#7256bc"] + }, + + AmStockChart: { + colors: ["#de4c4f", "#d8854f", "#eea638", "#a7a737", "#86a965", "#8aabb0", "#69c8ff", "#cfd27e", "#9d9888", "#916b8a", "#724887", "#7256bc"] + }, + + AmSlicedChart: { + outlineAlpha: 1, + outlineThickness: 2, + labelTickColor: "#FFFFFF", + labelTickAlpha: 0.3, + colors: ["#de4c4f", "#d8854f", "#eea638", "#a7a737", "#86a965", "#8aabb0", "#69c8ff", "#cfd27e", "#9d9888", "#916b8a", "#724887", "#7256bc"] + }, + + AmRectangularChart: { + zoomOutButtonColor: '#FFFFFF', + zoomOutButtonRollOverAlpha: 0.15, + zoomOutButtonImage: "lensWhite.png" + }, + + AxisBase: { + axisColor: "#FFFFFF", + axisAlpha: 0.3, + gridAlpha: 0.1, + gridColor: "#FFFFFF", + dashLength: 3 + }, + + ChartScrollbar: { + backgroundColor: "#000000", + backgroundAlpha: 0.2, + graphFillAlpha: 0.2, + graphLineAlpha: 0, + graphFillColor: "#FFFFFF", + selectedGraphFillColor: "#FFFFFF", + selectedGraphFillAlpha: 0.4, + selectedGraphLineColor: "#FFFFFF", + selectedBackgroundColor: "#FFFFFF", + selectedBackgroundAlpha: 0.09, + gridAlpha: 0.15 + }, + + ChartCursor: { + cursorColor: "#FFFFFF", + color: "#000000", + cursorAlpha: 0.5 + }, + + AmLegend: { + color: "#e7e7e7" + }, + + AmGraph: { + lineAlpha: 0.9 + }, + + + GaugeArrow: { + color: "#FFFFFF", + alpha: 0.8, + nailAlpha: 0, + innerRadius: "40%", + nailRadius: 15, + startWidth: 15, + borderAlpha: 0.8, + nailBorderAlpha: 0 + }, + + GaugeAxis: { + tickColor: "#FFFFFF", + tickAlpha: 1, + tickLength: 15, + minorTickLength: 8, + axisThickness: 3, + axisColor: '#FFFFFF', + axisAlpha: 1, + bandAlpha: 0.8 + }, + + TrendLine: { + lineColor: "#c03246", + lineAlpha: 0.8 + }, + + // ammap + AreasSettings: { + alpha: 0.8, + color: "#FFFFFF", + colorSolid: "#000000", + unlistedAreasAlpha: 0.4, + unlistedAreasColor: "#FFFFFF", + outlineColor: "#000000", + outlineAlpha: 0.5, + outlineThickness: 0.5, + rollOverColor: "#3c5bdc", + rollOverOutlineColor: "#000000", + selectedOutlineColor: "#000000", + selectedColor: "#f15135", + unlistedAreasOutlineColor: "#000000", + unlistedAreasOutlineAlpha: 0.5 + }, + + LinesSettings: { + color: "#FFFFFF", + alpha: 0.8 + }, + + ImagesSettings: { + alpha: 0.8, + labelColor: "#FFFFFF", + color: "#FFFFFF", + labelRollOverColor: "#3c5bdc" + }, + + ZoomControl: { + buttonRollOverColor: "#3c5bdc", + buttonFillColor: "#738f58", + buttonBorderColor: "#738f58", + buttonFillAlpha: 0.8, + gridBackgroundColor: "#FFFFFF", + buttonBorderAlpha:0, + buttonCornerRadius:2, + gridAlpha:0.5, + gridBackgroundColor:"#FFFFFF", + homeIconFile:"homeIconWhite.gif", + buttonIconAlpha:0.6, + gridAlpha: 0.2, + buttonSize:20 + }, + + SmallMap: { + mapColor: "#FFFFFF", + rectangleColor: "#FFFFFF", + backgroundColor: "#000000", + backgroundAlpha: 0.7, + borderThickness: 1, + borderAlpha: 0.8 + }, + + // the defaults below are set using CSS syntax, you can use any existing css property + // if you don't use Stock chart, you can delete lines below + PeriodSelector: { + color: "#e7e7e7" + }, + + PeriodButton: { + color: "#e7e7e7", + background: "transparent", + opacity: 0.7, + border: "1px solid rgba(255, 255, 255, .15)", + MozBorderRadius: "5px", + borderRadius: "5px", + margin: "1px", + outline: "none", + boxSizing: "border-box" + }, + + PeriodButtonSelected: { + color: "#e7e7e7", + backgroundColor: "rgba(255, 255, 255, 0.1)", + border: "1px solid rgba(255, 255, 255, .3)", + MozBorderRadius: "5px", + borderRadius: "5px", + margin: "1px", + outline: "none", + opacity: 1, + boxSizing: "border-box" + }, + + PeriodInputField: { + color: "#e7e7e7", + background: "transparent", + border: "1px solid rgba(255, 255, 255, .15)", + outline: "none" + }, + + DataSetSelector: { + color: "#e7e7e7", + selectedBackgroundColor: "rgba(255, 255, 255, .25)", + rollOverBackgroundColor: "rgba(255, 255, 255, .15)" + }, + + DataSetCompareList: { + color: "#e7e7e7", + lineHeight: "100%", + boxSizing: "initial", + webkitBoxSizing: "initial", + border: "1px solid rgba(255, 255, 255, .15)" + }, + + DataSetSelect: { + border: "1px solid rgba(255, 255, 255, .15)", + outline: "none" + } + +}; \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/themes/chalk.js b/ResoursesManager/ResoursesManager/amcharts/themes/chalk.js new file mode 100644 index 0000000..e383032 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/themes/chalk.js @@ -0,0 +1,217 @@ +AmCharts.themes.chalk = { + + themeName: "chalk", + + AmChart: { + color: "#e7e7e7", + fontFamily: "Covered By Your Grace", + fontSize: 18, + handDrawn: true, + backgroundColor: "#282828" + }, + + AmCoordinateChart: { + colors: ["#FFFFFF", "#e384a6", "#f4d499", "#4d90d6", "#c7e38c", "#9986c8", "#edf28c", "#ffd1d4", "#5ee1dc", "#b0eead", "#fef85a", "#8badd2"] + }, + + AmSlicedChart: { + outlineAlpha: 1, + labelTickColor: "#FFFFFF", + labelTickAlpha: 0.3, + colors: ["#FFFFFF", "#e384a6", "#f4d499", "#4d90d6", "#c7e38c", "#9986c8", "#edf28c", "#ffd1d4", "#5ee1dc", "#b0eead", "#fef85a", "#8badd2"] + }, + + AmStockChart: { + colors: ["#FFFFFF", "#e384a6", "#f4d499", "#4d90d6", "#c7e38c", "#9986c8", "#edf28c", "#ffd1d4", "#5ee1dc", "#b0eead", "#fef85a", "#8badd2"] + }, + + AmRectangularChart: { + + zoomOutButtonColor: '#FFFFFF', + zoomOutButtonRollOverAlpha: 0.15, + zoomOutButtonImage: "lensWhite.png" + }, + + AxisBase: { + axisColor: "#FFFFFF", + gridColor: "#FFFFFF" + }, + + ChartScrollbar: { + backgroundColor: "#FFFFFF", + backgroundAlpha: 0.2, + graphFillAlpha: 0.5, + graphLineAlpha: 0, + selectedBackgroundColor: "#000000", + selectedBackgroundAlpha: 0.25, + fontSize: 15, + gridAlpha: 0.15 + }, + + ChartCursor: { + cursorColor: "#FFFFFF", + color: "#000000" + }, + + AmLegend: { + color: "#e7e7e7", + markerSize: 20 + }, + + AmGraph: { + lineAlpha: 0.8 + }, + + + GaugeArrow: { + color: "#FFFFFF", + alpha: 0.1, + nailAlpha: 0, + innerRadius: "40%", + nailRadius: 15, + startWidth: 15, + borderAlpha: 0.8, + nailBorderAlpha: 0 + }, + + GaugeAxis: { + tickColor: "#FFFFFF", + tickAlpha: 0.8, + tickLength: 15, + minorTickLength: 8, + axisThickness: 3, + axisColor: '#FFFFFF', + axisAlpha: 0.8, + bandAlpha: 0.4 + }, + + TrendLine: { + lineColor: "#c03246", + lineAlpha: 0.8 + }, + + // ammap + AmMap: { + handDrawn: false + }, + + AreasSettings: { + alpha: 0.8, + color: "#FFFFFF", + colorSolid: "#000000", + unlistedAreasAlpha: 0.4, + unlistedAreasColor: "#FFFFFF", + outlineColor: "#000000", + outlineAlpha: 0.5, + outlineThickness: 0.5, + rollOverColor: "#4d90d6", + rollOverOutlineColor: "#000000", + selectedOutlineColor: "#000000", + selectedColor: "#e384a6", + unlistedAreasOutlineColor: "#000000", + unlistedAreasOutlineAlpha: 0.5 + }, + + LinesSettings: { + color: "#FFFFFF", + alpha: 0.8 + }, + + ImagesSettings: { + alpha: 0.8, + labelFontSize: 16, + labelColor: "#FFFFFF", + color: "#FFFFFF", + labelRollOverColor: "#4d90d6" + }, + + ZoomControl: { + buttonRollOverColor: "#4d90d6", + buttonFillColor: "#e384a6", + buttonFillAlpha: 0.8, + buttonBorderColor: "#FFFFFF", + gridBackgroundColor: "#FFFFFF", + gridAlpha: 0.8 + }, + + SmallMap: { + mapColor: "#FFFFFF", + rectangleColor: "#FFFFFF", + backgroundColor: "#000000", + backgroundAlpha: 0.7, + borderThickness: 1, + borderAlpha: 0.8 + }, + + + // the defaults below are set using CSS syntax, you can use any existing css property + // if you don't use Stock chart, you can delete lines below + PeriodSelector: { + fontFamily: "Covered By Your Grace", + fontSize:"16px", + color: "#e7e7e7" + }, + + PeriodButton: { + fontFamily: "Covered By Your Grace", + fontSize:"16px", + color: "#e7e7e7", + background: "transparent", + opacity: 0.7, + border: "1px solid rgba(255, 255, 255, .15)", + MozBorderRadius: "5px", + borderRadius: "5px", + margin: "1px", + outline: "none", + boxSizing: "border-box" + }, + + PeriodButtonSelected: { + fontFamily: "Covered By Your Grace", + fontSize:"16px", + color: "#e7e7e7", + backgroundColor: "rgba(255, 255, 255, 0.1)", + border: "1px solid rgba(255, 255, 255, .3)", + MozBorderRadius: "5px", + borderRadius: "5px", + margin: "1px", + outline: "none", + opacity: 1, + boxSizing: "border-box" + }, + + PeriodInputField: { + fontFamily: "Covered By Your Grace", + fontSize:"16px", + color: "#e7e7e7", + background: "transparent", + border: "1px solid rgba(255, 255, 255, .15)", + outline: "none" + }, + + DataSetSelector: { + fontFamily: "Covered By Your Grace", + fontSize:"16px", + color: "#e7e7e7", + selectedBackgroundColor: "rgba(255, 255, 255, .25)", + rollOverBackgroundColor: "rgba(255, 255, 255, .15)" + }, + + DataSetCompareList: { + fontFamily: "Covered By Your Grace", + fontSize:"16px", + color: "#e7e7e7", + lineHeight: "100%", + boxSizing: "initial", + webkitBoxSizing: "initial", + border: "1px solid rgba(255, 255, 255, .15)" + }, + + DataSetSelect: { + fontFamily: "Covered By Your Grace", + fontSize:"16px", + border: "1px solid rgba(255, 255, 255, .15)", + outline: "none" + } + +}; \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/themes/dark.js b/ResoursesManager/ResoursesManager/amcharts/themes/dark.js new file mode 100644 index 0000000..37713d0 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/themes/dark.js @@ -0,0 +1,205 @@ +AmCharts.themes.dark = { + + themeName: "dark", + + AmChart: { + color: "#e7e7e7", backgroundColor: "#282828" + }, + + AmCoordinateChart: { + colors: ["#ae85c9", "#aab9f7", "#b6d2ff", "#c9e6f2", "#c9f0e1", "#e8d685", "#e0ad63", "#d48652", "#d27362", "#495fba", "#7a629b", "#8881cc"] + }, + + AmStockChart: { + colors: ["#639dbd", "#e8d685", "#ae85c9", "#c9f0e1", "#d48652", "#629b6d", "#719dc3", "#719dc3"] + }, + + AmSlicedChart: { + outlineAlpha: 1, + outlineThickness: 2, + labelTickColor: "#FFFFFF", + labelTickAlpha: 0.3, + colors: ["#495fba", "#e8d685", "#ae85c9", "#c9f0e1", "#d48652", "#629b6d", "#719dc3", "#719dc3"] + }, + + AmRectangularChart: { + zoomOutButtonColor: '#FFFFFF', + zoomOutButtonRollOverAlpha: 0.15, + zoomOutButtonImage: "lensWhite.png" + }, + + AxisBase: { + axisColor: "#FFFFFF", + axisAlpha: 0.3, + gridAlpha: 0.1, + gridColor: "#FFFFFF", + dashLength: 3 + }, + + ChartScrollbar: { + backgroundColor: "#000000", + backgroundAlpha: 0.2, + graphFillAlpha: 0.2, + graphLineAlpha: 0, + graphFillColor: "#FFFFFF", + selectedGraphFillColor: "#FFFFFF", + selectedGraphFillAlpha: 0.4, + selectedGraphLineColor: "#FFFFFF", + selectedBackgroundColor: "#FFFFFF", + selectedBackgroundAlpha: 0.09, + gridAlpha: 0.15 + }, + + ChartCursor: { + cursorColor: "#FFFFFF", + color: "#000000", + cursorAlpha: 0.5 + }, + + AmLegend: { + color: "#e7e7e7" + }, + + AmGraph: { + lineAlpha: 0.9 + }, + + + GaugeArrow: { + color: "#FFFFFF", + alpha: 0.8, + nailAlpha: 0, + innerRadius: "40%", + nailRadius: 15, + startWidth: 15, + borderAlpha: 0.8, + nailBorderAlpha: 0 + }, + + GaugeAxis: { + tickColor: "#FFFFFF", + tickAlpha: 1, + tickLength: 15, + minorTickLength: 8, + axisThickness: 3, + axisColor: '#FFFFFF', + axisAlpha: 1, + bandAlpha: 0.8 + }, + + TrendLine: { + lineColor: "#c03246", + lineAlpha: 0.8 + }, + + // ammap + AreasSettings: { + alpha: 0.8, + color: "#FFFFFF", + colorSolid: "#000000", + unlistedAreasAlpha: 0.4, + unlistedAreasColor: "#FFFFFF", + outlineColor: "#000000", + outlineAlpha: 0.5, + outlineThickness: 0.5, + rollOverColor: "#3c5bdc", + rollOverOutlineColor: "#000000", + selectedOutlineColor: "#000000", + selectedColor: "#f15135", + unlistedAreasOutlineColor: "#000000", + unlistedAreasOutlineAlpha: 0.5 + }, + + LinesSettings: { + color: "#FFFFFF", + alpha: 0.8 + }, + + ImagesSettings: { + alpha: 0.8, + labelColor: "#FFFFFF", + color: "#FFFFFF", + labelRollOverColor: "#3c5bdc" + }, + + ZoomControl: { + buttonRollOverColor: "#3c5bdc", + buttonFillColor: "#f15135", + buttonFillAlpha: 0.8, + gridBackgroundColor: "#FFFFFF", + buttonBorderAlpha:0, + buttonCornerRadius:2, + gridAlpha:0.5, + gridBackgroundColor:"#FFFFFF", + homeIconFile:"homeIconWhite.gif", + buttonIconAlpha:0.6, + gridAlpha: 0.2, + buttonSize:20 + }, + + SmallMap: { + mapColor: "#FFFFFF", + rectangleColor: "#FFFFFF", + backgroundColor: "#000000", + backgroundAlpha: 0.7, + borderThickness: 1, + borderAlpha: 0.8 + }, + + // the defaults below are set using CSS syntax, you can use any existing css property + // if you don't use Stock chart, you can delete lines below + PeriodSelector: { + color: "#e7e7e7" + }, + + PeriodButton: { + color: "#e7e7e7", + background: "transparent", + opacity: 0.7, + border: "1px solid rgba(255, 255, 255, .15)", + MozBorderRadius: "5px", + borderRadius: "5px", + margin: "1px", + outline: "none", + boxSizing: "border-box" + }, + + PeriodButtonSelected: { + color: "#e7e7e7", + backgroundColor: "rgba(255, 255, 255, 0.1)", + border: "1px solid rgba(255, 255, 255, .3)", + MozBorderRadius: "5px", + borderRadius: "5px", + margin: "1px", + outline: "none", + opacity: 1, + boxSizing: "border-box" + }, + + PeriodInputField: { + color: "#e7e7e7", + background: "transparent", + border: "1px solid rgba(255, 255, 255, .15)", + outline: "none" + }, + + DataSetSelector: { + color: "#e7e7e7", + selectedBackgroundColor: "rgba(255, 255, 255, .25)", + rollOverBackgroundColor: "rgba(255, 255, 255, .15)" + }, + + DataSetCompareList: { + color: "#e7e7e7", + lineHeight: "100%", + boxSizing: "initial", + webkitBoxSizing: "initial", + border: "1px solid rgba(255, 255, 255, .15)" + }, + + DataSetSelect: { + border: "1px solid rgba(255, 255, 255, .15)", + outline: "none" + } + +}; \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/themes/light.js b/ResoursesManager/ResoursesManager/amcharts/themes/light.js new file mode 100644 index 0000000..9714721 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/themes/light.js @@ -0,0 +1,199 @@ +AmCharts.themes.light = { + + themeName:"light", + + AmChart: { + color: "#000000", backgroundColor: "#FFFFFF" + }, + + AmCoordinateChart: { + colors: ["#67b7dc", "#fdd400", "#84b761", "#cc4748", "#cd82ad", "#2f4074", "#448e4d", "#b7b83f", "#b9783f", "#b93e3d", "#913167"] + }, + + AmStockChart: { + colors: ["#67b7dc", "#fdd400", "#84b761", "#cc4748", "#cd82ad", "#2f4074", "#448e4d", "#b7b83f", "#b9783f", "#b93e3d", "#913167"] + }, + + AmSlicedChart: { + colors: ["#67b7dc", "#fdd400", "#84b761", "#cc4748", "#cd82ad", "#2f4074", "#448e4d", "#b7b83f", "#b9783f", "#b93e3d", "#913167"], + outlineAlpha: 1, + outlineThickness: 2, + labelTickColor: "#000000", + labelTickAlpha: 0.3 + }, + + AmRectangularChart: { + zoomOutButtonColor: '#000000', + zoomOutButtonRollOverAlpha: 0.15, + zoomOutButtonImage: "lens.png" + }, + + AxisBase: { + axisColor: "#000000", + axisAlpha: 0.3, + gridAlpha: 0.1, + gridColor: "#000000" + }, + + ChartScrollbar: { + backgroundColor: "#000000", + backgroundAlpha: 0.12, + graphFillAlpha: 0.5, + graphLineAlpha: 0, + selectedBackgroundColor: "#FFFFFF", + selectedBackgroundAlpha: 0.4, + gridAlpha: 0.15 + }, + + ChartCursor: { + cursorColor: "#000000", + color: "#FFFFFF", + cursorAlpha: 0.5 + }, + + AmLegend: { + color: "#000000" + }, + + AmGraph: { + lineAlpha: 0.9 + }, + GaugeArrow: { + color: "#000000", + alpha: 0.8, + nailAlpha: 0, + innerRadius: "40%", + nailRadius: 15, + startWidth: 15, + borderAlpha: 0.8, + nailBorderAlpha: 0 + }, + + GaugeAxis: { + tickColor: "#000000", + tickAlpha: 1, + tickLength: 15, + minorTickLength: 8, + axisThickness: 3, + axisColor: '#000000', + axisAlpha: 1, + bandAlpha: 0.8 + }, + + TrendLine: { + lineColor: "#c03246", + lineAlpha: 0.8 + }, + + // ammap + AreasSettings: { + alpha: 0.8, + color: "#67b7dc", + colorSolid: "#003767", + unlistedAreasAlpha: 0.4, + unlistedAreasColor: "#000000", + outlineColor: "#FFFFFF", + outlineAlpha: 0.5, + outlineThickness: 0.5, + rollOverColor: "#3c5bdc", + rollOverOutlineColor: "#FFFFFF", + selectedOutlineColor: "#FFFFFF", + selectedColor: "#f15135", + unlistedAreasOutlineColor: "#FFFFFF", + unlistedAreasOutlineAlpha: 0.5 + }, + + LinesSettings: { + color: "#000000", + alpha: 0.8 + }, + + ImagesSettings: { + alpha: 0.8, + labelColor: "#000000", + color: "#000000", + labelRollOverColor: "#3c5bdc" + }, + + ZoomControl: { + buttonRollOverColor: "#3c5bdc", + buttonFillColor: "#3994e2", + buttonBorderColor: "#3994e2", + buttonFillAlpha: 0.8, + gridBackgroundColor: "#FFFFFF", + buttonBorderAlpha:0, + buttonCornerRadius:2, + gridColor:"#FFFFFF", + gridBackgroundColor:"#000000", + buttonIconAlpha:0.6, + gridAlpha: 0.6, + buttonSize:20 + }, + + SmallMap: { + mapColor: "#000000", + rectangleColor: "#f15135", + backgroundColor: "#FFFFFF", + backgroundAlpha: 0.7, + borderThickness: 1, + borderAlpha: 0.8 + }, + + // the defaults below are set using CSS syntax, you can use any existing css property + // if you don't use Stock chart, you can delete lines below + PeriodSelector: { + color: "#000000" + }, + + PeriodButton: { + color: "#000000", + background: "transparent", + opacity: 0.7, + border: "1px solid rgba(0, 0, 0, .3)", + MozBorderRadius: "5px", + borderRadius: "5px", + margin: "1px", + outline: "none", + boxSizing: "border-box" + }, + + PeriodButtonSelected: { + color: "#000000", + backgroundColor: "#b9cdf5", + border: "1px solid rgba(0, 0, 0, .3)", + MozBorderRadius: "5px", + borderRadius: "5px", + margin: "1px", + outline: "none", + opacity: 1, + boxSizing: "border-box" + }, + + PeriodInputField: { + color: "#000000", + background: "transparent", + border: "1px solid rgba(0, 0, 0, .3)", + outline: "none" + }, + + DataSetSelector: { + + color: "#000000", + selectedBackgroundColor: "#b9cdf5", + rollOverBackgroundColor: "#a8b0e4" + }, + + DataSetCompareList: { + color: "#000000", + lineHeight: "100%", + boxSizing: "initial", + webkitBoxSizing: "initial", + border: "1px solid rgba(0, 0, 0, .3)" + }, + + DataSetSelect: { + border: "1px solid rgba(0, 0, 0, .3)", + outline: "none" + } + +}; \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/themes/patterns.js b/ResoursesManager/ResoursesManager/amcharts/themes/patterns.js new file mode 100644 index 0000000..0339648 --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/themes/patterns.js @@ -0,0 +1,259 @@ +AmCharts.themes.patterns = { + + themeName:"patterns", + + AmChart: { + color: "#000000", backgroundColor: "#FFFFFF" + }, + + AmCoordinateChart: { + colors:["#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000"], + patterns:[ + {"url":"patterns/black/pattern1.png", "width":4, "height":4}, + {"url":"patterns/black/pattern2.png", "width":4, "height":4}, + {"url":"patterns/black/pattern3.png", "width":4, "height":4}, + {"url":"patterns/black/pattern4.png", "width":4, "height":4}, + {"url":"patterns/black/pattern5.png", "width":4, "height":4}, + {"url":"patterns/black/pattern6.png", "width":4, "height":4}, + {"url":"patterns/black/pattern7.png", "width":4, "height":4}, + {"url":"patterns/black/pattern8.png", "width":4, "height":4}, + {"url":"patterns/black/pattern9.png", "width":4, "height":4}, + {"url":"patterns/black/pattern10.png", "width":4, "height":4}, + {"url":"patterns/black/pattern11.png", "width":4, "height":4}, + {"url":"patterns/black/pattern12.png", "width":4, "height":4}, + {"url":"patterns/black/pattern13.png", "width":4, "height":4}, + {"url":"patterns/black/pattern14.png", "width":4, "height":4}, + {"url":"patterns/black/pattern15.png", "width":4, "height":4}, + {"url":"patterns/black/pattern16.png", "width":4, "height":4}, + {"url":"patterns/black/pattern17.png", "width":4, "height":4}, + {"url":"patterns/black/pattern18.png", "width":4, "height":4}, + {"url":"patterns/black/pattern19.png", "width":4, "height":4}, + {"url":"patterns/black/pattern20.png", "width":4, "height":4}, + {"url":"patterns/black/pattern21.png", "width":4, "height":4}] + }, + + + AmStockChart: { + colors:["#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000"] + }, + + AmPieChart: { + depth3D:0, + angle:0, + labelRadius:10 + }, + + AmSlicedChart: { + outlineAlpha: 0.3, + colors:["#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000","#000000"], + outlineThickness: 1, + outlineColor:"#000000", + labelTickColor: "#000000", + labelTickAlpha: 0.3, + patterns:[ + {"url":"patterns/black/pattern1.png", "width":4, "height":4}, + {"url":"patterns/black/pattern2.png", "width":4, "height":4}, + {"url":"patterns/black/pattern3.png", "width":4, "height":4}, + {"url":"patterns/black/pattern4.png", "width":4, "height":4}, + {"url":"patterns/black/pattern5.png", "width":4, "height":4}, + {"url":"patterns/black/pattern6.png", "width":4, "height":4}, + {"url":"patterns/black/pattern7.png", "width":4, "height":4}, + {"url":"patterns/black/pattern8.png", "width":4, "height":4}, + {"url":"patterns/black/pattern9.png", "width":4, "height":4}, + {"url":"patterns/black/pattern10.png", "width":4, "height":4}, + {"url":"patterns/black/pattern11.png", "width":4, "height":4}, + {"url":"patterns/black/pattern12.png", "width":4, "height":4}, + {"url":"patterns/black/pattern13.png", "width":4, "height":4}, + {"url":"patterns/black/pattern14.png", "width":4, "height":4}, + {"url":"patterns/black/pattern15.png", "width":4, "height":4}, + {"url":"patterns/black/pattern16.png", "width":4, "height":4}, + {"url":"patterns/black/pattern17.png", "width":4, "height":4}, + {"url":"patterns/black/pattern18.png", "width":4, "height":4}, + {"url":"patterns/black/pattern19.png", "width":4, "height":4}, + {"url":"patterns/black/pattern20.png", "width":4, "height":4}, + {"url":"patterns/black/pattern21.png", "width":4, "height":4}] + }, + + AmRectangularChart: { + zoomOutButtonColor: '#000000', + zoomOutButtonRollOverAlpha: 0.15, + zoomOutButtonImage: "lens.png" + }, + + + + AxisBase: { + axisColor: "#000000", + axisAlpha: 0.3, + gridAlpha: 0.05, + gridColor: "#000000" + }, + + ChartScrollbar: { + backgroundColor: "#000000", + backgroundAlpha: 0.13, + graphFillAlpha: 0.4, + selectedGraphFillAlpha: 0.7, + graphLineAlpha: 0, + selectedBackgroundColor: "#FFFFFF", + selectedBackgroundAlpha: 0.9, + gridAlpha: 0.15 + }, + + ChartCursor: { + cursorColor: "#000000", + color: "#FFFFFF", + cursorAlpha: 0.5 + }, + + AmLegend: { + color: "#000000", + markerBorderAlpha:0.1, + markerSize:20, + switchColor:"#000000" + }, + + AmGraph: { + lineAlpha: 0.4, + fillAlphas:0.5 + }, + + AmAngularGauge:{ + faceAlpha:0.5, + facePattern:{"url":"patterns/black/pattern1.png", "width":4, "height":4} + }, + + + GaugeArrow: { + color: "#000000", + alpha: 1, + nailAlpha: 1, + innerRadius: "0%", + nailRadius: 15, + startWidth: 15, + borderAlpha: 1, + radius:"70%", + nailBorderAlpha: 1 + }, + + GaugeAxis: { + tickColor: "#000000", + tickAlpha: 1, + tickLength: 15, + minorTickLength: 8, + axisThickness: 1, + axisColor: '#000000', + axisAlpha: 1, + bandAlpha: 1 + }, + + TrendLine: { + lineColor: "#c03246", + lineAlpha: 0.8 + }, + + // ammap + AreasSettings: { + alpha: 0.8, + color: "#000000", + colorSolid: "#000000", + unlistedAreasAlpha: 0.4, + unlistedAreasColor: "#000000", + outlineColor: "#FFFFFF", + outlineAlpha: 0.5, + outlineThickness: 0.5, + rollOverColor: "#3c5bdc", + rollOverOutlineColor: "#FFFFFF", + selectedOutlineColor: "#FFFFFF", + selectedColor: "#f15135", + unlistedAreasOutlineColor: "#FFFFFF", + unlistedAreasOutlineAlpha: 0.5 + }, + + LinesSettings: { + color: "#000000", + alpha: 0.8 + }, + + ImagesSettings: { + alpha: 0.8, + labelColor: "#000000", + color: "#000000", + labelRollOverColor: "#3c5bdc" + }, + + ZoomControl: { + buttonRollOverColor: "#3c5bdc", + buttonFillColor: "#f15135", + buttonFillAlpha: 0.8, + buttonBorderColor: "#000000", + gridBackgroundColor: "#000000", + gridAlpha: 0.8 + }, + + SmallMap: { + mapColor: "#000000", + rectangleColor: "#FFFFFF", + backgroundColor: "#FFFFFF", + backgroundAlpha: 0.7, + borderThickness: 1, + borderAlpha: 0.8 + }, + + // the defaults below are set using CSS syntax, you can use any existing css property + // if you don't use Stock chart, you can delete lines below + PeriodSelector: { + color: "#000000" + }, + + PeriodButton: { + color: "#000000", + background: "transparent", + opacity: 0.7, + border: "1px solid rgba(0, 0, 0, .3)", + MozBorderRadius: "5px", + borderRadius: "5px", + margin: "1px", + outline: "none", + boxSizing: "border-box" + }, + + PeriodButtonSelected: { + color: "#000000", + backgroundColor: "rgba(0, 0, 0, 0.1)", + border: "1px solid rgba(0, 0, 0, .3)", + MozBorderRadius: "5px", + borderRadius: "5px", + margin: "1px", + outline: "none", + opacity: 1, + boxSizing: "border-box" + }, + + PeriodInputField: { + color: "#000000", + background: "transparent", + border: "1px solid rgba(0, 0, 0, .3)", + outline: "none" + }, + + DataSetSelector: { + color: "#000000", + selectedBackgroundColor: "rgba(0, 0, 0, .25)", + rollOverBackgroundColor: "rgba(0, 0, 0, .15)" + }, + + DataSetCompareList: { + color: "#000000", + lineHeight: "100%", + boxSizing: "initial", + webkitBoxSizing: "initial", + border: "1px solid rgba(0, 0, 0, .3)" + }, + + DataSetSelect: { + border: "1px solid rgba(0, 0, 0, .3)", + outline: "none" + } + +}; \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/thirdPartySoftwareList.txt b/ResoursesManager/ResoursesManager/amcharts/thirdPartySoftwareList.txt new file mode 100644 index 0000000..7e2ef4c --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/thirdPartySoftwareList.txt @@ -0,0 +1,31 @@ +********************************************************************************* +Third party software used: + + Jason S. Kerchner base class (http://livingmachines.net) + Licensed under BSD license: http://livingmachines.net/license/ + + David Knape & Patrick Mineault Bezier curves drawing logic. + + Code optimization made using Closure Compiling service: + http://closure-compiler.appspot.com/home + +Libraries used for exporting: + + filesaver: https://github.com/eligrey/FileSaver.js/ + https://github.com/eligrey/FileSaver.js/blob/master/LICENSE.md + + blobjs: https://github.com/eligrey/Blob.js/ + https://github.com/eligrey/Blob.js/blob/master/LICENSE.md + + fabricjs: https://github.com/kangax/fabric.js + https://github.com/kangax/fabric.js/blob/master/LICENSE + + jszip: https://github.com/Stuk/jszip + https://github.com/Stuk/jszip/blob/master/LICENSE.markdown + + pdfmake: https://github.com/bpampuch/pdfmake + https://github.com/bpampuch/pdfmake/blob/master/LICENSE + + SheetJS.js: https://github.com/SheetJS/js-xlsx + https://github.com/SheetJS/js-xlsx/blob/master/LICENSE +********************************************************************************* \ No newline at end of file diff --git a/ResoursesManager/ResoursesManager/amcharts/xy.js b/ResoursesManager/ResoursesManager/amcharts/xy.js new file mode 100644 index 0000000..21867ed --- /dev/null +++ b/ResoursesManager/ResoursesManager/amcharts/xy.js @@ -0,0 +1,19 @@ +(function(){var e=window.AmCharts;e.AmXYChart=e.Class({inherits:e.AmRectangularChart,construct:function(a){this.type="xy";e.AmXYChart.base.construct.call(this,a);this.cname="AmXYChart";this.theme=a;this.createEvents("zoomed");this.maxZoomFactor=20;e.applyTheme(this,a,this.cname)},initChart:function(){e.AmXYChart.base.initChart.call(this);this.dataChanged&&(this.updateData(),this.dataChanged=!1,this.dispatchDataUpdated=!0);this.updateScrollbar=!0;this.drawChart();this.autoMargins&&!this.marginsUpdated&& +(this.marginsUpdated=!0,this.measureMargins());var a=this.marginLeftReal,c=this.marginTopReal,b=this.plotAreaWidth,d=this.plotAreaHeight;this.graphsSet.clipRect(a,c,b,d);this.bulletSet.clipRect(a,c,b,d);this.trendLinesSet.clipRect(a,c,b,d)},prepareForExport:function(){var a=this.bulletSet;a.clipPath&&this.container.remove(a.clipPath)},createValueAxes:function(){var a=[],c=[];this.xAxes=a;this.yAxes=c;var b=this.valueAxes,d,f;for(f=0;ff){var e=f;f=d;d=e}b.dispatchZoomEvent(d,f)}}}},zoomObjects:function(a){var c=a.length,b,d;for(b=0;be&&(e=p);pthis.maxZoomFactor&&(a=this.maxZoomFactor);return a},fitH:function(a,c){var b=-(this.plotAreaWidth*c-this.plotAreaWidth); +a +